Index of /api/storage/app/public/attachments/TRADEDOR/notesfiles
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 106_Chargepoint Inst..> | 2025-09-17 10:31 | - | |
![[DIR]](/icons/folder.gif) | 130_Chargepoint Inst..> | 2025-09-17 14:46 | - | |
![[DIR]](/icons/folder.gif) | 133_Chargepoint Inst..> | 2025-09-17 14:47 | - | |
![[DIR]](/icons/folder.gif) | 603_Chargepoint Inst..> | 2025-09-23 14:51 | - | |
![[DIR]](/icons/folder.gif) | 1258_[0,0] Steve Ter..> | 2025-09-29 13:10 | - | |
![[DIR]](/icons/folder.gif) | 1266_Chargepoint Ins..> | 2025-09-29 13:28 | - | |
![[DIR]](/icons/folder.gif) | 1452_[0,0] S Terry -..> | 2025-09-30 14:34 | - | |
![[DIR]](/icons/folder.gif) | 1454_[0,0] Steve Ter..> | 2025-09-30 14:40 | - | |
![[DIR]](/icons/folder.gif) | 1455_[0,0] Steve Ter..> | 2025-09-30 14:42 | - | |
![[DIR]](/icons/folder.gif) | 1457_[0,0] Steve Ter..> | 2025-09-30 14:48 | - | |
![[DIR]](/icons/folder.gif) | 1653_[0,0] Steve Ter..> | 2025-10-01 14:52 | - | |
![[DIR]](/icons/folder.gif) | 1655_[0,0] Steve Ter..> | 2025-10-01 14:58 | - | |
![[DIR]](/icons/folder.gif) | 1831_C&M Glass Servi..> | 2025-10-02 12:56 | - | |
![[DIR]](/icons/folder.gif) | 1838_C&M Glass Servi..> | 2025-10-02 13:01 | - | |
![[DIR]](/icons/folder.gif) | 2188_[0,0] Steve Ter..> | 2025-10-03 15:19 | - | |
![[DIR]](/icons/folder.gif) | 2265_Michael Mazur ..> | 2025-10-06 10:13 | - | |
![[DIR]](/icons/folder.gif) | 2268_Michael Mazur ..> | 2025-10-06 10:14 | - | |
![[DIR]](/icons/folder.gif) | 2797_Chargepoint Ins..> | 2025-10-07 14:50 | - | |
![[DIR]](/icons/folder.gif) | 2821_[0,0] Devlinc ..> | 2025-10-07 15:14 | - | |
![[DIR]](/icons/folder.gif) | 3304_[0,0] SW Trade..> | 2025-10-09 07:50 | - | |
![[DIR]](/icons/folder.gif) | 3731_[0,0] SW Trade..> | 2025-10-10 08:41 | - | |
![[DIR]](/icons/folder.gif) | 4102_[0,0] Steve Ter..> | 2025-10-13 09:32 | - | |
![[DIR]](/icons/folder.gif) | 4104_[0,0] Steve Ter..> | 2025-10-13 09:38 | - | |
![[DIR]](/icons/folder.gif) | 4107_[0,0] Steve Ter..> | 2025-10-13 09:42 | - | |
![[DIR]](/icons/folder.gif) | 4110_[0,0] Steve Ter..> | 2025-10-13 09:47 | - | |
![[DIR]](/icons/folder.gif) | 4117_[0,0] Steve Ter..> | 2025-10-13 09:57 | - | |
![[DIR]](/icons/folder.gif) | 4120_[0,0] Steve Ter..> | 2025-10-13 09:57 | - | |
![[DIR]](/icons/folder.gif) | 4124_[0,0] Steve Ter..> | 2025-10-13 10:05 | - | |
![[DIR]](/icons/folder.gif) | 4128_[0,0] Steve Ter..> | 2025-10-13 10:13 | - | |
![[DIR]](/icons/folder.gif) | 4137_[0,0] Steve Ter..> | 2025-10-13 10:21 | - | |
![[DIR]](/icons/folder.gif) | 4138_[0,0] Steve Ter..> | 2025-10-13 10:27 | - | |
![[DIR]](/icons/folder.gif) | 4156_[0,0] Steve Ter..> | 2025-10-13 10:42 | - | |
![[DIR]](/icons/folder.gif) | 4161_[0,0] Steve Ter..> | 2025-10-13 10:46 | - | |
![[DIR]](/icons/folder.gif) | 4177_[0,0] Steve Ter..> | 2025-10-13 10:54 | - | |
![[DIR]](/icons/folder.gif) | 4180_[0,0] Steve Ter..> | 2025-10-13 10:59 | - | |
![[DIR]](/icons/folder.gif) | 4578_[0,0] Devlinc ..> | 2025-10-14 12:11 | - | |
![[DIR]](/icons/folder.gif) | 4691_[0,0] Devlinc ..> | 2025-10-14 13:21 | - | |
![[DIR]](/icons/folder.gif) | 4891_Contex Builders..> | 2025-10-15 09:59 | - | |
![[DIR]](/icons/folder.gif) | 5419_Gilberts Home I..> | 2025-10-16 12:45 | - | |
![[DIR]](/icons/folder.gif) | 5637_Chargepoint Ins..> | 2025-10-16 15:16 | - | |
![[DIR]](/icons/folder.gif) | 5654_Doorolla Ltd St..> | 2025-10-16 15:54 | - | |
![[DIR]](/icons/folder.gif) | 5656_Doorolla Ltd St..> | 2025-10-16 15:56 | - | |
![[DIR]](/icons/folder.gif) | 5659_Doorolla Ltd St..> | 2025-10-16 15:57 | - | |
![[DIR]](/icons/folder.gif) | 5660_Doorolla Ltd St..> | 2025-10-16 15:58 | - | |
![[DIR]](/icons/folder.gif) | 5902_Doorolla Ltd St..> | 2025-10-17 12:41 | - | |
![[DIR]](/icons/folder.gif) | 6013_Contex Builders..> | 2025-10-17 16:01 | - | |
![[DIR]](/icons/folder.gif) | 6050_Chargepoint Ins..> | 2025-10-20 08:17 | - | |
![[DIR]](/icons/folder.gif) | 6073_Doorolla Ltd St..> | 2025-10-20 08:40 | - | |
![[DIR]](/icons/folder.gif) | 6079_Doorolla Ltd St..> | 2025-10-20 08:44 | - | |
![[DIR]](/icons/folder.gif) | 6084_Doorolla Ltd St..> | 2025-10-20 08:54 | - | |
![[DIR]](/icons/folder.gif) | 6099_Doorolla Ltd St..> | 2025-10-20 09:13 | - | |
![[DIR]](/icons/folder.gif) | 6723_SW Trade Frames..> | 2025-10-22 07:23 | - | |
![[DIR]](/icons/folder.gif) | 6778_[0,0] Devlinc ..> | 2025-10-22 08:34 | - | |
![[DIR]](/icons/folder.gif) | 6784_[0,0] Devlinc ..> | 2025-10-22 08:34 | - | |
![[DIR]](/icons/folder.gif) | 6796_[0,0] Devlinc ..> | 2025-10-22 08:41 | - | |
![[DIR]](/icons/folder.gif) | 6965_Chargepoint Ins..> | 2025-10-22 12:39 | - | |
![[DIR]](/icons/folder.gif) | 6967_Chargepoint Ins..> | 2025-10-22 12:40 | - | |
![[DIR]](/icons/folder.gif) | 6973_Chargepoint Ins..> | 2025-10-22 12:43 | - | |
![[DIR]](/icons/folder.gif) | 6980_Doorolla Ltd St..> | 2025-10-22 12:46 | - | |
![[DIR]](/icons/folder.gif) | 6991_Doorolla Ltd St..> | 2025-10-22 12:49 | - | |
![[DIR]](/icons/folder.gif) | 6995_Doorolla Ltd St..> | 2025-10-22 12:50 | - | |
![[DIR]](/icons/folder.gif) | 6999_Doorolla Ltd St..> | 2025-10-22 12:51 | - | |
![[DIR]](/icons/folder.gif) | 7006_Doorolla Ltd St..> | 2025-10-22 12:51 | - | |
![[DIR]](/icons/folder.gif) | 7103_Doorolla Ltd St..> | 2025-10-22 14:28 | - | |
![[DIR]](/icons/folder.gif) | 7104_Doorolla Ltd St..> | 2025-10-22 14:28 | - | |
![[DIR]](/icons/folder.gif) | 7109_Doorolla Ltd St..> | 2025-10-22 14:40 | - | |
![[DIR]](/icons/folder.gif) | 7169_Doorolla Ltd St..> | 2025-10-23 06:43 | - | |
![[DIR]](/icons/folder.gif) | 7849_Michael Mazur ..> | 2025-10-24 09:13 | - | |
![[DIR]](/icons/folder.gif) | 7853_Michael Mazur ..> | 2025-10-24 09:16 | - | |
![[DIR]](/icons/folder.gif) | 7872_Chargepoint Ins..> | 2025-10-24 09:24 | - | |
![[DIR]](/icons/folder.gif) | 8042_Doorolla Ltd St..> | 2025-10-24 13:18 | - | |
![[DIR]](/icons/folder.gif) | 8048_Doorolla Ltd St..> | 2025-10-24 13:30 | - | |
![[DIR]](/icons/folder.gif) | 8050_Doorolla Ltd St..> | 2025-10-24 13:36 | - | |
![[DIR]](/icons/folder.gif) | 8326_Garage Doors 24..> | 2025-10-27 11:49 | - | |
![[DIR]](/icons/folder.gif) | 8330_Garage Doors 24..> | 2025-10-27 11:50 | - | |
![[DIR]](/icons/folder.gif) | 8332_Garage Doors 24..> | 2025-10-27 11:50 | - | |
![[DIR]](/icons/folder.gif) | 8531_Doorolla Ltd St..> | 2025-10-27 14:22 | - | |
![[DIR]](/icons/folder.gif) | 8536_Doorolla Ltd St..> | 2025-10-27 14:27 | - | |
![[DIR]](/icons/folder.gif) | 8539_Doorolla Ltd St..> | 2025-10-27 14:31 | - | |
![[DIR]](/icons/folder.gif) | 8556_Doorolla Ltd St..> | 2025-10-27 14:50 | - | |
![[DIR]](/icons/folder.gif) | 8639_Doorolla Ltd St..> | 2025-10-27 16:13 | - | |
![[DIR]](/icons/folder.gif) | 8647_Doorolla Ltd St..> | 2025-10-27 16:19 | - | |
![[DIR]](/icons/folder.gif) | 8669_Doorolla Ltd St..> | 2025-10-27 16:53 | - | |
![[DIR]](/icons/folder.gif) | 8673_Doorolla Ltd St..> | 2025-10-27 16:58 | - | |
![[DIR]](/icons/folder.gif) | 8675_Doorolla Ltd St..> | 2025-10-27 16:58 | - | |
![[DIR]](/icons/folder.gif) | 8721_Gilberts Home I..> | 2025-10-28 08:54 | - | |
![[DIR]](/icons/folder.gif) | 8722_Chargepoint Ins..> | 2025-10-28 08:55 | - | |
![[DIR]](/icons/folder.gif) | 8818_Avon Automated ..> | 2025-10-28 10:50 | - | |
![[DIR]](/icons/folder.gif) | 9586_Chargepoint Ins..> | 2025-10-30 08:27 | - | |
![[DIR]](/icons/folder.gif) | 9639_Doorolla Ltd St..> | 2025-10-30 09:20 | - | |
![[DIR]](/icons/folder.gif) | 9740_Doorolla Ltd St..> | 2025-10-30 11:05 | - | |
![[DIR]](/icons/folder.gif) | 9744_Doorolla Ltd St..> | 2025-10-30 11:10 | - | |
![[DIR]](/icons/folder.gif) | 9746_Doorolla Ltd St..> | 2025-10-30 11:15 | - | |
![[DIR]](/icons/folder.gif) | 9749_Doorolla Ltd St..> | 2025-10-30 11:23 | - | |
![[DIR]](/icons/folder.gif) | 9827_Doorolla Ltd St..> | 2025-10-30 13:29 | - | |
![[DIR]](/icons/folder.gif) | 9921_Devlinc Ltd T/ | 2025-10-30 14:59 | - | |
![[DIR]](/icons/folder.gif) | 9983_Chargepoint Ins..> | 2025-10-30 16:49 | - | |
![[DIR]](/icons/folder.gif) | 9990_Chargepoint Ins..> | 2025-10-30 17:00 | - | |
![[DIR]](/icons/folder.gif) | 9991_Chargepoint Ins..> | 2025-10-30 17:05 | - | |
![[DIR]](/icons/folder.gif) | 10010_Chargepoint In..> | 2025-10-31 07:51 | - | |
![[DIR]](/icons/folder.gif) | 10016_Chargepoint In..> | 2025-10-31 08:00 | - | |
![[DIR]](/icons/folder.gif) | 10110_Chargepoint In..> | 2025-10-31 09:11 | - | |
![[DIR]](/icons/folder.gif) | 10132_Chargepoint In..> | 2025-10-31 09:36 | - | |
![[DIR]](/icons/folder.gif) | 10133_Devlinc Ltd T/ | 2025-10-31 09:42 | - | |
![[DIR]](/icons/folder.gif) | 10134_Chargepoint In..> | 2025-10-31 09:43 | - | |
![[DIR]](/icons/folder.gif) | 10256_Doorolla Ltd S..> | 2025-10-31 11:41 | - | |
![[DIR]](/icons/folder.gif) | 10297_Chargepoint In..> | 2025-10-31 11:59 | - | |
![[DIR]](/icons/folder.gif) | 10424_Chargepoint In..> | 2025-10-31 16:03 | - | |
![[DIR]](/icons/folder.gif) | 10497_Doorolla Ltd S..> | 2025-11-03 09:09 | - | |
![[DIR]](/icons/folder.gif) | 10498_Doorolla Ltd S..> | 2025-11-03 09:10 | - | |
![[DIR]](/icons/folder.gif) | 10730_Chargepoint In..> | 2025-11-03 11:29 | - | |
![[DIR]](/icons/folder.gif) | 10880_Doorolla Ltd J..> | 2025-11-03 14:15 | - | |
![[DIR]](/icons/folder.gif) | 10883_Doorolla Ltd J..> | 2025-11-03 14:17 | - | |
![[DIR]](/icons/folder.gif) | 11053_Chargepoint In..> | 2025-11-04 07:41 | - | |
![[DIR]](/icons/folder.gif) | 11190_Chargepoint In..> | 2025-11-04 11:08 | - | |
![[DIR]](/icons/folder.gif) | 11202_Doorolla Ltd S..> | 2025-11-04 11:25 | - | |
![[DIR]](/icons/folder.gif) | 11699_Doorolla Ltd S..> | 2025-11-05 10:14 | - | |
![[DIR]](/icons/folder.gif) | 11703_Doorolla Ltd S..> | 2025-11-05 10:16 | - | |
![[DIR]](/icons/folder.gif) | 11704_Doorolla Ltd S..> | 2025-11-05 10:17 | - | |
![[DIR]](/icons/folder.gif) | 11708_Doorolla Ltd S..> | 2025-11-05 10:18 | - | |
![[DIR]](/icons/folder.gif) | 11711_Doorolla Ltd S..> | 2025-11-05 10:20 | - | |
![[DIR]](/icons/folder.gif) | 11713_Doorolla Ltd S..> | 2025-11-05 10:21 | - | |
![[DIR]](/icons/folder.gif) | 11715_Doorolla Ltd S..> | 2025-11-05 10:21 | - | |
![[DIR]](/icons/folder.gif) | 11811_Devlinc Ltd T/ | 2025-11-05 11:21 | - | |
![[DIR]](/icons/folder.gif) | 11899_Doorolla Ltd S..> | 2025-11-05 12:28 | - | |
![[DIR]](/icons/folder.gif) | 11902_Doorolla Ltd S..> | 2025-11-05 12:35 | - | |
![[DIR]](/icons/folder.gif) | 12202_Devlinc Ltd T/ | 2025-11-06 09:53 | - | |
![[DIR]](/icons/folder.gif) | 12204_Devlinc Ltd T/ | 2025-11-06 09:54 | - | |
![[DIR]](/icons/folder.gif) | 12211_Chargepoint In..> | 2025-11-06 10:03 | - | |
![[DIR]](/icons/folder.gif) | 12249_Gilberts Home ..> | 2025-11-06 11:09 | - | |
![[DIR]](/icons/folder.gif) | 12255_Gilberts Home ..> | 2025-11-06 11:15 | - | |
![[DIR]](/icons/folder.gif) | 12798_Doorolla Ltd S..> | 2025-11-07 12:00 | - | |
![[DIR]](/icons/folder.gif) | 12820_Doorolla Ltd S..> | 2025-11-07 12:27 | - | |
![[DIR]](/icons/folder.gif) | 12862_Doorolla Ltd S..> | 2025-11-07 14:21 | - | |
![[DIR]](/icons/folder.gif) | 13181_Doorolla Ltd S..> | 2025-11-10 10:04 | - | |
![[DIR]](/icons/folder.gif) | 13182_Doorolla Ltd S..> | 2025-11-10 10:06 | - | |
![[DIR]](/icons/folder.gif) | 13192_Doorolla Ltd S..> | 2025-11-10 10:15 | - | |
![[DIR]](/icons/folder.gif) | 13211_Doorolla Ltd S..> | 2025-11-10 10:45 | - | |
![[DIR]](/icons/folder.gif) | 13233_Doorolla Ltd S..> | 2025-11-10 11:19 | - | |
![[DIR]](/icons/folder.gif) | 13246_Doorolla Ltd S..> | 2025-11-10 11:28 | - | |
![[DIR]](/icons/folder.gif) | 13257_Doorolla Ltd S..> | 2025-11-10 11:38 | - | |
![[DIR]](/icons/folder.gif) | 13259_Doorolla Ltd S..> | 2025-11-10 11:40 | - | |
![[DIR]](/icons/folder.gif) | 13261_Doorolla Ltd S..> | 2025-11-10 11:46 | - | |
![[DIR]](/icons/folder.gif) | 13275_Doorolla Ltd S..> | 2025-11-10 11:56 | - | |
![[DIR]](/icons/folder.gif) | 13289_Doorolla Ltd S..> | 2025-11-10 12:00 | - | |
![[DIR]](/icons/folder.gif) | 13294_Doorolla Ltd S..> | 2025-11-10 12:06 | - | |
![[DIR]](/icons/folder.gif) | 13354_Chargepoint In..> | 2025-11-10 13:57 | - | |
![[DIR]](/icons/folder.gif) | 13415_Doorolla Ltd S..> | 2025-11-10 15:28 | - | |
![[DIR]](/icons/folder.gif) | 13434_Doorolla Ltd S..> | 2025-11-10 16:27 | - | |
![[DIR]](/icons/folder.gif) | 13495_Doorolla Ltd S..> | 2025-11-11 07:28 | - | |
![[DIR]](/icons/folder.gif) | 13576_Doorolla Ltd S..> | 2025-11-11 08:06 | - | |
![[DIR]](/icons/folder.gif) | 13578_Doorolla Ltd S..> | 2025-11-11 08:07 | - | |
![[DIR]](/icons/folder.gif) | 13665_Doorolla Ltd S..> | 2025-11-11 10:00 | - | |
![[DIR]](/icons/folder.gif) | 13666_Doorolla Ltd S..> | 2025-11-11 10:00 | - | |
![[DIR]](/icons/folder.gif) | 13672_Doorolla Ltd S..> | 2025-11-11 10:02 | - | |
![[DIR]](/icons/folder.gif) | 13676_Doorolla Ltd S..> | 2025-11-11 10:03 | - | |
![[DIR]](/icons/folder.gif) | 13679_Doorolla Ltd S..> | 2025-11-11 10:05 | - | |
![[DIR]](/icons/folder.gif) | 13683_Doorolla Ltd S..> | 2025-11-11 10:05 | - | |
![[DIR]](/icons/folder.gif) | 13733_Chargepoint In..> | 2025-11-11 10:39 | - | |
![[DIR]](/icons/folder.gif) | 13752_Chargepoint In..> | 2025-11-11 10:57 | - | |
![[DIR]](/icons/folder.gif) | 14471_Doorolla Ltd S..> | 2025-11-12 11:37 | - | |
![[DIR]](/icons/folder.gif) | 14583_Chargepoint In..> | 2025-11-12 13:21 | - | |
![[DIR]](/icons/folder.gif) | 14589_Chargepoint In..> | 2025-11-12 13:23 | - | |
![[DIR]](/icons/folder.gif) | 14673_Doorolla Ltd S..> | 2025-11-12 15:03 | - | |
![[DIR]](/icons/folder.gif) | 14735_Doorolla Ltd S..> | 2025-11-12 16:29 | - | |
![[DIR]](/icons/folder.gif) | 14739_Doorolla Ltd S..> | 2025-11-12 16:32 | - | |
![[DIR]](/icons/folder.gif) | 14942_Chargepoint In..> | 2025-11-13 11:19 | - | |
![[DIR]](/icons/folder.gif) | 15267_Chargepoint In..> | 2025-11-14 08:39 | - | |
![[DIR]](/icons/folder.gif) | 15269_Chargepoint In..> | 2025-11-14 08:41 | - | |
![[DIR]](/icons/folder.gif) | 15311_Chargepoint In..> | 2025-11-14 09:11 | - | |
![[DIR]](/icons/folder.gif) | 15695_Faith Home Imp..> | 2025-11-14 16:49 | - | |
![[DIR]](/icons/folder.gif) | 15716_Doorolla Ltd S..> | 2025-11-15 11:24 | - | |
![[DIR]](/icons/folder.gif) | 15830_Chargepoint In..> | 2025-11-17 09:18 | - | |
![[DIR]](/icons/folder.gif) | 15864_Chargepoint In..> | 2025-11-17 09:34 | - | |
![[DIR]](/icons/folder.gif) | 15890_Faith Home Imp..> | 2025-11-17 10:03 | - | |
![[DIR]](/icons/folder.gif) | 15974_Doorolla Ltd S..> | 2025-11-17 11:10 | - | |
![[DIR]](/icons/folder.gif) | 16093_Doorolla Ltd S..> | 2025-11-17 14:08 | - | |
![[DIR]](/icons/folder.gif) | 16094_Doorolla Ltd S..> | 2025-11-17 14:08 | - | |
![[DIR]](/icons/folder.gif) | 16096_Chargepoint In..> | 2025-11-17 14:11 | - | |
![[DIR]](/icons/folder.gif) | 16502_Chargepoint In..> | 2025-11-18 10:41 | - | |
![[DIR]](/icons/folder.gif) | 16532_Richard Stockb..> | 2025-11-18 11:05 | - | |
![[DIR]](/icons/folder.gif) | 16822_Doorolla Ltd S..> | 2025-11-18 15:44 | - | |
![[DIR]](/icons/folder.gif) | 16827_Doorolla Ltd S..> | 2025-11-18 15:46 | - | |
![[DIR]](/icons/folder.gif) | 16829_Doorolla Ltd S..> | 2025-11-18 15:48 | - | |
![[DIR]](/icons/folder.gif) | 16831_Doorolla Ltd S..> | 2025-11-18 15:49 | - | |
![[DIR]](/icons/folder.gif) | 16837_Doorolla Ltd S..> | 2025-11-18 15:52 | - | |
![[DIR]](/icons/folder.gif) | 16905_Michael Mazur ..> | 2025-11-19 07:11 | - | |
![[DIR]](/icons/folder.gif) | 16931_Doorolla Ltd S..> | 2025-11-19 07:37 | - | |
![[DIR]](/icons/folder.gif) | 16932_Doorolla Ltd S..> | 2025-11-19 07:37 | - | |
![[DIR]](/icons/folder.gif) | 16935_Doorolla Ltd S..> | 2025-11-19 07:38 | - | |
![[DIR]](/icons/folder.gif) | 16936_Doorolla Ltd S..> | 2025-11-19 07:38 | - | |
![[DIR]](/icons/folder.gif) | 16938_Doorolla Ltd S..> | 2025-11-19 07:39 | - | |
![[DIR]](/icons/folder.gif) | 16940_Doorolla Ltd S..> | 2025-11-19 07:40 | - | |
![[DIR]](/icons/folder.gif) | 16944_Doorolla Ltd S..> | 2025-11-19 07:42 | - | |
![[DIR]](/icons/folder.gif) | 16946_Doorolla Ltd S..> | 2025-11-19 07:43 | - | |
![[DIR]](/icons/folder.gif) | 16952_Doorolla Ltd S..> | 2025-11-19 07:44 | - | |
![[DIR]](/icons/folder.gif) | 16967_Chargepoint In..> | 2025-11-19 08:04 | - | |
![[DIR]](/icons/folder.gif) | 16971_Doorolla Ltd S..> | 2025-11-19 08:06 | - | |
![[DIR]](/icons/folder.gif) | 16975_Doorolla Ltd S..> | 2025-11-19 08:09 | - | |
![[DIR]](/icons/folder.gif) | 16980_Doorolla Ltd S..> | 2025-11-19 08:10 | - | |
![[DIR]](/icons/folder.gif) | 16982_Doorolla Ltd S..> | 2025-11-19 08:11 | - | |
![[DIR]](/icons/folder.gif) | 16984_Doorolla Ltd S..> | 2025-11-19 08:12 | - | |
![[DIR]](/icons/folder.gif) | 16986_Doorolla Ltd S..> | 2025-11-19 08:12 | - | |
![[DIR]](/icons/folder.gif) | 16990_Doorolla Ltd S..> | 2025-11-19 08:13 | - | |
![[DIR]](/icons/folder.gif) | 17000_Chargepoint In..> | 2025-11-19 08:20 | - | |
![[DIR]](/icons/folder.gif) | 17240_Chargepoint In..> | 2025-11-19 13:09 | - | |
![[DIR]](/icons/folder.gif) | 17241_Chargepoint In..> | 2025-11-19 13:09 | - | |
![[DIR]](/icons/folder.gif) | 17287_Chargepoint In..> | 2025-11-19 14:27 | - | |
![[DIR]](/icons/folder.gif) | 17459_Gilberts Home ..> | 2025-11-20 09:15 | - | |
![[DIR]](/icons/folder.gif) | 17463_Gilberts Home ..> | 2025-11-20 09:16 | - | |
![[DIR]](/icons/folder.gif) | 18312_Doorolla Ltd S..> | 2025-11-21 16:31 | - | |
![[DIR]](/icons/folder.gif) | 18313_Doorolla Ltd S..> | 2025-11-21 16:37 | - | |
![[DIR]](/icons/folder.gif) | 18317_Doorolla Ltd S..> | 2025-11-21 16:46 | - | |
![[DIR]](/icons/folder.gif) | 18326_Doorolla Ltd S..> | 2025-11-21 16:52 | - | |
![[DIR]](/icons/folder.gif) | 18333_Doorolla Ltd S..> | 2025-11-22 09:56 | - | |
![[DIR]](/icons/folder.gif) | 18364_Chargepoint In..> | 2025-11-24 08:15 | - | |
![[DIR]](/icons/folder.gif) | 18366_Chargepoint In..> | 2025-11-24 08:15 | - | |
![[DIR]](/icons/folder.gif) | 18647_Doorolla Ltd S..> | 2025-11-24 13:39 | - | |
![[DIR]](/icons/folder.gif) | 18799_P & R Door Sys..> | 2025-11-24 16:18 | - | |
![[DIR]](/icons/folder.gif) | 18906_Chargepoint In..> | 2025-11-25 08:20 | - | |
![[DIR]](/icons/folder.gif) | 18913_Doorolla Ltd S..> | 2025-11-25 08:22 | - | |
![[DIR]](/icons/folder.gif) | 19908_Doorflex Produ..> | 2025-11-26 12:02 | - | |
![[DIR]](/icons/folder.gif) | 20658_Chargepoint In..> | 2025-11-28 08:44 | - | |
![[DIR]](/icons/folder.gif) | 20661_Chargepoint In..> | 2025-11-28 09:00 | - | |
![[DIR]](/icons/folder.gif) | 20663_Chargepoint In..> | 2025-11-28 09:07 | - | |
![[DIR]](/icons/folder.gif) | 20678_Chargepoint In..> | 2025-11-28 09:10 | - | |
![[DIR]](/icons/folder.gif) | 20679_Chargepoint In..> | 2025-11-28 09:11 | - | |
![[DIR]](/icons/folder.gif) | 20702_Direct Trade P..> | 2025-11-28 09:32 | - | |
![[DIR]](/icons/folder.gif) | 20703_Direct Trade P..> | 2025-11-28 09:33 | - | |
![[DIR]](/icons/folder.gif) | 20823_Doorolla Ltd S..> | 2025-11-28 11:14 | - | |
![[DIR]](/icons/folder.gif) | 20825_Doorolla Ltd S..> | 2025-11-28 11:16 | - | |
![[DIR]](/icons/folder.gif) | 20839_Doorolla Ltd S..> | 2025-11-28 11:39 | - | |
![[DIR]](/icons/folder.gif) | 20841_Devlinc Ltd T/ | 2025-11-28 11:40 | - | |
![[DIR]](/icons/folder.gif) | 21425_Chargepoint In..> | 2025-12-01 12:51 | - | |
![[DIR]](/icons/folder.gif) | 21560_Richard Stockb..> | 2025-12-01 16:39 | - | |
![[DIR]](/icons/folder.gif) | 21563_Richard Stockb..> | 2025-12-01 16:39 | - | |
![[DIR]](/icons/folder.gif) | 21707_Direct Trade P..> | 2025-12-02 09:05 | - | |
![[DIR]](/icons/folder.gif) | 21711_Direct Trade P..> | 2025-12-02 09:08 | - | |
![[DIR]](/icons/folder.gif) | 22073_Chargepoint In..> | 2025-12-02 14:23 | - | |
![[DIR]](/icons/folder.gif) | 22074_Chargepoint In..> | 2025-12-02 14:24 | - | |
![[DIR]](/icons/folder.gif) | 22263_Right Choice M..> | 2025-12-03 08:33 | - | |
![[DIR]](/icons/folder.gif) | 23200_Devlinc Ltd T/ | 2025-12-05 08:18 | - | |
![[DIR]](/icons/folder.gif) | 23574_Doorolla Ltd S..> | 2025-12-05 15:53 | - | |
![[DIR]](/icons/folder.gif) | 23577_Doorolla Ltd S..> | 2025-12-05 15:54 | - | |
![[DIR]](/icons/folder.gif) | 23583_Doorolla Ltd S..> | 2025-12-05 16:44 | - | |
![[DIR]](/icons/folder.gif) | 23593_Chargepoint In..> | 2025-12-08 08:08 | - | |
![[DIR]](/icons/folder.gif) | 23597_Chargepoint In..> | 2025-12-08 08:10 | - | |
![[DIR]](/icons/folder.gif) | 23635_Chargepoint In..> | 2025-12-08 08:46 | - | |
![[DIR]](/icons/folder.gif) | 23638_Chargepoint In..> | 2025-12-08 08:49 | - | |
![[DIR]](/icons/folder.gif) | 24015_Doorolla Ltd S..> | 2025-12-09 07:53 | - | |
![[DIR]](/icons/folder.gif) | 24055_Doorolla Ltd S..> | 2025-12-09 08:39 | - | |
![[DIR]](/icons/folder.gif) | 24058_Doorolla Ltd S..> | 2025-12-09 08:42 | - | |
![[DIR]](/icons/folder.gif) | 24220_Avon Automated..> | 2025-12-09 10:29 | - | |
![[DIR]](/icons/folder.gif) | 24356_Chargepoint In..> | 2025-12-09 12:00 | - | |
![[DIR]](/icons/folder.gif) | 24371_Gilberts Home ..> | 2025-12-09 12:08 | - | |
![[DIR]](/icons/folder.gif) | 24374_Gilberts Home ..> | 2025-12-09 12:11 | - | |
![[DIR]](/icons/folder.gif) | 24378_Doorolla Ltd S..> | 2025-12-09 12:14 | - | |
![[DIR]](/icons/folder.gif) | 24392_Doorolla Ltd S..> | 2025-12-09 12:20 | - | |
![[DIR]](/icons/folder.gif) | 24576_Devlinc Ltd T/ | 2025-12-10 07:20 | - | |
![[DIR]](/icons/folder.gif) | 24890_Chargepoint In..> | 2025-12-11 07:58 | - | |
![[DIR]](/icons/folder.gif) | 24908_& Windows - G&..> | 2025-12-11 08:38 | - | |
![[DIR]](/icons/folder.gif) | 25054_Devlinc Ltd T/ | 2025-12-11 10:53 | - | |
![[DIR]](/icons/folder.gif) | 25461_Devlinc Ltd T/ | 2025-12-12 09:56 | - | |
![[DIR]](/icons/folder.gif) | 25545_Doorolla Ltd S..> | 2025-12-12 12:00 | - | |
![[DIR]](/icons/folder.gif) | 25546_Doorolla Ltd S..> | 2025-12-12 12:02 | - | |
![[DIR]](/icons/folder.gif) | 25547_Doorolla Ltd S..> | 2025-12-12 12:03 | - | |
![[DIR]](/icons/folder.gif) | 25549_Doorolla Ltd S..> | 2025-12-12 12:04 | - | |
![[DIR]](/icons/folder.gif) | 25550_Doorolla Ltd S..> | 2025-12-12 12:04 | - | |
![[DIR]](/icons/folder.gif) | 25551_Doorolla Ltd S..> | 2025-12-12 12:05 | - | |
![[DIR]](/icons/folder.gif) | 25561_Doorolla Ltd S..> | 2025-12-12 12:05 | - | |
![[DIR]](/icons/folder.gif) | 25562_Doorolla Ltd S..> | 2025-12-12 12:07 | - | |
![[DIR]](/icons/folder.gif) | 25563_Doorolla Ltd S..> | 2025-12-12 12:07 | - | |
![[DIR]](/icons/folder.gif) | 25564_Doorolla Ltd S..> | 2025-12-12 12:08 | - | |
![[DIR]](/icons/folder.gif) | 25565_Doorolla Ltd S..> | 2025-12-12 12:09 | - | |
![[DIR]](/icons/folder.gif) | 25567_Doorolla Ltd S..> | 2025-12-12 12:09 | - | |
![[DIR]](/icons/folder.gif) | 25569_Doorolla Ltd S..> | 2025-12-12 12:10 | - | |
![[DIR]](/icons/folder.gif) | 25571_Doorolla Ltd S..> | 2025-12-12 12:11 | - | |
![[DIR]](/icons/folder.gif) | 25572_Doorolla Ltd S..> | 2025-12-12 12:12 | - | |
![[DIR]](/icons/folder.gif) | 25573_Doorolla Ltd S..> | 2025-12-12 12:12 | - | |
![[DIR]](/icons/folder.gif) | 26641_Chargepoint In..> | 2025-12-16 08:21 | - | |
![[DIR]](/icons/folder.gif) | 26804_Doorolla Ltd S..> | 2025-12-16 11:26 | - | |
![[DIR]](/icons/folder.gif) | 26806_Doorolla Ltd S..> | 2025-12-16 11:29 | - | |
![[DIR]](/icons/folder.gif) | 26813_Doorolla Ltd S..> | 2025-12-16 11:36 | - | |
![[DIR]](/icons/folder.gif) | 26965_Devlinc Ltd T/ | 2025-12-16 14:33 | - | |
![[DIR]](/icons/folder.gif) | 27195_Doorolla Ltd S..> | 2025-12-17 08:52 | - | |
![[DIR]](/icons/folder.gif) | 27206_Doorolla Ltd S..> | 2025-12-17 09:09 | - | |
![[DIR]](/icons/folder.gif) | 27227_Doorolla Ltd S..> | 2025-12-17 09:25 | - | |
![[DIR]](/icons/folder.gif) | 27386_Doorflex Produ..> | 2025-12-17 11:41 | - | |
![[DIR]](/icons/folder.gif) | 27539_Doorolla Ltd S..> | 2025-12-17 15:58 | - | |
![[DIR]](/icons/folder.gif) | 27543_Doorolla Ltd S..> | 2025-12-17 16:04 | - | |
![[DIR]](/icons/folder.gif) | 27812_Faith Home Imp..> | 2025-12-18 12:30 | - | |
![[DIR]](/icons/folder.gif) | 27890_Doorolla Ltd S..> | 2025-12-18 13:56 | - | |
![[DIR]](/icons/folder.gif) | 27966_Doorolla Ltd S..> | 2025-12-18 16:04 | - | |
![[DIR]](/icons/folder.gif) | 28216_Doorolla Ltd S..> | 2025-12-19 11:53 | - | |
![[DIR]](/icons/folder.gif) | 28279_Doorolla Ltd S..> | 2025-12-19 14:00 | - | |
![[DIR]](/icons/folder.gif) | 28348_Doorolla Ltd S..> | 2025-12-19 15:02 | - | |
![[DIR]](/icons/folder.gif) | 28354_Doorolla Ltd S..> | 2025-12-19 15:05 | - | |
![[DIR]](/icons/folder.gif) | 28356_Doorolla Ltd S..> | 2025-12-19 15:05 | - | |
![[DIR]](/icons/folder.gif) | 28358_Doorolla Ltd S..> | 2025-12-19 15:06 | - | |
![[DIR]](/icons/folder.gif) | 28385_Doorolla Ltd S..> | 2025-12-19 16:16 | - | |
![[DIR]](/icons/folder.gif) | 28408_Chargepoint In..> | 2025-12-22 08:29 | - | |
![[DIR]](/icons/folder.gif) | 28844_Chargepoint In..> | 2025-12-23 09:10 | - | |
![[DIR]](/icons/folder.gif) | 28846_Chargepoint In..> | 2025-12-23 09:11 | - | |
![[DIR]](/icons/folder.gif) | 28848_Chargepoint In..> | 2025-12-23 09:12 | - | |
![[DIR]](/icons/folder.gif) | 28850_Chargepoint In..> | 2025-12-23 09:15 | - | |
![[DIR]](/icons/folder.gif) | 29230_Doorolla Ltd S..> | 2025-12-24 08:35 | - | |
![[DIR]](/icons/folder.gif) | 29499_Gilberts Home ..> | 2025-12-31 12:36 | - | |
![[DIR]](/icons/folder.gif) | 30023_Chargepoint In..> | 2026-01-05 09:41 | - | |
![[DIR]](/icons/folder.gif) | 30147_Chargepoint In..> | 2026-01-05 12:46 | - | |
![[DIR]](/icons/folder.gif) | 30420_Doorolla Ltd S..> | 2026-01-05 16:39 | - | |
![[DIR]](/icons/folder.gif) | 30468_Chargepoint In..> | 2026-01-06 08:27 | - | |
![[DIR]](/icons/folder.gif) | 30523_Chargepoint In..> | 2026-01-06 09:31 | - | |
![[DIR]](/icons/folder.gif) | 30866_Chargepoint In..> | 2026-01-06 15:15 | - | |
![[DIR]](/icons/folder.gif) | 30911_Doorolla Ltd S..> | 2026-01-06 15:30 | - | |
![[DIR]](/icons/folder.gif) | 30913_Doorolla Ltd S..> | 2026-01-06 15:31 | - | |
![[DIR]](/icons/folder.gif) | 30915_Doorolla Ltd S..> | 2026-01-06 15:31 | - | |
![[DIR]](/icons/folder.gif) | 31091_Chargepoint In..> | 2026-01-07 10:37 | - | |
![[DIR]](/icons/folder.gif) | 31093_Chargepoint In..> | 2026-01-07 10:37 | - | |
![[DIR]](/icons/folder.gif) | 31095_Chargepoint In..> | 2026-01-07 10:41 | - | |
![[DIR]](/icons/folder.gif) | 31096_Chargepoint In..> | 2026-01-07 10:41 | - | |
![[DIR]](/icons/folder.gif) | 31496_Doorolla Ltd S..> | 2026-01-08 09:42 | - | |
![[DIR]](/icons/folder.gif) | 31499_Doorolla Ltd S..> | 2026-01-08 09:43 | - | |
![[DIR]](/icons/folder.gif) | 31610_Chargepoint In..> | 2026-01-08 11:52 | - | |
![[DIR]](/icons/folder.gif) | 31967_Doorolla Ltd S..> | 2026-01-09 10:51 | - | |
![[DIR]](/icons/folder.gif) | 31969_Doorolla Ltd S..> | 2026-01-09 10:52 | - | |
![[DIR]](/icons/folder.gif) | 31971_Doorolla Ltd S..> | 2026-01-09 10:59 | - | |
![[DIR]](/icons/folder.gif) | 31993_Chargepoint In..> | 2026-01-09 11:23 | - | |
![[DIR]](/icons/folder.gif) | 31994_Chargepoint In..> | 2026-01-09 11:24 | - | |
![[DIR]](/icons/folder.gif) | 32037_Chargepoint In..> | 2026-01-09 12:25 | - | |
![[DIR]](/icons/folder.gif) | 32040_Chargepoint In..> | 2026-01-09 12:26 | - | |
![[DIR]](/icons/folder.gif) | 32146_Gilberts Home ..> | 2026-01-09 15:41 | - | |
![[DIR]](/icons/folder.gif) | 32147_Gilberts Home ..> | 2026-01-09 15:42 | - | |
![[DIR]](/icons/folder.gif) | 32473_Doorolla Ltd S..> | 2026-01-12 16:55 | - | |
![[DIR]](/icons/folder.gif) | 32507_Chargepoint In..> | 2026-01-13 08:13 | - | |
![[DIR]](/icons/folder.gif) | 32508_Chargepoint In..> | 2026-01-13 08:19 | - | |
![[DIR]](/icons/folder.gif) | 32710_Doorolla Ltd S..> | 2026-01-13 11:31 | - | |
![[DIR]](/icons/folder.gif) | 32752_Avon Automated..> | 2026-01-13 12:01 | - | |
![[DIR]](/icons/folder.gif) | 32778_Doorolla Ltd S..> | 2026-01-13 12:20 | - | |
![[DIR]](/icons/folder.gif) | 32827_Right Choice M..> | 2026-01-13 12:57 | - | |
![[DIR]](/icons/folder.gif) | 32965_UK Rollerdoors..> | 2026-01-13 16:55 | - | |
![[DIR]](/icons/folder.gif) | 33007_Doorolla Ltd S..> | 2026-01-14 08:34 | - | |
![[DIR]](/icons/folder.gif) | 33012_Doorolla Ltd S..> | 2026-01-14 08:46 | - | |
![[DIR]](/icons/folder.gif) | 33022_Doorolla Ltd S..> | 2026-01-14 08:58 | - | |
![[DIR]](/icons/folder.gif) | 33076_Doorolla Ltd S..> | 2026-01-14 09:46 | - | |
![[DIR]](/icons/folder.gif) | 33079_Chargepoint In..> | 2026-01-14 09:49 | - | |
![[DIR]](/icons/folder.gif) | 33208_Doorolla Ltd S..> | 2026-01-14 12:52 | - | |
![[DIR]](/icons/folder.gif) | 33216_Chargepoint In..> | 2026-01-14 13:16 | - | |
![[DIR]](/icons/folder.gif) | 33220_Chargepoint In..> | 2026-01-14 13:17 | - | |
![[DIR]](/icons/folder.gif) | 33377_Doorolla Ltd S..> | 2026-01-14 15:50 | - | |
![[DIR]](/icons/folder.gif) | 33383_Doorolla Ltd S..> | 2026-01-14 15:53 | - | |
![[DIR]](/icons/folder.gif) | 33440_Chargepoint In..> | 2026-01-14 16:48 | - | |
![[DIR]](/icons/folder.gif) | 33449_Chargepoint In..> | 2026-01-14 16:49 | - | |
![[DIR]](/icons/folder.gif) | 33815_Chargepoint In..> | 2026-01-15 13:57 | - | |
![[DIR]](/icons/folder.gif) | 33824_Chargepoint In..> | 2026-01-15 14:06 | - | |
![[DIR]](/icons/folder.gif) | 33957_GK Doors LTD T/ | 2026-01-15 15:46 | - | |
![[DIR]](/icons/folder.gif) | 33961_GK Doors LTD T/ | 2026-01-15 15:59 | - | |
![[DIR]](/icons/folder.gif) | 33993_Chargepoint In..> | 2026-01-15 16:49 | - | |
![[DIR]](/icons/folder.gif) | 34164_Chargepoint In..> | 2026-01-16 09:24 | - | |
![[DIR]](/icons/folder.gif) | 34166_Chargepoint In..> | 2026-01-16 09:26 | - | |
![[DIR]](/icons/folder.gif) | 34206_Doorolla Ltd S..> | 2026-01-16 09:51 | - | |
![[DIR]](/icons/folder.gif) | 34207_Chargepoint In..> | 2026-01-16 09:51 | - | |
![[DIR]](/icons/folder.gif) | 34241_Doorolla Ltd S..> | 2026-01-16 11:13 | - | |
![[DIR]](/icons/folder.gif) | 34405_Chargepoint In..> | 2026-01-19 07:26 | - | |
![[DIR]](/icons/folder.gif) | 34485_Doorolla Ltd S..> | 2026-01-19 09:09 | - | |
![[DIR]](/icons/folder.gif) | 34486_Doorolla Ltd S..> | 2026-01-19 09:09 | - | |
![[DIR]](/icons/folder.gif) | 34495_Doorolla Ltd S..> | 2026-01-19 09:40 | - | |
![[DIR]](/icons/folder.gif) | 34496_Doorolla Ltd S..> | 2026-01-19 09:40 | - | |
![[DIR]](/icons/folder.gif) | 34665_Chargepoint In..> | 2026-01-19 11:59 | - | |
![[DIR]](/icons/folder.gif) | 34772_Devlinc Ltd T/ | 2026-01-19 14:59 | - | |
![[DIR]](/icons/folder.gif) | 34773_Devlinc Ltd T/ | 2026-01-19 15:00 | - | |
![[DIR]](/icons/folder.gif) | 34808_Chargepoint In..> | 2026-01-19 15:55 | - | |
![[DIR]](/icons/folder.gif) | 35039_Doorolla Ltd S..> | 2026-01-20 10:38 | - | |
![[DIR]](/icons/folder.gif) | 35042_Doorolla Ltd S..> | 2026-01-20 10:41 | - | |
![[DIR]](/icons/folder.gif) | 35052_Doorolla Ltd S..> | 2026-01-20 10:42 | - | |
![[DIR]](/icons/folder.gif) | 35055_Doorolla Ltd S..> | 2026-01-20 10:43 | - | |
![[DIR]](/icons/folder.gif) | 35057_Doorolla Ltd S..> | 2026-01-20 10:44 | - | |
![[DIR]](/icons/folder.gif) | 35060_Doorolla Ltd S..> | 2026-01-20 10:45 | - | |
![[DIR]](/icons/folder.gif) | 35071_Doorolla Ltd S..> | 2026-01-20 10:53 | - | |
![[DIR]](/icons/folder.gif) | 35073_Doorolla Ltd S..> | 2026-01-20 10:54 | - | |
![[DIR]](/icons/folder.gif) | 35643_Chargepoint In..> | 2026-01-21 11:45 | - | |
![[DIR]](/icons/folder.gif) | 35773_Doorolla Ltd S..> | 2026-01-21 13:52 | - | |
![[DIR]](/icons/folder.gif) | 35903_Chargepoint In..> | 2026-01-22 08:51 | - | |
![[DIR]](/icons/folder.gif) | 35968_Chargepoint In..> | 2026-01-22 10:19 | - | |
![[DIR]](/icons/folder.gif) | 36171_Devlinc Ltd T/ | 2026-01-22 14:53 | - | |
![[DIR]](/icons/folder.gif) | 36278_Doorolla Ltd S..> | 2026-01-23 08:46 | - | |
![[DIR]](/icons/folder.gif) | 36280_Doorolla Ltd S..> | 2026-01-23 08:50 | - | |
![[DIR]](/icons/folder.gif) | 36542_Devlinc Ltd T/ | 2026-01-23 12:48 | - | |
![[DIR]](/icons/folder.gif) | 36543_Devlinc Ltd T/ | 2026-01-23 12:48 | - | |
![[DIR]](/icons/folder.gif) | 36545_Devlinc Ltd T/ | 2026-01-23 12:53 | - | |
![[DIR]](/icons/folder.gif) | 36546_Devlinc Ltd T/ | 2026-01-23 12:53 | - | |
![[DIR]](/icons/folder.gif) | 36550_Chargepoint In..> | 2026-01-23 13:13 | - | |
![[DIR]](/icons/folder.gif) | 36552_Gilberts Home ..> | 2026-01-23 13:14 | - | |
![[DIR]](/icons/folder.gif) | 36633_Devlinc Ltd T/ | 2026-01-23 14:19 | - | |
![[DIR]](/icons/folder.gif) | 36639_Chargepoint In..> | 2026-01-23 14:27 | - | |
![[DIR]](/icons/folder.gif) | 36707_Doorolla Ltd S..> | 2026-01-23 16:17 | - | |
![[DIR]](/icons/folder.gif) | 36708_Doorolla Ltd S..> | 2026-01-23 16:17 | - | |
![[DIR]](/icons/folder.gif) | 36717_Doorolla Ltd S..> | 2026-01-23 16:43 | - | |
![[DIR]](/icons/folder.gif) | 36718_Doorolla Ltd S..> | 2026-01-23 16:43 | - | |
![[DIR]](/icons/folder.gif) | 36719_Doorolla Ltd S..> | 2026-01-23 16:44 | - | |
![[DIR]](/icons/folder.gif) | 36720_Doorolla Ltd S..> | 2026-01-23 16:44 | - | |
![[DIR]](/icons/folder.gif) | 36790_Chargepoint In..> | 2026-01-26 09:10 | - | |
![[DIR]](/icons/folder.gif) | 36902_Chargepoint In..> | 2026-01-26 11:12 | - | |
![[DIR]](/icons/folder.gif) | 36903_Chargepoint In..> | 2026-01-26 11:13 | - | |
![[DIR]](/icons/folder.gif) | 36909_Chargepoint In..> | 2026-01-26 11:24 | - | |
![[DIR]](/icons/folder.gif) | 36974_Doorolla Ltd S..> | 2026-01-26 13:00 | - | |
![[DIR]](/icons/folder.gif) | 37030_GK Doors LTD T/ | 2026-01-26 13:34 | - | |
![[DIR]](/icons/folder.gif) | 37141_Doorolla Ltd S..> | 2026-01-26 14:52 | - | |
![[DIR]](/icons/folder.gif) | 37199_Chargepoint In..> | 2026-01-26 15:36 | - | |
![[DIR]](/icons/folder.gif) | 37206_Chargepoint In..> | 2026-01-26 15:41 | - | |
![[DIR]](/icons/folder.gif) | 37211_Chargepoint In..> | 2026-01-26 15:47 | - | |
![[DIR]](/icons/folder.gif) | 37219_Chargepoint In..> | 2026-01-26 16:00 | - | |
![[DIR]](/icons/folder.gif) | 37266_GK Doors LTD T/ | 2026-01-26 17:02 | - | |
![[DIR]](/icons/folder.gif) | 37267_GK Doors LTD T/ | 2026-01-26 17:12 | - | |
![[DIR]](/icons/folder.gif) | 37358_Devlinc Ltd T/ | 2026-01-27 09:59 | - | |
![[DIR]](/icons/folder.gif) | 37359_Devlinc Ltd T/ | 2026-01-27 10:00 | - | |
![[DIR]](/icons/folder.gif) | 37527_Ben Coxhill - 27/ | 2026-01-27 13:03 | - | |
![[DIR]](/icons/folder.gif) | 37627_Doorolla Ltd S..> | 2026-01-27 15:05 | - | |
![[DIR]](/icons/folder.gif) | 37629_Chargepoint In..> | 2026-01-27 15:06 | - | |
![[DIR]](/icons/folder.gif) | 37630_Chargepoint In..> | 2026-01-27 15:06 | - | |
![[DIR]](/icons/folder.gif) | 37721_Harpers Door S..> | 2026-01-27 16:56 | - | |
![[DIR]](/icons/folder.gif) | 37798_Doorolla Ltd S..> | 2026-01-28 09:45 | - | |
![[DIR]](/icons/folder.gif) | 37800_Doorolla Ltd S..> | 2026-01-28 09:49 | - | |
![[DIR]](/icons/folder.gif) | 38049_Harpers Door S..> | 2026-01-28 14:16 | - | |
![[DIR]](/icons/folder.gif) | 38177_GK Doors LTD T/ | 2026-01-29 08:17 | - | |
![[DIR]](/icons/folder.gif) | 38179_Chargepoint In..> | 2026-01-29 08:19 | - | |
![[DIR]](/icons/folder.gif) | 38182_GK Doors LTD T/ | 2026-01-29 08:22 | - | |
![[DIR]](/icons/folder.gif) | 38186_GK Doors LTD T/ | 2026-01-29 08:22 | - | |
![[DIR]](/icons/folder.gif) | 38429_Chargepoint In..> | 2026-01-29 12:53 | - | |
![[DIR]](/icons/folder.gif) | 38557_Chargepoint In..> | 2026-01-29 15:11 | - | |
![[DIR]](/icons/folder.gif) | 38591_Chargepoint In..> | 2026-01-29 16:20 | - | |
![[DIR]](/icons/folder.gif) | 38700_Chargepoint In..> | 2026-01-30 09:24 | - | |
![[DIR]](/icons/folder.gif) | 38701_Chargepoint In..> | 2026-01-30 09:24 | - | |
![[DIR]](/icons/folder.gif) | 38795_Doorolla Ltd S..> | 2026-01-30 10:42 | - | |
![[DIR]](/icons/folder.gif) | 38799_Doorolla Ltd S..> | 2026-01-30 10:43 | - | |
![[DIR]](/icons/folder.gif) | 38848_Chargepoint In..> | 2026-01-30 11:30 | - | |
![[DIR]](/icons/folder.gif) | 38873_Chargepoint In..> | 2026-01-30 11:55 | - | |
![[DIR]](/icons/folder.gif) | 38912_Electrical Ins..> | 2026-01-30 12:36 | - | |
![[DIR]](/icons/folder.gif) | 38914_Electrical Ins..> | 2026-01-30 12:51 | - | |
![[DIR]](/icons/folder.gif) | 38921_Chargepoint In..> | 2026-01-30 13:16 | - | |
![[DIR]](/icons/folder.gif) | 39016_Doorolla Ltd S..> | 2026-01-30 15:34 | - | |
![[DIR]](/icons/folder.gif) | 39060_Doorolla Ltd S..> | 2026-01-30 16:40 | - | |
![[DIR]](/icons/folder.gif) | 39061_Doorolla Ltd S..> | 2026-01-30 16:40 | - | |
![[DIR]](/icons/folder.gif) | 39062_Doorolla Ltd S..> | 2026-01-30 16:41 | - | |
![[DIR]](/icons/folder.gif) | 39064_Doorolla Ltd S..> | 2026-01-30 16:47 | - | |
![[DIR]](/icons/folder.gif) | 39066_Doorolla Ltd S..> | 2026-01-30 16:48 | - | |
![[DIR]](/icons/folder.gif) | 39316_Doorolla Ltd S..> | 2026-02-02 13:58 | - | |
![[DIR]](/icons/folder.gif) | 39327_Doorolla Ltd S..> | 2026-02-02 14:20 | - | |
![[DIR]](/icons/folder.gif) | 39329_Doorolla Ltd S..> | 2026-02-02 14:22 | - | |
![[DIR]](/icons/folder.gif) | 39338_Electrical Ins..> | 2026-02-02 14:48 | - | |
![[DIR]](/icons/folder.gif) | 39350_Mowbrey Partne..> | 2026-02-02 15:30 | - | |
![[DIR]](/icons/folder.gif) | 39498_Doorolla Ltd S..> | 2026-02-02 16:26 | - | |
![[DIR]](/icons/folder.gif) | 39504_Chargepoint In..> | 2026-02-02 16:51 | - | |
![[DIR]](/icons/folder.gif) | 39561_Electrical Ins..> | 2026-02-03 08:02 | - | |
![[DIR]](/icons/folder.gif) | 39593_Chargepoint In..> | 2026-02-03 08:16 | - | |
![[DIR]](/icons/folder.gif) | 39695_Mowbrey Partne..> | 2026-02-03 09:37 | - | |
![[DIR]](/icons/folder.gif) | 39715_Gilberts Home ..> | 2026-02-03 09:44 | - | |
![[DIR]](/icons/folder.gif) | 39752_Chargepoint In..> | 2026-02-03 10:03 | - | |
![[DIR]](/icons/folder.gif) | 39871_Chargepoint In..> | 2026-02-03 11:49 | - | |
![[DIR]](/icons/folder.gif) | 40032_G & H Windows ..> | 2026-02-03 14:40 | - | |
![[DIR]](/icons/folder.gif) | 40061_Devlinc Ltd T/ | 2026-02-03 15:11 | - | |
![[DIR]](/icons/folder.gif) | 40098_Chargepoint In..> | 2026-02-03 15:42 | - | |
![[DIR]](/icons/folder.gif) | 40212_GK Doors LTD T/ | 2026-02-03 16:51 | - | |
![[DIR]](/icons/folder.gif) | 40280_Chargepoint In..> | 2026-02-04 08:46 | - | |
![[DIR]](/icons/folder.gif) | 40285_Chargepoint In..> | 2026-02-04 08:50 | - | |
![[DIR]](/icons/folder.gif) | 40295_Chargepoint In..> | 2026-02-04 08:56 | - | |
![[DIR]](/icons/folder.gif) | 40347_Chargepoint In..> | 2026-02-04 10:27 | - | |
![[DIR]](/icons/folder.gif) | 40348_Chargepoint In..> | 2026-02-04 10:29 | - | |
![[DIR]](/icons/folder.gif) | 40358_Chargepoint In..> | 2026-02-04 10:43 | - | |
![[DIR]](/icons/folder.gif) | 40440_Chargepoint In..> | 2026-02-04 12:03 | - | |
![[DIR]](/icons/folder.gif) | 40512_Adams Industri..> | 2026-02-04 13:46 | - | |
![[DIR]](/icons/folder.gif) | 40621_Communication ..> | 2026-02-04 16:08 | - | |
![[DIR]](/icons/folder.gif) | 40625_Chargepoint In..> | 2026-02-04 16:17 | - | |
![[DIR]](/icons/folder.gif) | 40678_Doorolla Ltd S..> | 2026-02-05 07:29 | - | |
![[DIR]](/icons/folder.gif) | 40679_Doorolla Ltd S..> | 2026-02-05 07:29 | - | |
![[DIR]](/icons/folder.gif) | 40681_Doorolla Ltd S..> | 2026-02-05 07:30 | - | |
![[DIR]](/icons/folder.gif) | 40683_Doorolla Ltd S..> | 2026-02-05 07:30 | - | |
![[DIR]](/icons/folder.gif) | 40685_Doorolla Ltd S..> | 2026-02-05 07:31 | - | |
![[DIR]](/icons/folder.gif) | 40687_Doorolla Ltd S..> | 2026-02-05 07:31 | - | |
![[DIR]](/icons/folder.gif) | 40688_Doorolla Ltd S..> | 2026-02-05 07:31 | - | |
![[DIR]](/icons/folder.gif) | 40689_Doorolla Ltd S..> | 2026-02-05 07:32 | - | |
![[DIR]](/icons/folder.gif) | 40690_Doorolla Ltd S..> | 2026-02-05 07:32 | - | |
![[DIR]](/icons/folder.gif) | 40692_Doorolla Ltd S..> | 2026-02-05 07:33 | - | |
![[DIR]](/icons/folder.gif) | 40693_Doorolla Ltd S..> | 2026-02-05 07:33 | - | |
![[DIR]](/icons/folder.gif) | 40694_Doorolla Ltd S..> | 2026-02-05 07:34 | - | |
![[DIR]](/icons/folder.gif) | 40695_Doorolla Ltd S..> | 2026-02-05 07:34 | - | |
![[DIR]](/icons/folder.gif) | 40696_Doorolla Ltd S..> | 2026-02-05 07:35 | - | |
![[DIR]](/icons/folder.gif) | 40697_Doorolla Ltd S..> | 2026-02-05 07:35 | - | |
![[DIR]](/icons/folder.gif) | 40767_Chargepoint In..> | 2026-02-05 10:03 | - | |
![[DIR]](/icons/folder.gif) | 40967_Diversityscope..> | 2026-02-05 13:12 | - | |
![[DIR]](/icons/folder.gif) | 40969_Diversityscope..> | 2026-02-05 13:12 | - | |
![[DIR]](/icons/folder.gif) | 41085_Chargepoint In..> | 2026-02-05 15:51 | - | |
![[DIR]](/icons/folder.gif) | 41097_Doorolla Ltd S..> | 2026-02-05 16:17 | - | |
![[DIR]](/icons/folder.gif) | 41098_Doorolla Ltd S..> | 2026-02-05 16:18 | - | |
![[DIR]](/icons/folder.gif) | 41101_Doorolla Ltd S..> | 2026-02-05 16:19 | - | |
![[DIR]](/icons/folder.gif) | 41158_Diversityscope..> | 2026-02-06 07:54 | - | |
![[DIR]](/icons/folder.gif) | 41218_Doorolla Ltd S..> | 2026-02-06 09:08 | - | |
![[DIR]](/icons/folder.gif) | 41219_Doorolla Ltd S..> | 2026-02-06 09:15 | - | |
![[DIR]](/icons/folder.gif) | 41223_Doorolla Ltd S..> | 2026-02-06 09:23 | - | |
![[DIR]](/icons/folder.gif) | 41226_Doorolla Ltd S..> | 2026-02-06 09:32 | - | |
![[DIR]](/icons/folder.gif) | 41337_Diversityscope..> | 2026-02-06 11:40 | - | |
![[DIR]](/icons/folder.gif) | 41342_Doorolla Ltd S..> | 2026-02-06 11:54 | - | |
![[DIR]](/icons/folder.gif) | 41346_Doorolla Ltd S..> | 2026-02-06 11:57 | - | |
![[DIR]](/icons/folder.gif) | 41351_Doorolla Ltd S..> | 2026-02-06 12:07 | - | |
![[DIR]](/icons/folder.gif) | 41441_Tekcaj Holding..> | 2026-02-06 15:11 | - | |
![[DIR]](/icons/folder.gif) | 41442_Tekcaj Holding..> | 2026-02-06 15:11 | - | |
![[DIR]](/icons/folder.gif) | 41443_Tekcaj Holding..> | 2026-02-06 15:14 | - | |
![[DIR]](/icons/folder.gif) | 41445_GK Doors LTD T/ | 2026-02-06 15:19 | - | |
![[DIR]](/icons/folder.gif) | 41446_Chargepoint In..> | 2026-02-06 15:20 | - | |
![[DIR]](/icons/folder.gif) | 41495_Chargepoint In..> | 2026-02-09 08:13 | - | |
![[DIR]](/icons/folder.gif) | 42009_Chargepoint In..> | 2026-02-10 08:15 | - | |
![[DIR]](/icons/folder.gif) | 42013_Chargepoint In..> | 2026-02-10 08:17 | - | |
![[DIR]](/icons/folder.gif) | 42016_Chargepoint In..> | 2026-02-10 08:18 | - | |
![[DIR]](/icons/folder.gif) | 42170_Doorolla Ltd S..> | 2026-02-10 10:57 | - | |
![[DIR]](/icons/folder.gif) | 42173_Doorolla Ltd S..> | 2026-02-10 10:58 | - | |
![[DIR]](/icons/folder.gif) | 42176_Doorolla Ltd S..> | 2026-02-10 10:59 | - | |
![[DIR]](/icons/folder.gif) | 42341_Doorolla Ltd S..> | 2026-02-10 14:59 | - | |
![[DIR]](/icons/folder.gif) | 42342_Doorolla Ltd S..> | 2026-02-10 15:00 | - | |
![[DIR]](/icons/folder.gif) | 42344_Doorolla Ltd S..> | 2026-02-10 15:01 | - | |
![[DIR]](/icons/folder.gif) | 42346_Doorolla Ltd S..> | 2026-02-10 15:01 | - | |
![[DIR]](/icons/folder.gif) | 42514_Chargepoint In..> | 2026-02-11 09:22 | - | |
![[DIR]](/icons/folder.gif) | 42553_GK Doors LTD T/ | 2026-02-11 10:00 | - | |
![[DIR]](/icons/folder.gif) | 42556_GK Doors LTD T/ | 2026-02-11 10:01 | - | |
![[DIR]](/icons/folder.gif) | 42755_Chargepoint In..> | 2026-02-11 13:39 | - | |
![[DIR]](/icons/folder.gif) | 42885_Doorolla Ltd S..> | 2026-02-12 08:39 | - | |
![[DIR]](/icons/folder.gif) | 42893_Doorolla Ltd S..> | 2026-02-12 08:52 | - | |
![[DIR]](/icons/folder.gif) | 42916_Doorolla Ltd S..> | 2026-02-12 09:01 | - | |
![[DIR]](/icons/folder.gif) | 42920_Doorolla Ltd S..> | 2026-02-12 09:06 | - | |
![[DIR]](/icons/folder.gif) | 43031_Doorolla Ltd S..> | 2026-02-12 11:48 | - | |
![[DIR]](/icons/folder.gif) | 43033_Doorolla Ltd S..> | 2026-02-12 11:50 | - | |
![[DIR]](/icons/folder.gif) | 43048_Doorolla Ltd S..> | 2026-02-12 11:57 | - | |
![[DIR]](/icons/folder.gif) | 43050_Doorolla Ltd S..> | 2026-02-12 11:59 | - | |
![[DIR]](/icons/folder.gif) | 43423_Chargepoint In..> | 2026-02-13 08:51 | - | |
![[DIR]](/icons/folder.gif) | 43424_Chargepoint In..> | 2026-02-13 08:52 | - | |
![[DIR]](/icons/folder.gif) | 43426_Chargepoint In..> | 2026-02-13 08:52 | - | |
![[DIR]](/icons/folder.gif) | 43429_Chargepoint In..> | 2026-02-13 08:53 | - | |
![[DIR]](/icons/folder.gif) | 43464_Chargepoint In..> | 2026-02-13 09:14 | - | |
![[DIR]](/icons/folder.gif) | 43468_Chargepoint In..> | 2026-02-13 09:15 | - | |
![[DIR]](/icons/folder.gif) | 43493_Gilberts Home ..> | 2026-02-13 09:28 | - | |
![[DIR]](/icons/folder.gif) | 43665_Doorolla Ltd S..> | 2026-02-13 13:24 | - | |
![[DIR]](/icons/folder.gif) | 43668_Doorolla Ltd S..> | 2026-02-13 13:31 | - | |
![[DIR]](/icons/folder.gif) | 43682_Doorolla Ltd S..> | 2026-02-13 13:47 | - | |
![[DIR]](/icons/folder.gif) | 43685_Doorolla Ltd S..> | 2026-02-13 13:48 | - | |
![[DIR]](/icons/folder.gif) | 43716_Doorolla Ltd S..> | 2026-02-13 14:16 | - | |
![[DIR]](/icons/folder.gif) | 43723_Doorolla Ltd S..> | 2026-02-13 14:26 | - | |
![[DIR]](/icons/folder.gif) | 44166_Doorolla Ltd S..> | 2026-02-16 13:36 | - | |
![[DIR]](/icons/folder.gif) | 44173_Doorolla Ltd S..> | 2026-02-16 13:38 | - | |
![[DIR]](/icons/folder.gif) | 44191_Chargepoint In..> | 2026-02-16 13:51 | - | |
![[DIR]](/icons/folder.gif) | 44284_Chargepoint In..> | 2026-02-16 15:01 | - | |
![[DIR]](/icons/folder.gif) | 44657_Doorolla Ltd S..> | 2026-02-17 09:48 | - | |
![[DIR]](/icons/folder.gif) | 44667_Doorolla Ltd S..> | 2026-02-17 09:50 | - | |
![[DIR]](/icons/folder.gif) | 44670_Doorolla Ltd S..> | 2026-02-17 09:50 | - | |
![[DIR]](/icons/folder.gif) | 44673_Doorolla Ltd S..> | 2026-02-17 09:51 | - | |
![[DIR]](/icons/folder.gif) | 44676_Doorolla Ltd S..> | 2026-02-17 09:52 | - | |
![[DIR]](/icons/folder.gif) | 44679_Doorolla Ltd S..> | 2026-02-17 09:53 | - | |
![[DIR]](/icons/folder.gif) | 44682_Doorolla Ltd S..> | 2026-02-17 09:54 | - | |
![[DIR]](/icons/folder.gif) | 44685_Doorolla Ltd S..> | 2026-02-17 09:55 | - | |
![[DIR]](/icons/folder.gif) | 44688_Doorolla Ltd S..> | 2026-02-17 09:55 | - | |
![[DIR]](/icons/folder.gif) | 44691_Doorolla Ltd S..> | 2026-02-17 09:56 | - | |
![[DIR]](/icons/folder.gif) | 44789_Rhino Windows ..> | 2026-02-17 11:32 | - | |
![[DIR]](/icons/folder.gif) | 44885_Devlinc Ltd T/ | 2026-02-17 13:19 | - | |
![[DIR]](/icons/folder.gif) | 45097_Chargepoint In..> | 2026-02-17 16:50 | - | |
![[DIR]](/icons/folder.gif) | 45532_Chargepoint In..> | 2026-02-18 10:50 | - | |
![[DIR]](/icons/folder.gif) | 45820_Chargepoint In..> | 2026-02-18 15:33 | - | |
![[DIR]](/icons/folder.gif) | 45865_Doorolla Ltd S..> | 2026-02-18 16:46 | - | |
![[DIR]](/icons/folder.gif) | 46332_Doorolla Ltd S..> | 2026-02-20 07:37 | - | |
![[DIR]](/icons/folder.gif) | 46336_Doorolla Ltd S..> | 2026-02-20 07:39 | - | |
![[DIR]](/icons/folder.gif) | 46346_Doorolla Ltd S..> | 2026-02-20 07:50 | - | |
![[DIR]](/icons/folder.gif) | 46367_Chargepoint In..> | 2026-02-20 08:01 | - | |
![[DIR]](/icons/folder.gif) | 46432_GK Doors LTD T/ | 2026-02-20 09:05 | - | |
![[DIR]](/icons/folder.gif) | 46439_Adams Industri..> | 2026-02-20 09:08 | - | |
![[DIR]](/icons/folder.gif) | 46440_GK Doors LTD T/ | 2026-02-20 09:09 | - | |
![[DIR]](/icons/folder.gif) | 46446_Chargepoint In..> | 2026-02-20 09:12 | - | |
![[DIR]](/icons/folder.gif) | 46459_Gilberts Home ..> | 2026-02-20 09:33 | - | |
![[DIR]](/icons/folder.gif) | 46463_Gilberts Home ..> | 2026-02-20 09:42 | - | |
![[DIR]](/icons/folder.gif) | 46523_Chargepoint In..> | 2026-02-20 10:36 | - | |
![[DIR]](/icons/folder.gif) | 46657_Doorolla Ltd S..> | 2026-02-20 12:11 | - | |
![[DIR]](/icons/folder.gif) | 46696_Doorolla Ltd S..> | 2026-02-20 13:00 | - | |
![[DIR]](/icons/folder.gif) | 46728_Chargepoint In..> | 2026-02-20 13:31 | - | |
![[DIR]](/icons/folder.gif) | 46846_GK Doors LTD T/ | 2026-02-20 14:58 | - | |
![[DIR]](/icons/folder.gif) | 46896_Doorolla Ltd S..> | 2026-02-20 16:15 | - | |
![[DIR]](/icons/folder.gif) | 46897_Doorolla Ltd S..> | 2026-02-20 16:17 | - | |
![[DIR]](/icons/folder.gif) | 46898_Doorolla Ltd S..> | 2026-02-20 16:21 | - | |
![[DIR]](/icons/folder.gif) | 46904_Doorolla Ltd S..> | 2026-02-20 16:24 | - | |
![[DIR]](/icons/folder.gif) | 47040_GK Doors LTD T/ | 2026-02-23 11:24 | - | |
![[DIR]](/icons/folder.gif) | 47269_Doorolla Ltd S..> | 2026-02-23 16:01 | - | |
![[DIR]](/icons/folder.gif) | 47403_Devlinc Ltd T/ | 2026-02-24 08:22 | - | |
![[DIR]](/icons/folder.gif) | 47413_GK Doors LTD T/ | 2026-02-24 08:31 | - | |
![[DIR]](/icons/folder.gif) | 47613_Doorolla Ltd S..> | 2026-02-24 11:54 | - | |
![[DIR]](/icons/folder.gif) | 47614_Doorolla Ltd S..> | 2026-02-24 11:55 | - | |
![[DIR]](/icons/folder.gif) | 47615_Doorolla Ltd S..> | 2026-02-24 11:55 | - | |
![[DIR]](/icons/folder.gif) | 47616_Doorolla Ltd S..> | 2026-02-24 11:56 | - | |
![[DIR]](/icons/folder.gif) | 47618_Doorolla Ltd S..> | 2026-02-24 11:56 | - | |
![[DIR]](/icons/folder.gif) | 47619_Doorolla Ltd S..> | 2026-02-24 11:57 | - | |
![[DIR]](/icons/folder.gif) | 47620_Doorolla Ltd S..> | 2026-02-24 11:57 | - | |
![[DIR]](/icons/folder.gif) | 47621_Doorolla Ltd S..> | 2026-02-24 11:58 | - | |
![[DIR]](/icons/folder.gif) | 47622_Doorolla Ltd S..> | 2026-02-24 11:58 | - | |
![[DIR]](/icons/folder.gif) | 47925_Doorolla Ltd S..> | 2026-02-25 08:22 | - | |
![[DIR]](/icons/folder.gif) | 47952_Rhino Windows ..> | 2026-02-25 08:48 | - | |
![[DIR]](/icons/folder.gif) | 47990_Chargepoint In..> | 2026-02-25 09:25 | - | |
![[DIR]](/icons/folder.gif) | 48077_Doorolla Ltd S..> | 2026-02-25 10:54 | - | |
![[DIR]](/icons/folder.gif) | 48126_Electrical Ins..> | 2026-02-25 12:05 | - | |
![[DIR]](/icons/folder.gif) | 48140_Electrical Ins..> | 2026-02-25 12:16 | - | |
![[DIR]](/icons/folder.gif) | 48204_GK Doors LTD T/ | 2026-02-25 14:46 | - | |
![[DIR]](/icons/folder.gif) | 48562_Chargepoint In..> | 2026-02-26 12:47 | - | |
![[DIR]](/icons/folder.gif) | 48566_Chargepoint In..> | 2026-02-26 12:56 | - | |
![[DIR]](/icons/folder.gif) | 48568_Chargepoint In..> | 2026-02-26 12:57 | - | |
![[DIR]](/icons/folder.gif) | 48725_Avon Automated..> | 2026-02-26 16:02 | - | |
![[DIR]](/icons/folder.gif) | 48976_GK Doors LTD T/ | 2026-02-27 09:30 | - | |
![[DIR]](/icons/folder.gif) | 49063_Doorolla Ltd S..> | 2026-02-27 11:27 | - | |
![[DIR]](/icons/folder.gif) | 49242_Chargepoint In..> | 2026-02-27 15:33 | - | |
![[DIR]](/icons/folder.gif) | 49283_GK Doors LTD T/ | 2026-02-27 16:29 | - | |
![[DIR]](/icons/folder.gif) | 49290_Doorolla Ltd S..> | 2026-02-27 16:34 | - | |
![[DIR]](/icons/folder.gif) | 49353_Ecosse Garage ..> | 2026-03-02 08:33 | - | |
![[DIR]](/icons/folder.gif) | 49430_Chargepoint In..> | 2026-03-02 09:09 | - | |
![[DIR]](/icons/folder.gif) | 49535_GK Doors LTD T/ | 2026-03-02 10:24 | - | |
![[DIR]](/icons/folder.gif) | 49537_GK Doors LTD T/ | 2026-03-02 10:29 | - | |
![[DIR]](/icons/folder.gif) | 49557_GK Doors LTD T/ | 2026-03-02 10:46 | - | |
![[DIR]](/icons/folder.gif) | 49814_Chargepoint In..> | 2026-03-02 14:29 | - | |
![[DIR]](/icons/folder.gif) | 49837_GK Doors LTD T/ | 2026-03-02 14:42 | - | |
![[DIR]](/icons/folder.gif) | 49838_GK Doors LTD T/ | 2026-03-02 14:42 | - | |
![[DIR]](/icons/folder.gif) | 50107_Doorolla Ltd S..> | 2026-03-03 09:18 | - | |
![[DIR]](/icons/folder.gif) | 50109_Doorolla Ltd S..> | 2026-03-03 09:19 | - | |
![[DIR]](/icons/folder.gif) | 50346_GK Doors LTD T/ | 2026-03-03 14:23 | - | |
![[DIR]](/icons/folder.gif) | 50347_GK Doors LTD T/ | 2026-03-03 14:24 | - | |
![[DIR]](/icons/folder.gif) | 50350_GK Doors LTD T/ | 2026-03-03 14:26 | - | |
![[DIR]](/icons/folder.gif) | 50351_GK Doors LTD T/ | 2026-03-03 14:27 | - | |
![[DIR]](/icons/folder.gif) | 50593_Doorolla Ltd S..> | 2026-03-04 08:43 | - | |
![[DIR]](/icons/folder.gif) | 50598_Doorolla Ltd S..> | 2026-03-04 08:45 | - | |
![[DIR]](/icons/folder.gif) | 50601_Doorolla Ltd S..> | 2026-03-04 08:45 | - | |
![[DIR]](/icons/folder.gif) | 50604_Doorolla Ltd S..> | 2026-03-04 08:46 | - | |
![[DIR]](/icons/folder.gif) | 50677_GK Doors LTD T/ | 2026-03-04 09:43 | - | |
![[DIR]](/icons/folder.gif) | 50681_GK Doors LTD T/ | 2026-03-04 09:49 | - | |
![[DIR]](/icons/folder.gif) | 50688_GK Doors LTD T/ | 2026-03-04 09:56 | - | |
![[DIR]](/icons/folder.gif) | 50698_Chargepoint In..> | 2026-03-04 10:02 | - | |
![[DIR]](/icons/folder.gif) | 50832_GK Doors LTD T/ | 2026-03-04 11:51 | - | |
![[DIR]](/icons/folder.gif) | 50894_GK Doors LTD T/ | 2026-03-04 13:28 | - | |
![[DIR]](/icons/folder.gif) | 50896_GK Doors LTD T/ | 2026-03-04 13:29 | - | |
![[DIR]](/icons/folder.gif) | 50901_GK Doors LTD T/ | 2026-03-04 13:35 | - | |
![[DIR]](/icons/folder.gif) | 50933_Rhino Windows ..> | 2026-03-04 14:29 | - | |
![[DIR]](/icons/folder.gif) | 50960_GK Doors LTD T/ | 2026-03-04 15:20 | - | |
![[DIR]](/icons/folder.gif) | 50962_GK Doors LTD T/ | 2026-03-04 15:23 | - | |
![[DIR]](/icons/folder.gif) | 51010_Chargepoint In..> | 2026-03-04 15:57 | - | |
![[DIR]](/icons/folder.gif) | 51016_Chargepoint In..> | 2026-03-04 16:00 | - | |
![[DIR]](/icons/folder.gif) | 51065_Rhino Windows ..> | 2026-03-04 16:23 | - | |
![[DIR]](/icons/folder.gif) | 51104_Chargepoint In..> | 2026-03-04 16:56 | - | |
![[DIR]](/icons/folder.gif) | 51168_Doorolla Ltd S..> | 2026-03-05 08:11 | - | |
![[DIR]](/icons/folder.gif) | 51198_Freshopen Ltd (t/ | 2026-03-05 08:33 | - | |
![[DIR]](/icons/folder.gif) | 52021_Doorolla Ltd S..> | 2026-03-06 11:49 | - | |
![[DIR]](/icons/folder.gif) | 52258_Devlinc Ltd T/ | 2026-03-06 16:14 | - | |
![[DIR]](/icons/folder.gif) | 52279_Chargepoint In..> | 2026-03-09 07:44 | - | |
![[DIR]](/icons/folder.gif) | 52354_Doorolla Ltd S..> | 2026-03-09 08:33 | - | |
![[DIR]](/icons/folder.gif) | 52372_Doorolla Ltd S..> | 2026-03-09 08:58 | - | |
![[DIR]](/icons/folder.gif) | 52391_Doorolla Ltd S..> | 2026-03-09 09:06 | - | |
![[DIR]](/icons/folder.gif) | 52401_Doorolla Ltd S..> | 2026-03-09 09:09 | - | |
![[DIR]](/icons/folder.gif) | 52418_Chargepoint In..> | 2026-03-09 09:25 | - | |
![[DIR]](/icons/folder.gif) | 52616_Devlinc Ltd T/ | 2026-03-09 12:53 | - | |
![[DIR]](/icons/folder.gif) | 52624_GK Doors LTD T/ | 2026-03-09 13:09 | - | |
![[DIR]](/icons/folder.gif) | 52625_GK Doors LTD T/ | 2026-03-09 13:09 | - | |
![[DIR]](/icons/folder.gif) | 52634_Devlinc Ltd T/ | 2026-03-09 13:22 | - | |
![[DIR]](/icons/folder.gif) | 52637_Devlinc Ltd T/ | 2026-03-09 13:26 | - | |
![[DIR]](/icons/folder.gif) | 52674_GK Doors LTD T/ | 2026-03-09 13:49 | - | |
![[DIR]](/icons/folder.gif) | 52675_Doorolla Ltd S..> | 2026-03-09 13:51 | - | |
![[DIR]](/icons/folder.gif) | 52676_Doorolla Ltd S..> | 2026-03-09 13:51 | - | |
![[DIR]](/icons/folder.gif) | 52679_GK Doors LTD T/ | 2026-03-09 13:53 | - | |
![[DIR]](/icons/folder.gif) | 52713_Doorolla Ltd S..> | 2026-03-09 14:30 | - | |
![[DIR]](/icons/folder.gif) | 52740_Doorolla Ltd S..> | 2026-03-09 14:59 | - | |
![[DIR]](/icons/folder.gif) | 52937_Doorolla Ltd S..> | 2026-03-10 07:54 | - | |
![[DIR]](/icons/folder.gif) | 52939_Doorolla Ltd S..> | 2026-03-10 08:07 | - | |
![[DIR]](/icons/folder.gif) | 52999_Doorolla Ltd S..> | 2026-03-10 09:02 | - | |
![[DIR]](/icons/folder.gif) | 53001_Doorolla Ltd S..> | 2026-03-10 09:03 | - | |
![[DIR]](/icons/folder.gif) | 53005_Doorolla Ltd S..> | 2026-03-10 09:07 | - | |
![[DIR]](/icons/folder.gif) | 53007_Doorolla Ltd S..> | 2026-03-10 09:08 | - | |
![[DIR]](/icons/folder.gif) | 53055_Doorolla Ltd S..> | 2026-03-10 09:29 | - | |
![[DIR]](/icons/folder.gif) | 53061_Doorolla Ltd S..> | 2026-03-10 09:31 | - | |
![[DIR]](/icons/folder.gif) | 53070_Doorolla Ltd S..> | 2026-03-10 09:34 | - | |
![[DIR]](/icons/folder.gif) | 53079_Doorolla Ltd S..> | 2026-03-10 09:39 | - | |
![[DIR]](/icons/folder.gif) | 53081_Doorolla Ltd S..> | 2026-03-10 09:40 | - | |
![[DIR]](/icons/folder.gif) | 53195_Chargepoint In..> | 2026-03-10 12:10 | - | |
![[DIR]](/icons/folder.gif) | 53729_WW CONSTRUCTIO..> | 2026-03-11 10:26 | - | |
![[DIR]](/icons/folder.gif) | 53732_WW CONSTRUCTIO..> | 2026-03-11 10:26 | - | |
![[DIR]](/icons/folder.gif) | 54054_Devlinc Ltd T/ | 2026-03-12 09:28 | - | |
![[DIR]](/icons/folder.gif) | 54066_Doorolla Ltd S..> | 2026-03-12 09:37 | - | |
![[DIR]](/icons/folder.gif) | 54096_GK Doors LTD T/ | 2026-03-12 09:59 | - | |
![[DIR]](/icons/folder.gif) | 54097_GK Doors LTD T/ | 2026-03-12 09:59 | - | |
![[DIR]](/icons/folder.gif) | 54167_GK Doors LTD T/ | 2026-03-12 10:57 | - | |
![[DIR]](/icons/folder.gif) | 54480_Doorolla Ltd S..> | 2026-03-12 16:54 | - | |
![[DIR]](/icons/folder.gif) | 54482_Doorolla Ltd S..> | 2026-03-12 17:04 | - | |
![[DIR]](/icons/folder.gif) | 54483_Doorolla Ltd S..> | 2026-03-12 17:09 | - | |
![[DIR]](/icons/folder.gif) | 54631_Doorolla Ltd S..> | 2026-03-13 09:42 | - | |
![[DIR]](/icons/folder.gif) | 54637_Doorolla Ltd S..> | 2026-03-13 09:52 | - | |
![[DIR]](/icons/folder.gif) | 55015_Doorolla Ltd S..> | 2026-03-13 15:49 | - | |
![[DIR]](/icons/folder.gif) | 55024_Gilberts Home ..> | 2026-03-13 16:03 | - | |
![[DIR]](/icons/folder.gif) | 55124_GK Doors LTD T/ | 2026-03-16 09:17 | - | |
![[DIR]](/icons/folder.gif) | 55170_Ecosse Garage ..> | 2026-03-16 09:36 | - | |
![[DIR]](/icons/folder.gif) | 55779_Chargepoint In..> | 2026-03-17 11:42 | - | |
![[DIR]](/icons/folder.gif) | 55836_Doorolla Ltd S..> | 2026-03-17 13:35 | - | |
![[DIR]](/icons/folder.gif) | 55973_Doorolla Ltd S..> | 2026-03-17 15:04 | - | |
![[DIR]](/icons/folder.gif) | 55974_Doorolla Ltd S..> | 2026-03-17 15:04 | - | |
![[DIR]](/icons/folder.gif) | 56298_Doorolla Ltd S..> | 2026-03-18 11:36 | - | |
![[DIR]](/icons/folder.gif) | 56515_Rhino Windows ..> | 2026-03-18 15:01 | - | |
![[DIR]](/icons/folder.gif) | 56517_Rhino Windows ..> | 2026-03-18 15:03 | - | |
![[DIR]](/icons/folder.gif) | 56560_Freshopen Ltd (t/ | 2026-03-18 15:53 | - | |
![[DIR]](/icons/folder.gif) | 57195_GK Doors LTD T/ | 2026-03-20 08:31 | - | |
![[DIR]](/icons/folder.gif) | 57265_Doorolla Ltd S..> | 2026-03-20 09:39 | - | |
![[DIR]](/icons/folder.gif) | 57267_Doorolla Ltd S..> | 2026-03-20 09:39 | - | |
![[DIR]](/icons/folder.gif) | 57409_Admiral Home I..> | 2026-03-20 11:27 | - | |
![[DIR]](/icons/folder.gif) | 57467_Admiral Home I..> | 2026-03-20 12:36 | - | |
![[DIR]](/icons/folder.gif) | 57515_Chargepoint In..> | 2026-03-20 13:57 | - | |
![[DIR]](/icons/folder.gif) | 57701_Chargepoint In..> | 2026-03-23 08:15 | - | |
![[DIR]](/icons/folder.gif) | 57703_Chargepoint In..> | 2026-03-23 08:16 | - | |
![[DIR]](/icons/folder.gif) | 57719_Doorolla Ltd S..> | 2026-03-23 08:30 | - | |
![[DIR]](/icons/folder.gif) | 57727_Doorolla Ltd S..> | 2026-03-23 08:36 | - | |
![[DIR]](/icons/folder.gif) | 57736_Doorolla Ltd S..> | 2026-03-23 08:47 | - | |
![[DIR]](/icons/folder.gif) | 57738_Doorolla Ltd S..> | 2026-03-23 08:53 | - | |
![[DIR]](/icons/folder.gif) | 58128_Chargepoint In..> | 2026-03-23 14:29 | - | |
![[DIR]](/icons/folder.gif) | 58129_Chargepoint In..> | 2026-03-23 14:29 | - | |
![[DIR]](/icons/folder.gif) | 58154_Chargepoint In..> | 2026-03-23 15:21 | - | |
![[DIR]](/icons/folder.gif) | 58211_Devlinc Ltd T/ | 2026-03-23 16:34 | - | |
![[DIR]](/icons/folder.gif) | 58348_Chargepoint In..> | 2026-03-24 09:14 | - | |
![[DIR]](/icons/folder.gif) | 58361_Doorolla Ltd S..> | 2026-03-24 09:26 | - | |
![[DIR]](/icons/folder.gif) | 58369_GK Doors LTD T/ | 2026-03-24 09:29 | - | |
![[DIR]](/icons/folder.gif) | 58379_Doorolla Ltd S..> | 2026-03-24 09:40 | - | |
![[DIR]](/icons/folder.gif) | 58392_MG Securical L..> | 2026-03-24 09:48 | - | |
![[DIR]](/icons/folder.gif) | 58397_Doorolla Ltd S..> | 2026-03-24 09:52 | - | |
![[DIR]](/icons/folder.gif) | 58408_Doorolla Ltd S..> | 2026-03-24 10:07 | - | |
![[DIR]](/icons/folder.gif) | 58412_Doorolla Ltd S..> | 2026-03-24 10:07 | - | |
![[DIR]](/icons/folder.gif) | 58423_Doorolla Ltd S..> | 2026-03-24 10:10 | - | |
![[DIR]](/icons/folder.gif) | 58438_GK Doors LTD T/ | 2026-03-24 10:18 | - | |
![[DIR]](/icons/folder.gif) | 58440_GK Doors LTD T/ | 2026-03-24 10:19 | - | |
![[DIR]](/icons/folder.gif) | 58501_GK Doors LTD T/ | 2026-03-24 12:01 | - | |
![[DIR]](/icons/folder.gif) | 58506_Doorolla Ltd S..> | 2026-03-24 12:12 | - | |
![[DIR]](/icons/folder.gif) | 58554_Doorolla Ltd S..> | 2026-03-24 13:09 | - | |
![[DIR]](/icons/folder.gif) | 58761_GK Doors LTD T/ | 2026-03-24 15:41 | - | |
![[DIR]](/icons/folder.gif) | 58763_GK Doors LTD T/ | 2026-03-24 15:41 | - | |
![[DIR]](/icons/folder.gif) | 58915_Excellent Ltd ..> | 2026-03-25 09:03 | - | |
![[DIR]](/icons/folder.gif) | 59155_GK Doors LTD T/ | 2026-03-25 13:17 | - | |
![[DIR]](/icons/folder.gif) | 59204_Excellent Ltd ..> | 2026-03-25 13:45 | - | |
![[DIR]](/icons/folder.gif) | 59216_GK Doors LTD T/ | 2026-03-25 13:52 | - | |
![[DIR]](/icons/folder.gif) | 59318_Doorolla Ltd S..> | 2026-03-26 08:25 | - | |
![[DIR]](/icons/folder.gif) | 59329_Doorolla Ltd S..> | 2026-03-26 08:41 | - | |
![[DIR]](/icons/folder.gif) | 59333_Doorolla Ltd S..> | 2026-03-26 08:43 | - | |
![[DIR]](/icons/folder.gif) | 59334_Doorolla Ltd S..> | 2026-03-26 08:44 | - | |
![[DIR]](/icons/folder.gif) | 59340_Doorolla Ltd S..> | 2026-03-26 08:47 | - | |
![[DIR]](/icons/folder.gif) | 59341_Doorolla Ltd S..> | 2026-03-26 08:50 | - | |
![[DIR]](/icons/folder.gif) | 59348_Doorolla Ltd S..> | 2026-03-26 08:53 | - | |
![[DIR]](/icons/folder.gif) | 59350_Doorolla Ltd S..> | 2026-03-26 08:54 | - | |
![[DIR]](/icons/folder.gif) | 59359_Doorolla Ltd S..> | 2026-03-26 08:57 | - | |
![[DIR]](/icons/folder.gif) | 59369_Doorolla Ltd S..> | 2026-03-26 09:08 | - | |
![[DIR]](/icons/folder.gif) | 59373_Doorolla Ltd S..> | 2026-03-26 09:11 | - | |
![[DIR]](/icons/folder.gif) | 59513_Chargepoint In..> | 2026-03-26 10:50 | - | |
![[DIR]](/icons/folder.gif) | 59726_GK Doors LTD T/ | 2026-03-26 15:21 | - | |
![[DIR]](/icons/folder.gif) | 59727_GK Doors LTD T/ | 2026-03-26 15:21 | - | |
![[DIR]](/icons/folder.gif) | 59737_GK Doors LTD T/ | 2026-03-26 15:26 | - | |
![[DIR]](/icons/folder.gif) | 59740_GK Doors LTD T/ | 2026-03-26 15:26 | - | |
![[DIR]](/icons/folder.gif) | 59933_Chargepoint In..> | 2026-03-27 08:48 | - | |
![[DIR]](/icons/folder.gif) | 59945_Right Choice M..> | 2026-03-27 09:14 | - | |
![[DIR]](/icons/folder.gif) | 59985_Right Choice M..> | 2026-03-27 10:00 | - | |
![[DIR]](/icons/folder.gif) | 60046_GK Doors LTD T/ | 2026-03-27 10:52 | - | |
![[DIR]](/icons/folder.gif) | 60214_GK Doors LTD T/ | 2026-03-27 13:46 | - | |
![[DIR]](/icons/folder.gif) | 60333_GK Doors LTD T/ | 2026-03-27 16:43 | - | |
![[DIR]](/icons/folder.gif) | 60445_GK Doors LTD T/ | 2026-03-30 08:52 | - | |
![[DIR]](/icons/folder.gif) | 60871_GK Doors LTD T/ | 2026-03-30 15:43 | - | |
![[DIR]](/icons/folder.gif) | 61237_Doorolla Ltd S..> | 2026-03-31 12:27 | - | |
![[DIR]](/icons/folder.gif) | 61363_Doorolla Ltd S..> | 2026-03-31 12:55 | - | |
![[DIR]](/icons/folder.gif) | 61451_Chargepoint In..> | 2026-03-31 13:47 | - | |
![[DIR]](/icons/folder.gif) | 61608_Admiral Home I..> | 2026-04-01 07:32 | - | |
![[DIR]](/icons/folder.gif) | 61882_Doorolla Ltd S..> | 2026-04-01 12:14 | - | |
![[DIR]](/icons/folder.gif) | 61885_Doorolla Ltd S..> | 2026-04-01 12:16 | - | |
![[DIR]](/icons/folder.gif) | 61887_Doorolla Ltd S..> | 2026-04-01 12:16 | - | |
![[DIR]](/icons/folder.gif) | 62028_Regal Windows ..> | 2026-04-01 16:02 | - | |
![[DIR]](/icons/folder.gif) | 62030_Regal Windows ..> | 2026-04-01 16:02 | - | |
![[DIR]](/icons/folder.gif) | 62177_Doorolla Ltd S..> | 2026-04-02 08:50 | - | |
![[DIR]](/icons/folder.gif) | 62210_Chargepoint In..> | 2026-04-02 09:24 | - | |
![[DIR]](/icons/folder.gif) | 62213_GK Doors LTD T/ | 2026-04-02 09:25 | - | |
![[DIR]](/icons/folder.gif) | 62216_GK Doors LTD T/ | 2026-04-02 09:27 | - | |
![[DIR]](/icons/folder.gif) | 62223_Regal Windows ..> | 2026-04-02 09:37 | - | |
![[DIR]](/icons/folder.gif) | 62475_Admiral Home I..> | 2026-04-02 14:19 | - | |
![[DIR]](/icons/folder.gif) | 62491_Admiral Home I..> | 2026-04-02 14:45 | - | |
![[DIR]](/icons/folder.gif) | 62508_Reklaw Doors L..> | 2026-04-02 15:32 | - | |
![[DIR]](/icons/folder.gif) | 62509_Reklaw Doors L..> | 2026-04-02 15:32 | - | |
![[DIR]](/icons/folder.gif) | 62530_Doorolla Ltd S..> | 2026-04-07 06:17 | - | |
![[DIR]](/icons/folder.gif) | 62570_Doorolla Ltd S..> | 2026-04-07 07:12 | - | |
![[DIR]](/icons/folder.gif) | 62574_Doorolla Ltd S..> | 2026-04-07 07:22 | - | |
![[DIR]](/icons/folder.gif) | 62666_Rhino Windows ..> | 2026-04-07 08:27 | - | |
![[DIR]](/icons/folder.gif) | 62667_Rhino Windows ..> | 2026-04-07 08:28 | - | |
![[DIR]](/icons/folder.gif) | 62820_GK Doors LTD T/ | 2026-04-07 10:46 | - | |
![[DIR]](/icons/folder.gif) | 62821_GK Doors LTD T/ | 2026-04-07 10:46 | - | |
![[DIR]](/icons/folder.gif) | 62857_Devlinc Ltd T/ | 2026-04-07 11:00 | - | |
![[DIR]](/icons/folder.gif) | 62899_Rhino Windows ..> | 2026-04-07 11:46 | - | |
![[DIR]](/icons/folder.gif) | 62901_Rhino Windows ..> | 2026-04-07 11:47 | - | |
![[DIR]](/icons/folder.gif) | 63033_Reklaw Doors L..> | 2026-04-07 13:24 | - | |
![[DIR]](/icons/folder.gif) | 63039_Lockdown Rolle..> | 2026-04-07 13:34 | - | |
![[DIR]](/icons/folder.gif) | 63242_Gilberts Home ..> | 2026-04-07 15:40 | - | |
![[DIR]](/icons/folder.gif) | 63246_Chargepoint In..> | 2026-04-07 15:48 | - | |
![[DIR]](/icons/folder.gif) | 63254_Chargepoint In..> | 2026-04-07 15:54 | - | |
![[DIR]](/icons/folder.gif) | 63257_Chargepoint In..> | 2026-04-08 06:27 | - | |
![[DIR]](/icons/folder.gif) | 63268_Chargepoint In..> | 2026-04-08 06:38 | - | |
![[DIR]](/icons/folder.gif) | 63269_Gilberts Home ..> | 2026-04-08 06:41 | - | |
![[DIR]](/icons/folder.gif) | 63322_Chargepoint In..> | 2026-04-08 07:45 | - | |
![[DIR]](/icons/folder.gif) | 63347_Chargepoint In..> | 2026-04-08 08:09 | - | |
![[DIR]](/icons/folder.gif) | 63350_GK Doors LTD T/ | 2026-04-08 08:13 | - | |
![[DIR]](/icons/folder.gif) | 63354_GK Doors LTD T/ | 2026-04-08 08:14 | - | |
![[DIR]](/icons/folder.gif) | 63356_GK Doors LTD T/ | 2026-04-08 08:15 | - | |
![[DIR]](/icons/folder.gif) | 63361_GK Doors LTD T/ | 2026-04-08 08:16 | - | |
![[DIR]](/icons/folder.gif) | 63363_GK Doors LTD T/ | 2026-04-08 08:17 | - | |
![[DIR]](/icons/folder.gif) | 63365_GK Doors LTD T/ | 2026-04-08 08:19 | - | |
![[DIR]](/icons/folder.gif) | 63425_Mick Dennis - ..> | 2026-04-08 09:09 | - | |
![[DIR]](/icons/folder.gif) | 63611_Chargepoint In..> | 2026-04-08 13:13 | - | |
![[DIR]](/icons/folder.gif) | 63724_Doorolla Ltd S..> | 2026-04-08 14:47 | - | |
![[DIR]](/icons/folder.gif) | 63726_Doorolla Ltd S..> | 2026-04-08 14:48 | - | |
![[DIR]](/icons/folder.gif) | 63728_Doorolla Ltd S..> | 2026-04-08 14:49 | - | |
![[DIR]](/icons/folder.gif) | 63731_Doorolla Ltd S..> | 2026-04-08 14:50 | - | |
![[DIR]](/icons/folder.gif) | 63737_Doorolla Ltd S..> | 2026-04-08 14:51 | - | |
![[DIR]](/icons/folder.gif) | 63767_Lockdown Rolle..> | 2026-04-08 15:30 | - | |
![[DIR]](/icons/folder.gif) | 63793_Doorolla Ltd S..> | 2026-04-09 06:16 | - | |
![[DIR]](/icons/folder.gif) | 63797_Doorolla Ltd S..> | 2026-04-09 06:19 | - | |
![[DIR]](/icons/folder.gif) | 63799_Doorolla Ltd S..> | 2026-04-09 06:20 | - | |
![[DIR]](/icons/folder.gif) | 64141_Devlinc Ltd T/ | 2026-04-09 13:53 | - | |
![[DIR]](/icons/folder.gif) | 64143_Devlinc Ltd T/ | 2026-04-09 13:53 | - | |
![[DIR]](/icons/folder.gif) | 64316_Doorolla Ltd S..> | 2026-04-10 07:45 | - | |
![[DIR]](/icons/folder.gif) | 64343_Regal Windows ..> | 2026-04-10 08:04 | - | |
![[DIR]](/icons/folder.gif) | 64392_MG Securical L..> | 2026-04-10 08:14 | - | |
![[DIR]](/icons/folder.gif) | 64395_Doorolla Ltd S..> | 2026-04-10 08:16 | - | |
![[DIR]](/icons/folder.gif) | 64405_Doorolla Ltd S..> | 2026-04-10 08:33 | - | |
![[DIR]](/icons/folder.gif) | 64516_Doorolla Ltd S..> | 2026-04-10 11:31 | - | |
![[DIR]](/icons/folder.gif) | 64536_Doorolla Ltd S..> | 2026-04-10 12:09 | - | |
![[DIR]](/icons/folder.gif) | 64594_Doorolla Ltd S..> | 2026-04-10 12:48 | - | |
![[DIR]](/icons/folder.gif) | 64595_Doorolla Ltd S..> | 2026-04-10 12:48 | - | |
![[DIR]](/icons/folder.gif) | 64700_Doorolla Ltd S..> | 2026-04-10 14:10 | - | |
![[DIR]](/icons/folder.gif) | 64824_Chargepoint In..> | 2026-04-13 07:36 | - | |
![[DIR]](/icons/folder.gif) | 65070_Chargepoint In..> | 2026-04-13 11:10 | - | |
![[DIR]](/icons/folder.gif) | 65075_Chargepoint In..> | 2026-04-13 11:16 | - | |
![[DIR]](/icons/folder.gif) | 65339_Doorolla Ltd S..> | 2026-04-14 07:39 | - | |
![[DIR]](/icons/folder.gif) | 65346_Doorolla Ltd S..> | 2026-04-14 07:42 | - | |
![[DIR]](/icons/folder.gif) | 65404_Chargepoint In..> | 2026-04-14 08:43 | - | |
![[DIR]](/icons/folder.gif) | 65476_Doorolla Ltd S..> | 2026-04-14 09:59 | - | |
![[DIR]](/icons/folder.gif) | 65893_Chargepoint In..> | 2026-04-14 16:01 | - | |
![[DIR]](/icons/folder.gif) | 65908_Doorolla Ltd S..> | 2026-04-15 06:24 | - | |
![[DIR]](/icons/folder.gif) | 66575_Doorolla Ltd S..> | 2026-04-16 10:34 | - | |
![[DIR]](/icons/folder.gif) | 66576_Doorolla Ltd S..> | 2026-04-16 10:37 | - | |
![[DIR]](/icons/folder.gif) | 66581_Doorolla Ltd S..> | 2026-04-16 10:43 | - | |
![[DIR]](/icons/folder.gif) | 66586_Doorolla Ltd S..> | 2026-04-16 10:49 | - | |
![[DIR]](/icons/folder.gif) | 66589_Doorolla Ltd S..> | 2026-04-16 10:54 | - | |
![[DIR]](/icons/folder.gif) | 66866_Chargepoint In..> | 2026-04-16 14:57 | - | |
![[DIR]](/icons/folder.gif) | 66906_Chargepoint In..> | 2026-04-16 16:03 | - | |
![[DIR]](/icons/folder.gif) | 66949_Mick Dennis - ..> | 2026-04-17 07:45 | - | |
![[DIR]](/icons/folder.gif) | 66958_Doorolla Ltd S..> | 2026-04-17 08:00 | - | |
![[DIR]](/icons/folder.gif) | 66964_Chargepoint In..> | 2026-04-17 08:02 | - | |
![[DIR]](/icons/folder.gif) | 66969_Chargepoint In..> | 2026-04-17 08:13 | - | |
![[DIR]](/icons/folder.gif) | 66981_Doorolla Ltd S..> | 2026-04-17 08:45 | - | |
![[DIR]](/icons/folder.gif) | 67148_Chargepoint In..> | 2026-04-17 10:43 | - | |
![[DIR]](/icons/folder.gif) | 67185_Devlinc Ltd T/ | 2026-04-17 11:21 | - | |
![[DIR]](/icons/folder.gif) | 67201_GK Doors LTD T/ | 2026-04-17 11:45 | - | |
![[DIR]](/icons/folder.gif) | 67345_Doorolla Ltd S..> | 2026-04-17 13:54 | - | |
![[DIR]](/icons/folder.gif) | 67346_Doorolla Ltd S..> | 2026-04-17 13:54 | - | |
![[DIR]](/icons/folder.gif) | 67359_Doorolla Ltd S..> | 2026-04-17 14:13 | - | |
![[DIR]](/icons/folder.gif) | 67405_Chargepoint In..> | 2026-04-17 15:33 | - | |
![[DIR]](/icons/folder.gif) | 67634_Devlinc Ltd T/ | 2026-04-20 08:47 | - | |
![[DIR]](/icons/folder.gif) | 67635_Devlinc Ltd T/ | 2026-04-20 08:48 | - | |
![[DIR]](/icons/folder.gif) | 67636_Devlinc Ltd T/ | 2026-04-20 08:48 | - | |
![[DIR]](/icons/folder.gif) | 67637_Devlinc Ltd T/ | 2026-04-20 08:49 | - | |
![[DIR]](/icons/folder.gif) | 67827_Kenmar Propert..> | 2026-04-20 12:40 | - | |
![[DIR]](/icons/folder.gif) | 67828_Kenmar Propert..> | 2026-04-20 12:42 | - | |
![[DIR]](/icons/folder.gif) | 67953_GK Doors LTD T/ | 2026-04-20 14:45 | - | |
![[DIR]](/icons/folder.gif) | 68102_Doorolla Ltd S..> | 2026-04-21 07:27 | - | |
![[DIR]](/icons/folder.gif) | 68125_Chargepoint In..> | 2026-04-21 07:32 | - | |
![[DIR]](/icons/folder.gif) | 68134_Chargepoint In..> | 2026-04-21 07:33 | - | |
![[DIR]](/icons/folder.gif) | 68301_Mick Dennis - ..> | 2026-04-21 09:47 | - | |
![[DIR]](/icons/folder.gif) | 68491_Doorolla Ltd S..> | 2026-04-21 12:49 | - | |
![[DIR]](/icons/folder.gif) | 68661_Doorolla Ltd S..> | 2026-04-21 14:10 | - | |
![[DIR]](/icons/folder.gif) | 68693_Chargepoint In..> | 2026-04-21 14:44 | - | |
![[DIR]](/icons/folder.gif) | 68760_Chargepoint In..> | 2026-04-22 07:05 | - | |
![[DIR]](/icons/folder.gif) | 68761_Chargepoint In..> | 2026-04-22 07:06 | - | |
![[DIR]](/icons/folder.gif) | 68891_Devlinc Ltd T/ | 2026-04-22 09:26 | - | |
![[DIR]](/icons/folder.gif) | 69282_GK Doors LTD T/ | 2026-04-23 07:47 | - | |
![[DIR]](/icons/folder.gif) | 69292_GK Doors LTD T/ | 2026-04-23 07:52 | - | |
![[DIR]](/icons/folder.gif) | 69382_Devlinc Ltd T/ | 2026-04-23 09:37 | - | |
![[DIR]](/icons/folder.gif) | 69385_Devlinc Ltd T/ | 2026-04-23 09:39 | - | |
![[DIR]](/icons/folder.gif) | 69584_GK Doors LTD T/ | 2026-04-23 13:59 | - | |
![[DIR]](/icons/folder.gif) | 69726_Doorolla Ltd S..> | 2026-04-24 07:03 | - | |
![[DIR]](/icons/folder.gif) | 69731_Doorolla Ltd S..> | 2026-04-24 07:11 | - | |
![[DIR]](/icons/folder.gif) | 69740_Doorolla Ltd S..> | 2026-04-24 07:23 | - | |
![[DIR]](/icons/folder.gif) | 69777_Go Direct Door..> | 2026-04-24 08:08 | - | |
![[DIR]](/icons/folder.gif) | 69778_Go Direct Door..> | 2026-04-24 08:08 | - | |
![[DIR]](/icons/folder.gif) | 69779_Go Direct Door..> | 2026-04-24 08:09 | - | |
![[DIR]](/icons/folder.gif) | 69825_Gilberts Home ..> | 2026-04-24 08:39 | - | |
![[DIR]](/icons/folder.gif) | 69848_Go Direct Door..> | 2026-04-24 08:52 | - | |
![[DIR]](/icons/folder.gif) | 69869_Doorolla Ltd S..> | 2026-04-24 09:14 | - | |
![[DIR]](/icons/folder.gif) | 69889_Chargepoint In..> | 2026-04-24 09:23 | - | |
![[DIR]](/icons/folder.gif) | 69891_Chargepoint In..> | 2026-04-24 09:24 | - | |
![[DIR]](/icons/folder.gif) | 70043_Wellingborough..> | 2026-04-24 12:02 | - | |
![[DIR]](/icons/folder.gif) | 70051_ASM Windows Ad..> | 2026-04-24 12:22 | - | |
![[DIR]](/icons/folder.gif) | 70097_GK Doors LTD T/ | 2026-04-24 13:38 | - | |
![[DIR]](/icons/folder.gif) | 70125_GK Doors LTD T/ | 2026-04-24 13:59 | - | |
![[DIR]](/icons/folder.gif) | 70126_GK Doors LTD T/ | 2026-04-24 14:00 | - | |
![[DIR]](/icons/folder.gif) | 70132_ASM Windows Ad..> | 2026-04-24 14:15 | - | |
![[DIR]](/icons/folder.gif) | 70137_ASM Windows Ad..> | 2026-04-24 14:16 | - | |
![[DIR]](/icons/folder.gif) | 70138_ASM Windows Ad..> | 2026-04-24 14:17 | - | |
![[DIR]](/icons/folder.gif) | 70146_GK Doors LTD T/ | 2026-04-24 14:26 | - | |
![[ ]](/icons/layout.gif) | 33453_Statement_14-0..> | 2026-01-14 16:54 | 9.7K | |
![[ ]](/icons/layout.gif) | 38436_Statement_29-0..> | 2026-01-29 13:33 | 9.8K | |
![[ ]](/icons/layout.gif) | 38448_Statement_29-0..> | 2026-01-29 13:41 | 9.9K | |
![[ ]](/icons/layout.gif) | 33451_Statement_14-0..> | 2026-01-14 16:51 | 9.9K | |
![[ ]](/icons/layout.gif) | 2713_Rollermatic Gar..> | 2025-10-07 11:26 | 9.9K | |
![[ ]](/icons/layout.gif) | 28227_Doorolla Ltd S..> | 2025-12-19 11:59 | 10K | |
![[ ]](/icons/layout.gif) | 28230_Doorolla Ltd S..> | 2025-12-19 12:01 | 10K | |
![[ ]](/icons/layout.gif) | 38435_Statement_29-0..> | 2026-01-29 13:30 | 10K | |
![[ ]](/icons/layout.gif) | 34149_Statement_16-0..> | 2026-01-16 09:10 | 10K | |
![[ ]](/icons/layout.gif) | 14706_Alex Butler - ..> | 2025-11-12 16:09 | 10K | |
![[ ]](/icons/layout.gif) | 15019_Ian Lamonby - ..> | 2025-11-13 13:11 | 10K | |
![[ ]](/icons/layout.gif) | 14316_Frank Barker -..> | 2025-11-12 09:09 | 10K | |
![[ ]](/icons/layout.gif) | 13844_PJ.Munn Darren..> | 2025-11-11 13:23 | 10K | |
![[ ]](/icons/layout.gif) | 13849_PJ.Munn Darren..> | 2025-11-11 13:24 | 10K | |
![[ ]](/icons/layout.gif) | 13803_Nicola Vaughan..> | 2025-11-11 11:54 | 10K | |
![[ ]](/icons/layout.gif) | 14320_Tim Willis - R..> | 2025-11-12 09:12 | 10K | |
![[ ]](/icons/layout.gif) | 14170_Barker - Marty..> | 2025-11-12 07:22 | 10K | |
![[ ]](/icons/layout.gif) | 13894_CRS Maintenanc..> | 2025-11-11 13:43 | 10K | |
![[ ]](/icons/layout.gif) | 14114_Paul Leo - ORD..> | 2025-11-11 16:23 | 10K | |
![[ ]](/icons/layout.gif) | 14923_Terry Barker -..> | 2025-11-13 10:50 | 10K | |
![[ ]](/icons/layout.gif) | 28232_Doorolla Ltd S..> | 2025-12-19 12:02 | 10K | |
![[ ]](/icons/layout.gif) | 14928_Philip Cole - ..> | 2025-11-13 10:52 | 10K | |
![[ ]](/icons/layout.gif) | 28143_Rollermatic Ga..> | 2025-12-19 10:31 | 10K | |
![[ ]](/icons/layout.gif) | 15034_NBC Commercial..> | 2025-11-13 13:35 | 10K | |
![[ ]](/icons/layout.gif) | 14548_Steve Stagg - ..> | 2025-11-12 12:16 | 10K | |
![[ ]](/icons/layout.gif) | 14357_Christopher Ho..> | 2025-11-12 09:38 | 10K | |
![[ ]](/icons/layout.gif) | 14358_Christopher Ho..> | 2025-11-12 09:38 | 10K | |
![[ ]](/icons/layout.gif) | 13540_South Atlantic..> | 2025-11-11 07:41 | 10K | |
![[ ]](/icons/layout.gif) | 14485_Tony Evans - O..> | 2025-11-12 11:45 | 10K | |
![[ ]](/icons/layout.gif) | 13990_Piper Window S..> | 2025-11-11 14:34 | 10K | |
![[ ]](/icons/layout.gif) | 14497_James Sumner -..> | 2025-11-12 11:50 | 10K | |
![[ ]](/icons/layout.gif) | 36669_Roll Right Gar..> | 2026-01-23 15:24 | 10K | |
![[ ]](/icons/layout.gif) | 14398_LNR Door Solut..> | 2025-11-12 10:48 | 10K | |
![[ ]](/icons/layout.gif) | 13628_C&M Glass Serv..> | 2025-11-11 09:13 | 10K | |
![[ ]](/icons/layout.gif) | 14953_Mark Riggal El..> | 2025-11-13 11:33 | 10K | |
![[ ]](/icons/layout.gif) | 25473_J Brady Garage..> | 2025-12-12 10:46 | 10K | |
![[ ]](/icons/layout.gif) | 28140_Rollermatic Ga..> | 2025-12-19 10:25 | 10K | |
![[ ]](/icons/layout.gif) | 28137_Rollermatic Ga..> | 2025-12-19 10:15 | 10K | |
![[ ]](/icons/layout.gif) | 13899_Ace Garage Doo..> | 2025-11-11 13:48 | 10K | |
![[ ]](/icons/layout.gif) | 13909_Ace Garage Doo..> | 2025-11-11 13:52 | 10K | |
![[ ]](/icons/layout.gif) | 13919_Ace Garage Doo..> | 2025-11-11 14:04 | 10K | |
![[ ]](/icons/layout.gif) | 14137_Hunn Security ..> | 2025-11-11 16:43 | 10K | |
![[ ]](/icons/layout.gif) | 29163_Glenhurst Door..> | 2025-12-23 15:08 | 10K | |
![[ ]](/icons/layout.gif) | 13568_Zest Propertie..> | 2025-11-11 07:56 | 10K | |
![[ ]](/icons/layout.gif) | 14411_Glynn Banks - ..> | 2025-11-12 10:57 | 10K | |
![[ ]](/icons/layout.gif) | 43734_T D Rollerdoor..> | 2026-02-13 14:48 | 10K | |
![[ ]](/icons/layout.gif) | 13558_J Bowman Garag..> | 2025-11-11 07:52 | 10K | |
![[ ]](/icons/layout.gif) | 13551_J Bowman Garag..> | 2025-11-11 07:51 | 10K | |
![[ ]](/icons/layout.gif) | 36664_Eastern Frames..> | 2026-01-23 15:18 | 10K | |
![[ ]](/icons/layout.gif) | 14802_Replacement Ga..> | 2025-11-13 09:13 | 10K | |
![[ ]](/icons/layout.gif) | 14801_Replacement Ga..> | 2025-11-13 09:12 | 10K | |
![[ ]](/icons/layout.gif) | 14804_Replacement Ga..> | 2025-11-13 09:13 | 10K | |
![[ ]](/icons/layout.gif) | 38972_Statement_30-0..> | 2026-01-30 14:48 | 10K | |
![[ ]](/icons/layout.gif) | 15106_J Bowman Garag..> | 2025-11-13 15:48 | 10K | |
![[ ]](/icons/layout.gif) | 14914_TND Garage Doo..> | 2025-11-13 10:45 | 10K | |
![[ ]](/icons/layout.gif) | 14531_Hereford Mobil..> | 2025-11-12 12:07 | 10K | |
![[ ]](/icons/layout.gif) | 14192_Roll Right Gar..> | 2025-11-12 07:40 | 10K | |
![[ ]](/icons/layout.gif) | 799_Hanney Glazed Lt..> | 2025-09-24 15:52 | 10K | |
![[ ]](/icons/layout.gif) | 15116_Go Garage Door..> | 2025-11-13 15:51 | 10K | |
![[ ]](/icons/layout.gif) | 15112_Go Garage Door..> | 2025-11-13 15:50 | 10K | |
![[ ]](/icons/layout.gif) | 14771_M. A. E. Windo..> | 2025-11-13 08:45 | 10K | |
![[ ]](/icons/layout.gif) | 29249_Fortress Doors..> | 2025-12-24 11:26 | 10K | |
![[ ]](/icons/layout.gif) | 14768_Serenade Home ..> | 2025-11-13 08:42 | 10K | |
![[ ]](/icons/layout.gif) | 14184_The Lothian Ga..> | 2025-11-12 07:35 | 10K | |
![[ ]](/icons/layout.gif) | 32605_Rollermatic Ga..> | 2026-01-13 09:23 | 10K | |
![[ ]](/icons/layout.gif) | 14219_Avon Automated..> | 2025-11-12 08:07 | 10K | |
![[ ]](/icons/layout.gif) | 14221_Avon Automated..> | 2025-11-12 08:08 | 10K | |
![[ ]](/icons/layout.gif) | 33666_UK Rollerdoors..> | 2026-01-15 10:43 | 10K | |
![[ ]](/icons/layout.gif) | 33659_Chelmsford Rol..> | 2026-01-15 10:37 | 10K | |
![[ ]](/icons/layout.gif) | 33429_Statement_14-0..> | 2026-01-14 16:37 | 11K | |
![[ ]](/icons/layout.gif) | 1180_Roz Taylor - TA..> | 2025-09-29 08:37 | 11K | |
![[ ]](/icons/layout.gif) | 38440_Statement_29-0..> | 2026-01-29 13:40 | 11K | |
![[ ]](/icons/layout.gif) | 36676_J Brady Garage..> | 2026-01-23 15:34 | 11K | |
![[ ]](/icons/layout.gif) | 38989_J Brady Garage..> | 2026-01-30 15:12 | 11K | |
![[ ]](/icons/layout.gif) | 43714_J Brady Garage..> | 2026-02-13 14:14 | 11K | |
![[ ]](/icons/layout.gif) | 1613_ASM Windows Ada..> | 2025-10-01 13:45 | 11K | |
![[ ]](/icons/layout.gif) | 42318_The Lothian Ga..> | 2026-02-10 14:03 | 11K | |
![[ ]](/icons/layout.gif) | 39757_S.Cosgrove Ste..> | 2026-02-03 10:10 | 11K | |
![[ ]](/icons/layout.gif) | 5305_Avon Automated ..> | 2025-10-16 10:43 | 11K | |
![[ ]](/icons/layout.gif) | 16031_NW Automatic D..> | 2025-11-17 12:30 | 11K | |
![[ ]](/icons/layout.gif) | 1381_The Lothian Gar..> | 2025-09-30 10:14 | 11K | |
![[ ]](/icons/layout.gif) | 18761_Elevate Doors ..> | 2025-11-24 15:24 | 11K | |
![[ ]](/icons/layout.gif) | 42123_Hanney Glazed ..> | 2026-02-10 10:18 | 11K | |
![[ ]](/icons/layout.gif) | 1331_Dave Edwards - ..> | 2025-09-29 15:47 | 11K | |
![[ ]](/icons/layout.gif) | 1630_[0,0] Andy Sedd..> | 2025-10-01 14:11 | 11K | |
![[ ]](/icons/layout.gif) | 67357_NW Automatic D..> | 2026-04-17 14:06 | 11K | |
![[ ]](/icons/layout.gif) | 302_Prime Shutters L..> | 2025-09-19 12:28 | 11K | |
![[ ]](/icons/layout.gif) | 32650_Statement_13-0..> | 2026-01-13 10:54 | 11K | |
![[ ]](/icons/layout.gif) | 1606_Elevate Doors L..> | 2025-10-01 13:20 | 11K | |
![[ ]](/icons/layout.gif) | 1417_Rollermatic Gar..> | 2025-09-30 13:04 | 11K | |
![[ ]](/icons/layout.gif) | 1793_[0,0] Avon Aut..> | 2025-10-02 12:11 | 11K | |
![[ ]](/icons/layout.gif) | 43237_Norfolk Broads..> | 2026-02-12 15:42 | 11K | |
![[ ]](/icons/layout.gif) | 24407_NW Automatic D..> | 2025-12-09 13:00 | 11K | |
![[ ]](/icons/layout.gif) | 10989_Harrogate Home..> | 2025-11-03 15:53 | 11K | |
![[ ]](/icons/layout.gif) | 38652_Statement_30-0..> | 2026-01-30 08:00 | 11K | |
![[ ]](/icons/layout.gif) | 26649_SDS (Isle Of M..> | 2025-12-16 08:25 | 11K | |
![[ ]](/icons/layout.gif) | 2272_Ideal Industria..> | 2025-10-06 10:20 | 11K | |
![[ ]](/icons/layout.gif) | 41687_Statement_09-0..> | 2026-02-09 12:49 | 11K | |
![[ ]](/icons/layout.gif) | 28490_Wokingham Glaz..> | 2025-12-22 09:56 | 11K | |
![[ ]](/icons/layout.gif) | 33459_Statement_14-0..> | 2026-01-14 17:00 | 11K | |
![[ ]](/icons/layout.gif) | 38454_Statement_29-0..> | 2026-01-29 13:43 | 11K | |
![[ ]](/icons/layout.gif) | 38964_Fortress Doors..> | 2026-01-30 14:37 | 11K | |
![[ ]](/icons/layout.gif) | 42225_Keith Worboys ..> | 2026-02-10 11:50 | 11K | |
![[ ]](/icons/layout.gif) | 39755_Fortress Doors..> | 2026-02-03 10:08 | 11K | |
![[ ]](/icons/layout.gif) | 63811_Fortress Doors..> | 2026-04-09 06:42 | 11K | |
![[ ]](/icons/layout.gif) | 38556_SDS (Isle Of M..> | 2026-01-29 15:10 | 11K | |
![[ ]](/icons/layout.gif) | 17258_NBG Doors Nick..> | 2025-11-19 13:32 | 11K | |
![[ ]](/icons/layout.gif) | 17396_NBG Doors Nick..> | 2025-11-20 07:42 | 11K | |
![[ ]](/icons/layout.gif) | 34774_Elevate Doors ..> | 2026-01-19 15:01 | 11K | |
![[ ]](/icons/layout.gif) | 34775_Elevate Doors ..> | 2026-01-19 15:03 | 11K | |
![[ ]](/icons/layout.gif) | 50696_Danbury Garage..> | 2026-03-04 10:01 | 11K | |
![[ ]](/icons/layout.gif) | 5412_C&M Glass Servi..> | 2025-10-16 12:38 | 11K | |
![[ ]](/icons/layout.gif) | 18730_Easyroll Garag..> | 2025-11-24 14:33 | 11K | |
![[ ]](/icons/layout.gif) | 57676_CPS Custom Pro..> | 2026-03-20 16:36 | 11K | |
![[ ]](/icons/layout.gif) | 53260_J Bowman Garag..> | 2026-03-10 12:57 | 11K | |
![[ ]](/icons/layout.gif) | 53160_Fortress Doors..> | 2026-03-10 11:17 | 11K | |
![[ ]](/icons/layout.gif) | 9639_C & M Glass Chr..> | 2025-08-26 13:15 | 11K | |
![[ ]](/icons/layout.gif) | 64232_Danbury Garage..> | 2026-04-09 15:40 | 11K | |
![[ ]](/icons/layout.gif) | 4213_[0,0] Jason Wal..> | 2025-10-13 11:23 | 11K | |
![[ ]](/icons/layout.gif) | 47756_Statement_24-0..> | 2026-02-24 15:15 | 11K | |
![[ ]](/icons/layout.gif) | 9651_Hanney Glazed L..> | 2025-08-26 13:33 | 11K | |
![[ ]](/icons/layout.gif) | 5027_Academy Windows..> | 2025-10-15 13:55 | 11K | |
![[ ]](/icons/layout.gif) | 61918_Rolladoor NR9 ..> | 2026-04-01 12:46 | 11K | |
![[ ]](/icons/layout.gif) | 997_Danbury Garage D..> | 2025-09-26 09:53 | 11K | |
![[ ]](/icons/layout.gif) | 56733_Elite Glazing ..> | 2026-03-19 09:41 | 11K | |
![[ ]](/icons/layout.gif) | 56736_Elite Glazing ..> | 2026-03-19 09:43 | 11K | |
![[ ]](/icons/layout.gif) | 53742_J Bowman Garag..> | 2026-03-11 10:42 | 11K | |
![[ ]](/icons/layout.gif) | 36174_JCHI LTD - JCH..> | 2026-01-22 15:11 | 11K | |
![[ ]](/icons/layout.gif) | 55033_Go Direct Door..> | 2026-03-13 16:20 | 11K | |
![[ ]](/icons/layout.gif) | 2782_Elevate Doors L..> | 2025-10-07 14:04 | 11K | |
![[ ]](/icons/layout.gif) | 36732_Danbury Garage..> | 2026-01-26 07:49 | 11K | |
![[ ]](/icons/layout.gif) | 16188_Gary Dowse - D..> | 2025-11-17 16:12 | 11K | |
![[ ]](/icons/layout.gif) | 63516_Go Direct Door..> | 2026-04-08 10:50 | 11K | |
![[ ]](/icons/layout.gif) | 12561_Barbara Baker ..> | 2025-11-06 16:22 | 11K | |
![[ ]](/icons/layout.gif) | 56765_Elevate Doors ..> | 2026-03-19 10:11 | 11K | |
![[ ]](/icons/layout.gif) | 2795_The Lothian Gar..> | 2025-10-07 14:48 | 11K | |
![[ ]](/icons/layout.gif) | 44627_Lewis Taylor -..> | 2026-02-17 09:23 | 11K | |
![[ ]](/icons/layout.gif) | 57024_D Thurston Bui..> | 2026-03-19 14:57 | 11K | |
![[ ]](/icons/layout.gif) | 62518_J Brady Garage..> | 2026-04-02 16:03 | 11K | |
![[ ]](/icons/layout.gif) | 33466_Prestige Windo..> | 2026-01-15 07:47 | 11K | |
![[ ]](/icons/layout.gif) | 2481_The Lothian Gar..> | 2025-10-06 14:16 | 11K | |
![[ ]](/icons/layout.gif) | 58344_Clive Bailey -..> | 2026-03-24 09:09 | 11K | |
![[ ]](/icons/layout.gif) | 28922_Gary Frost - F..> | 2025-12-23 09:38 | 11K | |
![[ ]](/icons/layout.gif) | 8568_CWD Improvement..> | 2025-10-27 15:08 | 11K | |
![[ ]](/icons/layout.gif) | 14678_Danbury Garage..> | 2025-11-12 15:19 | 11K | |
![[ ]](/icons/layout.gif) | 46860_Gordon Kerr - ..> | 2026-02-20 15:11 | 11K | |
![[ ]](/icons/layout.gif) | 66436_Go Direct Door..> | 2026-04-16 07:24 | 11K | |
![[ ]](/icons/layout.gif) | 47405_DJM Fork Truck..> | 2026-02-24 08:25 | 11K | |
![[ ]](/icons/layout.gif) | 59250_ANDREW WALKER ..> | 2026-03-25 14:48 | 11K | |
![[ ]](/icons/layout.gif) | 40628_Elevate Doors ..> | 2026-02-04 16:21 | 11K | |
![[ ]](/icons/layout.gif) | 13191_Norfolk Broads..> | 2025-11-10 10:14 | 11K | |
![[ ]](/icons/layout.gif) | 69885_Todd Pugh - PU..> | 2026-04-24 09:21 | 11K | |
![[ ]](/icons/layout.gif) | 3887_Jody Baxter - B..> | 2025-10-10 12:44 | 11K | |
![[ ]](/icons/layout.gif) | 17128_Chiltern Doors..> | 2025-11-19 11:01 | 11K | |
![[ ]](/icons/layout.gif) | 18196_Dream Installa..> | 2025-11-21 13:06 | 11K | |
![[ ]](/icons/layout.gif) | 10975_Lewis - LEWI00..> | 2025-11-03 15:36 | 11K | |
![[ ]](/icons/layout.gif) | 70266_TPS Gates & Do..> | 2026-04-24 15:44 | 11K | |
![[ ]](/icons/layout.gif) | 5818_The Lothian Gar..> | 2025-10-17 10:48 | 11K | |
![[ ]](/icons/layout.gif) | 22218_J Brady Garage..> | 2025-12-02 17:14 | 11K | |
![[ ]](/icons/layout.gif) | 69508_C Marl Systems..> | 2026-04-23 12:41 | 11K | |
![[ ]](/icons/layout.gif) | 8659_Edward Denston ..> | 2025-10-27 16:40 | 11K | |
![[ ]](/icons/layout.gif) | 2418_David Punt - PU..> | 2025-10-06 12:56 | 11K | |
![[ ]](/icons/layout.gif) | 3788_M Lewis - LEWI0..> | 2025-10-10 10:54 | 11K | |
![[ ]](/icons/layout.gif) | 42841_Falcon Windows..> | 2026-02-11 16:58 | 11K | |
![[ ]](/icons/layout.gif) | 50690_Danbury Garage..> | 2026-03-04 09:57 | 11K | |
![[ ]](/icons/layout.gif) | 2239_Robert Cox - CO..> | 2025-10-06 08:51 | 11K | |
![[ ]](/icons/layout.gif) | 8364_Joe Round - ROU..> | 2025-10-27 12:02 | 11K | |
![[ ]](/icons/layout.gif) | 33539_A Miles Buildi..> | 2026-01-15 09:42 | 11K | |
![[ ]](/icons/layout.gif) | 4948_Ray Clarke - CL..> | 2025-10-15 12:22 | 11K | |
![[ ]](/icons/layout.gif) | 2102_Lionel Mewton -..> | 2025-10-03 12:20 | 12K | |
![[ ]](/icons/layout.gif) | 2667_Richard Hoyle -..> | 2025-10-07 09:52 | 12K | |
![[ ]](/icons/layout.gif) | 23793_Fortress Doors..> | 2025-12-08 11:17 | 12K | |
![[ ]](/icons/layout.gif) | 11146_Kevin Slater -..> | 2025-11-04 09:56 | 12K | |
![[ ]](/icons/layout.gif) | 5362_Ryan Hawley - H..> | 2025-10-16 11:58 | 12K | |
![[ ]](/icons/layout.gif) | 5374_Ben Lovell - LO..> | 2025-10-16 12:04 | 12K | |
![[ ]](/icons/layout.gif) | 20206_Ian Gaynor - G..> | 2025-11-27 10:55 | 12K | |
![[ ]](/icons/layout.gif) | 565_Aidan Murphy - M..> | 2025-09-23 12:05 | 12K | |
![[ ]](/icons/layout.gif) | 569_Steve Watts - WA..> | 2025-09-23 12:29 | 12K | |
![[ ]](/icons/layout.gif) | 1009_Rodger Gooding ..> | 2025-09-26 10:59 | 12K | |
![[ ]](/icons/layout.gif) | 2245_Russell White -..> | 2025-10-06 09:04 | 12K | |
![[ ]](/icons/layout.gif) | 2352_Steve Marriott ..> | 2025-10-06 11:44 | 12K | |
![[ ]](/icons/layout.gif) | 10793_Brian Hooper -..> | 2025-11-03 12:27 | 12K | |
![[ ]](/icons/layout.gif) | 11009_Alan Dobson - ..> | 2025-11-03 16:11 | 12K | |
![[ ]](/icons/layout.gif) | 10249_Carol Izatt - ..> | 2025-10-31 11:39 | 12K | |
![[ ]](/icons/layout.gif) | 1900_[0,0] Levart -..> | 2025-10-02 15:32 | 12K | |
![[ ]](/icons/layout.gif) | 2474_Ivan McDermott ..> | 2025-10-06 14:03 | 12K | |
![[ ]](/icons/layout.gif) | 8355_Kev Taylor - TA..> | 2025-10-27 11:56 | 12K | |
![[ ]](/icons/layout.gif) | 37810_Michael Mazur ..> | 2026-01-28 10:05 | 12K | |
![[ ]](/icons/layout.gif) | 8381_D Thurston Buil..> | 2025-10-27 12:12 | 12K | |
![[ ]](/icons/layout.gif) | 56104_Fortress Doors..> | 2026-03-17 16:42 | 12K | |
![[ ]](/icons/layout.gif) | 51978_Jurassic Doors..> | 2026-03-06 11:19 | 12K | |
![[ ]](/icons/layout.gif) | 61203_Matt Galway - ..> | 2026-03-31 11:41 | 12K | |
![[ ]](/icons/layout.gif) | 59278_Jurassic Doors..> | 2026-03-25 15:40 | 12K | |
![[ ]](/icons/layout.gif) | 3946_Leonard Harriso..> | 2025-10-10 13:52 | 12K | |
![[ ]](/icons/layout.gif) | 3111_Roy Roynting - ..> | 2025-10-08 12:23 | 12K | |
![[ ]](/icons/layout.gif) | 5436_Shaun Craft - C..> | 2025-10-16 12:59 | 12K | |
![[ ]](/icons/layout.gif) | 58346_S R W Services..> | 2026-03-24 09:10 | 12K | |
![[ ]](/icons/layout.gif) | 67963_Brian Wallace ..> | 2026-04-20 14:49 | 12K | |
![[ ]](/icons/layout.gif) | 2109_Timothy Noakes ..> | 2025-10-03 12:25 | 12K | |
![[ ]](/icons/layout.gif) | 13323_John Cuthberts..> | 2025-11-10 13:19 | 12K | |
![[ ]](/icons/layout.gif) | 5852_Simon Yeomans -..> | 2025-10-17 11:38 | 12K | |
![[ ]](/icons/layout.gif) | 2755_Trevor Rolfe - ..> | 2025-10-07 12:59 | 12K | |
![[ ]](/icons/layout.gif) | 15537_Ffenestri Amlw..> | 2025-11-14 13:44 | 12K | |
![[ ]](/icons/layout.gif) | 987_Nigel Travis - T..> | 2025-09-26 08:49 | 12K | |
![[ ]](/icons/layout.gif) | 2303_David Goodhew -..> | 2025-10-06 11:05 | 12K | |
![[ ]](/icons/layout.gif) | 12683_Catherine Evan..> | 2025-11-07 09:15 | 12K | |
![[ ]](/icons/layout.gif) | 558_Ian Prior - PRIO..> | 2025-09-23 11:57 | 12K | |
![[ ]](/icons/layout.gif) | 8372_Metcalfe - METC..> | 2025-10-27 12:07 | 12K | |
![[ ]](/icons/layout.gif) | 718_Heather Foster -..> | 2025-09-24 10:34 | 12K | |
![[ ]](/icons/layout.gif) | 42833_Go Direct Door..> | 2026-02-11 16:44 | 12K | |
![[ ]](/icons/layout.gif) | 592_Gary Pont - PONT..> | 2025-09-23 14:25 | 12K | |
![[ ]](/icons/layout.gif) | 11804_Gerrard Collin..> | 2025-11-05 11:19 | 12K | |
![[ ]](/icons/layout.gif) | 1668_Wilkins - WILK0..> | 2025-10-01 15:28 | 12K | |
![[ ]](/icons/layout.gif) | 10771_James Anderson..> | 2025-11-03 12:10 | 12K | |
![[ ]](/icons/layout.gif) | 2796_The Lothian Gar..> | 2025-10-07 14:49 | 12K | |
![[ ]](/icons/layout.gif) | 2376_Michael Selby -..> | 2025-10-06 12:13 | 12K | |
![[ ]](/icons/layout.gif) | 9345_Gary Edgar - ED..> | 2025-10-29 12:00 | 12K | |
![[ ]](/icons/layout.gif) | 10823_Alan Pattison ..> | 2025-11-03 13:03 | 12K | |
![[ ]](/icons/layout.gif) | 12897_Norfolk Broads..> | 2025-11-07 16:32 | 12K | |
![[ ]](/icons/layout.gif) | 64499_East Anglia Ro..> | 2026-04-10 11:15 | 12K | |
![[ ]](/icons/layout.gif) | 11766_Brenda Bussey ..> | 2025-11-05 11:05 | 12K | |
![[ ]](/icons/layout.gif) | 11774_Brenda Bussey ..> | 2025-11-05 11:10 | 12K | |
![[ ]](/icons/layout.gif) | 58162_Simon Marshall..> | 2026-03-23 15:29 | 12K | |
![[ ]](/icons/layout.gif) | 2384_Sara Morris - M..> | 2025-10-06 12:27 | 12K | |
![[ ]](/icons/layout.gif) | 61479_WADE WINDOWS I..> | 2026-03-31 14:26 | 12K | |
![[ ]](/icons/layout.gif) | 4139_The Lothian Gar..> | 2025-10-13 10:27 | 12K | |
![[ ]](/icons/layout.gif) | 4294_David Heckford ..> | 2025-10-13 13:20 | 12K | |
![[ ]](/icons/layout.gif) | 11789_Pete Metcalfe ..> | 2025-11-05 11:14 | 12K | |
![[ ]](/icons/layout.gif) | 10625_Kenneth Jones ..> | 2025-11-03 09:52 | 12K | |
![[ ]](/icons/layout.gif) | 590_Trevor Gibson - ..> | 2025-09-23 14:23 | 12K | |
![[ ]](/icons/layout.gif) | 2404_Simon Dobson - ..> | 2025-10-06 12:41 | 12K | |
![[ ]](/icons/layout.gif) | 9943_Ewan Robertson ..> | 2025-10-30 15:48 | 12K | |
![[ ]](/icons/layout.gif) | 50628_M. A. E. Windo..> | 2026-03-04 09:11 | 12K | |
![[ ]](/icons/layout.gif) | 10636_Kevin Credland..> | 2025-11-03 10:04 | 12K | |
![[ ]](/icons/layout.gif) | 39836_Eclipse Doors ..> | 2026-02-03 11:15 | 12K | |
![[ ]](/icons/layout.gif) | 66233_SDS (Isle Of M..> | 2026-04-15 12:02 | 12K | |
![[ ]](/icons/layout.gif) | 8320_Phillip Holland..> | 2025-10-27 11:48 | 12K | |
![[ ]](/icons/layout.gif) | 9735_Hobbs - Straps ..> | 2025-10-30 11:02 | 12K | |
![[ ]](/icons/layout.gif) | 9743_Hobbs - Straps ..> | 2025-10-30 11:09 | 12K | |
![[ ]](/icons/layout.gif) | 12824_Hobbs - Straps..> | 2025-11-07 12:37 | 12K | |
![[ ]](/icons/layout.gif) | 47406_DJM Fork Truck..> | 2026-02-24 08:26 | 12K | |
![[ ]](/icons/layout.gif) | 10833_Ashley Fieldho..> | 2025-11-03 13:11 | 12K | |
![[ ]](/icons/layout.gif) | 50831_Warnsham Windo..> | 2026-03-04 11:50 | 12K | |
![[ ]](/icons/layout.gif) | 599_Adam Jenkins - J..> | 2025-09-23 14:29 | 12K | |
![[ ]](/icons/layout.gif) | 52745_Fortress Doors..> | 2026-03-09 15:07 | 12K | |
![[ ]](/icons/layout.gif) | 24692_Ecosse Garage ..> | 2025-12-10 11:44 | 12K | |
![[ ]](/icons/layout.gif) | 707_Andy Green - GRE..> | 2025-09-24 10:30 | 12K | |
![[ ]](/icons/layout.gif) | 15490_Herts & Essex ..> | 2025-11-14 12:31 | 12K | |
![[ ]](/icons/layout.gif) | 67_[0,0] Jason Walke..> | 2025-09-16 15:20 | 12K | |
![[ ]](/icons/layout.gif) | 549_John Williams - ..> | 2025-09-23 11:21 | 12K | |
![[ ]](/icons/layout.gif) | 1805_Thomas Fitzgera..> | 2025-10-02 12:28 | 12K | |
![[ ]](/icons/layout.gif) | 10800_Matthew Armita..> | 2025-11-03 12:33 | 12K | |
![[ ]](/icons/layout.gif) | 605_John Williams - ..> | 2025-09-23 15:14 | 12K | |
![[ ]](/icons/layout.gif) | 50636_Danbury Garage..> | 2026-03-04 09:15 | 12K | |
![[ ]](/icons/layout.gif) | 8063_Mitchal Welberr..> | 2025-10-24 13:53 | 12K | |
![[ ]](/icons/layout.gif) | 10236_Paul Harman - ..> | 2025-10-31 11:35 | 12K | |
![[ ]](/icons/layout.gif) | 10841_Will Baxter - ..> | 2025-11-03 13:17 | 12K | |
![[ ]](/icons/layout.gif) | 54499_Statement_13-0..> | 2026-03-13 07:31 | 12K | |
![[ ]](/icons/layout.gif) | 1295_Imir Sela - SEL..> | 2025-09-29 14:31 | 12K | |
![[ ]](/icons/layout.gif) | 55396_Fortress Doors..> | 2026-03-16 13:58 | 12K | |
![[ ]](/icons/layout.gif) | 9999_Robert Coutts -..> | 2025-10-31 07:29 | 12K | |
![[ ]](/icons/layout.gif) | 1810_Graham Packham ..> | 2025-10-02 12:32 | 12K | |
![[ ]](/icons/layout.gif) | 825_Marcus Aston - A..> | 2025-09-25 08:05 | 12K | |
![[ ]](/icons/layout.gif) | 9798_Tony Saunders -..> | 2025-10-30 12:48 | 12K | |
![[ ]](/icons/layout.gif) | 21801_UK Rollerdoors..> | 2025-12-02 10:51 | 12K | |
![[ ]](/icons/layout.gif) | 37866_Statement_28-0..> | 2026-01-28 11:07 | 12K | |
![[ ]](/icons/layout.gif) | 595_Kris Glenwright ..> | 2025-09-23 14:27 | 12K | |
![[ ]](/icons/layout.gif) | 555_Reid - REID0001 ..> | 2025-09-23 11:55 | 12K | |
![[ ]](/icons/layout.gif) | 559_Ian Prior - PRIO..> | 2025-09-23 11:58 | 12K | |
![[ ]](/icons/layout.gif) | 594_Gary Pont - PONT..> | 2025-09-23 14:26 | 12K | |
![[ ]](/icons/layout.gif) | 8545_Doors 4 You Ltd..> | 2025-10-27 14:35 | 12K | |
![[ ]](/icons/layout.gif) | 570_Steve Watts - WA..> | 2025-09-23 12:29 | 12K | |
![[ ]](/icons/layout.gif) | 61463_WADE WINDOWS I..> | 2026-03-31 14:15 | 12K | |
![[ ]](/icons/layout.gif) | 8521_T D Rollerdoors..> | 2025-08-21 16:16 | 12K | |
![[ ]](/icons/layout.gif) | 12360_Peter Figg - H..> | 2025-11-06 12:10 | 12K | |
![[ ]](/icons/layout.gif) | 32010_LNR Door Solut..> | 2026-01-09 11:52 | 12K | |
![[ ]](/icons/layout.gif) | 46407_The Lothian Ga..> | 2026-02-20 08:43 | 12K | |
![[ ]](/icons/layout.gif) | 12522_Andy Jarvis - ..> | 2025-11-06 15:51 | 12K | |
![[ ]](/icons/layout.gif) | 61707_Fortress Doors..> | 2026-04-01 09:20 | 12K | |
![[ ]](/icons/layout.gif) | 4949_Ray Clarke - CL..> | 2025-10-15 12:22 | 12K | |
![[ ]](/icons/layout.gif) | 6728_Norfolk Broads ..> | 2025-10-22 07:27 | 12K | |
![[ ]](/icons/layout.gif) | 10976_Lewis - LEWI00..> | 2025-11-03 15:37 | 12K | |
![[ ]](/icons/layout.gif) | 2369_Leo Cordingley ..> | 2025-10-06 12:08 | 12K | |
![[ ]](/icons/layout.gif) | 5823_Fortress Doors ..> | 2025-10-17 10:54 | 12K | |
![[ ]](/icons/layout.gif) | 37170_Pro-Frame Wind..> | 2026-01-26 15:28 | 12K | |
![[ ]](/icons/layout.gif) | 61715_C & P Doors Cr..> | 2026-04-01 09:31 | 12K | |
![[ ]](/icons/layout.gif) | 63241_Wall Garage Do..> | 2026-04-07 15:36 | 12K | |
![[ ]](/icons/layout.gif) | 33472_John Bayley Bu..> | 2026-01-15 08:03 | 12K | |
![[ ]](/icons/layout.gif) | 49542_The Lothian Ga..> | 2026-03-02 10:31 | 12K | |
![[ ]](/icons/layout.gif) | 774_M & S Home Insta..> | 2025-09-24 14:05 | 12K | |
![[ ]](/icons/layout.gif) | 61067_Profascia Delr..> | 2026-03-31 10:11 | 12K | |
![[ ]](/icons/layout.gif) | 65835_Everbright Win..> | 2026-04-14 14:42 | 12K | |
![[ ]](/icons/layout.gif) | 16796_Sargent & Powe..> | 2025-11-18 15:34 | 12K | |
![[ ]](/icons/layout.gif) | 2789_The Lothian Gar..> | 2025-10-07 14:36 | 12K | |
![[ ]](/icons/layout.gif) | 7101_Bev Daniels - B..> | 2025-10-22 14:28 | 12K | |
![[ ]](/icons/layout.gif) | 47365_The Lothian Ga..> | 2026-02-23 17:09 | 12K | |
![[ ]](/icons/layout.gif) | 591_Trevor Gibson - ..> | 2025-09-23 14:24 | 12K | |
![[ ]](/icons/layout.gif) | 1012_Rodger Gooding ..> | 2025-09-26 11:00 | 12K | |
![[ ]](/icons/layout.gif) | 66266_Avon Automated..> | 2026-04-15 12:36 | 12K | |
![[ ]](/icons/layout.gif) | 601_Adam Jenkins - J..> | 2025-09-23 14:30 | 12K | |
![[ ]](/icons/layout.gif) | 1547_Paul Strachan -..> | 2025-10-01 08:58 | 12K | |
![[ ]](/icons/layout.gif) | 7196_Fortress Doors ..> | 2025-10-23 08:03 | 12K | |
![[ ]](/icons/layout.gif) | 20208_Ian Gaynor - G..> | 2025-11-27 10:56 | 12K | |
![[ ]](/icons/layout.gif) | 55026_C&J Contractor..> | 2026-03-13 16:11 | 12K | |
![[ ]](/icons/layout.gif) | 60935_Faith Home Imp..> | 2026-03-31 08:02 | 12K | |
![[ ]](/icons/layout.gif) | 585_Barry Powell - P..> | 2025-09-23 14:08 | 12K | |
![[ ]](/icons/layout.gif) | 586_Barry Powell - P..> | 2025-09-23 14:09 | 12K | |
![[ ]](/icons/layout.gif) | 7130_Garage Doors 24..> | 2025-10-22 15:00 | 12K | |
![[ ]](/icons/layout.gif) | 46825_Scotia Garage ..> | 2026-02-20 14:37 | 12K | |
![[ ]](/icons/layout.gif) | 1100_Leo Cordingley ..> | 2025-09-26 15:13 | 12K | |
![[ ]](/icons/layout.gif) | 1577_David Page - PA..> | 2025-10-01 10:32 | 12K | |
![[ ]](/icons/layout.gif) | 7158_Garage Doors 24..> | 2025-10-22 15:53 | 12K | |
![[ ]](/icons/layout.gif) | 15029_Norfolk Broads..> | 2025-11-13 13:22 | 12K | |
![[ ]](/icons/layout.gif) | 769_Fortress_Doors A..> | 2025-09-24 14:00 | 12K | |
![[ ]](/icons/layout.gif) | 1828_Sarah Calderban..> | 2025-10-02 12:52 | 12K | |
![[ ]](/icons/layout.gif) | 26436_MM Doors Micha..> | 2025-12-15 13:36 | 12K | |
![[ ]](/icons/layout.gif) | 5350_A J Cope Builde..> | 2025-10-16 11:43 | 12K | |
![[ ]](/icons/layout.gif) | 35423_P & R Door Sys..> | 2026-01-20 16:53 | 12K | |
![[ ]](/icons/layout.gif) | 8567_J Brady Garage ..> | 2025-10-27 15:05 | 12K | |
![[ ]](/icons/layout.gif) | 1075_Oakley Windows ..> | 2025-09-26 13:11 | 12K | |
![[ ]](/icons/layout.gif) | 1818_David Dawson - ..> | 2025-10-02 12:43 | 12K | |
![[ ]](/icons/layout.gif) | 10419_JM Doors Jon B..> | 2025-10-31 15:45 | 12K | |
![[ ]](/icons/layout.gif) | 553_Garry Parkes - P..> | 2025-09-23 11:35 | 12K | |
![[ ]](/icons/layout.gif) | 3641_Creagorry Motor..> | 2025-10-09 15:46 | 12K | |
![[ ]](/icons/layout.gif) | 574_Julie Noble - NO..> | 2025-09-23 12:54 | 12K | |
![[ ]](/icons/layout.gif) | 57669_Aplas Windows ..> | 2026-03-20 16:26 | 12K | |
![[ ]](/icons/layout.gif) | 3101_Whewell - WHEW0..> | 2025-10-08 12:18 | 12K | |
![[ ]](/icons/layout.gif) | 33530_Windowcraft De..> | 2026-01-15 09:38 | 12K | |
![[ ]](/icons/layout.gif) | 65032_Norfolk Broads..> | 2026-04-13 10:24 | 12K | |
![[ ]](/icons/layout.gif) | 563_Aidan Murphy - M..> | 2025-09-23 12:04 | 12K | |
![[ ]](/icons/layout.gif) | 564_Aidan Murphy - M..> | 2025-09-23 12:05 | 12K | |
![[ ]](/icons/layout.gif) | 5047_Norfolk Broads ..> | 2025-10-15 14:42 | 12K | |
![[ ]](/icons/layout.gif) | 6814_Maureen Bell - ..> | 2025-10-22 08:55 | 12K | |
![[ ]](/icons/layout.gif) | 53664_Tru-Fit Window..> | 2026-03-11 09:21 | 12K | |
![[ ]](/icons/layout.gif) | 180_[0,0] Reid - RE..> | 2025-09-18 10:00 | 12K | |
![[ ]](/icons/layout.gif) | 18836_Aldous Electri..> | 2025-11-24 16:43 | 12K | |
![[ ]](/icons/layout.gif) | 1817_David Dawson - ..> | 2025-10-02 12:42 | 12K | |
![[ ]](/icons/layout.gif) | 2055_[0,0] James Wal..> | 2025-10-03 12:08 | 12K | |
![[ ]](/icons/layout.gif) | 2734_David Punt - PU..> | 2025-10-07 12:18 | 12K | |
![[ ]](/icons/layout.gif) | 1263_Imir Sela - SEL..> | 2025-09-29 13:21 | 12K | |
![[ ]](/icons/layout.gif) | 3110_Roy Roynting - ..> | 2025-10-08 12:22 | 12K | |
![[ ]](/icons/layout.gif) | 16880_Norfolk Broads..> | 2025-11-18 16:37 | 12K | |
![[ ]](/icons/layout.gif) | 65063_Windowcraft De..> | 2026-04-13 11:03 | 12K | |
![[ ]](/icons/layout.gif) | 6001_Lexicus Develop..> | 2025-10-17 15:32 | 12K | |
![[ ]](/icons/layout.gif) | 62363_Excellent Ltd ..> | 2026-04-02 12:55 | 12K | |
![[ ]](/icons/layout.gif) | 7087_Maureen Bell - ..> | 2025-10-22 14:20 | 12K | |
![[ ]](/icons/layout.gif) | 7088_Maureen Bell - ..> | 2025-10-22 14:20 | 12K | |
![[ ]](/icons/layout.gif) | 2145_Kenneth Rowley ..> | 2025-10-03 13:32 | 12K | |
![[ ]](/icons/layout.gif) | 1546_Nathan Hayes - ..> | 2025-10-01 08:57 | 12K | |
![[ ]](/icons/layout.gif) | 2355_Steve Marriott ..> | 2025-10-06 11:45 | 12K | |
![[ ]](/icons/layout.gif) | 13117_C&M Glass Serv..> | 2025-11-10 09:11 | 12K | |
![[ ]](/icons/layout.gif) | 719_Heather Foster -..> | 2025-09-24 10:34 | 12K | |
![[ ]](/icons/layout.gif) | 597_Kris Glenwright ..> | 2025-09-23 14:28 | 12K | |
![[ ]](/icons/layout.gif) | 11539_CPS Custom Pro..> | 2025-11-05 08:28 | 12K | |
![[ ]](/icons/layout.gif) | 1903_[0,0] Levart -..> | 2025-10-02 15:34 | 12K | |
![[ ]](/icons/layout.gif) | 8358_Kev Taylor - TA..> | 2025-10-27 11:56 | 12K | |
![[ ]](/icons/layout.gif) | 6717_Norfolk Broads ..> | 2025-10-22 07:15 | 12K | |
![[ ]](/icons/layout.gif) | 28384_Charles Brown ..> | 2025-12-19 15:58 | 12K | |
![[ ]](/icons/layout.gif) | 3793_M Lewis - LEWI0..> | 2025-10-10 11:00 | 12K | |
![[ ]](/icons/layout.gif) | 66982_Doorolla Ltd S..> | 2026-04-17 08:46 | 12K | |
![[ ]](/icons/layout.gif) | 2108_Timothy Noakes ..> | 2025-10-03 12:25 | 12K | |
![[ ]](/icons/layout.gif) | 3768_Henry Attree - ..> | 2025-10-10 10:13 | 12K | |
![[ ]](/icons/layout.gif) | 5051_C&M Glass Servi..> | 2025-10-15 14:54 | 12K | |
![[ ]](/icons/layout.gif) | 12279_Anvile Enginee..> | 2025-11-06 11:33 | 12K | |
![[ ]](/icons/layout.gif) | 7262_Cyril Ralphs - ..> | 2025-10-23 10:05 | 12K | |
![[ ]](/icons/layout.gif) | 33538_James Windows ..> | 2026-01-15 09:40 | 12K | |
![[ ]](/icons/layout.gif) | 2672_Richard Hoyle -..> | 2025-10-07 09:53 | 12K | |
![[ ]](/icons/layout.gif) | 20744_Aldous Electri..> | 2025-11-28 10:16 | 12K | |
![[ ]](/icons/layout.gif) | 2378_Michael Selby -..> | 2025-10-06 12:14 | 12K | |
![[ ]](/icons/layout.gif) | 7159_Garage Doors 24..> | 2025-10-22 15:53 | 12K | |
![[ ]](/icons/layout.gif) | 4145_Tru-Fit Windows..> | 2025-10-13 10:32 | 12K | |
![[ ]](/icons/layout.gif) | 60642_T D Rollerdoor..> | 2026-03-30 13:26 | 12K | |
![[ ]](/icons/layout.gif) | 10824_Alan Pattison ..> | 2025-11-03 13:04 | 12K | |
![[ ]](/icons/layout.gif) | 16103_Rhino Windows ..> | 2025-11-17 14:19 | 12K | |
![[ ]](/icons/layout.gif) | 52277_Doorolla Ltd S..> | 2026-03-06 16:53 | 12K | |
![[ ]](/icons/layout.gif) | 305_Doors 4 You Ltd ..> | 2025-09-19 12:35 | 12K | |
![[ ]](/icons/layout.gif) | 1893_HARRISON - HARR..> | 2025-10-02 14:48 | 12K | |
![[ ]](/icons/layout.gif) | 8365_Joe Round - ROU..> | 2025-10-27 12:02 | 12K | |
![[ ]](/icons/layout.gif) | 10637_Kevin Credland..> | 2025-11-03 10:05 | 12K | |
![[ ]](/icons/layout.gif) | 10839_Will Baxter - ..> | 2025-11-03 13:16 | 12K | |
![[ ]](/icons/layout.gif) | 2386_Sara Morris - M..> | 2025-10-06 12:29 | 12K | |
![[ ]](/icons/layout.gif) | 3892_Jody Baxter - B..> | 2025-10-10 12:44 | 12K | |
![[ ]](/icons/layout.gif) | 11468_Tilehurst Home..> | 2025-11-04 15:19 | 12K | |
![[ ]](/icons/layout.gif) | 3809_Cerromar Soluti..> | 2025-10-10 11:21 | 12K | |
![[ ]](/icons/layout.gif) | 8690_Jurassic Doors ..> | 2025-10-28 07:54 | 12K | |
![[ ]](/icons/layout.gif) | 2756_Trevor Rolfe - ..> | 2025-10-07 12:59 | 12K | |
![[ ]](/icons/layout.gif) | 7619_Boombastic Door..> | 2025-07-31 15:51 | 12K | |
![[ ]](/icons/layout.gif) | 10624_Kenneth Jones ..> | 2025-11-03 09:51 | 12K | |
![[ ]](/icons/layout.gif) | 39855_Everbright Win..> | 2026-02-03 11:26 | 12K | |
![[ ]](/icons/layout.gif) | 5377_Ben Lovell - LO..> | 2025-10-16 12:05 | 12K | |
![[ ]](/icons/layout.gif) | 2101_Lionel Mewton -..> | 2025-10-03 12:20 | 12K | |
![[ ]](/icons/layout.gif) | 120_Rosie - ROSI0001..> | 2025-09-17 14:33 | 12K | |
![[ ]](/icons/layout.gif) | 12822_Hobbs - Straps..> | 2025-11-07 12:36 | 12K | |
![[ ]](/icons/layout.gif) | 12823_Hobbs - Straps..> | 2025-11-07 12:36 | 12K | |
![[ ]](/icons/layout.gif) | 872_Martin Wallbank ..> | 2025-09-25 12:04 | 12K | |
![[ ]](/icons/layout.gif) | 5367_Ryan Hawley - H..> | 2025-10-16 11:59 | 12K | |
![[ ]](/icons/layout.gif) | 12659_Hanney Glazed ..> | 2025-11-07 08:49 | 12K | |
![[ ]](/icons/layout.gif) | 3522_James Wall - WA..> | 2025-10-09 12:31 | 12K | |
![[ ]](/icons/layout.gif) | 11532_Myers Garage D..> | 2025-11-05 08:15 | 12K | |
![[ ]](/icons/layout.gif) | 11803_Gerrard Collin..> | 2025-11-05 11:18 | 12K | |
![[ ]](/icons/layout.gif) | 2406_Simon Dobson - ..> | 2025-10-06 12:42 | 12K | |
![[ ]](/icons/layout.gif) | 5402_Alps Home Impro..> | 2025-10-16 12:21 | 12K | |
![[ ]](/icons/layout.gif) | 2772_Hanney Glazed L..> | 2025-10-07 13:26 | 12K | |
![[ ]](/icons/layout.gif) | 11084_TPS Gates & Do..> | 2025-11-04 08:28 | 12K | |
![[ ]](/icons/layout.gif) | 9944_Ewan Robertson ..> | 2025-10-30 15:48 | 12K | |
![[ ]](/icons/layout.gif) | 34002_The Lothian Ga..> | 2026-01-15 17:03 | 12K | |
![[ ]](/icons/layout.gif) | 9620_T D Rollerdoors..> | 2025-10-30 08:58 | 12K | |
![[ ]](/icons/layout.gif) | 11773_Brenda Bussey ..> | 2025-11-05 11:10 | 12K | |
![[ ]](/icons/layout.gif) | 58304_R B Installati..> | 2026-03-24 08:40 | 12K | |
![[ ]](/icons/layout.gif) | 3843_James Newton - ..> | 2025-10-10 12:23 | 12K | |
![[ ]](/icons/layout.gif) | 10773_James Anderson..> | 2025-11-03 12:11 | 12K | |
![[ ]](/icons/layout.gif) | 7493_Richard Horspoo..> | 2025-10-23 12:37 | 12K | |
![[ ]](/icons/layout.gif) | 4534_Cerromar Ltd (T..> | 2025-10-14 10:22 | 12K | |
![[ ]](/icons/layout.gif) | 5856_Simon Yeomans -..> | 2025-10-17 11:39 | 12K | |
![[ ]](/icons/layout.gif) | 9565_Chelmsford Roll..> | 2025-10-30 08:02 | 12K | |
![[ ]](/icons/layout.gif) | 26437_MM Doors Micha..> | 2025-12-15 13:37 | 12K | |
![[ ]](/icons/layout.gif) | 1625_[0,0] Banniste..> | 2025-10-01 13:57 | 12K | |
![[ ]](/icons/layout.gif) | 3951_Leonard Harriso..> | 2025-10-10 13:54 | 12K | |
![[ ]](/icons/layout.gif) | 5642_Shaun Craft - C..> | 2025-10-16 15:22 | 12K | |
![[ ]](/icons/layout.gif) | 10831_Ashley Fieldho..> | 2025-11-03 13:11 | 12K | |
![[ ]](/icons/layout.gif) | 1811_Graham Packham ..> | 2025-10-02 12:33 | 12K | |
![[ ]](/icons/layout.gif) | 12362_Peter Figg - H..> | 2025-11-06 12:11 | 12K | |
![[ ]](/icons/layout.gif) | 10801_Matthew Armita..> | 2025-11-03 12:33 | 12K | |
![[ ]](/icons/layout.gif) | 1970_Jeffrey Everitt..> | 2025-10-03 09:31 | 12K | |
![[ ]](/icons/layout.gif) | 28572_Norfolk Broads..> | 2025-12-22 11:59 | 12K | |
![[ ]](/icons/layout.gif) | 576_Absolute Garage ..> | 2025-09-23 13:08 | 12K | |
![[ ]](/icons/layout.gif) | 58524_Camlen Fabrica..> | 2026-03-24 12:49 | 12K | |
![[ ]](/icons/layout.gif) | 8373_Metcalfe - METC..> | 2025-10-27 12:07 | 12K | |
![[ ]](/icons/layout.gif) | 5549_Michael Mazur ..> | 2025-10-16 14:07 | 12K | |
![[ ]](/icons/layout.gif) | 204_C & P Doors Crai..> | 2025-09-18 14:23 | 12K | |
![[ ]](/icons/layout.gif) | 1400_[0,0] R Higgs -..> | 2025-09-30 11:30 | 12K | |
![[ ]](/icons/layout.gif) | 1829_Sarah Calderban..> | 2025-10-02 12:53 | 12K | |
![[ ]](/icons/layout.gif) | 9457_Rollermatic Gar..> | 2025-10-29 14:50 | 12K | |
![[ ]](/icons/layout.gif) | 371_UK Rollerdoors D..> | 2025-09-22 08:47 | 12K | |
![[ ]](/icons/layout.gif) | 8705_Ideal Industria..> | 2025-10-28 08:25 | 12K | |
![[ ]](/icons/layout.gif) | 12520_Andy Jarvis - ..> | 2025-11-06 15:50 | 12K | |
![[ ]](/icons/layout.gif) | 13132_Nuvo Windows P..> | 2025-11-10 09:19 | 12K | |
![[ ]](/icons/layout.gif) | 1380_The Lothian Gar..> | 2025-09-30 10:13 | 12K | |
![[ ]](/icons/layout.gif) | 58338_CPS Custom Pro..> | 2026-03-24 09:08 | 12K | |
![[ ]](/icons/layout.gif) | 1145_Ideal Industria..> | 2025-09-29 07:45 | 12K | |
![[ ]](/icons/layout.gif) | 11012_Alan Dobson - ..> | 2025-11-03 16:11 | 12K | |
![[ ]](/icons/layout.gif) | 11523_J Brady Garage..> | 2025-11-05 08:05 | 12K | |
![[ ]](/icons/layout.gif) | 39268_SDS (Isle Of M..> | 2026-02-02 13:03 | 12K | |
![[ ]](/icons/layout.gif) | 4627_Cerromar Ltd (T..> | 2025-10-14 12:57 | 12K | |
![[ ]](/icons/layout.gif) | 8234_Simon Yeomans -..> | 2025-10-27 10:41 | 12K | |
![[ ]](/icons/layout.gif) | 5857_NW Automatic Do..> | 2025-10-17 11:39 | 12K | |
![[ ]](/icons/layout.gif) | 9348_Gary Edgar - ED..> | 2025-10-29 12:01 | 12K | |
![[ ]](/icons/layout.gif) | 5132_Pioneer Doors K..> | 2025-10-15 15:44 | 12K | |
![[ ]](/icons/layout.gif) | 13327_John Cuthberts..> | 2025-11-10 13:20 | 12K | |
![[ ]](/icons/layout.gif) | 92_Chelmsford Roller..> | 2025-09-17 08:48 | 12K | |
![[ ]](/icons/layout.gif) | 115_PDl Fabrications..> | 2025-09-17 14:15 | 12K | |
![[ ]](/icons/layout.gif) | 2162_Barker - BARK00..> | 2025-10-03 14:21 | 12K | |
![[ ]](/icons/layout.gif) | 4574_Garage Doors 24..> | 2025-10-14 11:30 | 12K | |
![[ ]](/icons/layout.gif) | 10252_Carol Izatt - ..> | 2025-10-31 11:39 | 12K | |
![[ ]](/icons/layout.gif) | 11092_TPS Gates & Do..> | 2025-11-04 08:29 | 12K | |
![[ ]](/icons/layout.gif) | 607_Chelmsford Rolle..> | 2025-09-23 15:15 | 12K | |
![[ ]](/icons/layout.gif) | 657_East Anglia Roll..> | 2025-09-24 07:46 | 12K | |
![[ ]](/icons/layout.gif) | 1306_[0,0] Steve Pac..> | 2025-09-29 14:53 | 12K | |
![[ ]](/icons/layout.gif) | 14498_James Sumner -..> | 2025-11-12 11:51 | 12K | |
![[ ]](/icons/layout.gif) | 41679_Keith Worboys ..> | 2026-02-09 12:30 | 12K | |
![[ ]](/icons/layout.gif) | 5297_Doorolla Ltd St..> | 2025-10-16 10:40 | 12K | |
![[ ]](/icons/layout.gif) | 351_Southern Conserv..> | 2025-09-22 07:27 | 12K | |
![[ ]](/icons/layout.gif) | 9629_TH Installation..> | 2025-10-30 09:05 | 12K | |
![[ ]](/icons/layout.gif) | 12065_Avon Automated..> | 2025-11-05 15:50 | 12K | |
![[ ]](/icons/layout.gif) | 7666_Nigel Ealand - ..> | 2025-10-24 06:49 | 12K | |
![[ ]](/icons/layout.gif) | 708_Andy Green - GRE..> | 2025-09-24 10:30 | 12K | |
![[ ]](/icons/layout.gif) | 931_Ideal Industrial..> | 2025-09-25 15:01 | 12K | |
![[ ]](/icons/layout.gif) | 8323_Phillip Holland..> | 2025-10-27 11:49 | 12K | |
![[ ]](/icons/layout.gif) | 8546_Doors 4 You Ltd..> | 2025-10-27 14:35 | 12K | |
![[ ]](/icons/layout.gif) | 7383_Stewart Paul St..> | 2025-10-23 11:32 | 12K | |
![[ ]](/icons/layout.gif) | 8064_Mitchal Welberr..> | 2025-10-24 13:53 | 12K | |
![[ ]](/icons/layout.gif) | 63116_UK Rollerdoors..> | 2026-04-07 14:07 | 12K | |
![[ ]](/icons/layout.gif) | 1191_Richard Hoyle -..> | 2025-09-29 09:21 | 12K | |
![[ ]](/icons/layout.gif) | 346_M. A. E. Windows..> | 2025-09-20 09:52 | 12K | |
![[ ]](/icons/layout.gif) | 572_Eclipse Doors Di..> | 2025-09-23 12:41 | 12K | |
![[ ]](/icons/layout.gif) | 10241_Paul Harman - ..> | 2025-10-31 11:35 | 12K | |
![[ ]](/icons/layout.gif) | 5354_A J Cope Builde..> | 2025-10-16 11:43 | 12K | |
![[ ]](/icons/layout.gif) | 9459_Rollermatic Gar..> | 2025-10-29 14:51 | 12K | |
![[ ]](/icons/layout.gif) | 10985_Elevate Doors ..> | 2025-11-03 15:47 | 12K | |
![[ ]](/icons/layout.gif) | 10290_Hughes House &..> | 2025-10-31 11:56 | 12K | |
![[ ]](/icons/layout.gif) | 61992_Fortress Doors..> | 2026-04-01 14:17 | 12K | |
![[ ]](/icons/layout.gif) | 272_P & R Door Syste..> | 2025-09-19 10:20 | 12K | |
![[ ]](/icons/layout.gif) | 3085_[0,0] Nigel Ter..> | 2025-10-08 11:38 | 12K | |
![[ ]](/icons/layout.gif) | 5684_Bryan Thompson ..> | 2025-10-17 06:41 | 12K | |
![[ ]](/icons/layout.gif) | 68432_SDS (Isle Of M..> | 2026-04-21 11:47 | 12K | |
![[ ]](/icons/layout.gif) | 618_East Anglia Roll..> | 2025-09-23 15:41 | 12K | |
![[ ]](/icons/layout.gif) | 954_TPS Gates & Door..> | 2025-09-26 07:17 | 12K | |
![[ ]](/icons/layout.gif) | 6004_Lexicus Develop..> | 2025-10-17 15:33 | 12K | |
![[ ]](/icons/layout.gif) | 5873_J Bowman Garage..> | 2025-10-17 12:00 | 12K | |
![[ ]](/icons/layout.gif) | 309_J Brady Garage D..> | 2025-09-19 12:49 | 12K | |
![[ ]](/icons/layout.gif) | 66372_Norfolk Broads..> | 2026-04-15 15:23 | 12K | |
![[ ]](/icons/layout.gif) | 20745_Aldous Electri..> | 2025-11-28 10:16 | 12K | |
![[ ]](/icons/layout.gif) | 577_Absolute Garage ..> | 2025-09-23 13:10 | 12K | |
![[ ]](/icons/layout.gif) | 646_Fortress_Doors A..> | 2025-09-24 07:31 | 12K | |
![[ ]](/icons/layout.gif) | 10995_Harrogate Home..> | 2025-11-03 15:56 | 12K | |
![[ ]](/icons/layout.gif) | 58347_Simon Marshall..> | 2026-03-24 09:11 | 12K | |
![[ ]](/icons/layout.gif) | 845_Absolute Garage ..> | 2025-09-25 10:01 | 12K | |
![[ ]](/icons/layout.gif) | 163_M. A. E. Windows..> | 2025-09-18 07:25 | 12K | |
![[ ]](/icons/layout.gif) | 2370_Leo Cordingley ..> | 2025-10-06 12:08 | 12K | |
![[ ]](/icons/layout.gif) | 12686_Catherine Evan..> | 2025-11-07 09:15 | 12K | |
![[ ]](/icons/layout.gif) | 14544_Steve Stagg - ..> | 2025-11-12 12:15 | 12K | |
![[ ]](/icons/layout.gif) | 14545_Steve Stagg - ..> | 2025-11-12 12:15 | 12K | |
![[ ]](/icons/layout.gif) | 969_Absolute Garage ..> | 2025-09-26 08:04 | 12K | |
![[ ]](/icons/layout.gif) | 10794_Brian Hooper -..> | 2025-11-03 12:27 | 12K | |
![[ ]](/icons/layout.gif) | 2799_J Brady Garage ..> | 2025-10-07 14:51 | 12K | |
![[ ]](/icons/layout.gif) | 9532_T D Rollerdoors..> | 2025-10-29 16:26 | 12K | |
![[ ]](/icons/layout.gif) | 1014_Secured Door & ..> | 2025-09-26 11:00 | 12K | |
![[ ]](/icons/layout.gif) | 5159_Pioneer Doors K..> | 2025-10-16 06:53 | 12K | |
![[ ]](/icons/layout.gif) | 11208_M. A. E. Windo..> | 2025-11-04 11:32 | 12K | |
![[ ]](/icons/layout.gif) | 37172_Danbury Garage..> | 2026-01-26 15:32 | 12K | |
![[ ]](/icons/layout.gif) | 731_BH Electrical Se..> | 2025-09-24 11:09 | 12K | |
![[ ]](/icons/layout.gif) | 1236_[0,0] Maximum ..> | 2025-09-29 11:56 | 12K | |
![[ ]](/icons/layout.gif) | 3025_[0,0] James Tur..> | 2025-10-08 10:18 | 12K | |
![[ ]](/icons/layout.gif) | 1152_Ideal Industria..> | 2025-09-29 07:47 | 12K | |
![[ ]](/icons/layout.gif) | 3289_[0,0] Nicola Ha..> | 2025-10-09 07:17 | 12K | |
![[ ]](/icons/layout.gif) | 38076_East Anglia Ro..> | 2026-01-28 15:01 | 12K | |
![[ ]](/icons/layout.gif) | 286_Fortress_Doors A..> | 2025-09-19 11:28 | 12K | |
![[ ]](/icons/layout.gif) | 8303_Swift Doors Ltd..> | 2025-10-27 11:43 | 12K | |
![[ ]](/icons/layout.gif) | 8989_Stewart Paul St..> | 2025-10-28 14:17 | 12K | |
![[ ]](/icons/layout.gif) | 10693_Ross Garage Do..> | 2025-11-03 11:08 | 12K | |
![[ ]](/icons/layout.gif) | 4074_East Anglia Rol..> | 2025-10-13 08:46 | 12K | |
![[ ]](/icons/layout.gif) | 11533_Myers Garage D..> | 2025-11-05 08:15 | 12K | |
![[ ]](/icons/layout.gif) | 12284_Anvile Enginee..> | 2025-11-06 11:34 | 12K | |
![[ ]](/icons/layout.gif) | 12729_Rollermatic Ga..> | 2025-11-07 10:36 | 12K | |
![[ ]](/icons/layout.gif) | 1744_[0,0] Laura R J..> | 2025-10-02 07:47 | 12K | |
![[ ]](/icons/layout.gif) | 10751_T D Rollerdoor..> | 2025-11-03 11:49 | 12K | |
![[ ]](/icons/layout.gif) | 7686_Tilehurst Home ..> | 2025-10-24 07:08 | 12K | |
![[ ]](/icons/layout.gif) | 11073_Absolute Garag..> | 2025-11-04 08:06 | 12K | |
![[ ]](/icons/layout.gif) | 4028_Rollermatic Gar..> | 2025-10-13 08:00 | 12K | |
![[ ]](/icons/layout.gif) | 10271_Doorolla Ltd S..> | 2025-10-31 11:46 | 12K | |
![[ ]](/icons/layout.gif) | 52371_Ideal Industri..> | 2026-03-09 08:56 | 12K | |
![[ ]](/icons/layout.gif) | 1155_Secured Door & ..> | 2025-09-29 07:53 | 12K | |
![[ ]](/icons/layout.gif) | 1156_Secured Door & ..> | 2025-09-29 07:53 | 12K | |
![[ ]](/icons/layout.gif) | 1603_Kelvin Bolton -..> | 2025-10-01 13:14 | 12K | |
![[ ]](/icons/layout.gif) | 5345_The Lothian Gar..> | 2025-10-16 11:36 | 12K | |
![[ ]](/icons/layout.gif) | 1612_M. A. E. Window..> | 2025-10-01 13:34 | 12K | |
![[ ]](/icons/layout.gif) | 3813_Cerromar Soluti..> | 2025-10-10 11:22 | 12K | |
![[ ]](/icons/layout.gif) | 5815_NW Automatic Do..> | 2025-10-17 10:39 | 12K | |
![[ ]](/icons/layout.gif) | 6963_The Lothian Gar..> | 2025-10-22 12:38 | 12K | |
![[ ]](/icons/layout.gif) | 5477_Absolute Garage..> | 2025-10-16 13:29 | 12K | |
![[ ]](/icons/layout.gif) | 5834_M. A. E. Window..> | 2025-10-17 11:06 | 12K | |
![[ ]](/icons/layout.gif) | 11475_Colin Hartgrov..> | 2025-11-04 15:24 | 12K | |
![[ ]](/icons/layout.gif) | 1568_Fortress_Doors ..> | 2025-10-01 09:45 | 12K | |
![[ ]](/icons/layout.gif) | 9360_Windoworld Tayl..> | 2025-10-29 13:00 | 12K | |
![[ ]](/icons/layout.gif) | 10920_J Brady Garage..> | 2025-11-03 14:48 | 12K | |
![[ ]](/icons/layout.gif) | 13131_Nuvo Windows P..> | 2025-11-10 09:19 | 12K | |
![[ ]](/icons/layout.gif) | 4585_Doorolla Steve ..> | 2025-10-14 12:18 | 12K | |
![[ ]](/icons/layout.gif) | 1551_[0,0] Mark Perh..> | 2025-10-01 09:01 | 12K | |
![[ ]](/icons/layout.gif) | 12221_S R W Services..> | 2025-11-06 10:22 | 12K | |
![[ ]](/icons/layout.gif) | 12800_Chelmsford Rol..> | 2025-11-07 12:01 | 12K | |
![[ ]](/icons/layout.gif) | 4027_[0,0] Andy Sedd..> | 2025-10-13 08:00 | 12K | |
![[ ]](/icons/layout.gif) | 13410_TPS Gates & Do..> | 2025-11-10 15:18 | 12K | |
![[ ]](/icons/layout.gif) | 582_Avon Automated G..> | 2025-09-23 14:03 | 12K | |
![[ ]](/icons/layout.gif) | 27099_Eden Propertie..> | 2025-12-16 16:41 | 12K | |
![[ ]](/icons/layout.gif) | 61771_Josh Glossop -..> | 2026-04-01 09:54 | 12K | |
![[ ]](/icons/layout.gif) | 14781_Marco Jaconell..> | 2025-11-13 09:06 | 12K | |
![[ ]](/icons/layout.gif) | 10817_East Anglia Ro..> | 2025-11-03 12:56 | 12K | |
![[ ]](/icons/layout.gif) | 521_Hanney Glazed Lt..> | 2025-09-23 09:43 | 12K | |
![[ ]](/icons/layout.gif) | 52360_Hanney Glazed ..> | 2026-03-09 08:45 | 12K | |
![[ ]](/icons/layout.gif) | 63621_East Anglia Ro..> | 2026-04-08 13:25 | 12K | |
![[ ]](/icons/layout.gif) | 7416_Jurassic Doors ..> | 2025-10-23 12:00 | 12K | |
![[ ]](/icons/layout.gif) | 5383_UK Rollerdoors ..> | 2025-10-16 12:10 | 12K | |
![[ ]](/icons/layout.gif) | 13121_C&M Glass Serv..> | 2025-11-10 09:12 | 12K | |
![[ ]](/icons/layout.gif) | 526_SDS (Isle Of Man..> | 2025-09-23 09:58 | 12K | |
![[ ]](/icons/layout.gif) | 8301_Eclipse Doors D..> | 2025-10-27 11:38 | 12K | |
![[ ]](/icons/layout.gif) | 33072_Wokingham Glaz..> | 2026-01-14 09:36 | 12K | |
![[ ]](/icons/layout.gif) | 411_JS Home Improvem..> | 2025-09-22 12:45 | 12K | |
![[ ]](/icons/layout.gif) | 584_Garage DoorMan M..> | 2025-09-23 14:06 | 12K | |
![[ ]](/icons/layout.gif) | 4345_Bespoke UPVC Wi..> | 2025-10-13 14:35 | 12K | |
![[ ]](/icons/layout.gif) | 10260_UK Rollerdoors..> | 2025-10-31 11:43 | 12K | |
![[ ]](/icons/layout.gif) | 1038_Doors 4 Garages..> | 2025-09-26 12:05 | 12K | |
![[ ]](/icons/layout.gif) | 11651_Rollermatic Ga..> | 2025-11-05 09:26 | 12K | |
![[ ]](/icons/layout.gif) | 915_Avon Automated G..> | 2025-09-25 14:41 | 12K | |
![[ ]](/icons/layout.gif) | 61161_SDS (Isle Of M..> | 2026-03-31 10:59 | 12K | |
![[ ]](/icons/layout.gif) | 6062_[0,0] Dean Bark..> | 2025-10-20 08:27 | 12K | |
![[ ]](/icons/layout.gif) | 59196_Open And Shut ..> | 2026-03-25 13:40 | 12K | |
![[ ]](/icons/layout.gif) | 653_Oakley Windows L..> | 2025-09-24 07:43 | 12K | |
![[ ]](/icons/layout.gif) | 7100_Bev Daniels - B..> | 2025-10-22 14:27 | 12K | |
![[ ]](/icons/layout.gif) | 9400_Shutter Tech UK..> | 2025-10-29 14:10 | 12K | |
![[ ]](/icons/layout.gif) | 1566_Fortress_Doors ..> | 2025-10-01 09:44 | 12K | |
![[ ]](/icons/layout.gif) | 851_J Brady Garage D..> | 2025-09-25 10:18 | 12K | |
![[ ]](/icons/layout.gif) | 11223_Ross Garage Do..> | 2025-11-04 11:37 | 12K | |
![[ ]](/icons/layout.gif) | 11783_Garage DoorMan..> | 2025-11-05 11:13 | 12K | |
![[ ]](/icons/layout.gif) | 1027_Hanney Glazed L..> | 2025-09-26 11:19 | 12K | |
![[ ]](/icons/layout.gif) | 4540_Danbury Garage ..> | 2025-10-14 10:27 | 12K | |
![[ ]](/icons/layout.gif) | 5860_NW Automatic Do..> | 2025-10-17 11:39 | 12K | |
![[ ]](/icons/layout.gif) | 49411_SDS (Isle Of M..> | 2026-03-02 08:47 | 12K | |
![[ ]](/icons/layout.gif) | 12141_Go Garage Door..> | 2025-11-06 09:32 | 12K | |
![[ ]](/icons/layout.gif) | 5501_J Brady Garage ..> | 2025-10-16 14:00 | 12K | |
![[ ]](/icons/layout.gif) | 1553_Avon Automated ..> | 2025-10-01 09:02 | 12K | |
![[ ]](/icons/layout.gif) | 11238_Wall Garage Do..> | 2025-11-04 11:43 | 12K | |
![[ ]](/icons/layout.gif) | 2346_[0,0] James Tur..> | 2025-10-06 11:33 | 12K | |
![[ ]](/icons/layout.gif) | 5678_East Anglia Rol..> | 2025-10-17 06:37 | 12K | |
![[ ]](/icons/layout.gif) | 11652_Rollermatic Ga..> | 2025-11-05 09:26 | 12K | |
![[ ]](/icons/layout.gif) | 13199_NTRAP NR11 7NZ..> | 2025-11-10 10:25 | 12K | |
![[ ]](/icons/layout.gif) | 8662_Edward Denston ..> | 2025-10-27 16:41 | 12K | |
![[ ]](/icons/layout.gif) | 10293_Hughes House &..> | 2025-10-31 11:56 | 12K | |
![[ ]](/icons/layout.gif) | 8380_D Thurston Buil..> | 2025-10-27 12:12 | 12K | |
![[ ]](/icons/layout.gif) | 12552_Warnsham Windo..> | 2025-11-06 16:01 | 12K | |
![[ ]](/icons/layout.gif) | 41079_Haines Homes C..> | 2026-02-05 15:44 | 12K | |
![[ ]](/icons/layout.gif) | 5407_Alps Home Impro..> | 2025-10-16 12:21 | 12K | |
![[ ]](/icons/layout.gif) | 7192_SW Trade Frames..> | 2025-10-23 07:52 | 12K | |
![[ ]](/icons/layout.gif) | 11542_CPS Custom Pro..> | 2025-11-05 08:28 | 12K | |
![[ ]](/icons/layout.gif) | 11042_Rollermatic Ga..> | 2025-11-03 16:37 | 12K | |
![[ ]](/icons/layout.gif) | 7688_Hanney Glazed L..> | 2025-10-24 07:09 | 12K | |
![[ ]](/icons/layout.gif) | 10869_Winspear - WIN..> | 2025-11-03 13:57 | 12K | |
![[ ]](/icons/layout.gif) | 6407_Beaver Plastic ..> | 2025-10-21 08:19 | 12K | |
![[ ]](/icons/layout.gif) | 44517_Chiltern Compl..> | 2026-02-17 08:38 | 12K | |
![[ ]](/icons/layout.gif) | 63_Cash Sale Cash Sa..> | 2025-09-16 09:32 | 12K | |
![[ ]](/icons/layout.gif) | 6405_Beaver Plastic ..> | 2025-10-21 08:19 | 12K | |
![[ ]](/icons/layout.gif) | 10811_Absolute Garag..> | 2025-11-03 12:49 | 12K | |
![[ ]](/icons/layout.gif) | 2046_Mick Moy Tyres ..> | 2025-10-03 12:01 | 12K | |
![[ ]](/icons/layout.gif) | 2809_[0,0] Andy Sedd..> | 2025-10-07 14:56 | 12K | |
![[ ]](/icons/layout.gif) | 73_A Stackhouse Wind..> | 2025-09-16 15:38 | 12K | |
![[ ]](/icons/layout.gif) | 11691_Elevate Doors ..> | 2025-11-05 10:11 | 12K | |
![[ ]](/icons/layout.gif) | 7020_Fortress Doors ..> | 2025-10-22 12:54 | 12K | |
![[ ]](/icons/layout.gif) | 4070_Andy Green - GR..> | 2025-10-13 08:43 | 12K | |
![[ ]](/icons/layout.gif) | 3582_J Brady Garage ..> | 2025-10-09 13:55 | 12K | |
![[ ]](/icons/layout.gif) | 6399_Garage DoorMan ..> | 2025-10-21 08:16 | 12K | |
![[ ]](/icons/layout.gif) | 318_Ideal Industrial..> | 2025-09-19 13:53 | 12K | |
![[ ]](/icons/layout.gif) | 8377_Ideal Industria..> | 2025-10-27 12:10 | 12K | |
![[ ]](/icons/layout.gif) | 11908_C&M Glass Serv..> | 2025-11-05 12:57 | 12K | |
![[ ]](/icons/layout.gif) | 548_A Stackhouse Win..> | 2025-09-23 11:18 | 12K | |
![[ ]](/icons/layout.gif) | 8743_Avon Automated ..> | 2025-10-28 09:24 | 12K | |
![[ ]](/icons/layout.gif) | 11144_M. A. E. Windo..> | 2025-11-04 09:52 | 12K | |
![[ ]](/icons/layout.gif) | 13309_The Lothian Ga..> | 2025-11-10 12:36 | 12K | |
![[ ]](/icons/layout.gif) | 14576_Elevate Doors ..> | 2025-11-12 13:15 | 12K | |
![[ ]](/icons/layout.gif) | 8822_Ross Garage Doo..> | 2025-10-28 10:53 | 12K | |
![[ ]](/icons/layout.gif) | 11036_Rollermatic Ga..> | 2025-11-03 16:34 | 12K | |
![[ ]](/icons/layout.gif) | 14070_Elmadhi - ELMA..> | 2025-11-11 15:37 | 12K | |
![[ ]](/icons/layout.gif) | 39170_The Lothian Ga..> | 2026-02-02 10:41 | 12K | |
![[ ]](/icons/layout.gif) | 1567_Fortress_Doors ..> | 2025-10-01 09:44 | 12K | |
![[ ]](/icons/layout.gif) | 8281_NW Automatic Do..> | 2025-10-27 11:21 | 12K | |
![[ ]](/icons/layout.gif) | 12210_C&M Glass Serv..> | 2025-11-06 10:00 | 12K | |
![[ ]](/icons/layout.gif) | 14679_The Lothian Ga..> | 2025-11-12 15:22 | 12K | |
![[ ]](/icons/layout.gif) | 52366_Hanney Glazed ..> | 2026-03-09 08:54 | 12K | |
![[ ]](/icons/layout.gif) | 7744_Beaver Plastic ..> | 2025-10-24 08:05 | 12K | |
![[ ]](/icons/layout.gif) | 10373_The Lothian Ga..> | 2025-10-31 13:32 | 12K | |
![[ ]](/icons/layout.gif) | 41672_The Lothian Ga..> | 2026-02-09 12:24 | 12K | |
![[ ]](/icons/layout.gif) | 13200_NTRAP NR11 7NZ..> | 2025-11-10 10:25 | 12K | |
![[ ]](/icons/layout.gif) | 6196_J Brady Garage ..> | 2025-10-20 12:36 | 12K | |
![[ ]](/icons/layout.gif) | 18758_Elevate Doors ..> | 2025-11-24 15:22 | 12K | |
![[ ]](/icons/layout.gif) | 65878_S Warrender El..> | 2026-04-14 15:41 | 12K | |
![[ ]](/icons/layout.gif) | 2865_Rollermatic Gar..> | 2025-10-08 07:52 | 12K | |
![[ ]](/icons/layout.gif) | 7768_Avon Automated ..> | 2025-10-24 08:44 | 12K | |
![[ ]](/icons/layout.gif) | 14530_Hereford Mobil..> | 2025-11-12 12:07 | 12K | |
![[ ]](/icons/layout.gif) | 6402_Garage DoorMan ..> | 2025-10-21 08:17 | 12K | |
![[ ]](/icons/layout.gif) | 14491_Rollermatic Ga..> | 2025-11-12 11:49 | 12K | |
![[ ]](/icons/layout.gif) | 12073_UK Rollerdoors..> | 2025-11-05 16:03 | 12K | |
![[ ]](/icons/layout.gif) | 7635_Scotia Garage D..> | 2025-10-23 15:44 | 12K | |
![[ ]](/icons/layout.gif) | 11786_Garage DoorMan..> | 2025-11-05 11:13 | 12K | |
![[ ]](/icons/layout.gif) | 7328_Scotia Garage D..> | 2025-10-23 11:02 | 12K | |
![[ ]](/icons/layout.gif) | 13631_C&M Glass Serv..> | 2025-11-11 09:14 | 12K | |
![[ ]](/icons/layout.gif) | 6134_The Lothian Gar..> | 2025-10-20 10:16 | 12K | |
![[ ]](/icons/layout.gif) | 5999_AS Industrial D..> | 2025-10-17 15:30 | 12K | |
![[ ]](/icons/layout.gif) | 11161_The Lothian Ga..> | 2025-11-04 10:27 | 12K | |
![[ ]](/icons/layout.gif) | 9849_The Lothian Gar..> | 2025-10-30 13:56 | 12K | |
![[ ]](/icons/layout.gif) | 12094_The Lothian Ga..> | 2025-11-05 17:06 | 12K | |
![[ ]](/icons/layout.gif) | 14310_C&M Glass Serv..> | 2025-11-12 09:06 | 12K | |
![[ ]](/icons/layout.gif) | 14288_Fortress Doors..> | 2025-11-12 08:30 | 12K | |
![[ ]](/icons/layout.gif) | 9048_The Lothian Gar..> | 2025-08-22 10:43 | 12K | |
![[ ]](/icons/layout.gif) | 49665_The Garage Doo..> | 2026-03-02 11:51 | 12K | |
![[ ]](/icons/layout.gif) | 6838_Avon Automated ..> | 2025-10-22 09:46 | 12K | |
![[ ]](/icons/layout.gif) | 5358_The Lothian Gar..> | 2025-10-16 11:51 | 12K | |
![[ ]](/icons/layout.gif) | 2222_Absolute Garage..> | 2025-10-06 08:04 | 12K | |
![[ ]](/icons/layout.gif) | 345_Ideal Industrial..> | 2025-09-19 16:04 | 12K | |
![[ ]](/icons/layout.gif) | 11674_Warnsham Windo..> | 2025-11-05 10:00 | 12K | |
![[ ]](/icons/layout.gif) | 2549_Absolute Garage..> | 2025-10-07 06:51 | 12K | |
![[ ]](/icons/layout.gif) | 4351_Lockdown Doors ..> | 2025-10-13 14:38 | 12K | |
![[ ]](/icons/layout.gif) | 7414_Ideal Industria..> | 2025-10-23 11:52 | 12K | |
![[ ]](/icons/layout.gif) | 2673_SDS (Isle Of Ma..> | 2025-10-07 10:00 | 12K | |
![[ ]](/icons/layout.gif) | 14568_Roll Right Gar..> | 2025-11-12 12:45 | 12K | |
![[ ]](/icons/layout.gif) | 13318_Roll Right Gar..> | 2025-11-10 12:57 | 12K | |
![[ ]](/icons/layout.gif) | 13569_NW Automatic D..> | 2025-11-11 07:56 | 12K | |
![[ ]](/icons/layout.gif) | 10413_NW Automatic D..> | 2025-10-31 15:42 | 12K | |
![[ ]](/icons/layout.gif) | 7129_Garage Doors 24..> | 2025-10-22 14:59 | 12K | |
![[ ]](/icons/layout.gif) | 6841_Avon Automated ..> | 2025-10-22 09:50 | 12K | |
![[ ]](/icons/layout.gif) | 524_SDS (Isle Of Man..> | 2025-09-23 09:56 | 12K | |
![[ ]](/icons/layout.gif) | 525_SDS (Isle Of Man..> | 2025-09-23 09:56 | 12K | |
![[ ]](/icons/layout.gif) | 1007_Secured Door & ..> | 2025-09-26 10:57 | 12K | |
![[ ]](/icons/layout.gif) | 25425_The Lothian Ga..> | 2025-12-12 08:57 | 12K | |
![[ ]](/icons/layout.gif) | 5045_The Lothian Gar..> | 2025-10-15 14:32 | 12K | |
![[ ]](/icons/layout.gif) | 3570_Windoworld Tayl..> | 2025-10-09 13:39 | 12K | |
![[ ]](/icons/layout.gif) | 9715_The Lothian Gar..> | 2025-08-26 14:38 | 12K | |
![[ ]](/icons/layout.gif) | 9363_Windoworld Tayl..> | 2025-10-29 13:06 | 12K | |
![[ ]](/icons/layout.gif) | 3639_Creagorry Motor..> | 2025-10-09 15:44 | 12K | |
![[ ]](/icons/layout.gif) | 9295_Automated Entry..> | 2025-10-29 09:50 | 12K | |
![[ ]](/icons/layout.gif) | 7781_Doors 4 Garages..> | 2025-10-24 08:50 | 12K | |
![[ ]](/icons/layout.gif) | 1504_Secured Door & ..> | 2025-10-01 06:54 | 12K | |
![[ ]](/icons/layout.gif) | 12786_T D Rollerdoor..> | 2025-11-07 11:34 | 12K | |
![[ ]](/icons/layout.gif) | 19721_Oakley Windows..> | 2025-11-26 09:46 | 12K | |
![[ ]](/icons/layout.gif) | 519_Northants Garage..> | 2025-09-23 09:10 | 12K | |
![[ ]](/icons/layout.gif) | 42428_Windowcraft De..> | 2026-02-11 08:00 | 12K | |
![[ ]](/icons/layout.gif) | 16102_South Atlantic..> | 2025-11-17 14:18 | 12K | |
![[ ]](/icons/layout.gif) | 9241_SW Trade Frames..> | 2025-10-29 08:58 | 12K | |
![[ ]](/icons/layout.gif) | 3275_S R W Services ..> | 2025-10-08 20:45 | 12K | |
![[ ]](/icons/layout.gif) | 20442_Northants Gara..> | 2025-11-27 13:58 | 12K | |
![[ ]](/icons/layout.gif) | 23575_East Anglia Ro..> | 2025-12-05 15:53 | 12K | |
![[ ]](/icons/layout.gif) | 38552_Starlite Home ..> | 2026-01-29 15:06 | 12K | |
![[ ]](/icons/layout.gif) | 7797_Boombastic Door..> | 2025-08-18 23:05 | 13K | |
![[ ]](/icons/layout.gif) | 37160_TPS Gates & Do..> | 2026-01-26 15:22 | 13K | |
![[ ]](/icons/layout.gif) | 33559_TPS Gates & Do..> | 2026-01-15 09:46 | 13K | |
![[ ]](/icons/layout.gif) | 2172_Maureen Bell - ..> | 2025-10-03 14:32 | 13K | |
![[ ]](/icons/layout.gif) | 744_Clifford Lowdell..> | 2025-09-24 12:05 | 13K | |
![[ ]](/icons/layout.gif) | 775_JP Hills James H..> | 2025-09-24 14:10 | 13K | |
![[ ]](/icons/layout.gif) | 15520_D J Furness Co..> | 2025-11-14 13:40 | 13K | |
![[ ]](/icons/layout.gif) | 742_P & R Door Syste..> | 2025-09-24 12:04 | 13K | |
![[ ]](/icons/layout.gif) | 5451_Shaun Craft - C..> | 2025-10-16 13:19 | 13K | |
![[ ]](/icons/layout.gif) | 11204_Myers Garage D..> | 2025-11-04 11:28 | 13K | |
![[ ]](/icons/layout.gif) | 7625_Blaster Garage ..> | 2025-08-01 09:59 | 13K | |
![[ ]](/icons/layout.gif) | 13736_Neil Hambling ..> | 2025-11-11 10:42 | 13K | |
![[ ]](/icons/layout.gif) | 62781_The Lothian Ga..> | 2026-04-07 09:55 | 13K | |
![[ ]](/icons/layout.gif) | 198_Doors 4 You Ltd ..> | 2025-09-18 12:50 | 13K | |
![[ ]](/icons/layout.gif) | 1301_[0,0] Ryan Mell..> | 2025-09-29 14:45 | 13K | |
![[ ]](/icons/layout.gif) | 11456_D H Gates and ..> | 2025-11-04 14:45 | 13K | |
![[ ]](/icons/layout.gif) | 1253_Lewis - LEWI000..> | 2025-09-29 12:59 | 13K | |
![[ ]](/icons/layout.gif) | 8072_Ronald Collins ..> | 2025-10-24 14:10 | 13K | |
![[ ]](/icons/layout.gif) | 334_Andy Green - GRE..> | 2025-09-19 15:27 | 13K | |
![[ ]](/icons/layout.gif) | 1448_[0,0] Ryan Mell..> | 2025-09-30 14:23 | 13K | |
![[ ]](/icons/layout.gif) | 11462_Mclaren - Serv..> | 2025-11-04 14:55 | 13K | |
![[ ]](/icons/layout.gif) | 14773_Mark Tapper - ..> | 2025-11-13 08:49 | 13K | |
![[ ]](/icons/layout.gif) | 4500_Mark Tapper - T..> | 2025-10-14 10:00 | 13K | |
![[ ]](/icons/layout.gif) | 4532_Cerromar Ltd (T..> | 2025-10-14 10:22 | 13K | |
![[ ]](/icons/layout.gif) | 1908_Academy Windows..> | 2025-10-02 15:44 | 13K | |
![[ ]](/icons/layout.gif) | 12064_Charlie Sander..> | 2025-11-05 15:48 | 13K | |
![[ ]](/icons/layout.gif) | 9940_Ewan Robertson ..> | 2025-10-30 15:47 | 13K | |
![[ ]](/icons/layout.gif) | 5595_Gordon Renfrew ..> | 2025-10-16 14:36 | 13K | |
![[ ]](/icons/layout.gif) | 1341_Robert Coutts -..> | 2025-09-30 07:08 | 13K | |
![[ ]](/icons/layout.gif) | 13314_Andrew Morgan ..> | 2025-11-10 12:45 | 13K | |
![[ ]](/icons/layout.gif) | 9346_Gary Edgar - ED..> | 2025-10-29 12:01 | 13K | |
![[ ]](/icons/layout.gif) | 2243_Academy Windows..> | 2025-10-06 08:59 | 13K | |
![[ ]](/icons/layout.gif) | 2249_Academy Windows..> | 2025-10-06 09:08 | 13K | |
![[ ]](/icons/layout.gif) | 2240_Robert Cox - CO..> | 2025-10-06 08:52 | 13K | |
![[ ]](/icons/layout.gif) | 6902_Doors 4 Garages..> | 2025-10-22 11:03 | 13K | |
![[ ]](/icons/layout.gif) | 3771_Cerromar Soluti..> | 2025-10-10 10:21 | 13K | |
![[ ]](/icons/layout.gif) | 6403_Danielle Milwar..> | 2025-10-21 08:17 | 13K | |
![[ ]](/icons/layout.gif) | 5664_John Cuthbertso..> | 2025-10-16 16:03 | 13K | |
![[ ]](/icons/layout.gif) | 1819_David Dawson - ..> | 2025-10-02 12:43 | 13K | |
![[ ]](/icons/layout.gif) | 10840_Will Baxter - ..> | 2025-11-03 13:16 | 13K | |
![[ ]](/icons/layout.gif) | 10825_Alan Pattison ..> | 2025-11-03 13:04 | 13K | |
![[ ]](/icons/layout.gif) | 181_[0,0] Reid - RE..> | 2025-09-18 10:01 | 13K | |
![[ ]](/icons/layout.gif) | 3103_Roy Roynting - ..> | 2025-10-08 12:22 | 13K | |
![[ ]](/icons/layout.gif) | 481_Fortress_Doors A..> | 2025-09-23 07:41 | 13K | |
![[ ]](/icons/layout.gif) | 11795_Gerrard Collin..> | 2025-11-05 11:18 | 13K | |
![[ ]](/icons/layout.gif) | 134_[0,0] James Turn..> | 2025-09-17 14:58 | 13K | |
![[ ]](/icons/layout.gif) | 10638_Kevin Credland..> | 2025-11-03 10:05 | 13K | |
![[ ]](/icons/layout.gif) | 593_Gary Pont - PONT..> | 2025-09-23 14:25 | 13K | |
![[ ]](/icons/layout.gif) | 2819_[0,0] Nicola Ha..> | 2025-10-07 15:08 | 13K | |
![[ ]](/icons/layout.gif) | 1576_David Page - PA..> | 2025-10-01 10:32 | 13K | |
![[ ]](/icons/layout.gif) | 5363_Ryan Hawley - H..> | 2025-10-16 11:58 | 13K | |
![[ ]](/icons/layout.gif) | 132_John Williams - ..> | 2025-09-17 14:46 | 13K | |
![[ ]](/icons/layout.gif) | 1976_[0,0] Jason Wal..> | 2025-10-03 10:03 | 13K | |
![[ ]](/icons/layout.gif) | 10621_Kenneth Jones ..> | 2025-11-03 09:51 | 13K | |
![[ ]](/icons/layout.gif) | 7261_Cyril Ralphs - ..> | 2025-10-23 10:05 | 13K | |
![[ ]](/icons/layout.gif) | 11791_Pete Metcalfe ..> | 2025-11-05 11:15 | 13K | |
![[ ]](/icons/layout.gif) | 2671_Richard Hoyle -..> | 2025-10-07 09:53 | 13K | |
![[ ]](/icons/layout.gif) | 11771_Brenda Bussey ..> | 2025-11-05 11:10 | 13K | |
![[ ]](/icons/layout.gif) | 1548_Paul Strachan -..> | 2025-10-01 08:58 | 13K | |
![[ ]](/icons/layout.gif) | 1336_1st 4 Outdoorso..> | 2025-09-30 06:18 | 13K | |
![[ ]](/icons/layout.gif) | 826_Marcus Aston - A..> | 2025-09-25 08:06 | 13K | |
![[ ]](/icons/layout.gif) | 2840_[0,0] Victoria ..> | 2025-10-07 16:02 | 13K | |
![[ ]](/icons/layout.gif) | 567_Steve Watts - WA..> | 2025-09-23 12:28 | 13K | |
![[ ]](/icons/layout.gif) | 589_Trevor Gibson - ..> | 2025-09-23 14:23 | 13K | |
![[ ]](/icons/layout.gif) | 4308_James Webster -..> | 2025-10-13 13:40 | 13K | |
![[ ]](/icons/layout.gif) | 4412_[0,0] Jason Wal..> | 2025-10-14 06:40 | 13K | |
![[ ]](/icons/layout.gif) | 600_Adam Jenkins - J..> | 2025-09-23 14:29 | 13K | |
![[ ]](/icons/layout.gif) | 11528_CPS Custom Pro..> | 2025-11-05 08:09 | 13K | |
![[ ]](/icons/layout.gif) | 5832_M. A. E. Window..> | 2025-10-17 11:06 | 13K | |
![[ ]](/icons/layout.gif) | 9733_Hobbs - Straps ..> | 2025-10-30 10:59 | 13K | |
![[ ]](/icons/layout.gif) | 9742_Hobbs - Straps ..> | 2025-10-30 11:09 | 13K | |
![[ ]](/icons/layout.gif) | 12821_Hobbs - Straps..> | 2025-11-07 12:35 | 13K | |
![[ ]](/icons/layout.gif) | 3767_Henry Attree - ..> | 2025-10-10 10:11 | 13K | |
![[ ]](/icons/layout.gif) | 10772_James Anderson..> | 2025-11-03 12:11 | 13K | |
![[ ]](/icons/layout.gif) | 10832_Ashley Fieldho..> | 2025-11-03 13:11 | 13K | |
![[ ]](/icons/layout.gif) | 573_Julie Noble - NO..> | 2025-09-23 12:54 | 13K | |
![[ ]](/icons/layout.gif) | 2104_Timothy Noakes ..> | 2025-10-03 12:24 | 13K | |
![[ ]](/icons/layout.gif) | 3948_Leonard Harriso..> | 2025-10-10 13:53 | 13K | |
![[ ]](/icons/layout.gif) | 7461_Scott Curie - S..> | 2025-10-23 12:14 | 13K | |
![[ ]](/icons/layout.gif) | 11013_Alan Dobson - ..> | 2025-11-03 16:12 | 13K | |
![[ ]](/icons/layout.gif) | 1013_Rodger Gooding ..> | 2025-09-26 11:00 | 13K | |
![[ ]](/icons/layout.gif) | 2304_David Goodhew -..> | 2025-10-06 11:06 | 13K | |
![[ ]](/icons/layout.gif) | 14319_Tim Willis - R..> | 2025-11-12 09:11 | 13K | |
![[ ]](/icons/layout.gif) | 2405_Simon Dobson - ..> | 2025-10-06 12:42 | 13K | |
![[ ]](/icons/layout.gif) | 10802_Matthew Armita..> | 2025-11-03 12:33 | 13K | |
![[ ]](/icons/layout.gif) | 2377_Michael Selby -..> | 2025-10-06 12:14 | 13K | |
![[ ]](/icons/layout.gif) | 2385_Sara Morris - M..> | 2025-10-06 12:28 | 13K | |
![[ ]](/icons/layout.gif) | 4554_Colin Hartgrove..> | 2025-10-14 10:56 | 13K | |
![[ ]](/icons/layout.gif) | 5695_Beaver Soluitio..> | 2025-10-17 06:58 | 13K | |
![[ ]](/icons/layout.gif) | 6373_Beaver Soluitio..> | 2025-10-20 15:49 | 13K | |
![[ ]](/icons/layout.gif) | 14315_Frank Barker -..> | 2025-11-12 09:09 | 13K | |
![[ ]](/icons/layout.gif) | 1461_William White -..> | 2025-09-30 15:03 | 13K | |
![[ ]](/icons/layout.gif) | 2529_The Lothian Gar..> | 2025-10-06 16:16 | 13K | |
![[ ]](/icons/layout.gif) | 10253_Carol Izatt - ..> | 2025-10-31 11:40 | 13K | |
![[ ]](/icons/layout.gif) | 57860_The Lothian Ga..> | 2026-03-23 10:24 | 13K | |
![[ ]](/icons/layout.gif) | 2954_[0,0] Victoria ..> | 2025-10-08 09:43 | 13K | |
![[ ]](/icons/layout.gif) | 2476_Ivan McDermott ..> | 2025-10-06 14:03 | 13K | |
![[ ]](/icons/layout.gif) | 23156_Keith Williets..> | 2025-12-04 16:09 | 13K | |
![[ ]](/icons/layout.gif) | 712_Heather Foster -..> | 2025-09-24 10:33 | 13K | |
![[ ]](/icons/layout.gif) | 405_Fortress_Doors A..> | 2025-09-22 10:50 | 13K | |
![[ ]](/icons/layout.gif) | 11149_Kevin Slater -..> | 2025-11-04 09:57 | 13K | |
![[ ]](/icons/layout.gif) | 11150_Kevin Slater -..> | 2025-11-04 09:57 | 13K | |
![[ ]](/icons/layout.gif) | 2525_Scotia Garage D..> | 2025-10-06 15:58 | 13K | |
![[ ]](/icons/layout.gif) | 10459_Doorolla Ltd S..> | 2025-11-03 08:31 | 13K | |
![[ ]](/icons/layout.gif) | 12521_Andy Jarvis - ..> | 2025-11-06 15:50 | 13K | |
![[ ]](/icons/layout.gif) | 14500_James Sumner -..> | 2025-11-12 11:51 | 13K | |
![[ ]](/icons/layout.gif) | 1053_Fortress_Doors ..> | 2025-09-26 12:53 | 13K | |
![[ ]](/icons/layout.gif) | 2144_Kenneth Rowley ..> | 2025-10-03 13:32 | 13K | |
![[ ]](/icons/layout.gif) | 3894_Jody Baxter - B..> | 2025-10-10 12:44 | 13K | |
![[ ]](/icons/layout.gif) | 4223_Richard Moore -..> | 2025-10-13 11:51 | 13K | |
![[ ]](/icons/layout.gif) | 14486_Tony Evans - O..> | 2025-11-12 11:46 | 13K | |
![[ ]](/icons/layout.gif) | 2336_Barclay - BARC0..> | 2025-10-06 11:11 | 13K | |
![[ ]](/icons/layout.gif) | 4331_R Chambers - R ..> | 2025-10-13 14:09 | 13K | |
![[ ]](/icons/layout.gif) | 111_[0,0] Steve Terr..> | 2025-09-17 13:26 | 13K | |
![[ ]](/icons/layout.gif) | 1330_The Lothian Gar..> | 2025-09-29 15:46 | 13K | |
![[ ]](/icons/layout.gif) | 14927_Philip Cole - ..> | 2025-11-13 10:51 | 13K | |
![[ ]](/icons/layout.gif) | 1812_Graham Packham ..> | 2025-10-02 12:34 | 13K | |
![[ ]](/icons/layout.gif) | 479_Fortress_Doors A..> | 2025-09-23 07:38 | 13K | |
![[ ]](/icons/layout.gif) | 5351_A J Cope Builde..> | 2025-10-16 11:43 | 13K | |
![[ ]](/icons/layout.gif) | 128_Cromer Garage Do..> | 2025-09-17 14:42 | 13K | |
![[ ]](/icons/layout.gif) | 129_Cromer Garage Do..> | 2025-09-17 14:42 | 13K | |
![[ ]](/icons/layout.gif) | 10242_Paul Harman - ..> | 2025-10-31 11:35 | 13K | |
![[ ]](/icons/layout.gif) | 3024_[0,0] James Tur..> | 2025-10-08 10:18 | 13K | |
![[ ]](/icons/layout.gif) | 673_Fortress_Doors A..> | 2025-09-24 08:08 | 13K | |
![[ ]](/icons/layout.gif) | 2248_Russell White -..> | 2025-10-06 09:05 | 13K | |
![[ ]](/icons/layout.gif) | 5378_Ben Lovell - LO..> | 2025-10-16 12:05 | 13K | |
![[ ]](/icons/layout.gif) | 12139_Go Garage Door..> | 2025-11-06 09:32 | 13K | |
![[ ]](/icons/layout.gif) | 1804_Thomas Fitzgera..> | 2025-10-02 12:28 | 13K | |
![[ ]](/icons/layout.gif) | 1806_Thomas Fitzgera..> | 2025-10-02 12:29 | 13K | |
![[ ]](/icons/layout.gif) | 3465_[0,0] Victoria ..> | 2025-10-09 11:28 | 13K | |
![[ ]](/icons/layout.gif) | 7379_Lyn Wright - Ly..> | 2025-10-23 11:28 | 13K | |
![[ ]](/icons/layout.gif) | 2297_[0,0] Nathan Wa..> | 2025-10-06 11:01 | 13K | |
![[ ]](/icons/layout.gif) | 1099_Leo Cordingley ..> | 2025-09-26 15:13 | 13K | |
![[ ]](/icons/layout.gif) | 12083_Garage Doors 2..> | 2025-11-05 16:26 | 13K | |
![[ ]](/icons/layout.gif) | 1545_Nathan Hayes - ..> | 2025-10-01 08:57 | 13K | |
![[ ]](/icons/layout.gif) | 11457_Oakley Windows..> | 2025-11-04 14:51 | 13K | |
![[ ]](/icons/layout.gif) | 11458_Oakley Windows..> | 2025-11-04 14:51 | 13K | |
![[ ]](/icons/layout.gif) | 10145_Rollermatic Ga..> | 2025-10-31 09:58 | 13K | |
![[ ]](/icons/layout.gif) | 7203_Ben Lovell - LO..> | 2025-10-23 08:14 | 13K | |
![[ ]](/icons/layout.gif) | 283_My Garage Door S..> | 2025-09-19 11:09 | 13K | |
![[ ]](/icons/layout.gif) | 14145_UK Rollerdoors..> | 2025-11-11 16:49 | 13K | |
![[ ]](/icons/layout.gif) | 306_Doors 4 You Ltd ..> | 2025-09-19 12:35 | 13K | |
![[ ]](/icons/layout.gif) | 1971_Jeffrey Everitt..> | 2025-10-03 09:32 | 13K | |
![[ ]](/icons/layout.gif) | 12274_Anvile Enginee..> | 2025-11-06 11:31 | 13K | |
![[ ]](/icons/layout.gif) | 13621_Open And Shut ..> | 2025-11-11 09:10 | 13K | |
![[ ]](/icons/layout.gif) | 839_Richard Horspool..> | 2025-09-25 09:46 | 13K | |
![[ ]](/icons/layout.gif) | 3520_James Wall - WA..> | 2025-10-09 12:31 | 13K | |
![[ ]](/icons/layout.gif) | 5968_Doorolla Ltd St..> | 2025-10-17 14:01 | 13K | |
![[ ]](/icons/layout.gif) | 6691_Elevate Doors L..> | 2025-10-21 15:46 | 13K | |
![[ ]](/icons/layout.gif) | 127_Rosie - ROSI0001..> | 2025-09-17 14:42 | 13K | |
![[ ]](/icons/layout.gif) | 14808_Elevate Doors ..> | 2025-11-13 09:19 | 13K | |
![[ ]](/icons/layout.gif) | 1929_Windowcraft Des..> | 2025-10-03 07:17 | 13K | |
![[ ]](/icons/layout.gif) | 2350_Windowcraft Des..> | 2025-10-06 11:38 | 13K | |
![[ ]](/icons/layout.gif) | 1605_[0,0] James Wal..> | 2025-10-01 13:19 | 13K | |
![[ ]](/icons/layout.gif) | 135_Doorolla Ltd Ste..> | 2025-09-17 15:03 | 13K | |
![[ ]](/icons/layout.gif) | 1175_[0,0] James Wal..> | 2025-09-29 08:31 | 13K | |
![[ ]](/icons/layout.gif) | 658_East Anglia Roll..> | 2025-09-24 07:47 | 13K | |
![[ ]](/icons/layout.gif) | 4072_East Anglia Rol..> | 2025-10-13 08:46 | 13K | |
![[ ]](/icons/layout.gif) | 7351_Salim Al-Khalil..> | 2025-10-23 11:15 | 13K | |
![[ ]](/icons/layout.gif) | 349_Southern Conserv..> | 2025-09-22 07:27 | 13K | |
![[ ]](/icons/layout.gif) | 6005_Lexicus Develop..> | 2025-10-17 15:33 | 13K | |
![[ ]](/icons/layout.gif) | 5734_East Anglia Rol..> | 2025-10-17 08:07 | 13K | |
![[ ]](/icons/layout.gif) | 1113_East Anglia Rol..> | 2025-09-26 15:54 | 13K | |
![[ ]](/icons/layout.gif) | 3288_[0,0] Nicola Ha..> | 2025-10-09 07:17 | 13K | |
![[ ]](/icons/layout.gif) | 13805_Nicola Vaughan..> | 2025-11-11 11:59 | 13K | |
![[ ]](/icons/layout.gif) | 14740_NW Automatic D..> | 2025-11-12 16:34 | 13K | |
![[ ]](/icons/layout.gif) | 2648_The Lothian Gar..> | 2025-10-07 09:25 | 13K | |
![[ ]](/icons/layout.gif) | 5996_East Anglia Rol..> | 2025-10-17 15:10 | 13K | |
![[ ]](/icons/layout.gif) | 8060_Mitchal Welberr..> | 2025-10-24 13:52 | 13K | |
![[ ]](/icons/layout.gif) | 5871_J Bowman Garage..> | 2025-10-17 11:59 | 13K | |
![[ ]](/icons/layout.gif) | 1830_Sarah Calderban..> | 2025-10-02 12:53 | 13K | |
![[ ]](/icons/layout.gif) | 3093_[0,0] Paul Stew..> | 2025-10-08 12:09 | 13K | |
![[ ]](/icons/layout.gif) | 10993_Harrogate Home..> | 2025-11-03 15:55 | 13K | |
![[ ]](/icons/layout.gif) | 11463_Oakley Windows..> | 2025-11-04 14:56 | 13K | |
![[ ]](/icons/layout.gif) | 11515_WADE WINDOWS I..> | 2025-11-04 16:52 | 13K | |
![[ ]](/icons/layout.gif) | 90_Chelmsford Roller..> | 2025-09-17 08:43 | 13K | |
![[ ]](/icons/layout.gif) | 338_Wokingham Glazin..> | 2025-09-19 15:35 | 13K | |
![[ ]](/icons/layout.gif) | 8783_Fortress Doors ..> | 2025-10-28 09:49 | 13K | |
![[ ]](/icons/layout.gif) | 617_East Anglia Roll..> | 2025-09-23 15:41 | 13K | |
![[ ]](/icons/layout.gif) | 596_Kris Glenwright ..> | 2025-09-23 14:28 | 13K | |
![[ ]](/icons/layout.gif) | 7368_Paul Kinsman - ..> | 2025-10-23 11:23 | 13K | |
![[ ]](/icons/layout.gif) | 205_C & P Doors Crai..> | 2025-09-18 14:23 | 13K | |
![[ ]](/icons/layout.gif) | 709_Andy Green - GRE..> | 2025-09-24 10:31 | 13K | |
![[ ]](/icons/layout.gif) | 4071_Andy Green - GR..> | 2025-10-13 08:43 | 13K | |
![[ ]](/icons/layout.gif) | 10377_Ross Garage Do..> | 2025-10-31 13:49 | 13K | |
![[ ]](/icons/layout.gif) | 750_C&M Glass Servic..> | 2025-09-24 12:36 | 13K | |
![[ ]](/icons/layout.gif) | 846_Absolute Garage ..> | 2025-09-25 10:01 | 13K | |
![[ ]](/icons/layout.gif) | 1032_Garage Doors 24..> | 2025-09-26 11:44 | 13K | |
![[ ]](/icons/layout.gif) | 11650_Rollermatic Ga..> | 2025-11-05 09:26 | 13K | |
![[ ]](/icons/layout.gif) | 952_TPS Gates & Door..> | 2025-09-26 07:16 | 13K | |
![[ ]](/icons/layout.gif) | 2492_Absolute Garage..> | 2025-10-06 14:30 | 13K | |
![[ ]](/icons/layout.gif) | 3086_[0,0] Nigel Ter..> | 2025-10-08 11:39 | 13K | |
![[ ]](/icons/layout.gif) | 642_Northants Garage..> | 2025-09-24 07:24 | 13K | |
![[ ]](/icons/layout.gif) | 837_The Lothian Gara..> | 2025-09-25 09:31 | 13K | |
![[ ]](/icons/layout.gif) | 11229_Ross Garage Do..> | 2025-11-04 11:38 | 13K | |
![[ ]](/icons/layout.gif) | 4758_Mark Tapper - T..> | 2025-10-14 15:07 | 13K | |
![[ ]](/icons/layout.gif) | 7605_SW Trade Frames..> | 2025-10-23 14:36 | 13K | |
![[ ]](/icons/layout.gif) | 534_Garage Door Repa..> | 2025-09-23 10:36 | 13K | |
![[ ]](/icons/layout.gif) | 8028_Fortress Doors ..> | 2025-10-24 13:04 | 13K | |
![[ ]](/icons/layout.gif) | 5679_All Door Engine..> | 2025-10-17 06:37 | 13K | |
![[ ]](/icons/layout.gif) | 5699_All Door Engine..> | 2025-10-17 07:00 | 13K | |
![[ ]](/icons/layout.gif) | 108_[0,0] Steve Terr..> | 2025-09-17 12:15 | 13K | |
![[ ]](/icons/layout.gif) | 2100_Lionel Mewton -..> | 2025-10-03 12:19 | 13K | |
![[ ]](/icons/layout.gif) | 4017_Rollermatic Gar..> | 2025-10-13 07:48 | 13K | |
![[ ]](/icons/layout.gif) | 116_PDl Fabrications..> | 2025-09-17 14:15 | 13K | |
![[ ]](/icons/layout.gif) | 308_J Brady Garage D..> | 2025-09-19 12:49 | 13K | |
![[ ]](/icons/layout.gif) | 535_Garage Door Repa..> | 2025-09-23 10:38 | 13K | |
![[ ]](/icons/layout.gif) | 13118_C&M Glass Serv..> | 2025-11-10 09:11 | 13K | |
![[ ]](/icons/layout.gif) | 6961_C & P Doors Cra..> | 2025-10-22 12:35 | 13K | |
![[ ]](/icons/layout.gif) | 1540_Avon Automated ..> | 2025-10-01 08:42 | 13K | |
![[ ]](/icons/layout.gif) | 12801_Chelmsford Rol..> | 2025-11-07 12:01 | 13K | |
![[ ]](/icons/layout.gif) | 6379_BBA Development..> | 2025-10-20 16:21 | 13K | |
![[ ]](/icons/layout.gif) | 644_Fortress_Doors A..> | 2025-09-24 07:30 | 13K | |
![[ ]](/icons/layout.gif) | 12222_S R W Services..> | 2025-11-06 10:22 | 13K | |
![[ ]](/icons/layout.gif) | 12704_Mr McArthur - ..> | 2025-11-07 09:55 | 13K | |
![[ ]](/icons/layout.gif) | 1464_Tru-Fit Windows..> | 2025-09-30 15:12 | 13K | |
![[ ]](/icons/layout.gif) | 4583_Doorolla Steve ..> | 2025-10-14 12:18 | 13K | |
![[ ]](/icons/layout.gif) | 224_The Lothian Gara..> | 2025-09-18 18:53 | 13K | |
![[ ]](/icons/layout.gif) | 3842_James Newton - ..> | 2025-10-10 12:22 | 13K | |
![[ ]](/icons/layout.gif) | 10818_East Anglia Ro..> | 2025-11-03 12:56 | 13K | |
![[ ]](/icons/layout.gif) | 2368_Leo Cordingley ..> | 2025-10-06 12:08 | 13K | |
![[ ]](/icons/layout.gif) | 14132_Hereford Mobil..> | 2025-11-11 16:40 | 13K | |
![[ ]](/icons/layout.gif) | 11648_Rollermatic Ga..> | 2025-11-05 09:23 | 13K | |
![[ ]](/icons/layout.gif) | 7389_Cara Luff - Car..> | 2025-10-23 11:35 | 13K | |
![[ ]](/icons/layout.gif) | 162_M. A. E. Windows..> | 2025-09-18 07:24 | 13K | |
![[ ]](/icons/layout.gif) | 1562_Tru-Fit Windows..> | 2025-10-01 09:36 | 13K | |
![[ ]](/icons/layout.gif) | 1471_Tru-Fit Windows..> | 2025-09-30 15:36 | 13K | |
![[ ]](/icons/layout.gif) | 7903_Ross Garage Doo..> | 2025-10-24 10:37 | 13K | |
![[ ]](/icons/layout.gif) | 7200_Eclipse Doors D..> | 2025-10-23 08:08 | 13K | |
![[ ]](/icons/layout.gif) | 9474_Gilberts Home I..> | 2025-10-29 15:08 | 13K | |
![[ ]](/icons/layout.gif) | 270_P & R Door Syste..> | 2025-09-19 10:19 | 13K | |
![[ ]](/icons/layout.gif) | 3019_[0,0] WINDOWORL..> | 2025-10-08 10:11 | 13K | |
![[ ]](/icons/layout.gif) | 2158_[0,0] Jason Wal..> | 2025-10-03 14:13 | 13K | |
![[ ]](/icons/layout.gif) | 1118_Rollermatic Gar..> | 2025-09-26 16:27 | 13K | |
![[ ]](/icons/layout.gif) | 9385_Shutter Tech UK..> | 2025-10-29 13:54 | 13K | |
![[ ]](/icons/layout.gif) | 1176_James Wall - WA..> | 2025-09-29 08:35 | 13K | |
![[ ]](/icons/layout.gif) | 10795_Brian Hooper -..> | 2025-11-03 12:27 | 13K | |
![[ ]](/icons/layout.gif) | 4025_[0,0] Andy Sedd..> | 2025-10-13 07:59 | 13K | |
![[ ]](/icons/layout.gif) | 13310_Doorolla Ltd S..> | 2025-11-10 12:37 | 13K | |
![[ ]](/icons/layout.gif) | 1554_Avon Automated ..> | 2025-10-01 09:02 | 13K | |
![[ ]](/icons/layout.gif) | 4342_Bespoke UPVC Wi..> | 2025-10-13 14:34 | 13K | |
![[ ]](/icons/layout.gif) | 1552_[0,0] Mark Perh..> | 2025-10-01 09:01 | 13K | |
![[ ]](/icons/layout.gif) | 5160_Pioneer Doors K..> | 2025-10-16 06:53 | 13K | |
![[ ]](/icons/layout.gif) | 6014_Norfolk Broads ..> | 2025-10-17 16:02 | 13K | |
![[ ]](/icons/layout.gif) | 2341_[0,0] Nathan Wa..> | 2025-10-06 11:27 | 13K | |
![[ ]](/icons/layout.gif) | 10434_Rolltex Hutter..> | 2025-10-31 16:59 | 13K | |
![[ ]](/icons/layout.gif) | 11040_Rollermatic Ga..> | 2025-11-03 16:37 | 13K | |
![[ ]](/icons/layout.gif) | 13791_Clic Garage Do..> | 2025-11-11 11:39 | 13K | |
![[ ]](/icons/layout.gif) | 2470_Academy Windows..> | 2025-10-06 13:55 | 13K | |
![[ ]](/icons/layout.gif) | 5838_Rollermatic Gar..> | 2025-10-17 11:15 | 13K | |
![[ ]](/icons/layout.gif) | 776_Fortress_Doors A..> | 2025-09-24 14:21 | 13K | |
![[ ]](/icons/layout.gif) | 1593_Proud 2 Fix Mat..> | 2025-10-01 12:30 | 13K | |
![[ ]](/icons/layout.gif) | 6021_[0,0] Dean Bark..> | 2025-10-20 07:26 | 13K | |
![[ ]](/icons/layout.gif) | 10262_UK Rollerdoors..> | 2025-10-31 11:44 | 13K | |
![[ ]](/icons/layout.gif) | 13128_Nuvo Windows P..> | 2025-11-10 09:17 | 13K | |
![[ ]](/icons/layout.gif) | 39351_Statement_02-0..> | 2026-02-02 15:30 | 13K | |
![[ ]](/icons/layout.gif) | 988_Nigel Travis - T..> | 2025-09-26 08:50 | 13K | |
![[ ]](/icons/layout.gif) | 11028_The Lothian Ga..> | 2025-11-03 16:25 | 13K | |
![[ ]](/icons/layout.gif) | 1709_The Lothian Gar..> | 2025-10-02 07:00 | 13K | |
![[ ]](/icons/layout.gif) | 13151_Catherine Evan..> | 2025-11-10 09:36 | 13K | |
![[ ]](/icons/layout.gif) | 1332_The Lothian Gar..> | 2025-09-29 15:54 | 13K | |
![[ ]](/icons/layout.gif) | 2749_[0,0] Jason Wal..> | 2025-10-07 12:54 | 13K | |
![[ ]](/icons/layout.gif) | 8566_Norfolk Broads ..> | 2025-10-27 15:01 | 13K | |
![[ ]](/icons/layout.gif) | 2288_SW Trade Frames..> | 2025-10-06 10:45 | 13K | |
![[ ]](/icons/layout.gif) | 11038_Norfolk Broads..> | 2025-11-03 16:36 | 13K | |
![[ ]](/icons/layout.gif) | 6006_Fortress Doors ..> | 2025-10-17 15:34 | 13K | |
![[ ]](/icons/layout.gif) | 12553_Warnsham Windo..> | 2025-11-06 16:02 | 13K | |
![[ ]](/icons/layout.gif) | 3814_Cerromar Soluti..> | 2025-10-10 11:22 | 13K | |
![[ ]](/icons/layout.gif) | 4212_[0,0] Jason Wal..> | 2025-10-13 11:22 | 13K | |
![[ ]](/icons/layout.gif) | 10812_Absolute Garag..> | 2025-11-03 12:49 | 13K | |
![[ ]](/icons/layout.gif) | 9847_The Lothian Gar..> | 2025-10-30 13:56 | 13K | |
![[ ]](/icons/layout.gif) | 6047_Custom Trade Sy..> | 2025-10-20 08:14 | 13K | |
![[ ]](/icons/layout.gif) | 10998_Rollermatic Ga..> | 2025-11-03 16:01 | 13K | |
![[ ]](/icons/layout.gif) | 11142_M. A. E. Windo..> | 2025-11-04 09:51 | 13K | |
![[ ]](/icons/layout.gif) | 2347_[0,0] James Tur..> | 2025-10-06 11:33 | 13K | |
![[ ]](/icons/layout.gif) | 10294_Hughes House &..> | 2025-10-31 11:56 | 13K | |
![[ ]](/icons/layout.gif) | 14577_Elevate Doors ..> | 2025-11-12 13:16 | 13K | |
![[ ]](/icons/layout.gif) | 11034_Rollermatic Ga..> | 2025-11-03 16:34 | 13K | |
![[ ]](/icons/layout.gif) | 11660_Highlands Elec..> | 2025-11-05 09:46 | 13K | |
![[ ]](/icons/layout.gif) | 11031_The Lothian Ga..> | 2025-11-03 16:29 | 13K | |
![[ ]](/icons/layout.gif) | 638_NW Automatic Doo..> | 2025-09-24 07:10 | 13K | |
![[ ]](/icons/layout.gif) | 5382_UK Rollerdoors ..> | 2025-10-16 12:10 | 13K | |
![[ ]](/icons/layout.gif) | 7968_Taundry Doors W..> | 2025-10-24 12:08 | 13K | |
![[ ]](/icons/layout.gif) | 9924_My Garage Door ..> | 2025-10-30 15:13 | 13K | |
![[ ]](/icons/layout.gif) | 730_BH Electrical Se..> | 2025-09-24 11:09 | 13K | |
![[ ]](/icons/layout.gif) | 13307_The Lothian Ga..> | 2025-11-10 12:35 | 13K | |
![[ ]](/icons/layout.gif) | 604_Chargepoint Inst..> | 2025-09-23 15:03 | 13K | |
![[ ]](/icons/layout.gif) | 10519_Rollermatic Ga..> | 2025-11-03 09:34 | 13K | |
![[ ]](/icons/layout.gif) | 768_Fortress_Doors A..> | 2025-09-24 13:59 | 13K | |
![[ ]](/icons/layout.gif) | 11787_Garage DoorMan..> | 2025-11-05 11:14 | 13K | |
![[ ]](/icons/layout.gif) | 532_Roll Right Garag..> | 2025-09-23 10:28 | 13K | |
![[ ]](/icons/layout.gif) | 1265_Fortress_Doors ..> | 2025-09-29 13:25 | 13K | |
![[ ]](/icons/layout.gif) | 11259_Doorolla Ltd S..> | 2025-11-04 11:58 | 13K | |
![[ ]](/icons/layout.gif) | 5415_C&M Glass Servi..> | 2025-10-16 12:40 | 13K | |
![[ ]](/icons/layout.gif) | 1909_The Lothian Gar..> | 2025-10-02 15:52 | 13K | |
![[ ]](/icons/layout.gif) | 1721_The Lothian Gar..> | 2025-10-02 07:08 | 13K | |
![[ ]](/icons/layout.gif) | 5680_East Anglia Rol..> | 2025-10-17 06:37 | 13K | |
![[ ]](/icons/layout.gif) | 8276_NW Automatic Do..> | 2025-10-27 11:20 | 13K | |
![[ ]](/icons/layout.gif) | 3601_Neef Neil MacDo..> | 2025-10-09 14:32 | 13K | |
![[ ]](/icons/layout.gif) | 6114_Warnsham Window..> | 2025-10-20 09:52 | 13K | |
![[ ]](/icons/layout.gif) | 9121_SW Trade Frames..> | 2025-10-28 16:51 | 13K | |
![[ ]](/icons/layout.gif) | 7112_Spa Roller Door..> | 2025-10-22 14:46 | 13K | |
![[ ]](/icons/layout.gif) | 8594_TH Installation..> | 2025-10-27 15:39 | 13K | |
![[ ]](/icons/layout.gif) | 10371_The Lothian Ga..> | 2025-10-31 13:30 | 13K | |
![[ ]](/icons/layout.gif) | 3033_Windoworld Tayl..> | 2025-10-08 10:25 | 13K | |
![[ ]](/icons/layout.gif) | 522_Hanney Glazed Lt..> | 2025-09-23 09:43 | 13K | |
![[ ]](/icons/layout.gif) | 7195_Fortress Doors ..> | 2025-10-23 08:02 | 13K | |
![[ ]](/icons/layout.gif) | 13792_Clic Garage Do..> | 2025-11-11 11:40 | 13K | |
![[ ]](/icons/layout.gif) | 8823_Ross Garage Doo..> | 2025-10-28 10:54 | 13K | |
![[ ]](/icons/layout.gif) | 12217_D J Furness Co..> | 2025-11-06 10:17 | 13K | |
![[ ]](/icons/layout.gif) | 7746_Beaver Plastic ..> | 2025-10-24 08:05 | 13K | |
![[ ]](/icons/layout.gif) | 9528_SW Trade Frames..> | 2025-10-29 16:24 | 13K | |
![[ ]](/icons/layout.gif) | 1033_The Lothian Gar..> | 2025-09-26 11:54 | 13K | |
![[ ]](/icons/layout.gif) | 8375_Ideal Industria..> | 2025-10-27 12:10 | 13K | |
![[ ]](/icons/layout.gif) | 13103_Island Home Im..> | 2025-11-10 08:50 | 13K | |
![[ ]](/icons/layout.gif) | 654_Oakley Windows L..> | 2025-09-24 07:43 | 13K | |
![[ ]](/icons/layout.gif) | 2057_[0,0] James Wal..> | 2025-10-03 12:08 | 13K | |
![[ ]](/icons/layout.gif) | 6836_Avon Automated ..> | 2025-10-22 09:45 | 13K | |
![[ ]](/icons/layout.gif) | 7110_Garage Doors 24..> | 2025-10-22 14:45 | 13K | |
![[ ]](/icons/layout.gif) | 4753_C&M Glass Servi..> | 2025-10-14 14:56 | 13K | |
![[ ]](/icons/layout.gif) | 14529_Hereford Mobil..> | 2025-11-12 12:06 | 13K | |
![[ ]](/icons/layout.gif) | 4909_[0,0] Steve Ter..> | 2025-10-15 10:49 | 13K | |
![[ ]](/icons/layout.gif) | 5408_Alps Home Impro..> | 2025-10-16 12:22 | 13K | |
![[ ]](/icons/layout.gif) | 14667_Danbury Garage..> | 2025-11-12 14:50 | 13K | |
![[ ]](/icons/layout.gif) | 1351_Oakley Windows ..> | 2025-09-30 07:40 | 13K | |
![[ ]](/icons/layout.gif) | 10410_NW Automatic D..> | 2025-10-31 15:41 | 13K | |
![[ ]](/icons/layout.gif) | 11159_The Lothian Ga..> | 2025-11-04 10:26 | 13K | |
![[ ]](/icons/layout.gif) | 2479_The Lothian Gar..> | 2025-10-06 14:14 | 13K | |
![[ ]](/icons/layout.gif) | 9826_Fortress Doors ..> | 2025-10-30 13:28 | 13K | |
![[ ]](/icons/layout.gif) | 7166_The Lothian Gar..> | 2025-10-22 16:02 | 13K | |
![[ ]](/icons/layout.gif) | 6315_East Anglia Rol..> | 2025-10-20 14:12 | 13K | |
![[ ]](/icons/layout.gif) | 7418_Jurassic Doors ..> | 2025-10-23 12:01 | 13K | |
![[ ]](/icons/layout.gif) | 6133_The Lothian Gar..> | 2025-10-20 10:16 | 13K | |
![[ ]](/icons/layout.gif) | 9818_Fortress Doors ..> | 2025-10-30 13:25 | 13K | |
![[ ]](/icons/layout.gif) | 683_Rollermatic Gara..> | 2025-09-24 08:42 | 13K | |
![[ ]](/icons/layout.gif) | 782_Craig Heard - HE..> | 2025-09-24 15:02 | 13K | |
![[ ]](/icons/layout.gif) | 12074_UK Rollerdoors..> | 2025-11-05 16:03 | 13K | |
![[ ]](/icons/layout.gif) | 14569_Roll Right Gar..> | 2025-11-12 12:45 | 13K | |
![[ ]](/icons/layout.gif) | 1066_Oakley Windows ..> | 2025-09-26 13:08 | 13K | |
![[ ]](/icons/layout.gif) | 2717_Tru-Fit Windows..> | 2025-10-07 11:38 | 13K | |
![[ ]](/icons/layout.gif) | 5948_The Lothian Gar..> | 2025-10-17 13:51 | 13K | |
![[ ]](/icons/layout.gif) | 5961_The Lothian Gar..> | 2025-10-17 13:59 | 13K | |
![[ ]](/icons/layout.gif) | 1704_The Lothian Gar..> | 2025-10-02 06:58 | 13K | |
![[ ]](/icons/layout.gif) | 5048_Norfolk Broads ..> | 2025-10-15 14:45 | 13K | |
![[ ]](/icons/layout.gif) | 9293_Automated Entry..> | 2025-10-29 09:50 | 13K | |
![[ ]](/icons/layout.gif) | 7324_Scotia Garage D..> | 2025-10-23 10:59 | 13K | |
![[ ]](/icons/layout.gif) | 74_A Stackhouse Wind..> | 2025-09-16 15:39 | 13K | |
![[ ]](/icons/layout.gif) | 6844_Avon Automated ..> | 2025-10-22 09:51 | 13K | |
![[ ]](/icons/layout.gif) | 1037_Doors 4 Garages..> | 2025-09-26 12:04 | 13K | |
![[ ]](/icons/layout.gif) | 5052_C&M Glass Servi..> | 2025-10-15 14:55 | 13K | |
![[ ]](/icons/layout.gif) | 1022_Hanney Glazed L..> | 2025-09-26 11:17 | 13K | |
![[ ]](/icons/layout.gif) | 9316_SW Trade Frames..> | 2025-10-29 10:54 | 13K | |
![[ ]](/icons/layout.gif) | 2045_Mick Moy Tyres ..> | 2025-10-03 12:00 | 13K | |
![[ ]](/icons/layout.gif) | 344_Ideal Industrial..> | 2025-09-19 15:55 | 13K | |
![[ ]](/icons/layout.gif) | 1738_The Lothian Gar..> | 2025-10-02 07:17 | 13K | |
![[ ]](/icons/layout.gif) | 5627_Norfolk Broads ..> | 2025-10-16 15:00 | 13K | |
![[ ]](/icons/layout.gif) | 5228_Norfolk Broads ..> | 2025-10-16 08:48 | 13K | |
![[ ]](/icons/layout.gif) | 2872_Rollermatic Gar..> | 2025-10-08 07:58 | 13K | |
![[ ]](/icons/layout.gif) | 998_Danbury Garage D..> | 2025-09-26 09:53 | 13K | |
![[ ]](/icons/layout.gif) | 7167_The Lothian Gar..> | 2025-10-22 16:02 | 13K | |
![[ ]](/icons/layout.gif) | 5998_AS Industrial D..> | 2025-10-17 15:29 | 13K | |
![[ ]](/icons/layout.gif) | 2816_The Lothian Gar..> | 2025-10-07 15:06 | 13K | |
![[ ]](/icons/layout.gif) | 13330_Catherine Evan..> | 2025-11-10 13:23 | 13K | |
![[ ]](/icons/layout.gif) | 14755_Norfolk Broads..> | 2025-11-13 08:17 | 13K | |
![[ ]](/icons/layout.gif) | 518_Northants Garage..> | 2025-09-23 09:04 | 13K | |
![[ ]](/icons/layout.gif) | 1028_Chargepoint Ins..> | 2025-09-26 11:28 | 13K | |
![[ ]](/icons/layout.gif) | 2790_The Lothian Gar..> | 2025-10-07 14:37 | 13K | |
![[ ]](/icons/layout.gif) | 937_Secured Door & G..> | 2025-09-25 15:20 | 13K | |
![[ ]](/icons/layout.gif) | 6396_SW Trade Frames..> | 2025-10-21 07:59 | 13K | |
![[ ]](/icons/layout.gif) | 2220_Absolute Garage..> | 2025-10-06 08:03 | 13K | |
![[ ]](/icons/layout.gif) | 5347_The Lothian Gar..> | 2025-10-16 11:37 | 13K | |
![[ ]](/icons/layout.gif) | 1127_Chargepoint Ins..> | 2025-09-29 07:24 | 13K | |
![[ ]](/icons/layout.gif) | 10143_Avon Automated..> | 2025-10-31 09:55 | 13K | |
![[ ]](/icons/layout.gif) | 1005_Secured Door & ..> | 2025-09-26 10:56 | 13K | |
![[ ]](/icons/layout.gif) | 10984_Elevate Doors ..> | 2025-11-03 15:45 | 13K | |
![[ ]](/icons/layout.gif) | 3010_Secured Door & ..> | 2025-10-08 10:05 | 13K | |
![[ ]](/icons/layout.gif) | 3038_Secured Door & ..> | 2025-10-08 10:32 | 13K | |
![[ ]](/icons/layout.gif) | 9364_Windoworld Tayl..> | 2025-10-29 13:06 | 13K | |
![[ ]](/icons/layout.gif) | 12041_Fortress Doors..> | 2025-11-05 15:17 | 13K | |
![[ ]](/icons/layout.gif) | 10417_Avon Automated..> | 2025-10-31 15:44 | 13K | |
![[ ]](/icons/layout.gif) | 3640_Creagorry Motor..> | 2025-10-09 15:44 | 13K | |
![[ ]](/icons/layout.gif) | 6762_SW Trade Frames..> | 2025-10-22 08:05 | 13K | |
![[ ]](/icons/layout.gif) | 8386_D Thurston Buil..> | 2025-10-27 12:14 | 13K | |
![[ ]](/icons/layout.gif) | 7190_SW Trade Frames..> | 2025-10-23 07:48 | 13K | |
![[ ]](/icons/layout.gif) | 14880_D J Furness Co..> | 2025-11-13 10:04 | 13K | |
![[ ]](/icons/layout.gif) | 5359_The Lothian Gar..> | 2025-10-16 11:52 | 13K | |
![[ ]](/icons/layout.gif) | 1378_The Lothian Gar..> | 2025-09-30 10:12 | 13K | |
![[ ]](/icons/layout.gif) | 5316_Ian Lamonby - L..> | 2025-10-16 10:53 | 13K | |
![[ ]](/icons/layout.gif) | 44772_Statement_17-0..> | 2026-02-17 11:15 | 14K | |
![[ ]](/icons/layout.gif) | 11689_Hanney Glazed ..> | 2025-11-05 10:11 | 14K | |
![[ ]](/icons/layout.gif) | 11173_The Lothian Ga..> | 2025-11-04 10:52 | 14K | |
![[ ]](/icons/layout.gif) | 8384_D Thurston Buil..> | 2025-10-27 12:14 | 14K | |
![[ ]](/icons/layout.gif) | 14729_Gilberts Home ..> | 2025-11-12 16:14 | 14K | |
![[ ]](/icons/layout.gif) | 5732_Doorolla Ltd St..> | 2025-10-17 08:05 | 14K | |
![[ ]](/icons/layout.gif) | 67354_Statement_17-0..> | 2026-04-17 13:59 | 14K | |
![[ ]](/icons/layout.gif) | 13641_Fortress Doors..> | 2025-11-11 09:49 | 14K | |
![[ ]](/icons/layout.gif) | 12113_D J Furness Co..> | 2025-11-06 08:56 | 14K | |
![[ ]](/icons/layout.gif) | 48633_Statement_26-0..> | 2026-02-26 14:13 | 14K | |
![[ ]](/icons/layout.gif) | 2594_SDS (Isle Of Ma..> | 2025-10-07 08:53 | 14K | |
![[ ]](/icons/layout.gif) | 50324_Statement_03-0..> | 2026-03-03 13:43 | 14K | |
![[ ]](/icons/layout.gif) | 9116_Warnsham Window..> | 2025-10-28 16:30 | 14K | |
![[ ]](/icons/layout.gif) | 13360_Warnsham Windo..> | 2025-11-10 14:02 | 14K | |
![[ ]](/icons/layout.gif) | 287_Hanney Glazed Lt..> | 2025-09-19 11:38 | 14K | |
![[ ]](/icons/layout.gif) | 244_Hanney Glazed Lt..> | 2025-09-19 08:00 | 14K | |
![[ ]](/icons/layout.gif) | 193_Hanney Glazed Lt..> | 2025-09-18 11:32 | 14K | |
![[ ]](/icons/layout.gif) | 7131_Garage Doors 24..> | 2025-10-22 15:00 | 15K | |
![[ ]](/icons/layout.gif) | 4338_Lockdown Doors ..> | 2025-10-13 14:29 | 15K | |
![[ ]](/icons/layout.gif) | 12787_T D Rollerdoor..> | 2025-11-07 11:34 | 15K | |
![[ ]](/icons/layout.gif) | 53088_Statement_10-0..> | 2026-03-10 09:51 | 15K | |
![[ ]](/icons/layout.gif) | 7784_Doors 4 Garages..> | 2025-10-24 08:51 | 15K | |
![[ ]](/icons/layout.gif) | 8021_Fortress Doors ..> | 2025-10-24 12:54 | 15K | |
![[ ]](/icons/layout.gif) | 285_Fortress_Doors A..> | 2025-09-19 11:28 | 15K | |
![[ ]](/icons/layout.gif) | 583_Garage DoorMan M..> | 2025-09-23 14:06 | 15K | |
![[ ]](/icons/layout.gif) | 337_Hanney Glazed Lt..> | 2025-09-19 15:34 | 16K | |
![[ ]](/icons/layout.gif) | 2603_SDS (Isle Of Ma..> | 2025-10-07 09:12 | 16K | |
![[ ]](/icons/layout.gif) | 8786_Elevate Doors L..> | 2025-10-28 09:50 | 17K | |
![[IMG]](/icons/image2.gif) | 115106-WhatsApp Imag..> | 2026-03-02 11:51 | 18K | |
![[ ]](/icons/layout.gif) | 904_SDS (Isle Of Man..> | 2025-09-25 14:15 | 18K | |
![[ ]](/icons/layout.gif) | 950_SDS (Isle Of Man..> | 2025-09-26 07:05 | 18K | |
![[ ]](/icons/layout.gif) | 1321_Sam Eaton - EAT..> | 2025-09-29 15:15 | 20K | |
![[ ]](/icons/layout.gif) | 1425_G A K Developme..> | 2025-09-30 13:28 | 22K | |
![[ ]](/icons/layout.gif) | 12757_G A K Developm..> | 2025-11-07 10:51 | 22K | |
![[ ]](/icons/layout.gif) | 54455_Grafton Ventur..> | 2026-03-12 16:32 | 26K | |
![[ ]](/icons/layout.gif) | 3173_Cooper - COOP00..> | 2025-10-08 13:51 | 35K | |
![[ ]](/icons/layout.gif) | 4715_Sean Kiely - KS..> | 2025-10-14 13:41 | 35K | |
![[ ]](/icons/layout.gif) | 4376_Ray Bailey - BA..> | 2025-10-13 15:01 | 35K | |
![[ ]](/icons/layout.gif) | 2278_Deri Evans - EV..> | 2025-10-06 10:37 | 35K | |
![[ ]](/icons/layout.gif) | 2226_Tahmid Kamal - ..> | 2025-10-06 08:18 | 35K | |
![[ ]](/icons/layout.gif) | 10654_Ian Davies - D..> | 2025-11-03 10:36 | 35K | |
![[ ]](/icons/layout.gif) | 824_Alan Davis - DAV..> | 2025-09-25 08:05 | 35K | |
![[ ]](/icons/layout.gif) | 3958_Paul Withers - ..> | 2025-10-10 14:10 | 35K | |
![[ ]](/icons/layout.gif) | 9270_Matt Head - HEA..> | 2025-10-29 09:23 | 35K | |
![[ ]](/icons/layout.gif) | 11107_Barbara Ebanks..> | 2025-11-04 08:51 | 35K | |
![[ ]](/icons/layout.gif) | 9919_Robert Bak - BA..> | 2025-10-30 14:56 | 35K | |
![[ ]](/icons/layout.gif) | 13426_Lewis Ward - W..> | 2025-11-10 16:10 | 35K | |
![[ ]](/icons/layout.gif) | 3508_Suddon - SUDD00..> | 2025-10-09 12:21 | 35K | |
![[ ]](/icons/layout.gif) | 3142_Carl Carnell - ..> | 2025-10-08 13:07 | 35K | |
![[ ]](/icons/layout.gif) | 3349_Gareth Shepherd..> | 2025-10-09 08:54 | 35K | |
![[ ]](/icons/layout.gif) | 3167_Suddon - SUDD00..> | 2025-10-08 13:50 | 35K | |
![[ ]](/icons/layout.gif) | 11025_Peter Stemp - ..> | 2025-11-03 16:20 | 35K | |
![[ ]](/icons/layout.gif) | 4300_David Heckford ..> | 2025-10-13 13:28 | 35K | |
![[ ]](/icons/layout.gif) | 4811_David Heckford ..> | 2025-10-15 07:50 | 35K | |
![[ ]](/icons/layout.gif) | 9901_Derek Wright - ..> | 2025-10-30 14:46 | 35K | |
![[ ]](/icons/layout.gif) | 3467_Vincent Cross -..> | 2025-10-09 11:35 | 35K | |
![[ ]](/icons/layout.gif) | 4347_Simon Barker - ..> | 2025-10-13 14:35 | 35K | |
![[ ]](/icons/layout.gif) | 9902_Derek Wright - ..> | 2025-10-30 14:46 | 35K | |
![[ ]](/icons/layout.gif) | 2654_Andrew Hodges -..> | 2025-10-07 09:44 | 35K | |
![[ ]](/icons/layout.gif) | 3403_Mark Prevost - ..> | 2025-10-09 09:40 | 35K | |
![[ ]](/icons/layout.gif) | 679_Neil McDonald - ..> | 2025-09-24 08:36 | 35K | |
![[ ]](/icons/layout.gif) | 12921_Barbara Baker ..> | 2025-11-08 13:33 | 35K | |
![[ ]](/icons/layout.gif) | 9235_Bart Gardener -..> | 2025-10-29 08:52 | 35K | |
![[ ]](/icons/layout.gif) | 5789_Ricky Foulgar -..> | 2025-10-17 10:12 | 35K | |
![[ ]](/icons/layout.gif) | 3457_Anton Mirosnits..> | 2025-10-09 11:10 | 35K | |
![[ ]](/icons/layout.gif) | 9308_Roger Fox - FOX..> | 2025-10-29 10:38 | 35K | |
![[ ]](/icons/layout.gif) | 12474_Barbara Baker ..> | 2025-11-06 14:52 | 35K | |
![[ ]](/icons/layout.gif) | 3456_Anton Mirosnits..> | 2025-10-09 11:09 | 35K | |
![[ ]](/icons/layout.gif) | 5163_Robert Vinney -..> | 2025-10-16 07:03 | 35K | |
![[ ]](/icons/layout.gif) | 5252_Robert Vinney -..> | 2025-10-16 09:02 | 35K | |
![[ ]](/icons/layout.gif) | 7504_Rodney Ide Rodn..> | 2025-10-23 12:50 | 35K | |
![[ ]](/icons/layout.gif) | 933_Alex Hope - HOPE..> | 2025-09-25 15:05 | 35K | |
![[ ]](/icons/layout.gif) | 4373_Mary Eim - EIMM..> | 2025-10-13 14:56 | 35K | |
![[ ]](/icons/layout.gif) | 10804_James Wilde - ..> | 2025-11-03 12:41 | 35K | |
![[ ]](/icons/layout.gif) | 8264_Ray Woodruff - ..> | 2025-10-27 11:09 | 35K | |
![[ ]](/icons/layout.gif) | 6342_Tobias Cripps -..> | 2025-10-20 14:25 | 35K | |
![[ ]](/icons/layout.gif) | 842_Bob Ewins - EWIN..> | 2025-09-25 09:51 | 35K | |
![[ ]](/icons/layout.gif) | 2198_Neil Plumridge ..> | 2025-10-05 09:55 | 35K | |
![[ ]](/icons/layout.gif) | 4389_Ralph English -..> | 2025-10-13 15:11 | 35K | |
![[ ]](/icons/layout.gif) | 9265_Linda Gett - GE..> | 2025-10-29 09:15 | 35K | |
![[ ]](/icons/layout.gif) | 7265_Michael Straker..> | 2025-10-23 10:07 | 35K | |
![[ ]](/icons/layout.gif) | 8576_Matthew Richard..> | 2025-10-27 15:20 | 35K | |
![[ ]](/icons/layout.gif) | 3159_Simon Absalom -..> | 2025-10-08 13:41 | 35K | |
![[ ]](/icons/layout.gif) | 3802_Kaz Suleman - S..> | 2025-10-10 11:18 | 35K | |
![[ ]](/icons/layout.gif) | 1645_Ian Ross Ross -..> | 2025-10-01 14:46 | 35K | |
![[ ]](/icons/layout.gif) | 3737_Ken Ingram - IN..> | 2025-10-10 08:57 | 35K | |
![[ ]](/icons/layout.gif) | 1745_Simon Wood - WO..> | 2025-10-02 07:49 | 35K | |
![[ ]](/icons/layout.gif) | 2596_Javeed Sandia -..> | 2025-10-07 08:56 | 35K | |
![[ ]](/icons/layout.gif) | 2765_James Howard - ..> | 2025-10-07 13:16 | 35K | |
![[ ]](/icons/layout.gif) | 3762_Simeon Lloyd - ..> | 2025-10-10 10:00 | 35K | |
![[ ]](/icons/layout.gif) | 1749_Glen Layfield -..> | 2025-10-02 07:58 | 35K | |
![[ ]](/icons/layout.gif) | 5274_Gerald McIntyre..> | 2025-10-16 09:45 | 35K | |
![[ ]](/icons/layout.gif) | 5276_Gerald McIntyre..> | 2025-10-16 09:45 | 35K | |
![[ ]](/icons/layout.gif) | 3607_Simon Knight - ..> | 2025-10-09 14:50 | 35K | |
![[ ]](/icons/layout.gif) | 608_Josh MacDonald -..> | 2025-09-23 15:15 | 35K | |
![[ ]](/icons/layout.gif) | 1707_Gordon Knight -..> | 2025-10-02 07:00 | 35K | |
![[ ]](/icons/layout.gif) | 5114_Carl Hayfield -..> | 2025-10-15 15:18 | 35K | |
![[ ]](/icons/layout.gif) | 9253_Neil Hudd - HUD..> | 2025-10-29 09:08 | 35K | |
![[ ]](/icons/layout.gif) | 10647_Izzed Izet - I..> | 2025-11-03 10:16 | 35K | |
![[ ]](/icons/layout.gif) | 10702_Matt Head - HE..> | 2025-11-03 11:12 | 35K | |
![[ ]](/icons/layout.gif) | 12133_Colin Barrow -..> | 2025-11-06 09:14 | 35K | |
![[ ]](/icons/layout.gif) | 2182_Mick Maye - MAY..> | 2025-10-03 14:42 | 35K | |
![[ ]](/icons/layout.gif) | 10151_Jonathan Mills..> | 2025-10-31 10:13 | 35K | |
![[ ]](/icons/layout.gif) | 936_James Radford - ..> | 2025-09-25 15:17 | 35K | |
![[ ]](/icons/layout.gif) | 5190_Christina Beame..> | 2025-10-16 07:14 | 35K | |
![[ ]](/icons/layout.gif) | 5784_Jay Dale - Jay ..> | 2025-10-17 09:57 | 35K | |
![[ ]](/icons/layout.gif) | 3606_Peter Gilbery -..> | 2025-10-09 14:41 | 35K | |
![[ ]](/icons/layout.gif) | 3773_Stephen Fairbro..> | 2025-10-10 10:28 | 35K | |
![[ ]](/icons/layout.gif) | 3774_Stephen Fairbro..> | 2025-10-10 10:29 | 35K | |
![[ ]](/icons/layout.gif) | 9865_Andrew Boylett ..> | 2025-10-30 14:15 | 35K | |
![[ ]](/icons/layout.gif) | 561_Steve Hubbard - ..> | 2025-09-23 12:03 | 35K | |
![[ ]](/icons/layout.gif) | 12931_Charlie Dune-A..> | 2025-11-08 15:19 | 35K | |
![[ ]](/icons/layout.gif) | 810_Gary Reynolds - ..> | 2025-09-25 06:52 | 35K | |
![[ ]](/icons/layout.gif) | 8570_Robert Curucu -..> | 2025-10-27 15:12 | 35K | |
![[ ]](/icons/layout.gif) | 9252_Nicholas Custan..> | 2025-10-29 09:07 | 35K | |
![[ ]](/icons/layout.gif) | 3803_Kaz Suleman - S..> | 2025-10-10 11:18 | 35K | |
![[ ]](/icons/layout.gif) | 3375_William Radford..> | 2025-10-09 09:11 | 35K | |
![[ ]](/icons/layout.gif) | 10858_Kevin Grosveno..> | 2025-11-03 13:46 | 35K | |
![[ ]](/icons/layout.gif) | 2526_David Price - P..> | 2025-10-06 16:07 | 35K | |
![[ ]](/icons/layout.gif) | 818_Flavio Arruda - ..> | 2025-09-25 07:56 | 35K | |
![[ ]](/icons/layout.gif) | 1725_Antony Rowe - R..> | 2025-10-02 07:09 | 35K | |
![[ ]](/icons/layout.gif) | 2203_Greg Brett - BR..> | 2025-10-06 07:08 | 35K | |
![[ ]](/icons/layout.gif) | 10316_Robert Bak - B..> | 2025-10-31 12:16 | 35K | |
![[ ]](/icons/layout.gif) | 7497_Andrew Reid And..> | 2025-10-23 12:41 | 35K | |
![[ ]](/icons/layout.gif) | 2356_Samuel Hockaday..> | 2025-10-06 11:50 | 35K | |
![[ ]](/icons/layout.gif) | 2357_Samuel Hockaday..> | 2025-10-06 11:52 | 35K | |
![[ ]](/icons/layout.gif) | 6056_Antony Tilston ..> | 2025-10-20 08:20 | 35K | |
![[ ]](/icons/layout.gif) | 13416_Darren Thompso..> | 2025-11-10 15:29 | 35K | |
![[ ]](/icons/layout.gif) | 7910_Ricky Foulgar -..> | 2025-10-24 10:58 | 35K | |
![[ ]](/icons/layout.gif) | 10034_Damien Lobb - ..> | 2025-10-31 08:19 | 35K | |
![[ ]](/icons/layout.gif) | 3659_Simon Knight - ..> | 2025-10-09 20:45 | 35K | |
![[ ]](/icons/layout.gif) | 10392_Mark Budden - ..> | 2025-10-31 14:45 | 35K | |
![[ ]](/icons/layout.gif) | 10502_Oliver Pilgers..> | 2025-11-03 09:24 | 35K | |
![[ ]](/icons/layout.gif) | 10511_Oliver Pilgers..> | 2025-11-03 09:31 | 35K | |
![[ ]](/icons/layout.gif) | 3658_Simon Knight - ..> | 2025-10-09 20:44 | 35K | |
![[ ]](/icons/layout.gif) | 3416_[0,0] Peter Urq..> | 2025-10-09 10:06 | 35K | |
![[ ]](/icons/layout.gif) | 2542_Neil Plumridge ..> | 2025-10-06 16:30 | 35K | |
![[ ]](/icons/layout.gif) | 7739_Ian Callagham I..> | 2025-10-24 08:04 | 35K | |
![[ ]](/icons/layout.gif) | 4387_Simeon Lloyd - ..> | 2025-10-13 15:07 | 35K | |
![[ ]](/icons/layout.gif) | 2544_Nikki Sabatini ..> | 2025-10-06 16:33 | 35K | |
![[ ]](/icons/layout.gif) | 5889_Elegant Windows..> | 2025-10-17 12:28 | 35K | |
![[ ]](/icons/layout.gif) | 8694_Joshua Mossop -..> | 2025-10-28 08:02 | 35K | |
![[ ]](/icons/layout.gif) | 886_Neil Ward - WARD..> | 2025-09-25 13:10 | 35K | |
![[ ]](/icons/layout.gif) | 7863_Colin Sweeney -..> | 2025-10-24 09:22 | 35K | |
![[ ]](/icons/layout.gif) | 12009_Phillip Speakm..> | 2025-11-05 14:42 | 35K | |
![[ ]](/icons/layout.gif) | 3484_Jakub Samp - SA..> | 2025-10-09 12:05 | 35K | |
![[ ]](/icons/layout.gif) | 4327_Adrian Michael ..> | 2025-10-13 14:05 | 35K | |
![[ ]](/icons/layout.gif) | 5428_Rafael Fernande..> | 2025-10-16 12:50 | 35K | |
![[ ]](/icons/layout.gif) | 5429_Rafael Fernande..> | 2025-10-16 12:50 | 35K | |
![[ ]](/icons/layout.gif) | 11017_Michael Rogers..> | 2025-11-03 16:14 | 35K | |
![[ ]](/icons/layout.gif) | 4634_Stephen McDermo..> | 2025-10-14 13:03 | 35K | |
![[ ]](/icons/layout.gif) | 7478_Ian Callagham I..> | 2025-10-23 12:25 | 35K | |
![[ ]](/icons/layout.gif) | 2518_Andrew Stibbs -..> | 2025-10-06 15:47 | 35K | |
![[ ]](/icons/layout.gif) | 8162_Mark Garrod - M..> | 2025-10-25 11:58 | 35K | |
![[ ]](/icons/layout.gif) | 890_Greig Matthewson..> | 2025-09-25 13:13 | 35K | |
![[ ]](/icons/layout.gif) | 7419_Alan Stirling A..> | 2025-10-23 12:01 | 35K | |
![[ ]](/icons/layout.gif) | 4732_Stephen Haygart..> | 2025-10-14 14:27 | 35K | |
![[ ]](/icons/layout.gif) | 9934_J Hallam Buildi..> | 2025-10-30 15:36 | 35K | |
![[ ]](/icons/layout.gif) | 12849_peter Heywood ..> | 2025-11-07 13:54 | 35K | |
![[ ]](/icons/layout.gif) | 8154_Dave Cordell Da..> | 2025-10-25 11:46 | 35K | |
![[ ]](/icons/layout.gif) | 6783_Jay Dale - Jay ..> | 2025-10-22 08:34 | 35K | |
![[ ]](/icons/layout.gif) | 9132_Robert Curucu -..> | 2025-10-29 07:59 | 35K | |
![[ ]](/icons/layout.gif) | 7891_Paul Busby Paul..> | 2025-10-24 10:11 | 35K | |
![[ ]](/icons/layout.gif) | 1762_Craig Skinner -..> | 2025-10-02 09:20 | 35K | |
![[ ]](/icons/layout.gif) | 2257_Nigel Bramley -..> | 2025-10-06 09:58 | 35K | |
![[ ]](/icons/layout.gif) | 3235_Daniel Jackson ..> | 2025-10-08 16:15 | 35K | |
![[ ]](/icons/layout.gif) | 6624_Andrew Newcombe..> | 2025-10-21 14:54 | 35K | |
![[ ]](/icons/layout.gif) | 3561_William Radford..> | 2025-10-09 13:18 | 35K | |
![[ ]](/icons/layout.gif) | 7335_Trevor Dousfiel..> | 2025-10-23 11:09 | 35K | |
![[ ]](/icons/layout.gif) | 2251_James Macmorlan..> | 2025-10-06 09:35 | 35K | |
![[ ]](/icons/layout.gif) | 12938_Mark Warner - ..> | 2025-11-10 07:08 | 35K | |
![[ ]](/icons/layout.gif) | 9670_Copper Jax Jami..> | 2025-10-30 10:01 | 35K | |
![[ ]](/icons/layout.gif) | 944_David Kirby - KI..> | 2025-09-25 15:50 | 35K | |
![[ ]](/icons/layout.gif) | 12565_Gillian Adams ..> | 2025-11-06 16:32 | 35K | |
![[ ]](/icons/layout.gif) | 5236_All Aspects Con..> | 2025-10-16 08:52 | 35K | |
![[ ]](/icons/layout.gif) | 7498_Andrew Reid And..> | 2025-10-23 12:41 | 35K | |
![[ ]](/icons/layout.gif) | 10805_James Wilde - ..> | 2025-11-03 12:41 | 35K | |
![[ ]](/icons/layout.gif) | 7906_Harley Lorence ..> | 2025-10-24 10:45 | 35K | |
![[ ]](/icons/layout.gif) | 5992_Neil Patching -..> | 2025-10-17 15:05 | 35K | |
![[ ]](/icons/layout.gif) | 2214_David Bracken -..> | 2025-10-06 07:39 | 35K | |
![[ ]](/icons/layout.gif) | 5131_Ebtech Engineer..> | 2025-10-15 15:44 | 35K | |
![[ ]](/icons/layout.gif) | 12902_Lindsey Jeavon..> | 2025-11-07 16:41 | 35K | |
![[ ]](/icons/layout.gif) | 11509_Martyn Cox - M..> | 2025-11-04 16:25 | 35K | |
![[ ]](/icons/layout.gif) | 12913_Bradley Hine-R..> | 2025-11-08 11:23 | 35K | |
![[ ]](/icons/layout.gif) | 8297_Dad Property Ma..> | 2025-10-27 11:31 | 35K | |
![[ ]](/icons/layout.gif) | 321_A J Cope Builder..> | 2025-09-19 14:02 | 35K | |
![[ ]](/icons/layout.gif) | 831_TJS Maintenance ..> | 2025-09-25 08:31 | 35K | |
![[ ]](/icons/layout.gif) | 861_Nature's Design ..> | 2025-09-25 10:54 | 35K | |
![[ ]](/icons/layout.gif) | 8181_LT Carpentry Le..> | 2025-10-27 08:49 | 35K | |
![[ ]](/icons/layout.gif) | 2575_Mark Riggal Ele..> | 2025-10-07 08:14 | 35K | |
![[ ]](/icons/layout.gif) | 12416_Martyn Cox - M..> | 2025-11-06 13:15 | 35K | |
![[ ]](/icons/layout.gif) | 12422_Martyn Cox - M..> | 2025-11-06 13:16 | 35K | |
![[ ]](/icons/layout.gif) | 5039_Craig Gulley Ha..> | 2025-10-15 14:01 | 35K | |
![[ ]](/icons/layout.gif) | 6922_Victoria Bundle..> | 2025-10-22 11:33 | 35K | |
![[ ]](/icons/layout.gif) | 1559_Dave Edwards - ..> | 2025-10-01 09:18 | 36K | |
![[ ]](/icons/layout.gif) | 9311_Roger Fox - FOX..> | 2025-10-29 10:39 | 36K | |
![[ ]](/icons/layout.gif) | 8110_Ray Woodruff - ..> | 2025-10-24 15:13 | 36K | |
![[ ]](/icons/layout.gif) | 8267_Ray Woodruff - ..> | 2025-10-27 11:10 | 36K | |
![[ ]](/icons/layout.gif) | 8701_Ray Woodruff - ..> | 2025-10-28 08:22 | 36K | |
![[ ]](/icons/layout.gif) | 12443_Adam Thompson ..> | 2025-11-06 13:34 | 36K | |
![[ ]](/icons/layout.gif) | 6923_Victoria Bundle..> | 2025-10-22 11:33 | 36K | |
![[ ]](/icons/layout.gif) | 42844_South Atlantic..> | 2026-02-12 07:42 | 36K | |
![[ ]](/icons/layout.gif) | 59208_Fortress Doors..> | 2026-03-25 13:47 | 36K | |
![[ ]](/icons/layout.gif) | 64302_Elevate Doors ..> | 2026-04-10 06:54 | 36K | |
![[ ]](/icons/layout.gif) | 41591_Everbright Win..> | 2026-02-09 10:47 | 36K | |
![[ ]](/icons/layout.gif) | 59148_Avon Automated..> | 2026-03-25 13:01 | 36K | |
![[ ]](/icons/layout.gif) | 56994_Avon Automated..> | 2026-03-19 14:18 | 36K | |
![[ ]](/icons/layout.gif) | 61573_Wall Garage Do..> | 2026-04-01 06:43 | 36K | |
![[ ]](/icons/layout.gif) | 62048_TPS Gates & Do..> | 2026-04-02 06:12 | 36K | |
![[ ]](/icons/layout.gif) | 61572_Ross Garage Do..> | 2026-04-01 06:42 | 36K | |
![[ ]](/icons/layout.gif) | 56686_J Brady Garage..> | 2026-03-19 08:49 | 36K | |
![[ ]](/icons/layout.gif) | 54077_J Brady Garage..> | 2026-03-12 09:44 | 37K | |
![[ ]](/icons/layout.gif) | 60499_Tilak Sharma -..> | 2026-03-30 10:35 | 37K | |
![[ ]](/icons/layout.gif) | 46006_Simon Hagger -..> | 2026-02-19 10:21 | 37K | |
![[ ]](/icons/layout.gif) | 49673_Lynne Young - ..> | 2026-03-02 12:01 | 37K | |
![[ ]](/icons/layout.gif) | 61568_Danbury Garage..> | 2026-04-01 06:37 | 37K | |
![[ ]](/icons/layout.gif) | 7616_Fortress Doors ..> | 2025-07-31 14:59 | 37K | |
![[ ]](/icons/layout.gif) | 20124_Laura White - ..> | 2025-11-27 08:56 | 37K | |
![[ ]](/icons/layout.gif) | 43475_JM Doors Jon B..> | 2026-02-13 09:16 | 37K | |
![[ ]](/icons/layout.gif) | 30145_Marcus Akid - ..> | 2026-01-05 12:40 | 37K | |
![[ ]](/icons/layout.gif) | 58570_Richard Horspo..> | 2026-03-24 13:35 | 37K | |
![[ ]](/icons/layout.gif) | 43027_Bandula Maduja..> | 2026-02-12 11:45 | 37K | |
![[ ]](/icons/layout.gif) | 41_Clifford Lowdell ..> | 2025-09-11 09:43 | 37K | |
![[ ]](/icons/layout.gif) | 51571_Karl Jones - A..> | 2026-03-05 14:10 | 37K | |
![[ ]](/icons/layout.gif) | 63381_Warnsham Windo..> | 2026-04-08 08:37 | 37K | |
![[ ]](/icons/layout.gif) | 53397_Tony Dovey Ton..> | 2026-03-10 14:40 | 37K | |
![[ ]](/icons/layout.gif) | 58123_D E Bliss Buil..> | 2026-03-23 14:24 | 37K | |
![[ ]](/icons/layout.gif) | 54072_Ideal Industri..> | 2026-03-12 09:41 | 37K | |
![[ ]](/icons/layout.gif) | 3460_[0,0] Iain Hair..> | 2025-10-09 11:24 | 37K | |
![[ ]](/icons/layout.gif) | 18024_David Shanahan..> | 2025-11-21 10:09 | 37K | |
![[ ]](/icons/layout.gif) | 34289_Thetford Glass..> | 2026-01-16 13:37 | 37K | |
![[ ]](/icons/layout.gif) | 17030_Gavin Morton -..> | 2025-11-19 08:44 | 37K | |
![[ ]](/icons/layout.gif) | 17039_Gavin Morton -..> | 2025-11-19 08:49 | 37K | |
![[ ]](/icons/layout.gif) | 35909_JA B79 8RW - W..> | 2026-01-22 08:58 | 37K | |
![[ ]](/icons/layout.gif) | 49851_DSC Glazing - ..> | 2026-03-02 14:52 | 37K | |
![[ ]](/icons/layout.gif) | 45463_Simon Chase Do..> | 2026-02-18 09:22 | 37K | |
![[ ]](/icons/layout.gif) | 39658_AWC Contractor..> | 2026-02-03 09:14 | 37K | |
![[ ]](/icons/layout.gif) | 30828_Paul Atkinson ..> | 2026-01-06 14:22 | 37K | |
![[ ]](/icons/layout.gif) | 43763_Bandula Maduja..> | 2026-02-16 07:42 | 37K | |
![[ ]](/icons/layout.gif) | 41992_Tony Dovey Ton..> | 2026-02-10 07:59 | 37K | |
![[ ]](/icons/layout.gif) | 20292_Robbie Simpson..> | 2025-11-27 11:33 | 37K | |
![[ ]](/icons/layout.gif) | 7617_Fortress Doors ..> | 2025-07-31 15:00 | 37K | |
![[ ]](/icons/layout.gif) | 7618_Fortress Doors ..> | 2025-07-31 15:01 | 37K | |
![[ ]](/icons/layout.gif) | 11051_RDM Engineerin..> | 2025-11-04 07:39 | 37K | |
![[ ]](/icons/layout.gif) | 12377_RDM Engineerin..> | 2025-11-06 12:25 | 37K | |
![[ ]](/icons/layout.gif) | 21172_Ceta Group Ltd..> | 2025-12-01 09:12 | 37K | |
![[ ]](/icons/layout.gif) | 50775_Welbeck Shutte..> | 2026-03-04 10:58 | 37K | |
![[ ]](/icons/layout.gif) | 65759_Kris Jones Kri..> | 2026-04-14 13:48 | 37K | |
![[ ]](/icons/layout.gif) | 34605_My Garage Door..> | 2026-01-19 11:08 | 37K | |
![[ ]](/icons/layout.gif) | 39782_Tucker Glass -..> | 2026-02-03 10:28 | 37K | |
![[ ]](/icons/layout.gif) | 12288_MM Doors Micha..> | 2025-11-06 11:40 | 37K | |
![[ ]](/icons/layout.gif) | 3964_Fresh Frames Ry..> | 2025-10-10 14:18 | 37K | |
![[ ]](/icons/layout.gif) | 4165_Fresh Frames Ry..> | 2025-10-13 10:52 | 37K | |
![[ ]](/icons/layout.gif) | 12805_Tony Dovey Ton..> | 2025-11-07 12:02 | 37K | |
![[ ]](/icons/layout.gif) | 17577_Harry Curtis -..> | 2025-11-20 11:29 | 37K | |
![[ ]](/icons/layout.gif) | 29861_Open And Shut ..> | 2026-01-02 15:09 | 37K | |
![[ ]](/icons/layout.gif) | 18531_Barry Eckland ..> | 2025-11-24 10:41 | 37K | |
![[ ]](/icons/layout.gif) | 47357_EcoGlaze Group..> | 2026-02-23 16:53 | 37K | |
![[ ]](/icons/layout.gif) | 928_JM Doors Jon Bun..> | 2025-09-25 14:53 | 37K | |
![[ ]](/icons/layout.gif) | 30611_Kris Jones Kri..> | 2026-01-06 10:46 | 37K | |
![[ ]](/icons/layout.gif) | 42219_Keith Worboys ..> | 2026-02-10 11:47 | 37K | |
![[ ]](/icons/layout.gif) | 54924_Spa Roller Doo..> | 2026-03-13 14:25 | 37K | |
![[ ]](/icons/layout.gif) | 8922_My Garage Door ..> | 2025-10-28 12:22 | 37K | |
![[ ]](/icons/layout.gif) | 21628_James King - N..> | 2025-12-02 07:46 | 37K | |
![[ ]](/icons/layout.gif) | 20496_Harry Curtis -..> | 2025-11-27 15:33 | 37K | |
![[ ]](/icons/layout.gif) | 31073_Harry Curtis -..> | 2026-01-07 10:18 | 37K | |
![[ ]](/icons/layout.gif) | 923_JM Doors Jon Bun..> | 2025-09-25 14:46 | 37K | |
![[ ]](/icons/layout.gif) | 59336_MnK Windows Ma..> | 2026-03-26 08:44 | 37K | |
![[ ]](/icons/layout.gif) | 922_JM Doors Jon Bun..> | 2025-09-25 14:45 | 37K | |
![[ ]](/icons/layout.gif) | 22013_Nuvo Windows P..> | 2025-12-02 12:45 | 37K | |
![[ ]](/icons/layout.gif) | 31874_ASSW Ltd BS10 ..> | 2026-01-09 08:21 | 37K | |
![[ ]](/icons/layout.gif) | 30950_Barry Eckland ..> | 2026-01-06 16:25 | 37K | |
![[ ]](/icons/layout.gif) | 34562_Harry Curtis -..> | 2026-01-19 10:46 | 37K | |
![[ ]](/icons/layout.gif) | 41994_Tony Dovey Ton..> | 2026-02-10 08:00 | 37K | |
![[ ]](/icons/layout.gif) | 10119_Ecosse Garage ..> | 2025-10-31 09:19 | 37K | |
![[ ]](/icons/layout.gif) | 30086_Thomas Bui - A..> | 2026-01-05 11:39 | 37K | |
![[ ]](/icons/layout.gif) | 55802_Windowology Lt..> | 2026-03-17 12:08 | 37K | |
![[ ]](/icons/layout.gif) | 48149_Douglas Ward -..> | 2026-02-25 13:20 | 37K | |
![[ ]](/icons/layout.gif) | 52991_RepairMyGarage..> | 2026-03-10 08:55 | 37K | |
![[ ]](/icons/layout.gif) | 56975_Alliance Garag..> | 2026-03-19 13:52 | 37K | |
![[ ]](/icons/layout.gif) | 61569_Danbury Garage..> | 2026-04-01 06:38 | 37K | |
![[ ]](/icons/layout.gif) | 21167_AJ Trade Andre..> | 2025-12-01 09:08 | 37K | |
![[ ]](/icons/layout.gif) | 43242_Doors 4 Garage..> | 2026-02-12 15:46 | 37K | |
![[ ]](/icons/layout.gif) | 64190_Design & Insta..> | 2026-04-09 14:56 | 37K | |
![[ ]](/icons/layout.gif) | 11871_L & C Bracey L..> | 2025-11-05 12:05 | 37K | |
![[ ]](/icons/layout.gif) | 55828_Doors Shutters..> | 2026-03-17 12:42 | 37K | |
![[ ]](/icons/layout.gif) | 65361_Pioneer Doors ..> | 2026-04-14 08:00 | 37K | |
![[ ]](/icons/layout.gif) | 4354_C&M Glass Servi..> | 2025-10-13 14:42 | 37K | |
![[ ]](/icons/layout.gif) | 9702_MnK Windows Ke..> | 2025-10-30 10:27 | 37K | |
![[ ]](/icons/layout.gif) | 54955_Thetford Glass..> | 2026-03-13 14:40 | 37K | |
![[ ]](/icons/layout.gif) | 64320_PDL Fabricatio..> | 2026-04-10 07:50 | 37K | |
![[ ]](/icons/layout.gif) | 7323_Aspect Maintena..> | 2025-10-23 10:55 | 37K | |
![[ ]](/icons/layout.gif) | 24351_LNR Door Solut..> | 2025-12-09 11:58 | 37K | |
![[ ]](/icons/layout.gif) | 68869_Harry Curtis H..> | 2026-04-22 09:01 | 37K | |
![[ ]](/icons/layout.gif) | 17816_Mac Automation..> | 2025-11-20 17:05 | 37K | |
![[ ]](/icons/layout.gif) | 5487_Hadrian Joinery..> | 2025-10-16 13:44 | 37K | |
![[ ]](/icons/layout.gif) | 46901_Marcus Akid - ..> | 2026-02-20 16:21 | 37K | |
![[ ]](/icons/layout.gif) | 42343_Doorolla Ltd S..> | 2026-02-10 15:00 | 37K | |
![[ ]](/icons/layout.gif) | 44917_MnK Windows K..> | 2026-02-17 13:34 | 37K | |
![[ ]](/icons/layout.gif) | 30675_Thetford Glass..> | 2026-01-06 11:45 | 37K | |
![[ ]](/icons/layout.gif) | 47658_AM Shutters M..> | 2026-02-24 12:32 | 37K | |
![[ ]](/icons/layout.gif) | 59352_Garage Doors 2..> | 2026-03-26 08:54 | 37K | |
![[ ]](/icons/layout.gif) | 65510_Garage Doors 2..> | 2026-04-14 10:24 | 37K | |
![[ ]](/icons/layout.gif) | 2123_Palms Construct..> | 2025-10-03 13:04 | 37K | |
![[ ]](/icons/layout.gif) | 44104_Ecosse Garage ..> | 2026-02-16 12:01 | 37K | |
![[ ]](/icons/layout.gif) | 60286_Garage Doors 2..> | 2026-03-27 14:44 | 37K | |
![[ ]](/icons/layout.gif) | 60287_Garage Doors 2..> | 2026-03-27 14:45 | 37K | |
![[ ]](/icons/layout.gif) | 30345_AJ Trade Andre..> | 2026-01-05 16:02 | 37K | |
![[ ]](/icons/layout.gif) | 18332_Jamie Wetheril..> | 2025-11-22 09:54 | 37K | |
![[ ]](/icons/layout.gif) | 21336_NBG Doors Nick..> | 2025-12-01 11:59 | 37K | |
![[ ]](/icons/layout.gif) | 55010_Serenade Home ..> | 2026-03-13 15:42 | 37K | |
![[ ]](/icons/layout.gif) | 48943_Thetford Glass..> | 2026-02-27 08:54 | 37K | |
![[ ]](/icons/layout.gif) | 70250_C Marl Systems..> | 2026-04-24 15:11 | 37K | |
![[ ]](/icons/layout.gif) | 6925_RS Doors Rob Sm..> | 2025-10-22 11:39 | 37K | |
![[ ]](/icons/layout.gif) | 47373_Go Direct Door..> | 2026-02-24 07:53 | 37K | |
![[ ]](/icons/layout.gif) | 16112_R L Roller Doo..> | 2025-11-17 14:33 | 37K | |
![[ ]](/icons/layout.gif) | 17819_Mac Automation..> | 2025-11-20 17:06 | 37K | |
![[ ]](/icons/layout.gif) | 17822_Mac Automation..> | 2025-11-20 17:14 | 37K | |
![[ ]](/icons/layout.gif) | 44083_Ecosse Garage ..> | 2026-02-16 11:42 | 37K | |
![[ ]](/icons/layout.gif) | 25124_TWD Limited St..> | 2025-12-11 13:13 | 37K | |
![[ ]](/icons/layout.gif) | 36255_3 Brothers Bui..> | 2026-01-23 08:05 | 37K | |
![[ ]](/icons/layout.gif) | 40908_Able Garage Do..> | 2026-02-05 11:26 | 37K | |
![[ ]](/icons/layout.gif) | 3318_C&M Glass Servi..> | 2025-10-09 08:12 | 37K | |
![[ ]](/icons/layout.gif) | 15555_MnK Windows Ma..> | 2025-11-14 14:08 | 37K | |
![[ ]](/icons/layout.gif) | 49105_Spa Roller Doo..> | 2026-02-27 12:35 | 37K | |
![[ ]](/icons/layout.gif) | 67868_Cash Building ..> | 2026-04-20 13:38 | 37K | |
![[ ]](/icons/layout.gif) | 67817_Mick Walklate ..> | 2026-04-20 12:30 | 37K | |
![[ ]](/icons/layout.gif) | 8827_Prorenovate Ian..> | 2025-10-28 10:57 | 37K | |
![[ ]](/icons/layout.gif) | 46666_Garage Doors 2..> | 2026-02-20 12:13 | 37K | |
![[ ]](/icons/layout.gif) | 49967_Easy-Roll Ben ..> | 2026-03-02 16:24 | 37K | |
![[ ]](/icons/layout.gif) | 57243_Norfolk Doors ..> | 2026-03-20 09:16 | 37K | |
![[ ]](/icons/layout.gif) | 48267_Chelmsford Rol..> | 2026-02-26 07:26 | 37K | |
![[ ]](/icons/layout.gif) | 17823_Mac Automation..> | 2025-11-20 17:14 | 37K | |
![[ ]](/icons/layout.gif) | 49466_Thetford Glass..> | 2026-03-02 09:33 | 37K | |
![[ ]](/icons/layout.gif) | 57036_Ezi-Dor Ltd Tr..> | 2026-03-19 15:24 | 37K | |
![[ ]](/icons/layout.gif) | 7046_RP Manufacturin..> | 2025-10-22 13:03 | 37K | |
![[ ]](/icons/layout.gif) | 30684_Thetford Glass..> | 2026-01-06 11:55 | 37K | |
![[ ]](/icons/layout.gif) | 2751_Michael Mazur ..> | 2025-10-07 12:56 | 37K | |
![[ ]](/icons/layout.gif) | 17675_Doors 4 You. P..> | 2025-11-20 14:09 | 37K | |
![[ ]](/icons/layout.gif) | 36736_Pro-Frame Wind..> | 2026-01-26 08:12 | 37K | |
![[ ]](/icons/layout.gif) | 48007_Liam Johnson -..> | 2026-02-25 09:31 | 37K | |
![[ ]](/icons/layout.gif) | 55453_Thetford Glass..> | 2026-03-16 14:13 | 37K | |
![[ ]](/icons/layout.gif) | 55482_Nuvo Windows P..> | 2026-03-16 14:32 | 37K | |
![[ ]](/icons/layout.gif) | 58047_RnR Home Impro..> | 2026-03-23 13:07 | 37K | |
![[ ]](/icons/layout.gif) | 6777_RS Doors Rob Sm..> | 2025-10-22 08:33 | 37K | |
![[ ]](/icons/layout.gif) | 17537_Do Not Use 1 M..> | 2025-11-20 10:51 | 37K | |
![[ ]](/icons/layout.gif) | 64094_Doors 4 Garage..> | 2026-04-09 12:28 | 37K | |
![[ ]](/icons/layout.gif) | 20519_AJ Trade Andre..> | 2025-11-27 16:03 | 37K | |
![[ ]](/icons/layout.gif) | 55492_Nuvo Windows P..> | 2026-03-16 14:37 | 37K | |
![[ ]](/icons/layout.gif) | 17673_Doors 4 You. P..> | 2025-11-20 14:09 | 37K | |
![[ ]](/icons/layout.gif) | 30882_Entador System..> | 2026-01-06 15:25 | 37K | |
![[ ]](/icons/layout.gif) | 56928_MnK Windows Ma..> | 2026-03-19 12:16 | 37K | |
![[ ]](/icons/layout.gif) | 62559_Replacement Ga..> | 2026-04-07 06:57 | 37K | |
![[ ]](/icons/layout.gif) | 62050_J Brady Garage..> | 2026-04-02 06:14 | 37K | |
![[ ]](/icons/layout.gif) | 3261_Nick Garlick - ..> | 2025-10-08 18:44 | 37K | |
![[ ]](/icons/layout.gif) | 17398_EcoGlaze Group..> | 2025-11-20 07:48 | 37K | |
![[ ]](/icons/layout.gif) | 18889_AM Shutters St..> | 2025-11-25 08:04 | 37K | |
![[ ]](/icons/layout.gif) | 52618_Peter Tomas Co..> | 2026-03-09 13:02 | 37K | |
![[ ]](/icons/layout.gif) | 57219_J Brady Garage..> | 2026-03-20 08:44 | 37K | |
![[ ]](/icons/layout.gif) | 59963_ADB Electrical..> | 2026-03-27 09:28 | 37K | |
![[ ]](/icons/layout.gif) | 1626_Absolute Garage..> | 2025-10-01 13:57 | 37K | |
![[ ]](/icons/layout.gif) | 12246_Tech HQ Dean B..> | 2025-11-06 11:07 | 37K | |
![[ ]](/icons/layout.gif) | 40411_Excellent Ltd ..> | 2026-02-04 11:37 | 37K | |
![[ ]](/icons/layout.gif) | 42769_Proud 2 Fix Ma..> | 2026-02-11 14:05 | 37K | |
![[ ]](/icons/layout.gif) | 43739_Garage Doors 2..> | 2026-02-13 15:11 | 37K | |
![[ ]](/icons/layout.gif) | 31004_Excellent Ltd ..> | 2026-01-07 08:48 | 37K | |
![[ ]](/icons/layout.gif) | 15710_AJ Trade Andre..> | 2025-11-15 11:09 | 37K | |
![[ ]](/icons/layout.gif) | 64101_Doors 4 Garage..> | 2026-04-09 12:39 | 37K | |
![[ ]](/icons/layout.gif) | 70150_Glazebright Gr..> | 2026-04-24 14:31 | 37K | |
![[ ]](/icons/layout.gif) | 1019_JD Cars Ltd Jer..> | 2025-09-26 11:10 | 37K | |
![[ ]](/icons/layout.gif) | 2285_[0,0] Andrew Ho..> | 2025-10-06 10:42 | 37K | |
![[ ]](/icons/layout.gif) | 8698_1st Shield Darr..> | 2025-10-28 08:08 | 37K | |
![[ ]](/icons/layout.gif) | 24192_Martin JOinery..> | 2025-12-09 09:36 | 37K | |
![[ ]](/icons/layout.gif) | 56260_Eaton Park Win..> | 2026-03-18 10:53 | 37K | |
![[ ]](/icons/layout.gif) | 22689_AM Shutters St..> | 2025-12-04 08:37 | 37K | |
![[ ]](/icons/layout.gif) | 49062_Ace Garage Doo..> | 2026-02-27 11:26 | 37K | |
![[ ]](/icons/layout.gif) | 6664_WINDOW WIZE LTD..> | 2025-10-21 15:29 | 37K | |
![[ ]](/icons/layout.gif) | 58568_Richard Horspo..> | 2026-03-24 13:34 | 37K | |
![[ ]](/icons/layout.gif) | 3323_Richard Stockbr..> | 2025-10-09 08:19 | 37K | |
![[ ]](/icons/layout.gif) | 46360_Rolladoor NR9 ..> | 2026-02-20 07:57 | 37K | |
![[ ]](/icons/layout.gif) | 2230_C&M Glass Servi..> | 2025-10-06 08:21 | 37K | |
![[ ]](/icons/layout.gif) | 20524_St Helens Upvc..> | 2025-11-27 16:10 | 37K | |
![[ ]](/icons/layout.gif) | 41683_Garage Doors 2..> | 2026-02-09 12:34 | 37K | |
![[ ]](/icons/layout.gif) | 55613_Dans Doors Dan..> | 2026-03-17 08:07 | 37K | |
![[ ]](/icons/layout.gif) | 1622_Absolute Garage..> | 2025-10-01 13:56 | 37K | |
![[ ]](/icons/layout.gif) | 18168_Tim Fix Garage..> | 2025-11-21 12:56 | 37K | |
![[ ]](/icons/layout.gif) | 30646_CWG Home Impro..> | 2026-01-06 11:21 | 37K | |
![[ ]](/icons/layout.gif) | 49752_UK Door System..> | 2026-03-02 14:01 | 37K | |
![[ ]](/icons/layout.gif) | 50216_Fortress Doors..> | 2026-03-03 11:20 | 37K | |
![[ ]](/icons/layout.gif) | 5793_S R W Services ..> | 2025-10-17 10:15 | 37K | |
![[ ]](/icons/layout.gif) | 37958_Price NG34 7RQ..> | 2026-01-28 13:31 | 37K | |
![[ ]](/icons/layout.gif) | 42136_CPS Custom Pro..> | 2026-02-10 10:32 | 37K | |
![[ ]](/icons/layout.gif) | 42855_T D Rollerdoor..> | 2026-02-12 07:51 | 37K | |
![[ ]](/icons/layout.gif) | 42856_T D Rollerdoor..> | 2026-02-12 07:52 | 37K | |
![[ ]](/icons/layout.gif) | 58184_Harry Curtis H..> | 2026-03-23 15:51 | 37K | |
![[ ]](/icons/layout.gif) | 59346_Phil Page Phil..> | 2026-03-26 08:52 | 37K | |
![[ ]](/icons/layout.gif) | 9138_Mark Perham Mar..> | 2025-10-29 08:08 | 37K | |
![[ ]](/icons/layout.gif) | 31106_Nix Building S..> | 2026-01-07 11:34 | 37K | |
![[ ]](/icons/layout.gif) | 34645_AJ Trade Andre..> | 2026-01-19 11:40 | 37K | |
![[ ]](/icons/layout.gif) | 52233_Ecosse Garage ..> | 2026-03-06 15:13 | 37K | |
![[ ]](/icons/layout.gif) | 15900_AJ Trade Andre..> | 2025-11-17 10:09 | 37K | |
![[ ]](/icons/layout.gif) | 19637_Doors And Gate..> | 2025-11-26 08:25 | 37K | |
![[ ]](/icons/layout.gif) | 40018_Eclipse Paving..> | 2026-02-03 14:13 | 37K | |
![[ ]](/icons/layout.gif) | 50218_Fortress Doors..> | 2026-03-03 11:21 | 37K | |
![[ ]](/icons/layout.gif) | 30585_Manor Projects..> | 2026-01-06 10:16 | 37K | |
![[ ]](/icons/layout.gif) | 44035_Bark Oak Build..> | 2026-02-16 11:05 | 37K | |
![[ ]](/icons/layout.gif) | 44613_Ross Garage Do..> | 2026-02-17 09:15 | 37K | |
![[ ]](/icons/layout.gif) | 6007_Nuvo Windows Pa..> | 2025-10-17 15:41 | 37K | |
![[ ]](/icons/layout.gif) | 35964_Shutter Tech U..> | 2026-01-22 10:17 | 37K | |
![[ ]](/icons/layout.gif) | 51964_Doors 4 Garage..> | 2026-03-06 10:47 | 37K | |
![[ ]](/icons/layout.gif) | 57363_CPS Custom Pro..> | 2026-03-20 10:43 | 37K | |
![[ ]](/icons/layout.gif) | 52104_Barry Eckland ..> | 2026-03-06 13:33 | 37K | |
![[ ]](/icons/layout.gif) | 68092_Jurassic Doors..> | 2026-04-21 07:20 | 37K | |
![[ ]](/icons/layout.gif) | 10114_Ecosse Garage ..> | 2025-10-31 09:17 | 37K | |
![[ ]](/icons/layout.gif) | 15492_Woods And Sons..> | 2025-11-14 12:42 | 37K | |
![[ ]](/icons/layout.gif) | 16456_T D Rollerdoor..> | 2025-11-18 09:57 | 37K | |
![[ ]](/icons/layout.gif) | 26672_LNR Door Solut..> | 2025-12-16 09:27 | 37K | |
![[ ]](/icons/layout.gif) | 59602_Price NG34 7RQ..> | 2026-03-26 12:14 | 37K | |
![[ ]](/icons/layout.gif) | 95_Harpers Door Spec..> | 2025-09-17 08:52 | 37K | |
![[ ]](/icons/layout.gif) | 3272_Palms Construct..> | 2025-10-08 20:11 | 37K | |
![[ ]](/icons/layout.gif) | 11865_ASSW Ltd BS10 ..> | 2025-11-05 12:03 | 37K | |
![[ ]](/icons/layout.gif) | 23595_R L Roller Doo..> | 2025-12-08 08:09 | 37K | |
![[ ]](/icons/layout.gif) | 38742_JJ Secure Door..> | 2026-01-30 09:48 | 37K | |
![[ ]](/icons/layout.gif) | 40316_Bijan Fouladga..> | 2026-02-04 09:38 | 37K | |
![[ ]](/icons/layout.gif) | 50280_Clic Garage Do..> | 2026-03-03 12:20 | 37K | |
![[ ]](/icons/layout.gif) | 18985_Ace Garage Doo..> | 2025-11-25 09:34 | 37K | |
![[ ]](/icons/layout.gif) | 35967_Shutter Tech U..> | 2026-01-22 10:18 | 37K | |
![[ ]](/icons/layout.gif) | 44697_PB Doors Paul ..> | 2026-02-17 10:01 | 37K | |
![[ ]](/icons/layout.gif) | 67911_NTRAP NR11 7NZ..> | 2026-04-20 14:13 | 37K | |
![[ ]](/icons/layout.gif) | 8602_TND Garage Door..> | 2025-10-27 15:45 | 37K | |
![[ ]](/icons/layout.gif) | 21663_TPS Gates & Do..> | 2025-12-02 08:17 | 37K | |
![[ ]](/icons/layout.gif) | 59884_Jurassic Doors..> | 2026-03-27 07:59 | 37K | |
![[ ]](/icons/layout.gif) | 70238_Chelmsford Rol..> | 2026-04-24 15:00 | 37K | |
![[ ]](/icons/layout.gif) | 6012_AMP Carpentry A..> | 2025-10-17 15:53 | 37K | |
![[ ]](/icons/layout.gif) | 6915_AMP Carpentry A..> | 2025-10-22 11:22 | 37K | |
![[ ]](/icons/layout.gif) | 32502_Automated Acce..> | 2026-01-13 08:08 | 37K | |
![[ ]](/icons/layout.gif) | 44115_Ecosse Garage ..> | 2026-02-16 12:02 | 37K | |
![[ ]](/icons/layout.gif) | 56671_Michael Mazur ..> | 2026-03-19 08:41 | 37K | |
![[ ]](/icons/layout.gif) | 2870_Eco Windows & D..> | 2025-10-08 07:57 | 37K | |
![[ ]](/icons/layout.gif) | 3271_Palms Construct..> | 2025-10-08 20:11 | 37K | |
![[ ]](/icons/layout.gif) | 34878_T D Rollerdoor..> | 2026-01-20 07:25 | 37K | |
![[ ]](/icons/layout.gif) | 12512_Ian Sanderson ..> | 2025-11-06 15:40 | 37K | |
![[ ]](/icons/layout.gif) | 25468_Warsash Window..> | 2025-12-12 10:34 | 37K | |
![[ ]](/icons/layout.gif) | 29939_Thetford Glass..> | 2026-01-05 08:25 | 37K | |
![[ ]](/icons/layout.gif) | 49268_Kieran Warner ..> | 2026-02-27 16:01 | 37K | |
![[ ]](/icons/layout.gif) | 17055_RH Doors & Shu..> | 2025-11-19 09:06 | 37K | |
![[ ]](/icons/layout.gif) | 31522_LNR Door Solut..> | 2026-01-08 10:26 | 37K | |
![[ ]](/icons/layout.gif) | 51125_PB Doors Paul ..> | 2026-03-05 07:24 | 37K | |
![[ ]](/icons/layout.gif) | 64739_Niche Interior..> | 2026-04-10 15:17 | 37K | |
![[ ]](/icons/layout.gif) | 18043_Ace Garage Doo..> | 2025-11-21 10:27 | 37K | |
![[ ]](/icons/layout.gif) | 22241_Norfolk Roller..> | 2025-12-03 07:56 | 37K | |
![[ ]](/icons/layout.gif) | 22243_Bryan Thompson..> | 2025-12-03 08:00 | 37K | |
![[ ]](/icons/layout.gif) | 43534_CPS Custom Pro..> | 2026-02-13 09:59 | 37K | |
![[ ]](/icons/layout.gif) | 34882_T D Rollerdoor..> | 2026-01-20 07:25 | 37K | |
![[ ]](/icons/layout.gif) | 69132_Digby Services..> | 2026-04-22 14:32 | 37K | |
![[ ]](/icons/layout.gif) | 34894_AM Shutters M..> | 2026-01-20 07:38 | 37K | |
![[ ]](/icons/layout.gif) | 48519_Lazarenko LU2 ..> | 2026-02-26 11:56 | 37K | |
![[ ]](/icons/layout.gif) | 56542_Spa Roller Doo..> | 2026-03-18 15:33 | 37K | |
![[ ]](/icons/layout.gif) | 1682_Four Counties D..> | 2025-10-01 15:53 | 37K | |
![[ ]](/icons/layout.gif) | 12398_L & C Bracey L..> | 2025-11-06 12:42 | 37K | |
![[ ]](/icons/layout.gif) | 40118_RP Manufacturi..> | 2026-02-03 15:55 | 37K | |
![[ ]](/icons/layout.gif) | 69540_Ecosse Garage ..> | 2026-04-23 13:24 | 37K | |
![[ ]](/icons/layout.gif) | 3073_1st Choice Secu..> | 2025-10-08 10:57 | 37K | |
![[ ]](/icons/layout.gif) | 3977_Evans & Fry Ltd..> | 2025-10-10 15:06 | 37K | |
![[ ]](/icons/layout.gif) | 33766_Scotia Garage ..> | 2026-01-15 12:32 | 37K | |
![[ ]](/icons/layout.gif) | 56533_Spa Roller Doo..> | 2026-03-18 15:31 | 37K | |
![[ ]](/icons/layout.gif) | 63098_Digby Services..> | 2026-04-07 13:54 | 37K | |
![[ ]](/icons/layout.gif) | 27061_Chelmsford Rol..> | 2025-12-16 16:16 | 37K | |
![[ ]](/icons/layout.gif) | 51661_SX Property Ma..> | 2026-03-05 16:12 | 37K | |
![[ ]](/icons/layout.gif) | 6789_Hadrian Joinery..> | 2025-10-22 08:37 | 37K | |
![[ ]](/icons/layout.gif) | 50354_Absolute Garag..> | 2026-03-03 14:34 | 37K | |
![[ ]](/icons/layout.gif) | 64985_Profascia Delr..> | 2026-04-13 09:26 | 37K | |
![[ ]](/icons/layout.gif) | 69613_Doorolla Ltd S..> | 2026-04-23 14:38 | 37K | |
![[ ]](/icons/layout.gif) | 32584_Nix Building S..> | 2026-01-13 09:07 | 37K | |
![[ ]](/icons/layout.gif) | 34235_St Helens Upvc..> | 2026-01-16 11:01 | 37K | |
![[ ]](/icons/layout.gif) | 36703_Island Home Im..> | 2026-01-23 15:57 | 37K | |
![[ ]](/icons/layout.gif) | 44696_PB Doors Paul ..> | 2026-02-17 10:00 | 37K | |
![[ ]](/icons/layout.gif) | 62562_Phil Page Phil..> | 2026-04-07 06:58 | 37K | |
![[ ]](/icons/layout.gif) | 30034_Doors 4 You. P..> | 2026-01-05 09:57 | 37K | |
![[ ]](/icons/layout.gif) | 64698_Scotia Garage ..> | 2026-04-10 14:00 | 37K | |
![[ ]](/icons/layout.gif) | 1647_[0,0] Fletcher ..> | 2025-10-01 14:49 | 37K | |
![[ ]](/icons/layout.gif) | 9623_T D Rollerdoors..> | 2025-10-30 08:59 | 37K | |
![[ ]](/icons/layout.gif) | 21151_MJS Installati..> | 2025-12-01 08:53 | 37K | |
![[ ]](/icons/layout.gif) | 21210_MJS Installati..> | 2025-12-01 09:38 | 37K | |
![[ ]](/icons/layout.gif) | 66536_DT Services Lt..> | 2026-04-16 09:03 | 37K | |
![[ ]](/icons/layout.gif) | 43227_Elevate Doors ..> | 2026-02-12 15:32 | 37K | |
![[ ]](/icons/layout.gif) | 2040_[0,0] Paul Birk..> | 2025-10-03 11:50 | 37K | |
![[ ]](/icons/layout.gif) | 2655_Ideal Industria..> | 2025-10-07 09:45 | 37K | |
![[ ]](/icons/layout.gif) | 11843_Scotia Garage ..> | 2025-11-05 11:51 | 37K | |
![[ ]](/icons/layout.gif) | 17916_Ace Garage Doo..> | 2025-11-21 08:51 | 37K | |
![[ ]](/icons/layout.gif) | 42932_Roll Right Gar..> | 2026-02-12 09:18 | 37K | |
![[ ]](/icons/layout.gif) | 6901_Piper Window Sy..> | 2025-10-22 11:01 | 37K | |
![[ ]](/icons/layout.gif) | 18127_MM Doors Micha..> | 2025-11-21 11:46 | 37K | |
![[ ]](/icons/layout.gif) | 51127_PB Doors Paul ..> | 2026-03-05 07:25 | 37K | |
![[ ]](/icons/layout.gif) | 11180_Rhino Windows ..> | 2025-11-04 11:00 | 37K | |
![[ ]](/icons/layout.gif) | 18891_AM Shutters St..> | 2025-11-25 08:05 | 37K | |
![[ ]](/icons/layout.gif) | 23207_Ross Garage Do..> | 2025-12-05 08:32 | 37K | |
![[ ]](/icons/layout.gif) | 51379_Window Repair ..> | 2026-03-05 11:11 | 37K | |
![[ ]](/icons/layout.gif) | 56251_Eaton Park Win..> | 2026-03-18 10:50 | 37K | |
![[ ]](/icons/layout.gif) | 57666_Aplas Windows ..> | 2026-03-20 16:25 | 37K | |
![[ ]](/icons/layout.gif) | 68489_Four Counties ..> | 2026-04-21 12:49 | 37K | |
![[ ]](/icons/layout.gif) | 7587_Smart Doors Hen..> | 2025-10-23 14:03 | 37K | |
![[ ]](/icons/layout.gif) | 7868_Michael Mazur M..> | 2025-10-24 09:23 | 37K | |
![[ ]](/icons/layout.gif) | 38983_Thomas Andrew ..> | 2026-01-30 15:03 | 37K | |
![[ ]](/icons/layout.gif) | 55530_Garden Room Pr..> | 2026-03-16 15:40 | 37K | |
![[ ]](/icons/layout.gif) | 56764_Starlite Home ..> | 2026-03-19 10:10 | 37K | |
![[ ]](/icons/layout.gif) | 9242_1st Choice Secu..> | 2025-10-29 09:03 | 37K | |
![[ ]](/icons/layout.gif) | 43090_Custom Trade S..> | 2026-02-12 12:58 | 37K | |
![[ ]](/icons/layout.gif) | 44616_Ross Garage Do..> | 2026-02-17 09:17 | 37K | |
![[ ]](/icons/layout.gif) | 64061_T & G Home Imp..> | 2026-04-09 11:00 | 37K | |
![[ ]](/icons/layout.gif) | 8419_Michael Mazur M..> | 2025-10-27 13:14 | 37K | |
![[ ]](/icons/layout.gif) | 47933_Doors 4 You Lt..> | 2026-02-25 08:32 | 37K | |
![[ ]](/icons/layout.gif) | 61027_Ace Garage Doo..> | 2026-03-31 09:17 | 37K | |
![[ ]](/icons/layout.gif) | 9254_1st Choice Secu..> | 2025-10-29 09:09 | 37K | |
![[ ]](/icons/layout.gif) | 21041_Rising Group L..> | 2025-11-28 16:13 | 37K | |
![[ ]](/icons/layout.gif) | 38289_Ross Garage Do..> | 2026-01-29 10:29 | 37K | |
![[ ]](/icons/layout.gif) | 56202_Eaton Park Win..> | 2026-03-18 10:00 | 37K | |
![[ ]](/icons/layout.gif) | 67814_LNR Door Solut..> | 2026-04-20 12:23 | 37K | |
![[ ]](/icons/layout.gif) | 21029_Cotswold Conse..> | 2025-11-28 15:52 | 37K | |
![[ ]](/icons/layout.gif) | 30222_Dial Delopment..> | 2026-01-05 14:16 | 37K | |
![[ ]](/icons/layout.gif) | 42004_1st Shield Dar..> | 2026-02-10 08:11 | 37K | |
![[ ]](/icons/layout.gif) | 1857_MJS Installatio..> | 2025-10-02 13:37 | 37K | |
![[ ]](/icons/layout.gif) | 58217_CPS Custom Pro..> | 2026-03-23 16:40 | 37K | |
![[ ]](/icons/layout.gif) | 68858_SW Trade Frame..> | 2026-04-22 08:53 | 37K | |
![[ ]](/icons/layout.gif) | 779_Gallagher Mainte..> | 2025-09-24 14:47 | 37K | |
![[ ]](/icons/layout.gif) | 17893_Doors 4 Garage..> | 2025-11-21 08:27 | 37K | |
![[ ]](/icons/layout.gif) | 38291_Ross Garage Do..> | 2026-01-29 10:30 | 37K | |
![[ ]](/icons/layout.gif) | 42538_Ross Garage Do..> | 2026-02-11 09:41 | 37K | |
![[ ]](/icons/layout.gif) | 65969_Easy-Roll Ben ..> | 2026-04-15 07:42 | 37K | |
![[ ]](/icons/layout.gif) | 23197_Eclipse Doors ..> | 2025-12-05 08:06 | 37K | |
![[ ]](/icons/layout.gif) | 30353_Rising Group L..> | 2026-01-05 16:07 | 37K | |
![[ ]](/icons/layout.gif) | 39691_Mowbrey Partne..> | 2026-02-03 09:36 | 37K | |
![[ ]](/icons/layout.gif) | 44617_Ross Garage Do..> | 2026-02-17 09:17 | 37K | |
![[ ]](/icons/layout.gif) | 65414_Reklaw Doors L..> | 2026-04-14 08:49 | 37K | |
![[ ]](/icons/layout.gif) | 30924_Eclipse Doors ..> | 2026-01-06 15:45 | 37K | |
![[ ]](/icons/layout.gif) | 39924_My Garage Door..> | 2026-02-03 12:22 | 37K | |
![[ ]](/icons/layout.gif) | 50223_Fortress Doors..> | 2026-03-03 11:23 | 37K | |
![[ ]](/icons/layout.gif) | 31911_Grant Tilley G..> | 2026-01-09 08:59 | 37K | |
![[ ]](/icons/layout.gif) | 60671_DP Windows Dar..> | 2026-03-30 13:50 | 37K | |
![[ ]](/icons/layout.gif) | 67367_Excellent Ltd ..> | 2026-04-17 14:24 | 37K | |
![[ ]](/icons/layout.gif) | 8563_Custom Trade Sy..> | 2025-10-27 14:56 | 37K | |
![[ ]](/icons/layout.gif) | 22116_Rollermatic Ga..> | 2025-12-02 15:15 | 37K | |
![[ ]](/icons/layout.gif) | 34265_John Bayley Bu..> | 2026-01-16 11:58 | 37K | |
![[ ]](/icons/layout.gif) | 28525_Toby Foster-Gr..> | 2025-12-22 10:54 | 37K | |
![[ ]](/icons/layout.gif) | 44496_CPS Custom Pro..> | 2026-02-17 08:27 | 37K | |
![[ ]](/icons/layout.gif) | 50203_Fortress Doors..> | 2026-03-03 11:15 | 37K | |
![[ ]](/icons/layout.gif) | 50217_Fortress Doors..> | 2026-03-03 11:20 | 37K | |
![[ ]](/icons/layout.gif) | 50222_Fortress Doors..> | 2026-03-03 11:22 | 37K | |
![[ ]](/icons/layout.gif) | 53858_Doors 4 You Lt..> | 2026-03-11 13:13 | 37K | |
![[ ]](/icons/layout.gif) | 68088_Warnsham Windo..> | 2026-04-21 07:17 | 37K | |
![[ ]](/icons/layout.gif) | 16421_Millcourt Prop..> | 2025-11-18 09:30 | 37K | |
![[ ]](/icons/layout.gif) | 21615_Herts & Essex ..> | 2025-12-02 07:14 | 37K | |
![[ ]](/icons/layout.gif) | 50212_Fortress Doors..> | 2026-03-03 11:18 | 37K | |
![[ ]](/icons/layout.gif) | 50214_Fortress Doors..> | 2026-03-03 11:19 | 37K | |
![[ ]](/icons/layout.gif) | 54050_1st Class Home..> | 2026-03-12 09:22 | 37K | |
![[ ]](/icons/layout.gif) | 1623_Absolute Garage..> | 2025-10-01 13:57 | 37K | |
![[ ]](/icons/layout.gif) | 20710_T D Rollerdoor..> | 2025-11-28 09:40 | 37K | |
![[ ]](/icons/layout.gif) | 28151_Whitburn Joine..> | 2025-12-19 10:38 | 37K | |
![[ ]](/icons/layout.gif) | 34746_CPS Custom Pro..> | 2026-01-19 14:28 | 37K | |
![[ ]](/icons/layout.gif) | 41659_Keith Worboys ..> | 2026-02-09 11:32 | 37K | |
![[ ]](/icons/layout.gif) | 50209_Fortress Doors..> | 2026-03-03 11:17 | 37K | |
![[ ]](/icons/layout.gif) | 50213_Fortress Doors..> | 2026-03-03 11:18 | 37K | |
![[ ]](/icons/layout.gif) | 50205_Fortress Doors..> | 2026-03-03 11:16 | 37K | |
![[ ]](/icons/layout.gif) | 50211_Fortress Doors..> | 2026-03-03 11:18 | 37K | |
![[ ]](/icons/layout.gif) | 17967_J Bowman Garag..> | 2025-11-21 09:16 | 37K | |
![[ ]](/icons/layout.gif) | 50204_Fortress Doors..> | 2026-03-03 11:16 | 37K | |
![[ ]](/icons/layout.gif) | 35963_Shutter Tech U..> | 2026-01-22 10:16 | 37K | |
![[ ]](/icons/layout.gif) | 35966_Shutter Tech U..> | 2026-01-22 10:18 | 37K | |
![[ ]](/icons/layout.gif) | 42020_L G Glazing Lt..> | 2026-02-10 08:20 | 37K | |
![[ ]](/icons/layout.gif) | 52096_Shrewsbury Des..> | 2026-03-06 13:30 | 37K | |
![[ ]](/icons/layout.gif) | 66605_Ecosse Garage ..> | 2026-04-16 11:09 | 37K | |
![[ ]](/icons/layout.gif) | 19246_Wall Garage Do..> | 2025-11-25 13:51 | 37K | |
![[ ]](/icons/layout.gif) | 29676_Garage Door Se..> | 2026-01-02 09:50 | 37K | |
![[ ]](/icons/layout.gif) | 36701_Island Home Im..> | 2026-01-23 15:57 | 37K | |
![[ ]](/icons/layout.gif) | 38297_Garage Door So..> | 2026-01-29 10:33 | 37K | |
![[ ]](/icons/layout.gif) | 58466_Camlen Fabrica..> | 2026-03-24 10:41 | 37K | |
![[ ]](/icons/layout.gif) | 7990_Ace Garage Door..> | 2025-10-24 12:32 | 37K | |
![[ ]](/icons/layout.gif) | 21118_TH Installatio..> | 2025-12-01 08:22 | 37K | |
![[ ]](/icons/layout.gif) | 27048_Chelmsford Rol..> | 2025-12-16 16:08 | 37K | |
![[ ]](/icons/layout.gif) | 30851_CWD Improvemen..> | 2026-01-06 15:06 | 37K | |
![[ ]](/icons/layout.gif) | 37957_Bloomfield Hom..> | 2026-01-28 13:23 | 37K | |
![[ ]](/icons/layout.gif) | 39527_Manor Projects..> | 2026-02-03 07:48 | 37K | |
![[ ]](/icons/layout.gif) | 47382_Proud 2 Fix Ma..> | 2026-02-24 08:14 | 37K | |
![[ ]](/icons/layout.gif) | 51382_Aldous Electri..> | 2026-03-05 11:21 | 37K | |
![[ ]](/icons/layout.gif) | 60583_MIB Electrical..> | 2026-03-30 12:13 | 37K | |
![[ ]](/icons/layout.gif) | 23995_1st Shield Dar..> | 2025-12-09 07:31 | 37K | |
![[ ]](/icons/layout.gif) | 42853_T D Rollerdoor..> | 2026-02-12 07:50 | 37K | |
![[ ]](/icons/layout.gif) | 44511_CPS Custom Pro..> | 2026-02-17 08:34 | 37K | |
![[ ]](/icons/layout.gif) | 56465_Eaton Park Win..> | 2026-03-18 13:41 | 37K | |
![[ ]](/icons/layout.gif) | 15720_CPS Custom Pro..> | 2025-11-15 11:36 | 37K | |
![[ ]](/icons/layout.gif) | 15721_CPS Custom Pro..> | 2025-11-15 11:36 | 37K | |
![[ ]](/icons/layout.gif) | 41628_Keith Worboys ..> | 2026-02-09 11:10 | 37K | |
![[ ]](/icons/layout.gif) | 56935_MnK Windows Ma..> | 2026-03-19 12:17 | 37K | |
![[ ]](/icons/layout.gif) | 63126_Garage Door Se..> | 2026-04-07 14:15 | 37K | |
![[ ]](/icons/layout.gif) | 21157_Elegant Window..> | 2025-12-01 09:01 | 37K | |
![[ ]](/icons/layout.gif) | 27695_Guy Hubbard Do..> | 2025-12-18 09:56 | 37K | |
![[ ]](/icons/layout.gif) | 40002_Glenhurst Door..> | 2026-02-03 13:56 | 37K | |
![[ ]](/icons/layout.gif) | 45284_Warnsham Windo..> | 2026-02-18 08:16 | 37K | |
![[ ]](/icons/layout.gif) | 51123_PB Doors Paul ..> | 2026-03-05 07:24 | 37K | |
![[ ]](/icons/layout.gif) | 27053_Chelmsford Rol..> | 2025-12-16 16:11 | 37K | |
![[ ]](/icons/layout.gif) | 63969_Stanair Indust..> | 2026-04-09 09:04 | 37K | |
![[ ]](/icons/layout.gif) | 66731_Digby Services..> | 2026-04-16 12:29 | 37K | |
![[ ]](/icons/layout.gif) | 22879_Swift Doors Lt..> | 2025-12-04 12:17 | 37K | |
![[ ]](/icons/layout.gif) | 39963_LNR Door Solut..> | 2026-02-03 13:07 | 37K | |
![[ ]](/icons/layout.gif) | 2364_Garage Door Sol..> | 2025-10-06 12:01 | 37K | |
![[ ]](/icons/layout.gif) | 2512_3 Brothers Buil..> | 2025-10-06 15:43 | 37K | |
![[ ]](/icons/layout.gif) | 8685_Fixed Abode Gar..> | 2025-10-28 07:50 | 37K | |
![[ ]](/icons/layout.gif) | 9463_Easy-Roll Camer..> | 2025-10-29 14:52 | 37K | |
![[ ]](/icons/layout.gif) | 17161_WINDOW WIZE LT..> | 2025-11-19 11:24 | 37K | |
![[ ]](/icons/layout.gif) | 39265_Norfolk & Norw..> | 2026-02-02 13:00 | 37K | |
![[ ]](/icons/layout.gif) | 55593_Doors 4 Garage..> | 2026-03-17 07:43 | 37K | |
![[ ]](/icons/layout.gif) | 58572_Richard Horspo..> | 2026-03-24 13:36 | 37K | |
![[ ]](/icons/layout.gif) | 58660_PJ Lockham Bui..> | 2026-03-24 14:07 | 37K | |
![[ ]](/icons/layout.gif) | 69545_Ecosse Garage ..> | 2026-04-23 13:29 | 37K | |
![[ ]](/icons/layout.gif) | 3483_MJS Installatio..> | 2025-10-09 12:05 | 37K | |
![[ ]](/icons/layout.gif) | 16238_Compass Constr..> | 2025-11-17 16:54 | 37K | |
![[ ]](/icons/layout.gif) | 24446_Oakmont Door S..> | 2025-12-09 14:32 | 37K | |
![[ ]](/icons/layout.gif) | 34817_AJ Trade Andre..> | 2026-01-19 16:19 | 37K | |
![[ ]](/icons/layout.gif) | 34881_AJ Trade Andre..> | 2026-01-20 07:25 | 37K | |
![[ ]](/icons/layout.gif) | 37355_UK Rollerdoors..> | 2026-01-27 09:57 | 37K | |
![[ ]](/icons/layout.gif) | 39558_Phil Page Phil..> | 2026-02-03 08:00 | 37K | |
![[ ]](/icons/layout.gif) | 42890_Lazarenko LU2 ..> | 2026-02-12 08:47 | 37K | |
![[ ]](/icons/layout.gif) | 61352_St Helens Upvc..> | 2026-03-31 12:50 | 37K | |
![[ ]](/icons/layout.gif) | 48269_Chelmsford Rol..> | 2026-02-26 07:27 | 37K | |
![[ ]](/icons/layout.gif) | 9793_Elevate Doors L..> | 2025-10-30 12:36 | 37K | |
![[ ]](/icons/layout.gif) | 27055_Chelmsford Rol..> | 2025-12-16 16:12 | 37K | |
![[ ]](/icons/layout.gif) | 38564_Euroglaze Ryan..> | 2026-01-29 15:40 | 37K | |
![[ ]](/icons/layout.gif) | 46359_RH Doors & Shu..> | 2026-02-20 07:56 | 37K | |
![[ ]](/icons/layout.gif) | 9790_Elevate Doors L..> | 2025-10-30 12:33 | 37K | |
![[ ]](/icons/layout.gif) | 16520_Bryan Thompson..> | 2025-11-18 11:00 | 37K | |
![[ ]](/icons/layout.gif) | 25747_Garage Door Re..> | 2025-12-12 14:41 | 37K | |
![[ ]](/icons/layout.gif) | 44307_The Garage Doo..> | 2026-02-16 15:41 | 37K | |
![[ ]](/icons/layout.gif) | 9801_Elevate Doors L..> | 2025-10-30 12:51 | 37K | |
![[ ]](/icons/layout.gif) | 46680_Evans Building..> | 2026-02-20 12:20 | 37K | |
![[ ]](/icons/layout.gif) | 51672_SX Property Ma..> | 2026-03-05 16:34 | 37K | |
![[ ]](/icons/layout.gif) | 66482_HSF Constructi..> | 2026-04-16 07:49 | 37K | |
![[ ]](/icons/layout.gif) | 30878_Entador System..> | 2026-01-06 15:24 | 37K | |
![[ ]](/icons/layout.gif) | 30959_ThermoGreen Lt..> | 2026-01-07 07:54 | 37K | |
![[ ]](/icons/layout.gif) | 37354_UK Rollerdoors..> | 2026-01-27 09:56 | 37K | |
![[ ]](/icons/layout.gif) | 43959_RnR Home Impro..> | 2026-02-16 09:51 | 37K | |
![[ ]](/icons/layout.gif) | 45275_Warnsham Windo..> | 2026-02-18 08:13 | 37K | |
![[ ]](/icons/layout.gif) | 48049_Regal Windows ..> | 2026-02-25 10:07 | 37K | |
![[ ]](/icons/layout.gif) | 56191_G & H Windows ..> | 2026-03-18 09:52 | 37K | |
![[ ]](/icons/layout.gif) | 8835_JDL Plumbing Jo..> | 2025-10-28 11:08 | 37K | |
![[ ]](/icons/layout.gif) | 17496_Elly Bales - B..> | 2025-11-20 09:58 | 37K | |
![[ ]](/icons/layout.gif) | 30251_Greg Bearsley ..> | 2026-01-05 14:53 | 37K | |
![[ ]](/icons/layout.gif) | 39563_J Brady Garage..> | 2026-02-03 08:04 | 37K | |
![[ ]](/icons/layout.gif) | 48517_Secure Entranc..> | 2026-02-26 11:55 | 37K | |
![[ ]](/icons/layout.gif) | 52737_Thomas Andrew ..> | 2026-03-09 14:57 | 37K | |
![[ ]](/icons/layout.gif) | 9320_CPS Custom Prop..> | 2025-10-29 11:09 | 37K | |
![[ ]](/icons/layout.gif) | 20455_EcoGlaze Group..> | 2025-11-27 14:09 | 37K | |
![[ ]](/icons/layout.gif) | 23194_Eclipse Doors ..> | 2025-12-05 08:05 | 37K | |
![[ ]](/icons/layout.gif) | 39850_Aldous Electri..> | 2026-02-03 11:17 | 37K | |
![[ ]](/icons/layout.gif) | 43217_Elevate Doors ..> | 2026-02-12 15:28 | 37K | |
![[ ]](/icons/layout.gif) | 52412_Scotia Garage ..> | 2026-03-09 09:17 | 37K | |
![[ ]](/icons/layout.gif) | 7574_Piper Window Sy..> | 2025-10-23 13:42 | 37K | |
![[ ]](/icons/layout.gif) | 9626_TH Installation..> | 2025-10-30 09:03 | 37K | |
![[ ]](/icons/layout.gif) | 55030_First Call Shu..> | 2026-03-13 16:18 | 37K | |
![[ ]](/icons/layout.gif) | 63101_Digby Services..> | 2026-04-07 13:55 | 37K | |
![[ ]](/icons/layout.gif) | 63102_Digby Services..> | 2026-04-07 13:56 | 37K | |
![[ ]](/icons/layout.gif) | 64775_IAmDoors Ltd S..> | 2026-04-10 16:07 | 37K | |
![[ ]](/icons/layout.gif) | 65286_CPS Custom Pro..> | 2026-04-13 16:00 | 37K | |
![[ ]](/icons/layout.gif) | 35965_Shutter Tech U..> | 2026-01-22 10:17 | 37K | |
![[ ]](/icons/layout.gif) | 37848_Future Constru..> | 2026-01-28 10:50 | 37K | |
![[ ]](/icons/layout.gif) | 55924_CPS Custom Pro..> | 2026-03-17 14:47 | 37K | |
![[ ]](/icons/layout.gif) | 61209_HTH Developmen..> | 2026-03-31 11:53 | 37K | |
![[ ]](/icons/layout.gif) | 9412_Rollerdoors 24 ..> | 2025-10-29 14:20 | 37K | |
![[ ]](/icons/layout.gif) | 12239_Marcus Akid - ..> | 2025-11-06 10:49 | 37K | |
![[ ]](/icons/layout.gif) | 8794_Doorolla Ltd S ..> | 2025-10-28 10:00 | 37K | |
![[ ]](/icons/layout.gif) | 11094_Ace Garage Doo..> | 2025-11-04 08:36 | 37K | |
![[ ]](/icons/layout.gif) | 15743_M. A. E. Windo..> | 2025-11-15 12:57 | 37K | |
![[ ]](/icons/layout.gif) | 21651_Replacement Ga..> | 2025-12-02 08:03 | 37K | |
![[ ]](/icons/layout.gif) | 59136_MJS Installati..> | 2026-03-25 12:32 | 37K | |
![[ ]](/icons/layout.gif) | 55117_CWG Home Impro..> | 2026-03-16 09:15 | 37K | |
![[ ]](/icons/layout.gif) | 61571_Eclipse Doors ..> | 2026-04-01 06:41 | 37K | |
![[ ]](/icons/layout.gif) | 64321_PDL Fabricatio..> | 2026-04-10 07:50 | 37K | |
![[ ]](/icons/layout.gif) | 2869_Eco Windows & D..> | 2025-10-08 07:56 | 37K | |
![[ ]](/icons/layout.gif) | 14574_Vincent Beech ..> | 2025-11-12 13:02 | 37K | |
![[ ]](/icons/layout.gif) | 22109_Rollermatic Ga..> | 2025-12-02 15:11 | 37K | |
![[ ]](/icons/layout.gif) | 38038_Dream Installa..> | 2026-01-28 14:05 | 37K | |
![[ ]](/icons/layout.gif) | 39728_Eclipse Doors ..> | 2026-02-03 09:55 | 37K | |
![[ ]](/icons/layout.gif) | 59210_Fortress Doors..> | 2026-03-25 13:48 | 37K | |
![[ ]](/icons/layout.gif) | 60913_Windowcraft De..> | 2026-03-31 07:04 | 37K | |
![[ ]](/icons/layout.gif) | 38042_Dream Installa..> | 2026-01-28 14:06 | 37K | |
![[ ]](/icons/layout.gif) | 42085_Scotia Garage ..> | 2026-02-10 09:52 | 37K | |
![[ ]](/icons/layout.gif) | 9799_Elevate Doors L..> | 2025-10-30 12:49 | 37K | |
![[ ]](/icons/layout.gif) | 43208_Elevate Doors ..> | 2026-02-12 15:19 | 37K | |
![[ ]](/icons/layout.gif) | 61419_NBC Commercial..> | 2026-03-31 13:34 | 37K | |
![[ ]](/icons/layout.gif) | 42212_EcoGlaze Group..> | 2026-02-10 11:37 | 37K | |
![[ ]](/icons/layout.gif) | 48118_Rhino Windows ..> | 2026-02-25 11:53 | 37K | |
![[ ]](/icons/layout.gif) | 48271_Chelmsford Rol..> | 2026-02-26 07:28 | 37K | |
![[ ]](/icons/layout.gif) | 70229_Chelmsford Rol..> | 2026-04-24 14:55 | 37K | |
![[ ]](/icons/layout.gif) | 6798_AJ Trade Andrew..> | 2025-10-22 08:41 | 37K | |
![[ ]](/icons/layout.gif) | 38293_Ross Garage Do..> | 2026-01-29 10:31 | 37K | |
![[ ]](/icons/layout.gif) | 3675_Highlands Elect..> | 2025-10-10 06:50 | 37K | |
![[ ]](/icons/layout.gif) | 30032_Doors 4 You Lt..> | 2026-01-05 09:56 | 37K | |
![[ ]](/icons/layout.gif) | 67835_Thomas Andrew ..> | 2026-04-20 12:56 | 37K | |
![[ ]](/icons/layout.gif) | 8779_Do Not Use Jame..> | 2025-10-28 09:42 | 37K | |
![[ ]](/icons/layout.gif) | 45266_Warnsham Windo..> | 2026-02-18 08:12 | 37K | |
![[ ]](/icons/layout.gif) | 66211_Elite Glazing ..> | 2026-04-15 11:24 | 37K | |
![[ ]](/icons/layout.gif) | 2269_Ideal Industria..> | 2025-10-06 10:19 | 37K | |
![[ ]](/icons/layout.gif) | 4760_Beltinge Glazin..> | 2025-10-14 15:10 | 37K | |
![[ ]](/icons/layout.gif) | 5285_Enlightened Sol..> | 2025-10-16 09:59 | 37K | |
![[ ]](/icons/layout.gif) | 9582_Replacement Gar..> | 2025-10-30 08:15 | 37K | |
![[ ]](/icons/layout.gif) | 22105_Rollermatic Ga..> | 2025-12-02 15:09 | 37K | |
![[ ]](/icons/layout.gif) | 9831_Admiral Home Im..> | 2025-10-30 13:33 | 37K | |
![[ ]](/icons/layout.gif) | 17883_Monmouthshire ..> | 2025-11-21 08:04 | 37K | |
![[ ]](/icons/layout.gif) | 44614_Ross Garage Do..> | 2026-02-17 09:16 | 37K | |
![[ ]](/icons/layout.gif) | 57807_Roller Doors 2..> | 2026-03-23 09:46 | 37K | |
![[ ]](/icons/layout.gif) | 30357_L & C Bracey L..> | 2026-01-05 16:12 | 37K | |
![[ ]](/icons/layout.gif) | 38040_Dream Installa..> | 2026-01-28 14:05 | 37K | |
![[ ]](/icons/layout.gif) | 55006_Mead Property ..> | 2026-03-13 15:37 | 37K | |
![[ ]](/icons/layout.gif) | 30868_J Bowman Garag..> | 2026-01-06 15:17 | 37K | |
![[ ]](/icons/layout.gif) | 9125_P & R Door Syst..> | 2025-10-29 07:43 | 37K | |
![[ ]](/icons/layout.gif) | 20757_Elegant Window..> | 2025-11-28 10:23 | 37K | |
![[ ]](/icons/layout.gif) | 59203_Wiltshire Gara..> | 2026-03-25 13:45 | 37K | |
![[ ]](/icons/layout.gif) | 60319_Moran Windows ..> | 2026-03-27 15:38 | 37K | |
![[ ]](/icons/layout.gif) | 18438_Illy Refurbish..> | 2025-11-24 08:33 | 37K | |
![[ ]](/icons/layout.gif) | 38703_Precise Builde..> | 2026-01-30 09:25 | 37K | |
![[ ]](/icons/layout.gif) | 45207_Jurassic Doors..> | 2026-02-18 07:55 | 37K | |
![[ ]](/icons/layout.gif) | 48038_Garage Door Re..> | 2026-02-25 09:53 | 37K | |
![[ ]](/icons/layout.gif) | 69321_Regal Windows ..> | 2026-04-23 08:04 | 37K | |
![[ ]](/icons/layout.gif) | 11123_C&M Glass Serv..> | 2025-11-04 09:09 | 37K | |
![[ ]](/icons/layout.gif) | 17973_Rhino Windows ..> | 2025-11-21 09:19 | 37K | |
![[ ]](/icons/layout.gif) | 40412_Excellent Ltd ..> | 2026-02-04 11:37 | 37K | |
![[ ]](/icons/layout.gif) | 41996_Will Simpson S..> | 2026-02-10 08:03 | 37K | |
![[ ]](/icons/layout.gif) | 48043_The Lothian Ga..> | 2026-02-25 10:02 | 37K | |
![[ ]](/icons/layout.gif) | 53855_Doors 4 You Lt..> | 2026-03-11 13:12 | 37K | |
![[ ]](/icons/layout.gif) | 56633_Elite Glazing ..> | 2026-03-19 07:51 | 37K | |
![[ ]](/icons/layout.gif) | 66940_Garage Makeove..> | 2026-04-17 07:42 | 37K | |
![[ ]](/icons/layout.gif) | 13203_Mowbrey Partne..> | 2025-11-10 10:32 | 37K | |
![[ ]](/icons/layout.gif) | 16516_JJ Secure Door..> | 2025-11-18 10:57 | 37K | |
![[ ]](/icons/layout.gif) | 23655_BBA Developmen..> | 2025-12-08 09:09 | 37K | |
![[ ]](/icons/layout.gif) | 32595_Ace Garage Doo..> | 2026-01-13 09:12 | 37K | |
![[ ]](/icons/layout.gif) | 39146_SW Trade Frame..> | 2026-02-02 09:51 | 37K | |
![[ ]](/icons/layout.gif) | 42954_Eclipse Doors ..> | 2026-02-12 09:57 | 37K | |
![[ ]](/icons/layout.gif) | 36495_3 Brothers Bui..> | 2026-01-23 11:43 | 37K | |
![[ ]](/icons/layout.gif) | 32521_Stapletons Loc..> | 2026-01-13 08:35 | 37K | |
![[ ]](/icons/layout.gif) | 35650_Eclipse Doors ..> | 2026-01-21 11:48 | 37K | |
![[ ]](/icons/layout.gif) | 2650_Elegant Windows..> | 2025-10-07 09:40 | 37K | |
![[ ]](/icons/layout.gif) | 7090_A.S.M Windows L..> | 2025-10-22 14:23 | 37K | |
![[ ]](/icons/layout.gif) | 17024_WADE WINDOWS I..> | 2025-11-19 08:36 | 37K | |
![[ ]](/icons/layout.gif) | 38292_Ross Garage Do..> | 2026-01-29 10:30 | 37K | |
![[ ]](/icons/layout.gif) | 40413_Excellent Ltd ..> | 2026-02-04 11:38 | 37K | |
![[ ]](/icons/layout.gif) | 42955_Eclipse Doors ..> | 2026-02-12 09:58 | 37K | |
![[ ]](/icons/layout.gif) | 15313_JDT Doors WV5 ..> | 2025-11-14 09:12 | 37K | |
![[ ]](/icons/layout.gif) | 15670_Barry Whitehea..> | 2025-11-14 15:19 | 37K | |
![[ ]](/icons/layout.gif) | 16251_Barry Whitehea..> | 2025-11-18 07:56 | 37K | |
![[ ]](/icons/layout.gif) | 22117_Rollermatic Ga..> | 2025-12-02 15:15 | 37K | |
![[ ]](/icons/layout.gif) | 22245_Rollerdoors 24..> | 2025-12-03 08:01 | 37K | |
![[ ]](/icons/layout.gif) | 45726_Elite Glazing ..> | 2026-02-18 14:26 | 37K | |
![[ ]](/icons/layout.gif) | 20921_Scotia Garage ..> | 2025-11-28 13:34 | 37K | |
![[ ]](/icons/layout.gif) | 20926_Scotia Garage ..> | 2025-11-28 13:38 | 37K | |
![[ ]](/icons/layout.gif) | 21161_Scotia Garage ..> | 2025-12-01 09:02 | 37K | |
![[ ]](/icons/layout.gif) | 53841_Emerald Garage..> | 2026-03-11 12:33 | 37K | |
![[ ]](/icons/layout.gif) | 2657_Elegant Windows..> | 2025-10-07 09:47 | 37K | |
![[ ]](/icons/layout.gif) | 19225_Hadrian Joiner..> | 2025-11-25 13:40 | 37K | |
![[ ]](/icons/layout.gif) | 33712_SDL DOOR REPAI..> | 2026-01-15 11:25 | 37K | |
![[ ]](/icons/layout.gif) | 42957_Eclipse Doors ..> | 2026-02-12 09:59 | 37K | |
![[ ]](/icons/layout.gif) | 43410_Scotia Garage ..> | 2026-02-13 08:34 | 37K | |
![[ ]](/icons/layout.gif) | 8895_B&B Electrical ..> | 2025-10-28 11:58 | 37K | |
![[ ]](/icons/layout.gif) | 21035_Cotswold Conse..> | 2025-11-28 16:01 | 37K | |
![[ ]](/icons/layout.gif) | 33650_Doors 4 Garage..> | 2026-01-15 10:20 | 37K | |
![[ ]](/icons/layout.gif) | 43225_Elevate Doors ..> | 2026-02-12 15:30 | 37K | |
![[ ]](/icons/layout.gif) | 45232_Eclipse Doors ..> | 2026-02-18 08:04 | 37K | |
![[ ]](/icons/layout.gif) | 47786_SGT Carpentry ..> | 2026-02-24 15:51 | 37K | |
![[ ]](/icons/layout.gif) | 7007_Alps Home Impro..> | 2025-10-22 12:52 | 37K | |
![[ ]](/icons/layout.gif) | 20723_Rollermatic Ga..> | 2025-11-28 09:47 | 37K | |
![[ ]](/icons/layout.gif) | 45847_Dream Installa..> | 2026-02-18 16:13 | 37K | |
![[ ]](/icons/layout.gif) | 47383_Proud 2 Fix Ma..> | 2026-02-24 08:14 | 37K | |
![[ ]](/icons/layout.gif) | 62548_Wall Garage Do..> | 2026-04-07 06:45 | 37K | |
![[ ]](/icons/layout.gif) | 27153_P & R Door Sys..> | 2025-12-17 08:00 | 37K | |
![[ ]](/icons/layout.gif) | 36131_Ace Garage Doo..> | 2026-01-22 13:19 | 37K | |
![[ ]](/icons/layout.gif) | 9788_Elevate Doors L..> | 2025-10-30 12:31 | 37K | |
![[ ]](/icons/layout.gif) | 18460_Aldous Electri..> | 2025-11-24 09:16 | 37K | |
![[ ]](/icons/layout.gif) | 23869_Brightside Kit..> | 2025-12-08 12:54 | 37K | |
![[ ]](/icons/layout.gif) | 27051_Chelmsford Rol..> | 2025-12-16 16:10 | 37K | |
![[ ]](/icons/layout.gif) | 39590_J Brady Garage..> | 2026-02-03 08:15 | 37K | |
![[ ]](/icons/layout.gif) | 50224_Fortress Doors..> | 2026-03-03 11:23 | 37K | |
![[ ]](/icons/layout.gif) | 8005_Cromer Garage D..> | 2025-10-24 12:37 | 37K | |
![[ ]](/icons/layout.gif) | 26480_Solidfix Home ..> | 2025-12-15 14:15 | 37K | |
![[ ]](/icons/layout.gif) | 37357_UK Rollerdoors..> | 2026-01-27 09:58 | 37K | |
![[ ]](/icons/layout.gif) | 60426_FV CONSERVATOR..> | 2026-03-30 08:39 | 37K | |
![[ ]](/icons/layout.gif) | 31795_Moran Windows ..> | 2026-01-08 15:40 | 37K | |
![[ ]](/icons/layout.gif) | 34261_SW Trade Frame..> | 2026-01-16 11:55 | 37K | |
![[ ]](/icons/layout.gif) | 43670_Ace Garage Doo..> | 2026-02-13 13:36 | 37K | |
![[ ]](/icons/layout.gif) | 48845_Cromer Garage ..> | 2026-02-27 07:52 | 37K | |
![[ ]](/icons/layout.gif) | 62051_J Brady Garage..> | 2026-04-02 06:14 | 37K | |
![[ ]](/icons/layout.gif) | 7882_DPS Building Se..> | 2025-10-24 09:51 | 37K | |
![[ ]](/icons/layout.gif) | 47123_BH Electrical ..> | 2026-02-23 13:44 | 37K | |
![[ ]](/icons/layout.gif) | 57220_J Brady Garage..> | 2026-03-20 08:44 | 37K | |
![[ ]](/icons/layout.gif) | 59338_Wanstall Ltd. ..> | 2026-03-26 08:45 | 37K | |
![[ ]](/icons/layout.gif) | 8002_Cromer Garage D..> | 2025-10-24 12:36 | 37K | |
![[ ]](/icons/layout.gif) | 9415_J Bowman Garage..> | 2025-10-29 14:22 | 37K | |
![[ ]](/icons/layout.gif) | 38290_Ross Garage Do..> | 2026-01-29 10:29 | 37K | |
![[ ]](/icons/layout.gif) | 38643_Windowcraft De..> | 2026-01-30 07:50 | 37K | |
![[ ]](/icons/layout.gif) | 45271_Warnsham Windo..> | 2026-02-18 08:13 | 37K | |
![[ ]](/icons/layout.gif) | 12841_RBC Electrical..> | 2025-11-07 13:42 | 37K | |
![[ ]](/icons/layout.gif) | 50207_Fortress Doors..> | 2026-03-03 11:17 | 37K | |
![[ ]](/icons/layout.gif) | 52987_Rhino Windows ..> | 2026-03-10 08:52 | 37K | |
![[ ]](/icons/layout.gif) | 56625_Elite Glazing ..> | 2026-03-19 07:48 | 37K | |
![[ ]](/icons/layout.gif) | 59211_Fortress Doors..> | 2026-03-25 13:49 | 37K | |
![[ ]](/icons/layout.gif) | 18968_WRM Constructi..> | 2025-11-25 08:55 | 37K | |
![[ ]](/icons/layout.gif) | 25479_CPS Custom Pro..> | 2025-12-12 10:48 | 37K | |
![[ ]](/icons/layout.gif) | 50215_Fortress Doors..> | 2026-03-03 11:19 | 37K | |
![[ ]](/icons/layout.gif) | 53853_Wall Garage Do..> | 2026-03-11 13:08 | 37K | |
![[ ]](/icons/layout.gif) | 56677_J Brady Garage..> | 2026-03-19 08:43 | 37K | |
![[ ]](/icons/layout.gif) | 62564_Ideal Industri..> | 2026-04-07 06:59 | 37K | |
![[ ]](/icons/layout.gif) | 8781_J Brady Garage ..> | 2025-10-28 09:44 | 37K | |
![[ ]](/icons/layout.gif) | 45644_J Bowman Garag..> | 2026-02-18 13:27 | 37K | |
![[ ]](/icons/layout.gif) | 12777_Scotia Garage ..> | 2025-11-07 11:29 | 37K | |
![[ ]](/icons/layout.gif) | 16744_Rollerdoors 24..> | 2025-11-18 14:48 | 37K | |
![[ ]](/icons/layout.gif) | 17969_J Bowman Garag..> | 2025-11-21 09:17 | 37K | |
![[ ]](/icons/layout.gif) | 11055_J Brady Garage..> | 2025-11-04 07:45 | 37K | |
![[ ]](/icons/layout.gif) | 17021_WADE WINDOWS I..> | 2025-11-19 08:35 | 37K | |
![[ ]](/icons/layout.gif) | 48718_Michael Mazur ..> | 2026-02-26 15:52 | 37K | |
![[ ]](/icons/layout.gif) | 9131_M. A. E. Window..> | 2025-10-29 07:56 | 37K | |
![[ ]](/icons/layout.gif) | 36277_Regal Windows ..> | 2026-01-23 08:42 | 37K | |
![[ ]](/icons/layout.gif) | 44325_Garage Door So..> | 2026-02-16 15:47 | 37K | |
![[ ]](/icons/layout.gif) | 47392_DJM Fork Truck..> | 2026-02-24 08:19 | 37K | |
![[ ]](/icons/layout.gif) | 11059_J Brady Garage..> | 2025-11-04 07:48 | 37K | |
![[ ]](/icons/layout.gif) | 46958_Greenhill Prop..> | 2026-02-23 09:36 | 37K | |
![[ ]](/icons/layout.gif) | 48121_Rhino Windows ..> | 2026-02-25 11:54 | 37K | |
![[ ]](/icons/layout.gif) | 54082_Custom Access ..> | 2026-03-12 09:45 | 37K | |
![[ ]](/icons/layout.gif) | 63438_Weatherproof W..> | 2026-04-08 09:13 | 37K | |
![[ ]](/icons/layout.gif) | 6665_WINDOW WIZE LTD..> | 2025-10-21 15:29 | 37K | |
![[ ]](/icons/layout.gif) | 16411_M. A. E. Windo..> | 2025-11-18 09:25 | 37K | |
![[ ]](/icons/layout.gif) | 58258_Entador System..> | 2026-03-24 07:56 | 37K | |
![[ ]](/icons/layout.gif) | 11525_J Brady Garage..> | 2025-11-05 08:06 | 37K | |
![[ ]](/icons/layout.gif) | 58137_Rising Group L..> | 2026-03-23 14:48 | 37K | |
![[ ]](/icons/layout.gif) | 23264_Tru-Fit Windo..> | 2025-12-05 08:56 | 37K | |
![[ ]](/icons/layout.gif) | 45206_Jurassic Doors..> | 2026-02-18 07:53 | 37K | |
![[ ]](/icons/layout.gif) | 21686_Iwanicki - Loc..> | 2025-12-02 08:36 | 37K | |
![[ ]](/icons/layout.gif) | 25137_Evans Building..> | 2025-12-11 13:16 | 37K | |
![[ ]](/icons/layout.gif) | 48048_Regal Windows ..> | 2026-02-25 10:06 | 37K | |
![[ ]](/icons/layout.gif) | 48531_NTRAP NR11 7NZ..> | 2026-02-26 12:28 | 37K | |
![[ ]](/icons/layout.gif) | 9129_M. A. E. Window..> | 2025-10-29 07:56 | 37K | |
![[ ]](/icons/layout.gif) | 34346_Go Direct Door..> | 2026-01-16 14:33 | 37K | |
![[ ]](/icons/layout.gif) | 62034_Serenade Home ..> | 2026-04-02 06:00 | 37K | |
![[ ]](/icons/layout.gif) | 49503_Chelmsford Rol..> | 2026-03-02 09:48 | 37K | |
![[ ]](/icons/layout.gif) | 18356_Scotia Garage ..> | 2025-11-22 11:19 | 37K | |
![[ ]](/icons/layout.gif) | 21645_J Brady Garage..> | 2025-12-02 07:58 | 37K | |
![[ ]](/icons/layout.gif) | 35655_Eclipse Doors ..> | 2026-01-21 11:49 | 37K | |
![[ ]](/icons/layout.gif) | 47376_Go Direct Door..> | 2026-02-24 08:04 | 37K | |
![[ ]](/icons/layout.gif) | 49494_Chelmsford Rol..> | 2026-03-02 09:45 | 37K | |
![[ ]](/icons/layout.gif) | 19650_Keswick Develo..> | 2025-11-26 08:47 | 37K | |
![[ ]](/icons/layout.gif) | 43209_Elevate Doors ..> | 2026-02-12 15:19 | 37K | |
![[ ]](/icons/layout.gif) | 43216_Elevate Doors ..> | 2026-02-12 15:27 | 37K | |
![[ ]](/icons/layout.gif) | 43191_Serenade Home ..> | 2026-02-12 14:56 | 37K | |
![[ ]](/icons/layout.gif) | 21625_J Brady Garage..> | 2025-12-02 07:21 | 37K | |
![[ ]](/icons/layout.gif) | 34283_Evans & Fry Lt..> | 2026-01-16 13:32 | 37K | |
![[ ]](/icons/layout.gif) | 57818_Roller Doors 2..> | 2026-03-23 09:49 | 37K | |
![[ ]](/icons/layout.gif) | 50220_Fortress Doors..> | 2026-03-03 11:22 | 37K | |
![[ ]](/icons/layout.gif) | 65963_Serenade Home ..> | 2026-04-15 07:36 | 37K | |
![[ ]](/icons/layout.gif) | 70262_S Warrender El..> | 2026-04-24 15:43 | 37K | |
![[ ]](/icons/layout.gif) | 48265_Chelmsford Rol..> | 2026-02-26 07:26 | 37K | |
![[ ]](/icons/layout.gif) | 48277_Chelmsford Rol..> | 2026-02-26 07:31 | 37K | |
![[ ]](/icons/layout.gif) | 49490_Chelmsford Rol..> | 2026-03-02 09:43 | 37K | |
![[ ]](/icons/layout.gif) | 62542_UK Rollerdoors..> | 2026-04-07 06:41 | 37K | |
![[ ]](/icons/layout.gif) | 20721_Rollermatic Ga..> | 2025-11-28 09:47 | 37K | |
![[ ]](/icons/layout.gif) | 20740_S Warrender El..> | 2025-11-28 10:15 | 37K | |
![[ ]](/icons/layout.gif) | 34887_P & R Door Sys..> | 2026-01-20 07:32 | 37K | |
![[ ]](/icons/layout.gif) | 49314_Evans Building..> | 2026-02-27 17:10 | 37K | |
![[ ]](/icons/layout.gif) | 18939_Absolute Garag..> | 2025-11-25 08:33 | 37K | |
![[ ]](/icons/layout.gif) | 20714_Rollermatic Ga..> | 2025-11-28 09:44 | 37K | |
![[ ]](/icons/layout.gif) | 30964_Herts & Essex ..> | 2026-01-07 07:58 | 37K | |
![[ ]](/icons/layout.gif) | 45844_Dream Installa..> | 2026-02-18 16:08 | 37K | |
![[ ]](/icons/layout.gif) | 53861_Doors 4 You Lt..> | 2026-03-11 13:14 | 37K | |
![[ ]](/icons/layout.gif) | 8497_Highlands Elect..> | 2025-10-27 13:49 | 37K | |
![[ ]](/icons/layout.gif) | 47397_DJM Fork Truck..> | 2026-02-24 08:20 | 37K | |
![[ ]](/icons/layout.gif) | 50219_Fortress Doors..> | 2026-03-03 11:21 | 37K | |
![[ ]](/icons/layout.gif) | 69225_Faith Home Imp..> | 2026-04-23 06:48 | 37K | |
![[ ]](/icons/layout.gif) | 22107_Rollermatic Ga..> | 2025-12-02 15:10 | 37K | |
![[ ]](/icons/layout.gif) | 33644_Chelmsford Rol..> | 2026-01-15 10:11 | 37K | |
![[ ]](/icons/layout.gif) | 42283_Southwest Cons..> | 2026-02-10 13:00 | 37K | |
![[ ]](/icons/layout.gif) | 7708_SDL Door Repair..> | 2025-10-24 07:31 | 37K | |
![[ ]](/icons/layout.gif) | 20718_Rollermatic Ga..> | 2025-11-28 09:45 | 37K | |
![[ ]](/icons/layout.gif) | 48279_Chelmsford Rol..> | 2026-02-26 07:58 | 37K | |
![[ ]](/icons/layout.gif) | 56680_M. A. E. Windo..> | 2026-03-19 08:45 | 37K | |
![[ ]](/icons/layout.gif) | 70240_Chelmsford Rol..> | 2026-04-24 15:02 | 37K | |
![[ ]](/icons/layout.gif) | 16054_Hadrian Joiner..> | 2025-11-17 13:20 | 37K | |
![[ ]](/icons/layout.gif) | 34097_UK Door System..> | 2026-01-16 08:28 | 37K | |
![[ ]](/icons/layout.gif) | 41162_South Atlantic..> | 2026-02-06 07:58 | 37K | |
![[ ]](/icons/layout.gif) | 48909_Eastern Frames..> | 2026-02-27 08:14 | 37K | |
![[ ]](/icons/layout.gif) | 55013_Serenade Home ..> | 2026-03-13 15:43 | 37K | |
![[ ]](/icons/layout.gif) | 56509_3 Counties (Sa..> | 2026-03-18 14:53 | 37K | |
![[ ]](/icons/layout.gif) | 58851_J Brady Garage..> | 2026-03-25 08:10 | 37K | |
![[ ]](/icons/layout.gif) | 9791_Elevate Doors L..> | 2025-10-30 12:34 | 37K | |
![[ ]](/icons/layout.gif) | 9792_Elevate Doors L..> | 2025-10-30 12:35 | 37K | |
![[ ]](/icons/layout.gif) | 20727_Andrew James W..> | 2025-11-28 09:49 | 37K | |
![[ ]](/icons/layout.gif) | 48024_3 Counties (Sa..> | 2026-02-25 09:41 | 37K | |
![[ ]](/icons/layout.gif) | 48847_Bryan Thompson..> | 2026-02-27 07:54 | 37K | |
![[ ]](/icons/layout.gif) | 49689_ASSW Ltd BS10 ..> | 2026-03-02 12:09 | 37K | |
![[ ]](/icons/layout.gif) | 61224_Cerromar Solut..> | 2026-03-31 12:17 | 37K | |
![[ ]](/icons/layout.gif) | 9127_Cromer Garage D..> | 2025-10-29 07:49 | 37K | |
![[ ]](/icons/layout.gif) | 37362_J Brady Garage..> | 2026-01-27 10:01 | 37K | |
![[ ]](/icons/layout.gif) | 43229_Elevate Doors ..> | 2026-02-12 15:34 | 37K | |
![[ ]](/icons/layout.gif) | 56193_P & R Door Sys..> | 2026-03-18 09:52 | 37K | |
![[ ]](/icons/layout.gif) | 2664_Elegant Windows..> | 2025-10-07 09:51 | 37K | |
![[ ]](/icons/layout.gif) | 39565_J Brady Garage..> | 2026-02-03 08:05 | 37K | |
![[ ]](/icons/layout.gif) | 57815_Roller Doors 2..> | 2026-03-23 09:48 | 37K | |
![[ ]](/icons/layout.gif) | 59331_Go Direct Door..> | 2026-03-26 08:41 | 37K | |
![[ ]](/icons/layout.gif) | 69235_Rollermatic Ga..> | 2026-04-23 06:54 | 37K | |
![[ ]](/icons/layout.gif) | 27057_Chelmsford Rol..> | 2025-12-16 16:14 | 37K | |
![[ ]](/icons/layout.gif) | 43231_Elevate Doors ..> | 2026-02-12 15:35 | 37K | |
![[ ]](/icons/layout.gif) | 43234_Elevate Doors ..> | 2026-02-12 15:37 | 37K | |
![[ ]](/icons/layout.gif) | 48664_T D Rollerdoor..> | 2026-02-26 14:50 | 37K | |
![[ ]](/icons/layout.gif) | 49485_Chelmsford Rol..> | 2026-03-02 09:41 | 37K | |
![[ ]](/icons/layout.gif) | 21639_J Brady Garage..> | 2025-12-02 07:57 | 37K | |
![[ ]](/icons/layout.gif) | 69240_Rollermatic Ga..> | 2026-04-23 06:56 | 37K | |
![[ ]](/icons/layout.gif) | 8773_J Brady Garage ..> | 2025-10-28 09:40 | 37K | |
![[ ]](/icons/layout.gif) | 37097_Ace Garage Doo..> | 2026-01-26 14:05 | 37K | |
![[ ]](/icons/layout.gif) | 37332_Rhino Windows ..> | 2026-01-27 09:36 | 37K | |
![[ ]](/icons/layout.gif) | 48915_Eastern Frames..> | 2026-02-27 08:17 | 37K | |
![[ ]](/icons/layout.gif) | 49751_UK Door System..> | 2026-03-02 14:00 | 37K | |
![[ ]](/icons/layout.gif) | 51219_J Brady Garage..> | 2026-03-05 08:54 | 37K | |
![[ ]](/icons/layout.gif) | 70242_Chelmsford Rol..> | 2026-04-24 15:03 | 37K | |
![[ ]](/icons/layout.gif) | 8017_Roll Right Gara..> | 2025-10-24 12:48 | 37K | |
![[ ]](/icons/layout.gif) | 8769_J Brady Garage ..> | 2025-10-28 09:38 | 37K | |
![[ ]](/icons/layout.gif) | 16369_J Brady Garage..> | 2025-11-18 08:56 | 37K | |
![[ ]](/icons/layout.gif) | 17681_UK Door System..> | 2025-11-20 14:14 | 37K | |
![[ ]](/icons/layout.gif) | 39589_J Brady Garage..> | 2026-02-03 08:14 | 37K | |
![[ ]](/icons/layout.gif) | 21622_The Lothian Ga..> | 2025-12-02 07:19 | 37K | |
![[ ]](/icons/layout.gif) | 43228_Elevate Doors ..> | 2026-02-12 15:33 | 37K | |
![[ ]](/icons/layout.gif) | 49479_Chelmsford Rol..> | 2026-03-02 09:38 | 37K | |
![[ ]](/icons/layout.gif) | 69213_Rollermatic Ga..> | 2026-04-23 06:36 | 37K | |
![[ ]](/icons/layout.gif) | 57582_Scotia Garage ..> | 2026-03-20 15:36 | 37K | |
![[ ]](/icons/layout.gif) | 2491_Garage Door Sol..> | 2025-10-06 14:29 | 37K | |
![[ ]](/icons/layout.gif) | 69246_Rollermatic Ga..> | 2026-04-23 06:58 | 37K | |
![[ ]](/icons/layout.gif) | 70232_Chelmsford Rol..> | 2026-04-24 14:56 | 37K | |
![[ ]](/icons/layout.gif) | 9800_Elevate Doors L..> | 2025-10-30 12:50 | 37K | |
![[ ]](/icons/layout.gif) | 24882_Barry Eckland ..> | 2025-12-10 16:50 | 37K | |
![[ ]](/icons/layout.gif) | 43207_Elevate Doors ..> | 2026-02-12 15:18 | 37K | |
![[ ]](/icons/layout.gif) | 59906_J Brady Garage..> | 2026-03-27 08:10 | 37K | |
![[ ]](/icons/layout.gif) | 37361_Norfolk Roller..> | 2026-01-27 10:00 | 37K | |
![[ ]](/icons/layout.gif) | 11057_J Brady Garage..> | 2025-11-04 07:47 | 37K | |
![[ ]](/icons/layout.gif) | 19241_Mowbrey Partne..> | 2025-11-25 13:49 | 37K | |
![[ ]](/icons/layout.gif) | 28804_J Brady Garage..> | 2025-12-23 07:38 | 37K | |
![[ ]](/icons/layout.gif) | 45281_Warnsham Windo..> | 2026-02-18 08:15 | 37K | |
![[ ]](/icons/layout.gif) | 48281_Chelmsford Rol..> | 2026-02-26 07:59 | 37K | |
![[ ]](/icons/layout.gif) | 58854_J Brady Garage..> | 2026-03-25 08:11 | 37K | |
![[ ]](/icons/layout.gif) | 62257_Hadrian Joiner..> | 2026-04-02 10:20 | 37K | |
![[ ]](/icons/layout.gif) | 6805_Go Garage Doors..> | 2025-10-22 08:47 | 37K | |
![[ ]](/icons/layout.gif) | 23190_Danbury Garage..> | 2025-12-05 07:52 | 37K | |
![[ ]](/icons/layout.gif) | 27064_Chelmsford Rol..> | 2025-12-16 16:17 | 37K | |
![[ ]](/icons/layout.gif) | 39570_Go Direct Door..> | 2026-02-03 08:08 | 37K | |
![[ ]](/icons/layout.gif) | 47411_SDS (Isle Of M..> | 2026-02-24 08:29 | 37K | |
![[ ]](/icons/layout.gif) | 48275_Chelmsford Rol..> | 2026-02-26 07:30 | 37K | |
![[ ]](/icons/layout.gif) | 21619_The Lothian Ga..> | 2025-12-02 07:17 | 37K | |
![[ ]](/icons/layout.gif) | 49481_Chelmsford Rol..> | 2026-03-02 09:40 | 37K | |
![[ ]](/icons/layout.gif) | 69250_Rollermatic Ga..> | 2026-04-23 06:59 | 37K | |
![[ ]](/icons/layout.gif) | 48436_Go Direct Door..> | 2026-02-26 10:48 | 37K | |
![[ ]](/icons/layout.gif) | 69227_Rollermatic Ga..> | 2026-04-23 06:49 | 37K | |
![[ ]](/icons/layout.gif) | 70248_Chelmsford Rol..> | 2026-04-24 15:05 | 37K | |
![[ ]](/icons/layout.gif) | 4832_Dan O'Brien - O..> | 2025-10-15 08:29 | 37K | |
![[ ]](/icons/layout.gif) | 20716_Rollermatic Ga..> | 2025-11-28 09:45 | 37K | |
![[ ]](/icons/layout.gif) | 21617_The Lothian Ga..> | 2025-12-02 07:16 | 37K | |
![[ ]](/icons/layout.gif) | 39579_Go Direct Door..> | 2026-02-03 08:12 | 37K | |
![[ ]](/icons/layout.gif) | 42952_Eclipse Doors ..> | 2026-02-12 09:55 | 37K | |
![[ ]](/icons/layout.gif) | 43194_Serenade Home ..> | 2026-02-12 14:57 | 37K | |
![[ ]](/icons/layout.gif) | 43200_Elevate Doors ..> | 2026-02-12 15:17 | 37K | |
![[ ]](/icons/layout.gif) | 66081_J Brady Garage..> | 2026-04-15 09:26 | 37K | |
![[ ]](/icons/layout.gif) | 43232_Elevate Doors ..> | 2026-02-12 15:36 | 37K | |
![[ ]](/icons/layout.gif) | 52930_Danbury Garage..> | 2026-03-10 07:28 | 37K | |
![[ ]](/icons/layout.gif) | 11527_J Brady Garage..> | 2025-11-05 08:08 | 37K | |
![[ ]](/icons/layout.gif) | 20750_Roll Right Gar..> | 2025-11-28 10:18 | 37K | |
![[ ]](/icons/layout.gif) | 37318_CRBS Electrica..> | 2026-01-27 09:10 | 37K | |
![[ ]](/icons/layout.gif) | 48913_Eastern Frames..> | 2026-02-27 08:16 | 37K | |
![[ ]](/icons/layout.gif) | 70244_Chelmsford Rol..> | 2026-04-24 15:04 | 37K | |
![[ ]](/icons/layout.gif) | 43226_Elevate Doors ..> | 2026-02-12 15:31 | 37K | |
![[ ]](/icons/layout.gif) | 59882_Jurassic Doors..> | 2026-03-27 07:58 | 37K | |
![[ ]](/icons/layout.gif) | 11063_Absolute Garag..> | 2025-11-04 07:49 | 37K | |
![[ ]](/icons/layout.gif) | 48515_M & S Home Ins..> | 2026-02-26 11:54 | 37K | |
![[ ]](/icons/layout.gif) | 9140_Roll Right Gara..> | 2025-10-29 08:11 | 37K | |
![[ ]](/icons/layout.gif) | 26327_L W Bennion Bu..> | 2025-12-15 12:49 | 37K | |
![[ ]](/icons/layout.gif) | 51315_SH PROPERTY MA..> | 2026-03-05 10:12 | 37K | |
![[ ]](/icons/layout.gif) | 15705_UK Door System..> | 2025-11-15 10:48 | 37K | |
![[ ]](/icons/layout.gif) | 35921_Norfolk Broads..> | 2026-01-22 09:10 | 37K | |
![[ ]](/icons/layout.gif) | 37363_J Brady Garage..> | 2026-01-27 10:01 | 37K | |
![[ ]](/icons/layout.gif) | 59878_Secure Entranc..> | 2026-03-27 07:56 | 37K | |
![[ ]](/icons/layout.gif) | 40225_Herts & Essex ..> | 2026-02-04 07:39 | 37K | |
![[ ]](/icons/layout.gif) | 48261_Chelmsford Rol..> | 2026-02-26 07:24 | 37K | |
![[ ]](/icons/layout.gif) | 48914_Eastern Frames..> | 2026-02-27 08:17 | 37K | |
![[ ]](/icons/layout.gif) | 49492_Chelmsford Rol..> | 2026-03-02 09:44 | 37K | |
![[ ]](/icons/layout.gif) | 49499_Chelmsford Rol..> | 2026-03-02 09:47 | 37K | |
![[ ]](/icons/layout.gif) | 10978_Garage Door So..> | 2025-11-03 15:38 | 37K | |
![[ ]](/icons/layout.gif) | 16531_The Lothian Ga..> | 2025-11-18 11:04 | 37K | |
![[ ]](/icons/layout.gif) | 18027_David Shanahan..> | 2025-11-21 10:10 | 37K | |
![[ ]](/icons/layout.gif) | 49496_Chelmsford Rol..> | 2026-03-02 09:46 | 37K | |
![[ ]](/icons/layout.gif) | 70235_Chelmsford Rol..> | 2026-04-24 14:58 | 37K | |
![[ ]](/icons/layout.gif) | 43233_Elevate Doors ..> | 2026-02-12 15:36 | 37K | |
![[ ]](/icons/layout.gif) | 45282_Warnsham Windo..> | 2026-02-18 08:15 | 37K | |
![[ ]](/icons/layout.gif) | 9485_Rollermatic Gar..> | 2025-10-29 15:36 | 37K | |
![[ ]](/icons/layout.gif) | 39149_SW Trade Frame..> | 2026-02-02 09:53 | 37K | |
![[ ]](/icons/layout.gif) | 68069_J Brady Garage..> | 2026-04-21 07:08 | 37K | |
![[ ]](/icons/layout.gif) | 69248_Rollermatic Ga..> | 2026-04-23 06:59 | 37K | |
![[ ]](/icons/layout.gif) | 9794_Elevate Doors L..> | 2025-10-30 12:38 | 37K | |
![[ ]](/icons/layout.gif) | 9797_Elevate Doors L..> | 2025-10-30 12:43 | 37K | |
![[ ]](/icons/layout.gif) | 11065_Absolute Garag..> | 2025-11-04 07:50 | 37K | |
![[ ]](/icons/layout.gif) | 23267_Tru-Fit Window..> | 2025-12-05 08:57 | 37K | |
![[ ]](/icons/layout.gif) | 28750_Michael Mazur ..> | 2025-12-22 16:38 | 37K | |
![[ ]](/icons/layout.gif) | 30316_Charles Brown ..> | 2026-01-05 15:51 | 37K | |
![[ ]](/icons/layout.gif) | 43673_Windoors Harol..> | 2026-02-13 13:37 | 37K | |
![[ ]](/icons/layout.gif) | 48273_Chelmsford Rol..> | 2026-02-26 07:29 | 37K | |
![[ ]](/icons/layout.gif) | 56684_The Lothian Ga..> | 2026-03-19 08:48 | 37K | |
![[ ]](/icons/layout.gif) | 48045_The Lothian Ga..> | 2026-02-25 10:03 | 37K | |
![[ ]](/icons/layout.gif) | 54452_SDL DOOR REPAI..> | 2026-03-12 16:29 | 37K | |
![[ ]](/icons/layout.gif) | 20755_Roll Right Gar..> | 2025-11-28 10:20 | 37K | |
![[ ]](/icons/layout.gif) | 27986_Garage Door So..> | 2025-12-18 16:30 | 37K | |
![[ ]](/icons/layout.gif) | 34891_Go Direct Door..> | 2026-01-20 07:37 | 37K | |
![[ ]](/icons/layout.gif) | 39724_Oakley Windows..> | 2026-02-03 09:52 | 37K | |
![[ ]](/icons/layout.gif) | 43012_Go Direct Door..> | 2026-02-12 11:25 | 37K | |
![[ ]](/icons/layout.gif) | 45202_J Brady Garage..> | 2026-02-18 07:50 | 37K | |
![[ ]](/icons/layout.gif) | 20712_Rollermatic Ga..> | 2025-11-28 09:43 | 37K | |
![[ ]](/icons/layout.gif) | 30957_Go Garage Door..> | 2026-01-07 07:54 | 37K | |
![[ ]](/icons/layout.gif) | 34889_J Brady Garage..> | 2026-01-20 07:36 | 37K | |
![[ ]](/icons/layout.gif) | 43204_Elevate Doors ..> | 2026-02-12 15:18 | 37K | |
![[ ]](/icons/layout.gif) | 69217_Go Direct Door..> | 2026-04-23 06:39 | 37K | |
![[ ]](/icons/layout.gif) | 11071_Fixed Abode Ga..> | 2025-11-04 07:56 | 37K | |
![[ ]](/icons/layout.gif) | 35922_Norfolk Broads..> | 2026-01-22 09:11 | 37K | |
![[ ]](/icons/layout.gif) | 53540_Chelmsford Rol..> | 2026-03-11 07:50 | 37K | |
![[ ]](/icons/layout.gif) | 67288_Garage Door So..> | 2026-04-17 12:57 | 37K | |
![[ ]](/icons/layout.gif) | 69242_Rollermatic Ga..> | 2026-04-23 06:57 | 37K | |
![[ ]](/icons/layout.gif) | 38320_Garage Door So..> | 2026-01-29 10:40 | 37K | |
![[ ]](/icons/layout.gif) | 42953_Eclipse Doors ..> | 2026-02-12 09:56 | 37K | |
![[ ]](/icons/layout.gif) | 45199_J Brady Garage..> | 2026-02-18 07:48 | 37K | |
![[ ]](/icons/layout.gif) | 47409_SDS (Isle Of M..> | 2026-02-24 08:28 | 37K | |
![[ ]](/icons/layout.gif) | 59328_Go Direct Door..> | 2026-03-26 08:40 | 37K | |
![[ ]](/icons/layout.gif) | 51068_Rhino Windows ..> | 2026-03-04 16:26 | 37K | |
![[ ]](/icons/layout.gif) | 30965_J Brady Garage..> | 2026-01-07 07:58 | 37K | |
![[ ]](/icons/layout.gif) | 43197_UK Rollerdoors..> | 2026-02-12 15:16 | 37K | |
![[ ]](/icons/layout.gif) | 48046_The Lothian Ga..> | 2026-02-25 10:04 | 37K | |
![[ ]](/icons/layout.gif) | 23988_NW Automatic D..> | 2025-12-08 16:44 | 37K | |
![[ ]](/icons/layout.gif) | 31525_M. A. E. Windo..> | 2026-01-08 10:35 | 37K | |
![[ ]](/icons/layout.gif) | 39584_Go Direct Door..> | 2026-02-03 08:13 | 37K | |
![[ ]](/icons/layout.gif) | 48263_Chelmsford Rol..> | 2026-02-26 07:25 | 37K | |
![[ ]](/icons/layout.gif) | 48450_Go Direct Door..> | 2026-02-26 10:49 | 37K | |
![[ ]](/icons/layout.gif) | 68070_J Brady Garage..> | 2026-04-21 07:09 | 37K | |
![[ ]](/icons/layout.gif) | 8015_Go Garage Doors..> | 2025-10-24 12:46 | 37K | |
![[ ]](/icons/layout.gif) | 35918_Norfolk Broads..> | 2026-01-22 09:09 | 37K | |
![[ ]](/icons/layout.gif) | 13364_Rhino Windows ..> | 2025-11-10 14:09 | 37K | |
![[ ]](/icons/layout.gif) | 22895_Jurassic Doors..> | 2025-12-04 12:22 | 37K | |
![[ ]](/icons/layout.gif) | 47913_J Brady Garage..> | 2026-02-25 07:10 | 37K | |
![[ ]](/icons/layout.gif) | 39582_Go Direct Door..> | 2026-02-03 08:12 | 37K | |
![[ ]](/icons/layout.gif) | 44319_Garage Door So..> | 2026-02-16 15:44 | 37K | |
![[ ]](/icons/layout.gif) | 12103_Adams Industri..> | 2025-11-06 08:40 | 37K | |
![[ ]](/icons/layout.gif) | 30967_J Brady Garage..> | 2026-01-07 07:59 | 37K | |
![[ ]](/icons/layout.gif) | 37333_Rhino Windows ..> | 2026-01-27 09:37 | 37K | |
![[ ]](/icons/layout.gif) | 48907_Eastern Frames..> | 2026-02-27 08:11 | 37K | |
![[ ]](/icons/layout.gif) | 37121_Absolute Garag..> | 2026-01-26 14:25 | 37K | |
![[ ]](/icons/layout.gif) | 43071_Verdi Home Imp..> | 2026-02-12 12:13 | 37K | |
![[ ]](/icons/layout.gif) | 43222_Elevate Doors ..> | 2026-02-12 15:29 | 37K | |
![[ ]](/icons/layout.gif) | 43196_UK Rollerdoors..> | 2026-02-12 15:16 | 37K | |
![[ ]](/icons/layout.gif) | 44310_Garage Door So..> | 2026-02-16 15:42 | 37K | |
![[ ]](/icons/layout.gif) | 10981_Garage Door So..> | 2025-11-03 15:42 | 37K | |
![[ ]](/icons/layout.gif) | 16605_Omni Gates and..> | 2025-11-18 12:14 | 37K | |
![[ ]](/icons/layout.gif) | 20708_Ideal Industri..> | 2025-11-28 09:39 | 37K | |
![[ ]](/icons/layout.gif) | 39535_AS Industrial ..> | 2026-02-03 07:52 | 37K | |
![[ ]](/icons/layout.gif) | 38634_J Brady Garage..> | 2026-01-30 07:44 | 37K | |
![[ ]](/icons/layout.gif) | 39533_All Door Engin..> | 2026-02-03 07:51 | 37K | |
![[ ]](/icons/layout.gif) | 30966_J Brady Garage..> | 2026-01-07 07:58 | 37K | |
![[ ]](/icons/layout.gif) | 38218_M. A. E. Windo..> | 2026-01-29 09:06 | 37K | |
![[ ]](/icons/layout.gif) | 38330_Garage Door So..> | 2026-01-29 10:42 | 37K | |
![[ ]](/icons/layout.gif) | 39531_All Door Engin..> | 2026-02-03 07:50 | 37K | |
![[ ]](/icons/layout.gif) | 48906_Eastern Frames..> | 2026-02-27 08:10 | 37K | |
![[ ]](/icons/layout.gif) | 31126_NTRAP NR11 7NZ..> | 2026-01-07 12:44 | 37K | |
![[ ]](/icons/layout.gif) | 42965_The Lothian Ga..> | 2026-02-12 10:06 | 37K | |
![[ ]](/icons/layout.gif) | 45277_Warnsham Windo..> | 2026-02-18 08:14 | 37K | |
![[ ]](/icons/layout.gif) | 49507_Chelmsford Rol..> | 2026-03-02 09:49 | 37K | |
![[ ]](/icons/layout.gif) | 17168_M. A. E. Windo..> | 2025-11-19 11:33 | 37K | |
![[ ]](/icons/layout.gif) | 40227_Absolute Garag..> | 2026-02-04 07:40 | 37K | |
![[ ]](/icons/layout.gif) | 48911_Eastern Frames..> | 2026-02-27 08:15 | 37K | |
![[ ]](/icons/layout.gif) | 67294_Garage Door So..> | 2026-04-17 13:00 | 37K | |
![[ ]](/icons/layout.gif) | 30822_M. A. E. Windo..> | 2026-01-06 14:20 | 37K | |
![[ ]](/icons/layout.gif) | 44695_Doorolla Ltd S..> | 2026-02-17 09:57 | 37K | |
![[ ]](/icons/layout.gif) | 48916_Eastern Frames..> | 2026-02-27 08:18 | 37K | |
![[ ]](/icons/layout.gif) | 8627_Cerromar Soluti..> | 2025-10-27 16:02 | 37K | |
![[ ]](/icons/layout.gif) | 32021_SDS (Isle Of M..> | 2026-01-09 11:58 | 37K | |
![[ ]](/icons/layout.gif) | 36264_Chelmsford Rol..> | 2026-01-23 08:26 | 37K | |
![[ ]](/icons/layout.gif) | 44329_Garage Door So..> | 2026-02-16 15:48 | 37K | |
![[ ]](/icons/layout.gif) | 36262_Chelmsford Rol..> | 2026-01-23 08:25 | 37K | |
![[ ]](/icons/layout.gif) | 3222_M. A. E. Window..> | 2025-10-08 15:58 | 37K | |
![[ ]](/icons/layout.gif) | 35644_Roll Right Gar..> | 2026-01-21 11:45 | 37K | |
![[ ]](/icons/layout.gif) | 23924_1st Shield Dar..> | 2025-12-08 14:31 | 37K | |
![[ ]](/icons/layout.gif) | 35373_SDL DOOR REPAI..> | 2026-01-20 15:57 | 37K | |
![[ ]](/icons/layout.gif) | 8611_Cerromar Soluti..> | 2025-10-27 15:55 | 37K | |
![[ ]](/icons/layout.gif) | 44615_Ross Garage Do..> | 2026-02-17 09:16 | 37K | |
![[ ]](/icons/layout.gif) | 27583_SDS (Isle Of M..> | 2025-12-17 16:52 | 37K | |
![[ ]](/icons/layout.gif) | 53901_Worcestershire..> | 2026-03-11 13:53 | 37K | |
![[ ]](/icons/layout.gif) | 66947_J Brady Garage..> | 2026-04-17 07:45 | 37K | |
![[ ]](/icons/layout.gif) | 48910_Eastern Frames..> | 2026-02-27 08:14 | 37K | |
![[ ]](/icons/layout.gif) | 11067_ThermoGreen Lt..> | 2025-11-04 07:52 | 37K | |
![[ ]](/icons/layout.gif) | 23219_Apollo Glass L..> | 2025-12-05 08:45 | 37K | |
![[ ]](/icons/layout.gif) | 28919_SDS (Isle Of M..> | 2025-12-23 09:37 | 37K | |
![[ ]](/icons/layout.gif) | 35652_Eclipse Doors ..> | 2026-01-21 11:49 | 37K | |
![[ ]](/icons/layout.gif) | 43072_Verdi Home Imp..> | 2026-02-12 12:14 | 37K | |
![[ ]](/icons/layout.gif) | 45280_Warnsham Windo..> | 2026-02-18 08:14 | 37K | |
![[ ]](/icons/layout.gif) | 48055_East Anglia Ro..> | 2026-02-25 10:09 | 37K | |
![[ ]](/icons/layout.gif) | 37184_Moran Windows ..> | 2026-01-26 15:34 | 37K | |
![[ ]](/icons/layout.gif) | 45209_Jurassic Doors..> | 2026-02-18 07:56 | 37K | |
![[ ]](/icons/layout.gif) | 48454_Go Direct Door..> | 2026-02-26 10:49 | 37K | |
![[ ]](/icons/layout.gif) | 59932_Avon Automated..> | 2026-03-27 08:47 | 37K | |
![[ ]](/icons/layout.gif) | 48044_The Lothian Ga..> | 2026-02-25 10:02 | 37K | |
![[ ]](/icons/layout.gif) | 17041_M. A. E. Windo..> | 2025-11-19 08:50 | 37K | |
![[ ]](/icons/layout.gif) | 69233_Rollermatic Ga..> | 2026-04-23 06:53 | 37K | |
![[ ]](/icons/layout.gif) | 12354_Absolute Garag..> | 2025-11-06 12:03 | 37K | |
![[ ]](/icons/layout.gif) | 16840_Norfolk Roller..> | 2025-11-18 15:58 | 37K | |
![[ ]](/icons/layout.gif) | 47386_M. A. E. Windo..> | 2026-02-24 08:16 | 37K | |
![[ ]](/icons/layout.gif) | 20900_Ross Garage Do..> | 2025-11-28 12:28 | 37K | |
![[ ]](/icons/layout.gif) | 14957_Mark Tapper - ..> | 2025-11-13 11:38 | 37K | |
![[ ]](/icons/layout.gif) | 17533_NW Automatic D..> | 2025-11-20 10:50 | 37K | |
![[ ]](/icons/layout.gif) | 26461_L W Bennion Bu..> | 2025-12-15 13:52 | 37K | |
![[ ]](/icons/layout.gif) | 9760_M. A. E. Window..> | 2025-10-30 11:47 | 37K | |
![[ ]](/icons/layout.gif) | 39727_Eclipse Doors ..> | 2026-02-03 09:54 | 37K | |
![[ ]](/icons/layout.gif) | 69237_Rollermatic Ga..> | 2026-04-23 06:55 | 37K | |
![[ ]](/icons/layout.gif) | 29864_Open And Shut ..> | 2026-01-02 15:10 | 37K | |
![[ ]](/icons/layout.gif) | 12350_Absolute Garag..> | 2025-11-06 12:01 | 37K | |
![[ ]](/icons/layout.gif) | 38310_Garage Door So..> | 2026-01-29 10:35 | 37K | |
![[ ]](/icons/layout.gif) | 69252_Rollermatic Ga..> | 2026-04-23 07:00 | 37K | |
![[ ]](/icons/layout.gif) | 9789_Elevate Doors L..> | 2025-10-30 12:32 | 37K | |
![[ ]](/icons/layout.gif) | 43677_M. A. E. Windo..> | 2026-02-13 13:39 | 37K | |
![[ ]](/icons/layout.gif) | 15548_J Brady Garage..> | 2025-11-14 13:51 | 37K | |
![[ ]](/icons/layout.gif) | 57810_Roller Doors 2..> | 2026-03-23 09:47 | 37K | |
![[ ]](/icons/layout.gif) | 9135_M. A. E. Window..> | 2025-10-29 08:06 | 37K | |
![[ ]](/icons/layout.gif) | 12062_Garage Door So..> | 2025-11-05 15:35 | 37K | |
![[ ]](/icons/layout.gif) | 43074_Verdi Home Imp..> | 2026-02-12 12:14 | 37K | |
![[ ]](/icons/layout.gif) | 33643_Chelmsford Rol..> | 2026-01-15 10:10 | 37K | |
![[ ]](/icons/layout.gif) | 8774_J Brady Garage ..> | 2025-10-28 09:41 | 37K | |
![[ ]](/icons/layout.gif) | 16242_Custom Access ..> | 2025-11-17 17:07 | 37K | |
![[ ]](/icons/layout.gif) | 53856_Wall Garage Do..> | 2026-03-11 13:13 | 37K | |
![[ ]](/icons/layout.gif) | 54445_SDL DOOR REPAI..> | 2026-03-12 16:27 | 37K | |
![[ ]](/icons/layout.gif) | 38327_Garage Door So..> | 2026-01-29 10:41 | 37K | |
![[ ]](/icons/layout.gif) | 45283_Warnsham Windo..> | 2026-02-18 08:16 | 37K | |
![[ ]](/icons/layout.gif) | 9840_M. A. E. Window..> | 2025-10-30 13:41 | 37K | |
![[ ]](/icons/layout.gif) | 31023_M. A. E. Windo..> | 2026-01-07 09:23 | 37K | |
![[ ]](/icons/layout.gif) | 12225_Garage Door So..> | 2025-11-06 10:25 | 37K | |
![[ ]](/icons/layout.gif) | 39603_SDS (Isle Of M..> | 2026-02-03 08:19 | 37K | |
![[ ]](/icons/layout.gif) | 61048_Go Direct Door..> | 2026-03-31 09:30 | 37K | |
![[ ]](/icons/layout.gif) | 17800_Aldous Electri..> | 2025-11-20 16:27 | 37K | |
![[ ]](/icons/layout.gif) | 30999_Nix Building S..> | 2026-01-07 08:43 | 37K | |
![[ ]](/icons/layout.gif) | 32017_SDS (Isle Of M..> | 2026-01-09 11:54 | 37K | |
![[ ]](/icons/layout.gif) | 48054_East Anglia Ro..> | 2026-02-25 10:08 | 37K | |
![[ ]](/icons/layout.gif) | 23362_James Wall - A..> | 2025-12-05 10:11 | 37K | |
![[ ]](/icons/layout.gif) | 47997_M. A. E. Windo..> | 2026-02-25 09:30 | 37K | |
![[ ]](/icons/layout.gif) | 42426_J Brady Garage..> | 2026-02-11 07:48 | 37K | |
![[ ]](/icons/layout.gif) | 8136_Garage Door Sol..> | 2025-10-25 10:57 | 37K | |
![[ ]](/icons/layout.gif) | 15048_T D Rollerdoor..> | 2025-11-13 13:53 | 37K | |
![[ ]](/icons/layout.gif) | 40417_NW Automatic D..> | 2026-02-04 11:41 | 37K | |
![[ ]](/icons/layout.gif) | 44619_Avon Automated..> | 2026-02-17 09:19 | 37K | |
![[ ]](/icons/layout.gif) | 54437_SDL DOOR REPAI..> | 2026-03-12 16:25 | 37K | |
![[ ]](/icons/layout.gif) | 17125_NTRAP NR11 7NZ..> | 2025-11-19 10:55 | 37K | |
![[ ]](/icons/layout.gif) | 32372_Nix Building S..> | 2026-01-12 11:41 | 37K | |
![[ ]](/icons/layout.gif) | 52697_SW Trade Frame..> | 2026-03-09 14:11 | 37K | |
![[ ]](/icons/layout.gif) | 17219_Doorolla Ltd S..> | 2025-11-19 12:14 | 37K | |
![[ ]](/icons/layout.gif) | 25195_Rising Group L..> | 2025-12-11 15:04 | 37K | |
![[ ]](/icons/layout.gif) | 22902_PB Doors Paul ..> | 2025-12-04 12:27 | 37K | |
![[ ]](/icons/layout.gif) | 6761_Midland Garage ..> | 2025-10-22 08:05 | 37K | |
![[ ]](/icons/layout.gif) | 54278_M. A. E. Windo..> | 2026-03-12 14:18 | 37K | |
![[ ]](/icons/layout.gif) | 16534_The Lothian Ga..> | 2025-11-18 11:06 | 37K | |
![[ ]](/icons/layout.gif) | 25375_SDS (Isle Of M..> | 2025-12-12 08:21 | 37K | |
![[ ]](/icons/layout.gif) | 70246_Chelmsford Rol..> | 2026-04-24 15:04 | 37K | |
![[ ]](/icons/layout.gif) | 15872_Wall Garage Do..> | 2025-11-17 09:46 | 37K | |
![[ ]](/icons/layout.gif) | 17150_Avon Automated..> | 2025-11-19 11:10 | 37K | |
![[ ]](/icons/layout.gif) | 22885_Heavy Metal En..> | 2025-12-04 12:19 | 37K | |
![[ ]](/icons/layout.gif) | 17809_Ace Garage Doo..> | 2025-11-20 16:47 | 37K | |
![[ ]](/icons/layout.gif) | 25484_New Forest Rol..> | 2025-12-12 11:02 | 37K | |
![[ ]](/icons/layout.gif) | 40420_NW Automatic D..> | 2026-02-04 11:43 | 37K | |
![[ ]](/icons/layout.gif) | 33111_Fortress Doors..> | 2026-01-14 10:38 | 37K | |
![[ ]](/icons/layout.gif) | 48052_East Anglia Ro..> | 2026-02-25 10:07 | 37K | |
![[ ]](/icons/layout.gif) | 23359_Wall Garage Do..> | 2025-12-05 10:09 | 37K | |
![[ ]](/icons/layout.gif) | 21242_New Forest Rol..> | 2025-12-01 09:58 | 37K | |
![[ ]](/icons/layout.gif) | 15842_MG Securical L..> | 2025-11-17 09:19 | 37K | |
![[ ]](/icons/layout.gif) | 37353_Eden Propertie..> | 2026-01-27 09:55 | 37K | |
![[ ]](/icons/layout.gif) | 15545_J Brady Garage..> | 2025-11-14 13:49 | 37K | |
![[ ]](/icons/layout.gif) | 42967_The Lothian Ga..> | 2026-02-12 10:07 | 37K | |
![[ ]](/icons/layout.gif) | 34885_M. A. E. Windo..> | 2026-01-20 07:26 | 37K | |
![[ ]](/icons/layout.gif) | 24706_Tim Fix Garage..> | 2025-12-10 12:15 | 37K | |
![[ ]](/icons/layout.gif) | 24696_J Brady Garage..> | 2025-12-10 11:49 | 37K | |
![[ ]](/icons/layout.gif) | 31873_ASSW Ltd BS10 ..> | 2026-01-09 08:20 | 37K | |
![[ ]](/icons/layout.gif) | 55938_Ideal Industri..> | 2026-03-17 14:51 | 37K | |
![[ ]](/icons/layout.gif) | 6753_Midland Garage ..> | 2025-10-22 08:01 | 37K | |
![[ ]](/icons/layout.gif) | 12047_peter Heywood ..> | 2025-11-05 15:26 | 37K | |
![[ ]](/icons/layout.gif) | 29217_T D Rollerdoor..> | 2025-12-24 08:18 | 37K | |
![[ ]](/icons/layout.gif) | 9795_Elevate Doors L..> | 2025-10-30 12:39 | 37K | |
![[ ]](/icons/layout.gif) | 16721_Herts & Essex ..> | 2025-11-18 14:24 | 37K | |
![[ ]](/icons/layout.gif) | 16488_Doorflex Produ..> | 2025-11-18 10:21 | 37K | |
![[ ]](/icons/layout.gif) | 33146_Tim Fix Garage..> | 2026-01-14 11:07 | 37K | |
![[ ]](/icons/layout.gif) | 20698_Avon Automated..> | 2025-11-28 09:32 | 37K | |
![[ ]](/icons/layout.gif) | 42962_The Lothian Ga..> | 2026-02-12 10:04 | 37K | |
![[ ]](/icons/layout.gif) | 48904_Eastern Frames..> | 2026-02-27 08:09 | 37K | |
![[ ]](/icons/layout.gif) | 29736_Windows Plus U..> | 2026-01-02 11:35 | 37K | |
![[ ]](/icons/layout.gif) | 30462_Rollermatic Ga..> | 2026-01-06 08:14 | 37K | |
![[ ]](/icons/layout.gif) | 29932_Rollermatic Ga..> | 2026-01-05 08:19 | 37K | |
![[ ]](/icons/layout.gif) | 23449_Cromer Garage ..> | 2025-12-05 11:59 | 37K | |
![[ ]](/icons/layout.gif) | 23302_Garage Doors N..> | 2025-12-05 09:12 | 37K | |
![[ ]](/icons/layout.gif) | 20818_MG Securical L..> | 2025-11-28 11:07 | 37K | |
![[ ]](/icons/layout.gif) | 24497_Doorflex Produ..> | 2025-12-09 15:54 | 37K | |
![[ ]](/icons/layout.gif) | 42968_The Lothian Ga..> | 2026-02-12 10:08 | 37K | |
![[ ]](/icons/layout.gif) | 46677_M. A. E. Windo..> | 2026-02-20 12:18 | 37K | |
![[ ]](/icons/layout.gif) | 36699_Avon Automated..> | 2026-01-23 15:56 | 37K | |
![[ ]](/icons/layout.gif) | 46676_M. A. E. Windo..> | 2026-02-20 12:18 | 37K | |
![[ ]](/icons/layout.gif) | 24651_Herts & Essex ..> | 2025-12-10 09:31 | 37K | |
![[ ]](/icons/layout.gif) | 59149_Avon Automated..> | 2026-03-25 13:01 | 37K | |
![[ ]](/icons/layout.gif) | 17349_Andrew James W..> | 2025-11-19 14:58 | 37K | |
![[ ]](/icons/layout.gif) | 42966_The Lothian Ga..> | 2026-02-12 10:07 | 37K | |
![[ ]](/icons/layout.gif) | 68096_Avon Automated..> | 2026-04-21 07:22 | 37K | |
![[ ]](/icons/layout.gif) | 42964_The Lothian Ga..> | 2026-02-12 10:05 | 37K | |
![[ ]](/icons/layout.gif) | 23488_ThermoGreen Lt..> | 2025-12-05 14:19 | 37K | |
![[ ]](/icons/layout.gif) | 38288_DP Installatio..> | 2026-01-29 10:28 | 37K | |
![[ ]](/icons/layout.gif) | 61560_The Lothian Ga..> | 2026-04-01 06:29 | 37K | |
![[ ]](/icons/layout.gif) | 23150_Swift Doors Lt..> | 2025-12-04 16:05 | 37K | |
![[ ]](/icons/layout.gif) | 30254_Eclipse Doors ..> | 2026-01-05 14:53 | 37K | |
![[ ]](/icons/layout.gif) | 42960_The Lothian Ga..> | 2026-02-12 10:03 | 37K | |
![[ ]](/icons/layout.gif) | 48047_The Lothian Ga..> | 2026-02-25 10:05 | 37K | |
![[ ]](/icons/layout.gif) | 35645_Roll Right Gar..> | 2026-01-21 11:45 | 37K | |
![[ ]](/icons/layout.gif) | 42963_The Lothian Ga..> | 2026-02-12 10:05 | 37K | |
![[ ]](/icons/layout.gif) | 20552_Essex Prestige..> | 2025-11-27 16:24 | 37K | |
![[ ]](/icons/layout.gif) | 26789_Wiltshire Gara..> | 2025-12-16 11:22 | 37K | |
![[ ]](/icons/layout.gif) | 36697_Avon Automated..> | 2026-01-23 15:55 | 37K | |
![[ ]](/icons/layout.gif) | 36700_Avon Automated..> | 2026-01-23 15:56 | 37K | |
![[ ]](/icons/layout.gif) | 12363_Absolute Garag..> | 2025-11-06 12:11 | 37K | |
![[ ]](/icons/layout.gif) | 20686_Avon Automated..> | 2025-11-28 09:28 | 37K | |
![[ ]](/icons/layout.gif) | 32877_EZ2OWN Ltd Pau..> | 2026-01-13 13:39 | 37K | |
![[ ]](/icons/layout.gif) | 15351_C&M Glass Serv..> | 2025-11-14 09:34 | 37K | |
![[ ]](/icons/layout.gif) | 14958_Mark Tapper - ..> | 2025-11-13 11:38 | 37K | |
![[ ]](/icons/layout.gif) | 25196_Rising Group L..> | 2025-12-11 15:04 | 37K | |
![[ ]](/icons/layout.gif) | 18171_Tim Fix Garage..> | 2025-11-21 12:56 | 37K | |
![[ ]](/icons/layout.gif) | 30672_Wall Garage Do..> | 2026-01-06 11:41 | 37K | |
![[ ]](/icons/layout.gif) | 30927_ThermoGreen Lt..> | 2026-01-06 15:47 | 37K | |
![[ ]](/icons/layout.gif) | 17255_NBG Doors Nick..> | 2025-11-19 13:29 | 37K | |
![[ ]](/icons/layout.gif) | 24617_Windows Plus U..> | 2025-12-10 08:29 | 37K | |
![[ ]](/icons/layout.gif) | 68094_Avon Automated..> | 2026-04-21 07:21 | 37K | |
![[ ]](/icons/layout.gif) | 23983_NW Automatic D..> | 2025-12-08 16:37 | 37K | |
![[ ]](/icons/layout.gif) | 16993_Doorolla Ltd S..> | 2025-11-19 08:15 | 37K | |
![[ ]](/icons/layout.gif) | 15547_J Brady Garage..> | 2025-11-14 13:50 | 37K | |
![[ ]](/icons/layout.gif) | 17977_Ace Garage Doo..> | 2025-11-21 09:20 | 37K | |
![[ ]](/icons/layout.gif) | 27783_Elevate Doors ..> | 2025-12-18 11:51 | 37K | |
![[ ]](/icons/layout.gif) | 23148_Aldous Electri..> | 2025-12-04 16:04 | 37K | |
![[ ]](/icons/layout.gif) | 24406_NW Automatic D..> | 2025-12-09 12:56 | 37K | |
![[ ]](/icons/layout.gif) | 20696_Avon Automated..> | 2025-11-28 09:31 | 37K | |
![[ ]](/icons/layout.gif) | 24003_Excellent Ltd ..> | 2025-12-09 07:43 | 37K | |
![[ ]](/icons/layout.gif) | 20700_Avon Automated..> | 2025-11-28 09:32 | 37K | |
![[ ]](/icons/layout.gif) | 19090_Garage Door Re..> | 2025-11-25 12:27 | 37K | |
![[ ]](/icons/layout.gif) | 17126_NTRAP NR11 7NZ..> | 2025-11-19 10:55 | 37K | |
![[ ]](/icons/layout.gif) | 24701_Ecosse Garage ..> | 2025-12-10 12:08 | 37K | |
![[ ]](/icons/layout.gif) | 20688_Avon Automated..> | 2025-11-28 09:30 | 37K | |
![[ ]](/icons/layout.gif) | 44618_Avon Automated..> | 2026-02-17 09:18 | 37K | |
![[ ]](/icons/layout.gif) | 16108_Ffenestri Amlw..> | 2025-11-17 14:27 | 37K | |
![[ ]](/icons/layout.gif) | 25610_Fortress Doors..> | 2025-12-12 13:03 | 37K | |
![[ ]](/icons/layout.gif) | 18732_Easyroll Garag..> | 2025-11-24 14:34 | 37K | |
![[ ]](/icons/layout.gif) | 33019_T D Rollerdoor..> | 2026-01-14 08:53 | 37K | |
![[ ]](/icons/layout.gif) | 26515_Rollermatic Ga..> | 2025-12-15 15:28 | 37K | |
![[ ]](/icons/layout.gif) | 30248_Eclipse Doors ..> | 2026-01-05 14:52 | 37K | |
![[ ]](/icons/layout.gif) | 31669_NW Automatic D..> | 2026-01-08 13:12 | 37K | |
![[ ]](/icons/layout.gif) | 26961_Elevate Doors ..> | 2025-12-16 14:31 | 37K | |
![[ ]](/icons/layout.gif) | 22582_Garage Door So..> | 2025-12-03 14:42 | 37K | |
![[ ]](/icons/layout.gif) | 27132_Dream Installa..> | 2025-12-17 07:31 | 37K | |
![[ ]](/icons/layout.gif) | 28781_Wokingham Glaz..> | 2025-12-23 07:33 | 37K | |
![[ ]](/icons/layout.gif) | 33137_Glenhurst Door..> | 2026-01-14 11:02 | 37K | |
![[ ]](/icons/layout.gif) | 23184_C & P Doors Cr..> | 2025-12-05 07:13 | 37K | |
![[ ]](/icons/layout.gif) | 15659_Roll Right Gar..> | 2025-11-14 14:32 | 37K | |
![[ ]](/icons/layout.gif) | 44620_Avon Automated..> | 2026-02-17 09:19 | 37K | |
![[ ]](/icons/layout.gif) | 20765_Oakley Windows..> | 2025-11-28 10:33 | 37K | |
![[ ]](/icons/layout.gif) | 21234_Garage Door So..> | 2025-12-01 09:52 | 37K | |
![[ ]](/icons/layout.gif) | 19626_Danbury Garage..> | 2025-11-26 08:18 | 37K | |
![[ ]](/icons/layout.gif) | 15543_J Brady Garage..> | 2025-11-14 13:47 | 37K | |
![[ ]](/icons/layout.gif) | 24364_Island Home Im..> | 2025-12-09 12:06 | 37K | |
![[ ]](/icons/layout.gif) | 15693_Fortress Doors..> | 2025-11-14 16:15 | 37K | |
![[ ]](/icons/layout.gif) | 25207_Doorflex Produ..> | 2025-12-11 15:34 | 37K | |
![[ ]](/icons/layout.gif) | 24694_Ecosse Garage ..> | 2025-12-10 11:48 | 37K | |
![[ ]](/icons/layout.gif) | 30102_Absolute Garag..> | 2026-01-05 11:56 | 37K | |
![[ ]](/icons/layout.gif) | 33014_T D Rollerdoor..> | 2026-01-14 08:50 | 37K | |
![[ ]](/icons/layout.gif) | 18720_Rolrun Garage ..> | 2025-11-24 14:23 | 37K | |
![[ ]](/icons/layout.gif) | 24880_Barry Eckland ..> | 2025-12-10 16:49 | 37K | |
![[ ]](/icons/layout.gif) | 27950_Wokingham Glaz..> | 2025-12-18 15:38 | 37K | |
![[ ]](/icons/layout.gif) | 8817_Roger Fox - FOX..> | 2025-10-28 10:50 | 37K | |
![[ ]](/icons/layout.gif) | 17265_Window Repair ..> | 2025-11-19 13:45 | 37K | |
![[ ]](/icons/layout.gif) | 17610_A Complete Win..> | 2025-11-20 12:16 | 37K | |
![[ ]](/icons/layout.gif) | 21850_Absolute Garag..> | 2025-12-02 11:13 | 37K | |
![[ ]](/icons/layout.gif) | 33069_Absolute Garag..> | 2026-01-14 09:34 | 37K | |
![[ ]](/icons/layout.gif) | 23910_Cromer Garage ..> | 2025-12-08 14:15 | 37K | |
![[ ]](/icons/layout.gif) | 17787_P & R Door Sys..> | 2025-11-20 16:13 | 37K | |
![[ ]](/icons/layout.gif) | 26306_Wellingborough..> | 2025-12-15 12:12 | 37K | |
![[ ]](/icons/layout.gif) | 30860_Rollermatic Ga..> | 2026-01-06 15:13 | 37K | |
![[ ]](/icons/layout.gif) | 11502_Adam Thompson ..> | 2025-11-04 16:08 | 37K | |
![[ ]](/icons/layout.gif) | 11504_Adam Thompson ..> | 2025-11-04 16:09 | 37K | |
![[ ]](/icons/layout.gif) | 29740_Elevate Doors ..> | 2026-01-02 11:36 | 37K | |
![[ ]](/icons/layout.gif) | 16452_Doorolla Ltd S..> | 2025-11-18 09:57 | 37K | |
![[ ]](/icons/layout.gif) | 29741_Elevate Doors ..> | 2026-01-02 11:36 | 37K | |
![[ ]](/icons/layout.gif) | 8108_Ray Woodruff - ..> | 2025-10-24 15:13 | 37K | |
![[ ]](/icons/layout.gif) | 17778_P & R Door Sys..> | 2025-11-20 16:07 | 37K | |
![[ ]](/icons/layout.gif) | 21857_Rollermatic Ga..> | 2025-12-02 11:19 | 37K | |
![[ ]](/icons/layout.gif) | 22210_MMKR Home Impr..> | 2025-12-02 16:47 | 37K | |
![[ ]](/icons/layout.gif) | 15261_Oakley Windows..> | 2025-11-14 08:23 | 37K | |
![[ ]](/icons/layout.gif) | 17345_Ffenestri Amlw..> | 2025-11-19 14:49 | 37K | |
![[ ]](/icons/layout.gif) | 15004_Oakley Windows..> | 2025-11-13 12:44 | 37K | |
![[ ]](/icons/layout.gif) | 25216_Dream Installa..> | 2025-12-11 15:47 | 37K | |
![[ ]](/icons/layout.gif) | 30435_Eastern Frames..> | 2026-01-05 16:56 | 37K | |
![[ ]](/icons/layout.gif) | 19231_Hadrian Joiner..> | 2025-11-25 13:41 | 37K | |
![[ ]](/icons/layout.gif) | 17228_Rollermatic Ga..> | 2025-11-19 12:27 | 37K | |
![[ ]](/icons/layout.gif) | 17831_NW Automatic D..> | 2025-11-21 07:24 | 37K | |
![[ ]](/icons/layout.gif) | 25611_Fortress Doors..> | 2025-12-12 13:03 | 37K | |
![[ ]](/icons/layout.gif) | 18131_MM Doors Micha..> | 2025-11-21 11:46 | 37K | |
![[ ]](/icons/layout.gif) | 17392_Verdi Home Imp..> | 2025-11-19 16:42 | 37K | |
![[ ]](/icons/layout.gif) | 25574_Doorolla Ltd S..> | 2025-12-12 12:13 | 37K | |
![[ ]](/icons/layout.gif) | 27219_J Brady Garage..> | 2025-12-17 09:16 | 37K | |
![[ ]](/icons/layout.gif) | 16801_Wall Garage Do..> | 2025-11-18 15:36 | 37K | |
![[ ]](/icons/layout.gif) | 24695_Ecosse Garage ..> | 2025-12-10 11:48 | 37K | |
![[ ]](/icons/layout.gif) | 19631_J Brady Garage..> | 2025-11-26 08:24 | 37K | |
![[ ]](/icons/layout.gif) | 12699_Adam Thompson ..> | 2025-11-07 09:50 | 37K | |
![[ ]](/icons/layout.gif) | 24698_J Brady Garage..> | 2025-12-10 11:51 | 37K | |
![[ ]](/icons/layout.gif) | 27215_J Brady Garage..> | 2025-12-17 09:15 | 37K | |
![[ ]](/icons/layout.gif) | 15701_Absolute Garag..> | 2025-11-14 17:01 | 37K | |
![[ ]](/icons/layout.gif) | 26950_Norfolk Broads..> | 2025-12-16 14:28 | 37K | |
![[ ]](/icons/layout.gif) | 3463_[0,0] Iain Hair..> | 2025-10-09 11:25 | 37K | |
![[ ]](/icons/layout.gif) | 1570_Dawn Watson - D..> | 2025-10-01 10:03 | 37K | |
![[ ]](/icons/layout.gif) | 6744_Victoria Bundle..> | 2025-10-22 07:48 | 37K | |
![[ ]](/icons/layout.gif) | 29220_Norfolk Broads..> | 2025-12-24 08:24 | 37K | |
![[ ]](/icons/layout.gif) | 16998_Affordable Loc..> | 2025-11-19 08:18 | 37K | |
![[ ]](/icons/layout.gif) | 21781_Rollermatic Ga..> | 2025-12-02 10:13 | 37K | |
![[ ]](/icons/layout.gif) | 20140_Fortress Doors..> | 2025-11-27 09:19 | 37K | |
![[ ]](/icons/layout.gif) | 24687_East Anglia Ro..> | 2025-12-10 10:56 | 37K | |
![[ ]](/icons/layout.gif) | 31221_Clic Garage Do..> | 2026-01-07 14:57 | 37K | |
![[ ]](/icons/layout.gif) | 25127_The Lothian Ga..> | 2025-12-11 13:14 | 37K | |
![[ ]](/icons/layout.gif) | 24237_Danbury Garage..> | 2025-12-09 10:41 | 37K | |
![[ ]](/icons/layout.gif) | 32817_East Anglia Ro..> | 2026-01-13 12:51 | 37K | |
![[ ]](/icons/layout.gif) | 21134_Rollermatic Ga..> | 2025-12-01 08:31 | 37K | |
![[ ]](/icons/layout.gif) | 11503_Adam Thompson ..> | 2025-11-04 16:09 | 37K | |
![[ ]](/icons/layout.gif) | 8967_ThermoGreen Ltd..> | 2025-10-28 14:07 | 37K | |
![[ ]](/icons/layout.gif) | 18137_The Lothian Ga..> | 2025-11-21 12:04 | 37K | |
![[ ]](/icons/layout.gif) | 30501_Eastern Frames..> | 2026-01-06 09:11 | 37K | |
![[ ]](/icons/layout.gif) | 32455_Prestige Windo..> | 2026-01-12 16:30 | 37K | |
![[ ]](/icons/layout.gif) | 25122_The Lothian Ga..> | 2025-12-11 13:13 | 37K | |
![[ ]](/icons/layout.gif) | 23165_J Brady Garage..> | 2025-12-04 16:29 | 37K | |
![[ ]](/icons/layout.gif) | 29633_The Lothian Ga..> | 2026-01-02 08:31 | 37K | |
![[ ]](/icons/layout.gif) | 25119_The Lothian Ga..> | 2025-12-11 13:13 | 37K | |
![[ ]](/icons/layout.gif) | 31098_Avon Automated..> | 2026-01-07 10:42 | 37K | |
![[ ]](/icons/layout.gif) | 29626_The Lothian Ga..> | 2026-01-02 08:23 | 37K | |
![[ ]](/icons/layout.gif) | 22438_Clic Garage Do..> | 2025-12-03 13:12 | 37K | |
![[ ]](/icons/layout.gif) | 12238_Marcus Akid - ..> | 2025-11-06 10:48 | 37K | |
![[ ]](/icons/layout.gif) | 29628_The Lothian Ga..> | 2026-01-02 08:24 | 37K | |
![[ ]](/icons/layout.gif) | 31223_Clic Garage Do..> | 2026-01-07 14:58 | 37K | |
![[ ]](/icons/layout.gif) | 29635_The Lothian Ga..> | 2026-01-02 08:31 | 37K | |
![[ ]](/icons/layout.gif) | 29640_The Lothian Ga..> | 2026-01-02 08:41 | 38K | |
![[ ]](/icons/layout.gif) | 27071_Rollermatic Ga..> | 2025-12-16 16:27 | 38K | |
![[ ]](/icons/layout.gif) | 31791_The Lothian Ga..> | 2026-01-08 15:38 | 38K | |
![[ ]](/icons/layout.gif) | 30908_J Brady Garage..> | 2026-01-06 15:29 | 38K | |
![[ ]](/icons/layout.gif) | 59207_Fortress Doors..> | 2026-03-25 13:47 | 38K | |
![[ ]](/icons/layout.gif) | 56683_Go Direct Door..> | 2026-03-19 08:46 | 38K | |
![[ ]](/icons/layout.gif) | 66465_Regal Windows ..> | 2026-04-16 07:39 | 38K | |
![[ ]](/icons/layout.gif) | 16630_Andrew James W..> | 2025-11-18 12:50 | 38K | |
![[ ]](/icons/layout.gif) | 54569_Rollermatic Ga..> | 2026-03-13 08:24 | 38K | |
![[ ]](/icons/layout.gif) | 23965_Steve Cartmell..> | 2025-12-08 15:51 | 38K | |
![[ ]](/icons/layout.gif) | 1843_[0,0] Restaric..> | 2025-10-02 13:27 | 38K | |
![[ ]](/icons/layout.gif) | 17027_Doorolla Ltd S..> | 2025-11-19 08:38 | 38K | |
![[ ]](/icons/layout.gif) | 17408_Windoworld Ltd..> | 2025-11-20 08:09 | 38K | |
![[ ]](/icons/layout.gif) | 18028_David Shanahan..> | 2025-11-21 10:10 | 38K | |
![[ ]](/icons/layout.gif) | 16603_Omni Gates and..> | 2025-11-18 12:12 | 38K | |
![[ ]](/icons/layout.gif) | 15831_MG Securical L..> | 2025-11-17 09:18 | 38K | |
![[ ]](/icons/layout.gif) | 16243_Custom Access ..> | 2025-11-17 17:07 | 38K | |
![[ ]](/icons/layout.gif) | 18100_Wokingham Glaz..> | 2025-11-21 11:15 | 38K | |
![[ ]](/icons/layout.gif) | 18563_Thomas Andrew ..> | 2025-11-24 11:25 | 38K | |
![[ ]](/icons/layout.gif) | 17451_Rollermatic Ga..> | 2025-11-20 09:10 | 38K | |
![[ ]](/icons/layout.gif) | 16022_James Wall - A..> | 2025-11-17 12:11 | 38K | |
![[ ]](/icons/layout.gif) | 16489_Doorflex Produ..> | 2025-11-18 10:22 | 38K | |
![[ ]](/icons/layout.gif) | 23967_TWD Limited St..> | 2025-12-08 15:54 | 38K | |
![[ ]](/icons/layout.gif) | 18224_T D Rollerdoor..> | 2025-11-21 14:02 | 38K | |
![[ ]](/icons/layout.gif) | 61567_The Lothian Ga..> | 2026-04-01 06:36 | 38K | |
![[ ]](/icons/layout.gif) | 24040_TWD Limited St..> | 2025-12-09 08:22 | 38K | |
![[ ]](/icons/layout.gif) | 17215_Andrew James W..> | 2025-11-19 12:06 | 38K | |
![[ ]](/icons/layout.gif) | 17464_Fortress Doors..> | 2025-11-20 09:17 | 38K | |
![[ ]](/icons/layout.gif) | 18476_Fortress Doors..> | 2025-11-24 09:49 | 38K | |
![[ ]](/icons/layout.gif) | 17983_The Lothian Ga..> | 2025-11-21 09:25 | 38K | |
![[ ]](/icons/layout.gif) | 9371_Tucker Glass - ..> | 2025-10-29 13:33 | 38K | |
![[ ]](/icons/layout.gif) | 18472_Chelmsford Rol..> | 2025-11-24 09:42 | 38K | |
![[ ]](/icons/layout.gif) | 16261_TH Installatio..> | 2025-11-18 08:14 | 38K | |
![[ ]](/icons/layout.gif) | 913_Garage Door Repa..> | 2025-09-25 14:39 | 38K | |
![[ ]](/icons/layout.gif) | 18172_Tim Fix Garage..> | 2025-11-21 12:57 | 38K | |
![[ ]](/icons/layout.gif) | 25126_TWD Limited St..> | 2025-12-11 13:14 | 38K | |
![[ ]](/icons/layout.gif) | 16454_Doorolla Ltd S..> | 2025-11-18 09:57 | 38K | |
![[ ]](/icons/layout.gif) | 907_Garage Door Repa..> | 2025-09-25 14:35 | 38K | |
![[ ]](/icons/layout.gif) | 18477_Elevate Doors ..> | 2025-11-24 09:52 | 38K | |
![[ ]](/icons/layout.gif) | 17227_Rollermatic Ga..> | 2025-11-19 12:27 | 38K | |
![[ ]](/icons/layout.gif) | 17807_Ace Garage Doo..> | 2025-11-20 16:43 | 38K | |
![[ ]](/icons/layout.gif) | 17611_A Complete Win..> | 2025-11-20 12:16 | 38K | |
![[ ]](/icons/layout.gif) | 17254_NBG Doors Nick..> | 2025-11-19 13:28 | 38K | |
![[ ]](/icons/layout.gif) | 2844_[0,0] Restaric..> | 2025-10-07 16:08 | 38K | |
![[ ]](/icons/layout.gif) | 15988_Roll Right Gar..> | 2025-11-17 11:38 | 38K | |
![[ ]](/icons/layout.gif) | 16018_Glen McNulty -..> | 2025-11-17 12:05 | 38K | |
![[ ]](/icons/layout.gif) | 17391_Verdi Home Imp..> | 2025-11-19 16:42 | 38K | |
![[ ]](/icons/layout.gif) | 15258_Oakley Windows..> | 2025-11-14 08:23 | 38K | |
![[ ]](/icons/layout.gif) | 1322_Easy-Roll Camer..> | 2025-09-29 15:20 | 38K | |
![[ ]](/icons/layout.gif) | 23413_Illy Refurbish..> | 2025-12-05 11:18 | 38K | |
![[ ]](/icons/layout.gif) | 17789_P & R Door Sys..> | 2025-11-20 16:13 | 38K | |
![[ ]](/icons/layout.gif) | 17779_P & R Door Sys..> | 2025-11-20 16:08 | 38K | |
![[ ]](/icons/layout.gif) | 16106_Ffenestri Amlw..> | 2025-11-17 14:27 | 38K | |
![[ ]](/icons/layout.gif) | 17216_Andrew James W..> | 2025-11-19 12:06 | 38K | |
![[ ]](/icons/layout.gif) | 18299_Avon Automated..> | 2025-11-21 16:00 | 38K | |
![[ ]](/icons/layout.gif) | 16028_Lockdown Rolle..> | 2025-11-17 12:25 | 38K | |
![[ ]](/icons/layout.gif) | 16254_The Lothian Ga..> | 2025-11-18 07:57 | 38K | |
![[ ]](/icons/layout.gif) | 3760_UK Rollerdoors ..> | 2025-10-10 09:56 | 38K | |
![[ ]](/icons/layout.gif) | 9652_Marcus Akid - G..> | 2025-10-30 09:42 | 38K | |
![[ ]](/icons/layout.gif) | 6038_Affordable Lock..> | 2025-10-20 08:07 | 38K | |
![[ ]](/icons/layout.gif) | 15702_Absolute Garag..> | 2025-11-14 17:01 | 38K | |
![[ ]](/icons/layout.gif) | 16917_J Brady Garage..> | 2025-11-19 07:25 | 38K | |
![[ ]](/icons/layout.gif) | 9560_TH Installation..> | 2025-10-29 16:57 | 38K | |
![[ ]](/icons/layout.gif) | 18132_MM Doors Micha..> | 2025-11-21 11:46 | 38K | |
![[ ]](/icons/layout.gif) | 17355_The Lothian Ga..> | 2025-11-19 15:36 | 38K | |
![[ ]](/icons/layout.gif) | 62120_Go Direct Door..> | 2026-04-02 07:30 | 38K | |
![[ ]](/icons/layout.gif) | 20179_Northants Gara..> | 2025-11-27 10:00 | 38K | |
![[ ]](/icons/layout.gif) | 18717_Rolrun Garage ..> | 2025-11-24 14:19 | 39K | |
![[ ]](/icons/layout.gif) | 1340_SDS (Isle Of Ma..> | 2025-09-30 06:59 | 39K | |
![[ ]](/icons/layout.gif) | 16631_Essex Prestige..> | 2025-11-18 12:54 | 39K | |
![[ ]](/icons/layout.gif) | 22095_J Brady Garage..> | 2025-12-02 14:45 | 39K | |
![[ ]](/icons/layout.gif) | 6361_UK Rollerdoors ..> | 2025-10-20 14:49 | 39K | |
![[ ]](/icons/layout.gif) | 15525_D J Furness Co..> | 2025-11-14 13:41 | 39K | |
![[ ]](/icons/layout.gif) | 17352_The Lothian Ga..> | 2025-11-19 15:08 | 39K | |
![[ ]](/icons/layout.gif) | 15936_Rollermatic Ga..> | 2025-11-17 10:48 | 39K | |
![[ ]](/icons/layout.gif) | 59904_The Lothian Ga..> | 2026-03-27 08:09 | 39K | |
![[ ]](/icons/layout.gif) | 63124_Avon Automated..> | 2026-04-07 14:14 | 39K | |
![[ ]](/icons/layout.gif) | 31926_J Brady Garage..> | 2026-01-09 09:14 | 39K | |
![[ ]](/icons/layout.gif) | 68089_Elevate Doors ..> | 2026-04-21 07:18 | 40K | |
![[ ]](/icons/layout.gif) | 61653_June Overett -..> | 2026-04-01 08:30 | 40K | |
![[ ]](/icons/layout.gif) | 64301_Elevate Doors ..> | 2026-04-10 06:53 | 40K | |
![[ ]](/icons/layout.gif) | 59200_Fortress Doors..> | 2026-03-25 13:44 | 40K | |
![[ ]](/icons/layout.gif) | 60502_Tilak Sharma -..> | 2026-03-30 10:35 | 40K | |
![[ ]](/icons/layout.gif) | 43030_Bandula Maduja..> | 2026-02-12 11:46 | 40K | |
![[ ]](/icons/layout.gif) | 43764_Bandula Maduja..> | 2026-02-16 07:42 | 40K | |
![[ ]](/icons/layout.gif) | 46009_Simon Hagger -..> | 2026-02-19 10:23 | 40K | |
![[ ]](/icons/layout.gif) | 49676_Lynne Young - ..> | 2026-03-02 12:02 | 40K | |
![[ ]](/icons/layout.gif) | 55009_Elevate Doors ..> | 2026-03-13 15:41 | 40K | |
![[ ]](/icons/layout.gif) | 60420_NBC Commercial..> | 2026-03-30 08:30 | 40K | |
![[ ]](/icons/layout.gif) | 61574_East Anglia Ro..> | 2026-04-01 06:44 | 40K | |
![[ ]](/icons/layout.gif) | 65345_Doorolla Ltd S..> | 2026-04-14 07:41 | 40K | |
![[ ]](/icons/layout.gif) | 39610_Guy GMC Herefo..> | 2026-02-03 08:22 | 40K | |
![[ ]](/icons/layout.gif) | 38583_Tony Dovey Ton..> | 2026-01-29 16:01 | 40K | |
![[ ]](/icons/layout.gif) | 43983_Matc Rivers - ..> | 2026-02-16 10:26 | 40K | |
![[ ]](/icons/layout.gif) | 50774_Welbeck Shutte..> | 2026-03-04 10:58 | 40K | |
![[ ]](/icons/layout.gif) | 64981_AJD Contracts ..> | 2026-04-13 09:22 | 40K | |
![[ ]](/icons/layout.gif) | 65354_Michael Harper..> | 2026-04-14 07:52 | 40K | |
![[ ]](/icons/layout.gif) | 39780_S.Cosgrove Ste..> | 2026-02-03 10:27 | 40K | |
![[ ]](/icons/layout.gif) | 54925_Spa Roller Doo..> | 2026-03-13 14:25 | 40K | |
![[ ]](/icons/layout.gif) | 36840_Geoff Webb - W..> | 2026-01-26 10:05 | 40K | |
![[ ]](/icons/layout.gif) | 43479_JM Doors Jon B..> | 2026-02-13 09:16 | 40K | |
![[ ]](/icons/layout.gif) | 57037_Ezi-Dor Ltd Tr..> | 2026-03-19 15:24 | 40K | |
![[ ]](/icons/layout.gif) | 49712_Pro-Door Ltd P..> | 2026-03-02 12:58 | 40K | |
![[ ]](/icons/layout.gif) | 69151_Magdalena Smit..> | 2026-04-22 15:00 | 40K | |
![[ ]](/icons/layout.gif) | 60414_William Pritch..> | 2026-03-30 08:25 | 40K | |
![[ ]](/icons/layout.gif) | 48009_Liam Johnson -..> | 2026-02-25 09:32 | 40K | |
![[ ]](/icons/layout.gif) | 46616_Go Direct Door..> | 2026-02-20 11:43 | 40K | |
![[ ]](/icons/layout.gif) | 57686_Darren Woodall..> | 2026-03-20 16:59 | 40K | |
![[ ]](/icons/layout.gif) | 34539_NTRAP NR11 7NZ..> | 2026-01-19 10:24 | 40K | |
![[ ]](/icons/layout.gif) | 35695_Norfolk Broads..> | 2026-01-21 12:26 | 40K | |
![[ ]](/icons/layout.gif) | 39049_PB Doors Paul ..> | 2026-01-30 16:26 | 40K | |
![[ ]](/icons/layout.gif) | 61047_IAmDoors Ltd S..> | 2026-03-31 09:29 | 40K | |
![[ ]](/icons/layout.gif) | 44851_Tony Dovey Ton..> | 2026-02-17 13:06 | 40K | |
![[ ]](/icons/layout.gif) | 67783_EZ2OWN Ltd Pau..> | 2026-04-20 11:07 | 40K | |
![[ ]](/icons/layout.gif) | 34292_Thetford Glass..> | 2026-01-16 13:37 | 40K | |
![[ ]](/icons/layout.gif) | 58969_Jurassic Doors..> | 2026-03-25 09:53 | 40K | |
![[ ]](/icons/layout.gif) | 42320_Anthony Sulliv..> | 2026-02-10 14:13 | 40K | |
![[ ]](/icons/layout.gif) | 66606_Ecosse Garage ..> | 2026-04-16 11:10 | 40K | |
![[ ]](/icons/layout.gif) | 60478_Reklaw Doors L..> | 2026-03-30 10:00 | 40K | |
![[ ]](/icons/layout.gif) | 40544_Eastern Frames..> | 2026-02-04 14:34 | 40K | |
![[ ]](/icons/layout.gif) | 35606_Elevate Doors ..> | 2026-01-21 11:21 | 40K | |
![[ ]](/icons/layout.gif) | 58448_Grant Tilley G..> | 2026-03-24 10:32 | 40K | |
![[ ]](/icons/layout.gif) | 65774_Serenade Home ..> | 2026-04-14 14:11 | 40K | |
![[ ]](/icons/layout.gif) | 69976_Avon Automated..> | 2026-04-24 10:30 | 40K | |
![[ ]](/icons/layout.gif) | 64652_Profascia Delr..> | 2026-04-10 13:17 | 40K | |
![[ ]](/icons/layout.gif) | 36456_Willow Builder..> | 2026-01-23 11:12 | 40K | |
![[ ]](/icons/layout.gif) | 39207_T D Rollerdoor..> | 2026-02-02 11:21 | 40K | |
![[ ]](/icons/layout.gif) | 48933_Windoors Harol..> | 2026-02-27 08:42 | 40K | |
![[ ]](/icons/layout.gif) | 50291_Wall Garage Do..> | 2026-03-03 13:02 | 40K | |
![[ ]](/icons/layout.gif) | 54959_Thetford Glass..> | 2026-03-13 14:41 | 40K | |
![[ ]](/icons/layout.gif) | 63176_CWD Improvemen..> | 2026-04-07 15:11 | 40K | |
![[ ]](/icons/layout.gif) | 39806_Norfolk Broads..> | 2026-02-03 10:41 | 40K | |
![[ ]](/icons/layout.gif) | 39809_Norfolk Broads..> | 2026-02-03 10:41 | 40K | |
![[ ]](/icons/layout.gif) | 41100_Doorolla Ltd S..> | 2026-02-05 16:18 | 40K | |
![[ ]](/icons/layout.gif) | 51965_Doors 4 Garage..> | 2026-03-06 10:48 | 40K | |
![[ ]](/icons/layout.gif) | 59372_Doorolla Ltd S..> | 2026-03-26 09:09 | 40K | |
![[ ]](/icons/layout.gif) | 39057_PB Doors Paul ..> | 2026-01-30 16:31 | 40K | |
![[ ]](/icons/layout.gif) | 44153_Ross Garage Do..> | 2026-02-16 12:45 | 40K | |
![[ ]](/icons/layout.gif) | 48053_Wall Garage Do..> | 2026-02-25 10:07 | 40K | |
![[ ]](/icons/layout.gif) | 41580_New Forest Rol..> | 2026-02-09 10:26 | 40K | |
![[ ]](/icons/layout.gif) | 66633_Secure Entranc..> | 2026-04-16 11:31 | 40K | |
![[ ]](/icons/layout.gif) | 43657_J Brady Garage..> | 2026-02-13 13:09 | 40K | |
![[ ]](/icons/layout.gif) | 44699_T D Rollerdoor..> | 2026-02-17 10:02 | 40K | |
![[ ]](/icons/layout.gif) | 65356_Doorolla Ltd S..> | 2026-04-14 07:54 | 40K | |
![[ ]](/icons/layout.gif) | 69476_Rolladoor NR9 ..> | 2026-04-23 11:58 | 40K | |
![[ ]](/icons/layout.gif) | 51292_Chelmsford Rol..> | 2026-03-05 09:56 | 40K | |
![[ ]](/icons/layout.gif) | 65334_Ezi-Dor Ltd Tr..> | 2026-04-14 07:29 | 40K | |
![[ ]](/icons/layout.gif) | 34540_NTRAP NR11 7NZ..> | 2026-01-19 10:24 | 40K | |
![[ ]](/icons/layout.gif) | 35696_Norfolk Broads..> | 2026-01-21 12:26 | 40K | |
![[ ]](/icons/layout.gif) | 37234_P & R Door Sys..> | 2026-01-26 16:26 | 40K | |
![[ ]](/icons/layout.gif) | 49970_Easy-Roll Ben ..> | 2026-03-02 16:25 | 40K | |
![[ ]](/icons/layout.gif) | 58905_MG Securical L..> | 2026-03-25 08:56 | 40K | |
![[ ]](/icons/layout.gif) | 60236_Simon Piggin P..> | 2026-03-27 14:04 | 40K | |
![[ ]](/icons/layout.gif) | 42151_Eastern Frames..> | 2026-02-10 10:55 | 40K | |
![[ ]](/icons/layout.gif) | 35549_Rollermatic Ga..> | 2026-01-21 09:37 | 40K | |
![[ ]](/icons/layout.gif) | 36976_P & R Door Sys..> | 2026-01-26 13:02 | 40K | |
![[ ]](/icons/layout.gif) | 36463_Chelmsford Rol..> | 2026-01-23 11:17 | 40K | |
![[ ]](/icons/layout.gif) | 43600_Chelmsford Rol..> | 2026-02-13 11:41 | 40K | |
![[ ]](/icons/layout.gif) | 60960_NTRAP NR11 7NZ..> | 2026-03-31 08:42 | 40K | |
![[ ]](/icons/layout.gif) | 41684_Garage Doors 2..> | 2026-02-09 12:34 | 40K | |
![[ ]](/icons/layout.gif) | 64104_Doors 4 Garage..> | 2026-04-09 12:39 | 40K | |
![[ ]](/icons/layout.gif) | 50296_Wall Garage Do..> | 2026-03-03 13:04 | 40K | |
![[ ]](/icons/layout.gif) | 55601_Norfolk & Norw..> | 2026-03-17 07:58 | 40K | |
![[ ]](/icons/layout.gif) | 47713_Serenade Home ..> | 2026-02-24 14:12 | 40K | |
![[ ]](/icons/layout.gif) | 11032_Rollermatic Ga..> | 2025-11-03 16:30 | 40K | |
![[ ]](/icons/layout.gif) | 63139_T D Rollerdoor..> | 2026-04-07 14:29 | 40K | |
![[ ]](/icons/layout.gif) | 38020_Dream Installa..> | 2026-01-28 13:53 | 40K | |
![[ ]](/icons/layout.gif) | 67804_Serenade Home ..> | 2026-04-20 12:02 | 40K | |
![[ ]](/icons/layout.gif) | 55175_JM Doors Jon B..> | 2026-03-16 09:38 | 40K | |
![[ ]](/icons/layout.gif) | 63472_PB Doors Paul ..> | 2026-04-08 10:02 | 40K | |
![[ ]](/icons/layout.gif) | 68098_Howlett Garage..> | 2026-04-21 07:22 | 40K | |
![[ ]](/icons/layout.gif) | 35936_JCHI LTD - JCH..> | 2026-01-22 09:38 | 40K | |
![[ ]](/icons/layout.gif) | 35989_JCHI LTD - JCH..> | 2026-01-22 10:51 | 40K | |
![[ ]](/icons/layout.gif) | 69379_Dream Installa..> | 2026-04-23 09:31 | 40K | |
![[ ]](/icons/layout.gif) | 105009-35936_JCHI LT..> | 2026-01-22 10:50 | 40K | |
![[ ]](/icons/layout.gif) | 64986_Profascia Delr..> | 2026-04-13 09:26 | 40K | |
![[ ]](/icons/layout.gif) | 61422_NBC Commercial..> | 2026-03-31 13:34 | 40K | |
![[ ]](/icons/layout.gif) | 61856_T D Rollerdoor..> | 2026-04-01 12:00 | 40K | |
![[ ]](/icons/layout.gif) | 34161_T D Rollerdoor..> | 2026-01-16 09:23 | 40K | |
![[ ]](/icons/layout.gif) | 62946_UK Rollerdoors..> | 2026-04-07 12:19 | 40K | |
![[ ]](/icons/layout.gif) | 41450_T D Rollerdoor..> | 2026-02-06 15:25 | 40K | |
![[ ]](/icons/layout.gif) | 42223_Keith Worboys ..> | 2026-02-10 11:48 | 40K | |
![[ ]](/icons/layout.gif) | 64097_Doors 4 Garage..> | 2026-04-09 12:29 | 40K | |
![[ ]](/icons/layout.gif) | 58787_Chelmsford Rol..> | 2026-03-24 16:08 | 40K | |
![[ ]](/icons/layout.gif) | 42017_J Brady Garage..> | 2026-02-10 08:19 | 40K | |
![[ ]](/icons/layout.gif) | 35443_Ideal Industri..> | 2026-01-21 07:44 | 40K | |
![[ ]](/icons/layout.gif) | 63317_Clic Garage Do..> | 2026-04-08 07:39 | 40K | |
![[ ]](/icons/layout.gif) | 57954_NBG Doors Nick..> | 2026-03-23 11:19 | 40K | |
![[ ]](/icons/layout.gif) | 47165_Lockdown Rolle..> | 2026-02-23 15:12 | 40K | |
![[ ]](/icons/layout.gif) | 59407_Elevate Doors ..> | 2026-03-26 09:48 | 40K | |
![[ ]](/icons/layout.gif) | 65513_Garage Doors 2..> | 2026-04-14 10:24 | 40K | |
![[ ]](/icons/layout.gif) | 58052_RnR Home Impro..> | 2026-03-23 13:07 | 40K | |
![[ ]](/icons/layout.gif) | 68268_UK Rollerdoors..> | 2026-04-21 09:40 | 40K | |
![[ ]](/icons/layout.gif) | 41894_Warnsham Windo..> | 2026-02-09 16:20 | 40K | |
![[ ]](/icons/layout.gif) | 51151_D H Gates And ..> | 2026-03-05 08:04 | 40K | |
![[ ]](/icons/layout.gif) | 59137_MJS Installati..> | 2026-03-25 12:32 | 40K | |
![[ ]](/icons/layout.gif) | 35068_Elevate Doors ..> | 2026-01-20 10:52 | 40K | |
![[ ]](/icons/layout.gif) | 48150_Douglas Ward -..> | 2026-02-25 13:21 | 40K | |
![[ ]](/icons/layout.gif) | 57693_Fortress Doors..> | 2026-03-23 08:07 | 40K | |
![[ ]](/icons/layout.gif) | 59205_Wiltshire Gara..> | 2026-03-25 13:45 | 40K | |
![[ ]](/icons/layout.gif) | 44877_J Brady Garage..> | 2026-02-17 13:14 | 40K | |
![[ ]](/icons/layout.gif) | 39913_Ross Garage Do..> | 2026-02-03 12:15 | 40K | |
![[ ]](/icons/layout.gif) | 40780_Dawson Buildin..> | 2026-02-05 10:15 | 40K | |
![[ ]](/icons/layout.gif) | 46930_T D Rollerdoor..> | 2026-02-23 08:38 | 40K | |
![[ ]](/icons/layout.gif) | 36674_Absolute Garag..> | 2026-01-23 15:25 | 40K | |
![[ ]](/icons/layout.gif) | 37847_Future Constru..> | 2026-01-28 10:50 | 40K | |
![[ ]](/icons/layout.gif) | 36457_Willow Builder..> | 2026-01-23 11:12 | 40K | |
![[ ]](/icons/layout.gif) | 40033_Doorflex Produ..> | 2026-02-03 14:40 | 40K | |
![[ ]](/icons/layout.gif) | 43252_Regal Windows ..> | 2026-02-12 15:59 | 40K | |
![[ ]](/icons/layout.gif) | 66483_HSF Constructi..> | 2026-04-16 07:49 | 40K | |
![[ ]](/icons/layout.gif) | 57662_T D Rollerdoor..> | 2026-03-20 16:13 | 40K | |
![[ ]](/icons/layout.gif) | 60079_Wall Garage Do..> | 2026-03-27 11:24 | 40K | |
![[ ]](/icons/layout.gif) | 60565_T D Rollerdoor..> | 2026-03-30 12:04 | 40K | |
![[ ]](/icons/layout.gif) | 45002_Secure Entranc..> | 2026-02-17 14:29 | 40K | |
![[ ]](/icons/layout.gif) | 52727_JM Doors Jon B..> | 2026-03-09 14:42 | 40K | |
![[ ]](/icons/layout.gif) | 59144_Ross Garage Do..> | 2026-03-25 12:46 | 40K | |
![[ ]](/icons/layout.gif) | 41357_Richard Horspo..> | 2026-02-06 12:12 | 40K | |
![[ ]](/icons/layout.gif) | 44213_Fortress Doors..> | 2026-02-16 14:11 | 40K | |
![[ ]](/icons/layout.gif) | 34215_Proud 2 Fix Ma..> | 2026-01-16 10:19 | 40K | |
![[ ]](/icons/layout.gif) | 54500_Hanney Glazed ..> | 2026-03-13 07:31 | 40K | |
![[ ]](/icons/layout.gif) | 69488_Essex Prestige..> | 2026-04-23 12:11 | 40K | |
![[ ]](/icons/layout.gif) | 50293_Wall Garage Do..> | 2026-03-03 13:03 | 40K | |
![[ ]](/icons/layout.gif) | 54540_ThermoGreen Lt..> | 2026-03-13 07:58 | 40K | |
![[ ]](/icons/layout.gif) | 50003_CWD Improvemen..> | 2026-03-02 17:02 | 40K | |
![[ ]](/icons/layout.gif) | 50168_CWD Improvemen..> | 2026-03-03 09:54 | 40K | |
![[ ]](/icons/layout.gif) | 34431_UK Rollerdoors..> | 2026-01-19 07:50 | 40K | |
![[ ]](/icons/layout.gif) | 35225_Elevate Doors ..> | 2026-01-20 14:26 | 40K | |
![[ ]](/icons/layout.gif) | 46686_Coles Building..> | 2026-02-20 12:38 | 40K | |
![[ ]](/icons/layout.gif) | 45729_Elite Glazing ..> | 2026-02-18 14:26 | 40K | |
![[ ]](/icons/layout.gif) | 50357_Absolute Garag..> | 2026-03-03 14:35 | 40K | |
![[ ]](/icons/layout.gif) | 51616_Rollermatic Ga..> | 2026-03-05 15:12 | 40K | |
![[ ]](/icons/layout.gif) | 48039_Garage Door Re..> | 2026-02-25 09:55 | 40K | |
![[ ]](/icons/layout.gif) | 65847_Fortress Doors..> | 2026-04-14 14:51 | 40K | |
![[ ]](/icons/layout.gif) | 69506_Evans Building..> | 2026-04-23 12:38 | 40K | |
![[ ]](/icons/layout.gif) | 34368_M. A. E. Windo..> | 2026-01-16 15:18 | 40K | |
![[ ]](/icons/layout.gif) | 56979_Alliance Garag..> | 2026-03-19 13:52 | 40K | |
![[ ]](/icons/layout.gif) | 36218_M & S Home Ins..> | 2026-01-22 16:37 | 40K | |
![[ ]](/icons/layout.gif) | 57687_J Brady Garage..> | 2026-03-20 16:59 | 40K | |
![[ ]](/icons/layout.gif) | 70265_S Warrender El..> | 2026-04-24 15:43 | 40K | |
![[ ]](/icons/layout.gif) | 59427_P & R Door Sys..> | 2026-03-26 10:17 | 40K | |
![[ ]](/icons/layout.gif) | 33636_Eclipse Doors ..> | 2026-01-15 10:02 | 40K | |
![[ ]](/icons/layout.gif) | 50292_Wall Garage Do..> | 2026-03-03 13:03 | 40K | |
![[ ]](/icons/layout.gif) | 68807_CWD Improvemen..> | 2026-04-22 07:50 | 40K | |
![[ ]](/icons/layout.gif) | 33935_Ross Garage Do..> | 2026-01-15 15:16 | 40K | |
![[ ]](/icons/layout.gif) | 35226_Elevate Doors ..> | 2026-01-20 14:26 | 40K | |
![[ ]](/icons/layout.gif) | 38699_MW Property Ma..> | 2026-01-30 09:22 | 40K | |
![[ ]](/icons/layout.gif) | 36354_T D Rollerdoor..> | 2026-01-23 10:11 | 40K | |
![[ ]](/icons/layout.gif) | 57808_Roller Doors 2..> | 2026-03-23 09:47 | 40K | |
![[ ]](/icons/layout.gif) | 43624_Ideal Industri..> | 2026-02-13 12:05 | 40K | |
![[ ]](/icons/layout.gif) | 69944_Wanstall Ltd. ..> | 2026-04-24 10:11 | 40K | |
![[ ]](/icons/layout.gif) | 55925_CPS Custom Pro..> | 2026-03-17 14:47 | 40K | |
![[ ]](/icons/layout.gif) | 37728_Excellent Ltd ..> | 2026-01-28 07:11 | 40K | |
![[ ]](/icons/layout.gif) | 37729_Excellent Ltd ..> | 2026-01-28 07:13 | 40K | |
![[ ]](/icons/layout.gif) | 41458_T D Rollerdoor..> | 2026-02-06 15:33 | 40K | |
![[ ]](/icons/layout.gif) | 44108_Ecosse Garage ..> | 2026-02-16 12:01 | 40K | |
![[ ]](/icons/layout.gif) | 48630_Windowcraft De..> | 2026-02-26 14:12 | 40K | |
![[ ]](/icons/layout.gif) | 48636_Windowcraft De..> | 2026-02-26 14:18 | 40K | |
![[ ]](/icons/layout.gif) | 63945_Wall Garage Do..> | 2026-04-09 08:28 | 40K | |
![[ ]](/icons/layout.gif) | 55184_Ross Garage Do..> | 2026-03-16 09:48 | 40K | |
![[ ]](/icons/layout.gif) | 37335_Rhino Windows ..> | 2026-01-27 09:40 | 40K | |
![[ ]](/icons/layout.gif) | 67497_Herts & Essex ..> | 2026-04-20 07:50 | 40K | |
![[ ]](/icons/layout.gif) | 40003_Glenhurst Door..> | 2026-02-03 13:56 | 40K | |
![[ ]](/icons/layout.gif) | 33676_UK Rollerdoors..> | 2026-01-15 10:49 | 40K | |
![[ ]](/icons/layout.gif) | 33470_Alps Home Impr..> | 2026-01-15 08:02 | 40K | |
![[ ]](/icons/layout.gif) | 56603_M. A. E. Windo..> | 2026-03-18 16:53 | 40K | |
![[ ]](/icons/layout.gif) | 60337_CPS Custom Pro..> | 2026-03-27 16:54 | 40K | |
![[ ]](/icons/layout.gif) | 35021_Wessex Industr..> | 2026-01-20 10:10 | 40K | |
![[ ]](/icons/layout.gif) | 61815_Rollermatic Ga..> | 2026-04-01 11:08 | 40K | |
![[ ]](/icons/layout.gif) | 38535_SDS (Isle Of M..> | 2026-01-29 14:31 | 40K | |
![[ ]](/icons/layout.gif) | 69799_Right Choice M..> | 2026-04-24 08:25 | 40K | |
![[ ]](/icons/layout.gif) | 38567_Euroglaze Ryan..> | 2026-01-29 15:41 | 40K | |
![[ ]](/icons/layout.gif) | 42389_Ross Garage Do..> | 2026-02-10 16:07 | 40K | |
![[ ]](/icons/layout.gif) | 67057_UK Rollerdoors..> | 2026-04-17 10:05 | 40K | |
![[ ]](/icons/layout.gif) | 54493_Warnsham Windo..> | 2026-03-13 07:21 | 40K | |
![[ ]](/icons/layout.gif) | 69480_Rolladoor NR9 ..> | 2026-04-23 12:03 | 40K | |
![[ ]](/icons/layout.gif) | 68210_T D Rollerdoor..> | 2026-04-21 08:31 | 40K | |
![[ ]](/icons/layout.gif) | 42933_Roll Right Gar..> | 2026-02-12 09:18 | 40K | |
![[ ]](/icons/layout.gif) | 59434_Clic Garage Do..> | 2026-03-26 10:30 | 40K | |
![[ ]](/icons/layout.gif) | 69759_Field Design A..> | 2026-04-24 07:41 | 40K | |
![[ ]](/icons/layout.gif) | 39767_Garage Door Ma..> | 2026-02-03 10:14 | 40K | |
![[ ]](/icons/layout.gif) | 59063_Warnsham Windo..> | 2026-03-25 11:01 | 40K | |
![[ ]](/icons/layout.gif) | 36764_J Brady Garage..> | 2026-01-26 08:33 | 40K | |
![[ ]](/icons/layout.gif) | 63022_Thomas Andrew ..> | 2026-04-07 13:15 | 40K | |
![[ ]](/icons/layout.gif) | 66417_Bryan Thompson..> | 2026-04-16 07:00 | 40K | |
![[ ]](/icons/layout.gif) | 34162_T D Rollerdoor..> | 2026-01-16 09:23 | 40K | |
![[ ]](/icons/layout.gif) | 48751_Rollermatic Ga..> | 2026-02-26 16:46 | 40K | |
![[ ]](/icons/layout.gif) | 33494_J Brady Garage..> | 2026-01-15 08:33 | 40K | |
![[ ]](/icons/layout.gif) | 57675_T D Rollerdoor..> | 2026-03-20 16:31 | 40K | |
![[ ]](/icons/layout.gif) | 52621_Peter Tomas Co..> | 2026-03-09 13:02 | 40K | |
![[ ]](/icons/layout.gif) | 66843_Jurassic Doors..> | 2026-04-16 14:15 | 40K | |
![[ ]](/icons/layout.gif) | 38301_Garage Door So..> | 2026-01-29 10:34 | 40K | |
![[ ]](/icons/layout.gif) | 40516_Adams Industri..> | 2026-02-04 13:52 | 40K | |
![[ ]](/icons/layout.gif) | 43046_Chelmsford Rol..> | 2026-02-12 11:55 | 40K | |
![[ ]](/icons/layout.gif) | 50687_Ross Garage Do..> | 2026-03-04 09:56 | 40K | |
![[ ]](/icons/layout.gif) | 60237_Simon Piggin P..> | 2026-03-27 14:04 | 40K | |
![[ ]](/icons/layout.gif) | 63554_Ross Garage Do..> | 2026-04-08 12:04 | 40K | |
![[ ]](/icons/layout.gif) | 50676_Southwest Cons..> | 2026-03-04 09:43 | 40K | |
![[ ]](/icons/layout.gif) | 40833_Herts & Essex ..> | 2026-02-05 10:42 | 40K | |
![[ ]](/icons/layout.gif) | 43240_Norfolk Broads..> | 2026-02-12 15:44 | 40K | |
![[ ]](/icons/layout.gif) | 46912_Norfolk Broads..> | 2026-02-20 16:48 | 40K | |
![[ ]](/icons/layout.gif) | 35069_Elevate Doors ..> | 2026-01-20 10:52 | 40K | |
![[ ]](/icons/layout.gif) | 55103_Southern Conse..> | 2026-03-16 08:47 | 40K | |
![[ ]](/icons/layout.gif) | 46688_Coles Building..> | 2026-02-20 12:39 | 40K | |
![[ ]](/icons/layout.gif) | 57816_Roller Doors 2..> | 2026-03-23 09:48 | 40K | |
![[ ]](/icons/layout.gif) | 60072_Somerglaze Win..> | 2026-03-27 11:21 | 40K | |
![[ ]](/icons/layout.gif) | 33925_Oakley Windows..> | 2026-01-15 15:10 | 40K | |
![[ ]](/icons/layout.gif) | 52345_Dream Installa..> | 2026-03-09 08:26 | 40K | |
![[ ]](/icons/layout.gif) | 48557_Elevate Doors ..> | 2026-02-26 12:41 | 40K | |
![[ ]](/icons/layout.gif) | 53781_J Brady Garage..> | 2026-03-11 11:47 | 40K | |
![[ ]](/icons/layout.gif) | 38543_Absolute Garag..> | 2026-01-29 14:38 | 40K | |
![[ ]](/icons/layout.gif) | 57435_R B Installati..> | 2026-03-20 12:05 | 40K | |
![[ ]](/icons/layout.gif) | 63539_The Lothian Ga..> | 2026-04-08 11:25 | 40K | |
![[ ]](/icons/layout.gif) | 66637_The Lothian Ga..> | 2026-04-16 11:38 | 40K | |
![[ ]](/icons/layout.gif) | 68152_All Doors Repa..> | 2026-04-21 07:43 | 40K | |
![[ ]](/icons/layout.gif) | 44326_Garage Door So..> | 2026-02-16 15:48 | 40K | |
![[ ]](/icons/layout.gif) | 35798_St Helens Upvc..> | 2026-01-21 14:31 | 40K | |
![[ ]](/icons/layout.gif) | 39007_Everbright Win..> | 2026-01-30 15:28 | 40K | |
![[ ]](/icons/layout.gif) | 54494_Warnsham Windo..> | 2026-03-13 07:22 | 40K | |
![[ ]](/icons/layout.gif) | 42364_Garage Door So..> | 2026-02-10 15:38 | 40K | |
![[ ]](/icons/layout.gif) | 46048_Roll Right Gar..> | 2026-02-19 11:06 | 40K | |
![[ ]](/icons/layout.gif) | 46254_Bryan Thompson..> | 2026-02-19 15:52 | 40K | |
![[ ]](/icons/layout.gif) | 48555_Elevate Doors ..> | 2026-02-26 12:40 | 40K | |
![[ ]](/icons/layout.gif) | 58468_Profascia Delr..> | 2026-03-24 10:41 | 40K | |
![[ ]](/icons/layout.gif) | 46386_SDS (Isle Of M..> | 2026-02-20 08:21 | 40K | |
![[ ]](/icons/layout.gif) | 63028_Rolladoor NR9 ..> | 2026-04-07 13:17 | 40K | |
![[ ]](/icons/layout.gif) | 65001_Roller Doors 2..> | 2026-04-13 09:53 | 40K | |
![[ ]](/icons/layout.gif) | 58138_Rising Group L..> | 2026-03-23 14:49 | 40K | |
![[ ]](/icons/layout.gif) | 62049_Gilberts Home ..> | 2026-04-02 06:13 | 40K | |
![[ ]](/icons/layout.gif) | 44116_Ecosse Garage ..> | 2026-02-16 12:02 | 40K | |
![[ ]](/icons/layout.gif) | 38331_Garage Door So..> | 2026-01-29 10:43 | 40K | |
![[ ]](/icons/layout.gif) | 62997_Rolladoor NR9 ..> | 2026-04-07 12:55 | 40K | |
![[ ]](/icons/layout.gif) | 33590_Garage Door So..> | 2026-01-15 09:53 | 40K | |
![[ ]](/icons/layout.gif) | 65763_Kris Jones Kri..> | 2026-04-14 13:49 | 40K | |
![[ ]](/icons/layout.gif) | 40305_A Complete Win..> | 2026-02-04 09:20 | 40K | |
![[ ]](/icons/layout.gif) | 64423_Eastern Frames..> | 2026-04-10 08:52 | 40K | |
![[ ]](/icons/layout.gif) | 66321_Adams Industri..> | 2026-04-15 14:22 | 40K | |
![[ ]](/icons/layout.gif) | 66322_Adams Industri..> | 2026-04-15 14:24 | 40K | |
![[ ]](/icons/layout.gif) | 62784_Rollermatic Ga..> | 2026-04-07 10:02 | 40K | |
![[ ]](/icons/layout.gif) | 62322_DP Installatio..> | 2026-04-02 12:11 | 40K | |
![[ ]](/icons/layout.gif) | 57667_Aplas Windows ..> | 2026-03-20 16:25 | 40K | |
![[ ]](/icons/layout.gif) | 36356_T D Rollerdoor..> | 2026-01-23 10:11 | 40K | |
![[ ]](/icons/layout.gif) | 68805_Electricity & ..> | 2026-04-22 07:46 | 40K | |
![[ ]](/icons/layout.gif) | 33916_Oakley Windows..> | 2026-01-15 15:06 | 40K | |
![[ ]](/icons/layout.gif) | 46749_DJM Fork Truck..> | 2026-02-20 14:14 | 40K | |
![[ ]](/icons/layout.gif) | 43520_Warnsham Windo..> | 2026-02-13 09:47 | 40K | |
![[ ]](/icons/layout.gif) | 52748_Rollermatic Ga..> | 2026-03-09 15:17 | 40K | |
![[ ]](/icons/layout.gif) | 56627_Elite Glazing ..> | 2026-03-19 07:48 | 40K | |
![[ ]](/icons/layout.gif) | 63542_The Lothian Ga..> | 2026-04-08 11:26 | 40K | |
![[ ]](/icons/layout.gif) | 33743_Hanney Glazed ..> | 2026-01-15 12:07 | 40K | |
![[ ]](/icons/layout.gif) | 44109_Ecosse Garage ..> | 2026-02-16 12:01 | 40K | |
![[ ]](/icons/layout.gif) | 66089_Ross Garage Do..> | 2026-04-15 09:39 | 40K | |
![[ ]](/icons/layout.gif) | 56635_Elite Glazing ..> | 2026-03-19 07:52 | 40K | |
![[ ]](/icons/layout.gif) | 37518_East Anglia Ro..> | 2026-01-27 12:48 | 40K | |
![[ ]](/icons/layout.gif) | 65926_All Doors Repa..> | 2026-04-15 06:47 | 40K | |
![[ ]](/icons/layout.gif) | 41457_T D Rollerdoor..> | 2026-02-06 15:32 | 40K | |
![[ ]](/icons/layout.gif) | 38328_Garage Door So..> | 2026-01-29 10:42 | 40K | |
![[ ]](/icons/layout.gif) | 33578_Garage Door So..> | 2026-01-15 09:51 | 40K | |
![[ ]](/icons/layout.gif) | 35231_Eastern Frames..> | 2026-01-20 14:28 | 40K | |
![[ ]](/icons/layout.gif) | 57819_Roller Doors 2..> | 2026-03-23 09:49 | 40K | |
![[ ]](/icons/layout.gif) | 56793_Norfolk Doors ..> | 2026-03-19 10:42 | 40K | |
![[ ]](/icons/layout.gif) | 57336_Roller Doors 2..> | 2026-03-20 10:18 | 40K | |
![[ ]](/icons/layout.gif) | 44330_Garage Door So..> | 2026-02-16 15:49 | 40K | |
![[ ]](/icons/layout.gif) | 53417_J Brady Garage..> | 2026-03-10 15:29 | 40K | |
![[ ]](/icons/layout.gif) | 42981_Garage Door So..> | 2026-02-12 10:45 | 40K | |
![[ ]](/icons/layout.gif) | 57812_Roller Doors 2..> | 2026-03-23 09:47 | 40K | |
![[ ]](/icons/layout.gif) | 62261_Garage Door So..> | 2026-04-02 10:24 | 40K | |
![[ ]](/icons/layout.gif) | 61063_Profascia Delr..> | 2026-03-31 10:10 | 40K | |
![[ ]](/icons/layout.gif) | 46855_DJM Fork Truck..> | 2026-02-20 15:01 | 40K | |
![[ ]](/icons/layout.gif) | 50281_Clic Garage Do..> | 2026-03-03 12:20 | 40K | |
![[ ]](/icons/layout.gif) | 33919_Oakley Windows..> | 2026-01-15 15:07 | 40K | |
![[ ]](/icons/layout.gif) | 33920_Oakley Windows..> | 2026-01-15 15:07 | 40K | |
![[ ]](/icons/layout.gif) | 56620_East Anglia Ro..> | 2026-03-19 07:35 | 40K | |
![[ ]](/icons/layout.gif) | 39834_Clic Garage Do..> | 2026-02-03 11:11 | 40K | |
![[ ]](/icons/layout.gif) | 57872_Able Crane Ser..> | 2026-03-23 10:32 | 40K | |
![[ ]](/icons/layout.gif) | 43495_Gilberts Home ..> | 2026-02-13 09:29 | 40K | |
![[ ]](/icons/layout.gif) | 33917_Oakley Windows..> | 2026-01-15 15:06 | 40K | |
![[ ]](/icons/layout.gif) | 55025_Mead Property ..> | 2026-03-13 16:03 | 40K | |
![[ ]](/icons/layout.gif) | 61588_Go Direct Door..> | 2026-04-01 07:17 | 40K | |
![[ ]](/icons/layout.gif) | 66220_Secure Entranc..> | 2026-04-15 11:34 | 40K | |
![[ ]](/icons/layout.gif) | 37467_Fortress Doors..> | 2026-01-27 12:00 | 40K | |
![[ ]](/icons/layout.gif) | 41024_South Atlantic..> | 2026-02-05 14:22 | 40K | |
![[ ]](/icons/layout.gif) | 61592_Go Direct Door..> | 2026-04-01 07:20 | 40K | |
![[ ]](/icons/layout.gif) | 61922_Go Direct Door..> | 2026-04-01 12:55 | 40K | |
![[ ]](/icons/layout.gif) | 43047_Elevate Doors ..> | 2026-02-12 11:55 | 40K | |
![[ ]](/icons/layout.gif) | 65174_J Brady Garage..> | 2026-04-13 12:55 | 40K | |
![[ ]](/icons/layout.gif) | 62139_Go Direct Door..> | 2026-04-02 07:42 | 40K | |
![[ ]](/icons/layout.gif) | 62023_Go Direct Door..> | 2026-04-01 15:47 | 40K | |
![[ ]](/icons/layout.gif) | 62084_Go Direct Door..> | 2026-04-02 07:13 | 40K | |
![[ ]](/icons/layout.gif) | 62022_Avon Automated..> | 2026-04-01 15:41 | 40K | |
![[ ]](/icons/layout.gif) | 53782_J Brady Garage..> | 2026-03-11 11:48 | 40K | |
![[ ]](/icons/layout.gif) | 56600_J Brady Garage..> | 2026-03-18 16:51 | 40K | |
![[ ]](/icons/layout.gif) | 43551_Rollermatic Ga..> | 2026-02-13 10:29 | 40K | |
![[ ]](/icons/layout.gif) | 45671_Avon Automated..> | 2026-02-18 13:57 | 40K | |
![[ ]](/icons/layout.gif) | 50724_Roche Commerci..> | 2026-03-04 10:36 | 40K | |
![[ ]](/icons/layout.gif) | 39008_Everbright Win..> | 2026-01-30 15:28 | 40K | |
![[ ]](/icons/layout.gif) | 62258_Hadrian Joiner..> | 2026-04-02 10:20 | 40K | |
![[ ]](/icons/layout.gif) | 38536_SDS (Isle Of M..> | 2026-01-29 14:31 | 40K | |
![[ ]](/icons/layout.gif) | 40954_UK Rollerdoors..> | 2026-02-05 13:03 | 40K | |
![[ ]](/icons/layout.gif) | 54496_Warnsham Windo..> | 2026-03-13 07:24 | 40K | |
![[ ]](/icons/layout.gif) | 60953_Oakley Windows..> | 2026-03-31 08:39 | 40K | |
![[ ]](/icons/layout.gif) | 41678_Keith Worboys ..> | 2026-02-09 12:29 | 40K | |
![[ ]](/icons/layout.gif) | 59756_Rollermatic Ga..> | 2026-03-26 15:38 | 40K | |
![[ ]](/icons/layout.gif) | 33886_Norfolk Broads..> | 2026-01-15 14:53 | 40K | |
![[ ]](/icons/layout.gif) | 33892_Norfolk Broads..> | 2026-01-15 14:57 | 40K | |
![[ ]](/icons/layout.gif) | 66993_T D Rollerdoor..> | 2026-04-17 08:59 | 40K | |
![[ ]](/icons/layout.gif) | 50201_Danbury Garage..> | 2026-03-03 11:14 | 40K | |
![[ ]](/icons/layout.gif) | 36107_Garage Door Ma..> | 2026-01-22 12:18 | 40K | |
![[ ]](/icons/layout.gif) | 48526_Oakley Windows..> | 2026-02-26 12:07 | 40K | |
![[ ]](/icons/layout.gif) | 48532_NTRAP NR11 7NZ..> | 2026-02-26 12:29 | 40K | |
![[ ]](/icons/layout.gif) | 40210_Haines Homes C..> | 2026-02-03 16:51 | 40K | |
![[ ]](/icons/layout.gif) | 46747_DJM Fork Truck..> | 2026-02-20 14:11 | 40K | |
![[ ]](/icons/layout.gif) | 41345_South Atlantic..> | 2026-02-06 11:55 | 40K | |
![[ ]](/icons/layout.gif) | 36535_NW Automatic D..> | 2026-01-23 12:35 | 40K | |
![[ ]](/icons/layout.gif) | 38028_Wokingham Glaz..> | 2026-01-28 13:58 | 40K | |
![[ ]](/icons/layout.gif) | 33890_Norfolk Broads..> | 2026-01-15 14:56 | 40K | |
![[ ]](/icons/layout.gif) | 35924_Avon Automated..> | 2026-01-22 09:15 | 40K | |
![[ ]](/icons/layout.gif) | 37932_The Window And..> | 2026-01-28 12:38 | 40K | |
![[ ]](/icons/layout.gif) | 55634_Garage Door Au..> | 2026-03-17 08:34 | 40K | |
![[ ]](/icons/layout.gif) | 48378_Cromer Garage ..> | 2026-02-26 10:33 | 40K | |
![[ ]](/icons/layout.gif) | 52274_Ideal Industri..> | 2026-03-06 16:41 | 40K | |
![[ ]](/icons/layout.gif) | 40046_Norfolk Broads..> | 2026-02-03 14:57 | 40K | |
![[ ]](/icons/layout.gif) | 40047_Norfolk Broads..> | 2026-02-03 14:58 | 40K | |
![[ ]](/icons/layout.gif) | 52894_DJM Fork Truck..> | 2026-03-09 16:56 | 40K | |
![[ ]](/icons/layout.gif) | 33733_Ross Garage Do..> | 2026-01-15 11:58 | 40K | |
![[ ]](/icons/layout.gif) | 39133_Avon Automated..> | 2026-02-02 09:27 | 40K | |
![[ ]](/icons/layout.gif) | 47010_SDS (Isle Of M..> | 2026-02-23 10:35 | 40K | |
![[ ]](/icons/layout.gif) | 58512_The Lothian Ga..> | 2026-03-24 12:21 | 40K | |
![[ ]](/icons/layout.gif) | 62474_Ideal Industri..> | 2026-04-02 14:19 | 40K | |
![[ ]](/icons/layout.gif) | 36109_Garage Door Ma..> | 2026-01-22 12:20 | 40K | |
![[ ]](/icons/layout.gif) | 61604_Ideal Industri..> | 2026-04-01 07:29 | 40K | |
![[ ]](/icons/layout.gif) | 35094_Elevate Doors ..> | 2026-01-20 11:14 | 40K | |
![[ ]](/icons/layout.gif) | 69843_The Lothian Ga..> | 2026-04-24 08:47 | 40K | |
![[ ]](/icons/layout.gif) | 36628_NW Automatic D..> | 2026-01-23 14:16 | 40K | |
![[ ]](/icons/layout.gif) | 36536_NW Automatic D..> | 2026-01-23 12:36 | 40K | |
![[ ]](/icons/layout.gif) | 38029_Wokingham Glaz..> | 2026-01-28 13:58 | 40K | |
![[ ]](/icons/layout.gif) | 36110_Garage Door Ma..> | 2026-01-22 12:20 | 40K | |
![[ ]](/icons/layout.gif) | 56553_The Lothian Ga..> | 2026-03-18 15:44 | 40K | |
![[ ]](/icons/layout.gif) | 69607_Hanney Glazed ..> | 2026-04-23 14:37 | 40K | |
![[ ]](/icons/layout.gif) | 33465_Prestige Windo..> | 2026-01-15 07:42 | 40K | |
![[ ]](/icons/layout.gif) | 38527_Avon Automated..> | 2026-01-29 14:23 | 40K | |
![[ ]](/icons/layout.gif) | 39147_SW Trade Frame..> | 2026-02-02 09:52 | 40K | |
![[ ]](/icons/layout.gif) | 63320_Hanney Glazed ..> | 2026-04-08 07:40 | 40K | |
![[ ]](/icons/layout.gif) | 34568_Harry Curtis -..> | 2026-01-19 10:47 | 40K | |
![[ ]](/icons/layout.gif) | 54529_The Lothian Ga..> | 2026-03-13 07:53 | 40K | |
![[ ]](/icons/layout.gif) | 35432_Eden Propertie..> | 2026-01-21 07:25 | 40K | |
![[ ]](/icons/layout.gif) | 49710_The Garage Doo..> | 2026-03-02 12:44 | 40K | |
![[ ]](/icons/layout.gif) | 49715_The Garage Doo..> | 2026-03-02 13:07 | 40K | |
![[ ]](/icons/layout.gif) | 43058_Elevate Doors ..> | 2026-02-12 12:03 | 41K | |
![[ ]](/icons/layout.gif) | 35452_The Lothian Ga..> | 2026-01-21 07:59 | 41K | |
![[ ]](/icons/layout.gif) | 47935_Doors 4 You Lt..> | 2026-02-25 08:32 | 41K | |
![[ ]](/icons/layout.gif) | 64625_The Lothian Ga..> | 2026-04-10 12:52 | 41K | |
![[ ]](/icons/layout.gif) | 68276_Fortress Doors..> | 2026-04-21 09:42 | 41K | |
![[ ]](/icons/layout.gif) | 42000_Keith Worboys ..> | 2026-02-10 08:08 | 41K | |
![[ ]](/icons/layout.gif) | 6201_M Scott - Viney..> | 2025-10-20 12:45 | 41K | |
![[ ]](/icons/layout.gif) | 59195_Fortress Doors..> | 2026-03-25 13:39 | 41K | |
![[ ]](/icons/layout.gif) | 38555_Starlite Home ..> | 2026-01-29 15:08 | 42K | |
![[ ]](/icons/layout.gif) | 56431_Starlite Home ..> | 2026-03-18 13:17 | 42K | |
![[ ]](/icons/layout.gif) | 49414_SDS (Isle Of M..> | 2026-03-02 08:48 | 42K | |
![[ ]](/icons/layout.gif) | 64325_SDS (Isle Of M..> | 2026-04-10 07:55 | 42K | |
![[ ]](/icons/layout.gif) | 43473_East Anglia Ro..> | 2026-02-13 09:15 | 42K | |
![[ ]](/icons/layout.gif) | 48553_Elevate Doors ..> | 2026-02-26 12:39 | 42K | |
![[ ]](/icons/layout.gif) | 35000_Elevate Doors ..> | 2026-01-20 09:51 | 42K | |
![[ ]](/icons/layout.gif) | 35227_Elevate Doors ..> | 2026-01-20 14:27 | 42K | |
![[ ]](/icons/layout.gif) | 69788_Elevate Doors ..> | 2026-04-24 08:15 | 42K | |
![[ ]](/icons/layout.gif) | 37723_Excellent Ltd ..> | 2026-01-28 07:09 | 42K | |
![[ ]](/icons/layout.gif) | 6608_M Scott - Viney..> | 2025-10-21 14:39 | 42K | |
![[ ]](/icons/layout.gif) | 6287_M Scott - Viney..> | 2025-10-20 13:47 | 42K | |
![[ ]](/icons/layout.gif) | 69785_Elevate Doors ..> | 2026-04-24 08:14 | 43K | |
![[ ]](/icons/layout.gif) | 54426_Grafton Ventur..> | 2026-03-12 16:16 | 43K | |
![[ ]](/icons/layout.gif) | 54462_Grafton Ventur..> | 2026-03-12 16:37 | 43K | |
![[ ]](/icons/layout.gif) | 10808_James Wilde - ..> | 2025-11-03 12:42 | 44K | |
![[ ]](/icons/layout.gif) | 5445_John Easton - E..> | 2025-10-16 13:02 | 44K | |
![[ ]](/icons/layout.gif) | 1276_Bobby Wright - ..> | 2025-09-29 13:42 | 44K | |
![[ ]](/icons/layout.gif) | 3219_John Neale - NE..> | 2025-10-08 15:29 | 44K | |
![[ ]](/icons/layout.gif) | 1644_Ian Ross Ross -..> | 2025-10-01 14:46 | 44K | |
![[ ]](/icons/layout.gif) | 689_Nature's Design ..> | 2025-09-24 09:02 | 44K | |
![[ ]](/icons/layout.gif) | 4506_Oscar Okoronta ..> | 2025-10-14 10:05 | 44K | |
![[ ]](/icons/layout.gif) | 4724_Ian Lamonby - L..> | 2025-10-14 13:54 | 44K | |
![[ ]](/icons/layout.gif) | 6355_Tobias Cripps -..> | 2025-10-20 14:34 | 44K | |
![[ ]](/icons/layout.gif) | 9676_Copper Jax Jami..> | 2025-10-30 10:02 | 44K | |
![[ ]](/icons/layout.gif) | 873_Nature's Design ..> | 2025-09-25 12:15 | 44K | |
![[ ]](/icons/layout.gif) | 11483_Julian Dick - ..> | 2025-11-04 15:42 | 44K | |
![[ ]](/icons/layout.gif) | 554_Ian Smith - SMIT..> | 2025-09-23 11:51 | 44K | |
![[ ]](/icons/layout.gif) | 14573_Adam Reed - RE..> | 2025-11-12 12:57 | 44K | |
![[ ]](/icons/layout.gif) | 633_Ian Smith - SMIT..> | 2025-09-24 05:32 | 44K | |
![[ ]](/icons/layout.gif) | 8058_Martin Layfield..> | 2025-10-24 13:51 | 44K | |
![[ ]](/icons/layout.gif) | 8024_Martin Snell - ..> | 2025-10-24 12:56 | 44K | |
![[ ]](/icons/layout.gif) | 811_Gary Reynolds - ..> | 2025-09-25 06:52 | 44K | |
![[ ]](/icons/layout.gif) | 835_Gary Reynolds - ..> | 2025-09-25 09:10 | 44K | |
![[ ]](/icons/layout.gif) | 819_Flavio Arruda - ..> | 2025-09-25 07:57 | 44K | |
![[ ]](/icons/layout.gif) | 606_Josh MacDonald -..> | 2025-09-23 15:15 | 44K | |
![[ ]](/icons/layout.gif) | 1065_Adrian Jackson ..> | 2025-09-26 13:08 | 44K | |
![[ ]](/icons/layout.gif) | 887_Neil Ward - WARD..> | 2025-09-25 13:11 | 44K | |
![[ ]](/icons/layout.gif) | 10451_Barbara Ebanks..> | 2025-11-03 08:21 | 44K | |
![[ ]](/icons/layout.gif) | 3449_Anton Mirosnits..> | 2025-10-09 10:59 | 44K | |
![[ ]](/icons/layout.gif) | 8071_Trevor Thirwell..> | 2025-10-24 14:06 | 44K | |
![[ ]](/icons/layout.gif) | 562_Steve Hubbard - ..> | 2025-09-23 12:03 | 44K | |
![[ ]](/icons/layout.gif) | 8980_Bart Bart Garde..> | 2025-10-28 14:16 | 44K | |
![[ ]](/icons/layout.gif) | 10150_Mark Budden - ..> | 2025-10-31 10:11 | 44K | |
![[ ]](/icons/layout.gif) | 14608_Adam Reed - RE..> | 2025-11-12 13:44 | 44K | |
![[ ]](/icons/layout.gif) | 557_Stuart Challinor..> | 2025-09-23 11:56 | 44K | |
![[ ]](/icons/layout.gif) | 2283_Deri Evans - EV..> | 2025-10-06 10:38 | 44K | |
![[ ]](/icons/layout.gif) | 3374_William Radford..> | 2025-10-09 09:11 | 44K | |
![[ ]](/icons/layout.gif) | 7164_Gary Ungless - ..> | 2025-10-22 16:01 | 44K | |
![[ ]](/icons/layout.gif) | 9467_Jonathan Mills ..> | 2025-10-29 14:55 | 44K | |
![[ ]](/icons/layout.gif) | 9972_Linda Gett - GE..> | 2025-10-30 16:29 | 44K | |
![[ ]](/icons/layout.gif) | 2527_David Price - P..> | 2025-10-06 16:08 | 44K | |
![[ ]](/icons/layout.gif) | 14797_Sean Gilfillan..> | 2025-11-13 09:11 | 44K | |
![[ ]](/icons/layout.gif) | 843_Bob Ewins - EWIN..> | 2025-09-25 09:51 | 44K | |
![[ ]](/icons/layout.gif) | 1060_Alex Hope - HOP..> | 2025-09-26 13:06 | 44K | |
![[ ]](/icons/layout.gif) | 7912_Ian Smith - SMI..> | 2025-10-24 11:03 | 44K | |
![[ ]](/icons/layout.gif) | 9076_Matt Head - HEA..> | 2025-10-28 15:36 | 44K | |
![[ ]](/icons/layout.gif) | 101_Karen Price - PR..> | 2025-09-17 09:19 | 44K | |
![[ ]](/icons/layout.gif) | 1228_B - B0000001 - ..> | 2025-09-29 11:22 | 44K | |
![[ ]](/icons/layout.gif) | 2237_Tahmid Kamal - ..> | 2025-10-06 08:42 | 44K | |
![[ ]](/icons/layout.gif) | 2166_Jon Taylor - ....> | 2025-10-03 14:23 | 44K | |
![[ ]](/icons/layout.gif) | 1446_David Ball - BA..> | 2025-09-30 14:20 | 44K | |
![[ ]](/icons/layout.gif) | 5899_Oakley Bates - ..> | 2025-10-17 12:37 | 44K | |
![[ ]](/icons/layout.gif) | 7752_Jean-Michel Can..> | 2025-10-24 08:13 | 44K | |
![[ ]](/icons/layout.gif) | 9494_Martin Layfield..> | 2025-10-29 15:42 | 44K | |
![[ ]](/icons/layout.gif) | 1116_John Nicholson ..> | 2025-09-26 16:18 | 44K | |
![[ ]](/icons/layout.gif) | 891_Greig Matthewson..> | 2025-09-25 13:13 | 44K | |
![[ ]](/icons/layout.gif) | 2697_Andrew Hodges -..> | 2025-10-07 10:43 | 44K | |
![[ ]](/icons/layout.gif) | 1225_Alan Davis - DA..> | 2025-09-29 11:17 | 44K | |
![[ ]](/icons/layout.gif) | 6971_David Ball - BA..> | 2025-10-22 12:42 | 44K | |
![[ ]](/icons/layout.gif) | 9930_Robert Bak - BA..> | 2025-10-30 15:29 | 44K | |
![[ ]](/icons/layout.gif) | 10815_James Irons - ..> | 2025-11-03 12:51 | 44K | |
![[ ]](/icons/layout.gif) | 2181_Mick Maye - MAY..> | 2025-10-03 14:41 | 44K | |
![[ ]](/icons/layout.gif) | 3521_Simon Absalom -..> | 2025-10-09 12:31 | 44K | |
![[ ]](/icons/layout.gif) | 5945_Sean Kiely - KS..> | 2025-10-17 13:50 | 44K | |
![[ ]](/icons/layout.gif) | 10319_Robert Bak - B..> | 2025-10-31 12:16 | 44K | |
![[ ]](/icons/layout.gif) | 9955_Jonathan Mills ..> | 2025-10-30 16:13 | 44K | |
![[ ]](/icons/layout.gif) | 7900_Gerald McIntyre..> | 2025-10-24 10:24 | 44K | |
![[ ]](/icons/layout.gif) | 8220_Trevor Thirwell..> | 2025-10-27 10:02 | 44K | |
![[ ]](/icons/layout.gif) | 11111_Barbara Ebanks..> | 2025-11-04 08:52 | 44K | |
![[ ]](/icons/layout.gif) | 1907_Gordon Knight -..> | 2025-10-02 15:41 | 44K | |
![[ ]](/icons/layout.gif) | 5800_Ricky Foulgar -..> | 2025-10-17 10:24 | 44K | |
![[ ]](/icons/layout.gif) | 3470_Vincent Cross -..> | 2025-10-09 11:44 | 44K | |
![[ ]](/icons/layout.gif) | 7588_Adrian Jackson ..> | 2025-10-23 14:11 | 44K | |
![[ ]](/icons/layout.gif) | 4386_Simeon Lloyd - ..> | 2025-10-13 15:07 | 44K | |
![[ ]](/icons/layout.gif) | 10395_Mark Budden - ..> | 2025-10-31 14:46 | 44K | |
![[ ]](/icons/layout.gif) | 11016_Michael Rogers..> | 2025-11-03 16:14 | 44K | |
![[ ]](/icons/layout.gif) | 940_James Radford - ..> | 2025-09-25 15:31 | 44K | |
![[ ]](/icons/layout.gif) | 2209_Greg Brett - BR..> | 2025-10-06 07:19 | 44K | |
![[ ]](/icons/layout.gif) | 8997_WJM Cars Willia..> | 2025-10-28 14:21 | 44K | |
![[ ]](/icons/layout.gif) | 4211_Elaine Hurley -..> | 2025-10-13 11:22 | 44K | |
![[ ]](/icons/layout.gif) | 6057_Antony Tilston ..> | 2025-10-20 08:21 | 44K | |
![[ ]](/icons/layout.gif) | 672_Pardeep Chahal -..> | 2025-09-24 08:07 | 44K | |
![[ ]](/icons/layout.gif) | 2678_Javeed Sandia -..> | 2025-10-07 10:05 | 44K | |
![[ ]](/icons/layout.gif) | 7224_Joshua Mossop -..> | 2025-10-23 08:53 | 44K | |
![[ ]](/icons/layout.gif) | 945_David Kirby - KI..> | 2025-09-25 15:50 | 44K | |
![[ ]](/icons/layout.gif) | 2541_Neil Plumridge ..> | 2025-10-06 16:29 | 44K | |
![[ ]](/icons/layout.gif) | 5281_Robert Vinney -..> | 2025-10-16 09:56 | 44K | |
![[ ]](/icons/layout.gif) | 9873_Andrew Boylett ..> | 2025-10-30 14:24 | 44K | |
![[ ]](/icons/layout.gif) | 10703_Matt Head - HE..> | 2025-11-03 11:12 | 44K | |
![[ ]](/icons/layout.gif) | 3399_Gareth Shepherd..> | 2025-10-09 09:36 | 44K | |
![[ ]](/icons/layout.gif) | 10407_Knowles Brothe..> | 2025-10-31 15:29 | 44K | |
![[ ]](/icons/layout.gif) | 11826_Ian Davies - D..> | 2025-11-05 11:33 | 44K | |
![[ ]](/icons/layout.gif) | 4158_Anton Mirosnits..> | 2025-10-13 10:43 | 44K | |
![[ ]](/icons/layout.gif) | 4969_Elliott Mills -..> | 2025-10-15 12:39 | 44K | |
![[ ]](/icons/layout.gif) | 5010_Mark Shaw - SHA..> | 2025-10-15 13:28 | 44K | |
![[ ]](/icons/layout.gif) | 12732_Colin Barrow -..> | 2025-11-07 10:37 | 44K | |
![[ ]](/icons/layout.gif) | 2545_Nikki Sabatini ..> | 2025-10-06 16:34 | 44K | |
![[ ]](/icons/layout.gif) | 3511_Suddon - SUDD00..> | 2025-10-09 12:22 | 44K | |
![[ ]](/icons/layout.gif) | 5393_Andy Beresford ..> | 2025-10-16 12:16 | 44K | |
![[ ]](/icons/layout.gif) | 1772_Michael Rogers ..> | 2025-10-02 10:32 | 44K | |
![[ ]](/icons/layout.gif) | 5372_Andy Knowles - ..> | 2025-10-16 12:03 | 44K | |
![[ ]](/icons/layout.gif) | 4917_Simon Barker - ..> | 2025-10-15 11:05 | 44K | |
![[ ]](/icons/layout.gif) | 5417_Paul Withers - ..> | 2025-10-16 12:41 | 44K | |
![[ ]](/icons/layout.gif) | 5409_Christina Beame..> | 2025-10-16 12:22 | 44K | |
![[ ]](/icons/layout.gif) | 8927_Paul Busby Paul..> | 2025-10-28 12:25 | 44K | |
![[ ]](/icons/layout.gif) | 3605_Peter Gilbery -..> | 2025-10-09 14:41 | 44K | |
![[ ]](/icons/layout.gif) | 4372_Mary Eim - EIMM..> | 2025-10-13 14:56 | 44K | |
![[ ]](/icons/layout.gif) | 2153_Lewis Davison -..> | 2025-10-03 13:44 | 44K | |
![[ ]](/icons/layout.gif) | 7791_Karen Price - P..> | 2025-10-24 08:53 | 44K | |
![[ ]](/icons/layout.gif) | 7800_Karen Price - P..> | 2025-10-24 08:55 | 44K | |
![[ ]](/icons/layout.gif) | 8847_Paul Busby Paul..> | 2025-10-28 11:13 | 44K | |
![[ ]](/icons/layout.gif) | 2362_Samuel Hockaday..> | 2025-10-06 11:56 | 44K | |
![[ ]](/icons/layout.gif) | 3585_Jakub Samp - SA..> | 2025-10-09 13:56 | 44K | |
![[ ]](/icons/layout.gif) | 9521_Joshua Mossop -..> | 2025-10-29 16:11 | 44K | |
![[ ]](/icons/layout.gif) | 11733_Kevin Grosveno..> | 2025-11-05 10:42 | 44K | |
![[ ]](/icons/layout.gif) | 2263_Nigel Bramley -..> | 2025-10-06 10:01 | 44K | |
![[ ]](/icons/layout.gif) | 3538_Carl Carnell - ..> | 2025-10-09 12:48 | 44K | |
![[ ]](/icons/layout.gif) | 3549_Carl Carnell - ..> | 2025-10-09 13:07 | 44K | |
![[ ]](/icons/layout.gif) | 12720_Gareth Shepher..> | 2025-11-07 10:09 | 44K | |
![[ ]](/icons/layout.gif) | 14118_Paul Leo - ORD..> | 2025-11-11 16:23 | 44K | |
![[ ]](/icons/layout.gif) | 7332_Trevor Dousfiel..> | 2025-10-23 11:08 | 44K | |
![[ ]](/icons/layout.gif) | 12721_Drinkwater - D..> | 2025-11-07 10:13 | 44K | |
![[ ]](/icons/layout.gif) | 4218_Kaz Suleman - S..> | 2025-10-13 11:30 | 44K | |
![[ ]](/icons/layout.gif) | 7867_Colin Sweeney -..> | 2025-10-24 09:23 | 44K | |
![[ ]](/icons/layout.gif) | 7964_LT Carpentry Le..> | 2025-10-24 12:07 | 44K | |
![[ ]](/icons/layout.gif) | 3560_William Radford..> | 2025-10-09 13:18 | 44K | |
![[ ]](/icons/layout.gif) | 832_TJS Maintenance ..> | 2025-09-25 08:31 | 44K | |
![[ ]](/icons/layout.gif) | 5427_Rafael Fernande..> | 2025-10-16 12:50 | 44K | |
![[ ]](/icons/layout.gif) | 13429_Darren Thompso..> | 2025-11-10 16:11 | 44K | |
![[ ]](/icons/layout.gif) | 9989_Derek Wright - ..> | 2025-10-30 16:58 | 44K | |
![[ ]](/icons/layout.gif) | 5149_PlumbRight Dave..> | 2025-10-15 15:55 | 44K | |
![[ ]](/icons/layout.gif) | 6785_Jay Dale - Jay ..> | 2025-10-22 08:35 | 44K | |
![[ ]](/icons/layout.gif) | 10039_Damien Lobb - ..> | 2025-10-31 08:20 | 44K | |
![[ ]](/icons/layout.gif) | 1940_David Jenkinson..> | 2025-10-03 07:47 | 44K | |
![[ ]](/icons/layout.gif) | 12936_Mark Warner - ..> | 2025-11-10 07:07 | 44K | |
![[ ]](/icons/layout.gif) | 10452_Barbara Ebanks..> | 2025-11-03 08:21 | 44K | |
![[ ]](/icons/layout.gif) | 12209_Nigel Bramley ..> | 2025-11-06 09:57 | 44K | |
![[ ]](/icons/layout.gif) | 12765_Ken Ingram - I..> | 2025-11-07 11:23 | 44K | |
![[ ]](/icons/layout.gif) | 1585_Edmund Walaszek..> | 2025-10-01 10:35 | 44K | |
![[ ]](/icons/layout.gif) | 4979_Sam Pitchford -..> | 2025-10-15 12:46 | 44K | |
![[ ]](/icons/layout.gif) | 1936_Drinkwater - DR..> | 2025-10-03 07:41 | 44K | |
![[ ]](/icons/layout.gif) | 7690_TJS Maintenance..> | 2025-10-24 07:12 | 44K | |
![[ ]](/icons/layout.gif) | 4999_Stephen Haygart..> | 2025-10-15 13:08 | 44K | |
![[ ]](/icons/layout.gif) | 6097_Stephen Haygart..> | 2025-10-20 09:05 | 44K | |
![[ ]](/icons/layout.gif) | 2255_James Macmorlan..> | 2025-10-06 09:39 | 44K | |
![[ ]](/icons/layout.gif) | 4814_David Heckford ..> | 2025-10-15 07:51 | 44K | |
![[ ]](/icons/layout.gif) | 9961_J Hallam Buildi..> | 2025-10-30 16:17 | 44K | |
![[ ]](/icons/layout.gif) | 3810_Ken Ingram - IN..> | 2025-10-10 11:21 | 44K | |
![[ ]](/icons/layout.gif) | 10445_Knowles Brothe..> | 2025-11-03 08:08 | 44K | |
![[ ]](/icons/layout.gif) | 14800_Sean Gilfillan..> | 2025-11-13 09:11 | 44K | |
![[ ]](/icons/layout.gif) | 5993_Neil Patching -..> | 2025-10-17 15:05 | 44K | |
![[ ]](/icons/layout.gif) | 11716_Daniel Jackson..> | 2025-11-05 10:22 | 44K | |
![[ ]](/icons/layout.gif) | 322_A J Cope Builder..> | 2025-09-19 14:03 | 44K | |
![[ ]](/icons/layout.gif) | 4993_Adrian Michael ..> | 2025-10-15 13:03 | 44K | |
![[ ]](/icons/layout.gif) | 2049_Dilwyn Morgan -..> | 2025-10-03 12:06 | 44K | |
![[ ]](/icons/layout.gif) | 7745_Ian Callagham I..> | 2025-10-24 08:05 | 44K | |
![[ ]](/icons/layout.gif) | 3660_Simon Knight - ..> | 2025-10-09 20:45 | 44K | |
![[ ]](/icons/layout.gif) | 5893_Elegant Windows..> | 2025-10-17 12:29 | 44K | |
![[ ]](/icons/layout.gif) | 3234_Daniel Jackson ..> | 2025-10-08 16:13 | 44K | |
![[ ]](/icons/layout.gif) | 2219_David Bracken -..> | 2025-10-06 07:59 | 44K | |
![[ ]](/icons/layout.gif) | 3610_Simon Knight - ..> | 2025-10-09 14:52 | 44K | |
![[ ]](/icons/layout.gif) | 4638_Stephen McDermo..> | 2025-10-14 13:05 | 44K | |
![[ ]](/icons/layout.gif) | 8298_Dad Property Ma..> | 2025-10-27 11:31 | 44K | |
![[ ]](/icons/layout.gif) | 11512_Martyn Cox - M..> | 2025-11-04 16:25 | 44K | |
![[ ]](/icons/layout.gif) | 12418_Martyn Cox - M..> | 2025-11-06 13:15 | 44K | |
![[ ]](/icons/layout.gif) | 12424_Martyn Cox - M..> | 2025-11-06 13:17 | 44K | |
![[ ]](/icons/layout.gif) | 3022_Daniel Jackson ..> | 2025-10-08 10:13 | 44K | |
![[ ]](/icons/layout.gif) | 2157_Martin Meechan ..> | 2025-10-03 13:53 | 44K | |
![[ ]](/icons/layout.gif) | 5888_Geoff Holloway ..> | 2025-10-17 12:17 | 44K | |
![[ ]](/icons/layout.gif) | 4960_Ralph English -..> | 2025-10-15 12:28 | 44K | |
![[ ]](/icons/layout.gif) | 4962_Ralph English -..> | 2025-10-15 12:30 | 44K | |
![[ ]](/icons/layout.gif) | 4396_Stephen Fairbro..> | 2025-10-13 15:24 | 44K | |
![[ ]](/icons/layout.gif) | 12762_David Bracken ..> | 2025-11-07 11:00 | 44K | |
![[ ]](/icons/layout.gif) | 5870_All Aspects Con..> | 2025-10-17 11:58 | 44K | |
![[ ]](/icons/layout.gif) | 2943_David Read - Dw..> | 2025-10-08 09:06 | 44K | |
![[ ]](/icons/layout.gif) | 3780_[0,0] Peter Urq..> | 2025-10-10 10:47 | 44K | |
![[ ]](/icons/layout.gif) | 6714_Ebtech Engineer..> | 2025-10-22 07:05 | 44K | |
![[ ]](/icons/layout.gif) | 7818_A J Cope Builde..> | 2025-10-24 09:02 | 44K | |
![[ ]](/icons/layout.gif) | 2580_Mark Riggal Ele..> | 2025-10-07 08:23 | 44K | |
![[ ]](/icons/layout.gif) | 5440_Harley Lorence ..> | 2025-10-16 13:00 | 44K | |
![[ ]](/icons/layout.gif) | 5827_Harley Lorence ..> | 2025-10-17 11:00 | 44K | |
![[ ]](/icons/layout.gif) | 14131_Hunn Security ..> | 2025-11-11 16:40 | 44K | |
![[ ]](/icons/layout.gif) | 12184_Highgrove Cons..> | 2025-11-06 09:47 | 44K | |
![[ ]](/icons/layout.gif) | 14564_Glynn Banks - ..> | 2025-11-12 12:30 | 44K | |
![[ ]](/icons/layout.gif) | 682_Neil McDonald - ..> | 2025-09-24 08:36 | 45K | |
![[ ]](/icons/layout.gif) | 833_Neil McDonald - ..> | 2025-09-25 08:41 | 45K | |
![[ ]](/icons/layout.gif) | 552_Sean Hemens - HE..> | 2025-09-23 11:31 | 45K | |
![[ ]](/icons/layout.gif) | 12208_James Howard -..> | 2025-11-06 09:57 | 45K | |
![[ ]](/icons/layout.gif) | 2920_James Howard - ..> | 2025-10-08 08:42 | 45K | |
![[ ]](/icons/layout.gif) | 1956_Mel Bexley - BE..> | 2025-10-03 08:38 | 45K | |
![[ ]](/icons/layout.gif) | 1763_Craig Skinner -..> | 2025-10-02 09:21 | 45K | |
![[ ]](/icons/layout.gif) | 7851_Sean Hemens - H..> | 2025-10-24 09:14 | 45K | |
![[ ]](/icons/layout.gif) | 9563_Nicholas Custan..> | 2025-10-29 17:03 | 45K | |
![[ ]](/icons/layout.gif) | 2517_Andrew Stibbs -..> | 2025-10-06 15:46 | 45K | |
![[ ]](/icons/layout.gif) | 5038_Craig Gulley Ha..> | 2025-10-15 14:00 | 46K | |
![[ ]](/icons/layout.gif) | 10516_Oliver Pilgers..> | 2025-11-03 09:32 | 46K | |
![[ ]](/icons/layout.gif) | 9035_Elevate Doors L..> | 2025-10-28 14:59 | 46K | |
![[ ]](/icons/layout.gif) | 23914_MnK Windows K..> | 2025-12-08 14:25 | 46K | |
![[ ]](/icons/layout.gif) | 9033_Elevate Doors L..> | 2025-10-28 14:58 | 46K | |
![[ ]](/icons/layout.gif) | 9029_Elevate Doors L..> | 2025-10-28 14:51 | 46K | |
![[ ]](/icons/layout.gif) | 1451_[0,0] Dean Bark..> | 2025-09-30 14:32 | 46K | |
![[ ]](/icons/layout.gif) | 16710_ASM Windows Ad..> | 2025-11-18 14:04 | 46K | |
![[ ]](/icons/layout.gif) | 9023_Elevate Doors L..> | 2025-10-28 14:48 | 46K | |
![[ ]](/icons/layout.gif) | 9025_Elevate Doors L..> | 2025-10-28 14:49 | 46K | |
![[ ]](/icons/layout.gif) | 9027_Elevate Doors L..> | 2025-10-28 14:50 | 46K | |
![[ ]](/icons/layout.gif) | 19757_Rollerdoors 24..> | 2025-11-26 10:39 | 46K | |
![[ ]](/icons/layout.gif) | 19603_T D Rollerdoor..> | 2025-11-26 07:52 | 46K | |
![[ ]](/icons/layout.gif) | 30249_Greg Bearsley ..> | 2026-01-05 14:52 | 46K | |
![[ ]](/icons/layout.gif) | 3590_J Brady Garage ..> | 2025-10-09 14:00 | 46K | |
![[ ]](/icons/layout.gif) | 23457_Ross Garage Do..> | 2025-12-05 12:24 | 46K | |
![[ ]](/icons/layout.gif) | 5259_Rollerdoors 24 ..> | 2025-10-16 09:12 | 46K | |
![[ ]](/icons/layout.gif) | 16625_Karl Jones - I..> | 2025-11-18 12:32 | 46K | |
![[ ]](/icons/layout.gif) | 6009_Nuvo Windows Pa..> | 2025-10-17 15:43 | 46K | |
![[ ]](/icons/layout.gif) | 725_JD Cars Ltd Jero..> | 2025-09-24 11:00 | 46K | |
![[ ]](/icons/layout.gif) | 30355_Rising Group L..> | 2026-01-05 16:10 | 46K | |
![[ ]](/icons/layout.gif) | 23902_Oakley Windows..> | 2025-12-08 14:14 | 46K | |
![[ ]](/icons/layout.gif) | 48_Clifford Lowdell ..> | 2025-09-11 10:18 | 46K | |
![[ ]](/icons/layout.gif) | 60_Clifford Lowdell ..> | 2025-09-15 13:18 | 46K | |
![[ ]](/icons/layout.gif) | 7850_Nuvo Windows Pa..> | 2025-10-24 09:14 | 46K | |
![[ ]](/icons/layout.gif) | 546_Clifford Lowdell..> | 2025-09-23 11:06 | 46K | |
![[ ]](/icons/layout.gif) | 16116_Gavin Morton -..> | 2025-11-17 14:35 | 46K | |
![[ ]](/icons/layout.gif) | 15024_Proud 2 Fix Ma..> | 2025-11-13 13:20 | 46K | |
![[ ]](/icons/layout.gif) | 12183_Shutter Tech U..> | 2025-11-06 09:47 | 46K | |
![[ ]](/icons/layout.gif) | 14082_Chiltern Doors..> | 2025-11-11 15:45 | 46K | |
![[ ]](/icons/layout.gif) | 2041_[0,0] Paul Birk..> | 2025-10-03 11:50 | 46K | |
![[ ]](/icons/layout.gif) | 581_Wyon Ltd Giles D..> | 2025-09-23 14:01 | 46K | |
![[ ]](/icons/layout.gif) | 6460_Highlands Elect..> | 2025-10-21 10:29 | 46K | |
![[ ]](/icons/layout.gif) | 16573_BRISTOL GARAGE..> | 2025-11-18 11:35 | 46K | |
![[ ]](/icons/layout.gif) | 14172_Barker - Marty..> | 2025-11-12 07:23 | 46K | |
![[ ]](/icons/layout.gif) | 5777_Ace Garage Door..> | 2025-10-17 09:50 | 46K | |
![[ ]](/icons/layout.gif) | 8810_Wellingborough ..> | 2025-10-28 10:10 | 46K | |
![[ ]](/icons/layout.gif) | 32009_LNR Door Solut..> | 2026-01-09 11:51 | 46K | |
![[ ]](/icons/layout.gif) | 27806_M. B. Bells Lt..> | 2025-12-18 12:25 | 46K | |
![[ ]](/icons/layout.gif) | 911_JM Doors Jon Bun..> | 2025-09-25 14:37 | 46K | |
![[ ]](/icons/layout.gif) | 8118_Jordan Shepphar..> | 2025-10-24 15:58 | 46K | |
![[ ]](/icons/layout.gif) | 17211_NTRAP NR11 7NZ..> | 2025-11-19 12:00 | 46K | |
![[ ]](/icons/layout.gif) | 6378_Shutter Tech UK..> | 2025-10-20 16:16 | 46K | |
![[ ]](/icons/layout.gif) | 32044_Jacob Bourne -..> | 2026-01-09 12:38 | 46K | |
![[ ]](/icons/layout.gif) | 30826_Paul Atkinson ..> | 2026-01-06 14:22 | 46K | |
![[ ]](/icons/layout.gif) | 8114_RP Manufacturin..> | 2025-10-24 15:44 | 46K | |
![[ ]](/icons/layout.gif) | 16136_Reklaw WF11 0F..> | 2025-11-17 15:21 | 46K | |
![[ ]](/icons/layout.gif) | 33147_Ideal Industri..> | 2026-01-14 11:07 | 46K | |
![[ ]](/icons/layout.gif) | 2122_[0,0] Neil Pric..> | 2025-10-03 13:00 | 46K | |
![[ ]](/icons/layout.gif) | 2881_Nick Garlick - ..> | 2025-10-08 08:20 | 46K | |
![[ ]](/icons/layout.gif) | 3262_Nick Garlick - ..> | 2025-10-08 18:44 | 46K | |
![[ ]](/icons/layout.gif) | 7696_SDL Door Repair..> | 2025-10-24 07:16 | 46K | |
![[ ]](/icons/layout.gif) | 6359_R L Roller Door..> | 2025-10-20 14:44 | 46K | |
![[ ]](/icons/layout.gif) | 14020_Glenhurst Door..> | 2025-11-11 15:06 | 46K | |
![[ ]](/icons/layout.gif) | 3476_[0,0] James Bow..> | 2025-10-09 11:57 | 46K | |
![[ ]](/icons/layout.gif) | 22070_M Scott - Glen..> | 2025-12-02 14:21 | 46K | |
![[ ]](/icons/layout.gif) | 5771_David Mann - Ex..> | 2025-10-17 09:46 | 46K | |
![[ ]](/icons/layout.gif) | 7322_Aspect Maintena..> | 2025-10-23 10:55 | 46K | |
![[ ]](/icons/layout.gif) | 22302_AM Shutters St..> | 2025-12-03 09:17 | 46K | |
![[ ]](/icons/layout.gif) | 23587_Michael Mazur ..> | 2025-12-05 17:01 | 46K | |
![[ ]](/icons/layout.gif) | 18518_Barry Eckland ..> | 2025-11-24 10:10 | 46K | |
![[ ]](/icons/layout.gif) | 27379_Entador System..> | 2025-12-17 11:21 | 46K | |
![[ ]](/icons/layout.gif) | 22133_AM Shutters M..> | 2025-12-02 15:43 | 46K | |
![[ ]](/icons/layout.gif) | 16769_RH Doors & Shu..> | 2025-11-18 15:15 | 46K | |
![[ ]](/icons/layout.gif) | 738_Heavy Metal Engi..> | 2025-09-24 11:48 | 46K | |
![[ ]](/icons/layout.gif) | 19802_1st Shield Dar..> | 2025-11-26 11:30 | 46K | |
![[ ]](/icons/layout.gif) | 24044_Mowbrey Partne..> | 2025-12-09 08:28 | 46K | |
![[ ]](/icons/layout.gif) | 24046_Mowbrey Partne..> | 2025-12-09 08:28 | 46K | |
![[ ]](/icons/layout.gif) | 124_Garage Doors 247..> | 2025-09-17 14:36 | 46K | |
![[ ]](/icons/layout.gif) | 16626_Karl Jones - I..> | 2025-11-18 12:33 | 46K | |
![[ ]](/icons/layout.gif) | 27722_Avon Automated..> | 2025-12-18 11:00 | 46K | |
![[ ]](/icons/layout.gif) | 32807_Fortress Doors..> | 2026-01-13 12:48 | 46K | |
![[ ]](/icons/layout.gif) | 233_Ace Garage Doors..> | 2025-09-19 06:59 | 46K | |
![[ ]](/icons/layout.gif) | 8421_Michael Mazur M..> | 2025-10-27 13:14 | 46K | |
![[ ]](/icons/layout.gif) | 8478_Mark Perham Mar..> | 2025-10-27 13:34 | 46K | |
![[ ]](/icons/layout.gif) | 12022_G B Installati..> | 2025-11-05 15:05 | 46K | |
![[ ]](/icons/layout.gif) | 12874_L G Glazing Lt..> | 2025-11-07 15:01 | 46K | |
![[ ]](/icons/layout.gif) | 8925_My Garage Door ..> | 2025-10-28 12:22 | 46K | |
![[ ]](/icons/layout.gif) | 17582_Harry Curtis -..> | 2025-11-20 11:34 | 46K | |
![[ ]](/icons/layout.gif) | 9251_UK Rollerdoors ..> | 2025-10-29 09:07 | 46K | |
![[ ]](/icons/layout.gif) | 17453_EZ2OWN Ltd Pau..> | 2025-11-20 09:12 | 46K | |
![[ ]](/icons/layout.gif) | 28388_Absolute Garag..> | 2025-12-19 16:31 | 46K | |
![[ ]](/icons/layout.gif) | 12758_Price NG34 7RQ..> | 2025-11-07 10:52 | 46K | |
![[ ]](/icons/layout.gif) | 20499_Harry Curtis -..> | 2025-11-27 15:33 | 46K | |
![[ ]](/icons/layout.gif) | 893_Access Door Serv..> | 2025-09-25 13:24 | 46K | |
![[ ]](/icons/layout.gif) | 7874_AM Shutters Ste..> | 2025-10-24 09:26 | 46K | |
![[ ]](/icons/layout.gif) | 7875_AM Shutters Ste..> | 2025-10-24 09:26 | 46K | |
![[ ]](/icons/layout.gif) | 15805_Roll Right Gar..> | 2025-11-17 08:51 | 46K | |
![[ ]](/icons/layout.gif) | 8826_Prorenovate Ian..> | 2025-10-28 10:57 | 46K | |
![[ ]](/icons/layout.gif) | 13134_Zest Propertie..> | 2025-11-10 09:20 | 46K | |
![[ ]](/icons/layout.gif) | 753_Chargepoint Inst..> | 2025-09-24 12:43 | 46K | |
![[ ]](/icons/layout.gif) | 895_Access Door Serv..> | 2025-09-25 13:25 | 46K | |
![[ ]](/icons/layout.gif) | 8189_Go Garage Doors..> | 2025-10-27 09:04 | 46K | |
![[ ]](/icons/layout.gif) | 21177_Ceta Group Ltd..> | 2025-12-01 09:12 | 46K | |
![[ ]](/icons/layout.gif) | 9720_Ecosse Garage D..> | 2025-10-30 10:43 | 46K | |
![[ ]](/icons/layout.gif) | 19811_AM Shutters St..> | 2025-11-26 11:31 | 46K | |
![[ ]](/icons/layout.gif) | 1495_[0,0] AJ Trade..> | 2025-09-30 20:17 | 46K | |
![[ ]](/icons/layout.gif) | 8919_EcoGlaze Group ..> | 2025-10-28 12:17 | 46K | |
![[ ]](/icons/layout.gif) | 16813_PB Doors Paul ..> | 2025-11-18 15:41 | 46K | |
![[ ]](/icons/layout.gif) | 21632_James King - N..> | 2025-12-02 07:47 | 46K | |
![[ ]](/icons/layout.gif) | 7870_1st Shield Darr..> | 2025-10-24 09:23 | 46K | |
![[ ]](/icons/layout.gif) | 8010_Fixed Abode Gar..> | 2025-10-24 12:43 | 46K | |
![[ ]](/icons/layout.gif) | 8183_Go Garage Doors..> | 2025-10-27 08:52 | 46K | |
![[ ]](/icons/layout.gif) | 24983_Simon Piggin S..> | 2025-12-11 10:00 | 46K | |
![[ ]](/icons/layout.gif) | 32600_Jacob Bourne -..> | 2026-01-13 09:21 | 46K | |
![[ ]](/icons/layout.gif) | 11869_ASSW Ltd ASSW..> | 2025-11-05 12:04 | 46K | |
![[ ]](/icons/layout.gif) | 903_Smart Doors Henr..> | 2025-09-25 13:54 | 46K | |
![[ ]](/icons/layout.gif) | 1429_Aj Trade Aj Tr..> | 2025-09-30 13:31 | 46K | |
![[ ]](/icons/layout.gif) | 7409_JM Doors Jon Bu..> | 2025-10-23 11:49 | 46K | |
![[ ]](/icons/layout.gif) | 10344_Oakley Windows..> | 2025-10-31 12:44 | 46K | |
![[ ]](/icons/layout.gif) | 22247_Shutter Tech U..> | 2025-12-03 08:03 | 46K | |
![[ ]](/icons/layout.gif) | 30047_AM Shutters M..> | 2026-01-05 10:20 | 46K | |
![[ ]](/icons/layout.gif) | 7713_SDL Door Repair..> | 2025-10-24 07:32 | 46K | |
![[ ]](/icons/layout.gif) | 6008_Nuvo Windows Pa..> | 2025-10-17 15:42 | 46K | |
![[ ]](/icons/layout.gif) | 16960_Regal Windows ..> | 2025-11-19 07:47 | 46K | |
![[ ]](/icons/layout.gif) | 27541_Whitburn Joine..> | 2025-12-17 16:02 | 46K | |
![[ ]](/icons/layout.gif) | 31218_Harry Curtis -..> | 2026-01-07 14:51 | 46K | |
![[ ]](/icons/layout.gif) | 27506_NTRAP NR11 7NZ..> | 2025-12-17 15:05 | 46K | |
![[ ]](/icons/layout.gif) | 14175_Chiltern Doors..> | 2025-11-12 07:23 | 46K | |
![[ ]](/icons/layout.gif) | 22304_AM Shutters St..> | 2025-12-03 09:18 | 46K | |
![[ ]](/icons/layout.gif) | 89_Harpers Door Spec..> | 2025-09-17 08:40 | 46K | |
![[ ]](/icons/layout.gif) | 975_CRS Maintenance ..> | 2025-09-26 08:31 | 46K | |
![[ ]](/icons/layout.gif) | 985_Doors 4 Garages ..> | 2025-09-26 08:47 | 46K | |
![[ ]](/icons/layout.gif) | 15489_C Marl Systems..> | 2025-11-14 12:28 | 46K | |
![[ ]](/icons/layout.gif) | 6465_Highlands Elect..> | 2025-10-21 10:31 | 46K | |
![[ ]](/icons/layout.gif) | 25603_Terry Barker -..> | 2025-12-12 12:55 | 46K | |
![[ ]](/icons/layout.gif) | 7408_JM Doors Jon Bu..> | 2025-10-23 11:47 | 46K | |
![[ ]](/icons/layout.gif) | 26153_Garage Door Se..> | 2025-12-15 08:01 | 46K | |
![[ ]](/icons/layout.gif) | 19257_Anthony Garth ..> | 2025-11-25 14:01 | 46K | |
![[ ]](/icons/layout.gif) | 30680_Thetford Glass..> | 2026-01-06 11:47 | 46K | |
![[ ]](/icons/layout.gif) | 466_Garage Door Solu..> | 2025-09-23 07:17 | 47K | |
![[ ]](/icons/layout.gif) | 28020_NTRAP NR11 7NZ..> | 2025-12-19 07:36 | 47K | |
![[ ]](/icons/layout.gif) | 609_Garage Door Solu..> | 2025-09-23 15:20 | 47K | |
![[ ]](/icons/layout.gif) | 6776_RS Doors Rob Sm..> | 2025-10-22 08:33 | 47K | |
![[ ]](/icons/layout.gif) | 8811_Wellingborough ..> | 2025-10-28 10:11 | 47K | |
![[ ]](/icons/layout.gif) | 20213_TCR Sussex Ltd..> | 2025-11-27 10:56 | 47K | |
![[ ]](/icons/layout.gif) | 27803_Anthony Garth ..> | 2025-12-18 12:21 | 47K | |
![[ ]](/icons/layout.gif) | 5765_Custom Trade Sy..> | 2025-10-17 09:18 | 47K | |
![[ ]](/icons/layout.gif) | 12181_Shutter Tech U..> | 2025-11-06 09:46 | 47K | |
![[ ]](/icons/layout.gif) | 18753_Illy Refurbish..> | 2025-11-24 14:59 | 47K | |
![[ ]](/icons/layout.gif) | 18798_Barry Eckland ..> | 2025-11-24 16:17 | 47K | |
![[ ]](/icons/layout.gif) | 25605_Glenhurst Door..> | 2025-12-12 12:57 | 47K | |
![[ ]](/icons/layout.gif) | 8901_EcoGlaze Group ..> | 2025-10-28 12:05 | 47K | |
![[ ]](/icons/layout.gif) | 9545_J Brady Garage ..> | 2025-10-29 16:39 | 47K | |
![[ ]](/icons/layout.gif) | 22217_Nuvo Windows P..> | 2025-12-02 17:12 | 47K | |
![[ ]](/icons/layout.gif) | 26831_Nuvo Windows P..> | 2025-12-16 11:58 | 47K | |
![[ ]](/icons/layout.gif) | 996_JWK Electrical L..> | 2025-09-26 09:45 | 47K | |
![[ ]](/icons/layout.gif) | 20143_WADE WINDOWS I..> | 2025-11-27 09:24 | 47K | |
![[ ]](/icons/layout.gif) | 9264_ASSW Ltd BS10 7..> | 2025-10-29 09:15 | 47K | |
![[ ]](/icons/layout.gif) | 9718_Ecosse Garage D..> | 2025-10-30 10:43 | 47K | |
![[ ]](/icons/layout.gif) | 9724_Rhino Windows A..> | 2025-10-30 10:53 | 47K | |
![[ ]](/icons/layout.gif) | 28367_NTRAP NR11 7NZ..> | 2025-12-19 15:13 | 47K | |
![[ ]](/icons/layout.gif) | 3301_Michael Mazur ..> | 2025-10-09 07:40 | 47K | |
![[ ]](/icons/layout.gif) | 12723_Regal Windows ..> | 2025-11-07 10:14 | 47K | |
![[ ]](/icons/layout.gif) | 17401_EcoGlaze Group..> | 2025-11-20 07:49 | 47K | |
![[ ]](/icons/layout.gif) | 17373_All About Door..> | 2025-11-19 15:47 | 47K | |
![[ ]](/icons/layout.gif) | 27222_Ace Garage Doo..> | 2025-12-17 09:17 | 47K | |
![[ ]](/icons/layout.gif) | 27512_NTRAP NR11 7NZ..> | 2025-12-17 15:13 | 47K | |
![[ ]](/icons/layout.gif) | 30687_Thetford Glass..> | 2026-01-06 11:57 | 47K | |
![[ ]](/icons/layout.gif) | 12030_Fortress Doors..> | 2025-11-05 15:11 | 47K | |
![[ ]](/icons/layout.gif) | 8906_WINDOW WIZE LTD..> | 2025-10-28 12:07 | 47K | |
![[ ]](/icons/layout.gif) | 28365_NTRAP NR11 7NZ..> | 2025-12-19 15:12 | 47K | |
![[ ]](/icons/layout.gif) | 8233_Admiral Home Im..> | 2025-10-27 10:37 | 47K | |
![[ ]](/icons/layout.gif) | 8560_Custom Trade Sy..> | 2025-10-27 14:55 | 47K | |
![[ ]](/icons/layout.gif) | 22132_AM Shutters St..> | 2025-12-02 15:43 | 47K | |
![[ ]](/icons/layout.gif) | 30616_Kris Jones Kri..> | 2026-01-06 10:52 | 47K | |
![[ ]](/icons/layout.gif) | 12196_Eastern Frames..> | 2025-11-06 09:51 | 47K | |
![[ ]](/icons/layout.gif) | 16027_Woods And Sons..> | 2025-11-17 12:21 | 47K | |
![[ ]](/icons/layout.gif) | 12581_L & C Bracey L..> | 2025-11-06 16:56 | 47K | |
![[ ]](/icons/layout.gif) | 24193_Martin JOinery..> | 2025-12-09 09:36 | 47K | |
![[ ]](/icons/layout.gif) | 611_Rhino Windows An..> | 2025-09-23 15:27 | 47K | |
![[ ]](/icons/layout.gif) | 15467_MG Securical L..> | 2025-11-14 12:11 | 47K | |
![[ ]](/icons/layout.gif) | 22248_Shutter Tech U..> | 2025-12-03 08:04 | 47K | |
![[ ]](/icons/layout.gif) | 251_Garage Door Solu..> | 2025-09-19 08:36 | 47K | |
![[ ]](/icons/layout.gif) | 7656_Do Not Use Jame..> | 2025-10-24 06:44 | 47K | |
![[ ]](/icons/layout.gif) | 23598_R L Roller Doo..> | 2025-12-08 08:10 | 47K | |
![[ ]](/icons/layout.gif) | 6790_Hadrian Joinery..> | 2025-10-22 08:37 | 47K | |
![[ ]](/icons/layout.gif) | 7876_AM Shutters Ste..> | 2025-10-24 09:27 | 47K | |
![[ ]](/icons/layout.gif) | 12880_Doorflex Produ..> | 2025-11-07 15:47 | 47K | |
![[ ]](/icons/layout.gif) | 1080_AAES Electrical..> | 2025-09-26 13:24 | 47K | |
![[ ]](/icons/layout.gif) | 12037_Fortress Doors..> | 2025-11-05 15:15 | 47K | |
![[ ]](/icons/layout.gif) | 12582_L & C Bracey L..> | 2025-11-06 16:58 | 47K | |
![[ ]](/icons/layout.gif) | 12507_Ian Sanderson ..> | 2025-11-06 15:38 | 47K | |
![[ ]](/icons/layout.gif) | 28366_NTRAP NR11 7NZ..> | 2025-12-19 15:13 | 47K | |
![[ ]](/icons/layout.gif) | 3326_Richard Stockbr..> | 2025-10-09 08:20 | 47K | |
![[ ]](/icons/layout.gif) | 6360_R L Roller Door..> | 2025-10-20 14:44 | 47K | |
![[ ]](/icons/layout.gif) | 18159_Able Garage Do..> | 2025-11-21 12:33 | 47K | |
![[ ]](/icons/layout.gif) | 24993_Shutter Tech U..> | 2025-12-11 10:04 | 47K | |
![[ ]](/icons/layout.gif) | 10122_Ecosse Garage ..> | 2025-10-31 09:19 | 47K | |
![[ ]](/icons/layout.gif) | 29331_Bloomfield Hom..> | 2025-12-29 08:45 | 47K | |
![[ ]](/icons/layout.gif) | 1490_NBC Commercial ..> | 2025-09-30 20:11 | 47K | |
![[ ]](/icons/layout.gif) | 4185_Richard Stockbr..> | 2025-10-13 11:15 | 47K | |
![[ ]](/icons/layout.gif) | 7856_Do Not Use 1 Ma..> | 2025-10-24 09:19 | 47K | |
![[ ]](/icons/layout.gif) | 14286_Fortress Doors..> | 2025-11-12 08:29 | 47K | |
![[ ]](/icons/layout.gif) | 7761_Lidget Compton ..> | 2025-10-24 08:35 | 47K | |
![[ ]](/icons/layout.gif) | 20412_Rhino Windows ..> | 2025-11-27 12:26 | 47K | |
![[ ]](/icons/layout.gif) | 29675_Garage Door Se..> | 2026-01-02 09:50 | 47K | |
![[ ]](/icons/layout.gif) | 12205_Custom Trade S..> | 2025-11-06 09:55 | 47K | |
![[ ]](/icons/layout.gif) | 14294_All Doors Repa..> | 2025-11-12 08:39 | 47K | |
![[ ]](/icons/layout.gif) | 19698_Doors And Gate..> | 2025-11-26 09:05 | 47K | |
![[ ]](/icons/layout.gif) | 2807_Doors 4 You. Pa..> | 2025-10-07 14:55 | 47K | |
![[ ]](/icons/layout.gif) | 12883_Doorflex Produ..> | 2025-11-07 15:50 | 47K | |
![[ ]](/icons/layout.gif) | 16978_Doorolla Ltd S..> | 2025-11-19 08:10 | 47K | |
![[ ]](/icons/layout.gif) | 22559_Norfolk Roller..> | 2025-12-03 14:10 | 47K | |
![[ ]](/icons/layout.gif) | 30156_All Doors Repa..> | 2026-01-05 13:03 | 47K | |
![[ ]](/icons/layout.gif) | 10258_Doorolla Ltd S..> | 2025-10-31 11:42 | 47K | |
![[ ]](/icons/layout.gif) | 12035_Fortress Doors..> | 2025-11-05 15:13 | 47K | |
![[ ]](/icons/layout.gif) | 17446_Garage Doors 2..> | 2025-11-20 09:01 | 47K | |
![[ ]](/icons/layout.gif) | 27788_1st Shield Dar..> | 2025-12-18 11:56 | 47K | |
![[ ]](/icons/layout.gif) | 1798_[0,0] Paul Birk..> | 2025-10-02 12:13 | 47K | |
![[ ]](/icons/layout.gif) | 5782_Go Garage Doors..> | 2025-10-17 09:53 | 47K | |
![[ ]](/icons/layout.gif) | 12179_Shutter Tech U..> | 2025-11-06 09:45 | 47K | |
![[ ]](/icons/layout.gif) | 28828_Garage Door Se..> | 2025-12-23 08:23 | 47K | |
![[ ]](/icons/layout.gif) | 5780_Go Garage Doors..> | 2025-10-17 09:52 | 47K | |
![[ ]](/icons/layout.gif) | 7883_DPS Building Se..> | 2025-10-24 09:51 | 47K | |
![[ ]](/icons/layout.gif) | 12380_RDM Engineerin..> | 2025-11-06 12:26 | 47K | |
![[ ]](/icons/layout.gif) | 849_Rhino Windows An..> | 2025-09-25 10:09 | 47K | |
![[ ]](/icons/layout.gif) | 6975_Protect Install..> | 2025-10-22 12:44 | 47K | |
![[ ]](/icons/layout.gif) | 8975_Doorolla Ltd St..> | 2025-10-28 14:14 | 47K | |
![[ ]](/icons/layout.gif) | 18129_Avon Automated..> | 2025-11-21 11:46 | 47K | |
![[ ]](/icons/layout.gif) | 19806_1st Shield Dar..> | 2025-11-26 11:31 | 47K | |
![[ ]](/icons/layout.gif) | 900_Ffenestri Amlwch..> | 2025-09-25 13:40 | 47K | |
![[ ]](/icons/layout.gif) | 7392_Dream Installat..> | 2025-10-23 11:38 | 47K | |
![[ ]](/icons/layout.gif) | 9248_UK Rollerdoors ..> | 2025-10-29 09:05 | 47K | |
![[ ]](/icons/layout.gif) | 9002_Elevate Doors L..> | 2025-10-28 14:24 | 47K | |
![[ ]](/icons/layout.gif) | 20492_WADE WINDOWS I..> | 2025-11-27 15:26 | 47K | |
![[ ]](/icons/layout.gif) | 2803_Doors 4 You. Pa..> | 2025-10-07 14:54 | 47K | |
![[ ]](/icons/layout.gif) | 4417_Ace Garage Door..> | 2025-10-14 06:54 | 47K | |
![[ ]](/icons/layout.gif) | 11519_SDL Door Repai..> | 2025-11-05 07:36 | 47K | |
![[ ]](/icons/layout.gif) | 13714_Guy Hubbard Do..> | 2025-11-11 10:15 | 47K | |
![[ ]](/icons/layout.gif) | 30575_Marcus Akid - ..> | 2026-01-06 09:53 | 47K | |
![[ ]](/icons/layout.gif) | 7871_AM Shutters Ste..> | 2025-10-24 09:24 | 47K | |
![[ ]](/icons/layout.gif) | 10678_Fixed Abode Ga..> | 2025-11-03 10:55 | 47K | |
![[ ]](/icons/layout.gif) | 17443_Fortress Doors..> | 2025-11-20 09:00 | 47K | |
![[ ]](/icons/layout.gif) | 21231_AJ Trade Andre..> | 2025-12-01 09:50 | 47K | |
![[ ]](/icons/layout.gif) | 30348_AJ Trade Andre..> | 2026-01-05 16:03 | 47K | |
![[ ]](/icons/layout.gif) | 31798_1st Shield Dar..> | 2026-01-08 15:41 | 47K | |
![[ ]](/icons/layout.gif) | 610_Rhino Windows An..> | 2025-09-23 15:26 | 47K | |
![[ ]](/icons/layout.gif) | 10330_Replacement Ga..> | 2025-10-31 12:26 | 47K | |
![[ ]](/icons/layout.gif) | 12767_Ecosse Garage ..> | 2025-11-07 11:24 | 47K | |
![[ ]](/icons/layout.gif) | 15015_Hereford Mobil..> | 2025-11-13 13:09 | 47K | |
![[ ]](/icons/layout.gif) | 28154_Whitburn Joine..> | 2025-12-19 10:38 | 47K | |
![[ ]](/icons/layout.gif) | 1681_Four Counties D..> | 2025-10-01 15:53 | 47K | |
![[ ]](/icons/layout.gif) | 12207_Garage Door Re..> | 2025-11-06 09:56 | 47K | |
![[ ]](/icons/layout.gif) | 16798_Wall Garage Do..> | 2025-11-18 15:35 | 47K | |
![[ ]](/icons/layout.gif) | 18154_P & R Door Sys..> | 2025-11-21 12:30 | 47K | |
![[ ]](/icons/layout.gif) | 14323_CWD Improvemen..> | 2025-11-12 09:14 | 47K | |
![[ ]](/icons/layout.gif) | 15463_Wanstall Ltd. ..> | 2025-11-14 12:08 | 47K | |
![[ ]](/icons/layout.gif) | 23181_The Handyman C..> | 2025-12-04 17:03 | 47K | |
![[ ]](/icons/layout.gif) | 27672_Replacement Ga..> | 2025-12-18 09:41 | 47K | |
![[ ]](/icons/layout.gif) | 30160_All Doors Repa..> | 2026-01-05 13:07 | 47K | |
![[ ]](/icons/layout.gif) | 8688_Fixed Abode Gar..> | 2025-10-28 07:51 | 47K | |
![[ ]](/icons/layout.gif) | 10332_Replacement Ga..> | 2025-10-31 12:27 | 47K | |
![[ ]](/icons/layout.gif) | 18275_Oakley Windows..> | 2025-11-21 15:28 | 47K | |
![[ ]](/icons/layout.gif) | 145_M. A. E. Windows..> | 2025-09-17 15:43 | 47K | |
![[ ]](/icons/layout.gif) | 7390_Dream Installat..> | 2025-10-23 11:35 | 47K | |
![[ ]](/icons/layout.gif) | 7391_Dream Installat..> | 2025-10-23 11:37 | 47K | |
![[ ]](/icons/layout.gif) | 17403_J Bowman Garag..> | 2025-11-20 08:07 | 47K | |
![[ ]](/icons/layout.gif) | 30158_All Doors Repa..> | 2026-01-05 13:04 | 47K | |
![[ ]](/icons/layout.gif) | 32780_Replacement Ga..> | 2026-01-13 12:23 | 47K | |
![[ ]](/icons/layout.gif) | 7662_Ross Garage Doo..> | 2025-10-24 06:48 | 47K | |
![[ ]](/icons/layout.gif) | 7691_NBC Commercial ..> | 2025-10-24 07:13 | 47K | |
![[ ]](/icons/layout.gif) | 23599_R L Roller Doo..> | 2025-12-08 08:10 | 47K | |
![[ ]](/icons/layout.gif) | 5907_Alps Home Impro..> | 2025-10-17 12:45 | 47K | |
![[ ]](/icons/layout.gif) | 10117_Ecosse Garage ..> | 2025-10-31 09:18 | 47K | |
![[ ]](/icons/layout.gif) | 27586_Replacement Ga..> | 2025-12-18 07:06 | 47K | |
![[ ]](/icons/layout.gif) | 13988_Ace Garage Doo..> | 2025-11-11 14:33 | 47K | |
![[ ]](/icons/layout.gif) | 26959_Avon Automated..> | 2025-12-16 14:30 | 47K | |
![[ ]](/icons/layout.gif) | 3270_Palms Construct..> | 2025-10-08 20:10 | 47K | |
![[ ]](/icons/layout.gif) | 5797_S R W Services ..> | 2025-10-17 10:20 | 47K | |
![[ ]](/icons/layout.gif) | 11181_Rhino Windows ..> | 2025-11-04 11:01 | 47K | |
![[ ]](/icons/layout.gif) | 12714_Scotia Garage ..> | 2025-11-07 10:05 | 47K | |
![[ ]](/icons/layout.gif) | 13534_NW Automatic D..> | 2025-11-11 07:39 | 47K | |
![[ ]](/icons/layout.gif) | 13539_NW Automatic D..> | 2025-11-11 07:40 | 47K | |
![[ ]](/icons/layout.gif) | 9261_Elevate Doors L..> | 2025-10-29 09:14 | 47K | |
![[ ]](/icons/layout.gif) | 10328_Replacement Ga..> | 2025-10-31 12:25 | 47K | |
![[ ]](/icons/layout.gif) | 10340_Eclipse Doors ..> | 2025-10-31 12:40 | 47K | |
![[ ]](/icons/layout.gif) | 12026_Fortress Doors..> | 2025-11-05 15:08 | 47K | |
![[ ]](/icons/layout.gif) | 12146_Avon Automated..> | 2025-11-06 09:35 | 47K | |
![[ ]](/icons/layout.gif) | 18096_Mac Automation..> | 2025-11-21 11:12 | 47K | |
![[ ]](/icons/layout.gif) | 19093_Garage Door Re..> | 2025-11-25 12:30 | 47K | |
![[ ]](/icons/layout.gif) | 23607_TH Installatio..> | 2025-12-08 08:18 | 47K | |
![[ ]](/icons/layout.gif) | 8400_NW Automatic Do..> | 2025-10-27 12:51 | 47K | |
![[ ]](/icons/layout.gif) | 18289_Doorolla Ltd S..> | 2025-11-21 15:48 | 47K | |
![[ ]](/icons/layout.gif) | 18304_Doorolla Ltd S..> | 2025-11-21 16:18 | 47K | |
![[ ]](/icons/layout.gif) | 30919_Doors 4 Garage..> | 2026-01-06 15:33 | 47K | |
![[ ]](/icons/layout.gif) | 16929_Doorolla Ltd S..> | 2025-11-19 07:36 | 47K | |
![[ ]](/icons/layout.gif) | 17380_Fortress Doors..> | 2025-11-19 15:51 | 47K | |
![[ ]](/icons/layout.gif) | 855_Heavy Metal Engi..> | 2025-09-25 10:40 | 47K | |
![[ ]](/icons/layout.gif) | 3070_1st Choice Secu..> | 2025-10-08 10:54 | 47K | |
![[ ]](/icons/layout.gif) | 8678_Doors 4 Garages..> | 2025-10-27 17:07 | 47K | |
![[ ]](/icons/layout.gif) | 10336_Replacement Ga..> | 2025-10-31 12:31 | 47K | |
![[ ]](/icons/layout.gif) | 16275_AJ Trade Andre..> | 2025-11-18 08:19 | 47K | |
![[ ]](/icons/layout.gif) | 18288_Doorolla Ltd S..> | 2025-11-21 15:47 | 47K | |
![[ ]](/icons/layout.gif) | 18303_Doorolla Ltd S..> | 2025-11-21 16:18 | 47K | |
![[ ]](/icons/layout.gif) | 30237_All Doors Repa..> | 2026-01-05 14:26 | 47K | |
![[ ]](/icons/layout.gif) | 7013_Doorolla Ltd S ..> | 2025-10-22 12:53 | 47K | |
![[ ]](/icons/layout.gif) | 9531_Absolute Garage..> | 2025-10-29 16:25 | 47K | |
![[ ]](/icons/layout.gif) | 23903_Oakley Windows..> | 2025-12-08 14:14 | 47K | |
![[ ]](/icons/layout.gif) | 23909_Oakley Windows..> | 2025-12-08 14:15 | 47K | |
![[ ]](/icons/layout.gif) | 24369_Island Home Im..> | 2025-12-09 12:07 | 47K | |
![[ ]](/icons/layout.gif) | 27587_Replacement Ga..> | 2025-12-18 07:06 | 47K | |
![[ ]](/icons/layout.gif) | 19244_Wanstall Ltd. ..> | 2025-11-25 13:51 | 47K | |
![[ ]](/icons/layout.gif) | 19342_Keswick Develo..> | 2025-11-25 15:28 | 47K | |
![[ ]](/icons/layout.gif) | 2547_Replacement Gar..> | 2025-10-06 17:01 | 47K | |
![[ ]](/icons/layout.gif) | 7572_Piper Window Sy..> | 2025-10-23 13:41 | 47K | |
![[ ]](/icons/layout.gif) | 15012_Elevate Doors ..> | 2025-11-13 13:03 | 47K | |
![[ ]](/icons/layout.gif) | 15296_Doors 4 Garage..> | 2025-11-14 09:01 | 47K | |
![[ ]](/icons/layout.gif) | 11124_C&M Glass Serv..> | 2025-11-04 09:09 | 47K | |
![[ ]](/icons/layout.gif) | 2127_Palms Construct..> | 2025-10-03 13:06 | 47K | |
![[ ]](/icons/layout.gif) | 7412_Norfolk Roller ..> | 2025-10-23 11:51 | 47K | |
![[ ]](/icons/layout.gif) | 12768_Ecosse Garage ..> | 2025-11-07 11:25 | 47K | |
![[ ]](/icons/layout.gif) | 16958_Eastern Frames..> | 2025-11-19 07:46 | 47K | |
![[ ]](/icons/layout.gif) | 24730_Fortress Doors..> | 2025-12-10 13:26 | 47K | |
![[ ]](/icons/layout.gif) | 616_M & S Home Insta..> | 2025-09-23 15:40 | 47K | |
![[ ]](/icons/layout.gif) | 7914_Garage Door Rep..> | 2025-10-24 11:04 | 47K | |
![[ ]](/icons/layout.gif) | 13902_Ace Garage Doo..> | 2025-11-11 13:48 | 47K | |
![[ ]](/icons/layout.gif) | 18286_Doorolla Ltd S..> | 2025-11-21 15:47 | 47K | |
![[ ]](/icons/layout.gif) | 18301_Doorolla Ltd S..> | 2025-11-21 16:13 | 47K | |
![[ ]](/icons/layout.gif) | 23877_Dream Installa..> | 2025-12-08 13:36 | 47K | |
![[ ]](/icons/layout.gif) | 30854_Secure Entranc..> | 2026-01-06 15:09 | 47K | |
![[ ]](/icons/layout.gif) | 23904_Oakley Windows..> | 2025-12-08 14:15 | 47K | |
![[ ]](/icons/layout.gif) | 1945_[0,0] Wayne Gil..> | 2025-10-03 08:01 | 47K | |
![[ ]](/icons/layout.gif) | 14022_Rhino Windows ..> | 2025-11-11 15:16 | 47K | |
![[ ]](/icons/layout.gif) | 16734_Garage Doors N..> | 2025-11-18 14:36 | 47K | |
![[ ]](/icons/layout.gif) | 17892_Doors 4 Garage..> | 2025-11-21 08:27 | 47K | |
![[ ]](/icons/layout.gif) | 4765_The Garage Door..> | 2025-10-14 15:14 | 47K | |
![[ ]](/icons/layout.gif) | 6944_C & P Doors Cra..> | 2025-10-22 12:16 | 47K | |
![[ ]](/icons/layout.gif) | 10517_Harpers Door S..> | 2025-11-03 09:32 | 47K | |
![[ ]](/icons/layout.gif) | 14018_Hereford Mobil..> | 2025-11-11 15:04 | 47K | |
![[ ]](/icons/layout.gif) | 5485_Doors 4 Garages..> | 2025-10-16 13:42 | 47K | |
![[ ]](/icons/layout.gif) | 7812_Harpers Door Sp..> | 2025-10-24 08:59 | 47K | |
![[ ]](/icons/layout.gif) | 19349_Keswick Develo..> | 2025-11-25 15:33 | 47K | |
![[ ]](/icons/layout.gif) | 26156_Garage Door Se..> | 2025-12-15 08:03 | 47K | |
![[ ]](/icons/layout.gif) | 5646_Doors 4 Garages..> | 2025-10-16 15:30 | 47K | |
![[ ]](/icons/layout.gif) | 5938_Absolute Garage..> | 2025-10-17 13:43 | 47K | |
![[ ]](/icons/layout.gif) | 16568_WADE WINDOWS I..> | 2025-11-18 11:30 | 47K | |
![[ ]](/icons/layout.gif) | 6215_Rhino Windows A..> | 2025-10-20 12:52 | 47K | |
![[ ]](/icons/layout.gif) | 16290_Bryan Thompson..> | 2025-11-18 08:26 | 47K | |
![[ ]](/icons/layout.gif) | 16819_PB Doors Paul ..> | 2025-11-18 15:42 | 47K | |
![[ ]](/icons/layout.gif) | 25467_Warsash Window..> | 2025-12-12 10:34 | 47K | |
![[ ]](/icons/layout.gif) | 32609_Automated Acce..> | 2026-01-13 09:25 | 47K | |
![[ ]](/icons/layout.gif) | 17710_Ace Garage Doo..> | 2025-11-20 15:13 | 47K | |
![[ ]](/icons/layout.gif) | 26955_Fortress Doors..> | 2025-12-16 14:29 | 47K | |
![[ ]](/icons/layout.gif) | 27106_Ross Garage Do..> | 2025-12-16 16:43 | 47K | |
![[ ]](/icons/layout.gif) | 6984_Doorolla Ltd S ..> | 2025-10-22 12:47 | 47K | |
![[ ]](/icons/layout.gif) | 6987_Doorolla Ltd S ..> | 2025-10-22 12:48 | 47K | |
![[ ]](/icons/layout.gif) | 10326_Replacement Ga..> | 2025-10-31 12:24 | 47K | |
![[ ]](/icons/layout.gif) | 16771_RH Doors & Shu..> | 2025-11-18 15:16 | 47K | |
![[ ]](/icons/layout.gif) | 7212_Roll Right Gara..> | 2025-10-23 08:51 | 47K | |
![[ ]](/icons/layout.gif) | 11365_RBC Electrical..> | 2025-11-04 13:26 | 47K | |
![[ ]](/icons/layout.gif) | 14282_Chelmsford Rol..> | 2025-11-12 08:28 | 47K | |
![[ ]](/icons/layout.gif) | 18157_Lidget Compton..> | 2025-11-21 12:32 | 47K | |
![[ ]](/icons/layout.gif) | 24732_Fortress Doors..> | 2025-12-10 13:27 | 47K | |
![[ ]](/icons/layout.gif) | 1089_Access Door Ser..> | 2025-09-26 14:33 | 47K | |
![[ ]](/icons/layout.gif) | 29637_Fortress Doors..> | 2026-01-02 08:40 | 47K | |
![[ ]](/icons/layout.gif) | 6194_Rhino Windows A..> | 2025-10-20 12:29 | 47K | |
![[ ]](/icons/layout.gif) | 25592_Replacement Ga..> | 2025-12-12 12:31 | 47K | |
![[ ]](/icons/layout.gif) | 1358_[0,0] Martin Ch..> | 2025-09-30 08:12 | 47K | |
![[ ]](/icons/layout.gif) | 7689_JWK Electrical ..> | 2025-10-24 07:11 | 47K | |
![[ ]](/icons/layout.gif) | 10426_J Brady Garage..> | 2025-10-31 16:12 | 47K | |
![[ ]](/icons/layout.gif) | 15010_Elevate Doors ..> | 2025-11-13 13:02 | 47K | |
![[ ]](/icons/layout.gif) | 25607_Glenhurst Door..> | 2025-12-12 12:58 | 47K | |
![[ ]](/icons/layout.gif) | 27588_Replacement Ga..> | 2025-12-18 07:07 | 47K | |
![[ ]](/icons/layout.gif) | 30240_Eclipse Doors ..> | 2026-01-05 14:42 | 47K | |
![[ ]](/icons/layout.gif) | 16988_Doorolla Ltd S..> | 2025-11-19 08:13 | 47K | |
![[ ]](/icons/layout.gif) | 23391_PB Doors Paul ..> | 2025-12-05 11:01 | 47K | |
![[ ]](/icons/layout.gif) | 25139_Evans Building..> | 2025-12-11 13:16 | 47K | |
![[ ]](/icons/layout.gif) | 1950_Eclipse Doors D..> | 2025-10-03 08:31 | 47K | |
![[ ]](/icons/layout.gif) | 30618_AS Industrial ..> | 2026-01-06 10:54 | 47K | |
![[ ]](/icons/layout.gif) | 7043_RP Manufacturin..> | 2025-10-22 13:03 | 47K | |
![[ ]](/icons/layout.gif) | 7579_T D Rollerdoors..> | 2025-10-23 13:54 | 47K | |
![[ ]](/icons/layout.gif) | 7941_Elevate Doors L..> | 2025-10-24 11:19 | 47K | |
![[ ]](/icons/layout.gif) | 23144_EcoGlaze Group..> | 2025-12-04 15:59 | 47K | |
![[ ]](/icons/layout.gif) | 6970_[0,0] Thomas Ne..> | 2025-10-22 12:41 | 47K | |
![[ ]](/icons/layout.gif) | 17412_J Bowman Garag..> | 2025-11-20 08:09 | 47K | |
![[ ]](/icons/layout.gif) | 2811_[0,0] Andy Sedd..> | 2025-10-07 14:57 | 47K | |
![[ ]](/icons/layout.gif) | 3574_J Brady Garage ..> | 2025-10-09 13:44 | 47K | |
![[ ]](/icons/layout.gif) | 16519_Bryan Thompson..> | 2025-11-18 11:00 | 47K | |
![[ ]](/icons/layout.gif) | 6779_Garage Door Sol..> | 2025-10-22 08:34 | 47K | |
![[ ]](/icons/layout.gif) | 7924_Rhino Windows A..> | 2025-10-24 11:10 | 47K | |
![[ ]](/icons/layout.gif) | 7925_Rhino Windows A..> | 2025-10-24 11:11 | 47K | |
![[ ]](/icons/layout.gif) | 14308_Ace Garage Doo..> | 2025-11-12 09:05 | 47K | |
![[ ]](/icons/layout.gif) | 21042_Rising Group L..> | 2025-11-28 16:14 | 47K | |
![[ ]](/icons/layout.gif) | 23605_TH Installatio..> | 2025-12-08 08:16 | 47K | |
![[ ]](/icons/layout.gif) | 7869_Michael Mazur M..> | 2025-10-24 09:23 | 47K | |
![[ ]](/icons/layout.gif) | 28974_Fortress Doors..> | 2025-12-23 10:39 | 47K | |
![[ ]](/icons/layout.gif) | 2232_C&M Glass Servi..> | 2025-10-06 08:26 | 47K | |
![[ ]](/icons/layout.gif) | 3089_Doors 4 Garages..> | 2025-10-08 11:56 | 47K | |
![[ ]](/icons/layout.gif) | 16795_Rollermatic Ga..> | 2025-11-18 15:34 | 47K | |
![[ ]](/icons/layout.gif) | 25755_Solidfix Home ..> | 2025-12-12 14:56 | 47K | |
![[ ]](/icons/layout.gif) | 9517_Absolute Garage..> | 2025-10-29 16:09 | 47K | |
![[ ]](/icons/layout.gif) | 16955_Doorolla Ltd S..> | 2025-11-19 07:45 | 47K | |
![[ ]](/icons/layout.gif) | 21037_Cotswold Conse..> | 2025-11-28 16:02 | 47K | |
![[ ]](/icons/layout.gif) | 23879_Dream Installa..> | 2025-12-08 13:36 | 47K | |
![[ ]](/icons/layout.gif) | 6977_Doorolla Ltd S ..> | 2025-10-22 12:45 | 47K | |
![[ ]](/icons/layout.gif) | 14464_Doorolla Ltd S..> | 2025-11-12 11:33 | 47K | |
![[ ]](/icons/layout.gif) | 15803_Absolute Garag..> | 2025-11-17 08:47 | 47K | |
![[ ]](/icons/layout.gif) | 16560_WADE WINDOWS I..> | 2025-11-18 11:30 | 47K | |
![[ ]](/icons/layout.gif) | 25584_Regal Windows ..> | 2025-12-12 12:24 | 47K | |
![[ ]](/icons/layout.gif) | 25585_Regal Windows ..> | 2025-12-12 12:25 | 47K | |
![[ ]](/icons/layout.gif) | 32789_Fortress Doors..> | 2026-01-13 12:29 | 47K | |
![[ ]](/icons/layout.gif) | 7410_Fortress Doors ..> | 2025-10-23 11:50 | 47K | |
![[ ]](/icons/layout.gif) | 13559_J Bowman Garag..> | 2025-11-11 07:53 | 47K | |
![[ ]](/icons/layout.gif) | 13669_Doorolla Ltd S..> | 2025-11-11 10:01 | 47K | |
![[ ]](/icons/layout.gif) | 16427_Millcourt Prop..> | 2025-11-18 09:32 | 47K | |
![[ ]](/icons/layout.gif) | 20522_AJ Trade Andre..> | 2025-11-27 16:03 | 47K | |
![[ ]](/icons/layout.gif) | 27668_Replacement Ga..> | 2025-12-18 09:37 | 47K | |
![[ ]](/icons/layout.gif) | 920_M & S Home Insta..> | 2025-09-25 14:43 | 47K | |
![[ ]](/icons/layout.gif) | 7694_Proud 2 Fix Mat..> | 2025-10-24 07:16 | 47K | |
![[ ]](/icons/layout.gif) | 18120_Monmouthshire ..> | 2025-11-21 11:40 | 47K | |
![[ ]](/icons/layout.gif) | 1651_[0,0] Fletcher ..> | 2025-10-01 14:50 | 47K | |
![[ ]](/icons/layout.gif) | 12194_Eastern Frames..> | 2025-11-06 09:51 | 47K | |
![[ ]](/icons/layout.gif) | 12200_Eastern Frames..> | 2025-11-06 09:53 | 47K | |
![[ ]](/icons/layout.gif) | 14275_Chelmsford Rol..> | 2025-11-12 08:24 | 47K | |
![[ ]](/icons/layout.gif) | 17405_J Bowman Garag..> | 2025-11-20 08:08 | 47K | |
![[ ]](/icons/layout.gif) | 18337_Absolute Garag..> | 2025-11-22 10:07 | 47K | |
![[ ]](/icons/layout.gif) | 7597_Chelmsford Roll..> | 2025-10-23 14:16 | 47K | |
![[ ]](/icons/layout.gif) | 30250_Eclipse Doors ..> | 2026-01-05 14:53 | 47K | |
![[ ]](/icons/layout.gif) | 6203_Rhino Windows A..> | 2025-10-20 12:46 | 47K | |
![[ ]](/icons/layout.gif) | 6209_Rhino Windows A..> | 2025-10-20 12:51 | 47K | |
![[ ]](/icons/layout.gif) | 7651_J Brady Garage ..> | 2025-10-24 06:39 | 47K | |
![[ ]](/icons/layout.gif) | 11701_Doorolla Ltd S..> | 2025-11-05 10:15 | 47K | |
![[ ]](/icons/layout.gif) | 12725_Replacement Ga..> | 2025-11-07 10:24 | 47K | |
![[ ]](/icons/layout.gif) | 1854_Absolute Garage..> | 2025-10-02 13:36 | 47K | |
![[ ]](/icons/layout.gif) | 22393_All Door Engin..> | 2025-12-03 11:55 | 47K | |
![[ ]](/icons/layout.gif) | 22555_Colin Adams Wi..> | 2025-12-03 14:07 | 47K | |
![[ ]](/icons/layout.gif) | 25200_WADE WINDOWS I..> | 2025-12-11 15:09 | 47K | |
![[ ]](/icons/layout.gif) | 28116_Doors 4 Garage..> | 2025-12-19 09:12 | 47K | |
![[ ]](/icons/layout.gif) | 32297_Doors 4 Garage..> | 2026-01-12 09:26 | 47K | |
![[ ]](/icons/layout.gif) | 11706_Doorolla Ltd S..> | 2025-11-05 10:18 | 47K | |
![[ ]](/icons/layout.gif) | 12740_Eclipse Doors ..> | 2025-11-07 10:40 | 47K | |
![[ ]](/icons/layout.gif) | 27103_Ross Garage Do..> | 2025-12-16 16:42 | 47K | |
![[ ]](/icons/layout.gif) | 27667_Replacement Ga..> | 2025-12-18 09:37 | 47K | |
![[ ]](/icons/layout.gif) | 27670_Replacement Ga..> | 2025-12-18 09:38 | 47K | |
![[ ]](/icons/layout.gif) | 29739_Elevate Doors ..> | 2026-01-02 11:35 | 47K | |
![[ ]](/icons/layout.gif) | 32765_Regal Windows ..> | 2026-01-13 12:10 | 47K | |
![[ ]](/icons/layout.gif) | 4768_The Garage Door..> | 2025-10-14 15:16 | 47K | |
![[ ]](/icons/layout.gif) | 12186_All Door Engin..> | 2025-11-06 09:48 | 47K | |
![[ ]](/icons/layout.gif) | 12188_All Door Engin..> | 2025-11-06 09:49 | 47K | |
![[ ]](/icons/layout.gif) | 15315_JDT Doors WV5 ..> | 2025-11-14 09:12 | 47K | |
![[ ]](/icons/layout.gif) | 31909_Grant Tilley G..> | 2026-01-09 08:58 | 47K | |
![[ ]](/icons/layout.gif) | 5826_Absolute Garage..> | 2025-10-17 10:55 | 47K | |
![[ ]](/icons/layout.gif) | 16127_The Garage Doo..> | 2025-11-17 14:57 | 47K | |
![[ ]](/icons/layout.gif) | 24734_Fortress Doors..> | 2025-12-10 13:28 | 47K | |
![[ ]](/icons/layout.gif) | 6618_P & R Door Syst..> | 2025-10-21 14:50 | 47K | |
![[ ]](/icons/layout.gif) | 6619_P & R Door Syst..> | 2025-10-21 14:52 | 47K | |
![[ ]](/icons/layout.gif) | 12156_Danbury Garage..> | 2025-11-06 09:39 | 47K | |
![[ ]](/icons/layout.gif) | 21215_MJS Installati..> | 2025-12-01 09:39 | 47K | |
![[ ]](/icons/layout.gif) | 25594_Replacement Ga..> | 2025-12-12 12:33 | 47K | |
![[ ]](/icons/layout.gif) | 27513_NTRAP NR11 7NZ..> | 2025-12-17 15:14 | 47K | |
![[ ]](/icons/layout.gif) | 12471_C&M Glass Serv..> | 2025-11-06 14:50 | 47K | |
![[ ]](/icons/layout.gif) | 2801_C&M Glass Servi..> | 2025-10-07 14:53 | 47K | |
![[ ]](/icons/layout.gif) | 5481_J Bowman Garage..> | 2025-10-16 13:38 | 47K | |
![[ ]](/icons/layout.gif) | 7661_Do Not Use Jame..> | 2025-10-24 06:47 | 47K | |
![[ ]](/icons/layout.gif) | 9323_CPS Custom Prop..> | 2025-10-29 11:10 | 47K | |
![[ ]](/icons/layout.gif) | 10342_J Brady Garage..> | 2025-10-31 12:42 | 47K | |
![[ ]](/icons/layout.gif) | 8833_JDL Plumbing Jo..> | 2025-10-28 11:07 | 47K | |
![[ ]](/icons/layout.gif) | 9018_Elevate Doors L..> | 2025-10-28 14:44 | 47K | |
![[ ]](/icons/layout.gif) | 12783_MJS Installati..> | 2025-11-07 11:32 | 47K | |
![[ ]](/icons/layout.gif) | 16736_Rollerdoors 24..> | 2025-11-18 14:38 | 47K | |
![[ ]](/icons/layout.gif) | 18290_Doorolla Ltd S..> | 2025-11-21 15:49 | 47K | |
![[ ]](/icons/layout.gif) | 18305_Doorolla Ltd S..> | 2025-11-21 16:19 | 47K | |
![[ ]](/icons/layout.gif) | 29743_Elevate Doors ..> | 2026-01-02 11:37 | 47K | |
![[ ]](/icons/layout.gif) | 9267_CPS - Custom Pr..> | 2025-10-29 09:17 | 47K | |
![[ ]](/icons/layout.gif) | 11579_Doors 4 Garage..> | 2025-11-05 08:43 | 47K | |
![[ ]](/icons/layout.gif) | 20174_Fortress Doors..> | 2025-11-27 09:56 | 47K | |
![[ ]](/icons/layout.gif) | 27810_Faith Home Imp..> | 2025-12-18 12:30 | 47K | |
![[ ]](/icons/layout.gif) | 6797_AJ Trade Andrew..> | 2025-10-22 08:41 | 47K | |
![[ ]](/icons/layout.gif) | 12842_M. A. E. Windo..> | 2025-11-07 13:42 | 47K | |
![[ ]](/icons/layout.gif) | 11367_J Brady Garage..> | 2025-11-04 13:28 | 47K | |
![[ ]](/icons/layout.gif) | 21120_TH Installatio..> | 2025-12-01 08:22 | 47K | |
![[ ]](/icons/layout.gif) | 22384_J Bowman Garag..> | 2025-12-03 11:45 | 47K | |
![[ ]](/icons/layout.gif) | 22440_Ross Garage Do..> | 2025-12-03 13:17 | 47K | |
![[ ]](/icons/layout.gif) | 28864_J Bowman Garag..> | 2025-12-23 09:21 | 47K | |
![[ ]](/icons/layout.gif) | 30660_Elite Glazing ..> | 2026-01-06 11:34 | 47K | |
![[ ]](/icons/layout.gif) | 7180_Beaver Plastic ..> | 2025-10-23 07:25 | 47K | |
![[ ]](/icons/layout.gif) | 7770_Gilberts Home I..> | 2025-10-24 08:45 | 47K | |
![[ ]](/icons/layout.gif) | 16543_Compass Constr..> | 2025-11-18 11:08 | 47K | |
![[ ]](/icons/layout.gif) | 26545_EcoGlaze Group..> | 2025-12-15 15:49 | 47K | |
![[ ]](/icons/layout.gif) | 28342_WADE WINDOWS I..> | 2025-12-19 14:59 | 47K | |
![[ ]](/icons/layout.gif) | 29223_Ross Garage Do..> | 2025-12-24 08:29 | 47K | |
![[ ]](/icons/layout.gif) | 11370_J Brady Garage..> | 2025-11-04 13:29 | 47K | |
![[ ]](/icons/layout.gif) | 11832_Windowcraft De..> | 2025-11-05 11:40 | 47K | |
![[ ]](/icons/layout.gif) | 12827_M. A. E. Windo..> | 2025-11-07 12:57 | 47K | |
![[ ]](/icons/layout.gif) | 15028_J Brady Garage..> | 2025-11-13 13:22 | 47K | |
![[ ]](/icons/layout.gif) | 20151_Chelmsford Rol..> | 2025-11-27 09:31 | 47K | |
![[ ]](/icons/layout.gif) | 3588_C&M Glass Servi..> | 2025-10-09 13:59 | 47K | |
![[ ]](/icons/layout.gif) | 18287_Doorolla Ltd S..> | 2025-11-21 15:47 | 47K | |
![[ ]](/icons/layout.gif) | 18302_Doorolla Ltd S..> | 2025-11-21 16:17 | 47K | |
![[ ]](/icons/layout.gif) | 20118_TH Installatio..> | 2025-11-27 08:44 | 47K | |
![[ ]](/icons/layout.gif) | 26625_T D Rollerdoor..> | 2025-12-16 07:53 | 47K | |
![[ ]](/icons/layout.gif) | 1856_Absolute Garage..> | 2025-10-02 13:37 | 47K | |
![[ ]](/icons/layout.gif) | 22382_J Bowman Garag..> | 2025-12-03 11:44 | 47K | |
![[ ]](/icons/layout.gif) | 24990_All Door Engin..> | 2025-12-11 10:03 | 47K | |
![[ ]](/icons/layout.gif) | 28868_J Bowman Garag..> | 2025-12-23 09:22 | 47K | |
![[ ]](/icons/layout.gif) | 29641_Fortress Doors..> | 2026-01-02 08:41 | 47K | |
![[ ]](/icons/layout.gif) | 29678_Garage Door Se..> | 2026-01-02 09:51 | 47K | |
![[ ]](/icons/layout.gif) | 29679_Garage Door Se..> | 2026-01-02 09:51 | 47K | |
![[ ]](/icons/layout.gif) | 5830_Absolute Garage..> | 2025-10-17 11:00 | 47K | |
![[ ]](/icons/layout.gif) | 8130_Garage Door Sol..> | 2025-10-25 10:15 | 47K | |
![[ ]](/icons/layout.gif) | 8896_B&B Electrical ..> | 2025-10-28 11:58 | 47K | |
![[ ]](/icons/layout.gif) | 17468_Gilberts Home ..> | 2025-11-20 09:19 | 47K | |
![[ ]](/icons/layout.gif) | 24349_Replacement Ga..> | 2025-12-09 11:51 | 47K | |
![[ ]](/icons/layout.gif) | 30162_All Doors Repa..> | 2026-01-05 13:07 | 47K | |
![[ ]](/icons/layout.gif) | 12191_All Door Engin..> | 2025-11-06 09:50 | 47K | |
![[ ]](/icons/layout.gif) | 6200_Rhino Windows A..> | 2025-10-20 12:44 | 47K | |
![[ ]](/icons/layout.gif) | 24347_Replacement Ga..> | 2025-12-09 11:50 | 47K | |
![[ ]](/icons/layout.gif) | 27507_NTRAP NR11 7NZ..> | 2025-12-17 15:05 | 47K | |
![[ ]](/icons/layout.gif) | 27730_Oakley Windows..> | 2025-12-18 11:15 | 47K | |
![[ ]](/icons/layout.gif) | 28827_Garage Door Se..> | 2025-12-23 08:23 | 47K | |
![[ ]](/icons/layout.gif) | 12028_Fortress Doors..> | 2025-11-05 15:09 | 47K | |
![[ ]](/icons/layout.gif) | 12734_Rollermatic Ga..> | 2025-11-07 10:38 | 47K | |
![[ ]](/icons/layout.gif) | 28972_Fortress Doors..> | 2025-12-23 10:39 | 47K | |
![[ ]](/icons/layout.gif) | 780_Gallagher Mainte..> | 2025-09-24 14:48 | 47K | |
![[ ]](/icons/layout.gif) | 2177_Rhino Windows A..> | 2025-10-03 14:37 | 47K | |
![[ ]](/icons/layout.gif) | 2860_Eco Windows & D..> | 2025-10-08 07:46 | 47K | |
![[ ]](/icons/layout.gif) | 3280_TH Installation..> | 2025-10-09 07:01 | 47K | |
![[ ]](/icons/layout.gif) | 7660_J Brady Garage ..> | 2025-10-24 06:46 | 47K | |
![[ ]](/icons/layout.gif) | 7859_Ffenestri Amlwc..> | 2025-10-24 09:20 | 47K | |
![[ ]](/icons/layout.gif) | 12706_C&M Glass Serv..> | 2025-11-07 09:59 | 47K | |
![[ ]](/icons/layout.gif) | 16793_Rollermatic Ga..> | 2025-11-18 15:32 | 47K | |
![[ ]](/icons/layout.gif) | 25198_Rhino Windows ..> | 2025-12-11 15:07 | 47K | |
![[ ]](/icons/layout.gif) | 26970_Entador System..> | 2025-12-16 14:36 | 47K | |
![[ ]](/icons/layout.gif) | 29643_Fortress Doors..> | 2026-01-02 08:42 | 47K | |
![[ ]](/icons/layout.gif) | 5476_Absolute Garage..> | 2025-10-16 13:29 | 47K | |
![[ ]](/icons/layout.gif) | 7659_Cromer Garage D..> | 2025-10-24 06:46 | 47K | |
![[ ]](/icons/layout.gif) | 7857_Do Not Use 1 Ma..> | 2025-10-24 09:19 | 47K | |
![[ ]](/icons/layout.gif) | 13555_J Bowman Garag..> | 2025-11-11 07:52 | 47K | |
![[ ]](/icons/layout.gif) | 15542_J Brady Garage..> | 2025-11-14 13:47 | 47K | |
![[ ]](/icons/layout.gif) | 23139_EcoGlaze Group..> | 2025-12-04 15:58 | 47K | |
![[ ]](/icons/layout.gif) | 20415_Rhino Windows ..> | 2025-11-27 12:27 | 47K | |
![[ ]](/icons/layout.gif) | 22379_J Bowman Garag..> | 2025-12-03 11:40 | 47K | |
![[ ]](/icons/layout.gif) | 28860_J Bowman Garag..> | 2025-12-23 09:20 | 47K | |
![[ ]](/icons/layout.gif) | 16789_Rollermatic Ga..> | 2025-11-18 15:29 | 47K | |
![[ ]](/icons/layout.gif) | 21342_NBG Doors Nick..> | 2025-12-01 12:00 | 47K | |
![[ ]](/icons/layout.gif) | 22391_Heavy Metal En..> | 2025-12-03 11:53 | 47K | |
![[ ]](/icons/layout.gif) | 28341_Fortress Doors..> | 2025-12-19 14:59 | 47K | |
![[ ]](/icons/layout.gif) | 2711_Ideal Industria..> | 2025-10-07 11:20 | 47K | |
![[ ]](/icons/layout.gif) | 18343_Absolute Garag..> | 2025-11-22 10:30 | 47K | |
![[ ]](/icons/layout.gif) | 29742_Elevate Doors ..> | 2026-01-02 11:37 | 47K | |
![[ ]](/icons/layout.gif) | 32749_J Brady Garage..> | 2026-01-13 11:58 | 47K | |
![[ ]](/icons/layout.gif) | 6220_Rhino Windows A..> | 2025-10-20 12:54 | 47K | |
![[ ]](/icons/layout.gif) | 19907_Elevate Doors ..> | 2025-11-26 12:01 | 47K | |
![[ ]](/icons/layout.gif) | 24413_Brightside Kit..> | 2025-12-09 13:26 | 47K | |
![[ ]](/icons/layout.gif) | 27671_Replacement Ga..> | 2025-12-18 09:40 | 47K | |
![[ ]](/icons/layout.gif) | 27797_EcoGlaze Group..> | 2025-12-18 12:12 | 47K | |
![[ ]](/icons/layout.gif) | 5266_M. A. E. Window..> | 2025-10-16 09:19 | 47K | |
![[ ]](/icons/layout.gif) | 7054_Fortress Doors ..> | 2025-10-22 13:07 | 47K | |
![[ ]](/icons/layout.gif) | 7852_Absolute Garage..> | 2025-10-24 09:15 | 47K | |
![[ ]](/icons/layout.gif) | 15797_Absolute Garag..> | 2025-11-17 08:36 | 47K | |
![[ ]](/icons/layout.gif) | 17378_Fortress Doors..> | 2025-11-19 15:50 | 47K | |
![[ ]](/icons/layout.gif) | 20527_St Helens Upvc..> | 2025-11-27 16:10 | 47K | |
![[ ]](/icons/layout.gif) | 20808_Eclipse Doors ..> | 2025-11-28 10:57 | 47K | |
![[ ]](/icons/layout.gif) | 22050_Tilehurst Home..> | 2025-12-02 13:45 | 47K | |
![[ ]](/icons/layout.gif) | 30633_CWG Home Impro..> | 2026-01-06 11:10 | 47K | |
![[ ]](/icons/layout.gif) | 31796_Moran Windows ..> | 2026-01-08 15:40 | 47K | |
![[ ]](/icons/layout.gif) | 9000_Elevate Doors L..> | 2025-10-28 14:22 | 47K | |
![[ ]](/icons/layout.gif) | 15544_J Brady Garage..> | 2025-11-14 13:48 | 47K | |
![[ ]](/icons/layout.gif) | 1565_Replacement Gar..> | 2025-10-01 09:43 | 47K | |
![[ ]](/icons/layout.gif) | 1599_CPS - Custom Pr..> | 2025-10-01 13:08 | 47K | |
![[ ]](/icons/layout.gif) | 12198_Eastern Frames..> | 2025-11-06 09:52 | 47K | |
![[ ]](/icons/layout.gif) | 18047_Ace Garage Doo..> | 2025-11-21 10:28 | 47K | |
![[ ]](/icons/layout.gif) | 23185_C & P Doors Cr..> | 2025-12-05 07:13 | 47K | |
![[ ]](/icons/layout.gif) | 2274_Ideal Industria..> | 2025-10-06 10:20 | 47K | |
![[ ]](/icons/layout.gif) | 11722_Gilberts Home ..> | 2025-11-05 10:26 | 47K | |
![[ ]](/icons/layout.gif) | 16925_Gilberts Home ..> | 2025-11-19 07:28 | 47K | |
![[ ]](/icons/layout.gif) | 19401_P & R Door Sys..> | 2025-11-25 16:01 | 47K | |
![[ ]](/icons/layout.gif) | 19543_P & R Door Sys..> | 2025-11-25 17:00 | 47K | |
![[ ]](/icons/layout.gif) | 22560_Norfolk Roller..> | 2025-12-03 14:11 | 47K | |
![[ ]](/icons/layout.gif) | 28119_Doors 4 Garage..> | 2025-12-19 09:13 | 47K | |
![[ ]](/icons/layout.gif) | 32288_Doors 4 Garage..> | 2026-01-12 09:25 | 47K | |
![[ ]](/icons/layout.gif) | 8917_EcoGlaze Group ..> | 2025-10-28 12:16 | 47K | |
![[ ]](/icons/layout.gif) | 9266_ASSW Ltd BS10 7..> | 2025-10-29 09:15 | 47K | |
![[ ]](/icons/layout.gif) | 17376_Chelmsford Rol..> | 2025-11-19 15:50 | 47K | |
![[ ]](/icons/layout.gif) | 14280_Chelmsford Rol..> | 2025-11-12 08:27 | 47K | |
![[ ]](/icons/layout.gif) | 19651_Keswick Develo..> | 2025-11-26 08:47 | 47K | |
![[ ]](/icons/layout.gif) | 22812_JJ Secure Door..> | 2025-12-04 10:34 | 47K | |
![[ ]](/icons/layout.gif) | 30289_Eclipse Doors ..> | 2026-01-05 15:11 | 47K | |
![[ ]](/icons/layout.gif) | 1851_Absolute Garage..> | 2025-10-02 13:35 | 47K | |
![[ ]](/icons/layout.gif) | 6154_Highlands Elect..> | 2025-10-20 11:06 | 47K | |
![[ ]](/icons/layout.gif) | 25548_Doorolla Ltd S..> | 2025-12-12 12:03 | 47K | |
![[ ]](/icons/layout.gif) | 26750_Sargent & Powe..> | 2025-12-16 10:42 | 47K | |
![[ ]](/icons/layout.gif) | 28856_Sargent & Powe..> | 2025-12-23 09:19 | 47K | |
![[ ]](/icons/layout.gif) | 30304_Warnsham Windo..> | 2026-01-05 15:34 | 47K | |
![[ ]](/icons/layout.gif) | 1928_M. A. E. Window..> | 2025-10-03 07:16 | 47K | |
![[ ]](/icons/layout.gif) | 7860_Heavy Metal Eng..> | 2025-10-24 09:21 | 47K | |
![[ ]](/icons/layout.gif) | 17680_UK Door System..> | 2025-11-20 14:13 | 47K | |
![[ ]](/icons/layout.gif) | 27725_Chiltern Doors..> | 2025-12-18 11:11 | 47K | |
![[ ]](/icons/layout.gif) | 28346_Dream Installa..> | 2025-12-19 15:01 | 47K | |
![[ ]](/icons/layout.gif) | 32024_J Brady Garage..> | 2026-01-09 12:01 | 47K | |
![[ ]](/icons/layout.gif) | 14111_UK Door System..> | 2025-11-11 16:18 | 47K | |
![[ ]](/icons/layout.gif) | 28344_Dream Installa..> | 2025-12-19 15:00 | 47K | |
![[ ]](/icons/layout.gif) | 30288_Eclipse Doors ..> | 2026-01-05 15:09 | 47K | |
![[ ]](/icons/layout.gif) | 1861_M. A. E. Window..> | 2025-10-02 13:44 | 47K | |
![[ ]](/icons/layout.gif) | 11720_Gilberts Home ..> | 2025-11-05 10:26 | 47K | |
![[ ]](/icons/layout.gif) | 24200_BBA Developmen..> | 2025-12-09 09:52 | 47K | |
![[ ]](/icons/layout.gif) | 615_Roll Right Garag..> | 2025-09-23 15:29 | 47K | |
![[ ]](/icons/layout.gif) | 2707_MJS Installatio..> | 2025-10-07 11:14 | 47K | |
![[ ]](/icons/layout.gif) | 14171_Chiltern Doors..> | 2025-11-12 07:22 | 47K | |
![[ ]](/icons/layout.gif) | 18859_EcoGlaze Group..> | 2025-11-25 07:59 | 47K | |
![[ ]](/icons/layout.gif) | 30242_Eclipse Doors ..> | 2026-01-05 14:44 | 47K | |
![[ ]](/icons/layout.gif) | 614_Roll Right Garag..> | 2025-09-23 15:29 | 47K | |
![[ ]](/icons/layout.gif) | 16255_Barry Whitehea..> | 2025-11-18 08:01 | 47K | |
![[ ]](/icons/layout.gif) | 19548_Cartwright Win..> | 2025-11-25 17:02 | 47K | |
![[ ]](/icons/layout.gif) | 32227_J Bowman Garag..> | 2026-01-12 08:34 | 47K | |
![[ ]](/icons/layout.gif) | 7692_NBC Commercial ..> | 2025-10-24 07:13 | 47K | |
![[ ]](/icons/layout.gif) | 24344_Replacement Ga..> | 2025-12-09 11:48 | 47K | |
![[ ]](/icons/layout.gif) | 24478_EcoGlaze Group..> | 2025-12-09 15:26 | 47K | |
![[ ]](/icons/layout.gif) | 27112_Elevate Doors ..> | 2025-12-16 16:46 | 47K | |
![[ ]](/icons/layout.gif) | 6469_Go Garage Doors..> | 2025-10-21 10:36 | 47K | |
![[ ]](/icons/layout.gif) | 6627_Rollermatic Gar..> | 2025-10-21 14:56 | 47K | |
![[ ]](/icons/layout.gif) | 7377_East Anglia Rol..> | 2025-10-23 11:27 | 47K | |
![[ ]](/icons/layout.gif) | 7854_NW Automatic Do..> | 2025-10-24 09:17 | 47K | |
![[ ]](/icons/layout.gif) | 10246_All Door Engin..> | 2025-10-31 11:39 | 47K | |
![[ ]](/icons/layout.gif) | 16787_Rollermatic Ga..> | 2025-11-18 15:28 | 47K | |
![[ ]](/icons/layout.gif) | 32960_Sargent & Powe..> | 2026-01-13 16:28 | 47K | |
![[ ]](/icons/layout.gif) | 6597_Absolute Garage..> | 2025-10-21 14:06 | 47K | |
![[ ]](/icons/layout.gif) | 6567_M. A. E. Window..> | 2025-10-21 13:10 | 47K | |
![[ ]](/icons/layout.gif) | 22553_Colin Adams Wi..> | 2025-12-03 14:06 | 47K | |
![[ ]](/icons/layout.gif) | 26486_Solidfix Home ..> | 2025-12-15 14:16 | 47K | |
![[ ]](/icons/layout.gif) | 27796_Elegant Window..> | 2025-12-18 12:10 | 47K | |
![[ ]](/icons/layout.gif) | 32230_J Bowman Garag..> | 2026-01-12 08:35 | 47K | |
![[ ]](/icons/layout.gif) | 1414_Doorolla S Terr..> | 2025-09-30 12:52 | 47K | |
![[ ]](/icons/layout.gif) | 8993_Avon Automated ..> | 2025-10-28 14:19 | 47K | |
![[ ]](/icons/layout.gif) | 23137_EcoGlaze Group..> | 2025-12-04 15:55 | 47K | |
![[ ]](/icons/layout.gif) | 7407_All Doors Repai..> | 2025-10-23 11:47 | 47K | |
![[ ]](/icons/layout.gif) | 11668_Gilberts Home ..> | 2025-11-05 09:55 | 47K | |
![[ ]](/icons/layout.gif) | 20836_Eclipse Doors ..> | 2025-11-28 11:38 | 47K | |
![[ ]](/icons/layout.gif) | 21647_Go Garage Door..> | 2025-12-02 07:58 | 47K | |
![[ ]](/icons/layout.gif) | 8717_Absolute Garage..> | 2025-10-28 08:31 | 47K | |
![[ ]](/icons/layout.gif) | 8770_J Brady Garage ..> | 2025-10-28 09:38 | 47K | |
![[ ]](/icons/layout.gif) | 10288_Adams Industri..> | 2025-10-31 11:56 | 47K | |
![[ ]](/icons/layout.gif) | 30476_Ideal Industri..> | 2026-01-06 08:39 | 47K | |
![[ ]](/icons/layout.gif) | 12782_MJS Installati..> | 2025-11-07 11:31 | 47K | |
![[ ]](/icons/layout.gif) | 26859_Charles Brown ..> | 2025-12-16 13:05 | 47K | |
![[ ]](/icons/layout.gif) | 27694_Guy Hubbard Do..> | 2025-12-18 09:55 | 47K | |
![[ ]](/icons/layout.gif) | 32839_J Brady Garage..> | 2026-01-13 13:05 | 47K | |
![[ ]](/icons/layout.gif) | 32840_J Brady Garage..> | 2026-01-13 13:07 | 47K | |
![[ ]](/icons/layout.gif) | 7855_NW Automatic Do..> | 2025-10-24 09:18 | 47K | |
![[ ]](/icons/layout.gif) | 15540_J Brady Garage..> | 2025-11-14 13:46 | 47K | |
![[ ]](/icons/layout.gif) | 22589_Garage Door So..> | 2025-12-03 14:52 | 47K | |
![[ ]](/icons/layout.gif) | 27068_Rollermatic Ga..> | 2025-12-16 16:26 | 47K | |
![[ ]](/icons/layout.gif) | 27110_Elevate Doors ..> | 2025-12-16 16:45 | 47K | |
![[ ]](/icons/layout.gif) | 17136_T D Rollerdoor..> | 2025-11-19 11:04 | 47K | |
![[ ]](/icons/layout.gif) | 17139_Rollermatic Ga..> | 2025-11-19 11:06 | 47K | |
![[ ]](/icons/layout.gif) | 22023_CPS Custom Pro..> | 2025-12-02 13:16 | 47K | |
![[ ]](/icons/layout.gif) | 31225_Adams Industri..> | 2026-01-07 15:02 | 47K | |
![[ ]](/icons/layout.gif) | 7773_Gilberts Home I..> | 2025-10-24 08:46 | 47K | |
![[ ]](/icons/layout.gif) | 25731_P & R Door Sys..> | 2025-12-12 14:18 | 47K | |
![[ ]](/icons/layout.gif) | 27085_Rollermatic Ga..> | 2025-12-16 16:31 | 47K | |
![[ ]](/icons/layout.gif) | 32285_Rhino Windows ..> | 2026-01-12 09:23 | 47K | |
![[ ]](/icons/layout.gif) | 9011_Elevate Doors L..> | 2025-10-28 14:40 | 47K | |
![[ ]](/icons/layout.gif) | 12158_J Brady Garage..> | 2025-11-06 09:40 | 47K | |
![[ ]](/icons/layout.gif) | 15295_Doors 4 Garage..> | 2025-11-14 09:01 | 47K | |
![[ ]](/icons/layout.gif) | 6613_Rollermatic Gar..> | 2025-10-21 14:46 | 47K | |
![[ ]](/icons/layout.gif) | 22369_Doorolla Ltd S..> | 2025-12-03 11:27 | 47K | |
![[ ]](/icons/layout.gif) | 27204_EcoGlaze Group..> | 2025-12-17 09:05 | 47K | |
![[ ]](/icons/layout.gif) | 29018_J Brady Garage..> | 2025-12-23 11:36 | 47K | |
![[ ]](/icons/layout.gif) | 25192_Rhino Windows ..> | 2025-12-11 15:02 | 47K | |
![[ ]](/icons/layout.gif) | 30487_Rhino Windows ..> | 2026-01-06 08:55 | 47K | |
![[ ]](/icons/layout.gif) | 7653_J Brady Garage ..> | 2025-10-24 06:42 | 47K | |
![[ ]](/icons/layout.gif) | 7658_Cromer Garage D..> | 2025-10-24 06:45 | 47K | |
![[ ]](/icons/layout.gif) | 21224_Elegant Window..> | 2025-12-01 09:43 | 47K | |
![[ ]](/icons/layout.gif) | 28338_Fortress Doors..> | 2025-12-19 14:57 | 47K | |
![[ ]](/icons/layout.gif) | 13833_Roll Right Gar..> | 2025-11-11 13:13 | 47K | |
![[ ]](/icons/layout.gif) | 22568_Norfolk Roller..> | 2025-12-03 14:23 | 47K | |
![[ ]](/icons/layout.gif) | 20863_Elegant Window..> | 2025-11-28 11:55 | 47K | |
![[ ]](/icons/layout.gif) | 22366_MNH Windows & ..> | 2025-12-03 11:23 | 47K | |
![[ ]](/icons/layout.gif) | 9014_Elevate Doors L..> | 2025-10-28 14:41 | 47K | |
![[ ]](/icons/layout.gif) | 6629_Rollermatic Gar..> | 2025-10-21 14:57 | 47K | |
![[ ]](/icons/layout.gif) | 7655_J Brady Garage ..> | 2025-10-24 06:43 | 47K | |
![[ ]](/icons/layout.gif) | 10265_Doorolla Ltd S..> | 2025-10-31 11:44 | 47K | |
![[ ]](/icons/layout.gif) | 19828_SDS (Isle Of M..> | 2025-11-26 11:45 | 47K | |
![[ ]](/icons/layout.gif) | 27119_Elevate Doors ..> | 2025-12-16 16:51 | 47K | |
![[ ]](/icons/layout.gif) | 30255_Eclipse Doors ..> | 2026-01-05 14:55 | 47K | |
![[ ]](/icons/layout.gif) | 33018_T D Rollerdoor..> | 2026-01-14 08:51 | 47K | |
![[ ]](/icons/layout.gif) | 547_Fix My Garage Do..> | 2025-09-23 11:15 | 47K | |
![[ ]](/icons/layout.gif) | 16060_Hadrian Joiner..> | 2025-11-17 13:21 | 47K | |
![[ ]](/icons/layout.gif) | 20162_Chelmsford Rol..> | 2025-11-27 09:47 | 47K | |
![[ ]](/icons/layout.gif) | 22380_J Bowman Garag..> | 2025-12-03 11:42 | 47K | |
![[ ]](/icons/layout.gif) | 33062_Absolute Garag..> | 2026-01-14 09:25 | 47K | |
![[ ]](/icons/layout.gif) | 612_Roll Right Garag..> | 2025-09-23 15:27 | 47K | |
![[ ]](/icons/layout.gif) | 2858_Eco Windows & D..> | 2025-10-08 07:45 | 47K | |
![[ ]](/icons/layout.gif) | 13715_Guy Hubbard Do..> | 2025-11-11 10:16 | 47K | |
![[ ]](/icons/layout.gif) | 20153_Chelmsford Rol..> | 2025-11-27 09:33 | 47K | |
![[ ]](/icons/layout.gif) | 27122_Elevate Doors ..> | 2025-12-16 16:52 | 47K | |
![[ ]](/icons/layout.gif) | 25476_CPS Custom Pro..> | 2025-12-12 10:47 | 47K | |
![[ ]](/icons/layout.gif) | 8649_AOS Outdoor Kit..> | 2025-10-27 16:20 | 47K | |
![[ ]](/icons/layout.gif) | 12738_Rollermatic Ga..> | 2025-11-07 10:40 | 47K | |
![[ ]](/icons/layout.gif) | 22037_P & R Door Sys..> | 2025-12-02 13:38 | 47K | |
![[ ]](/icons/layout.gif) | 6600_Absolute Garage..> | 2025-10-21 14:07 | 47K | |
![[ ]](/icons/layout.gif) | 6601_Absolute Garage..> | 2025-10-21 14:07 | 47K | |
![[ ]](/icons/layout.gif) | 6615_Rollermatic Gar..> | 2025-10-21 14:48 | 47K | |
![[ ]](/icons/layout.gif) | 6616_Rollermatic Gar..> | 2025-10-21 14:49 | 47K | |
![[ ]](/icons/layout.gif) | 1348_AAES Electrical..> | 2025-09-30 07:12 | 47K | |
![[ ]](/icons/layout.gif) | 27233_Rollermatic Ga..> | 2025-12-17 09:28 | 47K | |
![[ ]](/icons/layout.gif) | 7395_Garage Door Sol..> | 2025-10-23 11:40 | 47K | |
![[ ]](/icons/layout.gif) | 7917_Garage Door Rep..> | 2025-10-24 11:05 | 47K | |
![[ ]](/icons/layout.gif) | 7918_Garage Door Rep..> | 2025-10-24 11:05 | 47K | |
![[ ]](/icons/layout.gif) | 7399_Garage Door Sol..> | 2025-10-23 11:42 | 47K | |
![[ ]](/icons/layout.gif) | 8696_P & R Door Syst..> | 2025-10-28 08:07 | 47K | |
![[ ]](/icons/layout.gif) | 22444_Elevate Doors ..> | 2025-12-03 13:18 | 47K | |
![[ ]](/icons/layout.gif) | 7230_Go Garage Doors..> | 2025-10-23 09:05 | 47K | |
![[ ]](/icons/layout.gif) | 7604_Doorolla Ltd St..> | 2025-10-23 14:32 | 47K | |
![[ ]](/icons/layout.gif) | 1864_M. A. E. Window..> | 2025-10-02 13:45 | 47K | |
![[ ]](/icons/layout.gif) | 1926_M. A. E. Window..> | 2025-10-03 07:15 | 47K | |
![[ ]](/icons/layout.gif) | 28821_Rhino Windows ..> | 2025-12-23 08:13 | 47K | |
![[ ]](/icons/layout.gif) | 32823_Eastern Frames..> | 2026-01-13 12:54 | 47K | |
![[ ]](/icons/layout.gif) | 22046_Oakley Windows..> | 2025-12-02 13:42 | 47K | |
![[ ]](/icons/layout.gif) | 18434_AOS Outdoor Ki..> | 2025-11-24 08:28 | 47K | |
![[ ]](/icons/layout.gif) | 21641_Go Garage Door..> | 2025-12-02 07:57 | 47K | |
![[ ]](/icons/layout.gif) | 27231_Rollermatic Ga..> | 2025-12-17 09:27 | 47K | |
![[ ]](/icons/layout.gif) | 7016_Doorolla Ltd S ..> | 2025-10-22 12:53 | 47K | |
![[ ]](/icons/layout.gif) | 6604_Absolute Garage..> | 2025-10-21 14:08 | 47K | |
![[ ]](/icons/layout.gif) | 32756_Avon Automated..> | 2026-01-13 12:05 | 47K | |
![[ ]](/icons/layout.gif) | 3647_Absolute Garage..> | 2025-10-09 16:03 | 47K | |
![[ ]](/icons/layout.gif) | 20880_S Warrender El..> | 2025-11-28 12:09 | 47K | |
![[ ]](/icons/layout.gif) | 30478_EcoGlaze Group..> | 2026-01-06 08:43 | 47K | |
![[ ]](/icons/layout.gif) | 15044_Go Garage Door..> | 2025-11-13 13:48 | 47K | |
![[ ]](/icons/layout.gif) | 15046_Go Garage Door..> | 2025-11-13 13:49 | 47K | |
![[ ]](/icons/layout.gif) | 27083_Rollermatic Ga..> | 2025-12-16 16:30 | 47K | |
![[ ]](/icons/layout.gif) | 32811_Fortress Doors..> | 2026-01-13 12:48 | 47K | |
![[ ]](/icons/layout.gif) | 15026_Eclipse Doors ..> | 2025-11-13 13:21 | 47K | |
![[ ]](/icons/layout.gif) | 2662_Elegant Windows..> | 2025-10-07 09:50 | 47K | |
![[ ]](/icons/layout.gif) | 12741_Eclipse Doors ..> | 2025-11-07 10:43 | 47K | |
![[ ]](/icons/layout.gif) | 12764_Eclipse Doors ..> | 2025-11-07 11:21 | 47K | |
![[ ]](/icons/layout.gif) | 13993_Piper Window S..> | 2025-11-11 14:34 | 47K | |
![[ ]](/icons/layout.gif) | 32766_Regal Windows ..> | 2026-01-13 12:10 | 47K | |
![[ ]](/icons/layout.gif) | 17466_Gilberts Home ..> | 2025-11-20 09:18 | 47K | |
![[ ]](/icons/layout.gif) | 6807_Go Garage Doors..> | 2025-10-22 08:47 | 47K | |
![[ ]](/icons/layout.gif) | 29950_Go Garage Door..> | 2026-01-05 08:34 | 47K | |
![[ ]](/icons/layout.gif) | 30066_Go Garage Door..> | 2026-01-05 11:20 | 47K | |
![[ ]](/icons/layout.gif) | 9020_Elevate Doors L..> | 2025-10-28 14:46 | 47K | |
![[ ]](/icons/layout.gif) | 18152_Avon Automated..> | 2025-11-21 12:29 | 47K | |
![[ ]](/icons/layout.gif) | 25125_The Lothian Ga..> | 2025-12-11 13:14 | 47K | |
![[ ]](/icons/layout.gif) | 17088_Heavy Metal En..> | 2025-11-19 09:45 | 47K | |
![[ ]](/icons/layout.gif) | 26963_Warnsham Windo..> | 2025-12-16 14:32 | 47K | |
![[ ]](/icons/layout.gif) | 27081_Rollermatic Ga..> | 2025-12-16 16:29 | 47K | |
![[ ]](/icons/layout.gif) | 30901_Norfolk Broads..> | 2026-01-06 15:27 | 47K | |
![[ ]](/icons/layout.gif) | 7394_Garage Door Sol..> | 2025-10-23 11:39 | 47K | |
![[ ]](/icons/layout.gif) | 8554_Go Garage Doors..> | 2025-10-27 14:46 | 47K | |
![[ ]](/icons/layout.gif) | 22634_Cerromar Solut..> | 2025-12-04 07:16 | 47K | |
![[ ]](/icons/layout.gif) | 6216_Rhino Windows A..> | 2025-10-20 12:53 | 47K | |
![[ ]](/icons/layout.gif) | 7776_Gilberts Home I..> | 2025-10-24 08:48 | 47K | |
![[ ]](/icons/layout.gif) | 7774_Gilberts Home I..> | 2025-10-24 08:47 | 47K | |
![[ ]](/icons/layout.gif) | 16555_Heavy Metal En..> | 2025-11-18 11:21 | 47K | |
![[ ]](/icons/layout.gif) | 27096_Warnsham Windo..> | 2025-12-16 16:40 | 47K | |
![[ ]](/icons/layout.gif) | 32282_Rhino Windows ..> | 2026-01-12 09:22 | 47K | |
![[ ]](/icons/layout.gif) | 6622_P & R Door Syst..> | 2025-10-21 14:53 | 47K | |
![[ ]](/icons/layout.gif) | 26459_L W Bennion Bu..> | 2025-12-15 13:52 | 47K | |
![[ ]](/icons/layout.gif) | 27100_Gilberts Home ..> | 2025-12-16 16:41 | 47K | |
![[ ]](/icons/layout.gif) | 20149_Chelmsford Rol..> | 2025-11-27 09:30 | 47K | |
![[ ]](/icons/layout.gif) | 8809_Wellingborough ..> | 2025-10-28 10:09 | 47K | |
![[ ]](/icons/layout.gif) | 11388_Garage Door So..> | 2025-11-04 13:39 | 47K | |
![[ ]](/icons/layout.gif) | 31752_LNR Door Solut..> | 2026-01-08 15:16 | 47K | |
![[ ]](/icons/layout.gif) | 32819_Dream Installa..> | 2026-01-13 12:52 | 47K | |
![[ ]](/icons/layout.gif) | 32837_J Brady Garage..> | 2026-01-13 13:04 | 47K | |
![[ ]](/icons/layout.gif) | 22039_J Brady Garage..> | 2025-12-02 13:39 | 47K | |
![[ ]](/icons/layout.gif) | 11380_Garage Door So..> | 2025-11-04 13:37 | 47K | |
![[ ]](/icons/layout.gif) | 23147_EcoGlaze Group..> | 2025-12-04 16:01 | 47K | |
![[ ]](/icons/layout.gif) | 6509_Roll Right Gara..> | 2025-10-21 12:21 | 47K | |
![[ ]](/icons/layout.gif) | 7765_Roll Right Gara..> | 2025-10-24 08:39 | 47K | |
![[ ]](/icons/layout.gif) | 28334_Warnsham Windo..> | 2025-12-19 14:56 | 47K | |
![[ ]](/icons/layout.gif) | 20158_Chelmsford Rol..> | 2025-11-27 09:45 | 47K | |
![[ ]](/icons/layout.gif) | 21644_Go Garage Door..> | 2025-12-02 07:58 | 47K | |
![[ ]](/icons/layout.gif) | 30149_All Doors Repa..> | 2026-01-05 12:58 | 47K | |
![[ ]](/icons/layout.gif) | 6221_Rhino Windows A..> | 2025-10-20 12:54 | 47K | |
![[ ]](/icons/layout.gif) | 18427_Roll Right Gar..> | 2025-11-24 08:20 | 47K | |
![[ ]](/icons/layout.gif) | 23409_Wellingborough..> | 2025-12-05 11:15 | 47K | |
![[ ]](/icons/layout.gif) | 28336_Warnsham Windo..> | 2025-12-19 14:57 | 47K | |
![[ ]](/icons/layout.gif) | 21637_Go Garage Door..> | 2025-12-02 07:57 | 47K | |
![[ ]](/icons/layout.gif) | 21702_Ideal Industri..> | 2025-12-02 08:58 | 47K | |
![[ ]](/icons/layout.gif) | 27798_EcoGlaze Group..> | 2025-12-18 12:13 | 47K | |
![[ ]](/icons/layout.gif) | 14276_Chelmsford Rol..> | 2025-11-12 08:24 | 47K | |
![[ ]](/icons/layout.gif) | 12148_Avon Automated..> | 2025-11-06 09:36 | 47K | |
![[ ]](/icons/layout.gif) | 30815_M. A. E. Windo..> | 2026-01-06 14:18 | 47K | |
![[ ]](/icons/layout.gif) | 20116_Roll Right Gar..> | 2025-11-27 08:42 | 47K | |
![[ ]](/icons/layout.gif) | 27989_Garage Door So..> | 2025-12-18 16:31 | 47K | |
![[ ]](/icons/layout.gif) | 31227_M. A. E. Windo..> | 2026-01-07 15:11 | 47K | |
![[ ]](/icons/layout.gif) | 32825_Eastern Frames..> | 2026-01-13 12:55 | 47K | |
![[ ]](/icons/layout.gif) | 18161_Rollermatic Ga..> | 2025-11-21 12:36 | 47K | |
![[ ]](/icons/layout.gif) | 7594_Chelmsford Roll..> | 2025-10-23 14:15 | 47K | |
![[ ]](/icons/layout.gif) | 7693_Wellingborough ..> | 2025-10-24 07:14 | 47K | |
![[ ]](/icons/layout.gif) | 23406_T D Rollerdoor..> | 2025-12-05 11:14 | 47K | |
![[ ]](/icons/layout.gif) | 30317_Charles Brown ..> | 2026-01-05 15:52 | 47K | |
![[ ]](/icons/layout.gif) | 25108_The Lothian Ga..> | 2025-12-11 13:04 | 47K | |
![[ ]](/icons/layout.gif) | 7393_Garage Door Sol..> | 2025-10-23 11:38 | 47K | |
![[ ]](/icons/layout.gif) | 12061_Garage Door So..> | 2025-11-05 15:34 | 47K | |
![[ ]](/icons/layout.gif) | 20107_Roll Right Gar..> | 2025-11-27 08:36 | 47K | |
![[ ]](/icons/layout.gif) | 28362_Avon Automated..> | 2025-12-19 15:10 | 47K | |
![[ ]](/icons/layout.gif) | 32961_Sargent & Powe..> | 2026-01-13 16:29 | 47K | |
![[ ]](/icons/layout.gif) | 29619_The Lothian Ga..> | 2026-01-02 08:22 | 47K | |
![[ ]](/icons/layout.gif) | 10285_Avon Automated..> | 2025-10-31 11:54 | 47K | |
![[ ]](/icons/layout.gif) | 12150_Avon Automated..> | 2025-11-06 09:37 | 47K | |
![[ ]](/icons/layout.gif) | 18147_Avon Automated..> | 2025-11-21 12:21 | 47K | |
![[ ]](/icons/layout.gif) | 18430_Roll Right Gar..> | 2025-11-24 08:21 | 47K | |
![[ ]](/icons/layout.gif) | 22446_Elevate Doors ..> | 2025-12-03 13:19 | 47K | |
![[ ]](/icons/layout.gif) | 9853_M. A. E. Window..> | 2025-10-30 14:02 | 47K | |
![[ ]](/icons/layout.gif) | 14496_The Lothian Ga..> | 2025-11-12 11:50 | 47K | |
![[ ]](/icons/layout.gif) | 22080_Taundry Doors ..> | 2025-12-02 14:31 | 47K | |
![[ ]](/icons/layout.gif) | 29232_Avon Automated..> | 2025-12-24 08:36 | 47K | |
![[ ]](/icons/layout.gif) | 32815_East Anglia Ro..> | 2026-01-13 12:50 | 47K | |
![[ ]](/icons/layout.gif) | 7762_Roll Right Gara..> | 2025-10-24 08:36 | 47K | |
![[ ]](/icons/layout.gif) | 22557_A Complete Win..> | 2025-12-03 14:09 | 47K | |
![[ ]](/icons/layout.gif) | 31501_SDS (Isle Of M..> | 2026-01-08 09:44 | 47K | |
![[ ]](/icons/layout.gif) | 25112_The Lothian Ga..> | 2025-12-11 13:08 | 47K | |
![[ ]](/icons/layout.gif) | 31949_Eastern Frames..> | 2026-01-09 10:07 | 47K | |
![[ ]](/icons/layout.gif) | 18149_Avon Automated..> | 2025-11-21 12:23 | 47K | |
![[ ]](/icons/layout.gif) | 20114_Roll Right Gar..> | 2025-11-27 08:40 | 47K | |
![[ ]](/icons/layout.gif) | 12775_Rollermatic Ga..> | 2025-11-07 11:29 | 47K | |
![[ ]](/icons/layout.gif) | 20121_Ideal Industri..> | 2025-11-27 08:47 | 47K | |
![[ ]](/icons/layout.gif) | 27042_Elevate Doors ..> | 2025-12-16 15:56 | 47K | |
![[ ]](/icons/layout.gif) | 6759_Midland Garage ..> | 2025-10-22 08:05 | 47K | |
![[ ]](/icons/layout.gif) | 26666_M. A. E. Windo..> | 2025-12-16 09:08 | 47K | |
![[ ]](/icons/layout.gif) | 6630_Rollermatic Gar..> | 2025-10-21 14:57 | 47K | |
![[ ]](/icons/layout.gif) | 6918_Absolute Garage..> | 2025-10-22 11:25 | 47K | |
![[ ]](/icons/layout.gif) | 12154_Danbury Garage..> | 2025-11-06 09:39 | 47K | |
![[ ]](/icons/layout.gif) | 22546_Avon Automated..> | 2025-12-03 14:03 | 47K | |
![[ ]](/icons/layout.gif) | 31793_The Lothian Ga..> | 2026-01-08 15:39 | 47K | |
![[ ]](/icons/layout.gif) | 12779_Rollermatic Ga..> | 2025-11-07 11:30 | 47K | |
![[ ]](/icons/layout.gif) | 22813_JJ Secure Door..> | 2025-12-04 10:34 | 47K | |
![[ ]](/icons/layout.gif) | 27721_Avon Automated..> | 2025-12-18 10:59 | 47K | |
![[ ]](/icons/layout.gif) | 3225_M. A. E. Window..> | 2025-10-08 16:01 | 47K | |
![[ ]](/icons/layout.gif) | 7767_Rollermatic Gar..> | 2025-10-24 08:40 | 47K | |
![[ ]](/icons/layout.gif) | 29622_The Lothian Ga..> | 2026-01-02 08:22 | 47K | |
![[ ]](/icons/layout.gif) | 12143_Avon Automated..> | 2025-11-06 09:35 | 47K | |
![[ ]](/icons/layout.gif) | 28364_Avon Automated..> | 2025-12-19 15:11 | 47K | |
![[ ]](/icons/layout.gif) | 12152_Avon Automated..> | 2025-11-06 09:38 | 47K | |
![[ ]](/icons/layout.gif) | 13597_NW Automatic D..> | 2025-11-11 08:34 | 47K | |
![[ ]](/icons/layout.gif) | 21635_Go Garage Door..> | 2025-12-02 07:56 | 47K | |
![[ ]](/icons/layout.gif) | 31025_M. A. E. Windo..> | 2026-01-07 09:25 | 47K | |
![[ ]](/icons/layout.gif) | 26762_SDS (Isle Of M..> | 2025-12-16 10:54 | 47K | |
![[ ]](/icons/layout.gif) | 14325_M. A. E. Windo..> | 2025-11-12 09:18 | 47K | |
![[ ]](/icons/layout.gif) | 13602_NW Automatic D..> | 2025-11-11 08:36 | 47K | |
![[ ]](/icons/layout.gif) | 7775_Gilberts Home I..> | 2025-10-24 08:48 | 47K | |
![[ ]](/icons/layout.gif) | 30082_M. A. E. Windo..> | 2026-01-05 11:32 | 47K | |
![[ ]](/icons/layout.gif) | 25437_SDS (Isle Of M..> | 2025-12-12 09:18 | 47K | |
![[ ]](/icons/layout.gif) | 9863_M. A. E. Window..> | 2025-10-30 14:13 | 47K | |
![[ ]](/icons/layout.gif) | 9868_M. A. E. Window..> | 2025-10-30 14:16 | 47K | |
![[ ]](/icons/layout.gif) | 14623_M. A. E. Windo..> | 2025-11-12 14:11 | 47K | |
![[ ]](/icons/layout.gif) | 14643_M. A. E. Windo..> | 2025-11-12 14:32 | 47K | |
![[ ]](/icons/layout.gif) | 22544_Avon Automated..> | 2025-12-03 14:02 | 47K | |
![[ ]](/icons/layout.gif) | 13544_NW Automatic D..> | 2025-11-11 07:43 | 47K | |
![[ ]](/icons/layout.gif) | 13545_NW Automatic D..> | 2025-11-11 07:44 | 47K | |
![[ ]](/icons/layout.gif) | 20147_Chelmsford Rol..> | 2025-11-27 09:29 | 47K | |
![[ ]](/icons/layout.gif) | 24284_The Lothian Ga..> | 2025-12-09 11:17 | 47K | |
![[ ]](/icons/layout.gif) | 24318_The Lothian Ga..> | 2025-12-09 11:36 | 47K | |
![[ ]](/icons/layout.gif) | 14490_The Lothian Ga..> | 2025-11-12 11:49 | 47K | |
![[ ]](/icons/layout.gif) | 30445_M. A. E. Windo..> | 2026-01-06 07:41 | 47K | |
![[ ]](/icons/layout.gif) | 24327_The Lothian Ga..> | 2025-12-09 11:42 | 47K | |
![[ ]](/icons/layout.gif) | 31542_M. A. E. Windo..> | 2026-01-08 10:40 | 47K | |
![[ ]](/icons/layout.gif) | 23357_M. A. E. Windo..> | 2025-12-05 09:59 | 47K | |
![[ ]](/icons/layout.gif) | 28351_Doorolla Ltd S..> | 2025-12-19 15:03 | 47K | |
![[ ]](/icons/layout.gif) | 29454_The Lothian Ga..> | 2025-12-30 08:40 | 47K | |
![[ ]](/icons/layout.gif) | 29612_The Lothian Ga..> | 2026-01-02 08:20 | 47K | |
![[ ]](/icons/layout.gif) | 27226_Cerromar Solut..> | 2025-12-17 09:25 | 47K | |
![[ ]](/icons/layout.gif) | 27150_Secured Door &..> | 2025-12-17 07:59 | 47K | |
![[ ]](/icons/layout.gif) | 7210_Absolute Garage..> | 2025-10-23 08:50 | 47K | |
![[ ]](/icons/layout.gif) | 29615_The Lothian Ga..> | 2026-01-02 08:21 | 47K | |
![[ ]](/icons/layout.gif) | 23367_M. A. E. Windo..> | 2025-12-05 10:24 | 47K | |
![[ ]](/icons/layout.gif) | 6754_Midland Garage ..> | 2025-10-22 08:02 | 47K | |
![[ ]](/icons/layout.gif) | 29456_The Lothian Ga..> | 2025-12-30 08:42 | 47K | |
![[ ]](/icons/layout.gif) | 31950_Eastern Frames..> | 2026-01-09 10:07 | 47K | |
![[ ]](/icons/layout.gif) | 9041_The Lothian Gar..> | 2025-10-28 15:22 | 47K | |
![[ ]](/icons/layout.gif) | 28332_East Anglia Ro..> | 2025-12-19 14:55 | 47K | |
![[ ]](/icons/layout.gif) | 25116_The Lothian Ga..> | 2025-12-11 13:09 | 47K | |
![[ ]](/icons/layout.gif) | 31789_The Lothian Ga..> | 2026-01-08 15:37 | 47K | |
![[ ]](/icons/layout.gif) | 24290_The Lothian Ga..> | 2025-12-09 11:19 | 47K | |
![[ ]](/icons/layout.gif) | 29455_The Lothian Ga..> | 2025-12-30 08:41 | 47K | |
![[ ]](/icons/layout.gif) | 29613_The Lothian Ga..> | 2026-01-02 08:20 | 47K | |
![[ ]](/icons/layout.gif) | 24713_The Lothian Ga..> | 2025-12-10 12:30 | 47K | |
![[ ]](/icons/layout.gif) | 24711_The Lothian Ga..> | 2025-12-10 12:29 | 47K | |
![[ ]](/icons/layout.gif) | 13603_NW Automatic D..> | 2025-11-11 08:36 | 47K | |
![[ ]](/icons/layout.gif) | 13598_NW Automatic D..> | 2025-11-11 08:35 | 47K | |
![[ ]](/icons/layout.gif) | 28984_Chelmsford Rol..> | 2025-12-23 10:44 | 47K | |
![[ ]](/icons/layout.gif) | 9042_The Lothian Gar..> | 2025-10-28 15:22 | 47K | |
![[ ]](/icons/layout.gif) | 798_Hanney Glazed Lt..> | 2025-09-24 15:51 | 48K | |
![[ ]](/icons/layout.gif) | 23429_Illy Refurbish..> | 2025-12-05 11:23 | 48K | |
![[ ]](/icons/layout.gif) | 7603_Hanney Glazed L..> | 2025-10-23 14:30 | 48K | |
![[ ]](/icons/layout.gif) | 23434_Illy Refurbish..> | 2025-12-05 11:27 | 48K | |
![[ ]](/icons/layout.gif) | 21358_PB Doors Paul ..> | 2025-12-01 12:10 | 48K | |
![[ ]](/icons/layout.gif) | 26854_Toby Foster-Gr..> | 2025-12-16 12:47 | 48K | |
![[ ]](/icons/layout.gif) | 7929_Ross Garage Doo..> | 2025-10-24 11:14 | 48K | |
![[ ]](/icons/layout.gif) | 18222_EcoGlaze Group..> | 2025-11-21 14:00 | 48K | |
![[ ]](/icons/layout.gif) | 5233_Windowology Ltd..> | 2025-10-16 08:51 | 48K | |
![[ ]](/icons/layout.gif) | 12173_Shutter Tech U..> | 2025-11-06 09:44 | 48K | |
![[ ]](/icons/layout.gif) | 7933_Ross Garage Doo..> | 2025-10-24 11:16 | 48K | |
![[ ]](/icons/layout.gif) | 4169_Fresh Frames Ry..> | 2025-10-13 10:53 | 48K | |
![[ ]](/icons/layout.gif) | 30045_AM Shutters St..> | 2026-01-05 10:20 | 48K | |
![[ ]](/icons/layout.gif) | 7909_Ross Garage Doo..> | 2025-10-24 10:58 | 48K | |
![[ ]](/icons/layout.gif) | 24354_LNR Door Solut..> | 2025-12-09 11:59 | 48K | |
![[ ]](/icons/layout.gif) | 26673_LNR Door Solut..> | 2025-12-16 09:27 | 48K | |
![[ ]](/icons/layout.gif) | 4791_Ace Garage Door..> | 2025-10-14 15:46 | 48K | |
![[ ]](/icons/layout.gif) | 12248_Tech HQ Dean B..> | 2025-11-06 11:08 | 48K | |
![[ ]](/icons/layout.gif) | 28526_Toby Foster-Gr..> | 2025-12-22 10:54 | 48K | |
![[ ]](/icons/layout.gif) | 16515_JJ Secure Door..> | 2025-11-18 10:57 | 48K | |
![[ ]](/icons/layout.gif) | 32791_Fortress Doors..> | 2026-01-13 12:31 | 48K | |
![[ ]](/icons/layout.gif) | 31086_Barry Eckland ..> | 2026-01-07 10:31 | 48K | |
![[ ]](/icons/layout.gif) | 27802_Mac Automation..> | 2025-12-18 12:19 | 48K | |
![[ ]](/icons/layout.gif) | 18109_Dream Installa..> | 2025-11-21 11:28 | 48K | |
![[ ]](/icons/layout.gif) | 15051_T D Rollerdoor..> | 2025-11-13 13:57 | 48K | |
![[ ]](/icons/layout.gif) | 15791_T D Rollerdoor..> | 2025-11-17 08:20 | 48K | |
![[ ]](/icons/layout.gif) | 22249_Shutter Tech U..> | 2025-12-03 08:06 | 48K | |
![[ ]](/icons/layout.gif) | 30151_All Doors Repa..> | 2026-01-05 13:00 | 48K | |
![[ ]](/icons/layout.gif) | 30154_All Doors Repa..> | 2026-01-05 13:01 | 48K | |
![[ ]](/icons/layout.gif) | 32787_Fortress Doors..> | 2026-01-13 12:28 | 48K | |
![[ ]](/icons/layout.gif) | 14305_Ace Garage Doo..> | 2025-11-12 09:03 | 48K | |
![[ ]](/icons/layout.gif) | 16808_PB Doors Paul ..> | 2025-11-18 15:40 | 48K | |
![[ ]](/icons/layout.gif) | 20456_EcoGlaze Group..> | 2025-11-27 14:10 | 48K | |
![[ ]](/icons/layout.gif) | 20799_J Brady Garage..> | 2025-11-28 10:51 | 48K | |
![[ ]](/icons/layout.gif) | 27719_UK Rollerdoors..> | 2025-12-18 10:56 | 48K | |
![[ ]](/icons/layout.gif) | 22044_Oakley Windows..> | 2025-12-02 13:41 | 48K | |
![[ ]](/icons/layout.gif) | 22450_M. B. Bells Lt..> | 2025-12-03 13:30 | 48K | |
![[ ]](/icons/layout.gif) | 20838_Replacement Ga..> | 2025-11-28 11:39 | 48K | |
![[ ]](/icons/layout.gif) | 32516_JM Doors Jon B..> | 2026-01-13 08:31 | 48K | |
![[ ]](/icons/layout.gif) | 17447_Rollerdoors 24..> | 2025-11-20 09:02 | 48K | |
![[ ]](/icons/layout.gif) | 30361_L & C Bracey L..> | 2026-01-05 16:13 | 48K | |
![[ ]](/icons/layout.gif) | 27728_Oakley Windows..> | 2025-12-18 11:14 | 48K | |
![[ ]](/icons/layout.gif) | 12736_Rollermatic Ga..> | 2025-11-07 10:39 | 48K | |
![[ ]](/icons/layout.gif) | 1483_St Helens Upvc ..> | 2025-09-30 17:56 | 48K | |
![[ ]](/icons/layout.gif) | 7009_Alps Home Impro..> | 2025-10-22 12:52 | 48K | |
![[ ]](/icons/layout.gif) | 2287_[0,0] Andrew Ho..> | 2025-10-06 10:43 | 48K | |
![[ ]](/icons/layout.gif) | 4357_C&M Glass Servi..> | 2025-10-13 14:43 | 48K | |
![[ ]](/icons/layout.gif) | 18144_T D Rollerdoor..> | 2025-11-21 12:16 | 48K | |
![[ ]](/icons/layout.gif) | 20168_Doors 4 You Lt..> | 2025-11-27 09:51 | 48K | |
![[ ]](/icons/layout.gif) | 20169_Doors 4 You Lt..> | 2025-11-27 09:52 | 48K | |
![[ ]](/icons/layout.gif) | 7404_All Doors Repai..> | 2025-10-23 11:45 | 48K | |
![[ ]](/icons/layout.gif) | 15538_J Brady Garage..> | 2025-11-14 13:45 | 48K | |
![[ ]](/icons/layout.gif) | 15541_J Brady Garage..> | 2025-11-14 13:46 | 48K | |
![[ ]](/icons/layout.gif) | 7654_C&M Glass Servi..> | 2025-10-24 06:42 | 48K | |
![[ ]](/icons/layout.gif) | 32785_Fortress Doors..> | 2026-01-13 12:27 | 48K | |
![[ ]](/icons/layout.gif) | 7778_Jurassic Doors ..> | 2025-10-24 08:49 | 48K | |
![[ ]](/icons/layout.gif) | 7405_All Doors Repai..> | 2025-10-23 11:46 | 48K | |
![[ ]](/icons/layout.gif) | 28978_Fortress Doors..> | 2025-12-23 10:41 | 48K | |
![[ ]](/icons/layout.gif) | 15006_Elevate Doors ..> | 2025-11-13 12:51 | 48K | |
![[ ]](/icons/layout.gif) | 27738_Eclipse Doors ..> | 2025-12-18 11:26 | 48K | |
![[ ]](/icons/layout.gif) | 27108_Windowcraft De..> | 2025-12-16 16:44 | 48K | |
![[ ]](/icons/layout.gif) | 24451_Oakmont Door S..> | 2025-12-09 14:41 | 48K | |
![[ ]](/icons/layout.gif) | 22370_Doorolla Ltd S..> | 2025-12-03 11:27 | 48K | |
![[ ]](/icons/layout.gif) | 25589_Replacement Ga..> | 2025-12-12 12:30 | 48K | |
![[ ]](/icons/layout.gif) | 7808_Warnsham Window..> | 2025-10-24 08:58 | 48K | |
![[ ]](/icons/layout.gif) | 6766_Beltinge Glazin..> | 2025-10-22 08:08 | 48K | |
![[ ]](/icons/layout.gif) | 29745_Elevate Doors ..> | 2026-01-02 11:38 | 48K | |
![[ ]](/icons/layout.gif) | 27736_Rollermatic Ga..> | 2025-12-18 11:24 | 48K | |
![[ ]](/icons/layout.gif) | 22042_Oakley Windows..> | 2025-12-02 13:40 | 48K | |
![[ ]](/icons/layout.gif) | 30852_CWD Improvemen..> | 2026-01-06 15:06 | 48K | |
![[ ]](/icons/layout.gif) | 6564_M. A. E. Window..> | 2025-10-21 13:08 | 48K | |
![[ ]](/icons/layout.gif) | 11387_Chelmsford Rol..> | 2025-11-04 13:39 | 48K | |
![[ ]](/icons/layout.gif) | 19555_Cartwright Win..> | 2025-11-25 17:03 | 48K | |
![[ ]](/icons/layout.gif) | 613_Roll Right Garag..> | 2025-09-23 15:28 | 48K | |
![[ ]](/icons/layout.gif) | 27217_J Brady Garage..> | 2025-12-17 09:15 | 48K | |
![[ ]](/icons/layout.gif) | 28809_SDS (Isle Of M..> | 2025-12-23 07:41 | 48K | |
![[ ]](/icons/layout.gif) | 29227_CWD Improvemen..> | 2025-12-24 08:32 | 48K | |
![[ ]](/icons/layout.gif) | 23178_Rising Group L..> | 2025-12-04 17:00 | 48K | |
![[ ]](/icons/layout.gif) | 7785_Jurassic Doors ..> | 2025-10-24 08:51 | 48K | |
![[ ]](/icons/layout.gif) | 27087_Gilberts Home ..> | 2025-12-16 16:32 | 48K | |
![[ ]](/icons/layout.gif) | 12039_Fortress Doors..> | 2025-11-05 15:16 | 48K | |
![[ ]](/icons/layout.gif) | 10908_Ace Garage Doo..> | 2025-11-03 14:41 | 48K | |
![[ ]](/icons/layout.gif) | 22062_Chelmsford Rol..> | 2025-12-02 14:13 | 48K | |
![[ ]](/icons/layout.gif) | 23880_Dream Installa..> | 2025-12-08 13:37 | 48K | |
![[ ]](/icons/layout.gif) | 1478_Swift Doors Ltd..> | 2025-09-30 17:43 | 48K | |
![[ ]](/icons/layout.gif) | 30588_Manor Projects..> | 2026-01-06 10:17 | 48K | |
![[ ]](/icons/layout.gif) | 7589_Swift Doors Ltd..> | 2025-10-23 14:12 | 48K | |
![[ ]](/icons/layout.gif) | 4896_PGD Doors Ltd S..> | 2025-10-15 10:03 | 48K | |
![[ ]](/icons/layout.gif) | 31505_SDS (Isle Of M..> | 2026-01-08 09:47 | 48K | |
![[ ]](/icons/layout.gif) | 7763_Roll Right Gara..> | 2025-10-24 08:38 | 48K | |
![[ ]](/icons/layout.gif) | 32280_Go Garage Door..> | 2026-01-12 09:20 | 48K | |
![[ ]](/icons/layout.gif) | 33106_Go Direct Door..> | 2026-01-14 10:32 | 48K | |
![[ ]](/icons/layout.gif) | 32813_East Anglia Ro..> | 2026-01-13 12:49 | 48K | |
![[ ]](/icons/layout.gif) | 18361_WRM Constructi..> | 2025-11-24 08:09 | 48K | |
![[ ]](/icons/layout.gif) | 31011_Dial Delopment..> | 2026-01-07 09:03 | 48K | |
![[ ]](/icons/layout.gif) | 15783_South Atlantic..> | 2025-11-17 07:51 | 48K | |
![[ ]](/icons/layout.gif) | 4148_Evans & Fry Ltd..> | 2025-10-13 10:33 | 48K | |
![[ ]](/icons/layout.gif) | 27816_L G Glazing Lt..> | 2025-12-18 12:32 | 48K | |
![[ ]](/icons/layout.gif) | 32774_Rollermatic Ga..> | 2026-01-13 12:18 | 48K | |
![[ ]](/icons/layout.gif) | 25187_L G Glazing Lt..> | 2025-12-11 14:57 | 48K | |
![[ ]](/icons/layout.gif) | 32776_Rollermatic Ga..> | 2026-01-13 12:19 | 48K | |
![[ ]](/icons/layout.gif) | 12770_The Lothian Ga..> | 2025-11-07 11:27 | 48K | |
![[ ]](/icons/layout.gif) | 18972_WRM Constructi..> | 2025-11-25 08:57 | 48K | |
![[ ]](/icons/layout.gif) | 12772_The Lothian Ga..> | 2025-11-07 11:27 | 48K | |
![[ ]](/icons/layout.gif) | 22449_Adams Industri..> | 2025-12-03 13:28 | 48K | |
![[ ]](/icons/layout.gif) | 24287_The Lothian Ga..> | 2025-12-09 11:19 | 48K | |
![[ ]](/icons/layout.gif) | 40365_AJ Trade Andre..> | 2026-02-04 11:02 | 49K | |
![[ ]](/icons/layout.gif) | 38601_Karl Stevens -..> | 2026-01-29 16:40 | 49K | |
![[ ]](/icons/layout.gif) | 39908_Terry Barker -..> | 2026-02-03 12:11 | 49K | |
![[ ]](/icons/layout.gif) | 37276_Rollerdoors 24..> | 2026-01-27 08:15 | 49K | |
![[ ]](/icons/layout.gif) | 43248_Doors 4 Garage..> | 2026-02-12 15:48 | 49K | |
![[ ]](/icons/layout.gif) | 57592_Kieran Warner ..> | 2026-03-20 15:47 | 49K | |
![[ ]](/icons/layout.gif) | 50179_MG Securical L..> | 2026-03-03 10:37 | 49K | |
![[ ]](/icons/layout.gif) | 40016_Doors Shutters..> | 2026-02-03 14:12 | 49K | |
![[ ]](/icons/layout.gif) | 40331_Terry Barker -..> | 2026-02-04 09:57 | 49K | |
![[ ]](/icons/layout.gif) | 40366_AJ Trade Andre..> | 2026-02-04 11:02 | 49K | |
![[ ]](/icons/layout.gif) | 40054_PB Doors Paul ..> | 2026-02-03 15:07 | 49K | |
![[ ]](/icons/layout.gif) | 42397_Adams Industri..> | 2026-02-10 16:21 | 49K | |
![[ ]](/icons/layout.gif) | 42398_Adams Industri..> | 2026-02-10 16:22 | 49K | |
![[ ]](/icons/layout.gif) | 46713_Marcus Akid - ..> | 2026-02-20 13:19 | 49K | |
![[ ]](/icons/layout.gif) | 49770_UK Door System..> | 2026-03-02 14:12 | 49K | |
![[ ]](/icons/layout.gif) | 44422_Joe Cross - An..> | 2026-02-17 07:54 | 49K | |
![[ ]](/icons/layout.gif) | 35018_JA B79 8RW - W..> | 2026-01-20 10:07 | 49K | |
![[ ]](/icons/layout.gif) | 44727_Jurassic Doors..> | 2026-02-17 10:30 | 49K | |
![[ ]](/icons/layout.gif) | 43500_Jurassic Doors..> | 2026-02-13 09:34 | 49K | |
![[ ]](/icons/layout.gif) | 34112_Adam Hayes - H..> | 2026-01-16 08:45 | 49K | |
![[ ]](/icons/layout.gif) | 41485_Tony Dovey Ton..> | 2026-02-06 16:58 | 49K | |
![[ ]](/icons/layout.gif) | 59229_MnK Windows Ma..> | 2026-03-25 14:18 | 49K | |
![[ ]](/icons/layout.gif) | 59998_Brownsec Gary ..> | 2026-03-27 10:16 | 49K | |
![[ ]](/icons/layout.gif) | 60000_Brownsec Gary ..> | 2026-03-27 10:18 | 49K | |
![[ ]](/icons/layout.gif) | 33928_Oakley Windows..> | 2026-01-15 15:11 | 49K | |
![[ ]](/icons/layout.gif) | 53297_Go Garage Door..> | 2026-03-10 13:32 | 49K | |
![[ ]](/icons/layout.gif) | 55062_Birchley Homes..> | 2026-03-16 07:43 | 49K | |
![[ ]](/icons/layout.gif) | 39150_SW Trade Frame..> | 2026-02-02 09:53 | 49K | |
![[ ]](/icons/layout.gif) | 42399_Adams Industri..> | 2026-02-10 16:22 | 49K | |
![[ ]](/icons/layout.gif) | 33505_AM Shutters M..> | 2026-01-15 08:43 | 49K | |
![[ ]](/icons/layout.gif) | 50471_DSC Glazing - ..> | 2026-03-03 17:08 | 49K | |
![[ ]](/icons/layout.gif) | 45500_Simon Chase Do..> | 2026-02-18 09:37 | 50K | |
![[ ]](/icons/layout.gif) | 40614_MM Doors Micha..> | 2026-02-04 16:03 | 50K | |
![[ ]](/icons/layout.gif) | 41481_Tony Dovey Ton..> | 2026-02-06 16:57 | 50K | |
![[ ]](/icons/layout.gif) | 48559_Elevate Doors ..> | 2026-02-26 12:44 | 50K | |
![[ ]](/icons/layout.gif) | 40579_MM Doors Micha..> | 2026-02-04 15:43 | 50K | |
![[ ]](/icons/layout.gif) | 35446_Secure Entranc..> | 2026-01-21 07:47 | 50K | |
![[ ]](/icons/layout.gif) | 35447_Secure Entranc..> | 2026-01-21 07:48 | 50K | |
![[ ]](/icons/layout.gif) | 36273_JA B79 8RW - W..> | 2026-01-23 08:38 | 50K | |
![[ ]](/icons/layout.gif) | 42466_Adams Industri..> | 2026-02-11 08:54 | 50K | |
![[ ]](/icons/layout.gif) | 35450_Grant Tilley G..> | 2026-01-21 07:50 | 50K | |
![[ ]](/icons/layout.gif) | 55056_Birchley Homes..> | 2026-03-16 07:42 | 50K | |
![[ ]](/icons/layout.gif) | 38324_Garage Door So..> | 2026-01-29 10:41 | 50K | |
![[ ]](/icons/layout.gif) | 59663_MnK Windows Ma..> | 2026-03-26 13:40 | 50K | |
![[ ]](/icons/layout.gif) | 61516_Woods And Sons..> | 2026-03-31 15:23 | 50K | |
![[ ]](/icons/layout.gif) | 50276_J Brady Garage..> | 2026-03-03 12:11 | 50K | |
![[ ]](/icons/layout.gif) | 62687_Digby Services..> | 2026-04-07 08:43 | 50K | |
![[ ]](/icons/layout.gif) | 60402_UK Ultra Doors..> | 2026-03-30 08:15 | 50K | |
![[ ]](/icons/layout.gif) | 51592_Karl Jones - A..> | 2026-03-05 14:32 | 50K | |
![[ ]](/icons/layout.gif) | 40260_Mtmworks Wayne..> | 2026-02-04 08:25 | 50K | |
![[ ]](/icons/layout.gif) | 56320_MM Doors Micha..> | 2026-03-18 11:53 | 50K | |
![[ ]](/icons/layout.gif) | 56534_Spa Roller Doo..> | 2026-03-18 15:32 | 50K | |
![[ ]](/icons/layout.gif) | 61207_Fortress Doors..> | 2026-03-31 11:52 | 50K | |
![[ ]](/icons/layout.gif) | 66822_NTRAP NR11 7NZ..> | 2026-04-16 13:53 | 50K | |
![[ ]](/icons/layout.gif) | 46285_Rolladoor NR9 ..> | 2026-02-19 17:02 | 50K | |
![[ ]](/icons/layout.gif) | 52854_Liam Walker - ..> | 2026-03-09 16:19 | 50K | |
![[ ]](/icons/layout.gif) | 33771_Fortress Doors..> | 2026-01-15 12:42 | 50K | |
![[ ]](/icons/layout.gif) | 42028_Tony Dovey Ton..> | 2026-02-10 08:34 | 50K | |
![[ ]](/icons/layout.gif) | 49273_Thetford Glass..> | 2026-02-27 16:12 | 50K | |
![[ ]](/icons/layout.gif) | 53808_J Brady Garage..> | 2026-03-11 12:02 | 50K | |
![[ ]](/icons/layout.gif) | 60404_UK Ultra Doors..> | 2026-03-30 08:16 | 50K | |
![[ ]](/icons/layout.gif) | 36334_NW Automatic D..> | 2026-01-23 10:03 | 50K | |
![[ ]](/icons/layout.gif) | 54253_AM Shutters St..> | 2026-03-12 13:53 | 50K | |
![[ ]](/icons/layout.gif) | 49575_Thetford Glass..> | 2026-03-02 11:04 | 50K | |
![[ ]](/icons/layout.gif) | 62500_Woods And Sons..> | 2026-04-02 15:14 | 50K | |
![[ ]](/icons/layout.gif) | 52091_Shrewsbury Des..> | 2026-03-06 13:25 | 50K | |
![[ ]](/icons/layout.gif) | 38305_Ideal Industri..> | 2026-01-29 10:34 | 50K | |
![[ ]](/icons/layout.gif) | 51269_NTRAP NR11 7NZ..> | 2026-03-05 09:48 | 50K | |
![[ ]](/icons/layout.gif) | 52105_Barry Eckland ..> | 2026-03-06 13:33 | 50K | |
![[ ]](/icons/layout.gif) | 33918_Oakley Windows..> | 2026-01-15 15:07 | 50K | |
![[ ]](/icons/layout.gif) | 40049_PB Doors Paul ..> | 2026-02-03 15:00 | 50K | |
![[ ]](/icons/layout.gif) | 44955_PB Doors Paul ..> | 2026-02-17 13:54 | 50K | |
![[ ]](/icons/layout.gif) | 42117_Chelmsford Rol..> | 2026-02-10 10:09 | 50K | |
![[ ]](/icons/layout.gif) | 56455_Design & Build..> | 2026-03-18 13:38 | 50K | |
![[ ]](/icons/layout.gif) | 48570_L G Glazing Lt..> | 2026-02-26 13:00 | 50K | |
![[ ]](/icons/layout.gif) | 39925_My Garage Door..> | 2026-02-03 12:22 | 50K | |
![[ ]](/icons/layout.gif) | 49999_Rolladoor NR9 ..> | 2026-03-02 17:00 | 50K | |
![[ ]](/icons/layout.gif) | 46518_Thetford Glass..> | 2026-02-20 10:18 | 50K | |
![[ ]](/icons/layout.gif) | 53084_Phil Page Phil..> | 2026-03-10 09:43 | 50K | |
![[ ]](/icons/layout.gif) | 55617_Rolladoor NR9 ..> | 2026-03-17 08:13 | 50K | |
![[ ]](/icons/layout.gif) | 59603_Price NG34 7RQ..> | 2026-03-26 12:14 | 50K | |
![[ ]](/icons/layout.gif) | 47067_EcoGlaze Group..> | 2026-02-23 12:03 | 50K | |
![[ ]](/icons/layout.gif) | 52656_TPS Gates & Do..> | 2026-03-09 13:30 | 50K | |
![[ ]](/icons/layout.gif) | 35236_Ross Garage Do..> | 2026-01-20 14:35 | 50K | |
![[ ]](/icons/layout.gif) | 40534_Lazarenko LU2 ..> | 2026-02-04 14:26 | 50K | |
![[ ]](/icons/layout.gif) | 53620_RP Manufacturi..> | 2026-03-11 09:01 | 50K | |
![[ ]](/icons/layout.gif) | 37956_Bloomfield Hom..> | 2026-01-28 13:23 | 50K | |
![[ ]](/icons/layout.gif) | 46508_EcoGlaze Group..> | 2026-02-20 10:08 | 50K | |
![[ ]](/icons/layout.gif) | 49122_Piper Window S..> | 2026-02-27 13:26 | 50K | |
![[ ]](/icons/layout.gif) | 50459_Windowcraft De..> | 2026-03-03 16:47 | 50K | |
![[ ]](/icons/layout.gif) | 56543_Spa Roller Doo..> | 2026-03-18 15:33 | 50K | |
![[ ]](/icons/layout.gif) | 35158_Proud 2 Fix Ma..> | 2026-01-20 12:30 | 50K | |
![[ ]](/icons/layout.gif) | 49281_Piper Window S..> | 2026-02-27 16:27 | 50K | |
![[ ]](/icons/layout.gif) | 50951_GU2 Design And..> | 2026-03-04 14:39 | 50K | |
![[ ]](/icons/layout.gif) | 33416_Oakley Windows..> | 2026-01-14 16:30 | 50K | |
![[ ]](/icons/layout.gif) | 59928_WADE WINDOWS I..> | 2026-03-27 08:44 | 50K | |
![[ ]](/icons/layout.gif) | 34796_My Garage Door..> | 2026-01-19 15:40 | 50K | |
![[ ]](/icons/layout.gif) | 55633_Rolladoor NR9 ..> | 2026-03-17 08:34 | 50K | |
![[ ]](/icons/layout.gif) | 33754_SDL DOOR REPAI..> | 2026-01-15 12:15 | 50K | |
![[ ]](/icons/layout.gif) | 36525_Tony Dovey Ton..> | 2026-01-23 12:23 | 50K | |
![[ ]](/icons/layout.gif) | 37111_NTRAP NR11 7NZ..> | 2026-01-26 14:11 | 50K | |
![[ ]](/icons/layout.gif) | 33498_Elevate Doors ..> | 2026-01-15 08:35 | 50K | |
![[ ]](/icons/layout.gif) | 55590_Nuvo Windows P..> | 2026-03-17 07:28 | 50K | |
![[ ]](/icons/layout.gif) | 69340_T D Rollerdoor..> | 2026-04-23 08:27 | 50K | |
![[ ]](/icons/layout.gif) | 36787_CPS Custom Pro..> | 2026-01-26 09:09 | 50K | |
![[ ]](/icons/layout.gif) | 43486_Windoors Harol..> | 2026-02-13 09:22 | 50K | |
![[ ]](/icons/layout.gif) | 47065_EcoGlaze Group..> | 2026-02-23 12:02 | 50K | |
![[ ]](/icons/layout.gif) | 48623_WADE WINDOWS I..> | 2026-02-26 14:04 | 50K | |
![[ ]](/icons/layout.gif) | 40963_Rollermatic Ga..> | 2026-02-05 13:08 | 50K | |
![[ ]](/icons/layout.gif) | 61906_Glenhurst Door..> | 2026-04-01 12:32 | 50K | |
![[ ]](/icons/layout.gif) | 46506_EcoGlaze Group..> | 2026-02-20 10:07 | 50K | |
![[ ]](/icons/layout.gif) | 46509_EcoGlaze Group..> | 2026-02-20 10:08 | 50K | |
![[ ]](/icons/layout.gif) | 69822_UK Ultra Doors..> | 2026-04-24 08:39 | 50K | |
![[ ]](/icons/layout.gif) | 34236_St Helens Upvc..> | 2026-01-16 11:01 | 50K | |
![[ ]](/icons/layout.gif) | 50172_CWD Improvemen..> | 2026-03-03 09:56 | 50K | |
![[ ]](/icons/layout.gif) | 52116_Fortress Doors..> | 2026-03-06 13:43 | 50K | |
![[ ]](/icons/layout.gif) | 64394_MG Securical L..> | 2026-04-10 08:15 | 50K | |
![[ ]](/icons/layout.gif) | 37745_L G Glazing Lt..> | 2026-01-28 08:24 | 50K | |
![[ ]](/icons/layout.gif) | 44733_Jurassic Doors..> | 2026-02-17 10:30 | 50K | |
![[ ]](/icons/layout.gif) | 44993_Fortress Doors..> | 2026-02-17 14:24 | 50K | |
![[ ]](/icons/layout.gif) | 49570_Doors 4 Garage..> | 2026-03-02 11:03 | 50K | |
![[ ]](/icons/layout.gif) | 58261_S R W Services..> | 2026-03-24 07:58 | 50K | |
![[ ]](/icons/layout.gif) | 62689_Digby Services..> | 2026-04-07 08:43 | 50K | |
![[ ]](/icons/layout.gif) | 49278_Spa Roller Doo..> | 2026-02-27 16:15 | 50K | |
![[ ]](/icons/layout.gif) | 50916_Window Repair ..> | 2026-03-04 13:55 | 50K | |
![[ ]](/icons/layout.gif) | 64004_UK Ultra Doors..> | 2026-04-09 09:49 | 50K | |
![[ ]](/icons/layout.gif) | 69327_Regal Windows ..> | 2026-04-23 08:09 | 50K | |
![[ ]](/icons/layout.gif) | 40909_Able Garage Do..> | 2026-02-05 11:27 | 50K | |
![[ ]](/icons/layout.gif) | 50001_CWD Improvemen..> | 2026-03-02 17:01 | 50K | |
![[ ]](/icons/layout.gif) | 60231_Simon Piggin P..> | 2026-03-27 14:01 | 50K | |
![[ ]](/icons/layout.gif) | 60239_Simon Piggin P..> | 2026-03-27 14:05 | 50K | |
![[ ]](/icons/layout.gif) | 47951_Fortress Doors..> | 2026-02-25 08:48 | 50K | |
![[ ]](/icons/layout.gif) | 48605_Fortress Doors..> | 2026-02-26 13:53 | 50K | |
![[ ]](/icons/layout.gif) | 49262_Happy Holdings..> | 2026-02-27 15:56 | 50K | |
![[ ]](/icons/layout.gif) | 49265_Happy Holdings..> | 2026-02-27 16:00 | 50K | |
![[ ]](/icons/layout.gif) | 50288_Fortress Doors..> | 2026-03-03 12:49 | 50K | |
![[ ]](/icons/layout.gif) | 66847_Jurassic Doors..> | 2026-04-16 14:16 | 50K | |
![[ ]](/icons/layout.gif) | 39059_PB Doors Paul ..> | 2026-01-30 16:32 | 50K | |
![[ ]](/icons/layout.gif) | 63177_CWD Improvemen..> | 2026-04-07 15:11 | 50K | |
![[ ]](/icons/layout.gif) | 61392_Fortress Doors..> | 2026-03-31 13:18 | 50K | |
![[ ]](/icons/layout.gif) | 37454_G & H Windows ..> | 2026-01-27 11:58 | 50K | |
![[ ]](/icons/layout.gif) | 40566_Fortress Doors..> | 2026-02-04 15:21 | 50K | |
![[ ]](/icons/layout.gif) | 44997_Fortress Doors..> | 2026-02-17 14:26 | 50K | |
![[ ]](/icons/layout.gif) | 64205_Wokingham Glaz..> | 2026-04-09 15:17 | 50K | |
![[ ]](/icons/layout.gif) | 55459_South Atlantic..> | 2026-03-16 14:17 | 50K | |
![[ ]](/icons/layout.gif) | 67274_Automated Door..> | 2026-04-17 12:45 | 50K | |
![[ ]](/icons/layout.gif) | 48586_Fortress Doors..> | 2026-02-26 13:41 | 50K | |
![[ ]](/icons/layout.gif) | 48974_Wokingham Glaz..> | 2026-02-27 09:27 | 50K | |
![[ ]](/icons/layout.gif) | 54841_T D Rollerdoor..> | 2026-03-13 13:19 | 50K | |
![[ ]](/icons/layout.gif) | 56693_Michael Mazur ..> | 2026-03-19 08:56 | 50K | |
![[ ]](/icons/layout.gif) | 37483_Phil Page Phil..> | 2026-01-27 12:07 | 50K | |
![[ ]](/icons/layout.gif) | 47072_EcoGlaze Group..> | 2026-02-23 12:04 | 50K | |
![[ ]](/icons/layout.gif) | 51279_Ross Garage Do..> | 2026-03-05 09:52 | 50K | |
![[ ]](/icons/layout.gif) | 53180_1st Class Home..> | 2026-03-10 11:39 | 50K | |
![[ ]](/icons/layout.gif) | 54501_Hanney Glazed ..> | 2026-03-13 07:32 | 50K | |
![[ ]](/icons/layout.gif) | 53036_All Doors Repa..> | 2026-03-10 09:20 | 50K | |
![[ ]](/icons/layout.gif) | 61227_Garage Door Se..> | 2026-03-31 12:18 | 50K | |
![[ ]](/icons/layout.gif) | 44734_Jurassic Doors..> | 2026-02-17 10:31 | 50K | |
![[ ]](/icons/layout.gif) | 55753_WADE WINDOWS I..> | 2026-03-17 11:07 | 50K | |
![[ ]](/icons/layout.gif) | 49010_Norfolk Doors ..> | 2026-02-27 10:07 | 50K | |
![[ ]](/icons/layout.gif) | 68822_CWD Improvemen..> | 2026-04-22 08:09 | 50K | |
![[ ]](/icons/layout.gif) | 46505_EcoGlaze Group..> | 2026-02-20 10:07 | 50K | |
![[ ]](/icons/layout.gif) | 51283_RH Doors & Shu..> | 2026-03-05 09:55 | 50K | |
![[ ]](/icons/layout.gif) | 51290_RH Doors & Shu..> | 2026-03-05 09:56 | 50K | |
![[ ]](/icons/layout.gif) | 60240_Garage Door Se..> | 2026-03-27 14:05 | 50K | |
![[ ]](/icons/layout.gif) | 60390_Oakley Windows..> | 2026-03-30 08:07 | 50K | |
![[ ]](/icons/layout.gif) | 68287_Fortress Doors..> | 2026-04-21 09:44 | 50K | |
![[ ]](/icons/layout.gif) | 37725_Excellent Ltd ..> | 2026-01-28 07:10 | 50K | |
![[ ]](/icons/layout.gif) | 63748_Wokingham Glaz..> | 2026-04-08 15:04 | 50K | |
![[ ]](/icons/layout.gif) | 42467_Adams Industri..> | 2026-02-11 08:55 | 50K | |
![[ ]](/icons/layout.gif) | 46921_RnR Home Impro..> | 2026-02-23 07:40 | 50K | |
![[ ]](/icons/layout.gif) | 64330_Ross Garage Do..> | 2026-04-10 07:59 | 50K | |
![[ ]](/icons/layout.gif) | 34749_CPS Custom Pro..> | 2026-01-19 14:28 | 50K | |
![[ ]](/icons/layout.gif) | 37754_Chiltern Doors..> | 2026-01-28 08:32 | 50K | |
![[ ]](/icons/layout.gif) | 48602_Fortress Doors..> | 2026-02-26 13:53 | 50K | |
![[ ]](/icons/layout.gif) | 60473_Kirsty Willis ..> | 2026-03-30 09:28 | 50K | |
![[ ]](/icons/layout.gif) | 44309_The Garage Doo..> | 2026-02-16 15:41 | 50K | |
![[ ]](/icons/layout.gif) | 59378_P & R Door Sys..> | 2026-03-26 09:24 | 50K | |
![[ ]](/icons/layout.gif) | 34792_UK Door System..> | 2026-01-19 15:37 | 50K | |
![[ ]](/icons/layout.gif) | 55698_Fortress Doors..> | 2026-03-17 09:56 | 50K | |
![[ ]](/icons/layout.gif) | 60335_Faith Home Imp..> | 2026-03-27 16:51 | 50K | |
![[ ]](/icons/layout.gif) | 60782_AJ Trade Andre..> | 2026-03-30 15:03 | 50K | |
![[ ]](/icons/layout.gif) | 44995_Fortress Doors..> | 2026-02-17 14:26 | 50K | |
![[ ]](/icons/layout.gif) | 47495_Chiltern Doors..> | 2026-02-24 10:11 | 50K | |
![[ ]](/icons/layout.gif) | 58256_AJ Trade Andre..> | 2026-03-24 07:55 | 50K | |
![[ ]](/icons/layout.gif) | 60783_AJ Trade Andre..> | 2026-03-30 15:04 | 50K | |
![[ ]](/icons/layout.gif) | 51825_EcoGlaze Group..> | 2026-03-06 09:05 | 50K | |
![[ ]](/icons/layout.gif) | 54697_RP Manufacturi..> | 2026-03-13 10:42 | 50K | |
![[ ]](/icons/layout.gif) | 54931_Replacement Ga..> | 2026-03-13 14:30 | 50K | |
![[ ]](/icons/layout.gif) | 62740_Garage Door Se..> | 2026-04-07 09:22 | 50K | |
![[ ]](/icons/layout.gif) | 68306_Doors 4 You Lt..> | 2026-04-21 09:49 | 50K | |
![[ ]](/icons/layout.gif) | 44598_Ace Garage Doo..> | 2026-02-17 09:03 | 50K | |
![[ ]](/icons/layout.gif) | 62600_Thomas Andrew ..> | 2026-04-07 08:07 | 50K | |
![[ ]](/icons/layout.gif) | 62811_Fortress Doors..> | 2026-04-07 10:42 | 50K | |
![[ ]](/icons/layout.gif) | 66837_Oakley Windows..> | 2026-04-16 14:00 | 50K | |
![[ ]](/icons/layout.gif) | 68648_Eclipse Doors ..> | 2026-04-21 13:54 | 50K | |
![[ ]](/icons/layout.gif) | 33773_Fortress Doors..> | 2026-01-15 12:44 | 50K | |
![[ ]](/icons/layout.gif) | 40647_Eclipse Paving..> | 2026-02-04 16:47 | 50K | |
![[ ]](/icons/layout.gif) | 54951_PB Doors Paul ..> | 2026-03-13 14:36 | 50K | |
![[ ]](/icons/layout.gif) | 69326_Regal Windows ..> | 2026-04-23 08:08 | 50K | |
![[ ]](/icons/layout.gif) | 55594_Doors 4 Garage..> | 2026-03-17 07:43 | 50K | |
![[ ]](/icons/layout.gif) | 61230_Garage Door Se..> | 2026-03-31 12:19 | 50K | |
![[ ]](/icons/layout.gif) | 62806_Fortress Doors..> | 2026-04-07 10:39 | 50K | |
![[ ]](/icons/layout.gif) | 43498_Entador System..> | 2026-02-13 09:31 | 50K | |
![[ ]](/icons/layout.gif) | 44881_Proud 2 Fix Ma..> | 2026-02-17 13:16 | 50K | |
![[ ]](/icons/layout.gif) | 56774_Oakley Windows..> | 2026-03-19 10:16 | 50K | |
![[ ]](/icons/layout.gif) | 36132_Ace Garage Doo..> | 2026-01-22 13:20 | 50K | |
![[ ]](/icons/layout.gif) | 36579_UK Rollerdoors..> | 2026-01-23 13:20 | 50K | |
![[ ]](/icons/layout.gif) | 40122_RP Manufacturi..> | 2026-02-03 15:57 | 50K | |
![[ ]](/icons/layout.gif) | 48018_1st Choice Sec..> | 2026-02-25 09:34 | 50K | |
![[ ]](/icons/layout.gif) | 54237_CWD Improvemen..> | 2026-03-12 13:38 | 50K | |
![[ ]](/icons/layout.gif) | 61225_Garage Door Se..> | 2026-03-31 12:17 | 50K | |
![[ ]](/icons/layout.gif) | 45687_Eclipse Doors ..> | 2026-02-18 14:05 | 50K | |
![[ ]](/icons/layout.gif) | 60246_Garage Door Se..> | 2026-03-27 14:07 | 50K | |
![[ ]](/icons/layout.gif) | 64385_P & R Door Sys..> | 2026-04-10 08:08 | 50K | |
![[ ]](/icons/layout.gif) | 34816_AJ Trade Andre..> | 2026-01-19 16:18 | 50K | |
![[ ]](/icons/layout.gif) | 34880_AJ Trade Andre..> | 2026-01-20 07:25 | 50K | |
![[ ]](/icons/layout.gif) | 35698_AJ Trade Andre..> | 2026-01-21 12:35 | 50K | |
![[ ]](/icons/layout.gif) | 36788_CPS Custom Pro..> | 2026-01-26 09:10 | 50K | |
![[ ]](/icons/layout.gif) | 37726_Excellent Ltd ..> | 2026-01-28 07:10 | 50K | |
![[ ]](/icons/layout.gif) | 51413_GU2 Design And..> | 2026-03-05 11:42 | 50K | |
![[ ]](/icons/layout.gif) | 54137_AAES Electrica..> | 2026-03-12 10:31 | 50K | |
![[ ]](/icons/layout.gif) | 35001_Elevate Doors ..> | 2026-01-20 09:52 | 50K | |
![[ ]](/icons/layout.gif) | 51286_Roll Right Gar..> | 2026-03-05 09:55 | 50K | |
![[ ]](/icons/layout.gif) | 52861_AAES Electrica..> | 2026-03-09 16:25 | 50K | |
![[ ]](/icons/layout.gif) | 54177_Doors 4 Garage..> | 2026-03-12 11:11 | 50K | |
![[ ]](/icons/layout.gif) | 55733_Regal Windows ..> | 2026-03-17 10:30 | 50K | |
![[ ]](/icons/layout.gif) | 59937_PLK Home & Win..> | 2026-03-27 08:55 | 50K | |
![[ ]](/icons/layout.gif) | 51260_Ecosse Garage ..> | 2026-03-05 09:39 | 50K | |
![[ ]](/icons/layout.gif) | 52952_Fixed Abode Ga..> | 2026-03-10 08:28 | 50K | |
![[ ]](/icons/layout.gif) | 53788_Dream Installa..> | 2026-03-11 11:49 | 50K | |
![[ ]](/icons/layout.gif) | 60244_Garage Door Se..> | 2026-03-27 14:06 | 50K | |
![[ ]](/icons/layout.gif) | 41544_Wokingham Glaz..> | 2026-02-09 09:20 | 50K | |
![[ ]](/icons/layout.gif) | 59432_1st Shield Dar..> | 2026-03-26 10:28 | 50K | |
![[ ]](/icons/layout.gif) | 59887_Bespoke Living..> | 2026-03-27 08:01 | 50K | |
![[ ]](/icons/layout.gif) | 68394_Eclipse Doors ..> | 2026-04-21 10:39 | 50K | |
![[ ]](/icons/layout.gif) | 68649_Eclipse Doors ..> | 2026-04-21 13:54 | 50K | |
![[ ]](/icons/layout.gif) | 48564_Replacement Ga..> | 2026-02-26 12:47 | 50K | |
![[ ]](/icons/layout.gif) | 67263_TPS Gates & Do..> | 2026-04-17 12:41 | 50K | |
![[ ]](/icons/layout.gif) | 68290_Fortress Doors..> | 2026-04-21 09:45 | 50K | |
![[ ]](/icons/layout.gif) | 42770_Proud 2 Fix Ma..> | 2026-02-11 14:05 | 50K | |
![[ ]](/icons/layout.gif) | 63802_AJ Trade Andre..> | 2026-04-09 06:26 | 50K | |
![[ ]](/icons/layout.gif) | 68054_Proud 2 Fix Ma..> | 2026-04-21 07:00 | 50K | |
![[ ]](/icons/layout.gif) | 33921_Oakley Windows..> | 2026-01-15 15:08 | 50K | |
![[ ]](/icons/layout.gif) | 33922_Oakley Windows..> | 2026-01-15 15:08 | 50K | |
![[ ]](/icons/layout.gif) | 44359_Bark Oak Build..> | 2026-02-16 16:16 | 50K | |
![[ ]](/icons/layout.gif) | 50390_Dream Installa..> | 2026-03-03 15:45 | 50K | |
![[ ]](/icons/layout.gif) | 61346_Garage Door Se..> | 2026-03-31 12:49 | 50K | |
![[ ]](/icons/layout.gif) | 68282_Fortress Doors..> | 2026-04-21 09:44 | 50K | |
![[ ]](/icons/layout.gif) | 35219_Elevate Doors ..> | 2026-01-20 14:24 | 50K | |
![[ ]](/icons/layout.gif) | 34349_P & R Door Sys..> | 2026-01-16 14:41 | 50K | |
![[ ]](/icons/layout.gif) | 47499_Serenade Home ..> | 2026-02-24 10:13 | 50K | |
![[ ]](/icons/layout.gif) | 56689_Julian Gallimo..> | 2026-03-19 08:50 | 50K | |
![[ ]](/icons/layout.gif) | 36492_3 Brothers Bui..> | 2026-01-23 11:43 | 50K | |
![[ ]](/icons/layout.gif) | 41711_Bridgford Inte..> | 2026-02-09 13:33 | 50K | |
![[ ]](/icons/layout.gif) | 43800_Stapletons Loc..> | 2026-02-16 08:44 | 50K | |
![[ ]](/icons/layout.gif) | 48599_Fortress Doors..> | 2026-02-26 13:51 | 50K | |
![[ ]](/icons/layout.gif) | 57082_P & R Door Sys..> | 2026-03-19 16:13 | 50K | |
![[ ]](/icons/layout.gif) | 43511_Jurassic Doors..> | 2026-02-13 09:38 | 50K | |
![[ ]](/icons/layout.gif) | 46717_Evans Building..> | 2026-02-20 13:21 | 50K | |
![[ ]](/icons/layout.gif) | 59495_Rising Group L..> | 2026-03-26 10:41 | 50K | |
![[ ]](/icons/layout.gif) | 64327_Ross Garage Do..> | 2026-04-10 07:57 | 50K | |
![[ ]](/icons/layout.gif) | 54075_J Bowman Garag..> | 2026-03-12 09:43 | 50K | |
![[ ]](/icons/layout.gif) | 59007_P & R Door Sys..> | 2026-03-25 10:52 | 50K | |
![[ ]](/icons/layout.gif) | 12832_Mowbrey Partne..> | 2025-11-07 13:24 | 50K | |
![[ ]](/icons/layout.gif) | 33923_Oakley Windows..> | 2026-01-15 15:08 | 50K | |
![[ ]](/icons/layout.gif) | 33924_Oakley Windows..> | 2026-01-15 15:09 | 50K | |
![[ ]](/icons/layout.gif) | 34171_Michael Mazur ..> | 2026-01-16 09:29 | 50K | |
![[ ]](/icons/layout.gif) | 67271_Ross Garage Do..> | 2026-04-17 12:44 | 50K | |
![[ ]](/icons/layout.gif) | 35896_Thomas Andrew ..> | 2026-01-22 08:27 | 50K | |
![[ ]](/icons/layout.gif) | 47497_Chiltern Doors..> | 2026-02-24 10:12 | 50K | |
![[ ]](/icons/layout.gif) | 48119_Rhino Windows ..> | 2026-02-25 11:53 | 50K | |
![[ ]](/icons/layout.gif) | 56263_Eaton Park Win..> | 2026-03-18 10:54 | 50K | |
![[ ]](/icons/layout.gif) | 61366_Proud 2 Fix Ma..> | 2026-03-31 13:01 | 50K | |
![[ ]](/icons/layout.gif) | 36502_3 Brothers Bui..> | 2026-01-23 11:58 | 50K | |
![[ ]](/icons/layout.gif) | 54929_Piper Window S..> | 2026-03-13 14:30 | 50K | |
![[ ]](/icons/layout.gif) | 56464_Eaton Park Win..> | 2026-03-18 13:41 | 50K | |
![[ ]](/icons/layout.gif) | 64308_P & R Door Sys..> | 2026-04-10 07:18 | 50K | |
![[ ]](/icons/layout.gif) | 66831_Oakley Windows..> | 2026-04-16 13:57 | 50K | |
![[ ]](/icons/layout.gif) | 36111_P & R Door Sys..> | 2026-01-22 12:24 | 50K | |
![[ ]](/icons/layout.gif) | 36112_P & R Door Sys..> | 2026-01-22 12:25 | 50K | |
![[ ]](/icons/layout.gif) | 40539_Ace Garage Doo..> | 2026-02-04 14:28 | 50K | |
![[ ]](/icons/layout.gif) | 40568_Garden Getaway..> | 2026-02-04 15:22 | 50K | |
![[ ]](/icons/layout.gif) | 53148_Replacement Ga..> | 2026-03-10 11:04 | 50K | |
![[ ]](/icons/layout.gif) | 63428_EcoGlaze Group..> | 2026-04-08 09:10 | 50K | |
![[ ]](/icons/layout.gif) | 38910_T & G Home Imp..> | 2026-01-30 12:32 | 50K | |
![[ ]](/icons/layout.gif) | 42198_J Bowman Garag..> | 2026-02-10 11:25 | 50K | |
![[ ]](/icons/layout.gif) | 44063_Avon Automated..> | 2026-02-16 11:21 | 50K | |
![[ ]](/icons/layout.gif) | 46539_Rhino Windows ..> | 2026-02-20 10:53 | 50K | |
![[ ]](/icons/layout.gif) | 55782_P & R Door Sys..> | 2026-03-17 11:58 | 50K | |
![[ ]](/icons/layout.gif) | 68823_CWD Improvemen..> | 2026-04-22 08:10 | 50K | |
![[ ]](/icons/layout.gif) | 51827_EcoGlaze Group..> | 2026-03-06 09:05 | 50K | |
![[ ]](/icons/layout.gif) | 34995_Elevate Doors ..> | 2026-01-20 09:49 | 50K | |
![[ ]](/icons/layout.gif) | 59231_Wessex Industr..> | 2026-03-25 14:19 | 50K | |
![[ ]](/icons/layout.gif) | 59342_ThermoGreen Lt..> | 2026-03-26 08:51 | 50K | |
![[ ]](/icons/layout.gif) | 60391_Oakley Windows..> | 2026-03-30 08:07 | 50K | |
![[ ]](/icons/layout.gif) | 37727_Excellent Ltd ..> | 2026-01-28 07:11 | 50K | |
![[ ]](/icons/layout.gif) | 52741_Thomas Andrew ..> | 2026-03-09 14:59 | 50K | |
![[ ]](/icons/layout.gif) | 55603_RnR Home Impro..> | 2026-03-17 08:04 | 50K | |
![[ ]](/icons/layout.gif) | 56510_3 Counties (Sa..> | 2026-03-18 14:54 | 50K | |
![[ ]](/icons/layout.gif) | 62757_EcoGlaze Group..> | 2026-04-07 09:39 | 50K | |
![[ ]](/icons/layout.gif) | 33769_Scotia Garage ..> | 2026-01-15 12:32 | 50K | |
![[ ]](/icons/layout.gif) | 35048_Elevate Doors ..> | 2026-01-20 10:42 | 50K | |
![[ ]](/icons/layout.gif) | 44987_All Doors Repa..> | 2026-02-17 14:18 | 50K | |
![[ ]](/icons/layout.gif) | 66965_EcoGlaze Group..> | 2026-04-17 08:02 | 50K | |
![[ ]](/icons/layout.gif) | 67269_Ross Garage Do..> | 2026-04-17 12:43 | 50K | |
![[ ]](/icons/layout.gif) | 43601_Chelmsford Rol..> | 2026-02-13 11:43 | 50K | |
![[ ]](/icons/layout.gif) | 51807_Thomas Andrew ..> | 2026-03-06 08:52 | 50K | |
![[ ]](/icons/layout.gif) | 60674_DP Windows Dar..> | 2026-03-30 13:50 | 50K | |
![[ ]](/icons/layout.gif) | 40591_Manor Projects..> | 2026-02-04 15:51 | 50K | |
![[ ]](/icons/layout.gif) | 50620_J Brady Garage..> | 2026-03-04 09:03 | 50K | |
![[ ]](/icons/layout.gif) | 46039_P & R Door Sys..> | 2026-02-19 10:40 | 50K | |
![[ ]](/icons/layout.gif) | 66833_Oakley Windows..> | 2026-04-16 14:00 | 50K | |
![[ ]](/icons/layout.gif) | 41428_PGD Doors Ltd ..> | 2026-02-06 14:37 | 50K | |
![[ ]](/icons/layout.gif) | 42181_EcoGlaze Group..> | 2026-02-10 11:08 | 50K | |
![[ ]](/icons/layout.gif) | 49426_J Brady Garage..> | 2026-03-02 09:04 | 50K | |
![[ ]](/icons/layout.gif) | 51132_Ideal Industri..> | 2026-03-05 07:33 | 50K | |
![[ ]](/icons/layout.gif) | 56446_3 Counties (Sa..> | 2026-03-18 13:30 | 50K | |
![[ ]](/icons/layout.gif) | 56890_Go Direct Door..> | 2026-03-19 11:26 | 50K | |
![[ ]](/icons/layout.gif) | 35439_Eclipse Doors ..> | 2026-01-21 07:41 | 50K | |
![[ ]](/icons/layout.gif) | 63431_EcoGlaze Group..> | 2026-04-08 09:12 | 50K | |
![[ ]](/icons/layout.gif) | 42193_J Bowman Garag..> | 2026-02-10 11:24 | 50K | |
![[ ]](/icons/layout.gif) | 52693_T D Rollerdoor..> | 2026-03-09 14:05 | 50K | |
![[ ]](/icons/layout.gif) | 61971_Serenade Home ..> | 2026-04-01 13:45 | 50K | |
![[ ]](/icons/layout.gif) | 42202_J Bowman Garag..> | 2026-02-10 11:26 | 50K | |
![[ ]](/icons/layout.gif) | 55118_CWG Home Impro..> | 2026-03-16 09:15 | 50K | |
![[ ]](/icons/layout.gif) | 55165_Ecosse Garage ..> | 2026-03-16 09:35 | 50K | |
![[ ]](/icons/layout.gif) | 62755_EcoGlaze Group..> | 2026-04-07 09:39 | 50K | |
![[ ]](/icons/layout.gif) | 33357_The Garage Doo..> | 2026-01-14 15:25 | 50K | |
![[ ]](/icons/layout.gif) | 53842_Emerald Garage..> | 2026-03-11 12:34 | 50K | |
![[ ]](/icons/layout.gif) | 55173_Ecosse Garage ..> | 2026-03-16 09:37 | 50K | |
![[ ]](/icons/layout.gif) | 48591_Replacement Ga..> | 2026-02-26 13:46 | 50K | |
![[ ]](/icons/layout.gif) | 58435_Fortress Doors..> | 2026-03-24 10:16 | 50K | |
![[ ]](/icons/layout.gif) | 68639_Eclipse Doors ..> | 2026-04-21 13:49 | 50K | |
![[ ]](/icons/layout.gif) | 68861_SW Trade Frame..> | 2026-04-22 08:53 | 50K | |
![[ ]](/icons/layout.gif) | 33417_Oakley Windows..> | 2026-01-14 16:30 | 50K | |
![[ ]](/icons/layout.gif) | 37098_Ace Garage Doo..> | 2026-01-26 14:05 | 50K | |
![[ ]](/icons/layout.gif) | 42488_Regal Windows ..> | 2026-02-11 09:08 | 50K | |
![[ ]](/icons/layout.gif) | 54180_CWG Home Impro..> | 2026-03-12 11:12 | 50K | |
![[ ]](/icons/layout.gif) | 59929_WADE WINDOWS I..> | 2026-03-27 08:45 | 50K | |
![[ ]](/icons/layout.gif) | 60249_J Bowman Garag..> | 2026-03-27 14:09 | 50K | |
![[ ]](/icons/layout.gif) | 61249_Replacement Ga..> | 2026-03-31 12:32 | 50K | |
![[ ]](/icons/layout.gif) | 36743_Pro-Frame Wind..> | 2026-01-26 08:13 | 50K | |
![[ ]](/icons/layout.gif) | 38984_Thomas Andrew ..> | 2026-01-30 15:03 | 50K | |
![[ ]](/icons/layout.gif) | 61370_HTH Developmen..> | 2026-03-31 13:01 | 50K | |
![[ ]](/icons/layout.gif) | 68643_Eclipse Doors ..> | 2026-04-21 13:51 | 50K | |
![[ ]](/icons/layout.gif) | 56254_Eaton Park Win..> | 2026-03-18 10:51 | 50K | |
![[ ]](/icons/layout.gif) | 59356_Garage Doors 2..> | 2026-03-26 08:56 | 50K | |
![[ ]](/icons/layout.gif) | 68642_Eclipse Doors ..> | 2026-04-21 13:51 | 50K | |
![[ ]](/icons/layout.gif) | 64337_Bryan Thompson..> | 2026-04-10 08:03 | 50K | |
![[ ]](/icons/layout.gif) | 33891_Norfolk Broads..> | 2026-01-15 14:56 | 50K | |
![[ ]](/icons/layout.gif) | 34282_Evans & Fry Lt..> | 2026-01-16 13:32 | 50K | |
![[ ]](/icons/layout.gif) | 44979_Dream Installa..> | 2026-02-17 14:16 | 50K | |
![[ ]](/icons/layout.gif) | 49315_Evans Building..> | 2026-02-27 17:10 | 50K | |
![[ ]](/icons/layout.gif) | 52127_Doors 4 You Lt..> | 2026-03-06 13:48 | 50K | |
![[ ]](/icons/layout.gif) | 36738_EcoGlaze Group..> | 2026-01-26 08:13 | 50K | |
![[ ]](/icons/layout.gif) | 42537_Direct Trade P..> | 2026-02-11 09:41 | 50K | |
![[ ]](/icons/layout.gif) | 49545_Ecosse Garage ..> | 2026-03-02 10:32 | 50K | |
![[ ]](/icons/layout.gif) | 59455_Secure Entranc..> | 2026-03-26 10:32 | 50K | |
![[ ]](/icons/layout.gif) | 61257_Doors 4 You Lt..> | 2026-03-31 12:35 | 50K | |
![[ ]](/icons/layout.gif) | 65892_ASSW Ltd BS10 ..> | 2026-04-14 15:57 | 50K | |
![[ ]](/icons/layout.gif) | 33502_Serenade Home ..> | 2026-01-15 08:39 | 50K | |
![[ ]](/icons/layout.gif) | 48717_Michael Mazur ..> | 2026-02-26 15:51 | 50K | |
![[ ]](/icons/layout.gif) | 37724_Excellent Ltd ..> | 2026-01-28 07:09 | 50K | |
![[ ]](/icons/layout.gif) | 55763_Go Direct Door..> | 2026-03-17 11:15 | 50K | |
![[ ]](/icons/layout.gif) | 42493_Replacement Ga..> | 2026-02-11 09:10 | 50K | |
![[ ]](/icons/layout.gif) | 44981_All Doors Repa..> | 2026-02-17 14:17 | 50K | |
![[ ]](/icons/layout.gif) | 46098_Scotia Garage ..> | 2026-02-19 12:54 | 50K | |
![[ ]](/icons/layout.gif) | 62906_Rhino Windows ..> | 2026-04-07 11:58 | 50K | |
![[ ]](/icons/layout.gif) | 36905_Rollerdoors 24..> | 2026-01-26 11:18 | 50K | |
![[ ]](/icons/layout.gif) | 38713_Devon Door & L..> | 2026-01-30 09:36 | 50K | |
![[ ]](/icons/layout.gif) | 58396_J Brady Garage..> | 2026-03-24 09:49 | 50K | |
![[ ]](/icons/layout.gif) | 61382_Cerromar Solut..> | 2026-03-31 13:09 | 50K | |
![[ ]](/icons/layout.gif) | 62673_Rhino Windows ..> | 2026-04-07 08:29 | 50K | |
![[ ]](/icons/layout.gif) | 48122_Rhino Windows ..> | 2026-02-25 11:54 | 50K | |
![[ ]](/icons/layout.gif) | 48596_Rollermatic Ga..> | 2026-02-26 13:48 | 50K | |
![[ ]](/icons/layout.gif) | 61956_J Brady Garage..> | 2026-04-01 13:42 | 50K | |
![[ ]](/icons/layout.gif) | 68637_Eclipse Doors ..> | 2026-04-21 13:49 | 50K | |
![[ ]](/icons/layout.gif) | 51317_SH PROPERTY MA..> | 2026-03-05 10:12 | 50K | |
![[ ]](/icons/layout.gif) | 54943_Rollermatic Ga..> | 2026-03-13 14:34 | 50K | |
![[ ]](/icons/layout.gif) | 67836_Thomas Andrew ..> | 2026-04-20 12:57 | 50K | |
![[ ]](/icons/layout.gif) | 44543_CPS Custom Pro..> | 2026-02-17 08:47 | 50K | |
![[ ]](/icons/layout.gif) | 33775_Fortress Doors..> | 2026-01-15 12:46 | 50K | |
![[ ]](/icons/layout.gif) | 46036_Go Direct Door..> | 2026-02-19 10:39 | 50K | |
![[ ]](/icons/layout.gif) | 46537_Rhino Windows ..> | 2026-02-20 10:53 | 50K | |
![[ ]](/icons/layout.gif) | 53849_UK Rollerdoors..> | 2026-03-11 12:46 | 50K | |
![[ ]](/icons/layout.gif) | 66972_Thomas Andrew ..> | 2026-04-17 08:18 | 50K | |
![[ ]](/icons/layout.gif) | 42847_South Atlantic..> | 2026-02-12 07:42 | 50K | |
![[ ]](/icons/layout.gif) | 54495_Warnsham Windo..> | 2026-03-13 07:23 | 50K | |
![[ ]](/icons/layout.gif) | 61254_Replacement Ga..> | 2026-03-31 12:34 | 50K | |
![[ ]](/icons/layout.gif) | 69325_Regal Windows ..> | 2026-04-23 08:07 | 50K | |
![[ ]](/icons/layout.gif) | 51694_Fixed Abode Ga..> | 2026-03-05 17:18 | 50K | |
![[ ]](/icons/layout.gif) | 47384_P & R Door Sys..> | 2026-02-24 08:15 | 50K | |
![[ ]](/icons/layout.gif) | 54948_Rollermatic Ga..> | 2026-03-13 14:36 | 50K | |
![[ ]](/icons/layout.gif) | 44896_Rollermatic Ga..> | 2026-02-17 13:25 | 50K | |
![[ ]](/icons/layout.gif) | 49566_MNH Windows & ..> | 2026-03-02 11:00 | 50K | |
![[ ]](/icons/layout.gif) | 63688_Go Direct Door..> | 2026-04-08 14:19 | 50K | |
![[ ]](/icons/layout.gif) | 44899_Rollermatic Ga..> | 2026-02-17 13:26 | 50K | |
![[ ]](/icons/layout.gif) | 62908_Rhino Windows ..> | 2026-04-07 11:58 | 50K | |
![[ ]](/icons/layout.gif) | 42520_Oakley Windows..> | 2026-02-11 09:28 | 50K | |
![[ ]](/icons/layout.gif) | 47227_BH Electrical ..> | 2026-02-23 15:52 | 50K | |
![[ ]](/icons/layout.gif) | 49559_M & S Home Ins..> | 2026-03-02 10:48 | 50K | |
![[ ]](/icons/layout.gif) | 56248_Eaton Park Win..> | 2026-03-18 10:50 | 50K | |
![[ ]](/icons/layout.gif) | 39599_Go Direct Door..> | 2026-02-03 08:17 | 50K | |
![[ ]](/icons/layout.gif) | 42504_Rollermatic Ga..> | 2026-02-11 09:14 | 50K | |
![[ ]](/icons/layout.gif) | 42943_Go Direct Door..> | 2026-02-12 09:26 | 50K | |
![[ ]](/icons/layout.gif) | 46387_Replacement Ga..> | 2026-02-20 08:21 | 50K | |
![[ ]](/icons/layout.gif) | 51747_SX Property Ma..> | 2026-03-06 07:37 | 50K | |
![[ ]](/icons/layout.gif) | 54870_ASSW Ltd BS10 ..> | 2026-03-13 14:10 | 50K | |
![[ ]](/icons/layout.gif) | 54945_Rollermatic Ga..> | 2026-03-13 14:35 | 50K | |
![[ ]](/icons/layout.gif) | 62847_Go Direct Door..> | 2026-04-07 10:56 | 50K | |
![[ ]](/icons/layout.gif) | 43414_Scotia Garage ..> | 2026-02-13 08:37 | 50K | |
![[ ]](/icons/layout.gif) | 47520_J Brady Garage..> | 2026-02-24 10:24 | 50K | |
![[ ]](/icons/layout.gif) | 62671_Rhino Windows ..> | 2026-04-07 08:29 | 50K | |
![[ ]](/icons/layout.gif) | 66963_EcoGlaze Group..> | 2026-04-17 08:02 | 50K | |
![[ ]](/icons/layout.gif) | 42490_Regal Windows ..> | 2026-02-11 09:09 | 50K | |
![[ ]](/icons/layout.gif) | 47547_Fortress Doors..> | 2026-02-24 10:43 | 50K | |
![[ ]](/icons/layout.gif) | 52092_Worcestershire..> | 2026-03-06 13:25 | 50K | |
![[ ]](/icons/layout.gif) | 33930_Oakley Windows..> | 2026-01-15 15:11 | 50K | |
![[ ]](/icons/layout.gif) | 44910_Eclipse Doors ..> | 2026-02-17 13:28 | 50K | |
![[ ]](/icons/layout.gif) | 34994_Elevate Doors ..> | 2026-01-20 09:48 | 50K | |
![[ ]](/icons/layout.gif) | 44998_Fortress Doors..> | 2026-02-17 14:27 | 50K | |
![[ ]](/icons/layout.gif) | 55761_Go Direct Door..> | 2026-03-17 11:14 | 50K | |
![[ ]](/icons/layout.gif) | 63035_All Door Engin..> | 2026-04-07 13:27 | 50K | |
![[ ]](/icons/layout.gif) | 48989_Go Direct Door..> | 2026-02-27 09:45 | 50K | |
![[ ]](/icons/layout.gif) | 64382_Replacement Ga..> | 2026-04-10 08:07 | 50K | |
![[ ]](/icons/layout.gif) | 51284_ASSW Ltd BS10 ..> | 2026-03-05 09:55 | 50K | |
![[ ]](/icons/layout.gif) | 52663_Scotia Garage ..> | 2026-03-09 13:36 | 50K | |
![[ ]](/icons/layout.gif) | 35224_Elevate Doors ..> | 2026-01-20 14:25 | 50K | |
![[ ]](/icons/layout.gif) | 47502_Serenade Home ..> | 2026-02-24 10:13 | 50K | |
![[ ]](/icons/layout.gif) | 52703_Eastern Frames..> | 2026-03-09 14:13 | 50K | |
![[ ]](/icons/layout.gif) | 62910_Rhino Windows ..> | 2026-04-07 11:59 | 50K | |
![[ ]](/icons/layout.gif) | 63801_Doorolla Ltd S..> | 2026-04-09 06:24 | 50K | |
![[ ]](/icons/layout.gif) | 42146_Eastern Frames..> | 2026-02-10 10:51 | 50K | |
![[ ]](/icons/layout.gif) | 43149_T D Rollerdoor..> | 2026-02-12 14:24 | 50K | |
![[ ]](/icons/layout.gif) | 42091_Scotia Garage ..> | 2026-02-10 09:52 | 50K | |
![[ ]](/icons/layout.gif) | 43063_Elevate Doors ..> | 2026-02-12 12:05 | 50K | |
![[ ]](/icons/layout.gif) | 48966_Rhino Windows ..> | 2026-02-27 09:22 | 50K | |
![[ ]](/icons/layout.gif) | 50384_Dream Installa..> | 2026-03-03 15:41 | 50K | |
![[ ]](/icons/layout.gif) | 61963_J Brady Garage..> | 2026-04-01 13:44 | 50K | |
![[ ]](/icons/layout.gif) | 43056_Elevate Doors ..> | 2026-02-12 12:02 | 50K | |
![[ ]](/icons/layout.gif) | 39121_Herts & Essex ..> | 2026-02-02 09:17 | 50K | |
![[ ]](/icons/layout.gif) | 55766_Go Direct Door..> | 2026-03-17 11:20 | 50K | |
![[ ]](/icons/layout.gif) | 62676_Rhino Windows ..> | 2026-04-07 08:31 | 50K | |
![[ ]](/icons/layout.gif) | 34111_Rhino Windows ..> | 2026-01-16 08:45 | 50K | |
![[ ]](/icons/layout.gif) | 34662_Garage Doors 2..> | 2026-01-19 11:55 | 50K | |
![[ ]](/icons/layout.gif) | 35220_Elevate Doors ..> | 2026-01-20 14:24 | 50K | |
![[ ]](/icons/layout.gif) | 37732_Excellent Ltd ..> | 2026-01-28 07:15 | 50K | |
![[ ]](/icons/layout.gif) | 43059_Elevate Doors ..> | 2026-02-12 12:04 | 50K | |
![[ ]](/icons/layout.gif) | 58391_J Brady Garage..> | 2026-03-24 09:47 | 50K | |
![[ ]](/icons/layout.gif) | 44892_Rollermatic Ga..> | 2026-02-17 13:23 | 50K | |
![[ ]](/icons/layout.gif) | 44894_Rollermatic Ga..> | 2026-02-17 13:24 | 50K | |
![[ ]](/icons/layout.gif) | 35087_Oakley Windows..> | 2026-01-20 11:08 | 50K | |
![[ ]](/icons/layout.gif) | 35171_Absolute Garag..> | 2026-01-20 13:34 | 50K | |
![[ ]](/icons/layout.gif) | 39607_Go Direct Door..> | 2026-02-03 08:20 | 50K | |
![[ ]](/icons/layout.gif) | 40253_Absolute Garag..> | 2026-02-04 08:19 | 50K | |
![[ ]](/icons/layout.gif) | 61359_J Brady Garage..> | 2026-03-31 12:53 | 50K | |
![[ ]](/icons/layout.gif) | 67204_J Brady Garage..> | 2026-04-17 12:06 | 50K | |
![[ ]](/icons/layout.gif) | 51670_FV CONSERVATOR..> | 2026-03-05 16:26 | 50K | |
![[ ]](/icons/layout.gif) | 66319_Adams Industri..> | 2026-04-15 14:21 | 50K | |
![[ ]](/icons/layout.gif) | 51595_3 Counties (Sa..> | 2026-03-05 14:35 | 50K | |
![[ ]](/icons/layout.gif) | 65933_Wellingborough..> | 2026-04-15 07:06 | 50K | |
![[ ]](/icons/layout.gif) | 55758_Go Direct Door..> | 2026-03-17 11:13 | 50K | |
![[ ]](/icons/layout.gif) | 42186_P & R Door Sys..> | 2026-02-10 11:19 | 50K | |
![[ ]](/icons/layout.gif) | 61609_P & R Door Sys..> | 2026-04-01 07:34 | 50K | |
![[ ]](/icons/layout.gif) | 34334_Hadrian Joiner..> | 2026-01-16 14:15 | 50K | |
![[ ]](/icons/layout.gif) | 43139_Danbury Garage..> | 2026-02-12 14:19 | 50K | |
![[ ]](/icons/layout.gif) | 44959_Elevate Doors ..> | 2026-02-17 13:57 | 50K | |
![[ ]](/icons/layout.gif) | 44960_Elevate Doors ..> | 2026-02-17 13:58 | 50K | |
![[ ]](/icons/layout.gif) | 47524_Chelmsford Rol..> | 2026-02-24 10:26 | 50K | |
![[ ]](/icons/layout.gif) | 58657_PJ Lockham Bui..> | 2026-03-24 14:06 | 50K | |
![[ ]](/icons/layout.gif) | 60276_Replacement Ga..> | 2026-03-27 14:33 | 50K | |
![[ ]](/icons/layout.gif) | 63332_Rhino Windows ..> | 2026-04-08 07:58 | 50K | |
![[ ]](/icons/layout.gif) | 43522_Eclipse Doors ..> | 2026-02-13 09:50 | 50K | |
![[ ]](/icons/layout.gif) | 47870_Adams Industri..> | 2026-02-24 16:39 | 50K | |
![[ ]](/icons/layout.gif) | 67211_J Brady Garage..> | 2026-04-17 12:12 | 50K | |
![[ ]](/icons/layout.gif) | 42178_Eastern Frames..> | 2026-02-10 11:00 | 50K | |
![[ ]](/icons/layout.gif) | 57189_Go Direct Door..> | 2026-03-20 08:27 | 50K | |
![[ ]](/icons/layout.gif) | 57680_Go Direct Door..> | 2026-03-20 16:50 | 50K | |
![[ ]](/icons/layout.gif) | 41594_Everbright Win..> | 2026-02-09 10:47 | 50K | |
![[ ]](/icons/layout.gif) | 43065_Elevate Doors ..> | 2026-02-12 12:06 | 50K | |
![[ ]](/icons/layout.gif) | 64387_Wall Garage Do..> | 2026-04-10 08:09 | 50K | |
![[ ]](/icons/layout.gif) | 67112_Garage Makeove..> | 2026-04-17 10:20 | 50K | |
![[ ]](/icons/layout.gif) | 56617_J Brady Garage..> | 2026-03-19 07:32 | 50K | |
![[ ]](/icons/layout.gif) | 60336_CPS Custom Pro..> | 2026-03-27 16:54 | 50K | |
![[ ]](/icons/layout.gif) | 33432_AOS Outdoor Ki..> | 2026-01-14 16:41 | 50K | |
![[ ]](/icons/layout.gif) | 43484_Windoors Harol..> | 2026-02-13 09:22 | 50K | |
![[ ]](/icons/layout.gif) | 44562_CPS Custom Pro..> | 2026-02-17 08:50 | 50K | |
![[ ]](/icons/layout.gif) | 60273_Replacement Ga..> | 2026-03-27 14:32 | 50K | |
![[ ]](/icons/layout.gif) | 61256_Replacement Ga..> | 2026-03-31 12:34 | 50K | |
![[ ]](/icons/layout.gif) | 35434_Rollermatic Ga..> | 2026-01-21 07:27 | 50K | |
![[ ]](/icons/layout.gif) | 37731_Excellent Ltd ..> | 2026-01-28 07:14 | 50K | |
![[ ]](/icons/layout.gif) | 34179_Elevate Doors ..> | 2026-01-16 09:33 | 50K | |
![[ ]](/icons/layout.gif) | 53528_Absolute Garag..> | 2026-03-11 07:40 | 50K | |
![[ ]](/icons/layout.gif) | 42942_Go Direct Door..> | 2026-02-12 09:25 | 50K | |
![[ ]](/icons/layout.gif) | 41988_Roll Right Gar..> | 2026-02-10 07:52 | 50K | |
![[ ]](/icons/layout.gif) | 57150_Go Direct Door..> | 2026-03-20 08:21 | 50K | |
![[ ]](/icons/layout.gif) | 36777_Go Direct Door..> | 2026-01-26 08:45 | 50K | |
![[ ]](/icons/layout.gif) | 43062_Elevate Doors ..> | 2026-02-12 12:04 | 50K | |
![[ ]](/icons/layout.gif) | 52877_Adams Industri..> | 2026-03-09 16:40 | 50K | |
![[ ]](/icons/layout.gif) | 54497_Warnsham Windo..> | 2026-03-13 07:24 | 50K | |
![[ ]](/icons/layout.gif) | 54936_Rollermatic Ga..> | 2026-03-13 14:32 | 50K | |
![[ ]](/icons/layout.gif) | 35036_Warnsham Windo..> | 2026-01-20 10:36 | 50K | |
![[ ]](/icons/layout.gif) | 35888_Rhino Windows ..> | 2026-01-22 08:14 | 50K | |
![[ ]](/icons/layout.gif) | 44873_J Brady Garage..> | 2026-02-17 13:12 | 50K | |
![[ ]](/icons/layout.gif) | 48970_Rhino Windows ..> | 2026-02-27 09:23 | 50K | |
![[ ]](/icons/layout.gif) | 50457_Windowcraft De..> | 2026-03-03 16:47 | 50K | |
![[ ]](/icons/layout.gif) | 59244_Fortress Doors..> | 2026-03-25 14:41 | 50K | |
![[ ]](/icons/layout.gif) | 50392_Dream Installa..> | 2026-03-03 15:46 | 50K | |
![[ ]](/icons/layout.gif) | 60322_Moran Windows ..> | 2026-03-27 15:39 | 50K | |
![[ ]](/icons/layout.gif) | 61407_Chelmsford Rol..> | 2026-03-31 13:25 | 50K | |
![[ ]](/icons/layout.gif) | 61264_Wellingborough..> | 2026-03-31 12:41 | 50K | |
![[ ]](/icons/layout.gif) | 61304_Dream Installa..> | 2026-03-31 12:43 | 50K | |
![[ ]](/icons/layout.gif) | 61598_Go Direct Door..> | 2026-04-01 07:24 | 50K | |
![[ ]](/icons/layout.gif) | 61927_Go Direct Door..> | 2026-04-01 12:58 | 50K | |
![[ ]](/icons/layout.gif) | 43064_Elevate Doors ..> | 2026-02-12 12:06 | 50K | |
![[ ]](/icons/layout.gif) | 46591_Go Direct Door..> | 2026-02-20 11:13 | 50K | |
![[ ]](/icons/layout.gif) | 47973_Go Direct Door..> | 2026-02-25 09:04 | 50K | |
![[ ]](/icons/layout.gif) | 48997_Future Proof H..> | 2026-02-27 09:52 | 50K | |
![[ ]](/icons/layout.gif) | 49432_J Brady Garage..> | 2026-03-02 09:10 | 50K | |
![[ ]](/icons/layout.gif) | 51054_J Brady Garage..> | 2026-03-04 16:10 | 50K | |
![[ ]](/icons/layout.gif) | 34996_Elevate Doors ..> | 2026-01-20 09:50 | 50K | |
![[ ]](/icons/layout.gif) | 38103_Go Direct Door..> | 2026-01-28 15:57 | 50K | |
![[ ]](/icons/layout.gif) | 60247_J Bowman Garag..> | 2026-03-27 14:08 | 50K | |
![[ ]](/icons/layout.gif) | 61389_Doors 4 You Lt..> | 2026-03-31 13:16 | 50K | |
![[ ]](/icons/layout.gif) | 49820_UK Door System..> | 2026-03-02 14:32 | 50K | |
![[ ]](/icons/layout.gif) | 50461_Windowcraft De..> | 2026-03-03 16:48 | 50K | |
![[ ]](/icons/layout.gif) | 44059_Avon Automated..> | 2026-02-16 11:21 | 50K | |
![[ ]](/icons/layout.gif) | 48551_Elevate Doors ..> | 2026-02-26 12:38 | 50K | |
![[ ]](/icons/layout.gif) | 59374_Elevate Doors ..> | 2026-03-26 09:21 | 50K | |
![[ ]](/icons/layout.gif) | 42145_Chelmsford Rol..> | 2026-02-10 10:50 | 50K | |
![[ ]](/icons/layout.gif) | 33927_Oakley Windows..> | 2026-01-15 15:10 | 50K | |
![[ ]](/icons/layout.gif) | 54257_Clic Garage Do..> | 2026-03-12 13:58 | 50K | |
![[ ]](/icons/layout.gif) | 57152_Go Direct Door..> | 2026-03-20 08:23 | 50K | |
![[ ]](/icons/layout.gif) | 37730_Excellent Ltd ..> | 2026-01-28 07:14 | 50K | |
![[ ]](/icons/layout.gif) | 42142_Chelmsford Rol..> | 2026-02-10 10:45 | 50K | |
![[ ]](/icons/layout.gif) | 44876_J Brady Garage..> | 2026-02-17 13:13 | 50K | |
![[ ]](/icons/layout.gif) | 59616_Windowcraft De..> | 2026-03-26 12:46 | 50K | |
![[ ]](/icons/layout.gif) | 35053_Elevate Doors ..> | 2026-01-20 10:43 | 50K | |
![[ ]](/icons/layout.gif) | 64339_Regal Windows ..> | 2026-04-10 08:03 | 50K | |
![[ ]](/icons/layout.gif) | 37286_SDS (Isle Of M..> | 2026-01-27 08:27 | 50K | |
![[ ]](/icons/layout.gif) | 46957_Greenhill Prop..> | 2026-02-23 09:35 | 50K | |
![[ ]](/icons/layout.gif) | 62845_Go Direct Door..> | 2026-04-07 10:56 | 50K | |
![[ ]](/icons/layout.gif) | 59430_All Door Engin..> | 2026-03-26 10:28 | 50K | |
![[ ]](/icons/layout.gif) | 48986_Go Direct Door..> | 2026-02-27 09:44 | 50K | |
![[ ]](/icons/layout.gif) | 62836_Go Direct Door..> | 2026-04-07 10:54 | 50K | |
![[ ]](/icons/layout.gif) | 34181_Elevate Doors ..> | 2026-01-16 09:33 | 50K | |
![[ ]](/icons/layout.gif) | 42485_Secure Entranc..> | 2026-02-11 09:07 | 50K | |
![[ ]](/icons/layout.gif) | 62881_Wellingborough..> | 2026-04-07 11:16 | 50K | |
![[ ]](/icons/layout.gif) | 43136_Danbury Garage..> | 2026-02-12 14:14 | 50K | |
![[ ]](/icons/layout.gif) | 49591_Go Direct Door..> | 2026-03-02 11:16 | 50K | |
![[ ]](/icons/layout.gif) | 62862_Eastern Frames..> | 2026-04-07 11:02 | 50K | |
![[ ]](/icons/layout.gif) | 43593_Chelmsford Rol..> | 2026-02-13 11:33 | 50K | |
![[ ]](/icons/layout.gif) | 53902_Worcestershire..> | 2026-03-11 13:53 | 50K | |
![[ ]](/icons/layout.gif) | 47528_Chelmsford Rol..> | 2026-02-24 10:28 | 50K | |
![[ ]](/icons/layout.gif) | 59742_Windowcraft De..> | 2026-03-26 15:29 | 50K | |
![[ ]](/icons/layout.gif) | 67056_UK Rollerdoors..> | 2026-04-17 10:05 | 50K | |
![[ ]](/icons/layout.gif) | 44871_J Brady Garage..> | 2026-02-17 13:11 | 50K | |
![[ ]](/icons/layout.gif) | 60551_Brownsec Gary ..> | 2026-03-30 11:31 | 50K | |
![[ ]](/icons/layout.gif) | 42134_Chelmsford Rol..> | 2026-02-10 10:30 | 50K | |
![[ ]](/icons/layout.gif) | 44848_Elevate Doors ..> | 2026-02-17 12:59 | 50K | |
![[ ]](/icons/layout.gif) | 51133_Ideal Industri..> | 2026-03-05 07:33 | 50K | |
![[ ]](/icons/layout.gif) | 39200_Future Constru..> | 2026-02-02 11:17 | 50K | |
![[ ]](/icons/layout.gif) | 42174_Eastern Frames..> | 2026-02-10 10:58 | 50K | |
![[ ]](/icons/layout.gif) | 61596_Go Direct Door..> | 2026-04-01 07:23 | 50K | |
![[ ]](/icons/layout.gif) | 34092_Absolute Garag..> | 2026-01-16 08:23 | 50K | |
![[ ]](/icons/layout.gif) | 46590_Go Direct Door..> | 2026-02-20 11:12 | 50K | |
![[ ]](/icons/layout.gif) | 47972_Go Direct Door..> | 2026-02-25 09:03 | 50K | |
![[ ]](/icons/layout.gif) | 47539_Chelmsford Rol..> | 2026-02-24 10:36 | 50K | |
![[ ]](/icons/layout.gif) | 55729_Wellingborough..> | 2026-03-17 10:28 | 50K | |
![[ ]](/icons/layout.gif) | 43606_Chelmsford Rol..> | 2026-02-13 11:48 | 50K | |
![[ ]](/icons/layout.gif) | 40308_A Complete Win..> | 2026-02-04 09:21 | 50K | |
![[ ]](/icons/layout.gif) | 42119_Chelmsford Rol..> | 2026-02-10 10:10 | 50K | |
![[ ]](/icons/layout.gif) | 37733_Excellent Ltd ..> | 2026-01-28 07:15 | 50K | |
![[ ]](/icons/layout.gif) | 47526_Chelmsford Rol..> | 2026-02-24 10:27 | 50K | |
![[ ]](/icons/layout.gif) | 43596_Chelmsford Rol..> | 2026-02-13 11:38 | 50K | |
![[ ]](/icons/layout.gif) | 56743_Avon Automated..> | 2026-03-19 09:51 | 50K | |
![[ ]](/icons/layout.gif) | 37890_SDL DOOR REPAI..> | 2026-01-28 11:38 | 50K | |
![[ ]](/icons/layout.gif) | 44929_SDL DOOR REPAI..> | 2026-02-17 13:48 | 50K | |
![[ ]](/icons/layout.gif) | 36774_Go Direct Door..> | 2026-01-26 08:41 | 50K | |
![[ ]](/icons/layout.gif) | 42499_Rollermatic Ga..> | 2026-02-11 09:12 | 50K | |
![[ ]](/icons/layout.gif) | 38313_Doors 4 You Lt..> | 2026-01-29 10:37 | 50K | |
![[ ]](/icons/layout.gif) | 63440_Weatherproof W..> | 2026-04-08 09:14 | 50K | |
![[ ]](/icons/layout.gif) | 68641_Eclipse Doors ..> | 2026-04-21 13:50 | 50K | |
![[ ]](/icons/layout.gif) | 34998_Elevate Doors ..> | 2026-01-20 09:51 | 50K | |
![[ ]](/icons/layout.gif) | 36768_Go Direct Door..> | 2026-01-26 08:37 | 50K | |
![[ ]](/icons/layout.gif) | 38655_Adams Industri..> | 2026-01-30 08:11 | 50K | |
![[ ]](/icons/layout.gif) | 63717_A Complete Win..> | 2026-04-08 14:45 | 50K | |
![[ ]](/icons/layout.gif) | 60817_R W Windows W..> | 2026-03-30 15:12 | 50K | |
![[ ]](/icons/layout.gif) | 37181_Moran Windows ..> | 2026-01-26 15:34 | 50K | |
![[ ]](/icons/layout.gif) | 38295_J Brady Garage..> | 2026-01-29 10:33 | 50K | |
![[ ]](/icons/layout.gif) | 53347_Garage Door & ..> | 2026-03-10 14:18 | 50K | |
![[ ]](/icons/layout.gif) | 66012_NTRAP NR11 7NZ..> | 2026-04-15 08:19 | 50K | |
![[ ]](/icons/layout.gif) | 37472_Chelmsford Rol..> | 2026-01-27 12:02 | 50K | |
![[ ]](/icons/layout.gif) | 43525_Absolute Garag..> | 2026-02-13 09:52 | 50K | |
![[ ]](/icons/layout.gif) | 44323_Garage Door So..> | 2026-02-16 15:46 | 50K | |
![[ ]](/icons/layout.gif) | 61600_Go Direct Door..> | 2026-04-01 07:25 | 50K | |
![[ ]](/icons/layout.gif) | 35221_Elevate Doors ..> | 2026-01-20 14:25 | 50K | |
![[ ]](/icons/layout.gif) | 42165_Eastern Frames..> | 2026-02-10 10:56 | 50K | |
![[ ]](/icons/layout.gif) | 46589_Go Direct Door..> | 2026-02-20 11:11 | 50K | |
![[ ]](/icons/layout.gif) | 47971_Go Direct Door..> | 2026-02-25 09:03 | 50K | |
![[ ]](/icons/layout.gif) | 44317_Garage Door So..> | 2026-02-16 15:43 | 50K | |
![[ ]](/icons/layout.gif) | 42140_Chelmsford Rol..> | 2026-02-10 10:44 | 50K | |
![[ ]](/icons/layout.gif) | 48612_Eclipse Doors ..> | 2026-02-26 13:59 | 50K | |
![[ ]](/icons/layout.gif) | 53076_Doorolla Ltd S..> | 2026-03-10 09:36 | 50K | |
![[ ]](/icons/layout.gif) | 35222_Elevate Doors ..> | 2026-01-20 14:25 | 50K | |
![[ ]](/icons/layout.gif) | 42110_Chelmsford Rol..> | 2026-02-10 10:02 | 50K | |
![[ ]](/icons/layout.gif) | 42111_Chelmsford Rol..> | 2026-02-10 10:03 | 50K | |
![[ ]](/icons/layout.gif) | 52122_Chelmsford Rol..> | 2026-03-06 13:46 | 50K | |
![[ ]](/icons/layout.gif) | 53615_Wall Garage Do..> | 2026-03-11 09:00 | 50K | |
![[ ]](/icons/layout.gif) | 49589_Go Direct Door..> | 2026-03-02 11:15 | 50K | |
![[ ]](/icons/layout.gif) | 53523_Absolute Garag..> | 2026-03-11 07:35 | 50K | |
![[ ]](/icons/layout.gif) | 47514_Avon Automated..> | 2026-02-24 10:21 | 50K | |
![[ ]](/icons/layout.gif) | 56750_Avon Automated..> | 2026-03-19 09:53 | 50K | |
![[ ]](/icons/layout.gif) | 63280_Digby Services..> | 2026-04-08 06:50 | 50K | |
![[ ]](/icons/layout.gif) | 40306_A Complete Win..> | 2026-02-04 09:20 | 50K | |
![[ ]](/icons/layout.gif) | 43150_T D Rollerdoor..> | 2026-02-12 14:25 | 50K | |
![[ ]](/icons/layout.gif) | 42168_Eastern Frames..> | 2026-02-10 10:56 | 50K | |
![[ ]](/icons/layout.gif) | 52849_Automated Acce..> | 2026-03-09 16:13 | 50K | |
![[ ]](/icons/layout.gif) | 67205_J Brady Garage..> | 2026-04-17 12:09 | 50K | |
![[ ]](/icons/layout.gif) | 44058_Avon Automated..> | 2026-02-16 11:20 | 50K | |
![[ ]](/icons/layout.gif) | 47541_Chelmsford Rol..> | 2026-02-24 10:36 | 50K | |
![[ ]](/icons/layout.gif) | 50395_East Anglia Ro..> | 2026-03-03 15:47 | 50K | |
![[ ]](/icons/layout.gif) | 43604_Chelmsford Rol..> | 2026-02-13 11:46 | 50K | |
![[ ]](/icons/layout.gif) | 47531_Chelmsford Rol..> | 2026-02-24 10:29 | 50K | |
![[ ]](/icons/layout.gif) | 61474_The Lothian Ga..> | 2026-03-31 14:25 | 50K | |
![[ ]](/icons/layout.gif) | 65934_Wellingborough..> | 2026-04-15 07:07 | 50K | |
![[ ]](/icons/layout.gif) | 65937_Future Constru..> | 2026-04-15 07:12 | 50K | |
![[ ]](/icons/layout.gif) | 54934_Rollermatic Ga..> | 2026-03-13 14:31 | 50K | |
![[ ]](/icons/layout.gif) | 43594_Chelmsford Rol..> | 2026-02-13 11:33 | 50K | |
![[ ]](/icons/layout.gif) | 43595_Chelmsford Rol..> | 2026-02-13 11:36 | 50K | |
![[ ]](/icons/layout.gif) | 46966_Greenhill Prop..> | 2026-02-23 09:51 | 50K | |
![[ ]](/icons/layout.gif) | 54447_SDL DOOR REPAI..> | 2026-03-12 16:27 | 50K | |
![[ ]](/icons/layout.gif) | 54259_Rollermatic Ga..> | 2026-03-12 13:59 | 50K | |
![[ ]](/icons/layout.gif) | 56618_J Brady Garage..> | 2026-03-19 07:32 | 50K | |
![[ ]](/icons/layout.gif) | 37513_Wellingborough..> | 2026-01-27 12:37 | 50K | |
![[ ]](/icons/layout.gif) | 59846_Madog Roller D..> | 2026-03-26 16:57 | 50K | |
![[ ]](/icons/layout.gif) | 55049_The Lothian Ga..> | 2026-03-16 07:39 | 50K | |
![[ ]](/icons/layout.gif) | 59425_The Lothian Ga..> | 2026-03-26 10:17 | 50K | |
![[ ]](/icons/layout.gif) | 31975_Avon Automated..> | 2026-01-09 11:05 | 50K | |
![[ ]](/icons/layout.gif) | 33475_Go Direct Door..> | 2026-01-15 08:07 | 50K | |
![[ ]](/icons/layout.gif) | 54438_SDL DOOR REPAI..> | 2026-03-12 16:25 | 50K | |
![[ ]](/icons/layout.gif) | 43605_Chelmsford Rol..> | 2026-02-13 11:47 | 50K | |
![[ ]](/icons/layout.gif) | 66638_SDL DOOR REPAI..> | 2026-04-16 11:38 | 50K | |
![[ ]](/icons/layout.gif) | 52698_SW Trade Frame..> | 2026-03-09 14:11 | 50K | |
![[ ]](/icons/layout.gif) | 61976_Rollermatic Ga..> | 2026-04-01 13:48 | 50K | |
![[ ]](/icons/layout.gif) | 42517_Warnsham Windo..> | 2026-02-11 09:28 | 50K | |
![[ ]](/icons/layout.gif) | 61586_Go Direct Door..> | 2026-04-01 07:15 | 50K | |
![[ ]](/icons/layout.gif) | 61921_Go Direct Door..> | 2026-04-01 12:54 | 50K | |
![[ ]](/icons/layout.gif) | 51817_SW Trade Frame..> | 2026-03-06 08:55 | 50K | |
![[ ]](/icons/layout.gif) | 61928_Go Direct Door..> | 2026-04-01 12:58 | 50K | |
![[ ]](/icons/layout.gif) | 55756_Ideal Industri..> | 2026-03-17 11:09 | 50K | |
![[ ]](/icons/layout.gif) | 41989_Roll Right Gar..> | 2026-02-10 07:54 | 50K | |
![[ ]](/icons/layout.gif) | 42113_Chelmsford Rol..> | 2026-02-10 10:04 | 50K | |
![[ ]](/icons/layout.gif) | 66639_SDL DOOR REPAI..> | 2026-04-16 11:39 | 50K | |
![[ ]](/icons/layout.gif) | 62513_Woods And Sons..> | 2026-04-02 15:52 | 50K | |
![[ ]](/icons/layout.gif) | 54091_SDS (Isle Of M..> | 2026-03-12 09:51 | 50K | |
![[ ]](/icons/layout.gif) | 44637_M. A. E. Windo..> | 2026-02-17 09:30 | 50K | |
![[ ]](/icons/layout.gif) | 42171_Eastern Frames..> | 2026-02-10 10:57 | 50K | |
![[ ]](/icons/layout.gif) | 47529_Chelmsford Rol..> | 2026-02-24 10:28 | 50K | |
![[ ]](/icons/layout.gif) | 13206_Mowbrey Partne..> | 2025-11-10 10:33 | 50K | |
![[ ]](/icons/layout.gif) | 39010_AM Shutters St..> | 2026-01-30 15:29 | 50K | |
![[ ]](/icons/layout.gif) | 42147_Eastern Frames..> | 2026-02-10 10:53 | 50K | |
![[ ]](/icons/layout.gif) | 60659_Go Direct Door..> | 2026-03-30 13:42 | 50K | |
![[ ]](/icons/layout.gif) | 18433_Mowbrey Partne..> | 2025-11-24 08:26 | 50K | |
![[ ]](/icons/layout.gif) | 64627_The Lothian Ga..> | 2026-04-10 12:52 | 50K | |
![[ ]](/icons/layout.gif) | 63020_Thomas Andrew ..> | 2026-04-07 13:13 | 50K | |
![[ ]](/icons/layout.gif) | 48541_Warnsham Windo..> | 2026-02-26 12:35 | 50K | |
![[ ]](/icons/layout.gif) | 35454_Rollermatic Ga..> | 2026-01-21 08:00 | 50K | |
![[ ]](/icons/layout.gif) | 56607_The Lothian Ga..> | 2026-03-19 07:15 | 50K | |
![[ ]](/icons/layout.gif) | 22040_Mowbrey Partne..> | 2025-12-02 13:39 | 50K | |
![[ ]](/icons/layout.gif) | 63277_Digby Services..> | 2026-04-08 06:47 | 50K | |
![[ ]](/icons/layout.gif) | 69840_The Lothian Ga..> | 2026-04-24 08:47 | 50K | |
![[ ]](/icons/layout.gif) | 55048_The Lothian Ga..> | 2026-03-16 07:39 | 50K | |
![[ ]](/icons/layout.gif) | 48617_The Lothian Ga..> | 2026-02-26 14:00 | 50K | |
![[ ]](/icons/layout.gif) | 61481_The Lothian Ga..> | 2026-03-31 14:27 | 50K | |
![[ ]](/icons/layout.gif) | 63021_Thomas Andrew ..> | 2026-04-07 13:14 | 50K | |
![[ ]](/icons/layout.gif) | 51118_M. A. E. Windo..> | 2026-03-05 07:01 | 50K | |
![[ ]](/icons/layout.gif) | 48615_Rollermatic Ga..> | 2026-02-26 14:00 | 50K | |
![[ ]](/icons/layout.gif) | 60885_MIB Electrical..> | 2026-03-30 15:56 | 50K | |
![[ ]](/icons/layout.gif) | 61476_The Lothian Ga..> | 2026-03-31 14:26 | 50K | |
![[ ]](/icons/layout.gif) | 63123_Avon Automated..> | 2026-04-07 14:12 | 50K | |
![[ ]](/icons/layout.gif) | 68645_Eclipse Doors ..> | 2026-04-21 13:52 | 50K | |
![[ ]](/icons/layout.gif) | 54453_SDL DOOR REPAI..> | 2026-03-12 16:29 | 50K | |
![[ ]](/icons/layout.gif) | 66636_SDL DOOR REPAI..> | 2026-04-16 11:38 | 50K | |
![[ ]](/icons/layout.gif) | 61472_The Lothian Ga..> | 2026-03-31 14:24 | 50K | |
![[ ]](/icons/layout.gif) | 59153_Eaton Park Win..> | 2026-03-25 13:15 | 50K | |
![[ ]](/icons/layout.gif) | 63966_P & R Door Sys..> | 2026-04-09 08:59 | 50K | |
![[ ]](/icons/layout.gif) | 61809_Thomas Andrew ..> | 2026-04-01 11:01 | 50K | |
![[ ]](/icons/layout.gif) | 38287_DP Installatio..> | 2026-01-29 10:27 | 50K | |
![[ ]](/icons/layout.gif) | 59152_Eaton Park Win..> | 2026-03-25 13:15 | 50K | |
![[ ]](/icons/layout.gif) | 60877_Southwest Cons..> | 2026-03-30 15:48 | 50K | |
![[ ]](/icons/layout.gif) | 39053_PB Doors Paul ..> | 2026-01-30 16:29 | 51K | |
![[ ]](/icons/layout.gif) | 55571_Emerald Garage..> | 2026-03-16 16:47 | 51K | |
![[ ]](/icons/layout.gif) | 54466_Windowology Lt..> | 2026-03-12 16:40 | 51K | |
![[ ]](/icons/layout.gif) | 46413_AM Shutters M..> | 2026-02-20 08:50 | 51K | |
![[ ]](/icons/layout.gif) | 42190_Fortress Doors..> | 2026-02-10 11:22 | 51K | |
![[ ]](/icons/layout.gif) | 55808_Windowology Lt..> | 2026-03-17 12:09 | 51K | |
![[ ]](/icons/layout.gif) | 62692_Digby Services..> | 2026-04-07 08:44 | 51K | |
![[ ]](/icons/layout.gif) | 33936_Ross Garage Do..> | 2026-01-15 15:17 | 51K | |
![[ ]](/icons/layout.gif) | 35873_Summit Securit..> | 2026-01-21 16:50 | 51K | |
![[ ]](/icons/layout.gif) | 69322_Regal Windows ..> | 2026-04-23 08:04 | 51K | |
![[ ]](/icons/layout.gif) | 39851_Aldous Electri..> | 2026-02-03 11:19 | 51K | |
![[ ]](/icons/layout.gif) | 48023_3 Counties (Sa..> | 2026-02-25 09:41 | 51K | |
![[ ]](/icons/layout.gif) | 53151_Regal Windows ..> | 2026-03-10 11:05 | 51K | |
![[ ]](/icons/layout.gif) | 62218_Entador System..> | 2026-04-02 09:28 | 51K | |
![[ ]](/icons/layout.gif) | 42867_USFL Group Ada..> | 2026-02-12 08:10 | 51K | |
![[ ]](/icons/layout.gif) | 46550_3 Counties (Sa..> | 2026-02-20 10:58 | 51K | |
![[ ]](/icons/layout.gif) | 47959_3 Counties (Sa..> | 2026-02-25 08:53 | 51K | |
![[ ]](/icons/layout.gif) | 49693_ASSW Ltd BS10 ..> | 2026-03-02 12:10 | 51K | |
![[ ]](/icons/layout.gif) | 34997_Elevate Doors ..> | 2026-01-20 09:50 | 51K | |
![[ ]](/icons/layout.gif) | 37306_Mowbrey Partne..> | 2026-01-27 08:55 | 51K | |
![[ ]](/icons/layout.gif) | 55702_Fortress Doors..> | 2026-03-17 09:58 | 51K | |
![[ ]](/icons/layout.gif) | 60392_Oakley Windows..> | 2026-03-30 08:08 | 51K | |
![[ ]](/icons/layout.gif) | 39051_PB Doors Paul ..> | 2026-01-30 16:28 | 51K | |
![[ ]](/icons/layout.gif) | 33926_Oakley Windows..> | 2026-01-15 15:10 | 51K | |
![[ ]](/icons/layout.gif) | 34184_Elevate Doors ..> | 2026-01-16 09:34 | 51K | |
![[ ]](/icons/layout.gif) | 46600_J Bowman Garag..> | 2026-02-20 11:21 | 51K | |
![[ ]](/icons/layout.gif) | 52988_Rhino Windows ..> | 2026-03-10 08:53 | 51K | |
![[ ]](/icons/layout.gif) | 56551_J Brady Garage..> | 2026-03-18 15:42 | 51K | |
![[ ]](/icons/layout.gif) | 50435_Right Choice M..> | 2026-03-03 16:35 | 51K | |
![[ ]](/icons/layout.gif) | 51819_Rhino Windows ..> | 2026-03-06 08:58 | 51K | |
![[ ]](/icons/layout.gif) | 44879_Proud 2 Fix Ma..> | 2026-02-17 13:15 | 51K | |
![[ ]](/icons/layout.gif) | 51396_Aldous Electri..> | 2026-03-05 11:29 | 51K | |
![[ ]](/icons/layout.gif) | 33929_Oakley Windows..> | 2026-01-15 15:11 | 51K | |
![[ ]](/icons/layout.gif) | 35002_Elevate Doors ..> | 2026-01-20 09:52 | 51K | |
![[ ]](/icons/layout.gif) | 45665_Avon Automated..> | 2026-02-18 13:56 | 51K | |
![[ ]](/icons/layout.gif) | 50975_ASSW Ltd BS10 ..> | 2026-03-04 15:41 | 51K | |
![[ ]](/icons/layout.gif) | 55720_Eclipse Doors ..> | 2026-03-17 10:16 | 51K | |
![[ ]](/icons/layout.gif) | 68646_Eclipse Doors ..> | 2026-04-21 13:53 | 51K | |
![[ ]](/icons/layout.gif) | 49428_J Brady Garage..> | 2026-03-02 09:05 | 51K | |
![[ ]](/icons/layout.gif) | 67368_Excellent Ltd ..> | 2026-04-17 14:24 | 51K | |
![[ ]](/icons/layout.gif) | 60431_FV CONSERVATOR..> | 2026-03-30 08:41 | 51K | |
![[ ]](/icons/layout.gif) | 39967_LNR Door Solut..> | 2026-02-03 13:08 | 51K | |
![[ ]](/icons/layout.gif) | 43602_Chelmsford Rol..> | 2026-02-13 11:44 | 51K | |
![[ ]](/icons/layout.gif) | 40056_Replacement Ga..> | 2026-02-03 15:08 | 51K | |
![[ ]](/icons/layout.gif) | 37469_Chelmsford Rol..> | 2026-01-27 12:02 | 51K | |
![[ ]](/icons/layout.gif) | 46018_Chelmsford Rol..> | 2026-02-19 10:30 | 51K | |
![[ ]](/icons/layout.gif) | 46026_Chelmsford Rol..> | 2026-02-19 10:33 | 51K | |
![[ ]](/icons/layout.gif) | 44903_Rollermatic Ga..> | 2026-02-17 13:27 | 51K | |
![[ ]](/icons/layout.gif) | 33255_Future Proof H..> | 2026-01-14 13:48 | 51K | |
![[ ]](/icons/layout.gif) | 67266_Ross Garage Do..> | 2026-04-17 12:42 | 51K | |
![[ ]](/icons/layout.gif) | 52655_TPS Gates & Do..> | 2026-03-09 13:29 | 51K | |
![[ ]](/icons/layout.gif) | 45940_Elite Glazing ..> | 2026-02-19 09:07 | 51K | |
![[ ]](/icons/layout.gif) | 62865_J Brady Garage..> | 2026-04-07 11:03 | 51K | |
![[ ]](/icons/layout.gif) | 40950_P & R Door Sys..> | 2026-02-05 12:31 | 51K | |
![[ ]](/icons/layout.gif) | 34264_SW Trade Frame..> | 2026-01-16 11:56 | 51K | |
![[ ]](/icons/layout.gif) | 36558_Absolute Garag..> | 2026-01-23 13:16 | 51K | |
![[ ]](/icons/layout.gif) | 41972_Will Simpson S..> | 2026-02-09 16:43 | 51K | |
![[ ]](/icons/layout.gif) | 35085_Oakley Windows..> | 2026-01-20 11:07 | 51K | |
![[ ]](/icons/layout.gif) | 43068_Elevate Doors ..> | 2026-02-12 12:07 | 51K | |
![[ ]](/icons/layout.gif) | 65903_J Brady Garage..> | 2026-04-15 06:23 | 51K | |
![[ ]](/icons/layout.gif) | 68640_Eclipse Doors ..> | 2026-04-21 13:50 | 51K | |
![[ ]](/icons/layout.gif) | 44846_Elevate Doors ..> | 2026-02-17 12:55 | 51K | |
![[ ]](/icons/layout.gif) | 34993_Elevate Doors ..> | 2026-01-20 09:48 | 51K | |
![[ ]](/icons/layout.gif) | 40319_Bijan Fouladga..> | 2026-02-04 09:39 | 51K | |
![[ ]](/icons/layout.gif) | 38348_Doors 4 You Lt..> | 2026-01-29 10:58 | 51K | |
![[ ]](/icons/layout.gif) | 38349_Doors 4 You Lt..> | 2026-01-29 10:59 | 51K | |
![[ ]](/icons/layout.gif) | 40983_Oakley Windows..> | 2026-02-05 13:31 | 51K | |
![[ ]](/icons/layout.gif) | 37124_Absolute Garag..> | 2026-01-26 14:26 | 51K | |
![[ ]](/icons/layout.gif) | 42042_Will Simpson S..> | 2026-02-10 08:56 | 51K | |
![[ ]](/icons/layout.gif) | 37459_Dream Installa..> | 2026-01-27 11:59 | 51K | |
![[ ]](/icons/layout.gif) | 61239_Avon Automated..> | 2026-03-31 12:28 | 51K | |
![[ ]](/icons/layout.gif) | 34104_Go Direct Door..> | 2026-01-16 08:34 | 51K | |
![[ ]](/icons/layout.gif) | 40307_A Complete Win..> | 2026-02-04 09:21 | 51K | |
![[ ]](/icons/layout.gif) | 63276_Digby Services..> | 2026-04-08 06:47 | 51K | |
![[ ]](/icons/layout.gif) | 46011_Chelmsford Rol..> | 2026-02-19 10:27 | 51K | |
![[ ]](/icons/layout.gif) | 62841_Go Direct Door..> | 2026-04-07 10:55 | 51K | |
![[ ]](/icons/layout.gif) | 62838_Go Direct Door..> | 2026-04-07 10:55 | 51K | |
![[ ]](/icons/layout.gif) | 38316_Garage Door So..> | 2026-01-29 10:37 | 51K | |
![[ ]](/icons/layout.gif) | 36559_Absolute Garag..> | 2026-01-23 13:16 | 51K | |
![[ ]](/icons/layout.gif) | 62904_Rhino Windows ..> | 2026-04-07 11:56 | 51K | |
![[ ]](/icons/layout.gif) | 62696_Rhino Windows ..> | 2026-04-07 08:45 | 51K | |
![[ ]](/icons/layout.gif) | 61594_Go Direct Door..> | 2026-04-01 07:21 | 51K | |
![[ ]](/icons/layout.gif) | 42188_J Brady Garage..> | 2026-02-10 11:20 | 51K | |
![[ ]](/icons/layout.gif) | 61478_The Lothian Ga..> | 2026-03-31 14:26 | 51K | |
![[ ]](/icons/layout.gif) | 34177_Elevate Doors ..> | 2026-01-16 09:32 | 51K | |
![[ ]](/icons/layout.gif) | 62071_Doors 4 Garage..> | 2026-04-02 06:51 | 51K | |
![[ ]](/icons/layout.gif) | 69838_The Lothian Ga..> | 2026-04-24 08:46 | 51K | |
![[ ]](/icons/layout.gif) | 1123_[0,0] Burgess ..> | 2025-09-29 07:18 | 51K | |
![[ ]](/icons/layout.gif) | 1326_[0,0] Cammack ..> | 2025-09-29 15:38 | 52K | |
![[ ]](/icons/layout.gif) | 1136_G A K Developme..> | 2025-09-29 07:37 | 52K | |
![[ ]](/icons/layout.gif) | 1364_Regal Windows L..> | 2025-09-30 08:34 | 52K | |
![[ ]](/icons/layout.gif) | 1453_Regal Windows L..> | 2025-09-30 14:37 | 52K | |
![[ ]](/icons/layout.gif) | 18126_Avon Automated..> | 2025-11-21 11:45 | 53K | |
![[ ]](/icons/layout.gif) | 55718_Avon Automated..> | 2026-03-17 10:15 | 53K | |
![[ ]](/icons/layout.gif) | 60095_Oakley Windows..> | 2026-03-27 11:57 | 54K | |
![[ ]](/icons/layout.gif) | 45659_Avon Automated..> | 2026-02-18 13:55 | 56K | |
![[ ]](/icons/layout.gif) | 42834_Ewan Clarke - ..> | 2026-02-11 16:46 | 60K | |
![[ ]](/icons/layout.gif) | 45208_Mark Knutton -..> | 2026-02-18 07:56 | 60K | |
![[ ]](/icons/layout.gif) | 40716_Steve Wattridg..> | 2026-02-05 08:37 | 60K | |
![[ ]](/icons/layout.gif) | 26906_Phil Atkins - ..> | 2025-12-16 13:28 | 60K | |
![[ ]](/icons/layout.gif) | 38969_Olphin - OLPH0..> | 2026-01-30 14:48 | 60K | |
![[ ]](/icons/layout.gif) | 69524_Jody Baxer - B..> | 2026-04-23 13:00 | 60K | |
![[ ]](/icons/layout.gif) | 23739_Ryan Mason - M..> | 2025-12-08 10:26 | 60K | |
![[ ]](/icons/layout.gif) | 30106_Jones - JONE00..> | 2026-01-05 11:57 | 60K | |
![[ ]](/icons/layout.gif) | 48978_Nick Norris - ..> | 2026-02-27 09:34 | 60K | |
![[ ]](/icons/layout.gif) | 26501_Brian Gent - G..> | 2025-12-15 15:19 | 60K | |
![[ ]](/icons/layout.gif) | 48927_Adam Lee - LEE..> | 2026-02-27 08:38 | 60K | |
![[ ]](/icons/layout.gif) | 29759_Wragg - WRAG00..> | 2026-01-02 11:56 | 60K | |
![[ ]](/icons/layout.gif) | 43954_Alan England -..> | 2026-02-16 09:49 | 60K | |
![[ ]](/icons/layout.gif) | 44732_Horsley - HORS..> | 2026-02-17 10:30 | 60K | |
![[ ]](/icons/layout.gif) | 31674_Ronald Collin ..> | 2026-01-08 13:19 | 60K | |
![[ ]](/icons/layout.gif) | 36185_David Gummer -..> | 2026-01-22 15:16 | 60K | |
![[ ]](/icons/layout.gif) | 54012_Danny Bee - BE..> | 2026-03-12 08:24 | 60K | |
![[ ]](/icons/layout.gif) | 60457_Darren Newbold..> | 2026-03-30 09:14 | 60K | |
![[ ]](/icons/layout.gif) | 19820_Mick Drake - D..> | 2025-11-26 11:40 | 60K | |
![[ ]](/icons/layout.gif) | 20794_Neil - NEIL000..> | 2025-11-28 10:48 | 60K | |
![[ ]](/icons/layout.gif) | 41775_Gary Scott - S..> | 2026-02-09 14:46 | 60K | |
![[ ]](/icons/layout.gif) | 23785_Tony Evans - E..> | 2025-12-08 11:10 | 60K | |
![[ ]](/icons/layout.gif) | 40709_James Commons ..> | 2026-02-05 08:31 | 60K | |
![[ ]](/icons/layout.gif) | 66900_Liam Carroll -..> | 2026-04-16 16:01 | 60K | |
![[ ]](/icons/layout.gif) | 49465_Peter Sayer - ..> | 2026-03-02 09:33 | 60K | |
![[ ]](/icons/layout.gif) | 54687_Mark Gamble - ..> | 2026-03-13 10:35 | 60K | |
![[ ]](/icons/layout.gif) | 28839_Matthew Saxby ..> | 2025-12-23 08:54 | 60K | |
![[ ]](/icons/layout.gif) | 38530_Kim Kimee - KI..> | 2026-01-29 14:28 | 60K | |
![[ ]](/icons/layout.gif) | 57324_M Wood - WOOD0..> | 2026-03-20 09:57 | 60K | |
![[ ]](/icons/layout.gif) | 65271_Roy Rogers - R..> | 2026-04-13 15:25 | 60K | |
![[ ]](/icons/layout.gif) | 65689_David Beet - B..> | 2026-04-14 12:46 | 60K | |
![[ ]](/icons/layout.gif) | 20759_Andrew Kirk - ..> | 2025-11-28 10:24 | 60K | |
![[ ]](/icons/layout.gif) | 27680_Roy Dunn - DUN..> | 2025-12-18 09:48 | 60K | |
![[ ]](/icons/layout.gif) | 44605_Chris Sheppard..> | 2026-02-17 09:11 | 60K | |
![[ ]](/icons/layout.gif) | 44904_Danny Baker - ..> | 2026-02-17 13:27 | 60K | |
![[ ]](/icons/layout.gif) | 67756_Tim Elms - ELM..> | 2026-04-20 10:43 | 60K | |
![[ ]](/icons/layout.gif) | 41635_Scott Brader -..> | 2026-02-09 11:13 | 60K | |
![[ ]](/icons/layout.gif) | 56807_Barry Carter -..> | 2026-03-19 10:58 | 60K | |
![[ ]](/icons/layout.gif) | 60451_Jennifer Cowle..> | 2026-03-30 09:10 | 60K | |
![[ ]](/icons/layout.gif) | 52856_Steve Courtney..> | 2026-03-09 16:19 | 60K | |
![[ ]](/icons/layout.gif) | 70182_Damien Gowan -..> | 2026-04-24 14:39 | 60K | |
![[ ]](/icons/layout.gif) | 44340_Marc Loppas - ..> | 2026-02-16 16:04 | 60K | |
![[ ]](/icons/layout.gif) | 60466_Mark McGuinnes..> | 2026-03-30 09:20 | 60K | |
![[ ]](/icons/layout.gif) | 30599_Martin Miles -..> | 2026-01-06 10:38 | 60K | |
![[ ]](/icons/layout.gif) | 39857_Dave Ellis - E..> | 2026-02-03 11:28 | 60K | |
![[ ]](/icons/layout.gif) | 41646_Aki Ahmed - AH..> | 2026-02-09 11:24 | 60K | |
![[ ]](/icons/layout.gif) | 17607_Chris Bird - B..> | 2025-11-20 12:15 | 60K | |
![[ ]](/icons/layout.gif) | 54093_Jon Sayers - S..> | 2026-03-12 09:53 | 60K | |
![[ ]](/icons/layout.gif) | 19269_Alan Patterson..> | 2025-11-25 14:23 | 60K | |
![[ ]](/icons/layout.gif) | 50656_Jo Fenton - Jo..> | 2026-03-04 09:24 | 60K | |
![[ ]](/icons/layout.gif) | 60939_Mark Baker - B..> | 2026-03-31 08:10 | 60K | |
![[ ]](/icons/layout.gif) | 19796_Richard Weir -..> | 2025-11-26 11:26 | 60K | |
![[ ]](/icons/layout.gif) | 35980_Joe Barker - B..> | 2026-01-22 10:47 | 60K | |
![[ ]](/icons/layout.gif) | 60484_Clive Benjamin..> | 2026-03-30 10:06 | 60K | |
![[ ]](/icons/layout.gif) | 19808_Chris Foulkes ..> | 2025-11-26 11:31 | 60K | |
![[ ]](/icons/layout.gif) | 30093_Bob Harvey - H..> | 2026-01-05 11:49 | 60K | |
![[ ]](/icons/layout.gif) | 30168_Jerry Warner -..> | 2026-01-05 13:12 | 60K | |
![[ ]](/icons/layout.gif) | 45929_Stephen Savory..> | 2026-02-19 09:01 | 60K | |
![[ ]](/icons/layout.gif) | 45060_Colin Scott - ..> | 2026-02-17 16:00 | 60K | |
![[ ]](/icons/layout.gif) | 48706_Victor Gooding..> | 2026-02-26 15:46 | 60K | |
![[ ]](/icons/layout.gif) | 19799_Richard Wear -..> | 2025-11-26 11:29 | 60K | |
![[ ]](/icons/layout.gif) | 31560_Ian George - G..> | 2026-01-08 11:01 | 60K | |
![[ ]](/icons/layout.gif) | 28732_Paul Booth - B..> | 2025-12-22 15:44 | 60K | |
![[ ]](/icons/layout.gif) | 65280_Keith Day - DA..> | 2026-04-13 15:44 | 60K | |
![[ ]](/icons/layout.gif) | 35508_Bone - BONE000..> | 2026-01-21 08:49 | 60K | |
![[ ]](/icons/layout.gif) | 67848_Chris Ball - B..> | 2026-04-20 13:08 | 60K | |
![[ ]](/icons/layout.gif) | 65882_Brenda Patters..> | 2026-04-14 15:50 | 60K | |
![[ ]](/icons/layout.gif) | 16052_Andy Porter - ..> | 2025-11-17 13:18 | 60K | |
![[ ]](/icons/layout.gif) | 29666_Mrs Davey - DA..> | 2026-01-02 09:10 | 60K | |
![[ ]](/icons/layout.gif) | 33488_Michael Parker..> | 2026-01-15 08:32 | 60K | |
![[ ]](/icons/layout.gif) | 36854_Dan Prior - PR..> | 2026-01-26 10:12 | 60K | |
![[ ]](/icons/layout.gif) | 44073_Mark Beresford..> | 2026-02-16 11:31 | 60K | |
![[ ]](/icons/layout.gif) | 46022_Andrew Thompso..> | 2026-02-19 10:32 | 60K | |
![[ ]](/icons/layout.gif) | 46980_Chris Turner -..> | 2026-02-23 10:04 | 60K | |
![[ ]](/icons/layout.gif) | 48350_Chris Turner -..> | 2026-02-26 09:29 | 60K | |
![[ ]](/icons/layout.gif) | 26416_Jonathan Dunn ..> | 2025-12-15 13:22 | 60K | |
![[ ]](/icons/layout.gif) | 50919_Patrick Crossl..> | 2026-03-04 14:00 | 60K | |
![[ ]](/icons/layout.gif) | 18018_Francis Wood -..> | 2025-11-21 10:02 | 60K | |
![[ ]](/icons/layout.gif) | 30493_Jonny Short - ..> | 2026-01-06 09:04 | 60K | |
![[ ]](/icons/layout.gif) | 44170_Alex Baraona -..> | 2026-02-16 13:37 | 60K | |
![[ ]](/icons/layout.gif) | 21479_Mike Speers - ..> | 2025-12-01 14:25 | 60K | |
![[ ]](/icons/layout.gif) | 29898_Woollard - WOO..> | 2026-01-02 15:51 | 60K | |
![[ ]](/icons/layout.gif) | 33843_Marc Nebbett -..> | 2026-01-15 14:29 | 60K | |
![[ ]](/icons/layout.gif) | 51313_Ian Carruthers..> | 2026-03-05 10:11 | 60K | |
![[ ]](/icons/layout.gif) | 57311_Wesley Mitchel..> | 2026-03-20 09:54 | 60K | |
![[ ]](/icons/layout.gif) | 18174_Phil Miller - ..> | 2025-11-21 13:01 | 60K | |
![[ ]](/icons/layout.gif) | 26718_Tim Seward - S..> | 2025-12-16 09:59 | 60K | |
![[ ]](/icons/layout.gif) | 54938_Lawrence Berry..> | 2026-03-13 14:33 | 60K | |
![[ ]](/icons/layout.gif) | 66545_Kevin Heaver -..> | 2026-04-16 09:19 | 60K | |
![[ ]](/icons/layout.gif) | 64707_Joe Madden - M..> | 2026-04-10 14:18 | 60K | |
![[ ]](/icons/layout.gif) | 65446_Ian Weller - W..> | 2026-04-14 09:06 | 60K | |
![[ ]](/icons/layout.gif) | 29843_Richard Bird -..> | 2026-01-02 14:44 | 60K | |
![[ ]](/icons/layout.gif) | 49222_Mike Fox - FOX..> | 2026-02-27 15:09 | 60K | |
![[ ]](/icons/layout.gif) | 41642_Ewan Clarke - ..> | 2026-02-09 11:21 | 60K | |
![[ ]](/icons/layout.gif) | 49660_Bernard Rice -..> | 2026-03-02 11:47 | 60K | |
![[ ]](/icons/layout.gif) | 67840_Billy Cook - C..> | 2026-04-20 13:01 | 60K | |
![[ ]](/icons/layout.gif) | 43467_Nicole Richmon..> | 2026-02-13 09:14 | 60K | |
![[ ]](/icons/layout.gif) | 44721_Ben Clifford -..> | 2026-02-17 10:26 | 60K | |
![[ ]](/icons/layout.gif) | 48395_Alan Brignull ..> | 2026-02-26 10:40 | 60K | |
![[ ]](/icons/layout.gif) | 63211_John Robson - ..> | 2026-04-07 15:17 | 60K | |
![[ ]](/icons/layout.gif) | 23836_Steve Bennison..> | 2025-12-08 12:06 | 60K | |
![[ ]](/icons/layout.gif) | 41617_Matt Pulman - ..> | 2026-02-09 11:03 | 60K | |
![[ ]](/icons/layout.gif) | 17574_Jack Valentine..> | 2025-11-20 11:25 | 60K | |
![[ ]](/icons/layout.gif) | 29890_Glen Mcarthur ..> | 2026-01-02 15:33 | 60K | |
![[ ]](/icons/layout.gif) | 16009_Simon Stewart ..> | 2025-11-17 11:55 | 60K | |
![[ ]](/icons/layout.gif) | 33971_David Ellis - ..> | 2026-01-15 16:10 | 60K | |
![[ ]](/icons/layout.gif) | 40209_Pete Ormerod -..> | 2026-02-03 16:50 | 60K | |
![[ ]](/icons/layout.gif) | 66288_Simon Bailey -..> | 2026-04-15 13:09 | 60K | |
![[ ]](/icons/layout.gif) | 30425_Neil Frost - F..> | 2026-01-05 16:46 | 60K | |
![[ ]](/icons/layout.gif) | 60850_Lucia Hudova -..> | 2026-03-30 15:27 | 60K | |
![[ ]](/icons/layout.gif) | 69580_Brian King - K..> | 2026-04-23 13:54 | 60K | |
![[ ]](/icons/layout.gif) | 30071_Edward Goldsmi..> | 2026-01-05 11:23 | 60K | |
![[ ]](/icons/layout.gif) | 34481_Cornel Pavel -..> | 2026-01-19 09:06 | 60K | |
![[ ]](/icons/layout.gif) | 54149_James Newman -..> | 2026-03-12 10:42 | 60K | |
![[ ]](/icons/layout.gif) | 60849_Lucia Hudova -..> | 2026-03-30 15:27 | 60K | |
![[ ]](/icons/layout.gif) | 30437_Paul Bates - B..> | 2026-01-05 17:04 | 60K | |
![[ ]](/icons/layout.gif) | 30940_Alan Faircloug..> | 2026-01-06 16:07 | 60K | |
![[ ]](/icons/layout.gif) | 60848_Lucia Hudova -..> | 2026-03-30 15:26 | 60K | |
![[ ]](/icons/layout.gif) | 29776_Andy Austin - ..> | 2026-01-02 12:36 | 60K | |
![[ ]](/icons/layout.gif) | 30229_Eric Hill - HI..> | 2026-01-05 14:22 | 60K | |
![[ ]](/icons/layout.gif) | 34579_Darrell Page -..> | 2026-01-19 10:52 | 60K | |
![[ ]](/icons/layout.gif) | 34583_Darrell Page -..> | 2026-01-19 10:53 | 60K | |
![[ ]](/icons/layout.gif) | 40303_Hillard - HILL..> | 2026-02-04 09:12 | 60K | |
![[ ]](/icons/layout.gif) | 45578_John Kennedy -..> | 2026-02-18 11:52 | 60K | |
![[ ]](/icons/layout.gif) | 46013_MIke Coombs - ..> | 2026-02-19 10:28 | 60K | |
![[ ]](/icons/layout.gif) | 29787_Chris Terry - ..> | 2026-01-02 13:01 | 60K | |
![[ ]](/icons/layout.gif) | 29788_Chris Terry - ..> | 2026-01-02 13:02 | 60K | |
![[ ]](/icons/layout.gif) | 33994_John Quinsee -..> | 2026-01-15 16:49 | 60K | |
![[ ]](/icons/layout.gif) | 16723_Scott Webster ..> | 2025-11-18 14:25 | 60K | |
![[ ]](/icons/layout.gif) | 23764_Daniel Hunt - ..> | 2025-12-08 10:54 | 60K | |
![[ ]](/icons/layout.gif) | 26703_A Walker - WAL..> | 2025-12-16 09:44 | 60K | |
![[ ]](/icons/layout.gif) | 51496_Knox - KNOX000..> | 2026-03-05 13:50 | 60K | |
![[ ]](/icons/layout.gif) | 55288_Barnes - Door ..> | 2026-03-16 12:53 | 60K | |
![[ ]](/icons/layout.gif) | 18294_Kerry Allen - ..> | 2025-11-21 15:59 | 60K | |
![[ ]](/icons/layout.gif) | 25734_Jamie Davies -..> | 2025-12-12 14:19 | 60K | |
![[ ]](/icons/layout.gif) | 42941_Hale - HALE000..> | 2026-02-12 09:24 | 60K | |
![[ ]](/icons/layout.gif) | 62191_Darren Newbold..> | 2026-04-02 09:03 | 60K | |
![[ ]](/icons/layout.gif) | 19037_Ian Church - C..> | 2025-11-25 10:56 | 60K | |
![[ ]](/icons/layout.gif) | 65238_Nigel Thompson..> | 2026-04-13 14:44 | 60K | |
![[ ]](/icons/layout.gif) | 23769_Steve Bennison..> | 2025-12-08 10:55 | 60K | |
![[ ]](/icons/layout.gif) | 17516_Simon Brown - ..> | 2025-11-20 10:36 | 60K | |
![[ ]](/icons/layout.gif) | 26559_Matthew Kimber..> | 2025-12-15 16:06 | 60K | |
![[ ]](/icons/layout.gif) | 45853_Philip Brown -..> | 2026-02-18 16:17 | 60K | |
![[ ]](/icons/layout.gif) | 52007_Greg Jarka - J..> | 2026-03-06 11:40 | 60K | |
![[ ]](/icons/layout.gif) | 66567_David Campbell..> | 2026-04-16 10:03 | 60K | |
![[ ]](/icons/layout.gif) | 21890_Anthony Jennin..> | 2025-12-02 11:49 | 60K | |
![[ ]](/icons/layout.gif) | 34571_Adam Downing -..> | 2026-01-19 10:47 | 60K | |
![[ ]](/icons/layout.gif) | 18036_Jamie Shires -..> | 2025-11-21 10:22 | 60K | |
![[ ]](/icons/layout.gif) | 21798_Paul Stimpson ..> | 2025-12-02 10:48 | 60K | |
![[ ]](/icons/layout.gif) | 26253_Mike Hicken - ..> | 2025-12-15 10:12 | 60K | |
![[ ]](/icons/layout.gif) | 39238_Claire Smith -..> | 2026-02-02 11:57 | 60K | |
![[ ]](/icons/layout.gif) | 53103_Tim Parker - P..> | 2026-03-10 10:25 | 60K | |
![[ ]](/icons/layout.gif) | 27817_Sg Motor Servi..> | 2025-12-18 12:32 | 60K | |
![[ ]](/icons/layout.gif) | 51650_Douglas Wright..> | 2026-03-05 16:00 | 60K | |
![[ ]](/icons/layout.gif) | 61583_Ionut Sanducu ..> | 2026-04-01 07:07 | 60K | |
![[ ]](/icons/layout.gif) | 16158_Gary Dowse - D..> | 2025-11-17 16:04 | 60K | |
![[ ]](/icons/layout.gif) | 34192_David Jenkinso..> | 2026-01-16 09:41 | 60K | |
![[ ]](/icons/layout.gif) | 48066_Daniel Gannawa..> | 2026-02-25 10:37 | 60K | |
![[ ]](/icons/layout.gif) | 45069_Calum Skinner ..> | 2026-02-17 16:05 | 60K | |
![[ ]](/icons/layout.gif) | 53916_Peter Constabl..> | 2026-03-11 14:27 | 60K | |
![[ ]](/icons/layout.gif) | 58931_Mike Rutter - ..> | 2026-03-25 09:23 | 60K | |
![[ ]](/icons/layout.gif) | 40884_Dennis Millier..> | 2026-02-05 11:01 | 60K | |
![[ ]](/icons/layout.gif) | 55322_Mark Wilson - ..> | 2026-03-16 13:18 | 60K | |
![[ ]](/icons/layout.gif) | 35119_Tony Williams ..> | 2026-01-20 11:29 | 60K | |
![[ ]](/icons/layout.gif) | 36922_Nigel Chapman ..> | 2026-01-26 11:52 | 60K | |
![[ ]](/icons/layout.gif) | 36972_Nigel Chapman ..> | 2026-01-26 12:39 | 60K | |
![[ ]](/icons/layout.gif) | 51426_Richard Smee -..> | 2026-03-05 11:53 | 60K | |
![[ ]](/icons/layout.gif) | 55470_Peter Davis - ..> | 2026-03-16 14:24 | 60K | |
![[ ]](/icons/layout.gif) | 57253_Mark Ellis - E..> | 2026-03-20 09:34 | 60K | |
![[ ]](/icons/layout.gif) | 58208_Paul Petrie - ..> | 2026-03-23 16:31 | 60K | |
![[ ]](/icons/layout.gif) | 58231_Paul Petrie - ..> | 2026-03-23 16:53 | 60K | |
![[ ]](/icons/layout.gif) | 23292_Graham Bradley..> | 2025-12-05 09:03 | 60K | |
![[ ]](/icons/layout.gif) | 23730_Ermal Mula - M..> | 2025-12-08 10:18 | 60K | |
![[ ]](/icons/layout.gif) | 39629_Derek Macdonal..> | 2026-02-03 08:40 | 60K | |
![[ ]](/icons/layout.gif) | 41540_Harriet Beck -..> | 2026-02-09 09:19 | 60K | |
![[ ]](/icons/layout.gif) | 52265_Michael Kavana..> | 2026-03-06 16:33 | 60K | |
![[ ]](/icons/layout.gif) | 67191_Anson Moniz - ..> | 2026-04-17 11:26 | 60K | |
![[ ]](/icons/layout.gif) | 15809_Alex Diaconu -..> | 2025-11-17 09:02 | 60K | |
![[ ]](/icons/layout.gif) | 18004_Adam Lodge - L..> | 2025-11-21 09:54 | 60K | |
![[ ]](/icons/layout.gif) | 24080_Paul Abel - AB..> | 2025-12-09 08:58 | 60K | |
![[ ]](/icons/layout.gif) | 25508_Graham Barnett..> | 2025-12-12 11:14 | 60K | |
![[ ]](/icons/layout.gif) | 41857_Richard Ashley..> | 2026-02-09 15:54 | 60K | |
![[ ]](/icons/layout.gif) | 64450_Peter Gill - G..> | 2026-04-10 09:38 | 60K | |
![[ ]](/icons/layout.gif) | 17146_Lynn Brighton ..> | 2025-11-19 11:09 | 60K | |
![[ ]](/icons/layout.gif) | 35111_Lee Smith - SM..> | 2026-01-20 11:26 | 60K | |
![[ ]](/icons/layout.gif) | 45070_Calum Skinner ..> | 2026-02-17 16:05 | 60K | |
![[ ]](/icons/layout.gif) | 46002_Juile Blant - ..> | 2026-02-19 10:10 | 60K | |
![[ ]](/icons/layout.gif) | 51452_Stephen Edward..> | 2026-03-05 12:26 | 60K | |
![[ ]](/icons/layout.gif) | 51453_Stephen Edward..> | 2026-03-05 12:26 | 60K | |
![[ ]](/icons/layout.gif) | 61539_John Connelly ..> | 2026-03-31 15:57 | 60K | |
![[ ]](/icons/layout.gif) | 24684_Stephen Cooper..> | 2025-12-10 10:48 | 60K | |
![[ ]](/icons/layout.gif) | 28191_Ian Parker - P..> | 2025-12-19 11:23 | 60K | |
![[ ]](/icons/layout.gif) | 32328_Danny Andrews ..> | 2026-01-12 10:49 | 60K | |
![[ ]](/icons/layout.gif) | 46365_John Kendrick ..> | 2026-02-20 08:00 | 60K | |
![[ ]](/icons/layout.gif) | 46490_Michael Cummin..> | 2026-02-20 10:00 | 60K | |
![[ ]](/icons/layout.gif) | 58230_Paul Petrie - ..> | 2026-03-23 16:53 | 60K | |
![[ ]](/icons/layout.gif) | 15857_Kieran Hayes -..> | 2025-11-17 09:27 | 60K | |
![[ ]](/icons/layout.gif) | 16069_Louis Martin -..> | 2025-11-17 13:26 | 60K | |
![[ ]](/icons/layout.gif) | 16224_Kieran Hayes -..> | 2025-11-17 16:36 | 60K | |
![[ ]](/icons/layout.gif) | 21883_Russell Steven..> | 2025-12-02 11:41 | 60K | |
![[ ]](/icons/layout.gif) | 31037_Peter Callis -..> | 2026-01-07 09:37 | 60K | |
![[ ]](/icons/layout.gif) | 33348_Graham Mills -..> | 2026-01-14 15:17 | 60K | |
![[ ]](/icons/layout.gif) | 33349_Graham Mills -..> | 2026-01-14 15:17 | 60K | |
![[ ]](/icons/layout.gif) | 53316_John Harding -..> | 2026-03-10 13:49 | 60K | |
![[ ]](/icons/layout.gif) | 53381_Neil Sherry - ..> | 2026-03-10 14:29 | 60K | |
![[ ]](/icons/layout.gif) | 61501_John Cullen - ..> | 2026-03-31 15:00 | 60K | |
![[ ]](/icons/layout.gif) | 69532_Steve West - W..> | 2026-04-23 13:04 | 60K | |
![[ ]](/icons/layout.gif) | 16591_Owen Atkinson ..> | 2025-11-18 12:00 | 60K | |
![[ ]](/icons/layout.gif) | 30370_Benjamin Walsh..> | 2026-01-05 16:20 | 60K | |
![[ ]](/icons/layout.gif) | 36430_Nathan Kelly -..> | 2026-01-23 10:49 | 60K | |
![[ ]](/icons/layout.gif) | 60647_Mark Budden - ..> | 2026-03-30 13:29 | 60K | |
![[ ]](/icons/layout.gif) | 16101_David Gregory ..> | 2025-11-17 14:18 | 60K | |
![[ ]](/icons/layout.gif) | 17108_Joshua Mason -..> | 2025-11-19 10:27 | 60K | |
![[ ]](/icons/layout.gif) | 46499_Paul Cleaver -..> | 2026-02-20 10:04 | 60K | |
![[ ]](/icons/layout.gif) | 59840_Len Fletcher -..> | 2026-03-26 16:50 | 60K | |
![[ ]](/icons/layout.gif) | 62202_James Cuthbert..> | 2026-04-02 09:16 | 60K | |
![[ ]](/icons/layout.gif) | 68198_Aaran Trew - T..> | 2026-04-21 08:27 | 60K | |
![[ ]](/icons/layout.gif) | 21505_Colin Cottrell..> | 2025-12-01 15:00 | 60K | |
![[ ]](/icons/layout.gif) | 24525_Daniel Donohoe..> | 2025-12-09 16:25 | 60K | |
![[ ]](/icons/layout.gif) | 39219_Richard Shortl..> | 2026-02-02 11:30 | 60K | |
![[ ]](/icons/layout.gif) | 46480_Clive Bennett ..> | 2026-02-20 09:58 | 60K | |
![[ ]](/icons/layout.gif) | 60894_Paul Sheridan ..> | 2026-03-30 16:00 | 60K | |
![[ ]](/icons/layout.gif) | 68401_Lucian Balazs ..> | 2026-04-21 10:54 | 60K | |
![[ ]](/icons/layout.gif) | 17556_Graham Bradley..> | 2025-11-20 10:59 | 60K | |
![[ ]](/icons/layout.gif) | 41626_Paul Taylor - ..> | 2026-02-09 11:09 | 60K | |
![[ ]](/icons/layout.gif) | 47657_Keith - Keith ..> | 2026-02-24 12:32 | 60K | |
![[ ]](/icons/layout.gif) | 18578_Craig Weston -..> | 2025-11-24 11:38 | 60K | |
![[ ]](/icons/layout.gif) | 55240_Steve Wattridg..> | 2026-03-16 10:53 | 60K | |
![[ ]](/icons/layout.gif) | 21872_Darryl Hayter ..> | 2025-12-02 11:25 | 60K | |
![[ ]](/icons/layout.gif) | 22255_Colin Cottrell..> | 2025-12-03 08:24 | 60K | |
![[ ]](/icons/layout.gif) | 24418_Mark Braybrook..> | 2025-12-09 13:54 | 60K | |
![[ ]](/icons/layout.gif) | 39243_Norman Gibson ..> | 2026-02-02 11:59 | 60K | |
![[ ]](/icons/layout.gif) | 44808_John Wilson - ..> | 2026-02-17 12:08 | 60K | |
![[ ]](/icons/layout.gif) | 65591_Lee Tigwell - ..> | 2026-04-14 12:11 | 60K | |
![[ ]](/icons/layout.gif) | 22694_Gary Wooldridg..> | 2025-12-04 08:41 | 60K | |
![[ ]](/icons/layout.gif) | 23651_Mick Massey - ..> | 2025-12-08 09:06 | 60K | |
![[ ]](/icons/layout.gif) | 34501_Mihai Raicu - ..> | 2026-01-19 09:44 | 60K | |
![[ ]](/icons/layout.gif) | 44744_Gordon Sneddon..> | 2026-02-17 10:36 | 60K | |
![[ ]](/icons/layout.gif) | 46693_Gary Linney - ..> | 2026-02-20 12:50 | 60K | |
![[ ]](/icons/layout.gif) | 22434_Stewart Walton..> | 2025-12-03 13:05 | 60K | |
![[ ]](/icons/layout.gif) | 24363_Philip Ward - ..> | 2025-12-09 12:06 | 60K | |
![[ ]](/icons/layout.gif) | 60308_Katy Gilhooly ..> | 2026-03-27 14:55 | 60K | |
![[ ]](/icons/layout.gif) | 67326_Mike Fox - Owe..> | 2026-04-17 13:33 | 60K | |
![[ ]](/icons/layout.gif) | 67397_Tim Bassett - ..> | 2026-04-17 15:00 | 60K | |
![[ ]](/icons/layout.gif) | 69454_Greg Goulding ..> | 2026-04-23 11:25 | 60K | |
![[ ]](/icons/layout.gif) | 27969_Percy Thumwood..> | 2025-12-18 16:06 | 60K | |
![[ ]](/icons/layout.gif) | 36444_Mark Styles - ..> | 2026-01-23 11:07 | 60K | |
![[ ]](/icons/layout.gif) | 59235_Bill Mitchell ..> | 2026-03-25 14:28 | 60K | |
![[ ]](/icons/layout.gif) | 45888_Keith Northeas..> | 2026-02-19 08:23 | 60K | |
![[ ]](/icons/layout.gif) | 65069_Joanne Harris ..> | 2026-04-13 11:10 | 60K | |
![[ ]](/icons/layout.gif) | 23737_Kevin Grosveno..> | 2025-12-08 10:24 | 60K | |
![[ ]](/icons/layout.gif) | 32232_Craig Hustwayt..> | 2026-01-12 08:38 | 60K | |
![[ ]](/icons/layout.gif) | 49912_Darren Newbold..> | 2026-03-02 16:02 | 60K | |
![[ ]](/icons/layout.gif) | 16141_Robin Staff - ..> | 2025-11-17 15:34 | 60K | |
![[ ]](/icons/layout.gif) | 17157_David Fleetwoo..> | 2025-11-19 11:20 | 60K | |
![[ ]](/icons/layout.gif) | 66623_Roger Price - ..> | 2026-04-16 11:23 | 60K | |
![[ ]](/icons/layout.gif) | 24214_Emlyn Roberts ..> | 2025-12-09 10:20 | 60K | |
![[ ]](/icons/layout.gif) | 26243_Adrian Carnegi..> | 2025-12-15 09:57 | 60K | |
![[ ]](/icons/layout.gif) | 43507_Keith Pearson ..> | 2026-02-13 09:37 | 60K | |
![[ ]](/icons/layout.gif) | 65724_Terry Welsh - ..> | 2026-04-14 13:32 | 60K | |
![[ ]](/icons/layout.gif) | 41654_David Harries ..> | 2026-02-09 11:27 | 60K | |
![[ ]](/icons/layout.gif) | 44295_John Stelmasia..> | 2026-02-16 15:26 | 60K | |
![[ ]](/icons/layout.gif) | 23740_Ryan Mason - M..> | 2025-12-08 10:29 | 60K | |
![[ ]](/icons/layout.gif) | 55021_Andy King - KI..> | 2026-03-13 15:57 | 60K | |
![[ ]](/icons/layout.gif) | 67922_Aaron Bloomfie..> | 2026-04-20 14:20 | 60K | |
![[ ]](/icons/layout.gif) | 39227_Paul Robinson ..> | 2026-02-02 11:37 | 60K | |
![[ ]](/icons/layout.gif) | 65434_Margaret Yates..> | 2026-04-14 09:00 | 60K | |
![[ ]](/icons/layout.gif) | 35398_Toby McNally -..> | 2026-01-20 16:28 | 60K | |
![[ ]](/icons/layout.gif) | 27742_Andrew Hobson ..> | 2025-12-18 11:29 | 60K | |
![[ ]](/icons/layout.gif) | 34200_Lee Ingold - I..> | 2026-01-16 09:48 | 60K | |
![[ ]](/icons/layout.gif) | 41276_Tony Scott - S..> | 2026-02-06 10:35 | 60K | |
![[ ]](/icons/layout.gif) | 24231_Kevin Binfield..> | 2025-12-09 10:39 | 60K | |
![[ ]](/icons/layout.gif) | 41167_James Hinton -..> | 2026-02-06 08:06 | 60K | |
![[ ]](/icons/layout.gif) | 27262_John Slimmers ..> | 2025-12-17 09:50 | 60K | |
![[ ]](/icons/layout.gif) | 38032_Laura Murphy -..> | 2026-01-28 14:01 | 60K | |
![[ ]](/icons/layout.gif) | 49735_Just Electrica..> | 2026-03-02 13:39 | 60K | |
![[ ]](/icons/layout.gif) | 51687_Andy Page - An..> | 2026-03-05 16:53 | 60K | |
![[ ]](/icons/layout.gif) | 58335_Paul Jenkins -..> | 2026-03-24 09:05 | 60K | |
![[ ]](/icons/layout.gif) | 61404_Blakemore Cons..> | 2026-03-31 13:25 | 60K | |
![[ ]](/icons/layout.gif) | 69289_Andrew Billing..> | 2026-04-23 07:50 | 60K | |
![[ ]](/icons/layout.gif) | 16233_James Bentley ..> | 2025-11-17 16:52 | 60K | |
![[ ]](/icons/layout.gif) | 34616_David Dix - DI..> | 2026-01-19 11:19 | 60K | |
![[ ]](/icons/layout.gif) | 65330_Andrew Billing..> | 2026-04-14 07:28 | 60K | |
![[ ]](/icons/layout.gif) | 70041_Graham Bradley..> | 2026-04-24 12:01 | 60K | |
![[ ]](/icons/layout.gif) | 39763_Laurence Arnol..> | 2026-02-03 10:13 | 60K | |
![[ ]](/icons/layout.gif) | 60437_Daniel Bowes- ..> | 2026-03-30 08:49 | 60K | |
![[ ]](/icons/layout.gif) | 16872_Ian Bilks - RD..> | 2025-11-18 16:26 | 60K | |
![[ ]](/icons/layout.gif) | 17034_Ian Bilks - RD..> | 2025-11-19 08:47 | 60K | |
![[ ]](/icons/layout.gif) | 23979_Josh Satturley..> | 2025-12-08 16:33 | 60K | |
![[ ]](/icons/layout.gif) | 23981_Josh Satturley..> | 2025-12-08 16:33 | 60K | |
![[ ]](/icons/layout.gif) | 37857_Andrew Comaish..> | 2026-01-28 10:57 | 60K | |
![[ ]](/icons/layout.gif) | 47160_Tom Morris - $..> | 2026-02-23 15:05 | 60K | |
![[ ]](/icons/layout.gif) | 54580_Andrew Loizou ..> | 2026-03-13 08:40 | 60K | |
![[ ]](/icons/layout.gif) | 67327_Carl O'grady -..> | 2026-04-17 13:35 | 60K | |
![[ ]](/icons/layout.gif) | 19797_Adam Lillywhit..> | 2025-11-26 11:28 | 60K | |
![[ ]](/icons/layout.gif) | 28952_Paul Cooper - ..> | 2025-12-23 10:19 | 60K | |
![[ ]](/icons/layout.gif) | 48478_John Pirrie - ..> | 2026-02-26 11:27 | 60K | |
![[ ]](/icons/layout.gif) | 16042_Mark Holmes - ..> | 2025-11-17 12:52 | 60K | |
![[ ]](/icons/layout.gif) | 42314_Colin Lambert ..> | 2026-02-10 13:49 | 60K | |
![[ ]](/icons/layout.gif) | 47159_Tom Morris - $..> | 2026-02-23 15:04 | 60K | |
![[ ]](/icons/layout.gif) | 62370_Kelvin Bolton ..> | 2026-04-02 12:59 | 60K | |
![[ ]](/icons/layout.gif) | 22889_Dianne Milling..> | 2025-12-04 12:20 | 60K | |
![[ ]](/icons/layout.gif) | 53145_Richard Davies..> | 2026-03-10 11:03 | 60K | |
![[ ]](/icons/layout.gif) | 46892_Josh West - WE..> | 2026-02-20 15:57 | 60K | |
![[ ]](/icons/layout.gif) | 66443_Ross Mcconvill..> | 2026-04-16 07:26 | 60K | |
![[ ]](/icons/layout.gif) | 67742_Neil Hanafin -..> | 2026-04-20 10:16 | 60K | |
![[ ]](/icons/layout.gif) | 18030_Danny Sacco - ..> | 2025-11-21 10:17 | 60K | |
![[ ]](/icons/layout.gif) | 20583_Gareth Cripps ..> | 2025-11-27 17:03 | 60K | |
![[ ]](/icons/layout.gif) | 33508_Tommy - Tommym..> | 2026-01-15 08:48 | 60K | |
![[ ]](/icons/layout.gif) | 60480_Pmd LTD - PMDL..> | 2026-03-30 10:03 | 60K | |
![[ ]](/icons/layout.gif) | 42734_Stuart Morgan ..> | 2026-02-11 13:13 | 60K | |
![[ ]](/icons/layout.gif) | 42862_Stuart Morgan ..> | 2026-02-12 08:07 | 60K | |
![[ ]](/icons/layout.gif) | 64206_Ian Smith - SM..> | 2026-04-09 15:17 | 60K | |
![[ ]](/icons/layout.gif) | 69914_Angus Raine - ..> | 2026-04-24 09:55 | 60K | |
![[ ]](/icons/layout.gif) | 19805_James Sumner -..> | 2025-11-26 11:30 | 60K | |
![[ ]](/icons/layout.gif) | 26245_Tom Harding - ..> | 2025-12-15 10:02 | 60K | |
![[ ]](/icons/layout.gif) | 49548_Steve Kirk - K..> | 2026-03-02 10:33 | 60K | |
![[ ]](/icons/layout.gif) | 17539_Andrew Lobb - ..> | 2025-11-20 10:52 | 60K | |
![[ ]](/icons/layout.gif) | 20815_Alistair Culsh..> | 2025-11-28 11:07 | 60K | |
![[ ]](/icons/layout.gif) | 40403_Peter Lewis - ..> | 2026-02-04 11:32 | 60K | |
![[ ]](/icons/layout.gif) | 57425_Derek Coward -..> | 2026-03-20 11:52 | 60K | |
![[ ]](/icons/layout.gif) | 15665_M T Atkinson -..> | 2025-11-14 14:49 | 60K | |
![[ ]](/icons/layout.gif) | 16043_Mark Holmes - ..> | 2025-11-17 12:52 | 60K | |
![[ ]](/icons/layout.gif) | 49294_Michael Toon -..> | 2026-02-27 16:40 | 60K | |
![[ ]](/icons/layout.gif) | 19056_Timea Horvath ..> | 2025-11-25 11:27 | 60K | |
![[ ]](/icons/layout.gif) | 67411_John Walsh - R..> | 2026-04-17 15:47 | 60K | |
![[ ]](/icons/layout.gif) | 19084_James Rankin -..> | 2025-11-25 12:17 | 60K | |
![[ ]](/icons/layout.gif) | 28741_Gary Frost - F..> | 2025-12-22 16:15 | 60K | |
![[ ]](/icons/layout.gif) | 34758_Paul Wise - WI..> | 2026-01-19 14:37 | 60K | |
![[ ]](/icons/layout.gif) | 60602_Andy Page - Ex..> | 2026-03-30 12:53 | 60K | |
![[ ]](/icons/layout.gif) | 64201_Gary Thom - TH..> | 2026-04-09 15:15 | 60K | |
![[ ]](/icons/layout.gif) | 16038_Alex Butler - ..> | 2025-11-17 12:47 | 60K | |
![[ ]](/icons/layout.gif) | 45608_Mark Ghent - H..> | 2026-02-18 12:17 | 60K | |
![[ ]](/icons/layout.gif) | 39823_Stephen Chambe..> | 2026-02-03 11:03 | 60K | |
![[ ]](/icons/layout.gif) | 41236_Tim Palmer - W..> | 2026-02-06 09:54 | 60K | |
![[ ]](/icons/layout.gif) | 44370_James Pullen -..> | 2026-02-16 16:24 | 60K | |
![[ ]](/icons/layout.gif) | 50056_Robert Cronk -..> | 2026-03-03 08:43 | 60K | |
![[ ]](/icons/layout.gif) | 55439_Mark Bowles - ..> | 2026-03-16 14:04 | 60K | |
![[ ]](/icons/layout.gif) | 59238_Bill Mitchell ..> | 2026-03-25 14:29 | 60K | |
![[ ]](/icons/layout.gif) | 18794_Charlie Sander..> | 2025-11-24 16:17 | 60K | |
![[ ]](/icons/layout.gif) | 22943_Andy Willis - ..> | 2025-12-04 13:40 | 60K | |
![[ ]](/icons/layout.gif) | 30555_Allan Shortman..> | 2026-01-06 09:48 | 60K | |
![[ ]](/icons/layout.gif) | 65048_Hibberd Matt -..> | 2026-04-13 10:37 | 60K | |
![[ ]](/icons/layout.gif) | 17570_Phil Coleman -..> | 2025-11-20 11:15 | 60K | |
![[ ]](/icons/layout.gif) | 26446_Daniel Davies ..> | 2025-12-15 13:40 | 60K | |
![[ ]](/icons/layout.gif) | 44661_Jack Taylor - ..> | 2026-02-17 09:49 | 60K | |
![[ ]](/icons/layout.gif) | 49368_Miriam Miriam ..> | 2026-03-02 08:40 | 60K | |
![[ ]](/icons/layout.gif) | 67379_Claire Poxon -..> | 2026-04-17 14:48 | 60K | |
![[ ]](/icons/layout.gif) | 47970_Michael Brough..> | 2026-02-25 09:02 | 60K | |
![[ ]](/icons/layout.gif) | 69355_Bert Taylor - ..> | 2026-04-23 08:50 | 60K | |
![[ ]](/icons/layout.gif) | 20848_Neil Stevens -..> | 2025-11-28 11:45 | 60K | |
![[ ]](/icons/layout.gif) | 31209_Ionut Sanducu ..> | 2026-01-07 14:06 | 60K | |
![[ ]](/icons/layout.gif) | 41143_David Pearson ..> | 2026-02-06 07:44 | 60K | |
![[ ]](/icons/layout.gif) | 50306_Tim Burton - B..> | 2026-03-03 13:14 | 60K | |
![[ ]](/icons/layout.gif) | 50584_Neil Bush - Ne..> | 2026-03-04 08:35 | 60K | |
![[ ]](/icons/layout.gif) | 57781_James Parry - ..> | 2026-03-23 09:21 | 60K | |
![[ ]](/icons/layout.gif) | 65348_Steve Binns - ..> | 2026-04-14 07:43 | 60K | |
![[ ]](/icons/layout.gif) | 66412_Richard Regan ..> | 2026-04-16 06:56 | 60K | |
![[ ]](/icons/layout.gif) | 19063_Simon Herbert ..> | 2025-11-25 11:37 | 60K | |
![[ ]](/icons/layout.gif) | 31442_James Smith - ..> | 2026-01-08 08:59 | 60K | |
![[ ]](/icons/layout.gif) | 68216_Steven Barbsle..> | 2026-04-21 08:34 | 60K | |
![[ ]](/icons/layout.gif) | 67375_Ryan Baxter - ..> | 2026-04-17 14:41 | 60K | |
![[ ]](/icons/layout.gif) | 17877_Patrick Banks ..> | 2025-11-21 07:59 | 60K | |
![[ ]](/icons/layout.gif) | 31443_James Smith - ..> | 2026-01-08 08:59 | 60K | |
![[ ]](/icons/layout.gif) | 32322_Sue Lincoln - ..> | 2026-01-12 10:26 | 60K | |
![[ ]](/icons/layout.gif) | 39522_John Cerosola ..> | 2026-02-03 07:37 | 60K | |
![[ ]](/icons/layout.gif) | 65005_Derek Jardine ..> | 2026-04-13 09:56 | 60K | |
![[ ]](/icons/layout.gif) | 69090_Luke Haddy - H..> | 2026-04-22 13:31 | 60K | |
![[ ]](/icons/layout.gif) | 26694_Andy Clarke - ..> | 2025-12-16 09:39 | 60K | |
![[ ]](/icons/layout.gif) | 29782_Abumchukwu Eje..> | 2026-01-02 12:48 | 60K | |
![[ ]](/icons/layout.gif) | 46951_Jason Martin -..> | 2026-02-23 09:33 | 60K | |
![[ ]](/icons/layout.gif) | 69361_Keith Jones - ..> | 2026-04-23 08:54 | 60K | |
![[ ]](/icons/layout.gif) | 44131_Jack Paul - In..> | 2026-02-16 12:22 | 60K | |
![[ ]](/icons/layout.gif) | 31109_Owen Ingram - ..> | 2026-01-07 11:46 | 60K | |
![[ ]](/icons/layout.gif) | 68028_Richard Keach ..> | 2026-04-20 15:48 | 60K | |
![[ ]](/icons/layout.gif) | 29313_Alan Wood - OR..> | 2025-12-29 08:22 | 60K | |
![[ ]](/icons/layout.gif) | 19085_James Rankin -..> | 2025-11-25 12:19 | 60K | |
![[ ]](/icons/layout.gif) | 20573_Sam Capone - H..> | 2025-11-27 16:51 | 60K | |
![[ ]](/icons/layout.gif) | 20579_Sam Capone - H..> | 2025-11-27 16:56 | 60K | |
![[ ]](/icons/layout.gif) | 24225_Matt Solomon -..> | 2025-12-09 10:36 | 60K | |
![[ ]](/icons/layout.gif) | 35833_Ian Frazer - K..> | 2026-01-21 15:46 | 60K | |
![[ ]](/icons/layout.gif) | 45025_Lee Cocker - C..> | 2026-02-17 15:08 | 60K | |
![[ ]](/icons/layout.gif) | 46972_Anthony Bendon..> | 2026-02-23 09:55 | 60K | |
![[ ]](/icons/layout.gif) | 51341_Steven Cole - ..> | 2026-03-05 10:37 | 60K | |
![[ ]](/icons/layout.gif) | 67138_Neil Hughes - ..> | 2026-04-17 10:36 | 60K | |
![[ ]](/icons/layout.gif) | 58229_CPS Ltd Pawel ..> | 2026-03-23 16:51 | 60K | |
![[ ]](/icons/layout.gif) | 18468_Andrew Bullen ..> | 2025-11-24 09:34 | 60K | |
![[ ]](/icons/layout.gif) | 20268_Gavin Battle -..> | 2025-11-27 11:09 | 60K | |
![[ ]](/icons/layout.gif) | 40435_Craig Reid - R..> | 2026-02-04 11:59 | 60K | |
![[ ]](/icons/layout.gif) | 55041_Harrold Knight..> | 2026-03-13 16:48 | 60K | |
![[ ]](/icons/layout.gif) | 67132_John Summerfie..> | 2026-04-17 10:32 | 60K | |
![[ ]](/icons/layout.gif) | 54085_Owain Hughes -..> | 2026-03-12 09:49 | 60K | |
![[ ]](/icons/layout.gif) | 65811_Gary Bernardo ..> | 2026-04-14 14:33 | 60K | |
![[ ]](/icons/layout.gif) | 20540_Shaun Hilton -..> | 2025-11-27 16:21 | 60K | |
![[ ]](/icons/layout.gif) | 57095_Paul Hazell - ..> | 2026-03-19 16:43 | 60K | |
![[ ]](/icons/layout.gif) | 16652_Tibbles - Lock..> | 2025-11-18 13:21 | 60K | |
![[ ]](/icons/layout.gif) | 20541_Shaun Hilton -..> | 2025-11-27 16:21 | 60K | |
![[ ]](/icons/layout.gif) | 41178_Adrian Hollowa..> | 2026-02-06 08:14 | 60K | |
![[ ]](/icons/layout.gif) | 46973_Anthony Bendon..> | 2026-02-23 09:56 | 60K | |
![[ ]](/icons/layout.gif) | 20888_Gibbons - GIBB..> | 2025-11-28 12:16 | 60K | |
![[ ]](/icons/layout.gif) | 31618_Scott Tatham -..> | 2026-01-08 11:59 | 60K | |
![[ ]](/icons/layout.gif) | 36118_Will Brown - K..> | 2026-01-22 12:38 | 60K | |
![[ ]](/icons/layout.gif) | 36290_Will Brown - K..> | 2026-01-23 09:24 | 60K | |
![[ ]](/icons/layout.gif) | 53668_Bradley Sincla..> | 2026-03-11 09:22 | 60K | |
![[ ]](/icons/layout.gif) | 58178_Paul Austin - ..> | 2026-03-23 15:47 | 60K | |
![[ ]](/icons/layout.gif) | 36098_Hubert Oginski..> | 2026-01-22 12:10 | 60K | |
![[ ]](/icons/layout.gif) | 42542_Frank Han - Re..> | 2026-02-11 09:48 | 60K | |
![[ ]](/icons/layout.gif) | 23745_Steve McFarlan..> | 2025-12-08 10:29 | 60K | |
![[ ]](/icons/layout.gif) | 16643_Paul Watkins -..> | 2025-11-18 13:18 | 60K | |
![[ ]](/icons/layout.gif) | 31606_Lindsey Wallis..> | 2026-01-08 11:47 | 60K | |
![[ ]](/icons/layout.gif) | 18997_Joe Davis - OR..> | 2025-11-25 10:01 | 60K | |
![[ ]](/icons/layout.gif) | 29453_Andrew Hobson ..> | 2025-12-30 07:53 | 60K | |
![[ ]](/icons/layout.gif) | 66641_Lyn Bryant-Nic..> | 2026-04-16 11:41 | 60K | |
![[ ]](/icons/layout.gif) | 35985_Julie Wrigth -..> | 2026-01-22 10:49 | 60K | |
![[ ]](/icons/layout.gif) | 36529_John Payne - O..> | 2026-01-23 12:26 | 60K | |
![[ ]](/icons/layout.gif) | 59491_Nathan Kempson..> | 2026-03-26 10:40 | 60K | |
![[ ]](/icons/layout.gif) | 68851_Stuart Badkin ..> | 2026-04-22 08:47 | 60K | |
![[ ]](/icons/layout.gif) | 49308_Andrew Fox - O..> | 2026-02-27 16:59 | 60K | |
![[ ]](/icons/layout.gif) | 69124_Stephan Potter..> | 2026-04-22 14:30 | 60K | |
![[ ]](/icons/layout.gif) | 15729_Vincent Beech ..> | 2025-11-15 12:03 | 60K | |
![[ ]](/icons/layout.gif) | 19318_Ian Bilks - RD..> | 2025-11-25 15:04 | 60K | |
![[ ]](/icons/layout.gif) | 31919_Russell Hudson..> | 2026-01-09 09:05 | 60K | |
![[ ]](/icons/layout.gif) | 30300_Phil Monday - ..> | 2026-01-05 15:27 | 60K | |
![[ ]](/icons/layout.gif) | 34296_Garry Houghton..> | 2026-01-16 13:43 | 60K | |
![[ ]](/icons/layout.gif) | 35983_Julie Wrigth -..> | 2026-01-22 10:48 | 60K | |
![[ ]](/icons/layout.gif) | 36223_Garry Houghton..> | 2026-01-22 16:39 | 60K | |
![[ ]](/icons/layout.gif) | 42826_Bob Peer - PEE..> | 2026-02-11 16:20 | 60K | |
![[ ]](/icons/layout.gif) | 69466_Paul Farrelly ..> | 2026-04-23 11:36 | 60K | |
![[ ]](/icons/layout.gif) | 19324_Ian Dilks - RD..> | 2025-11-25 15:08 | 60K | |
![[ ]](/icons/layout.gif) | 48661_Phil Nicholson..> | 2026-02-26 14:49 | 60K | |
![[ ]](/icons/layout.gif) | 15724_Zbigniew Tomic..> | 2025-11-15 11:42 | 60K | |
![[ ]](/icons/layout.gif) | 21266_Charlie Swift ..> | 2025-12-01 10:13 | 60K | |
![[ ]](/icons/layout.gif) | 31419_James Oldfield..> | 2026-01-08 08:41 | 60K | |
![[ ]](/icons/layout.gif) | 34189_Dave Crabtree ..> | 2026-01-16 09:36 | 60K | |
![[ ]](/icons/layout.gif) | 32686_Justin Finn - ..> | 2026-01-13 11:17 | 60K | |
![[ ]](/icons/layout.gif) | 32736_Mark Guyler - ..> | 2026-01-13 11:43 | 60K | |
![[ ]](/icons/layout.gif) | 33820_Justin Finn - ..> | 2026-01-15 14:03 | 60K | |
![[ ]](/icons/layout.gif) | 32679_D A Mummery - ..> | 2026-01-13 11:10 | 60K | |
![[ ]](/icons/layout.gif) | 47097_Robert Rovetto..> | 2026-02-23 13:08 | 60K | |
![[ ]](/icons/layout.gif) | 67458_Prashant Karke..> | 2026-04-20 07:10 | 60K | |
![[ ]](/icons/layout.gif) | 18633_Raven Fire And..> | 2025-11-24 13:29 | 60K | |
![[ ]](/icons/layout.gif) | 29319_John Duncan - ..> | 2025-12-29 08:26 | 60K | |
![[ ]](/icons/layout.gif) | 38364_Tony Phelps - ..> | 2026-01-29 11:04 | 60K | |
![[ ]](/icons/layout.gif) | 58088_Roy Good - Pho..> | 2026-03-23 13:35 | 60K | |
![[ ]](/icons/layout.gif) | 19001_Julian Clarke ..> | 2025-11-25 10:06 | 60K | |
![[ ]](/icons/layout.gif) | 29255_Chris Terry - ..> | 2025-12-29 07:36 | 60K | |
![[ ]](/icons/layout.gif) | 34102_Richard Hanlon..> | 2026-01-16 08:33 | 60K | |
![[ ]](/icons/layout.gif) | 52204_Charles Thomps..> | 2026-03-06 14:47 | 60K | |
![[ ]](/icons/layout.gif) | 23260_Paddock Builde..> | 2025-12-05 08:56 | 60K | |
![[ ]](/icons/layout.gif) | 31306_Paul Pringle -..> | 2026-01-08 07:56 | 60K | |
![[ ]](/icons/layout.gif) | 31714_Stuart Lee - R..> | 2026-01-08 14:08 | 60K | |
![[ ]](/icons/layout.gif) | 19124_Mike Smith - O..> | 2025-11-25 13:13 | 60K | |
![[ ]](/icons/layout.gif) | 21267_Charlie Swift ..> | 2025-12-01 10:13 | 60K | |
![[ ]](/icons/layout.gif) | 34190_Dave Crabtree ..> | 2026-01-16 09:36 | 60K | |
![[ ]](/icons/layout.gif) | 34697_Thomas Felipe ..> | 2026-01-19 13:12 | 60K | |
![[ ]](/icons/layout.gif) | 38220_Zdena Murgacov..> | 2026-01-29 09:11 | 60K | |
![[ ]](/icons/layout.gif) | 63948_Petru Chificia..> | 2026-04-09 08:38 | 60K | |
![[ ]](/icons/layout.gif) | 30309_Tom Collins - ..> | 2026-01-05 15:44 | 60K | |
![[ ]](/icons/layout.gif) | 40680_Brite Binu - B..> | 2026-02-05 07:30 | 60K | |
![[ ]](/icons/layout.gif) | 58152_Nick Plumb - O..> | 2026-03-23 15:07 | 60K | |
![[ ]](/icons/layout.gif) | 59481_Joe Targett - ..> | 2026-03-26 10:35 | 60K | |
![[ ]](/icons/layout.gif) | 47104_Dominic Savage..> | 2026-02-23 13:15 | 60K | |
![[ ]](/icons/layout.gif) | 50371_Tom Morris - $..> | 2026-03-03 15:13 | 60K | |
![[ ]](/icons/layout.gif) | 25160_Rob Warman - O..> | 2025-12-11 13:53 | 60K | |
![[ ]](/icons/layout.gif) | 32692_Guy Barker - O..> | 2026-01-13 11:21 | 60K | |
![[ ]](/icons/layout.gif) | 50370_Tom Morris - $..> | 2026-03-03 15:13 | 60K | |
![[ ]](/icons/layout.gif) | 54979_Stephen Foster..> | 2026-03-13 15:28 | 60K | |
![[ ]](/icons/layout.gif) | 62178_Nicks Carpentr..> | 2026-04-02 08:50 | 60K | |
![[ ]](/icons/layout.gif) | 23692_Matthew Robins..> | 2025-12-08 09:55 | 60K | |
![[ ]](/icons/layout.gif) | 64526_Danny Carter -..> | 2026-04-10 11:58 | 60K | |
![[ ]](/icons/layout.gif) | 67387_Lisa Muller - ..> | 2026-04-17 14:53 | 60K | |
![[ ]](/icons/layout.gif) | 32715_Stuart Lee - O..> | 2026-01-13 11:32 | 60K | |
![[ ]](/icons/layout.gif) | 38381_Rachael Komush..> | 2026-01-29 11:15 | 60K | |
![[ ]](/icons/layout.gif) | 27160_Alex George - ..> | 2025-12-17 08:15 | 60K | |
![[ ]](/icons/layout.gif) | 30864_Rob Percival -..> | 2026-01-06 15:13 | 60K | |
![[ ]](/icons/layout.gif) | 32700_John Bignell -..> | 2026-01-13 11:26 | 60K | |
![[ ]](/icons/layout.gif) | 34683_Ben Bradbury -..> | 2026-01-19 12:44 | 60K | |
![[ ]](/icons/layout.gif) | 47130_Edward Lawson ..> | 2026-02-23 14:02 | 60K | |
![[ ]](/icons/layout.gif) | 69338_Collin Pickeri..> | 2026-04-23 08:24 | 60K | |
![[ ]](/icons/layout.gif) | 54032_Jim Davis Carp..> | 2026-03-12 08:49 | 60K | |
![[ ]](/icons/layout.gif) | 21598_Thomas Hartley..> | 2025-12-01 16:53 | 60K | |
![[ ]](/icons/layout.gif) | 31030_Peter Gojka - ..> | 2026-01-07 09:26 | 60K | |
![[ ]](/icons/layout.gif) | 34628_Colin Macdonal..> | 2026-01-19 11:31 | 60K | |
![[ ]](/icons/layout.gif) | 34688_Colin Macdonal..> | 2026-01-19 12:50 | 60K | |
![[ ]](/icons/layout.gif) | 38835_A Long - Monty..> | 2026-01-30 10:54 | 60K | |
![[ ]](/icons/layout.gif) | 48430_Nigel Chapman ..> | 2026-02-26 10:48 | 60K | |
![[ ]](/icons/layout.gif) | 63156_Mark Bateman -..> | 2026-04-07 14:42 | 60K | |
![[ ]](/icons/layout.gif) | 28600_Gavin Shea - O..> | 2025-12-22 12:47 | 60K | |
![[ ]](/icons/layout.gif) | 30630_Shaun Butler -..> | 2026-01-06 11:09 | 60K | |
![[ ]](/icons/layout.gif) | 30753_Gary Harvey - ..> | 2026-01-06 12:37 | 60K | |
![[ ]](/icons/layout.gif) | 32401_Paul Samuels -..> | 2026-01-12 14:06 | 60K | |
![[ ]](/icons/layout.gif) | 38796_Gary Jones - P..> | 2026-01-30 10:42 | 60K | |
![[ ]](/icons/layout.gif) | 53687_Matthew Hunt -..> | 2026-03-11 09:42 | 60K | |
![[ ]](/icons/layout.gif) | 69804_Marc Sutton - ..> | 2026-04-24 08:26 | 60K | |
![[ ]](/icons/layout.gif) | 19432_Timea Horvath ..> | 2025-11-25 16:17 | 60K | |
![[ ]](/icons/layout.gif) | 31048_Andrew Hammond..> | 2026-01-07 09:53 | 60K | |
![[ ]](/icons/layout.gif) | 38192_Dave Barnett -..> | 2026-01-29 08:30 | 60K | |
![[ ]](/icons/layout.gif) | 39334_William Simmon..> | 2026-02-02 14:39 | 60K | |
![[ ]](/icons/layout.gif) | 47509_Chris Hodge - ..> | 2026-02-24 10:17 | 60K | |
![[ ]](/icons/layout.gif) | 36087_Andrew Marshal..> | 2026-01-22 11:59 | 60K | |
![[ ]](/icons/layout.gif) | 36284_Andrew Marshal..> | 2026-01-23 09:14 | 60K | |
![[ ]](/icons/layout.gif) | 38648_Jack Sowerby -..> | 2026-01-30 07:55 | 60K | |
![[ ]](/icons/layout.gif) | 49457_Jake Skipper -..> | 2026-03-02 09:29 | 60K | |
![[ ]](/icons/layout.gif) | 36898_Alan Middledit..> | 2026-01-26 11:06 | 60K | |
![[ ]](/icons/layout.gif) | 41516_Brian Higgins ..> | 2026-02-09 08:39 | 60K | |
![[ ]](/icons/layout.gif) | 60689_Adam Reynolds ..> | 2026-03-30 14:23 | 60K | |
![[ ]](/icons/layout.gif) | 63954_Cameron Grant ..> | 2026-04-09 08:48 | 60K | |
![[ ]](/icons/layout.gif) | 67718_David JACOB - ..> | 2026-04-20 09:57 | 60K | |
![[ ]](/icons/layout.gif) | 21184_Paul Jones - O..> | 2025-12-01 09:17 | 60K | |
![[ ]](/icons/layout.gif) | 37163_Simon Kirk - K..> | 2026-01-26 15:24 | 60K | |
![[ ]](/icons/layout.gif) | 23306_Icicle Service..> | 2025-12-05 09:16 | 60K | |
![[ ]](/icons/layout.gif) | 41268_Jakub Pilarski..> | 2026-02-06 10:29 | 60K | |
![[ ]](/icons/layout.gif) | 47369_J Bowman Garag..> | 2026-02-24 07:52 | 60K | |
![[ ]](/icons/layout.gif) | 36199_Ian Frazer - K..> | 2026-01-22 15:57 | 60K | |
![[ ]](/icons/layout.gif) | 38375_Montronix Jon ..> | 2026-01-29 11:10 | 60K | |
![[ ]](/icons/layout.gif) | 26747_Stan Annis - S..> | 2025-12-16 10:37 | 60K | |
![[ ]](/icons/layout.gif) | 31057_John Anderson ..> | 2026-01-07 10:01 | 60K | |
![[ ]](/icons/layout.gif) | 23169_Philip Drakele..> | 2025-12-04 16:40 | 60K | |
![[ ]](/icons/layout.gif) | 30343_Carol Plumley ..> | 2026-01-05 16:01 | 60K | |
![[ ]](/icons/layout.gif) | 47229_Jamie Hales - ..> | 2026-02-23 15:54 | 60K | |
![[ ]](/icons/layout.gif) | 60675_David Mattrave..> | 2026-03-30 13:50 | 60K | |
![[ ]](/icons/layout.gif) | 21050_James Gill - J..> | 2025-11-28 16:40 | 60K | |
![[ ]](/icons/layout.gif) | 21279_James Gill - J..> | 2025-12-01 10:24 | 60K | |
![[ ]](/icons/layout.gif) | 43978_Myles Reuben -..> | 2026-02-16 10:13 | 60K | |
![[ ]](/icons/layout.gif) | 44193_Myles Reuben -..> | 2026-02-16 13:52 | 60K | |
![[ ]](/icons/layout.gif) | 49247_Roy Clark - Ro..> | 2026-02-27 15:39 | 60K | |
![[ ]](/icons/layout.gif) | 26757_Liam Bradly - ..> | 2025-12-16 10:49 | 60K | |
![[ ]](/icons/layout.gif) | 66893_Brian Wallace ..> | 2026-04-16 15:48 | 60K | |
![[ ]](/icons/layout.gif) | 37942_Bob Rutherford..> | 2026-01-28 12:59 | 60K | |
![[ ]](/icons/layout.gif) | 64078_Steve Metcalfe..> | 2026-04-09 11:30 | 60K | |
![[ ]](/icons/layout.gif) | 18741_Kirsty Wood - ..> | 2025-11-24 14:41 | 60K | |
![[ ]](/icons/layout.gif) | 21388_Arturo Chichon..> | 2025-12-01 12:22 | 60K | |
![[ ]](/icons/layout.gif) | 45917_Alan Bailey - ..> | 2026-02-19 08:38 | 60K | |
![[ ]](/icons/layout.gif) | 24534_Greenlands Con..> | 2025-12-09 16:34 | 60K | |
![[ ]](/icons/layout.gif) | 28613_Jamie Brown - ..> | 2025-12-22 13:12 | 60K | |
![[ ]](/icons/layout.gif) | 45051_Adam Hodge - S..> | 2026-02-17 15:50 | 60K | |
![[ ]](/icons/layout.gif) | 47150_Sara Colton - ..> | 2026-02-23 14:48 | 60K | |
![[ ]](/icons/layout.gif) | 21558_Thomas Hartley..> | 2025-12-01 16:39 | 60K | |
![[ ]](/icons/layout.gif) | 21577_Thomas Hartley..> | 2025-12-01 16:45 | 60K | |
![[ ]](/icons/layout.gif) | 35577_CT Constructio..> | 2026-01-21 10:16 | 60K | |
![[ ]](/icons/layout.gif) | 47091_Allen Bogacki ..> | 2026-02-23 12:27 | 60K | |
![[ ]](/icons/layout.gif) | 27154_Christopher Th..> | 2025-12-17 08:03 | 60K | |
![[ ]](/icons/layout.gif) | 31477_Duane Snelling..> | 2026-01-08 09:13 | 60K | |
![[ ]](/icons/layout.gif) | 28606_Roger Thorpe -..> | 2025-12-22 12:50 | 60K | |
![[ ]](/icons/layout.gif) | 34804_Ann Kiley - An..> | 2026-01-19 15:47 | 60K | |
![[ ]](/icons/layout.gif) | 50064_David Amsden -..> | 2026-03-03 08:47 | 60K | |
![[ ]](/icons/layout.gif) | 65702_Sam Matthew Po..> | 2026-04-14 13:03 | 60K | |
![[ ]](/icons/layout.gif) | 30029_Christine Barr..> | 2026-01-05 09:45 | 60K | |
![[ ]](/icons/layout.gif) | 19219_Simon Hockley ..> | 2025-11-25 13:37 | 60K | |
![[ ]](/icons/layout.gif) | 29100_Harry Renshaw-..> | 2025-12-23 14:15 | 60K | |
![[ ]](/icons/layout.gif) | 29325_Andrew Walker ..> | 2025-12-29 08:30 | 60K | |
![[ ]](/icons/layout.gif) | 32171_Peter Callis -..> | 2026-01-09 16:14 | 60K | |
![[ ]](/icons/layout.gif) | 34270_Micheal Joyce ..> | 2026-01-16 12:17 | 60K | |
![[ ]](/icons/layout.gif) | 41208_Nathan Sudwort..> | 2026-02-06 08:54 | 60K | |
![[ ]](/icons/layout.gif) | 42795_Martin Hewlett..> | 2026-02-11 15:28 | 60K | |
![[ ]](/icons/layout.gif) | 44150_Paul O'Neill -..> | 2026-02-16 12:44 | 60K | |
![[ ]](/icons/layout.gif) | 69829_Martyn Edmisto..> | 2026-04-24 08:40 | 60K | |
![[ ]](/icons/layout.gif) | 53845_Daniel Waybour..> | 2026-03-11 12:37 | 60K | |
![[ ]](/icons/layout.gif) | 67390_Sam Pritcher -..> | 2026-04-17 14:55 | 60K | |
![[ ]](/icons/layout.gif) | 30283_Fiona Hitchcoc..> | 2026-01-05 15:02 | 60K | |
![[ ]](/icons/layout.gif) | 20917_Sam Capone - H..> | 2025-11-28 13:24 | 60K | |
![[ ]](/icons/layout.gif) | 64134_Matt Galway - ..> | 2026-04-09 13:42 | 60K | |
![[ ]](/icons/layout.gif) | 29262_Peter Ashworth..> | 2025-12-29 07:42 | 60K | |
![[ ]](/icons/layout.gif) | 31114_Stewart Armstr..> | 2026-01-07 11:58 | 60K | |
![[ ]](/icons/layout.gif) | 25173_Darren Mitchel..> | 2025-12-11 14:04 | 60K | |
![[ ]](/icons/layout.gif) | 32665_Michael Mazur ..> | 2026-01-13 11:03 | 60K | |
![[ ]](/icons/layout.gif) | 51603_georgina Dalby..> | 2026-03-05 14:48 | 60K | |
![[ ]](/icons/layout.gif) | 33264_Ricky Cresswel..> | 2026-01-14 13:56 | 60K | |
![[ ]](/icons/layout.gif) | 49136_John Pallot - ..> | 2026-02-27 13:44 | 60K | |
![[ ]](/icons/layout.gif) | 34985_Neil Robertson..> | 2026-01-20 09:25 | 60K | |
![[ ]](/icons/layout.gif) | 35011_Brian Cook - O..> | 2026-01-20 09:53 | 60K | |
![[ ]](/icons/layout.gif) | 20895_Matthew Bursle..> | 2025-11-28 12:24 | 60K | |
![[ ]](/icons/layout.gif) | 20973_Matthew Bursle..> | 2025-11-28 14:51 | 60K | |
![[ ]](/icons/layout.gif) | 23160_Dan Corrigall ..> | 2025-12-04 16:18 | 60K | |
![[ ]](/icons/layout.gif) | 49835_Paul Mitchell ..> | 2026-03-02 14:41 | 60K | |
![[ ]](/icons/layout.gif) | 23154_Keith Williets..> | 2025-12-04 16:09 | 60K | |
![[ ]](/icons/layout.gif) | 29268_Andrew Armstro..> | 2025-12-29 07:45 | 60K | |
![[ ]](/icons/layout.gif) | 22340_Audrey Walker ..> | 2025-12-03 10:12 | 60K | |
![[ ]](/icons/layout.gif) | 38224_Zdena Murgacov..> | 2026-01-29 09:13 | 60K | |
![[ ]](/icons/layout.gif) | 38232_Zdena Murgacov..> | 2026-01-29 09:28 | 60K | |
![[ ]](/icons/layout.gif) | 41002_Zdena Murgacov..> | 2026-02-05 13:55 | 60K | |
![[ ]](/icons/layout.gif) | 41006_Zdena Murgacov..> | 2026-02-05 13:58 | 60K | |
![[ ]](/icons/layout.gif) | 41012_Zdena Murgacov..> | 2026-02-05 14:03 | 60K | |
![[ ]](/icons/layout.gif) | 41020_Zdena Murgacov..> | 2026-02-05 14:20 | 60K | |
![[ ]](/icons/layout.gif) | 60841_James Fairbair..> | 2026-03-30 15:23 | 60K | |
![[ ]](/icons/layout.gif) | 29752_Jack Valentine..> | 2026-01-02 11:49 | 60K | |
![[ ]](/icons/layout.gif) | 34277_Nicole Richmon..> | 2026-01-16 13:25 | 60K | |
![[ ]](/icons/layout.gif) | 31701_William Wright..> | 2026-01-08 13:56 | 60K | |
![[ ]](/icons/layout.gif) | 67959_Tim Elms - Rep..> | 2026-04-20 14:48 | 60K | |
![[ ]](/icons/layout.gif) | 68001_Lewis Pearce -..> | 2026-04-20 15:15 | 60K | |
![[ ]](/icons/layout.gif) | 28705_Craig Cooper -..> | 2025-12-22 14:46 | 60K | |
![[ ]](/icons/layout.gif) | 29623_Leo Darling - ..> | 2026-01-02 08:23 | 60K | |
![[ ]](/icons/layout.gif) | 38837_Jason Woodall ..> | 2026-01-30 11:00 | 60K | |
![[ ]](/icons/layout.gif) | 48101_Michael Hider ..> | 2026-02-25 11:33 | 60K | |
![[ ]](/icons/layout.gif) | 22400_John Clark - O..> | 2025-12-03 11:59 | 60K | |
![[ ]](/icons/layout.gif) | 51869_Seaview Buildi..> | 2026-03-06 09:55 | 60K | |
![[ ]](/icons/layout.gif) | 69867_Michael George..> | 2026-04-24 09:07 | 60K | |
![[ ]](/icons/layout.gif) | 20105_Ian Gourley Tr..> | 2025-11-27 08:33 | 60K | |
![[ ]](/icons/layout.gif) | 48459_Nigel Chapman ..> | 2026-02-26 10:52 | 60K | |
![[ ]](/icons/layout.gif) | 29658_Jamie Stubbs -..> | 2026-01-02 09:07 | 60K | |
![[ ]](/icons/layout.gif) | 69107_Blackhawk Secu..> | 2026-04-22 14:00 | 60K | |
![[ ]](/icons/layout.gif) | 51245_Andrew Billing..> | 2026-03-05 09:19 | 60K | |
![[ ]](/icons/layout.gif) | 34221_Peter Lewis - ..> | 2026-01-16 10:27 | 60K | |
![[ ]](/icons/layout.gif) | 27945_Colin Davidson..> | 2025-12-18 15:36 | 60K | |
![[ ]](/icons/layout.gif) | 42234_Scott Tatham -..> | 2026-02-10 11:59 | 60K | |
![[ ]](/icons/layout.gif) | 22281_Steve Jackson ..> | 2025-12-03 08:47 | 60K | |
![[ ]](/icons/layout.gif) | 35762_Jonathan Foste..> | 2026-01-21 13:32 | 60K | |
![[ ]](/icons/layout.gif) | 27310_Anthony Kirk -..> | 2025-12-17 10:43 | 60K | |
![[ ]](/icons/layout.gif) | 23851_David Crowder ..> | 2025-12-08 12:14 | 60K | |
![[ ]](/icons/layout.gif) | 16844_Neil Hambling ..> | 2025-11-18 16:01 | 60K | |
![[ ]](/icons/layout.gif) | 39031_Total Control ..> | 2026-01-30 15:47 | 60K | |
![[ ]](/icons/layout.gif) | 69221_Eduardo Pestan..> | 2026-04-23 06:44 | 60K | |
![[ ]](/icons/layout.gif) | 69373_Jonathan Wareh..> | 2026-04-23 09:08 | 60K | |
![[ ]](/icons/layout.gif) | 15982_Cybaman Techno..> | 2025-11-17 11:25 | 60K | |
![[ ]](/icons/layout.gif) | 30059_Streamline Hom..> | 2026-01-05 11:02 | 60K | |
![[ ]](/icons/layout.gif) | 30517_Streamline Hom..> | 2026-01-06 09:25 | 60K | |
![[ ]](/icons/layout.gif) | 33281_A Miles Buildi..> | 2026-01-14 14:01 | 60K | |
![[ ]](/icons/layout.gif) | 39044_The Safety Sup..> | 2026-01-30 15:58 | 60K | |
![[ ]](/icons/layout.gif) | 61351_Eyeview Soluti..> | 2026-03-31 12:50 | 60K | |
![[ ]](/icons/layout.gif) | 30301_Phil Monday - ..> | 2026-01-05 15:29 | 60K | |
![[ ]](/icons/layout.gif) | 39945_Catherine Evan..> | 2026-02-03 12:29 | 60K | |
![[ ]](/icons/layout.gif) | 60034_Jacob Woodhous..> | 2026-03-27 10:46 | 60K | |
![[ ]](/icons/layout.gif) | 16035_Nathanael Cicc..> | 2025-11-17 12:46 | 60K | |
![[ ]](/icons/layout.gif) | 29758_Wragg - WRAG00..> | 2026-01-02 11:55 | 60K | |
![[ ]](/icons/layout.gif) | 15813_CH Develoments..> | 2025-11-17 09:09 | 60K | |
![[ ]](/icons/layout.gif) | 15817_CH Develoments..> | 2025-11-17 09:15 | 60K | |
![[ ]](/icons/layout.gif) | 30091_Bob Harvey - H..> | 2026-01-05 11:49 | 60K | |
![[ ]](/icons/layout.gif) | 58938_Gzim Sufa - RO..> | 2026-03-25 09:24 | 60K | |
![[ ]](/icons/layout.gif) | 21285_Martin Belsey ..> | 2025-12-01 10:27 | 60K | |
![[ ]](/icons/layout.gif) | 22620_Bob Viney - VI..> | 2025-12-03 16:35 | 60K | |
![[ ]](/icons/layout.gif) | 23744_Ryan Mason - M..> | 2025-12-08 10:29 | 60K | |
![[ ]](/icons/layout.gif) | 29786_Chris Terry - ..> | 2026-01-02 13:00 | 60K | |
![[ ]](/icons/layout.gif) | 28733_Paul Booth - B..> | 2025-12-22 15:44 | 60K | |
![[ ]](/icons/layout.gif) | 28190_Ian Parker - P..> | 2025-12-19 11:22 | 60K | |
![[ ]](/icons/layout.gif) | 29891_Glen Mcarthur ..> | 2026-01-02 15:33 | 60K | |
![[ ]](/icons/layout.gif) | 19795_Richard Weir -..> | 2025-11-26 11:26 | 60K | |
![[ ]](/icons/layout.gif) | 24795_Dick Worth - W..> | 2025-12-10 15:59 | 60K | |
![[ ]](/icons/layout.gif) | 33898_Paul Brookes -..> | 2026-01-15 15:01 | 60K | |
![[ ]](/icons/layout.gif) | 23770_Steve Bennison..> | 2025-12-08 10:55 | 60K | |
![[ ]](/icons/layout.gif) | 26719_Tim Seward - S..> | 2025-12-16 09:59 | 60K | |
![[ ]](/icons/layout.gif) | 17158_David Fleetwoo..> | 2025-11-19 11:21 | 60K | |
![[ ]](/icons/layout.gif) | 21262_Chandramani - ..> | 2025-12-01 10:08 | 60K | |
![[ ]](/icons/layout.gif) | 27818_Sg Motor Servi..> | 2025-12-18 12:32 | 60K | |
![[ ]](/icons/layout.gif) | 42821_Chiltern Compl..> | 2026-02-11 16:15 | 60K | |
![[ ]](/icons/layout.gif) | 19051_AMJ. Building ..> | 2025-11-25 11:20 | 60K | |
![[ ]](/icons/layout.gif) | 26909_Phil Atkins - ..> | 2025-12-16 13:29 | 60K | |
![[ ]](/icons/layout.gif) | 35877_Julian Hughes ..> | 2026-01-22 07:37 | 60K | |
![[ ]](/icons/layout.gif) | 20200_Ian Gaynor - G..> | 2025-11-27 10:51 | 60K | |
![[ ]](/icons/layout.gif) | 29469_Anthony Earl -..> | 2025-12-30 09:05 | 60K | |
![[ ]](/icons/layout.gif) | 27405_Y Waddingham -..> | 2025-12-17 12:09 | 60K | |
![[ ]](/icons/layout.gif) | 30426_Neil Frost - F..> | 2026-01-05 16:47 | 60K | |
![[ ]](/icons/layout.gif) | 29665_Mrs Davey - DA..> | 2026-01-02 09:09 | 60K | |
![[ ]](/icons/layout.gif) | 30695_James Shapcott..> | 2026-01-06 12:11 | 60K | |
![[ ]](/icons/layout.gif) | 29460_Diane Pearson ..> | 2025-12-30 08:48 | 60K | |
![[ ]](/icons/layout.gif) | 30123_Jason Peck - P..> | 2026-01-05 12:07 | 60K | |
![[ ]](/icons/layout.gif) | 30170_Jerry Warner -..> | 2026-01-05 13:13 | 60K | |
![[ ]](/icons/layout.gif) | 28842_Matthew Saxby ..> | 2025-12-23 08:54 | 60K | |
![[ ]](/icons/layout.gif) | 32005_Darrell Page -..> | 2026-01-09 11:51 | 60K | |
![[ ]](/icons/layout.gif) | 19823_Mick Drake - D..> | 2025-11-26 11:41 | 60K | |
![[ ]](/icons/layout.gif) | 26252_Mike Hicken - ..> | 2025-12-15 10:12 | 60K | |
![[ ]](/icons/layout.gif) | 19327_Aaron French -..> | 2025-11-25 15:10 | 60K | |
![[ ]](/icons/layout.gif) | 18797_Charlie Sander..> | 2025-11-24 16:17 | 60K | |
![[ ]](/icons/layout.gif) | 25003_George Catto -..> | 2025-12-11 10:07 | 60K | |
![[ ]](/icons/layout.gif) | 25733_Jamie Davies -..> | 2025-12-12 14:19 | 60K | |
![[ ]](/icons/layout.gif) | 29257_Chris Terry - ..> | 2025-12-29 07:37 | 60K | |
![[ ]](/icons/layout.gif) | 18177_Phil Miller - ..> | 2025-11-21 13:01 | 60K | |
![[ ]](/icons/layout.gif) | 28968_Martyn Wiles -..> | 2025-12-23 10:36 | 60K | |
![[ ]](/icons/layout.gif) | 29487_Andrew Spaught..> | 2025-12-31 08:18 | 60K | |
![[ ]](/icons/layout.gif) | 19276_Alan Patterson..> | 2025-11-25 14:24 | 60K | |
![[ ]](/icons/layout.gif) | 19801_Richard Wear -..> | 2025-11-26 11:29 | 60K | |
![[ ]](/icons/layout.gif) | 24682_Stephen Cooper..> | 2025-12-10 10:48 | 60K | |
![[ ]](/icons/layout.gif) | 21871_Darryl Hayter ..> | 2025-12-02 11:25 | 60K | |
![[ ]](/icons/layout.gif) | 26701_A Walker - WAL..> | 2025-12-16 09:44 | 60K | |
![[ ]](/icons/layout.gif) | 29315_Alan Wood - OR..> | 2025-12-29 08:23 | 60K | |
![[ ]](/icons/layout.gif) | 24799_Dick Worth - W..> | 2025-12-10 16:01 | 60K | |
![[ ]](/icons/layout.gif) | 30074_Edward Goldsmi..> | 2026-01-05 11:24 | 60K | |
![[ ]](/icons/layout.gif) | 21275_Peter Smith - ..> | 2025-12-01 10:20 | 60K | |
![[ ]](/icons/layout.gif) | 21282_Peter House - ..> | 2025-12-01 10:25 | 60K | |
![[ ]](/icons/layout.gif) | 27259_John Slimmers ..> | 2025-12-17 09:49 | 60K | |
![[ ]](/icons/layout.gif) | 19036_Ian Church - C..> | 2025-11-25 10:56 | 60K | |
![[ ]](/icons/layout.gif) | 30129_Tom Reid - REI..> | 2026-01-05 12:13 | 60K | |
![[ ]](/icons/layout.gif) | 22850_Michael Townse..> | 2025-12-04 11:51 | 60K | |
![[ ]](/icons/layout.gif) | 30496_Jonny Short - ..> | 2026-01-06 09:04 | 60K | |
![[ ]](/icons/layout.gif) | 27419_Sajid Patel - ..> | 2025-12-17 12:41 | 60K | |
![[ ]](/icons/layout.gif) | 26420_Jonathan Dunn ..> | 2025-12-15 13:25 | 60K | |
![[ ]](/icons/layout.gif) | 32716_Stuart Lee - O..> | 2026-01-13 11:32 | 60K | |
![[ ]](/icons/layout.gif) | 17045_Lisa De-Vall -..> | 2025-11-19 08:53 | 60K | |
![[ ]](/icons/layout.gif) | 16651_Tibbles - Lock..> | 2025-11-18 13:21 | 60K | |
![[ ]](/icons/layout.gif) | 23736_Kevin Grosveno..> | 2025-12-08 10:24 | 60K | |
![[ ]](/icons/layout.gif) | 30135_John Black - B..> | 2026-01-05 12:16 | 60K | |
![[ ]](/icons/layout.gif) | 22888_Dianne Milling..> | 2025-12-04 12:20 | 60K | |
![[ ]](/icons/layout.gif) | 29781_Abumchukwu Eje..> | 2026-01-02 12:47 | 60K | |
![[ ]](/icons/layout.gif) | 22433_Stewart Walton..> | 2025-12-03 13:03 | 60K | |
![[ ]](/icons/layout.gif) | 22435_Stewart Walton..> | 2025-12-03 13:05 | 60K | |
![[ ]](/icons/layout.gif) | 23141_Willow Builder..> | 2025-12-04 15:58 | 60K | |
![[ ]](/icons/layout.gif) | 30109_Jones - JONE00..> | 2026-01-05 11:58 | 60K | |
![[ ]](/icons/layout.gif) | 21799_Paul Stimpson ..> | 2025-12-02 10:48 | 60K | |
![[ ]](/icons/layout.gif) | 29775_Andy Austin - ..> | 2026-01-02 12:36 | 60K | |
![[ ]](/icons/layout.gif) | 26504_Brian Gent - G..> | 2025-12-15 15:20 | 60K | |
![[ ]](/icons/layout.gif) | 19798_Adam Lillywhit..> | 2025-11-26 11:28 | 60K | |
![[ ]](/icons/layout.gif) | 21482_Mike Speers - ..> | 2025-12-01 14:26 | 60K | |
![[ ]](/icons/layout.gif) | 26239_Adrian Carnegi..> | 2025-12-15 09:56 | 60K | |
![[ ]](/icons/layout.gif) | 32701_John Bignell -..> | 2026-01-13 11:26 | 60K | |
![[ ]](/icons/layout.gif) | 30603_Martin Miles -..> | 2026-01-06 10:38 | 60K | |
![[ ]](/icons/layout.gif) | 18022_Francis Wood -..> | 2025-11-21 10:03 | 60K | |
![[ ]](/icons/layout.gif) | 31038_Peter Callis -..> | 2026-01-07 09:37 | 60K | |
![[ ]](/icons/layout.gif) | 27683_Roy Dunn - DUN..> | 2025-12-18 09:48 | 60K | |
![[ ]](/icons/layout.gif) | 32801_Lisa Scattergo..> | 2026-01-13 12:47 | 60K | |
![[ ]](/icons/layout.gif) | 22368_Aidan Murphy -..> | 2025-12-03 11:26 | 60K | |
![[ ]](/icons/layout.gif) | 32014_Andrew Bowley ..> | 2026-01-09 11:53 | 60K | |
![[ ]](/icons/layout.gif) | 18033_Danny Sacco - ..> | 2025-11-21 10:17 | 60K | |
![[ ]](/icons/layout.gif) | 29483_David Marsden ..> | 2025-12-31 08:14 | 60K | |
![[ ]](/icons/layout.gif) | 22917_Trevor Doherty..> | 2025-12-04 12:51 | 60K | |
![[ ]](/icons/layout.gif) | 23589_Sam Bradwell -..> | 2025-12-08 06:26 | 60K | |
![[ ]](/icons/layout.gif) | 15158_Piotr Pigan - ..> | 2025-11-13 16:57 | 60K | |
![[ ]](/icons/layout.gif) | 32687_Justin Finn - ..> | 2026-01-13 11:17 | 60K | |
![[ ]](/icons/layout.gif) | 16961_David Heckford..> | 2025-11-19 07:47 | 60K | |
![[ ]](/icons/layout.gif) | 29270_Andrew Armstro..> | 2025-12-29 07:46 | 60K | |
![[ ]](/icons/layout.gif) | 21894_Anthony Jennin..> | 2025-12-02 11:49 | 60K | |
![[ ]](/icons/layout.gif) | 25174_Darren Mitchel..> | 2025-12-11 14:04 | 60K | |
![[ ]](/icons/layout.gif) | 30943_Alan Faircloug..> | 2026-01-06 16:08 | 60K | |
![[ ]](/icons/layout.gif) | 26692_Andy Clarke - ..> | 2025-12-16 09:38 | 60K | |
![[ ]](/icons/layout.gif) | 24230_Kevin Binfield..> | 2025-12-09 10:39 | 60K | |
![[ ]](/icons/layout.gif) | 28558_Danny Sacco - ..> | 2025-12-22 11:51 | 60K | |
![[ ]](/icons/layout.gif) | 28602_Gavin Shea - O..> | 2025-12-22 12:47 | 60K | |
![[ ]](/icons/layout.gif) | 28609_Danny Sacco - ..> | 2025-12-22 13:01 | 60K | |
![[ ]](/icons/layout.gif) | 29101_Harry Renshaw-..> | 2025-12-23 14:16 | 60K | |
![[ ]](/icons/layout.gif) | 31050_Andrew Hammond..> | 2026-01-07 09:53 | 60K | |
![[ ]](/icons/layout.gif) | 29264_Peter Ashworth..> | 2025-12-29 07:42 | 60K | |
![[ ]](/icons/layout.gif) | 21886_Russell Steven..> | 2025-12-02 11:42 | 60K | |
![[ ]](/icons/layout.gif) | 30558_Allan Shortman..> | 2026-01-06 09:48 | 60K | |
![[ ]](/icons/layout.gif) | 17283_Paul Harman - ..> | 2025-11-19 14:12 | 60K | |
![[ ]](/icons/layout.gif) | 26246_Tom Harding - ..> | 2025-12-15 10:02 | 60K | |
![[ ]](/icons/layout.gif) | 23295_Graham Bradley..> | 2025-12-05 09:03 | 60K | |
![[ ]](/icons/layout.gif) | 20763_Andrew Kirk - ..> | 2025-11-28 10:25 | 60K | |
![[ ]](/icons/layout.gif) | 32680_D A Mummery - ..> | 2026-01-13 11:11 | 60K | |
![[ ]](/icons/layout.gif) | 32682_D A Mummery - ..> | 2026-01-13 11:11 | 60K | |
![[ ]](/icons/layout.gif) | 32329_Danny Andrews ..> | 2026-01-12 10:49 | 60K | |
![[ ]](/icons/layout.gif) | 19807_Chris Foulkes ..> | 2025-11-26 11:31 | 60K | |
![[ ]](/icons/layout.gif) | 29321_John Duncan - ..> | 2025-12-29 08:27 | 60K | |
![[ ]](/icons/layout.gif) | 29258_Chris Terry - ..> | 2025-12-29 07:38 | 60K | |
![[ ]](/icons/layout.gif) | 32172_Peter Callis -..> | 2026-01-09 16:14 | 60K | |
![[ ]](/icons/layout.gif) | 17520_Simon Brown - ..> | 2025-11-20 10:37 | 60K | |
![[ ]](/icons/layout.gif) | 28989_Roly Dawson - ..> | 2025-12-23 10:47 | 60K | |
![[ ]](/icons/layout.gif) | 28969_Martyn Wiles -..> | 2025-12-23 10:37 | 61K | |
![[ ]](/icons/layout.gif) | 29327_Andrew Walker ..> | 2025-12-29 08:30 | 61K | |
![[ ]](/icons/layout.gif) | 29036_Martin Camble ..> | 2025-12-23 12:30 | 61K | |
![[ ]](/icons/layout.gif) | 29034_Martin Camble ..> | 2025-12-23 12:29 | 61K | |
![[ ]](/icons/layout.gif) | 23484_Barry MacPhers..> | 2025-12-05 14:15 | 61K | |
![[ ]](/icons/layout.gif) | 21855_UK Rollerdoors..> | 2025-12-02 11:18 | 61K | |
![[ ]](/icons/layout.gif) | 19064_Simon Herbert ..> | 2025-11-25 11:37 | 61K | |
![[ ]](/icons/layout.gif) | 23788_Tony Evans - E..> | 2025-12-08 11:11 | 61K | |
![[ ]](/icons/layout.gif) | 28707_Craig Cooper -..> | 2025-12-22 14:46 | 61K | |
![[ ]](/icons/layout.gif) | 28607_Roger Thorpe -..> | 2025-12-22 12:50 | 61K | |
![[ ]](/icons/layout.gif) | 22399_John Clark - O..> | 2025-12-03 11:58 | 61K | |
![[ ]](/icons/layout.gif) | 27420_Sajid Patel - ..> | 2025-12-17 12:41 | 61K | |
![[ ]](/icons/layout.gif) | 23276_Paddock Builde..> | 2025-12-05 08:58 | 61K | |
![[ ]](/icons/layout.gif) | 29904_Rob Percival -..> | 2026-01-02 15:52 | 61K | |
![[ ]](/icons/layout.gif) | 19803_James Sumner -..> | 2025-11-26 11:30 | 61K | |
![[ ]](/icons/layout.gif) | 31681_Ronald Collin ..> | 2026-01-08 13:20 | 61K | |
![[ ]](/icons/layout.gif) | 17280_Oscar Okoronta..> | 2025-11-19 14:04 | 61K | |
![[ ]](/icons/layout.gif) | 31031_Peter Gojka - ..> | 2026-01-07 09:27 | 61K | |
![[ ]](/icons/layout.gif) | 30372_Benjamin Walsh..> | 2026-01-05 16:20 | 61K | |
![[ ]](/icons/layout.gif) | 24387_ARC Limited Jo..> | 2025-12-09 12:18 | 61K | |
![[ ]](/icons/layout.gif) | 16924_B Marsh - MARS..> | 2025-11-19 07:28 | 61K | |
![[ ]](/icons/layout.gif) | 25511_Graham Barnett..> | 2025-12-12 11:16 | 61K | |
![[ ]](/icons/layout.gif) | 31972_Ronald Collin ..> | 2026-01-09 10:59 | 61K | |
![[ ]](/icons/layout.gif) | 32403_Paul Samuels -..> | 2026-01-12 14:07 | 61K | |
![[ ]](/icons/layout.gif) | 32666_Michael Mazur ..> | 2026-01-13 11:03 | 61K | |
![[ ]](/icons/layout.gif) | 19817_Edwards Engine..> | 2025-11-26 11:33 | 61K | |
![[ ]](/icons/layout.gif) | 19937_NTRAP NR11 7NZ..> | 2025-11-26 13:45 | 61K | |
![[ ]](/icons/layout.gif) | 29844_Richard Bird -..> | 2026-01-02 14:44 | 61K | |
![[ ]](/icons/layout.gif) | 19118_Piotr Pigan - ..> | 2025-11-25 13:09 | 61K | |
![[ ]](/icons/layout.gif) | 22338_Audrey Walker ..> | 2025-12-03 10:05 | 61K | |
![[ ]](/icons/layout.gif) | 16246_Marco Jaconell..> | 2025-11-18 07:38 | 61K | |
![[ ]](/icons/layout.gif) | 23835_Steve Bennison..> | 2025-12-08 12:03 | 61K | |
![[ ]](/icons/layout.gif) | 23309_Icicle Service..> | 2025-12-05 09:17 | 61K | |
![[ ]](/icons/layout.gif) | 29044_Smiths Electri..> | 2025-12-23 12:34 | 61K | |
![[ ]](/icons/layout.gif) | 32695_Guy Barker - O..> | 2026-01-13 11:21 | 61K | |
![[ ]](/icons/layout.gif) | 17790_Rupert Wood - ..> | 2025-11-20 16:14 | 61K | |
![[ ]](/icons/layout.gif) | 31973_Ronald Collin ..> | 2026-01-09 11:04 | 61K | |
![[ ]](/icons/layout.gif) | 31056_John Anderson ..> | 2026-01-07 10:01 | 61K | |
![[ ]](/icons/layout.gif) | 26443_Daniel Davies ..> | 2025-12-15 13:40 | 61K | |
![[ ]](/icons/layout.gif) | 18322_Rupert Wood - ..> | 2025-11-21 16:49 | 61K | |
![[ ]](/icons/layout.gif) | 32739_Mark Guyler - ..> | 2026-01-13 11:44 | 61K | |
![[ ]](/icons/layout.gif) | 15001_Vincent Beech ..> | 2025-11-13 12:43 | 61K | |
![[ ]](/icons/layout.gif) | 28393_Iain Bint - BI..> | 2025-12-19 16:38 | 61K | |
![[ ]](/icons/layout.gif) | 19941_Rupert Wood - ..> | 2025-11-26 14:08 | 61K | |
![[ ]](/icons/layout.gif) | 20289_Rupert Wood - ..> | 2025-11-27 11:32 | 61K | |
![[ ]](/icons/layout.gif) | 19794_Rupert Wood - ..> | 2025-11-26 11:26 | 61K | |
![[ ]](/icons/layout.gif) | 15002_Vincent Beech ..> | 2025-11-13 12:43 | 61K | |
![[ ]](/icons/layout.gif) | 20290_Rupert Wood - ..> | 2025-11-27 11:32 | 61K | |
![[ ]](/icons/layout.gif) | 16041_Mark Holmes - ..> | 2025-11-17 12:52 | 61K | |
![[ ]](/icons/layout.gif) | 22697_Gary Wooldridg..> | 2025-12-04 08:43 | 61K | |
![[ ]](/icons/layout.gif) | 19433_Timea Horvath ..> | 2025-11-25 16:17 | 61K | |
![[ ]](/icons/layout.gif) | 17156_David Fleetwoo..> | 2025-11-19 11:20 | 62K | |
![[ ]](/icons/layout.gif) | 18269_Tony Oxley - O..> | 2025-11-21 15:12 | 62K | |
![[ ]](/icons/layout.gif) | 18178_Phil Miller - ..> | 2025-11-21 13:01 | 62K | |
![[ ]](/icons/layout.gif) | 17696_Ewan Robertson..> | 2025-11-20 14:33 | 62K | |
![[ ]](/icons/layout.gif) | 17573_Jack Valentine..> | 2025-11-20 11:24 | 62K | |
![[ ]](/icons/layout.gif) | 18021_Francis Wood -..> | 2025-11-21 10:03 | 62K | |
![[ ]](/icons/layout.gif) | 16653_Tibbles - Lock..> | 2025-11-18 13:22 | 62K | |
![[ ]](/icons/layout.gif) | 17538_Andrew Lobb - ..> | 2025-11-20 10:52 | 62K | |
![[ ]](/icons/layout.gif) | 17555_Graham Bradley..> | 2025-11-20 10:58 | 62K | |
![[ ]](/icons/layout.gif) | 17569_Phil Coleman -..> | 2025-11-20 11:15 | 62K | |
![[ ]](/icons/layout.gif) | 17145_Lynn Brighton ..> | 2025-11-19 11:08 | 62K | |
![[ ]](/icons/layout.gif) | 18034_Danny Sacco - ..> | 2025-11-21 10:18 | 62K | |
![[ ]](/icons/layout.gif) | 15159_Piotr Pigan - ..> | 2025-11-13 16:57 | 62K | |
![[ ]](/icons/layout.gif) | 18270_Tony Oxley - O..> | 2025-11-21 15:12 | 62K | |
![[ ]](/icons/layout.gif) | 17521_Simon Brown - ..> | 2025-11-20 10:37 | 62K | |
![[ ]](/icons/layout.gif) | 17626_Lawrie Hudson ..> | 2025-11-20 12:46 | 62K | |
![[ ]](/icons/layout.gif) | 17277_Oscar Okoronta..> | 2025-11-19 14:04 | 62K | |
![[ ]](/icons/layout.gif) | 17606_Chris Bird - B..> | 2025-11-20 12:14 | 62K | |
![[ ]](/icons/layout.gif) | 27921_Andrew Hobson ..> | 2025-12-18 14:39 | 62K | |
![[ ]](/icons/layout.gif) | 28114_Andrew Hobson ..> | 2025-12-19 09:12 | 62K | |
![[ ]](/icons/layout.gif) | 16225_Bob Viney - VI..> | 2025-11-17 16:39 | 62K | |
![[ ]](/icons/layout.gif) | 68812_Eclipse Doors ..> | 2026-04-22 07:58 | 62K | |
![[ ]](/icons/layout.gif) | 15077_Ian Lamonby - ..> | 2025-11-13 14:55 | 62K | |
![[ ]](/icons/layout.gif) | 15078_Ian Lamonby - ..> | 2025-11-13 14:56 | 62K | |
![[ ]](/icons/layout.gif) | 17801_Mark Holmes - ..> | 2025-11-20 16:28 | 62K | |
![[ ]](/icons/layout.gif) | 16040_Mark Holmes - ..> | 2025-11-17 12:48 | 62K | |
![[ ]](/icons/layout.gif) | 55949_Eclipse Doors ..> | 2026-03-17 14:55 | 63K | |
![[ ]](/icons/layout.gif) | 33181_Edmund Walasze..> | 2026-01-14 11:41 | 63K | |
![[ ]](/icons/layout.gif) | 44728_Horsley - HORS..> | 2026-02-17 10:30 | 63K | |
![[ ]](/icons/layout.gif) | 47796_Ron Wells - WE..> | 2026-02-24 15:56 | 63K | |
![[ ]](/icons/layout.gif) | 57323_M Wood - WOOD0..> | 2026-03-20 09:57 | 63K | |
![[ ]](/icons/layout.gif) | 35122_Tony Williams ..> | 2026-01-20 11:31 | 63K | |
![[ ]](/icons/layout.gif) | 45577_John Kennedy -..> | 2026-02-18 11:51 | 63K | |
![[ ]](/icons/layout.gif) | 55181_Lukas Rabicki ..> | 2026-03-16 09:44 | 63K | |
![[ ]](/icons/layout.gif) | 34699_John Tuplin - ..> | 2026-01-19 13:13 | 63K | |
![[ ]](/icons/layout.gif) | 36451_Rob Watson - W..> | 2026-01-23 11:10 | 63K | |
![[ ]](/icons/layout.gif) | 42940_Hale - HALE000..> | 2026-02-12 09:24 | 63K | |
![[ ]](/icons/layout.gif) | 44171_Alex Baraona -..> | 2026-02-16 13:37 | 63K | |
![[ ]](/icons/layout.gif) | 37625_Parker - PARK0..> | 2026-01-27 15:00 | 63K | |
![[ ]](/icons/layout.gif) | 44722_Ben Clifford -..> | 2026-02-17 10:27 | 63K | |
![[ ]](/icons/layout.gif) | 46501_Paul Cleaver -..> | 2026-02-20 10:05 | 63K | |
![[ ]](/icons/layout.gif) | 58982_Bryan Jones - ..> | 2026-03-25 10:01 | 63K | |
![[ ]](/icons/layout.gif) | 57871_Philip Jones -..> | 2026-03-23 10:31 | 63K | |
![[ ]](/icons/layout.gif) | 34570_Adam Downing -..> | 2026-01-19 10:47 | 63K | |
![[ ]](/icons/layout.gif) | 48393_Alan Brignull ..> | 2026-02-26 10:40 | 63K | |
![[ ]](/icons/layout.gif) | 57831_Ian Hynd - HYN..> | 2026-03-23 09:57 | 63K | |
![[ ]](/icons/layout.gif) | 33303_Gibbins - GIBB..> | 2026-01-14 14:30 | 63K | |
![[ ]](/icons/layout.gif) | 41647_Aki Ahmed - AH..> | 2026-02-09 11:24 | 63K | |
![[ ]](/icons/layout.gif) | 41634_Scott Brader -..> | 2026-02-09 11:13 | 63K | |
![[ ]](/icons/layout.gif) | 34634_Bart Gardener ..> | 2026-01-19 11:34 | 63K | |
![[ ]](/icons/layout.gif) | 43958_Alan England -..> | 2026-02-16 09:50 | 63K | |
![[ ]](/icons/layout.gif) | 52942_Neary - Endloc..> | 2026-03-10 08:17 | 63K | |
![[ ]](/icons/layout.gif) | 67526_Ash Sterland -..> | 2026-04-20 08:09 | 63K | |
![[ ]](/icons/layout.gif) | 33997_John Quinsee -..> | 2026-01-15 16:50 | 63K | |
![[ ]](/icons/layout.gif) | 47482_John Horsley -..> | 2026-02-24 10:03 | 63K | |
![[ ]](/icons/layout.gif) | 51310_Ian Carruthers..> | 2026-03-05 10:10 | 63K | |
![[ ]](/icons/layout.gif) | 51312_Ian Carruthers..> | 2026-03-05 10:10 | 63K | |
![[ ]](/icons/layout.gif) | 44743_Gordon Sneddon..> | 2026-02-17 10:36 | 63K | |
![[ ]](/icons/layout.gif) | 44344_Marc Loppas - ..> | 2026-02-16 16:05 | 63K | |
![[ ]](/icons/layout.gif) | 44347_Marc Loppas - ..> | 2026-02-16 16:05 | 63K | |
![[ ]](/icons/layout.gif) | 48067_Daniel Gannawa..> | 2026-02-25 10:37 | 63K | |
![[ ]](/icons/layout.gif) | 45984_John Kendrick ..> | 2026-02-19 09:54 | 63K | |
![[ ]](/icons/layout.gif) | 50764_Javid Choudhri..> | 2026-03-04 10:51 | 63K | |
![[ ]](/icons/layout.gif) | 63484_T Dean - DEAN0..> | 2026-04-08 10:25 | 63K | |
![[ ]](/icons/layout.gif) | 46489_Michael Cummin..> | 2026-02-20 10:00 | 63K | |
![[ ]](/icons/layout.gif) | 63463_Tindall - TIND..> | 2026-04-08 09:54 | 63K | |
![[ ]](/icons/layout.gif) | 42315_Colin Lambert ..> | 2026-02-10 13:50 | 63K | |
![[ ]](/icons/layout.gif) | 55199_Stephen Ruane ..> | 2026-03-16 09:57 | 63K | |
![[ ]](/icons/layout.gif) | 58149_A Cummings - C..> | 2026-03-23 15:02 | 63K | |
![[ ]](/icons/layout.gif) | 53917_Peter Constabl..> | 2026-03-11 14:27 | 63K | |
![[ ]](/icons/layout.gif) | 33986_David Bate - B..> | 2026-01-15 16:39 | 63K | |
![[ ]](/icons/layout.gif) | 39244_Norman Gibson ..> | 2026-02-02 11:59 | 63K | |
![[ ]](/icons/layout.gif) | 42837_Ewan Clarke - ..> | 2026-02-11 16:46 | 63K | |
![[ ]](/icons/layout.gif) | 60469_Mark McGuinnes..> | 2026-03-30 09:20 | 63K | |
![[ ]](/icons/layout.gif) | 40656_Lee Newman - N..> | 2026-02-04 16:54 | 63K | |
![[ ]](/icons/layout.gif) | 46482_Clive Bennett ..> | 2026-02-20 09:58 | 63K | |
![[ ]](/icons/layout.gif) | 58976_Holly Coates -..> | 2026-03-25 09:57 | 63K | |
![[ ]](/icons/layout.gif) | 38973_Olphin - OLPH0..> | 2026-01-30 14:48 | 63K | |
![[ ]](/icons/layout.gif) | 41464_Bob Gordon - G..> | 2026-02-06 15:41 | 63K | |
![[ ]](/icons/layout.gif) | 66361_Nigel Brooks -..> | 2026-04-15 15:00 | 63K | |
![[ ]](/icons/layout.gif) | 34991_Yu Zhang - ZHA..> | 2026-01-20 09:45 | 63K | |
![[ ]](/icons/layout.gif) | 51651_Douglas Wright..> | 2026-03-05 16:00 | 63K | |
![[ ]](/icons/layout.gif) | 66289_Simon Bailey -..> | 2026-04-15 13:10 | 63K | |
![[ ]](/icons/layout.gif) | 36800_Phillip Simmon..> | 2026-01-26 09:25 | 63K | |
![[ ]](/icons/layout.gif) | 58677_Pearson - PEAR..> | 2026-03-24 14:25 | 63K | |
![[ ]](/icons/layout.gif) | 40404_Peter Lewis - ..> | 2026-02-04 11:33 | 63K | |
![[ ]](/icons/layout.gif) | 55191_Diane Gooch - ..> | 2026-03-16 09:50 | 63K | |
![[ ]](/icons/layout.gif) | 57864_Guy Warburton ..> | 2026-03-23 10:26 | 63K | |
![[ ]](/icons/layout.gif) | 42458_Colin Lambert ..> | 2026-02-11 08:48 | 63K | |
![[ ]](/icons/layout.gif) | 39189_Mike White - W..> | 2026-02-02 11:01 | 63K | |
![[ ]](/icons/layout.gif) | 47489_Ian Mayor-Smit..> | 2026-02-24 10:07 | 63K | |
![[ ]](/icons/layout.gif) | 52051_Andy Knights -..> | 2026-03-06 12:09 | 63K | |
![[ ]](/icons/layout.gif) | 33670_Paul Booth - B..> | 2026-01-15 10:44 | 63K | |
![[ ]](/icons/layout.gif) | 45063_Colin Scott - ..> | 2026-02-17 16:01 | 63K | |
![[ ]](/icons/layout.gif) | 36853_Dan Prior - PR..> | 2026-01-26 10:12 | 63K | |
![[ ]](/icons/layout.gif) | 44132_Jack Paul - In..> | 2026-02-16 12:22 | 63K | |
![[ ]](/icons/layout.gif) | 48981_Nick Norris - ..> | 2026-02-27 09:34 | 63K | |
![[ ]](/icons/layout.gif) | 54209_A Rapsey Limit..> | 2026-03-12 12:13 | 63K | |
![[ ]](/icons/layout.gif) | 41373_Keith Hook - H..> | 2026-02-06 12:28 | 63K | |
![[ ]](/icons/layout.gif) | 43926_Ian Gunn - GUN..> | 2026-02-16 09:47 | 63K | |
![[ ]](/icons/layout.gif) | 68414_Lee Shrimpton ..> | 2026-04-21 11:05 | 63K | |
![[ ]](/icons/layout.gif) | 39226_Paul Robinson ..> | 2026-02-02 11:36 | 63K | |
![[ ]](/icons/layout.gif) | 60895_Paul Sheridan ..> | 2026-03-30 16:00 | 63K | |
![[ ]](/icons/layout.gif) | 34581_Darrell Page -..> | 2026-01-19 10:53 | 63K | |
![[ ]](/icons/layout.gif) | 48930_Adam Lee - LEE..> | 2026-02-27 08:39 | 63K | |
![[ ]](/icons/layout.gif) | 67415_Frank De Vere ..> | 2026-04-17 15:49 | 63K | |
![[ ]](/icons/layout.gif) | 34588_Matthew Law - ..> | 2026-01-19 10:57 | 63K | |
![[ ]](/icons/layout.gif) | 45932_Stephen Savory..> | 2026-02-19 09:01 | 63K | |
![[ ]](/icons/layout.gif) | 65449_Ian Weller - W..> | 2026-04-14 09:07 | 63K | |
![[ ]](/icons/layout.gif) | 41641_Ewan Clarke - ..> | 2026-02-09 11:21 | 63K | |
![[ ]](/icons/layout.gif) | 39860_Dave Ellis - E..> | 2026-02-03 11:29 | 63K | |
![[ ]](/icons/layout.gif) | 63549_Mullen - MULL0..> | 2026-04-08 11:47 | 63K | |
![[ ]](/icons/layout.gif) | 69527_Jody Baxer - B..> | 2026-04-23 13:01 | 63K | |
![[ ]](/icons/layout.gif) | 41616_Matt Pulman - ..> | 2026-02-09 11:03 | 63K | |
![[ ]](/icons/layout.gif) | 40713_James Commons ..> | 2026-02-05 08:31 | 63K | |
![[ ]](/icons/layout.gif) | 44909_Danny Baker - ..> | 2026-02-17 13:28 | 63K | |
![[ ]](/icons/layout.gif) | 61500_John Cullen - ..> | 2026-03-31 15:00 | 63K | |
![[ ]](/icons/layout.gif) | 44077_Mark Beresford..> | 2026-02-16 11:31 | 63K | |
![[ ]](/icons/layout.gif) | 49469_Peter Sayer - ..> | 2026-03-02 09:33 | 63K | |
![[ ]](/icons/layout.gif) | 53105_Tim Parker - P..> | 2026-03-10 10:26 | 63K | |
![[ ]](/icons/layout.gif) | 45609_Mark Ghent - H..> | 2026-02-18 12:17 | 63K | |
![[ ]](/icons/layout.gif) | 50801_Bert Taylor - ..> | 2026-03-04 11:11 | 63K | |
![[ ]](/icons/layout.gif) | 35110_Lee Smith - SM..> | 2026-01-20 11:26 | 63K | |
![[ ]](/icons/layout.gif) | 39762_Laurence Arnol..> | 2026-02-03 10:13 | 64K | |
![[ ]](/icons/layout.gif) | 41625_Paul Taylor - ..> | 2026-02-09 11:09 | 64K | |
![[ ]](/icons/layout.gif) | 57314_Wesley Mitchel..> | 2026-03-20 09:54 | 64K | |
![[ ]](/icons/layout.gif) | 61127_Maurice Wilson..> | 2026-03-31 10:39 | 64K | |
![[ ]](/icons/layout.gif) | 66903_Liam Carroll -..> | 2026-04-16 16:02 | 64K | |
![[ ]](/icons/layout.gif) | 54692_Mark Gamble - ..> | 2026-03-13 10:35 | 64K | |
![[ ]](/icons/layout.gif) | 65693_David Beet - B..> | 2026-04-14 12:47 | 64K | |
![[ ]](/icons/layout.gif) | 39042_Tremlin Tremli..> | 2026-01-30 15:55 | 64K | |
![[ ]](/icons/layout.gif) | 56811_Barry Carter -..> | 2026-03-19 10:59 | 64K | |
![[ ]](/icons/layout.gif) | 34534_Michael Nevin ..> | 2026-01-19 10:21 | 64K | |
![[ ]](/icons/layout.gif) | 47969_Michael Brough..> | 2026-02-25 09:02 | 64K | |
![[ ]](/icons/layout.gif) | 60040_Jackie Hopkins..> | 2026-03-27 10:47 | 64K | |
![[ ]](/icons/layout.gif) | 60460_Darren Newbold..> | 2026-03-30 09:14 | 64K | |
![[ ]](/icons/layout.gif) | 67759_Tim Elms - ELM..> | 2026-04-20 10:44 | 64K | |
![[ ]](/icons/layout.gif) | 46003_Juile Blant - ..> | 2026-02-19 10:11 | 64K | |
![[ ]](/icons/layout.gif) | 57827_Diane Wheeler ..> | 2026-03-23 09:53 | 64K | |
![[ ]](/icons/layout.gif) | 60487_Clive Benjamin..> | 2026-03-30 10:07 | 64K | |
![[ ]](/icons/layout.gif) | 69832_Neil Wright - ..> | 2026-04-24 08:41 | 64K | |
![[ ]](/icons/layout.gif) | 52859_Steve Courtney..> | 2026-03-09 16:20 | 64K | |
![[ ]](/icons/layout.gif) | 33491_Michael Parker..> | 2026-01-15 08:32 | 64K | |
![[ ]](/icons/layout.gif) | 36429_Nathan Kelly -..> | 2026-01-23 10:49 | 64K | |
![[ ]](/icons/layout.gif) | 37626_Parker - PARK0..> | 2026-01-27 15:01 | 64K | |
![[ ]](/icons/layout.gif) | 39236_Claire Smith -..> | 2026-02-02 11:56 | 64K | |
![[ ]](/icons/layout.gif) | 41653_David Harries ..> | 2026-02-09 11:27 | 64K | |
![[ ]](/icons/layout.gif) | 41275_Tony Scott - S..> | 2026-02-06 10:35 | 64K | |
![[ ]](/icons/layout.gif) | 46919_Derek Read - R..> | 2026-02-20 17:04 | 64K | |
![[ ]](/icons/layout.gif) | 57841_Luigi Salvino ..> | 2026-03-23 10:06 | 64K | |
![[ ]](/icons/layout.gif) | 54100_Jon Sayers - S..> | 2026-03-12 10:03 | 64K | |
![[ ]](/icons/layout.gif) | 58421_Gary Reynolds ..> | 2026-03-24 10:09 | 64K | |
![[ ]](/icons/layout.gif) | 41576_Kristian Bulma..> | 2026-02-09 10:21 | 64K | |
![[ ]](/icons/layout.gif) | 67516_Samuel Wood - ..> | 2026-04-20 08:05 | 64K | |
![[ ]](/icons/layout.gif) | 54191_James Hall - L..> | 2026-03-12 11:25 | 64K | |
![[ ]](/icons/layout.gif) | 62851_Harry Elliott ..> | 2026-04-07 10:57 | 64K | |
![[ ]](/icons/layout.gif) | 49211_Kinsley - KINS..> | 2026-02-27 14:42 | 64K | |
![[ ]](/icons/layout.gif) | 60454_Jennifer Cowle..> | 2026-03-30 09:11 | 64K | |
![[ ]](/icons/layout.gif) | 62977_Wendy Lawson -..> | 2026-04-07 12:43 | 64K | |
![[ ]](/icons/layout.gif) | 67821_Jon Shepherd -..> | 2026-04-20 12:32 | 64K | |
![[ ]](/icons/layout.gif) | 38693_Alex Martinez ..> | 2026-01-30 09:13 | 64K | |
![[ ]](/icons/layout.gif) | 58206_Peter Graham -..> | 2026-03-23 16:27 | 64K | |
![[ ]](/icons/layout.gif) | 46025_Andrew Thompso..> | 2026-02-19 10:33 | 64K | |
![[ ]](/icons/layout.gif) | 38533_Kim Kimee - KI..> | 2026-01-29 14:29 | 64K | |
![[ ]](/icons/layout.gif) | 59384_Pearson - PEAR..> | 2026-03-26 09:32 | 64K | |
![[ ]](/icons/layout.gif) | 68254_Dharmin Mandal..> | 2026-04-21 09:30 | 64K | |
![[ ]](/icons/layout.gif) | 37856_Andrew Comaish..> | 2026-01-28 10:57 | 64K | |
![[ ]](/icons/layout.gif) | 33821_Justin Finn - ..> | 2026-01-15 14:03 | 64K | |
![[ ]](/icons/layout.gif) | 33823_Justin Finn - ..> | 2026-01-15 14:04 | 64K | |
![[ ]](/icons/layout.gif) | 34594_Keith Williets..> | 2026-01-19 11:02 | 64K | |
![[ ]](/icons/layout.gif) | 46016_MIke Coombs - ..> | 2026-02-19 10:28 | 64K | |
![[ ]](/icons/layout.gif) | 49547_Steve Kirk - K..> | 2026-03-02 10:33 | 64K | |
![[ ]](/icons/layout.gif) | 51343_Steven Cole - ..> | 2026-03-05 10:38 | 64K | |
![[ ]](/icons/layout.gif) | 63495_K Nowobilski -..> | 2026-04-08 10:34 | 64K | |
![[ ]](/icons/layout.gif) | 43472_Nicole Richmon..> | 2026-02-13 09:15 | 64K | |
![[ ]](/icons/layout.gif) | 67608_Michael Goulde..> | 2026-04-20 08:27 | 64K | |
![[ ]](/icons/layout.gif) | 48709_Victor Gooding..> | 2026-02-26 15:47 | 64K | |
![[ ]](/icons/layout.gif) | 54942_Lawrence Berry..> | 2026-03-13 14:34 | 64K | |
![[ ]](/icons/layout.gif) | 68262_David Perkins ..> | 2026-04-21 09:36 | 64K | |
![[ ]](/icons/layout.gif) | 70186_Damien Gowan -..> | 2026-04-24 14:39 | 64K | |
![[ ]](/icons/layout.gif) | 62791_Danny Andrews ..> | 2026-04-07 10:11 | 64K | |
![[ ]](/icons/layout.gif) | 38309_Voyce - Motor ..> | 2026-01-29 10:35 | 64K | |
![[ ]](/icons/layout.gif) | 40662_Ewan Clarke - ..> | 2026-02-04 16:59 | 64K | |
![[ ]](/icons/layout.gif) | 70042_Graham Bradley..> | 2026-04-24 12:01 | 64K | |
![[ ]](/icons/layout.gif) | 52268_Michael Kavana..> | 2026-03-06 16:33 | 64K | |
![[ ]](/icons/layout.gif) | 65433_Margaret Yates..> | 2026-04-14 08:59 | 64K | |
![[ ]](/icons/layout.gif) | 69014_John Walter Co..> | 2026-04-22 12:30 | 64K | |
![[ ]](/icons/layout.gif) | 39205_David Greenacr..> | 2026-02-02 11:20 | 64K | |
![[ ]](/icons/layout.gif) | 64449_Peter Gill - G..> | 2026-04-10 09:37 | 64K | |
![[ ]](/icons/layout.gif) | 69290_Andrew Billing..> | 2026-04-23 07:51 | 64K | |
![[ ]](/icons/layout.gif) | 51497_Knox - KNOX000..> | 2026-03-05 13:50 | 64K | |
![[ ]](/icons/layout.gif) | 37842_Knox - KNOX000..> | 2026-01-28 10:44 | 64K | |
![[ ]](/icons/layout.gif) | 46952_Jason Martin -..> | 2026-02-23 09:33 | 64K | |
![[ ]](/icons/layout.gif) | 62192_Darren Newbold..> | 2026-04-02 09:03 | 64K | |
![[ ]](/icons/layout.gif) | 55291_Barnes - Door ..> | 2026-03-16 12:53 | 64K | |
![[ ]](/icons/layout.gif) | 48353_Chris Turner -..> | 2026-02-26 09:29 | 64K | |
![[ ]](/icons/layout.gif) | 55243_Steve Wattridg..> | 2026-03-16 10:53 | 64K | |
![[ ]](/icons/layout.gif) | 55471_Peter Davis - ..> | 2026-03-16 14:24 | 64K | |
![[ ]](/icons/layout.gif) | 62371_Kelvin Bolton ..> | 2026-04-02 12:59 | 64K | |
![[ ]](/icons/layout.gif) | 42640_Nick Seabridge..> | 2026-02-11 11:29 | 64K | |
![[ ]](/icons/layout.gif) | 60438_Daniel Bowes- ..> | 2026-03-30 08:50 | 64K | |
![[ ]](/icons/layout.gif) | 36189_David Gummer -..> | 2026-01-22 15:17 | 64K | |
![[ ]](/icons/layout.gif) | 42796_Martin Hewlett..> | 2026-02-11 15:28 | 64K | |
![[ ]](/icons/layout.gif) | 38245_Keith Butler -..> | 2026-01-29 09:41 | 64K | |
![[ ]](/icons/layout.gif) | 39218_Richard Shortl..> | 2026-02-02 11:30 | 64K | |
![[ ]](/icons/layout.gif) | 41780_Kirk Phoenix -..> | 2026-02-09 14:47 | 64K | |
![[ ]](/icons/layout.gif) | 61620_Jules Moynan -..> | 2026-04-01 07:44 | 64K | |
![[ ]](/icons/layout.gif) | 63157_Mark Bateman -..> | 2026-04-07 14:43 | 64K | |
![[ ]](/icons/layout.gif) | 65728_Terry Welsh - ..> | 2026-04-14 13:32 | 64K | |
![[ ]](/icons/layout.gif) | 62203_James Cuthbert..> | 2026-04-02 09:16 | 64K | |
![[ ]](/icons/layout.gif) | 33167_Valentyna Sozo..> | 2026-01-14 11:20 | 64K | |
![[ ]](/icons/layout.gif) | 64525_Nigel Hoad - H..> | 2026-04-10 11:58 | 64K | |
![[ ]](/icons/layout.gif) | 65241_Nigel Thompson..> | 2026-04-13 14:44 | 64K | |
![[ ]](/icons/layout.gif) | 41691_Linkways David..> | 2026-02-09 12:50 | 64K | |
![[ ]](/icons/layout.gif) | 44609_Chris Sheppard..> | 2026-02-17 09:11 | 64K | |
![[ ]](/icons/layout.gif) | 69427_Brian Stoddart..> | 2026-04-23 10:59 | 64K | |
![[ ]](/icons/layout.gif) | 40304_Hillard - HILL..> | 2026-02-04 09:12 | 64K | |
![[ ]](/icons/layout.gif) | 48663_Phil Nicholson..> | 2026-02-26 14:50 | 64K | |
![[ ]](/icons/layout.gif) | 49917_Darren Newbold..> | 2026-03-02 16:03 | 64K | |
![[ ]](/icons/layout.gif) | 34500_Mihai Raicu - ..> | 2026-01-19 09:43 | 64K | |
![[ ]](/icons/layout.gif) | 46983_Chris Turner -..> | 2026-02-23 10:05 | 64K | |
![[ ]](/icons/layout.gif) | 33806_Paul Yathmouri..> | 2026-01-15 13:46 | 64K | |
![[ ]](/icons/layout.gif) | 49738_Just Electrica..> | 2026-03-02 13:39 | 64K | |
![[ ]](/icons/layout.gif) | 45918_Alan Bailey - ..> | 2026-02-19 08:38 | 64K | |
![[ ]](/icons/layout.gif) | 52203_Charles Thomps..> | 2026-03-06 14:47 | 64K | |
![[ ]](/icons/layout.gif) | 62179_Nicks Carpentr..> | 2026-04-02 08:50 | 64K | |
![[ ]](/icons/layout.gif) | 50065_David Amsden -..> | 2026-03-03 08:47 | 64K | |
![[ ]](/icons/layout.gif) | 69359_Bert Taylor - ..> | 2026-04-23 08:50 | 64K | |
![[ ]](/icons/layout.gif) | 58150_A Cummings - C..> | 2026-03-23 15:02 | 64K | |
![[ ]](/icons/layout.gif) | 38339_TGP Fabricatio..> | 2026-01-29 10:53 | 64K | |
![[ ]](/icons/layout.gif) | 61129_Maurice Wilson..> | 2026-03-31 10:40 | 64K | |
![[ ]](/icons/layout.gif) | 65887_Brenda Patters..> | 2026-04-14 15:50 | 64K | |
![[ ]](/icons/layout.gif) | 42543_Frank Han - Re..> | 2026-02-11 09:48 | 64K | |
![[ ]](/icons/layout.gif) | 67960_Tim Elms - Rep..> | 2026-04-20 14:48 | 64K | |
![[ ]](/icons/layout.gif) | 33987_David Bate - B..> | 2026-01-15 16:40 | 64K | |
![[ ]](/icons/layout.gif) | 44623_VIP Bin Cleani..> | 2026-02-17 09:23 | 64K | |
![[ ]](/icons/layout.gif) | 65274_Roy Rogers - R..> | 2026-04-13 15:25 | 64K | |
![[ ]](/icons/layout.gif) | 66415_Richard Regan ..> | 2026-04-16 06:57 | 64K | |
![[ ]](/icons/layout.gif) | 69364_Keith Jones - ..> | 2026-04-23 08:54 | 64K | |
![[ ]](/icons/layout.gif) | 41267_Jakub Pilarski..> | 2026-02-06 10:28 | 64K | |
![[ ]](/icons/layout.gif) | 69833_Neil Wright - ..> | 2026-04-24 08:41 | 64K | |
![[ ]](/icons/layout.gif) | 59494_Nathan Kempson..> | 2026-03-26 10:41 | 64K | |
![[ ]](/icons/layout.gif) | 65283_Keith Day - DA..> | 2026-04-13 15:44 | 64K | |
![[ ]](/icons/layout.gif) | 60963_Jibk Limited, ..> | 2026-03-31 08:43 | 64K | |
![[ ]](/icons/layout.gif) | 50059_Robert Cronk -..> | 2026-03-03 08:44 | 64K | |
![[ ]](/icons/layout.gif) | 69079_John Walter Co..> | 2026-04-22 13:09 | 64K | |
![[ ]](/icons/layout.gif) | 43931_Ian Gunn - GUN..> | 2026-02-16 09:47 | 64K | |
![[ ]](/icons/layout.gif) | 66644_Lyn Bryant-Nic..> | 2026-04-16 11:41 | 64K | |
![[ ]](/icons/layout.gif) | 69830_Martyn Edmisto..> | 2026-04-24 08:40 | 64K | |
![[ ]](/icons/layout.gif) | 38694_Alex Martinez ..> | 2026-01-30 09:13 | 64K | |
![[ ]](/icons/layout.gif) | 58089_Roy Good - Pho..> | 2026-03-23 13:36 | 64K | |
![[ ]](/icons/layout.gif) | 63753_Roy Good - Pho..> | 2026-04-08 15:15 | 64K | |
![[ ]](/icons/layout.gif) | 44717_MD Development..> | 2026-02-17 10:22 | 64K | |
![[ ]](/icons/layout.gif) | 41518_Brian Higgins ..> | 2026-02-09 08:40 | 64K | |
![[ ]](/icons/layout.gif) | 53688_Matthew Hunt -..> | 2026-03-11 09:42 | 64K | |
![[ ]](/icons/layout.gif) | 59485_Joe Targett - ..> | 2026-03-26 10:35 | 64K | |
![[ ]](/icons/layout.gif) | 54088_Owain Hughes -..> | 2026-03-12 09:49 | 64K | |
![[ ]](/icons/layout.gif) | 64079_Steve Metcalfe..> | 2026-04-09 11:30 | 64K | |
![[ ]](/icons/layout.gif) | 61192_Eyeview Soluti..> | 2026-03-31 11:22 | 64K | |
![[ ]](/icons/layout.gif) | 67722_David JACOB - ..> | 2026-04-20 09:58 | 64K | |
![[ ]](/icons/layout.gif) | 38378_Montronix Jon ..> | 2026-01-29 11:11 | 64K | |
![[ ]](/icons/layout.gif) | 58933_Mike Rutter - ..> | 2026-03-25 09:23 | 64K | |
![[ ]](/icons/layout.gif) | 38367_Tony Phelps - ..> | 2026-01-29 11:05 | 64K | |
![[ ]](/icons/layout.gif) | 66624_Roger Price - ..> | 2026-04-16 11:23 | 64K | |
![[ ]](/icons/layout.gif) | 34173_CWD Improvemen..> | 2026-01-16 09:30 | 64K | |
![[ ]](/icons/layout.gif) | 50163_CWD Improvemen..> | 2026-03-03 09:53 | 64K | |
![[ ]](/icons/layout.gif) | 65318_Andrew Billing..> | 2026-04-14 07:28 | 64K | |
![[ ]](/icons/layout.gif) | 69456_Greg Goulding ..> | 2026-04-23 11:26 | 64K | |
![[ ]](/icons/layout.gif) | 50000_CWD Improvemen..> | 2026-03-02 17:00 | 64K | |
![[ ]](/icons/layout.gif) | 41778_Gary Scott - S..> | 2026-02-09 14:46 | 64K | |
![[ ]](/icons/layout.gif) | 38384_Rachael Komush..> | 2026-01-29 11:15 | 64K | |
![[ ]](/icons/layout.gif) | 62979_Wendy Lawson -..> | 2026-04-07 12:43 | 64K | |
![[ ]](/icons/layout.gif) | 53382_Neil Sherry - ..> | 2026-03-10 14:29 | 64K | |
![[ ]](/icons/layout.gif) | 69667_Simon Burley -..> | 2026-04-23 15:38 | 64K | |
![[ ]](/icons/layout.gif) | 63496_K Nowobilski -..> | 2026-04-08 10:34 | 64K | |
![[ ]](/icons/layout.gif) | 41692_Linkways David..> | 2026-02-09 12:50 | 64K | |
![[ ]](/icons/layout.gif) | 40663_Ewan Clarke - ..> | 2026-02-04 16:59 | 64K | |
![[ ]](/icons/layout.gif) | 48102_Michael Hider ..> | 2026-02-25 11:34 | 64K | |
![[ ]](/icons/layout.gif) | 69470_Paul Farrelly ..> | 2026-04-23 11:37 | 64K | |
![[ ]](/icons/layout.gif) | 38340_TGP Fabricatio..> | 2026-01-29 10:53 | 64K | |
![[ ]](/icons/layout.gif) | 61353_Eyeview Soluti..> | 2026-03-31 12:50 | 64K | |
![[ ]](/icons/layout.gif) | 66548_Kevin Heaver -..> | 2026-04-16 09:20 | 64K | |
![[ ]](/icons/layout.gif) | 51246_Andrew Billing..> | 2026-03-05 09:19 | 64K | |
![[ ]](/icons/layout.gif) | 34685_Ben Bradbury -..> | 2026-01-19 12:44 | 64K | |
![[ ]](/icons/layout.gif) | 67141_Neil Hughes - ..> | 2026-04-17 10:36 | 64K | |
![[ ]](/icons/layout.gif) | 68031_Richard Keach ..> | 2026-04-20 15:48 | 64K | |
![[ ]](/icons/layout.gif) | 68647_Eclipse Doors ..> | 2026-04-21 13:53 | 64K | |
![[ ]](/icons/layout.gif) | 54975_John Driver - ..> | 2026-03-13 15:23 | 64K | |
![[ ]](/icons/layout.gif) | 39944_Catherine Evan..> | 2026-02-03 12:29 | 64K | |
![[ ]](/icons/layout.gif) | 46850_Marcin Mordak ..> | 2026-02-20 14:59 | 64K | |
![[ ]](/icons/unknown.gif) | 47595_Component Sold..> | 2026-02-24 11:43 | 64K | |
![[ ]](/icons/layout.gif) | 37750_Paul Yaghmouri..> | 2026-01-28 08:30 | 64K | |
![[ ]](/icons/layout.gif) | 24806_Davis - DAVI00..> | 2025-12-10 16:15 | 69K | |
![[ ]](/icons/layout.gif) | 31016_Paul Bates - B..> | 2026-01-07 09:10 | 69K | |
![[ ]](/icons/layout.gif) | 32350_Martin White -..> | 2026-01-12 11:07 | 69K | |
![[ ]](/icons/layout.gif) | 15070_Matt Smith - S..> | 2025-11-13 14:40 | 69K | |
![[ ]](/icons/layout.gif) | 31718_Stuart Lee - R..> | 2026-01-08 14:08 | 69K | |
![[ ]](/icons/layout.gif) | 27946_Colin Davidson..> | 2025-12-18 15:36 | 69K | |
![[ ]](/icons/layout.gif) | 14951_Mark Riggal El..> | 2025-11-13 11:33 | 69K | |
![[ ]](/icons/layout.gif) | 15071_Matt Smith - S..> | 2025-11-13 14:41 | 69K | |
![[ ]](/icons/layout.gif) | 16307_Cybaman Techno..> | 2025-11-18 08:46 | 69K | |
![[ ]](/icons/layout.gif) | 29902_Woollard - WOO..> | 2026-01-02 15:52 | 69K | |
![[ ]](/icons/layout.gif) | 30762_Luke Gatesy - ..> | 2026-01-06 13:06 | 69K | |
![[ ]](/icons/layout.gif) | 32418_Kamil Puzdrows..> | 2026-01-12 14:51 | 69K | |
![[ ]](/icons/layout.gif) | 20847_Neil Stevens -..> | 2025-11-28 11:45 | 69K | |
![[ ]](/icons/layout.gif) | 23129_Neil Stevens -..> | 2025-12-04 15:43 | 69K | |
![[ ]](/icons/layout.gif) | 16962_Carl Hayfield ..> | 2025-11-19 07:49 | 69K | |
![[ ]](/icons/layout.gif) | 16380_Simon Stewart ..> | 2025-11-18 09:07 | 69K | |
![[ ]](/icons/layout.gif) | 24361_Daniel Hunt - ..> | 2025-12-09 12:05 | 69K | |
![[ ]](/icons/layout.gif) | 31920_Russell Hudson..> | 2026-01-09 09:06 | 69K | |
![[ ]](/icons/layout.gif) | 27973_Percy Thumwood..> | 2025-12-18 16:11 | 69K | |
![[ ]](/icons/layout.gif) | 18297_Kerry Allen - ..> | 2025-11-21 16:00 | 69K | |
![[ ]](/icons/layout.gif) | 16834_Harrold Knight..> | 2025-11-18 15:50 | 69K | |
![[ ]](/icons/layout.gif) | 24323_Paul Abel - AB..> | 2025-12-09 11:41 | 69K | |
![[ ]](/icons/layout.gif) | 16039_Alex Butler - ..> | 2025-11-17 12:48 | 69K | |
![[ ]](/icons/layout.gif) | 24381_Ermal Mula - M..> | 2025-12-09 12:16 | 69K | |
![[ ]](/icons/layout.gif) | 24367_Philip Ward - ..> | 2025-12-09 12:07 | 69K | |
![[ ]](/icons/layout.gif) | 32582_Neal Prescott ..> | 2026-01-13 09:06 | 69K | |
![[ ]](/icons/layout.gif) | 19319_Ian Bilks - RD..> | 2025-11-25 15:04 | 69K | |
![[ ]](/icons/layout.gif) | 30872_Luke Gates - G..> | 2026-01-06 15:21 | 69K | |
![[ ]](/icons/layout.gif) | 19325_Ian Dilks - RD..> | 2025-11-25 15:08 | 69K | |
![[ ]](/icons/layout.gif) | 31231_Owen Ingram - ..> | 2026-01-07 15:18 | 69K | |
![[ ]](/icons/layout.gif) | 32512_Matt Huckle - ..> | 2026-01-13 08:20 | 69K | |
![[ ]](/icons/layout.gif) | 20011_Christina Beam..> | 2025-11-26 15:58 | 69K | |
![[ ]](/icons/layout.gif) | 24217_Emlyn Roberts ..> | 2025-12-09 10:20 | 69K | |
![[ ]](/icons/layout.gif) | 16081_Alex Diaconu -..> | 2025-11-17 13:41 | 69K | |
![[ ]](/icons/layout.gif) | 31565_Ian George - G..> | 2026-01-08 11:04 | 69K | |
![[ ]](/icons/layout.gif) | 15956_Iurii Derkach ..> | 2025-11-17 10:54 | 69K | |
![[ ]](/icons/layout.gif) | 16780_Chris Snowdon ..> | 2025-11-18 15:22 | 69K | |
![[ ]](/icons/layout.gif) | 32806_Lisa Scattergo..> | 2026-01-13 12:48 | 69K | |
![[ ]](/icons/layout.gif) | 27732_Charlie Dune-A..> | 2025-12-18 11:19 | 69K | |
![[ ]](/icons/layout.gif) | 30340_Carol Plumley ..> | 2026-01-05 16:01 | 69K | |
![[ ]](/icons/layout.gif) | 16784_Kieran Hayes -..> | 2025-11-18 15:25 | 69K | |
![[ ]](/icons/layout.gif) | 28742_Gary Frost - F..> | 2025-12-22 16:15 | 69K | |
![[ ]](/icons/layout.gif) | 28743_Gary Frost - F..> | 2025-12-22 16:16 | 69K | |
![[ ]](/icons/layout.gif) | 20887_Gibbons - GIBB..> | 2025-11-28 12:15 | 69K | |
![[ ]](/icons/layout.gif) | 32476_Neil Robertson..> | 2026-01-12 16:56 | 69K | |
![[ ]](/icons/layout.gif) | 32623_James Dixon - ..> | 2026-01-13 10:38 | 69K | |
![[ ]](/icons/layout.gif) | 24608_Daniel Donohoe..> | 2025-12-10 08:17 | 69K | |
![[ ]](/icons/layout.gif) | 29081_Paul Cooper - ..> | 2025-12-23 13:56 | 69K | |
![[ ]](/icons/layout.gif) | 17781_Dell Home Impr..> | 2025-11-20 16:08 | 69K | |
![[ ]](/icons/layout.gif) | 31240_Ionut Sanducu ..> | 2026-01-07 15:37 | 69K | |
![[ ]](/icons/layout.gif) | 15074_Matthew Green ..> | 2025-11-13 14:48 | 69K | |
![[ ]](/icons/layout.gif) | 28615_Jamie Brown - ..> | 2025-12-22 13:12 | 69K | |
![[ ]](/icons/layout.gif) | 21314_Charlie Swift ..> | 2025-12-01 10:49 | 69K | |
![[ ]](/icons/layout.gif) | 21381_Arturo Chichon..> | 2025-12-01 12:20 | 69K | |
![[ ]](/icons/layout.gif) | 21389_Arturo Chichon..> | 2025-12-01 12:23 | 69K | |
![[ ]](/icons/layout.gif) | 31303_Scott Tatham -..> | 2026-01-08 07:23 | 69K | |
![[ ]](/icons/layout.gif) | 18843_Raven Fire And..> | 2025-11-24 16:57 | 69K | |
![[ ]](/icons/layout.gif) | 22946_Andy Willis - ..> | 2025-12-04 13:40 | 69K | |
![[ ]](/icons/layout.gif) | 26758_Liam Bradly - ..> | 2025-12-16 10:49 | 69K | |
![[ ]](/icons/layout.gif) | 19619_James Rankin -..> | 2025-11-26 08:13 | 69K | |
![[ ]](/icons/layout.gif) | 26745_Stan Annis - S..> | 2025-12-16 10:37 | 69K | |
![[ ]](/icons/layout.gif) | 27772_Raven Fire And..> | 2025-12-18 11:40 | 69K | |
![[ ]](/icons/layout.gif) | 24422_Mark Braybrook..> | 2025-12-09 13:55 | 69K | |
![[ ]](/icons/layout.gif) | 30634_Shaun Butler -..> | 2026-01-06 11:10 | 69K | |
![[ ]](/icons/layout.gif) | 19009_Julian Clarke ..> | 2025-11-25 10:26 | 69K | |
![[ ]](/icons/layout.gif) | 26631_John Wilson - ..> | 2025-12-16 08:01 | 69K | |
![[ ]](/icons/layout.gif) | 22716_Matthew Robins..> | 2025-12-04 08:58 | 69K | |
![[ ]](/icons/layout.gif) | 31702_William Wright..> | 2026-01-08 13:56 | 69K | |
![[ ]](/icons/layout.gif) | 21603_Thomas Hartley..> | 2025-12-01 16:58 | 69K | |
![[ ]](/icons/layout.gif) | 27804_Sam Capone - H..> | 2025-12-18 12:22 | 69K | |
![[ ]](/icons/layout.gif) | 31678_James Oldfield..> | 2026-01-08 13:20 | 69K | |
![[ ]](/icons/layout.gif) | 19010_Joe Davis - OR..> | 2025-11-25 10:29 | 69K | |
![[ ]](/icons/layout.gif) | 25178_Rob Warman - O..> | 2025-12-11 14:21 | 69K | |
![[ ]](/icons/layout.gif) | 23348_Dan Corrigall ..> | 2025-12-05 09:46 | 69K | |
![[ ]](/icons/layout.gif) | 27308_Anthony Kirk -..> | 2025-12-17 10:43 | 69K | |
![[ ]](/icons/layout.gif) | 26726_James Walker -..> | 2025-12-16 10:07 | 69K | |
![[ ]](/icons/layout.gif) | 30756_Gary Harvey - ..> | 2026-01-06 12:37 | 69K | |
![[ ]](/icons/layout.gif) | 32905_John Kendrick ..> | 2026-01-13 14:19 | 69K | |
![[ ]](/icons/layout.gif) | 19690_RLP Robert Pay..> | 2025-11-26 09:02 | 69K | |
![[ ]](/icons/layout.gif) | 23170_Philip Drakele..> | 2025-12-04 16:41 | 69K | |
![[ ]](/icons/layout.gif) | 20402_Alison Wohlfor..> | 2025-11-27 12:02 | 69K | |
![[ ]](/icons/layout.gif) | 20601_Shaun Hilton -..> | 2025-11-28 07:39 | 69K | |
![[ ]](/icons/layout.gif) | 30312_Tom Collins - ..> | 2026-01-05 15:45 | 69K | |
![[ ]](/icons/layout.gif) | 18535_Andrew Bullen ..> | 2025-11-24 10:47 | 69K | |
![[ ]](/icons/layout.gif) | 32506_Graham Parrott..> | 2026-01-13 08:11 | 69K | |
![[ ]](/icons/layout.gif) | 20608_Gareth Cripps ..> | 2025-11-28 07:45 | 69K | |
![[ ]](/icons/layout.gif) | 27591_David Gilson -..> | 2025-12-18 07:25 | 69K | |
![[ ]](/icons/layout.gif) | 27304_Alex George - ..> | 2025-12-17 10:39 | 69K | |
![[ ]](/icons/layout.gif) | 30286_Fiona Hitchcoc..> | 2026-01-05 15:05 | 69K | |
![[ ]](/icons/layout.gif) | 29621_Leo Darling - ..> | 2026-01-02 08:22 | 69K | |
![[ ]](/icons/layout.gif) | 23748_Steve McFarlan..> | 2025-12-08 10:30 | 69K | |
![[ ]](/icons/layout.gif) | 20896_Matthew Bursle..> | 2025-11-28 12:24 | 69K | |
![[ ]](/icons/layout.gif) | 28987_RLP Robert Pay..> | 2025-12-23 10:46 | 69K | |
![[ ]](/icons/layout.gif) | 33010_Andrew Woolsto..> | 2026-01-14 08:41 | 69K | |
![[ ]](/icons/layout.gif) | 16747_Scott Webster ..> | 2025-11-18 14:50 | 69K | |
![[ ]](/icons/layout.gif) | 25777_Russell Parrat..> | 2025-12-12 15:21 | 69K | |
![[ ]](/icons/layout.gif) | 21286_James Gill - J..> | 2025-12-01 10:30 | 69K | |
![[ ]](/icons/layout.gif) | 16718_PJ.Munn Darren..> | 2025-11-18 14:20 | 69K | |
![[ ]](/icons/layout.gif) | 24243_Matt Solomon -..> | 2025-12-09 10:46 | 69K | |
![[ ]](/icons/layout.gif) | 23695_Matthew Robins..> | 2025-12-08 09:55 | 69K | |
![[ ]](/icons/layout.gif) | 19221_Simon Hockley ..> | 2025-11-25 13:38 | 69K | |
![[ ]](/icons/layout.gif) | 26734_David Gilson -..> | 2025-12-16 10:12 | 69K | |
![[ ]](/icons/layout.gif) | 24598_Greenlands Con..> | 2025-12-10 07:43 | 69K | |
![[ ]](/icons/layout.gif) | 30522_Streamline Hom..> | 2026-01-06 09:27 | 69K | |
![[ ]](/icons/layout.gif) | 31264_Streamline Hom..> | 2026-01-07 16:54 | 69K | |
![[ ]](/icons/layout.gif) | 27298_Christopher Th..> | 2025-12-17 10:23 | 69K | |
![[ ]](/icons/layout.gif) | 16036_Nathanael Cicc..> | 2025-11-17 12:46 | 69K | |
![[ ]](/icons/layout.gif) | 32596_Sam Oliver - E..> | 2026-01-13 09:12 | 69K | |
![[ ]](/icons/layout.gif) | 20398_Peter Urquhart..> | 2025-11-27 12:00 | 69K | |
![[ ]](/icons/layout.gif) | 21470_Peter Urquhart..> | 2025-12-01 14:10 | 69K | |
![[ ]](/icons/layout.gif) | 21445_Mike Smith - O..> | 2025-12-01 13:36 | 69K | |
![[ ]](/icons/layout.gif) | 31589_Duane Snelling..> | 2026-01-08 11:20 | 69K | |
![[ ]](/icons/layout.gif) | 20975_Matthew Bursle..> | 2025-11-28 14:51 | 69K | |
![[ ]](/icons/layout.gif) | 21246_Paul Jones - O..> | 2025-12-01 10:00 | 69K | |
![[ ]](/icons/layout.gif) | 19528_AMJ. Building ..> | 2025-11-25 16:51 | 69K | |
![[ ]](/icons/layout.gif) | 18307_Geoff - GEOF00..> | 2025-11-21 16:25 | 70K | |
![[ ]](/icons/layout.gif) | 30299_Phil Monday - ..> | 2026-01-05 15:27 | 70K | |
![[ ]](/icons/layout.gif) | 31686_Alex Millar - ..> | 2026-01-08 13:25 | 70K | |
![[ ]](/icons/layout.gif) | 32236_Craig Hustwayt..> | 2026-01-12 08:39 | 70K | |
![[ ]](/icons/layout.gif) | 24317_Josh Satturley..> | 2025-12-09 11:36 | 70K | |
![[ ]](/icons/layout.gif) | 18219_Adam Lodge - L..> | 2025-11-21 13:56 | 70K | |
![[ ]](/icons/layout.gif) | 19334_Craig Weston -..> | 2025-11-25 15:23 | 70K | |
![[ ]](/icons/layout.gif) | 27807_Adam Lodge - L..> | 2025-12-18 12:26 | 70K | |
![[ ]](/icons/layout.gif) | 19337_Ben Rye - RYEB..> | 2025-11-25 15:25 | 70K | |
![[ ]](/icons/layout.gif) | 17878_Patrick Banks ..> | 2025-11-21 07:59 | 70K | |
![[ ]](/icons/layout.gif) | 16654_Paul Watkins -..> | 2025-11-18 13:22 | 71K | |
![[ ]](/icons/layout.gif) | 68393_Eclipse Doors ..> | 2026-04-21 10:38 | 71K | |
![[ ]](/icons/layout.gif) | 29657_Jamie Stubbs -..> | 2026-01-02 09:07 | 71K | |
![[ ]](/icons/layout.gif) | 16842_Neil Hambling ..> | 2025-11-18 16:00 | 71K | |
![[ ]](/icons/layout.gif) | 17584_Lawrie Hudson ..> | 2025-11-20 11:37 | 71K | |
![[ ]](/icons/layout.gif) | 34101_Richard Hanlon..> | 2026-01-16 08:32 | 72K | |
![[ ]](/icons/layout.gif) | 44826_John Wilson - ..> | 2026-02-17 12:42 | 72K | |
![[ ]](/icons/layout.gif) | 54583_Andrew Loizou ..> | 2026-03-13 08:42 | 72K | |
![[ ]](/icons/layout.gif) | 65049_Hibberd Matt -..> | 2026-04-13 10:37 | 72K | |
![[ ]](/icons/layout.gif) | 54983_Stephen Foster..> | 2026-03-13 15:29 | 72K | |
![[ ]](/icons/layout.gif) | 45057_Adam Hodge - S..> | 2026-02-17 15:54 | 72K | |
![[ ]](/icons/layout.gif) | 60807_Katy Gilhooly ..> | 2026-03-30 15:07 | 72K | |
![[ ]](/icons/layout.gif) | 62504_Gary Linney - ..> | 2026-04-02 15:21 | 72K | |
![[ ]](/icons/layout.gif) | 34219_Peter Lewis - ..> | 2026-01-16 10:27 | 72K | |
![[ ]](/icons/layout.gif) | 46087_Ian Pearson Lo..> | 2026-02-19 12:08 | 72K | |
![[ ]](/icons/layout.gif) | 69421_David Squibb -..> | 2026-04-23 10:57 | 72K | |
![[ ]](/icons/layout.gif) | 60842_James Fairbair..> | 2026-03-30 15:23 | 72K | |
![[ ]](/icons/layout.gif) | 48461_Nigel Chapman ..> | 2026-02-26 10:52 | 72K | |
![[ ]](/icons/layout.gif) | 69652_Scott Gray - G..> | 2026-04-23 15:29 | 72K | |
![[ ]](/icons/layout.gif) | 57529_Martin Letting..> | 2026-03-20 14:16 | 72K | |
![[ ]](/icons/layout.gif) | 57875_Terry Welsh - ..> | 2026-03-23 10:32 | 72K | |
![[ ]](/icons/layout.gif) | 35779_John Rodemark ..> | 2026-01-21 13:58 | 72K | |
![[ ]](/icons/layout.gif) | 46893_Josh West - WE..> | 2026-02-20 15:57 | 72K | |
![[ ]](/icons/layout.gif) | 66061_Edward Smith -..> | 2026-04-15 09:00 | 72K | |
![[ ]](/icons/layout.gif) | 36636_Joe Barker - B..> | 2026-01-23 14:21 | 72K | |
![[ ]](/icons/layout.gif) | 50286_Tim Burton - B..> | 2026-03-03 12:30 | 72K | |
![[ ]](/icons/layout.gif) | 38426_James Whyte - ..> | 2026-01-29 12:31 | 72K | |
![[ ]](/icons/layout.gif) | 52003_Saul Pochin - ..> | 2026-03-06 11:37 | 72K | |
![[ ]](/icons/layout.gif) | 66017_Andrew Grant -..> | 2026-04-15 08:27 | 72K | |
![[ ]](/icons/layout.gif) | 62240_Hannah Beats -..> | 2026-04-02 09:53 | 72K | |
![[ ]](/icons/layout.gif) | 57357_Andy Hobson - ..> | 2026-03-20 10:40 | 72K | |
![[ ]](/icons/layout.gif) | 45878_Philip Brown -..> | 2026-02-19 07:58 | 72K | |
![[ ]](/icons/layout.gif) | 49992_Ron Foster - F..> | 2026-03-02 16:53 | 72K | |
![[ ]](/icons/layout.gif) | 61690_Ionut Sanducu ..> | 2026-04-01 09:04 | 72K | |
![[ ]](/icons/layout.gif) | 39520_John Cerosola ..> | 2026-02-03 07:36 | 72K | |
![[ ]](/icons/layout.gif) | 51457_Stephen Edward..> | 2026-03-05 12:33 | 72K | |
![[ ]](/icons/layout.gif) | 63823_Gary Thom - TH..> | 2026-04-09 07:06 | 72K | |
![[ ]](/icons/layout.gif) | 64202_Gary Thom - TH..> | 2026-04-09 15:16 | 72K | |
![[ ]](/icons/layout.gif) | 45889_Keith Northeas..> | 2026-02-19 08:24 | 72K | |
![[ ]](/icons/layout.gif) | 61616_John Connelly ..> | 2026-04-01 07:39 | 72K | |
![[ ]](/icons/layout.gif) | 67762_Paul Burns - B..> | 2026-04-20 10:45 | 72K | |
![[ ]](/icons/layout.gif) | 65114_Joanne Harris ..> | 2026-04-13 11:47 | 72K | |
![[ ]](/icons/layout.gif) | 67400_Tim Bassett - ..> | 2026-04-17 15:01 | 72K | |
![[ ]](/icons/layout.gif) | 62057_Grant Millar -..> | 2026-04-02 06:28 | 72K | |
![[ ]](/icons/layout.gif) | 63809_Matthew Law - ..> | 2026-04-09 06:38 | 72K | |
![[ ]](/icons/layout.gif) | 42674_Nick Staley - ..> | 2026-02-11 12:07 | 72K | |
![[ ]](/icons/layout.gif) | 65888_Jack Groom - G..> | 2026-04-14 15:52 | 72K | |
![[ ]](/icons/layout.gif) | 53257_Clint Davies -..> | 2026-03-10 12:35 | 72K | |
![[ ]](/icons/layout.gif) | 56922_Paul Hazel - H..> | 2026-03-19 12:11 | 72K | |
![[ ]](/icons/layout.gif) | 68852_Stuart Badkin ..> | 2026-04-22 08:48 | 72K | |
![[ ]](/icons/layout.gif) | 46870_Gordon Kerr - ..> | 2026-02-20 15:24 | 72K | |
![[ ]](/icons/layout.gif) | 61628_Lucia Hudova -..> | 2026-04-01 07:51 | 72K | |
![[ ]](/icons/layout.gif) | 45657_Barry White - ..> | 2026-02-18 13:54 | 72K | |
![[ ]](/icons/layout.gif) | 57096_Paul Hazell - ..> | 2026-03-19 16:43 | 72K | |
![[ ]](/icons/layout.gif) | 60481_Pmd LTD - PMDL..> | 2026-03-30 10:03 | 72K | |
![[ ]](/icons/layout.gif) | 52887_Stephen Shaw -..> | 2026-03-09 16:49 | 72K | |
![[ ]](/icons/layout.gif) | 59249_ANDREW WALKER ..> | 2026-03-25 14:47 | 72K | |
![[ ]](/icons/layout.gif) | 33213_Kawa Abdullah ..> | 2026-01-14 13:02 | 72K | |
![[ ]](/icons/layout.gif) | 52936_Cameron Ridler..> | 2026-03-10 07:44 | 72K | |
![[ ]](/icons/layout.gif) | 49522_Miriam Smyth -..> | 2026-03-02 10:00 | 72K | |
![[ ]](/icons/layout.gif) | 59259_Bill Mitchell ..> | 2026-03-25 15:08 | 72K | |
![[ ]](/icons/layout.gif) | 41699_Harriet Beck -..> | 2026-02-09 13:17 | 72K | |
![[ ]](/icons/layout.gif) | 58821_Andy Towser - ..> | 2026-03-24 16:33 | 72K | |
![[ ]](/icons/layout.gif) | 52898_Terry Hallett ..> | 2026-03-09 16:56 | 72K | |
![[ ]](/icons/layout.gif) | 57890_Terry Welsh - ..> | 2026-03-23 10:41 | 72K | |
![[ ]](/icons/layout.gif) | 63964_Ian Smith - SM..> | 2026-04-09 08:57 | 72K | |
![[ ]](/icons/layout.gif) | 64207_Ian Smith - SM..> | 2026-04-09 15:17 | 72K | |
![[ ]](/icons/layout.gif) | 68388_Joe Senior - S..> | 2026-04-21 10:33 | 72K | |
![[ ]](/icons/layout.gif) | 53258_Greg Jarka - J..> | 2026-03-10 12:37 | 72K | |
![[ ]](/icons/layout.gif) | 53196_Neil Pothecary..> | 2026-03-10 12:11 | 72K | |
![[ ]](/icons/layout.gif) | 51743_Andy Page - An..> | 2026-03-06 07:35 | 72K | |
![[ ]](/icons/layout.gif) | 68363_George Berridg..> | 2026-04-21 10:13 | 72K | |
![[ ]](/icons/layout.gif) | 63843_Adam Couzens -..> | 2026-04-09 07:28 | 72K | |
![[ ]](/icons/layout.gif) | 66023_Andrew Grant -..> | 2026-04-15 08:31 | 72K | |
![[ ]](/icons/layout.gif) | 52263_Mark Ellis - E..> | 2026-03-06 16:21 | 72K | |
![[ ]](/icons/layout.gif) | 64810_Karl Southern ..> | 2026-04-13 06:42 | 72K | |
![[ ]](/icons/layout.gif) | 35090_Percy Thumwood..> | 2026-01-20 11:10 | 72K | |
![[ ]](/icons/layout.gif) | 49289_Mike Fox - FOX..> | 2026-02-27 16:33 | 72K | |
![[ ]](/icons/layout.gif) | 53695_David Pearson ..> | 2026-03-11 09:45 | 72K | |
![[ ]](/icons/layout.gif) | 57008_James Bolsolve..> | 2026-03-19 14:31 | 72K | |
![[ ]](/icons/layout.gif) | 58345_Clive Bailey -..> | 2026-03-24 09:10 | 72K | |
![[ ]](/icons/layout.gif) | 43979_Myles Reuben -..> | 2026-02-16 10:13 | 72K | |
![[ ]](/icons/layout.gif) | 44192_Myles Reuben -..> | 2026-02-16 13:52 | 72K | |
![[ ]](/icons/layout.gif) | 47328_Tom Morris - $..> | 2026-02-23 16:27 | 72K | |
![[ ]](/icons/layout.gif) | 54162_James Newman -..> | 2026-03-12 10:52 | 72K | |
![[ ]](/icons/layout.gif) | 68427_Aaran Trew - T..> | 2026-04-21 11:36 | 72K | |
![[ ]](/icons/layout.gif) | 38836_A Long - Monty..> | 2026-01-30 10:55 | 72K | |
![[ ]](/icons/layout.gif) | 42736_Stuart Morgan ..> | 2026-02-11 13:13 | 72K | |
![[ ]](/icons/layout.gif) | 42863_Stuart Morgan ..> | 2026-02-12 08:08 | 72K | |
![[ ]](/icons/layout.gif) | 34195_David Jenkinso..> | 2026-01-16 09:42 | 72K | |
![[ ]](/icons/layout.gif) | 64298_Tyler Allen - ..> | 2026-04-10 06:49 | 72K | |
![[ ]](/icons/layout.gif) | 40522_James Morton -..> | 2026-02-04 14:08 | 72K | |
![[ ]](/icons/layout.gif) | 41707_Jon Durrant - ..> | 2026-02-09 13:28 | 72K | |
![[ ]](/icons/layout.gif) | 44666_Jack Taylor - ..> | 2026-02-17 09:50 | 72K | |
![[ ]](/icons/layout.gif) | 66232_Blackhawk Secu..> | 2026-04-15 11:55 | 72K | |
![[ ]](/icons/layout.gif) | 50372_Tom Morris - $..> | 2026-03-03 15:13 | 72K | |
![[ ]](/icons/layout.gif) | 65222_Stephen Boyle ..> | 2026-04-13 14:11 | 72K | |
![[ ]](/icons/layout.gif) | 50033_Harry Smith - ..> | 2026-03-03 08:26 | 72K | |
![[ ]](/icons/layout.gif) | 52869_Andrew Woolsto..> | 2026-03-09 16:28 | 72K | |
![[ ]](/icons/layout.gif) | 64848_DT Services Lt..> | 2026-04-13 07:54 | 72K | |
![[ ]](/icons/layout.gif) | 35512_Bone - BONE000..> | 2026-01-21 08:50 | 72K | |
![[ ]](/icons/layout.gif) | 63789_C F F Milsom -..> | 2026-04-08 15:58 | 72K | |
![[ ]](/icons/layout.gif) | 65349_Steve Binns - ..> | 2026-04-14 07:43 | 72K | |
![[ ]](/icons/layout.gif) | 69535_Steve West - W..> | 2026-04-23 13:05 | 72K | |
![[ ]](/icons/layout.gif) | 34298_Garry Houghton..> | 2026-01-16 13:44 | 72K | |
![[ ]](/icons/layout.gif) | 36224_Garry Houghton..> | 2026-01-22 16:40 | 72K | |
![[ ]](/icons/layout.gif) | 44216_Bob Peer - PEE..> | 2026-02-16 14:15 | 72K | |
![[ ]](/icons/layout.gif) | 61636_Mark Baker - B..> | 2026-04-01 08:07 | 72K | |
![[ ]](/icons/layout.gif) | 67932_Aaron Bloomfie..> | 2026-04-20 14:34 | 72K | |
![[ ]](/icons/layout.gif) | 41901_Richard Ashley..> | 2026-02-09 16:22 | 72K | |
![[ ]](/icons/layout.gif) | 50966_D Smith - SMIT..> | 2026-03-04 15:27 | 72K | |
![[ ]](/icons/layout.gif) | 51121_Stuart Burch -..> | 2026-03-05 07:20 | 72K | |
![[ ]](/icons/layout.gif) | 42824_Bob Peer - PEE..> | 2026-02-11 16:18 | 72K | |
![[ ]](/icons/layout.gif) | 60867_Paul Bryan - B..> | 2026-03-30 15:39 | 72K | |
![[ ]](/icons/layout.gif) | 44395_John Stelmasia..> | 2026-02-17 07:27 | 72K | |
![[ ]](/icons/layout.gif) | 60904_Barbara Ebanks..> | 2026-03-31 06:20 | 72K | |
![[ ]](/icons/layout.gif) | 64803_Danny Carter -..> | 2026-04-13 06:20 | 72K | |
![[ ]](/icons/layout.gif) | 40958_Dennis Millier..> | 2026-02-05 13:04 | 72K | |
![[ ]](/icons/layout.gif) | 59128_Matthew Collin..> | 2026-03-25 12:21 | 72K | |
![[ ]](/icons/layout.gif) | 35565_Eric Fleming -..> | 2026-01-21 09:58 | 72K | |
![[ ]](/icons/layout.gif) | 40437_Craig Reid - R..> | 2026-02-04 11:59 | 72K | |
![[ ]](/icons/layout.gif) | 53683_Bradley Sincla..> | 2026-03-11 09:39 | 72K | |
![[ ]](/icons/layout.gif) | 67135_John Summerfie..> | 2026-04-17 10:32 | 72K | |
![[ ]](/icons/layout.gif) | 68047_Paul Burns - B..> | 2026-04-21 06:41 | 72K | |
![[ ]](/icons/layout.gif) | 69125_Stephan Potter..> | 2026-04-22 14:30 | 72K | |
![[ ]](/icons/layout.gif) | 34759_Paul Wise - WI..> | 2026-01-19 14:37 | 72K | |
![[ ]](/icons/layout.gif) | 34760_Paul Wise - WI..> | 2026-01-19 14:38 | 72K | |
![[ ]](/icons/layout.gif) | 38649_Jack Sowerby -..> | 2026-01-30 07:56 | 72K | |
![[ ]](/icons/layout.gif) | 35837_Ian Frazer - K..> | 2026-01-21 15:47 | 72K | |
![[ ]](/icons/layout.gif) | 52883_Argo Gauld - G..> | 2026-03-09 16:44 | 72K | |
![[ ]](/icons/layout.gif) | 68475_Steven Barbsle..> | 2026-04-21 12:42 | 72K | |
![[ ]](/icons/layout.gif) | 50972_Patrick Crossl..> | 2026-03-04 15:32 | 72K | |
![[ ]](/icons/layout.gif) | 65812_Gary Bernardo ..> | 2026-04-14 14:33 | 72K | |
![[ ]](/icons/layout.gif) | 65020_Derek Jardine ..> | 2026-04-13 10:08 | 72K | |
![[ ]](/icons/layout.gif) | 36200_Ian Frazer - K..> | 2026-01-22 15:58 | 72K | |
![[ ]](/icons/layout.gif) | 41763_Gary Dingwall ..> | 2026-02-09 14:27 | 72K | |
![[ ]](/icons/layout.gif) | 55364_Mark Bowles - ..> | 2026-03-16 13:44 | 72K | |
![[ ]](/icons/layout.gif) | 49248_Roy Clark - Ro..> | 2026-02-27 15:39 | 72K | |
![[ ]](/icons/layout.gif) | 41172_James Hinton -..> | 2026-02-06 08:08 | 72K | |
![[ ]](/icons/layout.gif) | 47909_Alex Ford - FO..> | 2026-02-24 16:55 | 72K | |
![[ ]](/icons/layout.gif) | 67380_Claire Poxon -..> | 2026-04-17 14:48 | 72K | |
![[ ]](/icons/layout.gif) | 34188_Dave Crabtree ..> | 2026-01-16 09:35 | 72K | |
![[ ]](/icons/layout.gif) | 59944_Len Fletcher -..> | 2026-03-27 09:14 | 72K | |
![[ ]](/icons/layout.gif) | 49459_Jake Skipper -..> | 2026-03-02 09:30 | 72K | |
![[ ]](/icons/layout.gif) | 38427_James Whyte - ..> | 2026-01-29 12:32 | 72K | |
![[ ]](/icons/layout.gif) | 41350_Adrian Hollowa..> | 2026-02-06 12:06 | 72K | |
![[ ]](/icons/layout.gif) | 43549_Nick Staley - ..> | 2026-02-13 10:24 | 72K | |
![[ ]](/icons/layout.gif) | 47900_David Neale - ..> | 2026-02-24 16:42 | 72K | |
![[ ]](/icons/layout.gif) | 59262_Bill Mitchell ..> | 2026-03-25 15:11 | 72K | |
![[ ]](/icons/layout.gif) | 65865_David Bruntnel..> | 2026-04-14 15:13 | 72K | |
![[ ]](/icons/layout.gif) | 45026_Lee Cocker - C..> | 2026-02-17 15:09 | 72K | |
![[ ]](/icons/layout.gif) | 68681_Andrew Humphre..> | 2026-04-21 14:27 | 72K | |
![[ ]](/icons/layout.gif) | 34287_Tommy - Tommym..> | 2026-01-16 13:34 | 72K | |
![[ ]](/icons/layout.gif) | 67459_Prashant Karke..> | 2026-04-20 07:11 | 72K | |
![[ ]](/icons/layout.gif) | 68184_Eduardo Pestan..> | 2026-04-21 08:09 | 72K | |
![[ ]](/icons/layout.gif) | 35589_Connor Lewis -..> | 2026-01-21 10:21 | 72K | |
![[ ]](/icons/layout.gif) | 68041_Billy Cook - C..> | 2026-04-20 16:03 | 72K | |
![[ ]](/icons/layout.gif) | 69091_Luke Haddy - H..> | 2026-04-22 13:31 | 72K | |
![[ ]](/icons/layout.gif) | 47018_Anthony Bendon..> | 2026-02-23 10:45 | 72K | |
![[ ]](/icons/layout.gif) | 64761_Pawel Wolf - P..> | 2026-04-10 15:46 | 72K | |
![[ ]](/icons/layout.gif) | 63260_Max Hewitt - H..> | 2026-04-08 06:31 | 72K | |
![[ ]](/icons/layout.gif) | 68407_Collin Pickeri..> | 2026-04-21 11:01 | 72K | |
![[ ]](/icons/layout.gif) | 47256_Asa Herbert - ..> | 2026-02-23 16:00 | 72K | |
![[ ]](/icons/layout.gif) | 60538_Michael Penman..> | 2026-03-30 10:50 | 72K | |
![[ ]](/icons/layout.gif) | 63293_John Robson - ..> | 2026-04-08 06:58 | 72K | |
![[ ]](/icons/layout.gif) | 40682_Brite Binu - B..> | 2026-02-05 07:30 | 72K | |
![[ ]](/icons/layout.gif) | 44443_Matthew Place ..> | 2026-02-17 08:07 | 72K | |
![[ ]](/icons/layout.gif) | 47233_Edward Lawson ..> | 2026-02-23 15:56 | 72K | |
![[ ]](/icons/layout.gif) | 51137_Lynn Cox - ORD..> | 2026-03-05 07:36 | 72K | |
![[ ]](/icons/layout.gif) | 57340_James Bolsolve..> | 2026-03-20 10:24 | 72K | |
![[ ]](/icons/layout.gif) | 37165_Simon Kirk - K..> | 2026-01-26 15:24 | 72K | |
![[ ]](/icons/layout.gif) | 55578_Mark Wilson - ..> | 2026-03-17 07:08 | 72K | |
![[ ]](/icons/layout.gif) | 69108_Blackhawk Secu..> | 2026-04-22 14:00 | 72K | |
![[ ]](/icons/layout.gif) | 34484_Cornel Pavel -..> | 2026-01-19 09:07 | 72K | |
![[ ]](/icons/layout.gif) | 61425_Blakemore Cons..> | 2026-03-31 13:34 | 72K | |
![[ ]](/icons/layout.gif) | 61430_Blakemore Cons..> | 2026-03-31 13:38 | 72K | |
![[ ]](/icons/layout.gif) | 64135_Matt Galway - ..> | 2026-04-09 13:42 | 72K | |
![[ ]](/icons/layout.gif) | 52028_Greg Jarka - J..> | 2026-03-06 11:53 | 72K | |
![[ ]](/icons/layout.gif) | 42778_Falcon Windows..> | 2026-02-11 14:32 | 72K | |
![[ ]](/icons/layout.gif) | 65110_Nikolaos Anton..> | 2026-04-13 11:37 | 72K | |
![[ ]](/icons/layout.gif) | 38223_Zdena Murgacov..> | 2026-01-29 09:11 | 72K | |
![[ ]](/icons/layout.gif) | 38225_Zdena Murgacov..> | 2026-01-29 09:14 | 72K | |
![[ ]](/icons/layout.gif) | 38233_Zdena Murgacov..> | 2026-01-29 09:28 | 72K | |
![[ ]](/icons/layout.gif) | 41003_Zdena Murgacov..> | 2026-02-05 13:55 | 72K | |
![[ ]](/icons/layout.gif) | 41007_Zdena Murgacov..> | 2026-02-05 13:58 | 72K | |
![[ ]](/icons/layout.gif) | 41013_Zdena Murgacov..> | 2026-02-05 14:03 | 72K | |
![[ ]](/icons/layout.gif) | 41046_Zdena Murgacov..> | 2026-02-05 14:38 | 72K | |
![[ ]](/icons/layout.gif) | 58252_Paul Austin - ..> | 2026-03-24 07:54 | 72K | |
![[ ]](/icons/layout.gif) | 59950_Ian Hutchison ..> | 2026-03-27 09:17 | 72K | |
![[ ]](/icons/layout.gif) | 35402_Toby McNally -..> | 2026-01-20 16:31 | 72K | |
![[ ]](/icons/layout.gif) | 39711_Derek Macdonal..> | 2026-02-03 09:43 | 72K | |
![[ ]](/icons/layout.gif) | 65909_Sam Matthew Po..> | 2026-04-15 06:24 | 72K | |
![[ ]](/icons/layout.gif) | 67391_Sam Pritcher -..> | 2026-04-17 14:55 | 72K | |
![[ ]](/icons/layout.gif) | 45941_Mark Haviland ..> | 2026-02-19 09:07 | 72K | |
![[ ]](/icons/layout.gif) | 45074_Calum Skinner ..> | 2026-02-17 16:06 | 72K | |
![[ ]](/icons/layout.gif) | 67320_Derek Marney -..> | 2026-04-17 13:27 | 72K | |
![[ ]](/icons/layout.gif) | 69374_Jonathan Wareh..> | 2026-04-23 09:08 | 72K | |
![[ ]](/icons/layout.gif) | 70131_Collin Pickeri..> | 2026-04-24 14:09 | 72K | |
![[ ]](/icons/layout.gif) | 42267_James Hall - S..> | 2026-02-10 12:29 | 72K | |
![[ ]](/icons/layout.gif) | 54033_Jim Davis Carp..> | 2026-03-12 08:49 | 72K | |
![[ ]](/icons/layout.gif) | 50697_Neil Bush - Ne..> | 2026-03-04 10:02 | 72K | |
![[ ]](/icons/layout.gif) | 68006_Neil Hanafin -..> | 2026-04-20 15:17 | 72K | |
![[ ]](/icons/layout.gif) | 37232_Alan Middledit..> | 2026-01-26 16:25 | 72K | |
![[ ]](/icons/layout.gif) | 50050_Kevin Witton -..> | 2026-03-03 08:39 | 72K | |
![[ ]](/icons/layout.gif) | 64042_Cameron Grant ..> | 2026-04-09 10:44 | 72K | |
![[ ]](/icons/layout.gif) | 36293_Will Brown - K..> | 2026-01-23 09:27 | 72K | |
![[ ]](/icons/layout.gif) | 51223_Mark Pinckney ..> | 2026-03-05 08:59 | 72K | |
![[ ]](/icons/layout.gif) | 48588_Gary Jones - P..> | 2026-02-26 13:46 | 72K | |
![[ ]](/icons/layout.gif) | 67414_John Walsh - R..> | 2026-04-17 15:47 | 72K | |
![[ ]](/icons/layout.gif) | 35121_Cornel Pavel -..> | 2026-01-20 11:30 | 72K | |
![[ ]](/icons/layout.gif) | 35987_Julie Wrigth -..> | 2026-01-22 10:49 | 72K | |
![[ ]](/icons/layout.gif) | 51656_georgina Dalby..> | 2026-03-05 16:09 | 72K | |
![[ ]](/icons/layout.gif) | 44025_Stephen Price ..> | 2026-02-16 10:52 | 72K | |
![[ ]](/icons/layout.gif) | 51784_Richard Smee -..> | 2026-03-06 08:29 | 72K | |
![[ ]](/icons/layout.gif) | 68052_Chris Ball - B..> | 2026-04-21 06:59 | 72K | |
![[ ]](/icons/layout.gif) | 49013_Carl Herring -..> | 2026-02-27 10:13 | 72K | |
![[ ]](/icons/layout.gif) | 33227_Sue Lincoln - ..> | 2026-01-14 13:21 | 72K | |
![[ ]](/icons/layout.gif) | 61953_Crawford Storr..> | 2026-04-01 13:39 | 72K | |
![[ ]](/icons/layout.gif) | 47181_Robert Rovetto..> | 2026-02-23 15:36 | 72K | |
![[ ]](/icons/layout.gif) | 52666_Go Eco Green P..> | 2026-03-09 13:38 | 72K | |
![[ ]](/icons/layout.gif) | 52671_Go Eco Green P..> | 2026-03-09 13:44 | 72K | |
![[ ]](/icons/layout.gif) | 34271_Micheal Joyce ..> | 2026-01-16 12:18 | 72K | |
![[ ]](/icons/layout.gif) | 38428_James Whyte - ..> | 2026-01-29 12:32 | 72K | |
![[ ]](/icons/layout.gif) | 60902_Mark Budden - ..> | 2026-03-30 16:06 | 72K | |
![[ ]](/icons/layout.gif) | 50825_William Pritch..> | 2026-03-04 11:38 | 72K | |
![[ ]](/icons/layout.gif) | 35582_CT Constructio..> | 2026-01-21 10:18 | 72K | |
![[ ]](/icons/layout.gif) | 68021_Stephen Elliso..> | 2026-04-20 15:42 | 72K | |
![[ ]](/icons/layout.gif) | 34435_Neil Robertson..> | 2026-01-19 07:57 | 72K | |
![[ ]](/icons/layout.gif) | 34825_Colin Macdonal..> | 2026-01-19 16:26 | 72K | |
![[ ]](/icons/layout.gif) | 47324_Sara Colton - ..> | 2026-02-23 16:22 | 72K | |
![[ ]](/icons/layout.gif) | 69428_Paul Shelton -..> | 2026-04-23 11:02 | 72K | |
![[ ]](/icons/layout.gif) | 34789_Thomas Felipe ..> | 2026-01-19 15:22 | 72K | |
![[ ]](/icons/layout.gif) | 47176_Allen Bogacki ..> | 2026-02-23 15:30 | 72K | |
![[ ]](/icons/layout.gif) | 58190_Nick Plumb - O..> | 2026-03-23 15:59 | 72K | |
![[ ]](/icons/layout.gif) | 34803_Ann Kiley - An..> | 2026-01-19 15:47 | 72K | |
![[ ]](/icons/layout.gif) | 49301_Michael Toon -..> | 2026-02-27 16:49 | 72K | |
![[ ]](/icons/layout.gif) | 68242_Ryan Varley - ..> | 2026-04-21 09:09 | 72K | |
![[ ]](/icons/layout.gif) | 34278_Nicole Richmon..> | 2026-01-16 13:25 | 72K | |
![[ ]](/icons/layout.gif) | 47210_Dominic Savage..> | 2026-02-23 15:44 | 72K | |
![[ ]](/icons/layout.gif) | 49980_Graham Matthew..> | 2026-03-02 16:45 | 72K | |
![[ ]](/icons/layout.gif) | 68002_Lewis Pearce -..> | 2026-04-20 15:15 | 72K | |
![[ ]](/icons/layout.gif) | 35095_Anthony Kirk -..> | 2026-01-20 11:15 | 72K | |
![[ ]](/icons/layout.gif) | 41324_David Pearson ..> | 2026-02-06 11:01 | 72K | |
![[ ]](/icons/layout.gif) | 36287_Andrew Marshal..> | 2026-01-23 09:15 | 72K | |
![[ ]](/icons/layout.gif) | 36532_John Payne - O..> | 2026-01-23 12:27 | 72K | |
![[ ]](/icons/layout.gif) | 51106_RC Site Servic..> | 2026-03-04 16:59 | 72K | |
![[ ]](/icons/layout.gif) | 38156_Jason Woodall ..> | 2026-01-29 07:14 | 72K | |
![[ ]](/icons/layout.gif) | 49991_Paul Mitchell ..> | 2026-03-02 16:52 | 72K | |
![[ ]](/icons/layout.gif) | 56301_John Payne - P..> | 2026-03-18 11:38 | 72K | |
![[ ]](/icons/layout.gif) | 51328_Sam Murrie - O..> | 2026-03-05 10:16 | 72K | |
![[ ]](/icons/layout.gif) | 59991_Neil Porteous ..> | 2026-03-27 10:04 | 72K | |
![[ ]](/icons/layout.gif) | 41382_Nathan Sudwort..> | 2026-02-06 13:08 | 72K | |
![[ ]](/icons/layout.gif) | 42787_Falcon Windows..> | 2026-02-11 14:50 | 72K | |
![[ ]](/icons/layout.gif) | 70119_Michael George..> | 2026-04-24 13:54 | 72K | |
![[ ]](/icons/layout.gif) | 39045_The Safety Sup..> | 2026-01-30 15:58 | 72K | |
![[ ]](/icons/layout.gif) | 57019_Paul Collins -..> | 2026-03-19 14:50 | 72K | |
![[ ]](/icons/layout.gif) | 63301_Keith White - ..> | 2026-04-08 07:06 | 72K | |
![[ ]](/icons/layout.gif) | 38195_Dave Barnett -..> | 2026-01-29 08:32 | 72K | |
![[ ]](/icons/layout.gif) | 51131_Kevin Hill - O..> | 2026-03-05 07:28 | 72K | |
![[ ]](/icons/layout.gif) | 68286_Paul Farrelly ..> | 2026-04-21 09:44 | 72K | |
![[ ]](/icons/layout.gif) | 68294_Paul Farrelly ..> | 2026-04-21 09:46 | 72K | |
![[ ]](/icons/layout.gif) | 65817_Jonathan Isaac..> | 2026-04-14 14:36 | 72K | |
![[ ]](/icons/layout.gif) | 68724_John Barker - ..> | 2026-04-21 15:09 | 72K | |
![[ ]](/icons/layout.gif) | 60889_Adam Reynolds ..> | 2026-03-30 15:57 | 72K | |
![[ ]](/icons/layout.gif) | 49437_Andrew Fox - O..> | 2026-03-02 09:14 | 72K | |
![[ ]](/icons/layout.gif) | 61641_Josh Glossop -..> | 2026-04-01 08:12 | 72K | |
![[ ]](/icons/layout.gif) | 51138_Lynn Cox - ORD..> | 2026-03-05 07:36 | 72K | |
![[ ]](/icons/layout.gif) | 35764_Jonathan Foste..> | 2026-01-21 13:33 | 72K | |
![[ ]](/icons/layout.gif) | 67144_Brian Wallace ..> | 2026-04-17 10:38 | 72K | |
![[ ]](/icons/layout.gif) | 57539_Derek Coward -..> | 2026-03-20 14:20 | 72K | |
![[ ]](/icons/layout.gif) | 33284_A Miles Buildi..> | 2026-01-14 14:02 | 72K | |
![[ ]](/icons/layout.gif) | 39035_Total Control ..> | 2026-01-30 15:48 | 72K | |
![[ ]](/icons/layout.gif) | 51224_Mark Pinckney ..> | 2026-03-05 09:00 | 72K | |
![[ ]](/icons/layout.gif) | 35878_Julian Hughes ..> | 2026-01-22 07:38 | 72K | |
![[ ]](/icons/layout.gif) | 33974_David Ellis - ..> | 2026-01-15 16:11 | 72K | |
![[ ]](/icons/layout.gif) | 68244_Ryan Varley - ..> | 2026-04-21 09:09 | 72K | |
![[ ]](/icons/layout.gif) | 38157_Jason Woodall ..> | 2026-01-29 07:14 | 72K | |
![[ ]](/icons/layout.gif) | 61987_MHS Ltd Stephe..> | 2026-04-01 14:01 | 72K | |
![[ ]](/icons/layout.gif) | 68298_Paul Farrelly ..> | 2026-04-21 09:47 | 72K | |
![[ ]](/icons/layout.gif) | 69258_ELS PESTANA LT..> | 2026-04-23 07:17 | 72K | |
![[ ]](/icons/layout.gif) | 42907_Chiltern Compl..> | 2026-02-12 08:54 | 72K | |
![[ ]](/icons/layout.gif) | 55077_Mark Robertson..> | 2026-03-16 07:54 | 73K | |
![[ ]](/icons/layout.gif) | 36100_Hubert Oginski..> | 2026-01-22 12:10 | 73K | |
![[ ]](/icons/layout.gif) | 45054_Isocount UK Lt..> | 2026-02-17 15:53 | 73K | |
![[ ]](/icons/layout.gif) | 62027_Abhinav Bandi ..> | 2026-04-01 15:57 | 73K | |
![[ ]](/icons/layout.gif) | 58729_Ben Cussons - ..> | 2026-03-24 15:06 | 73K | |
![[ ]](/icons/layout.gif) | 39139_Lewis Robinson..> | 2026-02-02 09:37 | 73K | |
![[ ]](/icons/layout.gif) | 33382_Julian Jarvis ..> | 2026-01-14 15:52 | 74K | |
![[ ]](/icons/layout.gif) | 58884_Gzim Sufa - RO..> | 2026-03-25 08:43 | 74K | |
![[ ]](/icons/layout.gif) | 35853_Ben Rye - RYEB..> | 2026-01-21 15:59 | 74K | |
![[ ]](/icons/layout.gif) | 53206_Richard Davies..> | 2026-03-10 12:16 | 74K | |
![[ ]](/icons/layout.gif) | 40721_Steve Wattridg..> | 2026-02-05 08:41 | 74K | |
![[ ]](/icons/layout.gif) | 56501_Gary Austin - ..> | 2026-03-18 14:31 | 74K | |
![[ ]](/icons/layout.gif) | 57941_James Parry - ..> | 2026-03-23 11:08 | 74K | |
![[ ]](/icons/layout.gif) | 42758_Nigel Cole - R..> | 2026-02-11 13:42 | 74K | |
![[ ]](/icons/layout.gif) | 58937_Gzim Sufa - RO..> | 2026-03-25 09:24 | 74K | |
![[ ]](/icons/layout.gif) | 51111_Mike Powles - ..> | 2026-03-04 17:06 | 74K | |
![[ ]](/icons/layout.gif) | 69980_Angus Raine - ..> | 2026-04-24 10:31 | 74K | |
![[ ]](/icons/layout.gif) | 34201_Lee Ingold - I..> | 2026-01-16 09:48 | 74K | |
![[ ]](/icons/layout.gif) | 47363_Jamie Hales - ..> | 2026-02-23 17:02 | 74K | |
![[ ]](/icons/layout.gif) | 65023_R Hood Builder..> | 2026-04-13 10:13 | 74K | |
![[ ]](/icons/layout.gif) | 56502_Gary Austin - ..> | 2026-03-18 14:31 | 74K | |
![[ ]](/icons/layout.gif) | 33900_Paul Brookes -..> | 2026-01-15 15:02 | 74K | |
![[ ]](/icons/layout.gif) | 63849_Martina Connor..> | 2026-04-09 07:37 | 74K | |
![[ ]](/icons/layout.gif) | 65344_R Hood Builder..> | 2026-04-14 07:41 | 74K | |
![[ ]](/icons/layout.gif) | 64153_Martina Connor..> | 2026-04-09 13:58 | 74K | |
![[TXT]](/icons/text.gif) | 65118_Michael Mazur ..> | 2026-04-13 12:00 | 74K | |
![[ ]](/icons/layout.gif) | 2787_[0,0] Steve Ben..> | 2025-10-07 14:27 | 76K | |
![[ ]](/icons/layout.gif) | 2793_[0,0] Steve Ben..> | 2025-10-07 14:45 | 76K | |
![[ ]](/icons/layout.gif) | 2946_[0,0] Steve Ben..> | 2025-10-08 09:14 | 76K | |
![[ ]](/icons/layout.gif) | 3334_[0,0] Dave Bran..> | 2025-10-09 08:35 | 76K | |
![[ ]](/icons/layout.gif) | 3603_[0,0] Matt Gilm..> | 2025-10-09 14:37 | 76K | |
![[ ]](/icons/layout.gif) | 3199_[0,0] Dean Bark..> | 2025-10-08 15:11 | 76K | |
![[ ]](/icons/layout.gif) | 3594_[0,0] Matt Gilm..> | 2025-10-09 14:14 | 76K | |
![[ ]](/icons/layout.gif) | 3554_[0,0] Andy Sedd..> | 2025-10-09 13:16 | 76K | |
![[ ]](/icons/layout.gif) | 3555_[0,0] Andy Sedd..> | 2025-10-09 13:16 | 76K | |
![[ ]](/icons/layout.gif) | 3598_[0,0] Matt Gilm..> | 2025-10-09 14:26 | 76K | |
![[ ]](/icons/layout.gif) | 1474_[0,0] Dean Bark..> | 2025-09-30 15:45 | 76K | |
![[ ]](/icons/layout.gif) | 3562_[0,0] Jason Wal..> | 2025-10-09 13:19 | 76K | |
![[ ]](/icons/layout.gif) | 3496_[0,0] Allan Ste..> | 2025-10-09 12:09 | 76K | |
![[ ]](/icons/layout.gif) | 3567_[0,0] Steve Ter..> | 2025-10-09 13:35 | 76K | |
![[ ]](/icons/layout.gif) | 3575_[0,0] Steve Ter..> | 2025-10-09 13:46 | 76K | |
![[ ]](/icons/layout.gif) | 3407_[0,0] Chelmsfo..> | 2025-10-09 09:55 | 76K | |
![[ ]](/icons/layout.gif) | 3471_[0,0] James Bow..> | 2025-10-09 11:57 | 76K | |
![[ ]](/icons/layout.gif) | 736_J Brady Garage D..> | 2025-09-24 11:46 | 76K | |
![[ ]](/icons/layout.gif) | 3548_[0,0] Lui Field..> | 2025-10-09 13:02 | 76K | |
![[ ]](/icons/layout.gif) | 3424_[0,0] Wayne Gil..> | 2025-10-09 10:24 | 76K | |
![[ ]](/icons/layout.gif) | 448_Protect Installa..> | 2025-09-22 20:15 | 76K | |
![[ ]](/icons/layout.gif) | 5735_[0,0] Lui Field..> | 2025-10-17 08:08 | 76K | |
![[ ]](/icons/layout.gif) | 5653_[0,0] Lui Field..> | 2025-10-16 15:51 | 76K | |
![[ ]](/icons/layout.gif) | 5739_[0,0] Lui Field..> | 2025-10-17 08:17 | 76K | |
![[ ]](/icons/layout.gif) | 7317_Aspect Maintena..> | 2025-10-23 10:54 | 76K | |
![[ ]](/icons/layout.gif) | 6376_All About Doors..> | 2025-10-20 16:02 | 76K | |
![[ ]](/icons/layout.gif) | 4245_Rollerdoors 24 ..> | 2025-10-13 12:37 | 76K | |
![[ ]](/icons/layout.gif) | 5652_[0,0] Lui Field..> | 2025-10-16 15:49 | 76K | |
![[ ]](/icons/layout.gif) | 3581_[0,0] Steve Ter..> | 2025-10-09 13:53 | 76K | |
![[ ]](/icons/layout.gif) | 8128_All About Doors..> | 2025-10-25 10:12 | 76K | |
![[ ]](/icons/layout.gif) | 3329_Doors 4 Garages..> | 2025-10-09 08:23 | 76K | |
![[ ]](/icons/layout.gif) | 13150_Zest Propertie..> | 2025-11-10 09:34 | 76K | |
![[ ]](/icons/layout.gif) | 6335_T D Rollerdoors..> | 2025-10-20 14:23 | 76K | |
![[ ]](/icons/layout.gif) | 13777_Replacement Ga..> | 2025-11-11 11:27 | 76K | |
![[ ]](/icons/layout.gif) | 447_WINDOW WIZE LTD ..> | 2025-09-22 19:46 | 76K | |
![[ ]](/icons/layout.gif) | 3550_East Anglia Rol..> | 2025-10-09 13:07 | 76K | |
![[ ]](/icons/layout.gif) | 3592_[0,0] Steve Ter..> | 2025-10-09 14:07 | 76K | |
![[ ]](/icons/layout.gif) | 456_Doors 4 You. Pau..> | 2025-09-22 22:09 | 76K | |
![[ ]](/icons/layout.gif) | 455_Doors 4 You. Pau..> | 2025-09-22 22:06 | 76K | |
![[ ]](/icons/layout.gif) | 7537_Aspect Maintena..> | 2025-10-23 13:24 | 76K | |
![[ ]](/icons/layout.gif) | 3434_Richard Stockbr..> | 2025-10-09 10:44 | 76K | |
![[ ]](/icons/layout.gif) | 3629_Richard Stockbr..> | 2025-10-09 15:22 | 76K | |
![[ ]](/icons/layout.gif) | 1459_AM Shutters Ste..> | 2025-09-30 14:59 | 76K | |
![[ ]](/icons/layout.gif) | 184_NW Automatic Doo..> | 2025-09-18 10:15 | 76K | |
![[ ]](/icons/layout.gif) | 450_C&M Glass Servic..> | 2025-09-22 21:02 | 76K | |
![[ ]](/icons/layout.gif) | 16730_Rollerdoors 24..> | 2025-11-18 14:34 | 76K | |
![[ ]](/icons/layout.gif) | 7566_Piper Window Sy..> | 2025-10-23 13:40 | 76K | |
![[ ]](/icons/layout.gif) | 3529_MJS Installatio..> | 2025-10-09 12:42 | 76K | |
![[ ]](/icons/layout.gif) | 16741_Rollerdoors 24..> | 2025-11-18 14:44 | 76K | |
![[ ]](/icons/layout.gif) | 7225_Roll Right Gara..> | 2025-10-23 08:56 | 76K | |
![[ ]](/icons/layout.gif) | 451_C&M Glass Servic..> | 2025-09-22 21:04 | 76K | |
![[ ]](/icons/layout.gif) | 12904_Garage Door An..> | 2025-11-07 16:49 | 76K | |
![[ ]](/icons/layout.gif) | 1654_[0,0] Dayil Ran..> | 2025-10-01 14:54 | 76K | |
![[ ]](/icons/layout.gif) | 1684_[0,0] Dayil Ran..> | 2025-10-01 16:06 | 76K | |
![[ ]](/icons/layout.gif) | 12614_Garage Door An..> | 2025-11-07 07:59 | 76K | |
![[ ]](/icons/layout.gif) | 17031_Oakley Windows..> | 2025-11-19 08:47 | 76K | |
![[ ]](/icons/layout.gif) | 452_Tru-Fit Windows ..> | 2025-09-22 21:09 | 76K | |
![[ ]](/icons/layout.gif) | 3617_MJS Installatio..> | 2025-10-09 15:01 | 76K | |
![[ ]](/icons/layout.gif) | 454_Ideal Home Solut..> | 2025-09-22 21:41 | 76K | |
![[ ]](/icons/layout.gif) | 2039_[0,0] Paul Birk..> | 2025-10-03 11:49 | 76K | |
![[ ]](/icons/layout.gif) | 2528_[0,0] Steve Ter..> | 2025-10-06 16:09 | 76K | |
![[ ]](/icons/layout.gif) | 148_[0,0] Jason Walk..> | 2025-09-17 16:06 | 76K | |
![[ ]](/icons/layout.gif) | 3183_Highlands Elect..> | 2025-10-08 14:16 | 77K | |
![[ ]](/icons/layout.gif) | 4899_[0,0] Andy Sedd..> | 2025-10-15 10:17 | 77K | |
![[ ]](/icons/layout.gif) | 4908_[0,0] Andy Sedd..> | 2025-10-15 10:38 | 77K | |
![[ ]](/icons/layout.gif) | 3613_Oakley Windows ..> | 2025-10-09 14:56 | 77K | |
![[ ]](/icons/layout.gif) | 8116_Jordan Shepphar..> | 2025-10-24 15:57 | 77K | |
![[ ]](/icons/layout.gif) | 6214_M Scott - Geoff..> | 2025-10-20 12:52 | 77K | |
![[ ]](/icons/layout.gif) | 3615_MJS Installatio..> | 2025-10-09 15:00 | 77K | |
![[ ]](/icons/layout.gif) | 3981_Rollermatic Gar..> | 2025-10-10 15:45 | 77K | |
![[ ]](/icons/layout.gif) | 5134_All Doors Repai..> | 2025-10-15 15:46 | 77K | |
![[ ]](/icons/layout.gif) | 8087_AM Shutters Ste..> | 2025-10-24 14:33 | 77K | |
![[ ]](/icons/layout.gif) | 453_Harpers Door Spe..> | 2025-09-22 21:35 | 77K | |
![[ ]](/icons/layout.gif) | 5450_Proud 2 Fix Mat..> | 2025-10-16 13:12 | 77K | |
![[ ]](/icons/layout.gif) | 1243_[0,0] Ranie Day..> | 2025-09-29 12:40 | 77K | |
![[ ]](/icons/layout.gif) | 2806_[0,0] Peter Bot..> | 2025-10-07 14:55 | 77K | |
![[ ]](/icons/layout.gif) | 12885_Fortress Doors..> | 2025-11-07 15:53 | 77K | |
![[ ]](/icons/layout.gif) | 745_Jan - JAN00001 -..> | 2025-09-24 12:11 | 77K | |
![[ ]](/icons/layout.gif) | 11903_Greg Bearsley ..> | 2025-11-05 12:37 | 77K | |
![[ ]](/icons/layout.gif) | 8115_James Dean - DE..> | 2025-10-24 15:56 | 77K | |
![[ ]](/icons/layout.gif) | 3834_[0,0] Dave Bran..> | 2025-10-10 11:52 | 77K | |
![[ ]](/icons/layout.gif) | 10385_Fortress Doors..> | 2025-10-31 14:14 | 77K | |
![[ ]](/icons/layout.gif) | 4220_[0,0] Andy Sedd..> | 2025-10-13 11:46 | 77K | |
![[ ]](/icons/layout.gif) | 2129_[0,0] Peter Bot..> | 2025-10-03 13:09 | 77K | |
![[ ]](/icons/layout.gif) | 8396_James King - DE..> | 2025-10-27 12:36 | 77K | |
![[ ]](/icons/layout.gif) | 8119_James Dean - DE..> | 2025-10-24 15:59 | 77K | |
![[ ]](/icons/layout.gif) | 9488_PB Doors Paul B..> | 2025-10-29 15:37 | 77K | |
![[ ]](/icons/layout.gif) | 1465_[0,0] Steve Ter..> | 2025-09-30 15:14 | 77K | |
![[ ]](/icons/layout.gif) | 1632_[0,0] ASSW Ltd..> | 2025-10-01 14:14 | 77K | |
![[ ]](/icons/layout.gif) | 2173_[0,0] Mike Brow..> | 2025-10-03 14:33 | 77K | |
![[ ]](/icons/layout.gif) | 12691_Rollermatic Ga..> | 2025-11-07 09:25 | 77K | |
![[ ]](/icons/layout.gif) | 15422_Proud2fix Matt..> | 2025-11-14 11:29 | 77K | |
![[ ]](/icons/layout.gif) | 17093_John McCaw - M..> | 2025-11-19 09:57 | 77K | |
![[ ]](/icons/layout.gif) | 5670_Go Garage Doors..> | 2025-10-16 16:16 | 77K | |
![[ ]](/icons/layout.gif) | 4234_Garage Doors No..> | 2025-10-13 12:27 | 77K | |
![[ ]](/icons/layout.gif) | 5753_Ace Garage Door..> | 2025-10-17 08:48 | 77K | |
![[ ]](/icons/layout.gif) | 6316_Shutter Tech UK..> | 2025-10-20 14:14 | 77K | |
![[ ]](/icons/layout.gif) | 1244_[0,0] Ranie Day..> | 2025-09-29 12:43 | 77K | |
![[ ]](/icons/layout.gif) | 6372_R L Roller Door..> | 2025-10-20 15:46 | 77K | |
![[ ]](/icons/layout.gif) | 3969_Chris Pearce - ..> | 2025-10-10 14:34 | 77K | |
![[ ]](/icons/layout.gif) | 3221_[0,0] Mike Brow..> | 2025-10-08 15:40 | 77K | |
![[ ]](/icons/layout.gif) | 6225_M Scott - Glenn..> | 2025-10-20 12:56 | 77K | |
![[ ]](/icons/layout.gif) | 8106_M Scott - Glenn..> | 2025-10-24 15:07 | 77K | |
![[ ]](/icons/layout.gif) | 9704_M Scott - Glenn..> | 2025-10-30 10:32 | 77K | |
![[ ]](/icons/layout.gif) | 2133_[0,0] Peter Bot..> | 2025-10-03 13:18 | 77K | |
![[ ]](/icons/layout.gif) | 7235_Fortress Doors ..> | 2025-10-23 09:36 | 77K | |
![[ ]](/icons/layout.gif) | 9489_Mac Automation ..> | 2025-10-29 15:38 | 77K | |
![[ ]](/icons/layout.gif) | 15866_AM Shutters M..> | 2025-11-17 09:36 | 77K | |
![[ ]](/icons/layout.gif) | 6025_Michael Mazur M..> | 2025-10-20 07:31 | 77K | |
![[ ]](/icons/layout.gif) | 4921_Ecosse Garage D..> | 2025-10-15 11:19 | 77K | |
![[ ]](/icons/layout.gif) | 1629_[0,0] Andy Sedd..> | 2025-10-01 14:08 | 77K | |
![[ ]](/icons/layout.gif) | 5778_Ace Garage Door..> | 2025-10-17 09:50 | 77K | |
![[ ]](/icons/layout.gif) | 1624_[0,0] Andy Sedd..> | 2025-10-01 13:57 | 77K | |
![[ ]](/icons/layout.gif) | 2735_[0,0] James Wal..> | 2025-10-07 12:21 | 77K | |
![[ ]](/icons/layout.gif) | 4119_[0,0] Andy Sedd..> | 2025-10-13 09:57 | 77K | |
![[ ]](/icons/layout.gif) | 11979_Chiltern Doors..> | 2025-11-05 13:46 | 77K | |
![[ ]](/icons/layout.gif) | 1318_[0,0] Richard H..> | 2025-09-29 15:15 | 77K | |
![[ ]](/icons/layout.gif) | 8394_Fortress Doors ..> | 2025-10-27 12:25 | 77K | |
![[ ]](/icons/layout.gif) | 16013_Glen McNulty -..> | 2025-11-17 12:00 | 77K | |
![[ ]](/icons/layout.gif) | 42_Clifford Lowdell ..> | 2025-09-11 09:45 | 77K | |
![[ ]](/icons/layout.gif) | 2925_Prime Shutters ..> | 2025-10-08 08:47 | 77K | |
![[ ]](/icons/layout.gif) | 3156_1st Shield Darr..> | 2025-10-08 13:34 | 77K | |
![[ ]](/icons/layout.gif) | 3458_M.Adams Martin ..> | 2025-10-09 11:18 | 77K | |
![[ ]](/icons/layout.gif) | 1617_AM Shutters Ste..> | 2025-10-01 13:50 | 77K | |
![[ ]](/icons/layout.gif) | 6207_M Scott - Tom +..> | 2025-10-20 12:48 | 77K | |
![[ ]](/icons/layout.gif) | 1254_UK Rollerdoors ..> | 2025-09-29 13:01 | 77K | |
![[ ]](/icons/layout.gif) | 8542_C&M Glass Servi..> | 2025-10-27 14:33 | 77K | |
![[ ]](/icons/layout.gif) | 10431_Wanstall Ltd. ..> | 2025-10-31 16:45 | 77K | |
![[ ]](/icons/layout.gif) | 6243_1st Shield Darr..> | 2025-10-20 13:15 | 77K | |
![[ ]](/icons/layout.gif) | 121_1st Shield Darre..> | 2025-09-17 14:33 | 77K | |
![[ ]](/icons/layout.gif) | 146_1st Shield Darre..> | 2025-09-17 15:47 | 77K | |
![[ ]](/icons/layout.gif) | 11663_Replacement Ga..> | 2025-11-05 09:49 | 77K | |
![[ ]](/icons/layout.gif) | 1271_[0,0] AJ Trade..> | 2025-09-29 13:32 | 77K | |
![[ ]](/icons/layout.gif) | 1607_UK Rollerdoors ..> | 2025-10-01 13:26 | 77K | |
![[ ]](/icons/layout.gif) | 117_1st Shield Darre..> | 2025-09-17 14:28 | 77K | |
![[ ]](/icons/layout.gif) | 485_AM Shutters Mot..> | 2025-09-23 07:48 | 77K | |
![[ ]](/icons/layout.gif) | 16012_Glen McNulty -..> | 2025-11-17 11:58 | 77K | |
![[ ]](/icons/layout.gif) | 18334_EcoGlaze Group..> | 2025-11-22 09:57 | 77K | |
![[ ]](/icons/layout.gif) | 1339_[0,0] Rob Smith..> | 2025-09-30 06:41 | 77K | |
![[ ]](/icons/layout.gif) | 2748_Michael Mazur ..> | 2025-10-07 12:52 | 77K | |
![[ ]](/icons/layout.gif) | 6292_Shutter Tech UK..> | 2025-10-20 13:49 | 77K | |
![[ ]](/icons/layout.gif) | 10855_Phil Page Phil..> | 2025-11-03 13:45 | 77K | |
![[ ]](/icons/layout.gif) | 16076_Chiltern Doors..> | 2025-11-17 13:37 | 77K | |
![[ ]](/icons/layout.gif) | 2130_[0,0] S Terry -..> | 2025-10-03 13:10 | 77K | |
![[ ]](/icons/layout.gif) | 2813_[0,0] Craig Mar..> | 2025-10-07 15:01 | 77K | |
![[ ]](/icons/layout.gif) | 3079_Prime Shutters ..> | 2025-10-08 11:24 | 77K | |
![[ ]](/icons/layout.gif) | 2704_[0,0] Will Purs..> | 2025-10-07 11:03 | 77K | |
![[ ]](/icons/layout.gif) | 2947_[0,0] Nicola Ha..> | 2025-10-08 09:24 | 77K | |
![[ ]](/icons/layout.gif) | 8397_Pete McKeown In..> | 2025-10-27 12:42 | 77K | |
![[ ]](/icons/layout.gif) | 5669_Go Garage Doors..> | 2025-10-16 16:10 | 77K | |
![[ ]](/icons/layout.gif) | 18090_Entador System..> | 2025-11-21 11:04 | 77K | |
![[ ]](/icons/layout.gif) | 2530_[0,0] Steve Ter..> | 2025-10-06 16:24 | 77K | |
![[ ]](/icons/layout.gif) | 863_[0,0] Steve Bobb..> | 2025-09-25 11:22 | 77K | |
![[ ]](/icons/layout.gif) | 4069_[0,0] Nicola Ha..> | 2025-10-13 08:40 | 77K | |
![[ ]](/icons/layout.gif) | 684_CRS Maintenance ..> | 2025-09-24 08:47 | 77K | |
![[ ]](/icons/layout.gif) | 2768_Nick Garlick - ..> | 2025-10-07 13:20 | 77K | |
![[ ]](/icons/layout.gif) | 3565_[0,0] Nicola Ha..> | 2025-10-09 13:30 | 77K | |
![[ ]](/icons/layout.gif) | 3978_[0,0] Beasley ..> | 2025-10-10 15:14 | 77K | |
![[ ]](/icons/layout.gif) | 924_AM Shutters Stev..> | 2025-09-25 14:51 | 77K | |
![[ ]](/icons/layout.gif) | 8260_1st Shield Darr..> | 2025-10-27 11:06 | 77K | |
![[ ]](/icons/layout.gif) | 13391_Barker - Marty..> | 2025-11-10 14:41 | 77K | |
![[ ]](/icons/layout.gif) | 2533_[0,0] S Terry -..> | 2025-10-06 16:26 | 77K | |
![[ ]](/icons/layout.gif) | 2766_Custom Trade Sy..> | 2025-10-07 13:16 | 77K | |
![[ ]](/icons/layout.gif) | 3185_[0,0] S Terry -..> | 2025-10-08 14:24 | 77K | |
![[ ]](/icons/layout.gif) | 10888_Ross Garage Do..> | 2025-11-03 14:24 | 77K | |
![[ ]](/icons/layout.gif) | 11513_WADE WINDOWS I..> | 2025-11-04 16:33 | 77K | |
![[ ]](/icons/layout.gif) | 14691_Gavin Morton -..> | 2025-11-12 15:37 | 77K | |
![[ ]](/icons/layout.gif) | 2184_[0,0] Wayne Gil..> | 2025-10-03 14:50 | 77K | |
![[ ]](/icons/layout.gif) | 2682_PB Doors Paul B..> | 2025-10-07 10:09 | 77K | |
![[ ]](/icons/layout.gif) | 3974_[0,0] Beasley ..> | 2025-10-10 14:55 | 77K | |
![[ ]](/icons/layout.gif) | 3433_[0,0] Wayne Gil..> | 2025-10-09 10:40 | 77K | |
![[ ]](/icons/layout.gif) | 4143_[0,0] Beasley ..> | 2025-10-13 10:32 | 77K | |
![[ ]](/icons/layout.gif) | 6767_Dream Installat..> | 2025-10-22 08:15 | 77K | |
![[ ]](/icons/layout.gif) | 6894_Garage Door And..> | 2025-10-22 10:45 | 77K | |
![[ ]](/icons/layout.gif) | 3968_Fresh Frames Ry..> | 2025-10-10 14:24 | 77K | |
![[ ]](/icons/layout.gif) | 624_Doors 4 Garages ..> | 2025-09-23 16:07 | 77K | |
![[ ]](/icons/layout.gif) | 741_ASM Windows Adam..> | 2025-09-24 11:59 | 77K | |
![[ ]](/icons/layout.gif) | 803_Doors 4 Garages ..> | 2025-09-24 15:58 | 77K | |
![[ ]](/icons/layout.gif) | 908_JM Doors Jon Bun..> | 2025-09-25 14:36 | 77K | |
![[ ]](/icons/layout.gif) | 1164_ASM Windows Ada..> | 2025-09-29 08:04 | 77K | |
![[ ]](/icons/layout.gif) | 1272_Aj Trade Aj Tr..> | 2025-09-29 13:38 | 77K | |
![[ ]](/icons/layout.gif) | 2539_[0,0] S Terry -..> | 2025-10-06 16:28 | 77K | |
![[ ]](/icons/layout.gif) | 3130_[0,0] S Terry -..> | 2025-10-08 12:58 | 77K | |
![[ ]](/icons/layout.gif) | 7095_[0,0] Derek Lar..> | 2025-10-22 14:24 | 77K | |
![[ ]](/icons/layout.gif) | 1588_[0,0] Rob Smith..> | 2025-10-01 12:00 | 77K | |
![[ ]](/icons/layout.gif) | 2531_[0,0] S Terry -..> | 2025-10-06 16:25 | 77K | |
![[ ]](/icons/layout.gif) | 5124_Ross Garage Doo..> | 2025-10-15 15:41 | 77K | |
![[ ]](/icons/layout.gif) | 6839_RS Doors Rob Sm..> | 2025-10-22 09:50 | 77K | |
![[ ]](/icons/layout.gif) | 9365_Elevate Doors L..> | 2025-10-29 13:11 | 77K | |
![[ ]](/icons/layout.gif) | 17187_Entador System..> | 2025-11-19 11:44 | 77K | |
![[ ]](/icons/layout.gif) | 783_Oakley Windows L..> | 2025-09-24 15:12 | 77K | |
![[ ]](/icons/layout.gif) | 1458_[0,0] D B Reno..> | 2025-09-30 14:57 | 77K | |
![[ ]](/icons/layout.gif) | 1534_[0,0] D B Reno..> | 2025-10-01 08:26 | 77K | |
![[ ]](/icons/layout.gif) | 1538_[0,0] D B Reno..> | 2025-10-01 08:27 | 77K | |
![[ ]](/icons/layout.gif) | 4048_Ian Sanderson E..> | 2025-10-13 08:09 | 77K | |
![[ ]](/icons/layout.gif) | 6280_M Scott - Geoff..> | 2025-10-20 13:44 | 77K | |
![[ ]](/icons/layout.gif) | 97_Doors 4 Garages L..> | 2025-09-17 09:06 | 77K | |
![[ ]](/icons/layout.gif) | 212_Avon Automated G..> | 2025-09-18 15:45 | 77K | |
![[ ]](/icons/layout.gif) | 1199_1st Shield Darr..> | 2025-09-29 09:37 | 77K | |
![[ ]](/icons/layout.gif) | 2501_[0,0] John Fowl..> | 2025-10-06 14:56 | 77K | |
![[ ]](/icons/layout.gif) | 4885_[0,0] Steve Ter..> | 2025-10-15 09:49 | 77K | |
![[ ]](/icons/layout.gif) | 6423_Phil Page Phil ..> | 2025-10-21 08:51 | 77K | |
![[ ]](/icons/layout.gif) | 9328_TH Installation..> | 2025-10-29 11:32 | 77K | |
![[ ]](/icons/layout.gif) | 13987_Shutter Tech U..> | 2025-11-11 14:32 | 77K | |
![[ ]](/icons/layout.gif) | 82_[0,0] Jason Peaco..> | 2025-09-17 08:06 | 77K | |
![[ ]](/icons/layout.gif) | 3132_[0,0] Nicola Ha..> | 2025-10-08 12:59 | 77K | |
![[ ]](/icons/layout.gif) | 6742_Mark Perham Mar..> | 2025-10-22 07:47 | 77K | |
![[ ]](/icons/layout.gif) | 11521_Guy Hubbard Do..> | 2025-11-05 08:04 | 77K | |
![[ ]](/icons/layout.gif) | 248_Regal Windows Lu..> | 2025-09-19 08:32 | 77K | |
![[ ]](/icons/layout.gif) | 1379_Oakley Windows ..> | 2025-09-30 10:13 | 77K | |
![[ ]](/icons/layout.gif) | 3260_Nick Garlick - ..> | 2025-10-08 18:43 | 77K | |
![[ ]](/icons/layout.gif) | 6845_T D Rollerdoors..> | 2025-10-22 09:52 | 77K | |
![[ ]](/icons/layout.gif) | 11060_Glen McNulty -..> | 2025-11-04 07:48 | 77K | |
![[ ]](/icons/layout.gif) | 458_Lidget Compton L..> | 2025-09-23 06:59 | 77K | |
![[ ]](/icons/layout.gif) | 2185_[0,0] Thompson..> | 2025-10-03 14:57 | 77K | |
![[ ]](/icons/layout.gif) | 14386_Glenhurst Door..> | 2025-11-12 10:29 | 77K | |
![[ ]](/icons/layout.gif) | 1569_ASSW Ltd ASSW ..> | 2025-10-01 09:57 | 77K | |
![[ ]](/icons/layout.gif) | 2534_[0,0] S Terry -..> | 2025-10-06 16:27 | 77K | |
![[ ]](/icons/layout.gif) | 2736_[0,0] Wayne Gil..> | 2025-10-07 12:28 | 77K | |
![[ ]](/icons/layout.gif) | 3143_[0,0] S Terry -..> | 2025-10-08 13:07 | 77K | |
![[ ]](/icons/layout.gif) | 3833_PB Doors Paul B..> | 2025-10-10 11:38 | 77K | |
![[ ]](/icons/layout.gif) | 925_JM Doors Jon Bun..> | 2025-09-25 14:52 | 77K | |
![[ ]](/icons/layout.gif) | 2719_[0,0] Future Ke..> | 2025-10-07 11:53 | 77K | |
![[ ]](/icons/layout.gif) | 2720_[0,0] Future Ke..> | 2025-10-07 11:56 | 77K | |
![[ ]](/icons/layout.gif) | 4186_[0,0] Avon Aut..> | 2025-10-13 11:15 | 77K | |
![[ ]](/icons/layout.gif) | 6141_Mark Perham Mar..> | 2025-10-20 10:49 | 77K | |
![[ ]](/icons/layout.gif) | 6197_M Scott - Pete ..> | 2025-10-20 12:43 | 77K | |
![[ ]](/icons/layout.gif) | 6831_Oakley Homes C..> | 2025-10-22 09:26 | 77K | |
![[ ]](/icons/layout.gif) | 18519_Ace Garage Doo..> | 2025-11-24 10:12 | 77K | |
![[ ]](/icons/layout.gif) | 10454_Fortress Doors..> | 2025-11-03 08:24 | 77K | |
![[ ]](/icons/layout.gif) | 2017_[0,0] S Terry -..> | 2025-10-03 11:26 | 77K | |
![[ ]](/icons/layout.gif) | 4229_Garage Doors No..> | 2025-10-13 12:16 | 77K | |
![[ ]](/icons/layout.gif) | 8291_My Garage Door ..> | 2025-10-27 11:26 | 77K | |
![[ ]](/icons/layout.gif) | 2035_[0,0] Marjan Ma..> | 2025-10-03 11:46 | 77K | |
![[ ]](/icons/layout.gif) | 6393_Mark Perham Mar..> | 2025-10-21 07:49 | 77K | |
![[ ]](/icons/layout.gif) | 6590_Glenhurst Doors..> | 2025-10-21 13:40 | 77K | |
![[ ]](/icons/layout.gif) | 16382_Mac Automation..> | 2025-11-18 09:09 | 77K | |
![[ ]](/icons/layout.gif) | 622_Doors 4 Garages ..> | 2025-09-23 16:04 | 77K | |
![[ ]](/icons/layout.gif) | 802_Doors 4 Garages ..> | 2025-09-24 15:58 | 77K | |
![[ ]](/icons/layout.gif) | 2838_Matt Smith - Jo..> | 2025-10-07 15:55 | 77K | |
![[ ]](/icons/layout.gif) | 4187_[0,0] Avon Aut..> | 2025-10-13 11:17 | 77K | |
![[ ]](/icons/layout.gif) | 5701_Oakley Windows ..> | 2025-10-17 07:05 | 77K | |
![[ ]](/icons/layout.gif) | 16128_Reklaw WF11 0F..> | 2025-11-17 14:59 | 77K | |
![[ ]](/icons/layout.gif) | 17205_NTRAP NR11 7NZ..> | 2025-11-19 11:54 | 77K | |
![[ ]](/icons/layout.gif) | 1661_C&M Glass Servi..> | 2025-10-01 15:10 | 77K | |
![[ ]](/icons/layout.gif) | 312_Doorolla S Terry..> | 2025-09-19 13:27 | 77K | |
![[ ]](/icons/layout.gif) | 6010_AMP Carpentry A..> | 2025-10-17 15:52 | 77K | |
![[ ]](/icons/layout.gif) | 6914_AMP Carpentry A..> | 2025-10-22 11:22 | 77K | |
![[ ]](/icons/layout.gif) | 7237_AMP Carpentry A..> | 2025-10-23 09:44 | 77K | |
![[ ]](/icons/layout.gif) | 11536_EZ2OWN Ltd Pau..> | 2025-11-05 08:25 | 77K | |
![[ ]](/icons/layout.gif) | 16048_Reklaw WF11 0F..> | 2025-11-17 13:15 | 77K | |
![[ ]](/icons/layout.gif) | 916_JM Doors Jon Bun..> | 2025-09-25 14:42 | 77K | |
![[ ]](/icons/layout.gif) | 982_[0,0] Steve Bobb..> | 2025-09-26 08:43 | 77K | |
![[ ]](/icons/layout.gif) | 2788_Matt Smith - Jo..> | 2025-10-07 14:35 | 77K | |
![[ ]](/icons/layout.gif) | 5903_Alps Home Impro..> | 2025-10-17 12:41 | 77K | |
![[ ]](/icons/layout.gif) | 8174_Ace Garage Door..> | 2025-10-27 08:39 | 77K | |
![[ ]](/icons/layout.gif) | 1352_[0,0] Beasley ..> | 2025-09-30 07:47 | 77K | |
![[ ]](/icons/layout.gif) | 3591_Warsash Windows..> | 2025-10-09 14:05 | 77K | |
![[ ]](/icons/layout.gif) | 6606_NTRAP NR11 7NZ ..> | 2025-10-21 14:21 | 77K | |
![[ ]](/icons/layout.gif) | 13228_Doors 4 You Lt..> | 2025-11-10 11:14 | 77K | |
![[ ]](/icons/layout.gif) | 17828_Garage Door Se..> | 2025-11-21 07:19 | 77K | |
![[ ]](/icons/layout.gif) | 621_Wanstall Ltd. De..> | 2025-09-23 16:00 | 77K | |
![[ ]](/icons/layout.gif) | 757_Regal Windows Lu..> | 2025-09-24 13:03 | 77K | |
![[ ]](/icons/layout.gif) | 9931_All Door Engine..> | 2025-10-30 15:32 | 77K | |
![[ ]](/icons/layout.gif) | 619_Wanstall Ltd. De..> | 2025-09-23 15:53 | 77K | |
![[ ]](/icons/layout.gif) | 1389_[0,0] Dean Bark..> | 2025-09-30 10:36 | 77K | |
![[ ]](/icons/layout.gif) | 2540_[0,0] S Terry -..> | 2025-10-06 16:28 | 77K | |
![[ ]](/icons/layout.gif) | 3075_[0,0] S Terry -..> | 2025-10-08 11:08 | 77K | |
![[ ]](/icons/layout.gif) | 11477_Rhino Windows ..> | 2025-11-04 15:29 | 77K | |
![[ ]](/icons/layout.gif) | 80_Harpers Door Spec..> | 2025-09-17 07:47 | 77K | |
![[ ]](/icons/layout.gif) | 1442_[0,0] Dean Bark..> | 2025-09-30 14:18 | 77K | |
![[ ]](/icons/layout.gif) | 3277_[0,0] Nicola Ha..> | 2025-10-09 06:56 | 77K | |
![[ ]](/icons/layout.gif) | 12023_G B Installati..> | 2025-11-05 15:06 | 77K | |
![[ ]](/icons/layout.gif) | 247_Regal Windows Lu..> | 2025-09-19 08:25 | 77K | |
![[ ]](/icons/layout.gif) | 1020_JD Cars Ltd Jer..> | 2025-09-26 11:11 | 77K | |
![[ ]](/icons/layout.gif) | 12908_Shutter Tech U..> | 2025-11-07 16:58 | 77K | |
![[ ]](/icons/layout.gif) | 1596_AM Shutters Ste..> | 2025-10-01 12:38 | 77K | |
![[ ]](/icons/layout.gif) | 2504_[0,0] Michael L..> | 2025-10-06 15:30 | 77K | |
![[ ]](/icons/layout.gif) | 13765_Hanney Glazed ..> | 2025-11-11 11:08 | 77K | |
![[ ]](/icons/layout.gif) | 17206_NTRAP NR11 7NZ..> | 2025-11-19 11:59 | 77K | |
![[ ]](/icons/layout.gif) | 752_Chargepoint Inst..> | 2025-09-24 12:43 | 77K | |
![[ ]](/icons/layout.gif) | 1120_[0,0] Martin Ch..> | 2025-09-29 06:44 | 77K | |
![[ ]](/icons/layout.gif) | 12562_Eastern Frames..> | 2025-11-06 16:23 | 77K | |
![[ ]](/icons/layout.gif) | 18292_TCR Sussex Ltd..> | 2025-11-21 15:53 | 77K | |
![[ ]](/icons/layout.gif) | 81_J Brady Garage Do..> | 2025-09-17 07:58 | 77K | |
![[ ]](/icons/layout.gif) | 149_[0,0] Jason Walk..> | 2025-09-17 16:10 | 77K | |
![[ ]](/icons/layout.gif) | 1383_Dream Installat..> | 2025-09-30 10:21 | 77K | |
![[ ]](/icons/layout.gif) | 5706_G B Installatio..> | 2025-10-17 07:29 | 77K | |
![[ ]](/icons/layout.gif) | 9356_C Marl Systems ..> | 2025-10-29 12:40 | 77K | |
![[ ]](/icons/layout.gif) | 10054_WADE WINDOWS I..> | 2025-10-31 08:37 | 77K | |
![[ ]](/icons/layout.gif) | 11654_Replacement Ga..> | 2025-11-05 09:39 | 77K | |
![[ ]](/icons/layout.gif) | 207_3 Counties (Sand..> | 2025-09-18 14:40 | 77K | |
![[ ]](/icons/layout.gif) | 732_JP Hills James H..> | 2025-09-24 11:22 | 77K | |
![[ ]](/icons/layout.gif) | 743_JP Hills James H..> | 2025-09-24 12:05 | 77K | |
![[ ]](/icons/layout.gif) | 1237_NBC Commercial ..> | 2025-09-29 12:09 | 77K | |
![[ ]](/icons/layout.gif) | 1487_NBC Commercial ..> | 2025-09-30 20:09 | 77K | |
![[ ]](/icons/layout.gif) | 2132_[0,0] Steve Ter..> | 2025-10-03 13:13 | 77K | |
![[ ]](/icons/layout.gif) | 8112_RP Manufacturin..> | 2025-10-24 15:44 | 77K | |
![[ ]](/icons/layout.gif) | 8137_BRISTOL GARAGE ..> | 2025-10-25 11:02 | 77K | |
![[ ]](/icons/layout.gif) | 12905_Oakley Windows..> | 2025-11-07 16:50 | 77K | |
![[ ]](/icons/layout.gif) | 109_Norfolk Roller D..> | 2025-09-17 12:23 | 77K | |
![[ ]](/icons/layout.gif) | 620_Harpers Door Spe..> | 2025-09-23 15:55 | 77K | |
![[ ]](/icons/layout.gif) | 942_Scotia Garage Do..> | 2025-09-25 15:44 | 77K | |
![[ ]](/icons/layout.gif) | 1082_NBC Commercial ..> | 2025-09-26 13:49 | 77K | |
![[ ]](/icons/layout.gif) | 5215_Simon Piggin Si..> | 2025-10-16 08:17 | 77K | |
![[ ]](/icons/layout.gif) | 9722_Chiltern Doors ..> | 2025-10-30 10:49 | 77K | |
![[ ]](/icons/layout.gif) | 10657_3 Brothers Bui..> | 2025-11-03 10:39 | 77K | |
![[ ]](/icons/layout.gif) | 16446_Fortress Doors..> | 2025-11-18 09:49 | 77K | |
![[ ]](/icons/layout.gif) | 17019_Doorolla Ltd S..> | 2025-11-19 08:31 | 77K | |
![[ ]](/icons/layout.gif) | 17486_Harry Curtis -..> | 2025-11-20 09:52 | 77K | |
![[ ]](/icons/layout.gif) | 462_Doors 4 You. Pau..> | 2025-09-23 07:10 | 77K | |
![[ ]](/icons/layout.gif) | 1278_[0,0] Wayne Gil..> | 2025-09-29 13:51 | 77K | |
![[ ]](/icons/layout.gif) | 6830_Eastern Frames ..> | 2025-10-22 09:20 | 77K | |
![[ ]](/icons/layout.gif) | 5083_Doorolla Ltd St..> | 2025-10-15 15:09 | 77K | |
![[ ]](/icons/layout.gif) | 12935_Eclipse Doors ..> | 2025-11-08 15:30 | 77K | |
![[ ]](/icons/layout.gif) | 263_Optimum Doors Vl..> | 2025-09-19 09:33 | 77K | |
![[ ]](/icons/layout.gif) | 275_Optimum Doors Vl..> | 2025-09-19 10:36 | 77K | |
![[ ]](/icons/layout.gif) | 687_Ross Garage Door..> | 2025-09-24 08:59 | 77K | |
![[ ]](/icons/layout.gif) | 1026_JD Cars Ltd Jer..> | 2025-09-26 11:19 | 77K | |
![[ ]](/icons/layout.gif) | 3342_[0,0] Victoria ..> | 2025-10-09 08:48 | 77K | |
![[ ]](/icons/layout.gif) | 3835_[0,0] Wayne Gil..> | 2025-10-10 12:00 | 77K | |
![[ ]](/icons/layout.gif) | 972_CRS Maintenance ..> | 2025-09-26 08:30 | 77K | |
![[ ]](/icons/layout.gif) | 1441_[0,0] Beasley ..> | 2025-09-30 14:16 | 77K | |
![[ ]](/icons/layout.gif) | 8719_Regal Windows P..> | 2025-10-28 08:34 | 77K | |
![[ ]](/icons/layout.gif) | 9133_Regal Windows P..> | 2025-10-29 08:04 | 77K | |
![[ ]](/icons/layout.gif) | 484_Eclipse Doors Di..> | 2025-09-23 07:44 | 77K | |
![[ ]](/icons/layout.gif) | 685_Ross Garage Door..> | 2025-09-24 08:51 | 77K | |
![[ ]](/icons/layout.gif) | 1230_Ross Garage Doo..> | 2025-09-29 11:30 | 77K | |
![[ ]](/icons/layout.gif) | 460_Doors 4 You. Pau..> | 2025-09-23 07:07 | 77K | |
![[ ]](/icons/layout.gif) | 813_P & R Door Syste..> | 2025-09-25 07:35 | 77K | |
![[ ]](/icons/layout.gif) | 1315_[0,0] James Tur..> | 2025-09-29 15:09 | 77K | |
![[ ]](/icons/layout.gif) | 8432_Secure Entrance..> | 2025-10-27 13:18 | 77K | |
![[ ]](/icons/layout.gif) | 16073_Chiltern Doors..> | 2025-11-17 13:31 | 77K | |
![[ ]](/icons/layout.gif) | 5924_Garage Doors 24..> | 2025-10-17 13:29 | 77K | |
![[ ]](/icons/layout.gif) | 6123_Fortress Doors ..> | 2025-10-20 09:55 | 77K | |
![[ ]](/icons/layout.gif) | 9725_Secure Entrance..> | 2025-10-30 10:54 | 77K | |
![[ ]](/icons/layout.gif) | 11020_Secure Entranc..> | 2025-11-03 16:17 | 77K | |
![[ ]](/icons/layout.gif) | 14625_CPS Custom Pro..> | 2025-11-12 14:19 | 77K | |
![[ ]](/icons/layout.gif) | 8120_1st Shield Darr..> | 2025-10-25 08:14 | 77K | |
![[ ]](/icons/layout.gif) | 12583_Tony Dovey Ton..> | 2025-11-06 17:13 | 77K | |
![[ ]](/icons/layout.gif) | 18437_Illy Refurbish..> | 2025-11-24 08:32 | 77K | |
![[ ]](/icons/layout.gif) | 1333_ASM Windows Ada..> | 2025-09-30 05:54 | 77K | |
![[ ]](/icons/layout.gif) | 5632_All Door Engine..> | 2025-10-16 15:09 | 77K | |
![[ ]](/icons/layout.gif) | 17803_RH Doors & Shu..> | 2025-11-20 16:38 | 77K | |
![[ ]](/icons/layout.gif) | 3406_WINDOW WIZE LTD..> | 2025-10-09 09:55 | 77K | |
![[ ]](/icons/layout.gif) | 5651_All About Doors..> | 2025-10-16 15:43 | 77K | |
![[ ]](/icons/layout.gif) | 6108_All About Doors..> | 2025-10-20 09:47 | 77K | |
![[ ]](/icons/layout.gif) | 10859_Phil Page Phil..> | 2025-11-03 13:50 | 77K | |
![[ ]](/icons/layout.gif) | 15493_Woods And Sons..> | 2025-11-14 12:42 | 77K | |
![[ ]](/icons/layout.gif) | 12097_PDL Fabricatio..> | 2025-11-06 08:09 | 77K | |
![[ ]](/icons/layout.gif) | 12884_Entador System..> | 2025-11-07 15:52 | 77K | |
![[ ]](/icons/layout.gif) | 17385_EcoGlaze Group..> | 2025-11-19 16:23 | 77K | |
![[ ]](/icons/layout.gif) | 304_SW Trade Frames ..> | 2025-09-19 12:33 | 77K | |
![[ ]](/icons/layout.gif) | 328_Doorolla S Terry..> | 2025-09-19 14:47 | 77K | |
![[ ]](/icons/layout.gif) | 3769_Eclipse Doors D..> | 2025-10-10 10:13 | 77K | |
![[ ]](/icons/layout.gif) | 11685_C&M Glass Serv..> | 2025-11-05 10:09 | 77K | |
![[ ]](/icons/layout.gif) | 13590_Highlands Serv..> | 2025-11-11 08:29 | 77K | |
![[ ]](/icons/layout.gif) | 13704_Highlands Serv..> | 2025-11-11 10:11 | 77K | |
![[ ]](/icons/layout.gif) | 15031_JDT Doors WV5 ..> | 2025-11-13 13:30 | 77K | |
![[ ]](/icons/layout.gif) | 5217_Windowology Ltd..> | 2025-10-16 08:25 | 77K | |
![[ ]](/icons/layout.gif) | 144_Smart Doors Henr..> | 2025-09-17 15:43 | 77K | |
![[ ]](/icons/layout.gif) | 1283_[0,0] Andy Sedd..> | 2025-09-29 13:59 | 77K | |
![[ ]](/icons/layout.gif) | 4332_Eclipse Doors D..> | 2025-10-13 14:09 | 77K | |
![[ ]](/icons/layout.gif) | 10409_EcoGlaze Group..> | 2025-10-31 15:36 | 77K | |
![[ ]](/icons/layout.gif) | 13333_Fortress Doors..> | 2025-11-10 13:35 | 77K | |
![[ ]](/icons/layout.gif) | 13640_1st Shield Dar..> | 2025-11-11 09:44 | 77K | |
![[ ]](/icons/layout.gif) | 15977_Fortress Doors..> | 2025-11-17 11:17 | 77K | |
![[ ]](/icons/layout.gif) | 445_All About Doors...> | 2025-09-22 15:53 | 77K | |
![[ ]](/icons/layout.gif) | 5346_Mick Walklate W..> | 2025-10-16 11:36 | 77K | |
![[ ]](/icons/layout.gif) | 5761_Shutter Tech UK..> | 2025-10-17 09:10 | 77K | |
![[ ]](/icons/layout.gif) | 7117_Shutter Tech UK..> | 2025-10-22 14:55 | 77K | |
![[ ]](/icons/layout.gif) | 17271_Shutter Tech U..> | 2025-11-19 13:59 | 77K | |
![[ ]](/icons/layout.gif) | 1788_[0,0] Dean Bark..> | 2025-10-02 11:20 | 77K | |
![[ ]](/icons/layout.gif) | 2804_Garage Door Rep..> | 2025-10-07 14:54 | 77K | |
![[ ]](/icons/layout.gif) | 7102_[0,0] Derek Lar..> | 2025-10-22 14:28 | 77K | |
![[ ]](/icons/layout.gif) | 13332_Fortress Doors..> | 2025-11-10 13:34 | 77K | |
![[ ]](/icons/layout.gif) | 15519_Doors 4 You. P..> | 2025-11-14 13:28 | 77K | |
![[ ]](/icons/layout.gif) | 1192_AM Shutters Ste..> | 2025-09-29 09:26 | 77K | |
![[ ]](/icons/layout.gif) | 6136_Fortress Doors ..> | 2025-10-20 10:18 | 77K | |
![[ ]](/icons/layout.gif) | 7887_Smart Doors Hen..> | 2025-10-24 09:54 | 77K | |
![[ ]](/icons/layout.gif) | 9700_MnK Windows Ke..> | 2025-10-30 10:26 | 77K | |
![[ ]](/icons/layout.gif) | 17162_Scotia Garage ..> | 2025-11-19 11:25 | 77K | |
![[ ]](/icons/layout.gif) | 18065_Scotia Garage ..> | 2025-11-21 10:35 | 77K | |
![[ ]](/icons/layout.gif) | 1456_SS Garage Doors..> | 2025-09-30 14:44 | 77K | |
![[ ]](/icons/layout.gif) | 3597_[0,0] Custom Sy..> | 2025-10-09 14:25 | 77K | |
![[ ]](/icons/layout.gif) | 5222_Windowology Ltd..> | 2025-10-16 08:36 | 77K | |
![[ ]](/icons/layout.gif) | 7873_Ace Garage Door..> | 2025-10-24 09:25 | 77K | |
![[ ]](/icons/layout.gif) | 12289_MM Doors Micha..> | 2025-11-06 11:41 | 77K | |
![[ ]](/icons/layout.gif) | 14021_WADE WINDOWS I..> | 2025-11-11 15:09 | 77K | |
![[ ]](/icons/layout.gif) | 1335_[0,0] Travis Ad..> | 2025-09-30 06:14 | 77K | |
![[ ]](/icons/layout.gif) | 7758_C&M Glass Servi..> | 2025-10-24 08:27 | 77K | |
![[ ]](/icons/layout.gif) | 12310_PB Doors Paul ..> | 2025-11-06 11:53 | 77K | |
![[ ]](/icons/layout.gif) | 12898_Verdi Home Imp..> | 2025-11-07 16:36 | 77K | |
![[ ]](/icons/layout.gif) | 12934_Eclipse Doors ..> | 2025-11-08 15:26 | 77K | |
![[ ]](/icons/layout.gif) | 1638_[0,0] Wayne Gil..> | 2025-10-01 14:40 | 77K | |
![[ ]](/icons/layout.gif) | 5648_G B Installatio..> | 2025-10-16 15:33 | 77K | |
![[ ]](/icons/layout.gif) | 15035_NBC Commercial..> | 2025-11-13 13:35 | 77K | |
![[ ]](/icons/layout.gif) | 2582_UK Door Systems..> | 2025-10-07 08:28 | 77K | |
![[ ]](/icons/layout.gif) | 2706_Zest Properties..> | 2025-10-07 11:06 | 77K | |
![[ ]](/icons/layout.gif) | 5497_S R W Services ..> | 2025-10-16 13:55 | 77K | |
![[ ]](/icons/layout.gif) | 5794_S R W Services ..> | 2025-10-17 10:15 | 77K | |
![[ ]](/icons/layout.gif) | 8920_EcoGlaze Group ..> | 2025-10-28 12:17 | 77K | |
![[ ]](/icons/layout.gif) | 16109_Replacement Ga..> | 2025-11-17 14:30 | 77K | |
![[ ]](/icons/layout.gif) | 18329_Jamie Wetheril..> | 2025-11-22 09:53 | 77K | |
![[ ]](/icons/layout.gif) | 509_Protect Installa..> | 2025-09-23 08:22 | 77K | |
![[ ]](/icons/layout.gif) | 1608_Avon Automated ..> | 2025-10-01 13:29 | 77K | |
![[ ]](/icons/layout.gif) | 2972_Goldhill Glazin..> | 2025-10-08 09:56 | 77K | |
![[ ]](/icons/layout.gif) | 8125_Shutter Tech UK..> | 2025-10-25 08:49 | 77K | |
![[ ]](/icons/layout.gif) | 12861_Glenhurst Door..> | 2025-11-07 14:15 | 77K | |
![[ ]](/icons/layout.gif) | 14882_Avon Automated..> | 2025-11-13 10:09 | 77K | |
![[ ]](/icons/layout.gif) | 16668_Fortress Doors..> | 2025-11-18 13:43 | 77K | |
![[ ]](/icons/layout.gif) | 2812_Richard Stockbr..> | 2025-10-07 14:58 | 77K | |
![[ ]](/icons/layout.gif) | 6139_Fortress Doors ..> | 2025-10-20 10:32 | 77K | |
![[ ]](/icons/layout.gif) | 14866_PGD Doors Ltd ..> | 2025-11-13 09:54 | 77K | |
![[ ]](/icons/layout.gif) | 7633_SDL Door Repair..> | 2025-10-23 15:43 | 77K | |
![[ ]](/icons/layout.gif) | 269_Garage Door Solu..> | 2025-09-19 10:01 | 77K | |
![[ ]](/icons/layout.gif) | 853_1st Choice Secur..> | 2025-09-25 10:38 | 77K | |
![[ ]](/icons/layout.gif) | 857_Elevate Doors Lt..> | 2025-09-25 10:50 | 77K | |
![[ ]](/icons/layout.gif) | 901_Smart Doors Henr..> | 2025-09-25 13:43 | 77K | |
![[ ]](/icons/layout.gif) | 2690_[0,0] Wayne Gil..> | 2025-10-07 10:35 | 77K | |
![[ ]](/icons/layout.gif) | 3119_Chelmsford Roll..> | 2025-10-08 12:42 | 77K | |
![[ ]](/icons/layout.gif) | 8506_Fortress Doors ..> | 2025-10-27 14:06 | 77K | |
![[ ]](/icons/layout.gif) | 15182_Oakley Windows..> | 2025-11-14 07:35 | 77K | |
![[ ]](/icons/layout.gif) | 18266_NTRAP NR11 7NZ..> | 2025-11-21 15:02 | 77K | |
![[ ]](/icons/layout.gif) | 1660_AM Shutters Ste..> | 2025-10-01 15:08 | 77K | |
![[ ]](/icons/layout.gif) | 6968_Prorenovate Ian..> | 2025-10-22 12:40 | 77K | |
![[ ]](/icons/layout.gif) | 7113_Ace Garage Door..> | 2025-10-22 14:53 | 77K | |
![[ ]](/icons/layout.gif) | 12577_Fortress Doors..> | 2025-11-06 16:50 | 77K | |
![[ ]](/icons/layout.gif) | 15392_Woods And Sons..> | 2025-11-14 11:11 | 77K | |
![[ ]](/icons/layout.gif) | 150_Ace Garage Doors..> | 2025-09-17 16:28 | 77K | |
![[ ]](/icons/layout.gif) | 5772_Go Garage Doors..> | 2025-10-17 09:46 | 77K | |
![[ ]](/icons/layout.gif) | 6161_Fortress Doors ..> | 2025-10-20 11:13 | 77K | |
![[ ]](/icons/layout.gif) | 7413_Prorenovate Ian..> | 2025-10-23 11:52 | 77K | |
![[ ]](/icons/layout.gif) | 7998_J Brady Garage ..> | 2025-10-24 12:34 | 77K | |
![[ ]](/icons/layout.gif) | 12896_Verdi Home Imp..> | 2025-11-07 16:16 | 77K | |
![[ ]](/icons/layout.gif) | 14885_Doors 4 You. P..> | 2025-11-13 10:19 | 77K | |
![[ ]](/icons/layout.gif) | 17160_WINDOW WIZE LT..> | 2025-11-19 11:23 | 77K | |
![[ ]](/icons/layout.gif) | 267_Garage Door Solu..> | 2025-09-19 09:58 | 77K | |
![[ ]](/icons/layout.gif) | 896_Cromer Garage Do..> | 2025-09-25 13:26 | 77K | |
![[ ]](/icons/layout.gif) | 980_Dream Installati..> | 2025-09-26 08:40 | 77K | |
![[ ]](/icons/layout.gif) | 1405_Dream Installat..> | 2025-09-30 12:20 | 77K | |
![[ ]](/icons/layout.gif) | 1473_[0,0] Travis Ad..> | 2025-09-30 15:43 | 77K | |
![[ ]](/icons/layout.gif) | 3645_Absolute Garage..> | 2025-10-09 16:03 | 77K | |
![[ ]](/icons/layout.gif) | 5334_All Door Engine..> | 2025-10-16 11:01 | 77K | |
![[ ]](/icons/layout.gif) | 5335_All Door Engine..> | 2025-10-16 11:01 | 77K | |
![[ ]](/icons/layout.gif) | 10448_Fortress Doors..> | 2025-11-03 08:13 | 77K | |
![[ ]](/icons/layout.gif) | 11520_Home secure so..> | 2025-11-05 07:57 | 77K | |
![[ ]](/icons/layout.gif) | 12190_Phil Page Phil..> | 2025-11-06 09:50 | 77K | |
![[ ]](/icons/layout.gif) | 15991_Roll Right Gar..> | 2025-11-17 11:40 | 77K | |
![[ ]](/icons/layout.gif) | 16130_RH Doors & Shu..> | 2025-11-17 15:09 | 77K | |
![[ ]](/icons/layout.gif) | 4886_[0,0] Steve Ter..> | 2025-10-15 09:52 | 77K | |
![[ ]](/icons/layout.gif) | 4898_[0,0] James Bow..> | 2025-10-15 10:03 | 77K | |
![[ ]](/icons/layout.gif) | 5668_All Door Engine..> | 2025-10-16 16:07 | 77K | |
![[ ]](/icons/layout.gif) | 14290_MNH Windows & ..> | 2025-11-12 08:35 | 77K | |
![[ ]](/icons/layout.gif) | 15986_Fortress Doors..> | 2025-11-17 11:36 | 77K | |
![[ ]](/icons/layout.gif) | 18353_Anthony Garth ..> | 2025-11-22 11:03 | 77K | |
![[ ]](/icons/layout.gif) | 18532_Barry Eckland ..> | 2025-11-24 10:41 | 77K | |
![[ ]](/icons/layout.gif) | 912_Gilberts Home Im..> | 2025-09-25 14:38 | 77K | |
![[ ]](/icons/layout.gif) | 6466_Highlands Elect..> | 2025-10-21 10:31 | 77K | |
![[ ]](/icons/layout.gif) | 6847_Oakley Windows ..> | 2025-10-22 09:57 | 77K | |
![[ ]](/icons/layout.gif) | 8991_Dream Installat..> | 2025-10-28 14:18 | 77K | |
![[ ]](/icons/layout.gif) | 11841_Scotia Garage ..> | 2025-11-05 11:51 | 77K | |
![[ ]](/icons/layout.gif) | 12059_Fortress Doors..> | 2025-11-05 15:34 | 77K | |
![[ ]](/icons/layout.gif) | 12895_WADE WINDOWS I..> | 2025-11-07 16:05 | 77K | |
![[ ]](/icons/layout.gif) | 14270_Regal Windows ..> | 2025-11-12 08:13 | 77K | |
![[ ]](/icons/layout.gif) | 15085_All Doors Repa..> | 2025-11-13 15:05 | 77K | |
![[ ]](/icons/layout.gif) | 15388_Go Garage Door..> | 2025-11-14 11:03 | 77K | |
![[ ]](/icons/layout.gif) | 15742_All Doors Repa..> | 2025-11-15 12:52 | 77K | |
![[ ]](/icons/layout.gif) | 16144_Bloomfield Hom..> | 2025-11-17 15:43 | 77K | |
![[ ]](/icons/layout.gif) | 16370_L G Glazing Lt..> | 2025-11-18 08:56 | 77K | |
![[ ]](/icons/layout.gif) | 1193_Chelmsford Roll..> | 2025-09-29 09:31 | 77K | |
![[ ]](/icons/layout.gif) | 6126_Fortress Doors ..> | 2025-10-20 10:02 | 77K | |
![[ ]](/icons/layout.gif) | 11768_Replacement Ga..> | 2025-11-05 11:05 | 77K | |
![[ ]](/icons/layout.gif) | 16247_RH Doors & Shu..> | 2025-11-18 07:42 | 77K | |
![[ ]](/icons/layout.gif) | 352_Fortress_Doors A..> | 2025-09-22 07:44 | 77K | |
![[ ]](/icons/layout.gif) | 701_J Brady Garage D..> | 2025-09-24 10:06 | 77K | |
![[ ]](/icons/layout.gif) | 756_East Anglia Roll..> | 2025-09-24 12:59 | 77K | |
![[ ]](/icons/layout.gif) | 796_NW Automatic Doo..> | 2025-09-24 15:44 | 77K | |
![[ ]](/icons/layout.gif) | 1670_Palms Construct..> | 2025-10-01 15:36 | 77K | |
![[ ]](/icons/layout.gif) | 1966_Replacement Gar..> | 2025-10-03 09:23 | 77K | |
![[ ]](/icons/layout.gif) | 4730_The Garage Door..> | 2025-10-14 14:25 | 77K | |
![[ ]](/icons/layout.gif) | 8054_P & R Door Syst..> | 2025-10-24 13:47 | 77K | |
![[ ]](/icons/layout.gif) | 15719_CPS Custom Pro..> | 2025-11-15 11:35 | 77K | |
![[ ]](/icons/layout.gif) | 470_Replacement Gara..> | 2025-09-23 07:20 | 77K | |
![[ ]](/icons/layout.gif) | 1783_[0,0] Thomas Ne..> | 2025-10-02 11:09 | 77K | |
![[ ]](/icons/layout.gif) | 2171_All Doors Repai..> | 2025-10-03 14:30 | 77K | |
![[ ]](/icons/layout.gif) | 2186_Eclipse Doors D..> | 2025-10-03 15:00 | 77K | |
![[ ]](/icons/layout.gif) | 9964_NW Automatic Do..> | 2025-10-30 16:24 | 77K | |
![[ ]](/icons/layout.gif) | 18516_Barry Eckland ..> | 2025-11-24 10:09 | 77K | |
![[ ]](/icons/layout.gif) | 976_J Brady Garage D..> | 2025-09-26 08:36 | 77K | |
![[ ]](/icons/layout.gif) | 1085_NBC Commercial ..> | 2025-09-26 14:02 | 77K | |
![[ ]](/icons/layout.gif) | 8655_Able Garage Doo..> | 2025-10-27 16:35 | 77K | |
![[ ]](/icons/layout.gif) | 8867_Dream Installat..> | 2025-10-28 11:30 | 77K | |
![[ ]](/icons/layout.gif) | 10860_Ross Garage Do..> | 2025-11-03 13:50 | 77K | |
![[ ]](/icons/layout.gif) | 17835_TH Installatio..> | 2025-11-21 07:25 | 77K | |
![[ ]](/icons/layout.gif) | 1657_[0,0] Serenade..> | 2025-10-01 15:02 | 77K | |
![[ ]](/icons/layout.gif) | 1767_C&M Glass Servi..> | 2025-10-02 10:17 | 77K | |
![[ ]](/icons/layout.gif) | 1093_Herts & Essex G..> | 2025-09-26 14:57 | 77K | |
![[ ]](/icons/layout.gif) | 1242_Guy Hubbard Dou..> | 2025-09-29 12:36 | 77K | |
![[ ]](/icons/layout.gif) | 2128_Guy Hubbard Dou..> | 2025-10-03 13:07 | 77K | |
![[ ]](/icons/layout.gif) | 1050_Scotia Garage D..> | 2025-09-26 12:45 | 77K | |
![[ ]](/icons/layout.gif) | 1680_Four Counties D..> | 2025-10-01 15:53 | 77K | |
![[ ]](/icons/layout.gif) | 2134_[0,0] Chelmsfo..> | 2025-10-03 13:26 | 77K | |
![[ ]](/icons/layout.gif) | 2510_Replacement Gar..> | 2025-10-06 15:42 | 77K | |
![[ ]](/icons/layout.gif) | 5738_J Brady Garage ..> | 2025-10-17 08:13 | 77K | |
![[ ]](/icons/layout.gif) | 15374_Elevate Doors ..> | 2025-11-14 10:40 | 77K | |
![[ ]](/icons/layout.gif) | 123_Garage Doors 247..> | 2025-09-17 14:35 | 77K | |
![[ ]](/icons/layout.gif) | 311_Doorolla S Terry..> | 2025-09-19 13:18 | 77K | |
![[ ]](/icons/layout.gif) | 3955_Oakley Windows ..> | 2025-10-10 14:04 | 77K | |
![[ ]](/icons/layout.gif) | 7139_C&M Glass Servi..> | 2025-10-22 15:15 | 77K | |
![[ ]](/icons/layout.gif) | 7757_CWD Improvement..> | 2025-10-24 08:22 | 77K | |
![[ ]](/icons/layout.gif) | 8848_Avon Automated ..> | 2025-10-28 11:14 | 77K | |
![[ ]](/icons/layout.gif) | 550_Spa Roller Doors..> | 2025-09-23 11:22 | 77K | |
![[ ]](/icons/layout.gif) | 11466_Rhino Windows ..> | 2025-11-04 15:14 | 77K | |
![[ ]](/icons/layout.gif) | 16113_R L Roller Doo..> | 2025-11-17 14:34 | 77K | |
![[ ]](/icons/layout.gif) | 16239_Compass Constr..> | 2025-11-17 16:54 | 77K | |
![[ ]](/icons/layout.gif) | 16432_R L Roller Doo..> | 2025-11-18 09:36 | 77K | |
![[ ]](/icons/layout.gif) | 16539_Compass Constr..> | 2025-11-18 11:07 | 77K | |
![[ ]](/icons/layout.gif) | 16846_TH Installatio..> | 2025-11-18 16:04 | 77K | |
![[ ]](/icons/layout.gif) | 16957_Mac Automation..> | 2025-11-19 07:46 | 77K | |
![[ ]](/icons/layout.gif) | 17113_Mac Automation..> | 2025-11-19 10:37 | 77K | |
![[ ]](/icons/layout.gif) | 17339_Mac Automation..> | 2025-11-19 14:46 | 77K | |
![[ ]](/icons/layout.gif) | 696_J Brady Garage D..> | 2025-09-24 09:51 | 77K | |
![[ ]](/icons/layout.gif) | 3669_[0,0] Steve Ter..> | 2025-10-10 06:30 | 77K | |
![[ ]](/icons/layout.gif) | 4079_[0,0] James Bow..> | 2025-10-13 09:02 | 77K | |
![[ ]](/icons/layout.gif) | 5211_C&M Glass Servi..> | 2025-10-16 07:43 | 77K | |
![[ ]](/icons/layout.gif) | 9872_Eclipse Doors D..> | 2025-10-30 14:23 | 77K | |
![[ ]](/icons/layout.gif) | 11888_L & C Bracey L..> | 2025-11-05 12:24 | 77K | |
![[ ]](/icons/layout.gif) | 14139_All Doors Repa..> | 2025-11-11 16:44 | 77K | |
![[ ]](/icons/layout.gif) | 729_Custom Trade Sys..> | 2025-09-24 11:09 | 77K | |
![[ ]](/icons/layout.gif) | 1923_Windowcraft Des..> | 2025-10-03 07:11 | 77K | |
![[ ]](/icons/layout.gif) | 5816_Eclipse Doors D..> | 2025-10-17 10:46 | 77K | |
![[ ]](/icons/layout.gif) | 6774_Garage Door Sol..> | 2025-10-22 08:32 | 77K | |
![[ ]](/icons/layout.gif) | 11868_L & C Bracey L..> | 2025-11-05 12:04 | 77K | |
![[ ]](/icons/layout.gif) | 12625_L G Glazing Lt..> | 2025-11-07 08:09 | 77K | |
![[ ]](/icons/layout.gif) | 14151_Rhino Windows ..> | 2025-11-11 16:54 | 77K | |
![[ ]](/icons/layout.gif) | 634_East Anglia Roll..> | 2025-09-24 06:32 | 77K | |
![[ ]](/icons/layout.gif) | 1740_J Bowman Garage..> | 2025-10-02 07:25 | 77K | |
![[ ]](/icons/layout.gif) | 3580_[0,0] S Terry -..> | 2025-10-09 13:51 | 77K | |
![[ ]](/icons/layout.gif) | 8641_TPS Gates & Doo..> | 2025-10-27 16:16 | 77K | |
![[ ]](/icons/layout.gif) | 8663_TPS Gates & Doo..> | 2025-10-27 16:41 | 77K | |
![[ ]](/icons/layout.gif) | 18429_Ceta Group Ltd..> | 2025-11-24 08:21 | 77K | |
![[ ]](/icons/layout.gif) | 983_Doors 4 Garages ..> | 2025-09-26 08:45 | 77K | |
![[ ]](/icons/layout.gif) | 1964_Norfolk Roller ..> | 2025-10-03 09:11 | 77K | |
![[ ]](/icons/layout.gif) | 4622_P & R Door Syst..> | 2025-10-14 12:55 | 77K | |
![[ ]](/icons/layout.gif) | 9771_Fortress Doors ..> | 2025-10-30 12:00 | 77K | |
![[ ]](/icons/layout.gif) | 14156_Rhino Windows ..> | 2025-11-11 17:04 | 77K | |
![[ ]](/icons/layout.gif) | 406_Fixed Abode Gara..> | 2025-09-22 11:24 | 77K | |
![[ ]](/icons/layout.gif) | 797_NW Automatic Doo..> | 2025-09-24 15:47 | 77K | |
![[ ]](/icons/layout.gif) | 2348_Windowcraft Des..> | 2025-10-06 11:36 | 77K | |
![[ ]](/icons/layout.gif) | 2779_[0,0] SW Trade..> | 2025-10-07 13:51 | 77K | |
![[ ]](/icons/layout.gif) | 4497_Birchley Homes ..> | 2025-10-14 09:40 | 77K | |
![[ ]](/icons/layout.gif) | 5288_Fortress Doors ..> | 2025-10-16 10:16 | 77K | |
![[ ]](/icons/layout.gif) | 8053_Chelmsford Roll..> | 2025-10-24 13:43 | 77K | |
![[ ]](/icons/layout.gif) | 13038_TH Installatio..> | 2025-11-10 07:45 | 77K | |
![[ ]](/icons/layout.gif) | 1789_Chelmsford Roll..> | 2025-10-02 11:35 | 77K | |
![[ ]](/icons/layout.gif) | 1792_Chelmsford Roll..> | 2025-10-02 12:03 | 77K | |
![[ ]](/icons/layout.gif) | 4399_Elevate Doors L..> | 2025-10-13 15:36 | 77K | |
![[ ]](/icons/layout.gif) | 5655_CWD Improvement..> | 2025-10-16 15:56 | 77K | |
![[ ]](/icons/layout.gif) | 6065_J Brady Garage ..> | 2025-10-20 08:29 | 77K | |
![[ ]](/icons/layout.gif) | 6188_Rhino Windows A..> | 2025-10-20 12:19 | 77K | |
![[ ]](/icons/layout.gif) | 11517_Eastern Frames..> | 2025-11-04 16:52 | 77K | |
![[ ]](/icons/layout.gif) | 15343_CWD Improvemen..> | 2025-11-14 09:19 | 77K | |
![[ ]](/icons/layout.gif) | 18110_Scotia Garage ..> | 2025-11-21 11:28 | 77K | |
![[ ]](/icons/layout.gif) | 697_J Brady Garage D..> | 2025-09-24 10:02 | 77K | |
![[ ]](/icons/layout.gif) | 906_JWK Electrical L..> | 2025-09-25 14:20 | 77K | |
![[ ]](/icons/layout.gif) | 1662_Absolute Garage..> | 2025-10-01 15:13 | 77K | |
![[ ]](/icons/layout.gif) | 1963_Replacement Gar..> | 2025-10-03 09:09 | 77K | |
![[ ]](/icons/layout.gif) | 4077_[0,0] James Bow..> | 2025-10-13 08:55 | 77K | |
![[ ]](/icons/layout.gif) | 15895_AJ Trade Andre..> | 2025-11-17 10:09 | 77K | |
![[ ]](/icons/layout.gif) | 16032_Compass Constr..> | 2025-11-17 12:34 | 77K | |
![[ ]](/icons/layout.gif) | 17097_MnK Windows Ma..> | 2025-11-19 10:05 | 77K | |
![[ ]](/icons/layout.gif) | 2514_3 Brothers Buil..> | 2025-10-06 15:44 | 77K | |
![[ ]](/icons/layout.gif) | 4226_Garage Doors No..> | 2025-10-13 12:12 | 77K | |
![[ ]](/icons/layout.gif) | 6449_Garage Doors 24..> | 2025-10-21 10:13 | 77K | |
![[ ]](/icons/layout.gif) | 15277_Eastern Frames..> | 2025-11-14 08:53 | 77K | |
![[ ]](/icons/layout.gif) | 4513_Absolute Garage..> | 2025-10-14 10:11 | 77K | |
![[ ]](/icons/layout.gif) | 7152_Open And Shut D..> | 2025-10-22 15:48 | 77K | |
![[ ]](/icons/layout.gif) | 8045_Lidget Compton ..> | 2025-10-24 13:24 | 77K | |
![[ ]](/icons/layout.gif) | 10455_EcoGlaze Group..> | 2025-11-03 08:24 | 77K | |
![[ ]](/icons/layout.gif) | 11683_Replacement Ga..> | 2025-11-05 10:09 | 77K | |
![[ ]](/icons/layout.gif) | 948_NW Automatic Doo..> | 2025-09-25 15:58 | 77K | |
![[ ]](/icons/layout.gif) | 3091_[0,0] Beasley ..> | 2025-10-08 12:05 | 77K | |
![[ ]](/icons/layout.gif) | 4422_[0,0] Victoria ..> | 2025-10-14 07:41 | 77K | |
![[ ]](/icons/layout.gif) | 8186_Wall Garage Doo..> | 2025-10-27 08:57 | 77K | |
![[ ]](/icons/layout.gif) | 8572_Chiltern Doors ..> | 2025-10-27 15:14 | 77K | |
![[ ]](/icons/layout.gif) | 12872_L G Glazing Lt..> | 2025-11-07 15:00 | 77K | |
![[ ]](/icons/layout.gif) | 18489_1st Shield Dar..> | 2025-11-24 10:01 | 77K | |
![[ ]](/icons/layout.gif) | 4907_DPS Building Se..> | 2025-10-15 10:37 | 77K | |
![[ ]](/icons/layout.gif) | 6696_Garage Door Sol..> | 2025-10-21 16:01 | 77K | |
![[ ]](/icons/layout.gif) | 7672_TPS Gates & Doo..> | 2025-10-24 06:59 | 77K | |
![[ ]](/icons/layout.gif) | 8052_East Anglia Rol..> | 2025-10-24 13:43 | 77K | |
![[ ]](/icons/layout.gif) | 11729_Replacement Ga..> | 2025-11-05 10:39 | 77K | |
![[ ]](/icons/layout.gif) | 234_Ace Garage Doors..> | 2025-09-19 07:00 | 77K | |
![[ ]](/icons/layout.gif) | 637_Ezi-Dor Ltd Trac..> | 2025-09-24 07:06 | 77K | |
![[ ]](/icons/layout.gif) | 1386_Fixed Abode Gar..> | 2025-09-30 10:30 | 77K | |
![[ ]](/icons/layout.gif) | 3276_Sargent & Powel..> | 2025-10-09 06:50 | 77K | |
![[ ]](/icons/layout.gif) | 3648_SDS (Isle Of Ma..> | 2025-10-09 16:54 | 77K | |
![[ ]](/icons/layout.gif) | 5260_Fixed Abode Gar..> | 2025-10-16 09:15 | 77K | |
![[ ]](/icons/layout.gif) | 8537_Tru-Fit Window..> | 2025-10-27 14:28 | 77K | |
![[ ]](/icons/layout.gif) | 10648_AS Industrial ..> | 2025-11-03 10:21 | 77K | |
![[ ]](/icons/layout.gif) | 11752_Replacement Ga..> | 2025-11-05 10:57 | 77K | |
![[ ]](/icons/layout.gif) | 13663_Replacement Ga..> | 2025-11-11 09:59 | 77K | |
![[ ]](/icons/layout.gif) | 15299_JDT Doors WV5 ..> | 2025-11-14 09:08 | 77K | |
![[ ]](/icons/layout.gif) | 348_All Doors Repair..> | 2025-09-22 07:04 | 77K | |
![[ ]](/icons/layout.gif) | 463_Garage Door Solu..> | 2025-09-23 07:13 | 77K | |
![[ ]](/icons/layout.gif) | 5433_Eclipse Doors D..> | 2025-10-16 12:58 | 77K | |
![[ ]](/icons/layout.gif) | 11996_East Anglia Ro..> | 2025-11-05 14:17 | 77K | |
![[ ]](/icons/layout.gif) | 949_All Door Enginee..> | 2025-09-26 07:01 | 77K | |
![[ ]](/icons/layout.gif) | 467_Garage Door Solu..> | 2025-09-23 07:18 | 77K | |
![[ ]](/icons/layout.gif) | 777_Replacement Gara..> | 2025-09-24 14:26 | 77K | |
![[ ]](/icons/layout.gif) | 2175_Rhino Windows A..> | 2025-10-03 14:37 | 77K | |
![[ ]](/icons/layout.gif) | 276_Eco Windows & Do..> | 2025-09-19 10:45 | 77K | |
![[ ]](/icons/layout.gif) | 428_Garage Door Solu..> | 2025-09-22 14:52 | 77K | |
![[ ]](/icons/layout.gif) | 1652_[0,0] Fletcher ..> | 2025-10-01 14:50 | 77K | |
![[ ]](/icons/layout.gif) | 2845_All Door Engine..> | 2025-10-07 17:27 | 77K | |
![[ ]](/icons/layout.gif) | 3445_All Door Engine..> | 2025-10-09 10:55 | 77K | |
![[ ]](/icons/layout.gif) | 4912_All Door Engine..> | 2025-10-15 11:00 | 77K | |
![[ ]](/icons/layout.gif) | 5742_Elevate Doors L..> | 2025-10-17 08:33 | 77K | |
![[ ]](/icons/layout.gif) | 16129_RH Doors & Shu..> | 2025-11-17 15:01 | 77K | |
![[ ]](/icons/layout.gif) | 8066_Chelmsford Roll..> | 2025-10-24 13:57 | 77K | |
![[ ]](/icons/layout.gif) | 8165_Fortress Doors ..> | 2025-10-27 07:59 | 77K | |
![[ ]](/icons/layout.gif) | 8902_EcoGlaze Group ..> | 2025-10-28 12:05 | 77K | |
![[ ]](/icons/layout.gif) | 15161_Keswick Develo..> | 2025-11-13 17:06 | 77K | |
![[ ]](/icons/layout.gif) | 15518_Doorflex Produ..> | 2025-11-14 13:27 | 77K | |
![[ ]](/icons/layout.gif) | 690_J Brady Garage D..> | 2025-09-24 09:21 | 77K | |
![[ ]](/icons/layout.gif) | 5619_Eastern Frames ..> | 2025-10-16 14:52 | 77K | |
![[ ]](/icons/layout.gif) | 5708_Mick Walklate W..> | 2025-10-17 07:37 | 77K | |
![[ ]](/icons/layout.gif) | 7081_Oakley Windows ..> | 2025-10-22 13:58 | 77K | |
![[ ]](/icons/layout.gif) | 12834_Elevate Doors ..> | 2025-11-07 13:26 | 77K | |
![[ ]](/icons/layout.gif) | 13430_Eclipse Doors ..> | 2025-11-10 16:17 | 77K | |
![[ ]](/icons/layout.gif) | 264_Wellinborough Do..> | 2025-09-19 09:43 | 77K | |
![[ ]](/icons/layout.gif) | 266_Wellinborough Do..> | 2025-09-19 09:54 | 77K | |
![[ ]](/icons/layout.gif) | 947_NW Automatic Doo..> | 2025-09-25 15:54 | 77K | |
![[ ]](/icons/layout.gif) | 11653_Eastern Frames..> | 2025-11-05 09:38 | 77K | |
![[ ]](/icons/layout.gif) | 4502_Next Generation..> | 2025-10-14 10:04 | 77K | |
![[ ]](/icons/layout.gif) | 6470_Danbury Garage ..> | 2025-10-21 10:41 | 77K | |
![[ ]](/icons/layout.gif) | 17821_Mac Automation..> | 2025-11-20 17:13 | 77K | |
![[ ]](/icons/layout.gif) | 474_Rhino Windows An..> | 2025-09-23 07:29 | 77K | |
![[ ]](/icons/layout.gif) | 2126_Palms Construct..> | 2025-10-03 13:05 | 77K | |
![[ ]](/icons/layout.gif) | 14705_Eastern Frames..> | 2025-11-12 16:08 | 77K | |
![[ ]](/icons/layout.gif) | 981_Garage Door Repa..> | 2025-09-26 08:40 | 77K | |
![[ ]](/icons/layout.gif) | 1076_Replacement Gar..> | 2025-09-26 13:16 | 77K | |
![[ ]](/icons/layout.gif) | 2291_[0,0] Nathan Wa..> | 2025-10-06 10:57 | 77K | |
![[ ]](/icons/layout.gif) | 4734_The Garage Door..> | 2025-10-14 14:29 | 77K | |
![[ ]](/icons/layout.gif) | 7529_Mark Perham Mar..> | 2025-10-23 13:12 | 77K | |
![[ ]](/icons/layout.gif) | 8008_M. B. Bells Ltd..> | 2025-10-24 12:41 | 77K | |
![[ ]](/icons/layout.gif) | 13331_Fortress Doors..> | 2025-11-10 13:33 | 77K | |
![[ ]](/icons/layout.gif) | 847_Rhino Windows An..> | 2025-09-25 10:09 | 77K | |
![[ ]](/icons/layout.gif) | 5116_Ross Garage Doo..> | 2025-10-15 15:22 | 77K | |
![[ ]](/icons/layout.gif) | 112_Harpers Door Spe..> | 2025-09-17 13:55 | 77K | |
![[ ]](/icons/layout.gif) | 477_Rhino Windows An..> | 2025-09-23 07:36 | 77K | |
![[ ]](/icons/layout.gif) | 3732_Richard Stockbr..> | 2025-10-10 08:52 | 77K | |
![[ ]](/icons/layout.gif) | 6157_Rollermatic Gar..> | 2025-10-20 11:08 | 77K | |
![[ ]](/icons/layout.gif) | 12881_Doorflex Produ..> | 2025-11-07 15:49 | 77K | |
![[ ]](/icons/layout.gif) | 15709_AJ Trade Andre..> | 2025-11-15 11:09 | 77K | |
![[ ]](/icons/layout.gif) | 2574_Rhino Windows A..> | 2025-10-07 08:06 | 77K | |
![[ ]](/icons/layout.gif) | 4752_The Garage Door..> | 2025-10-14 14:55 | 77K | |
![[ ]](/icons/layout.gif) | 5118_B&B Electrical ..> | 2025-10-15 15:36 | 77K | |
![[ ]](/icons/layout.gif) | 678_Elevate Doors Lt..> | 2025-09-24 08:32 | 77K | |
![[ ]](/icons/layout.gif) | 1234_Doorolla Steve ..> | 2025-09-29 11:40 | 77K | |
![[ ]](/icons/layout.gif) | 1314_Fixed Abode Gar..> | 2025-09-29 15:07 | 77K | |
![[ ]](/icons/layout.gif) | 1357_[0,0] Martin Ch..> | 2025-09-30 08:12 | 77K | |
![[ ]](/icons/layout.gif) | 2956_Highlands Elect..> | 2025-10-08 09:46 | 77K | |
![[ ]](/icons/layout.gif) | 3309_[0,0] Chelmsfo..> | 2025-10-09 07:57 | 77K | |
![[ ]](/icons/layout.gif) | 7916_P & R Door Syst..> | 2025-10-24 11:05 | 77K | |
![[ ]](/icons/layout.gif) | 1121_East Anglia Rol..> | 2025-09-29 06:49 | 77K | |
![[ ]](/icons/layout.gif) | 6898_C&M Glass Servi..> | 2025-10-22 11:00 | 77K | |
![[ ]](/icons/layout.gif) | 13372_LNR Door Solut..> | 2025-11-10 14:16 | 77K | |
![[ ]](/icons/layout.gif) | 17477_Serenade Home ..> | 2025-11-20 09:32 | 77K | |
![[ ]](/icons/layout.gif) | 897_Ffenestri Amlwch..> | 2025-09-25 13:39 | 77K | |
![[ ]](/icons/layout.gif) | 1110_Proud 2 Fix Mat..> | 2025-09-26 15:50 | 77K | |
![[ ]](/icons/layout.gif) | 3315_Chelmsford Roll..> | 2025-10-09 08:08 | 77K | |
![[ ]](/icons/layout.gif) | 7173_WADE WINDOWS IP..> | 2025-10-23 06:49 | 77K | |
![[ ]](/icons/layout.gif) | 8739_AM Shutters Ste..> | 2025-10-28 09:23 | 77K | |
![[ ]](/icons/layout.gif) | 12878_Doorflex Produ..> | 2025-11-07 15:46 | 77K | |
![[ ]](/icons/layout.gif) | 211_C&M Glass Servic..> | 2025-09-18 15:43 | 77K | |
![[ ]](/icons/layout.gif) | 4408_Garage Doors No..> | 2025-10-13 15:48 | 77K | |
![[ ]](/icons/layout.gif) | 5104_Rollermatic Gar..> | 2025-10-15 15:15 | 77K | |
![[ ]](/icons/layout.gif) | 10440_Warnsham Windo..> | 2025-11-03 08:02 | 77K | |
![[ ]](/icons/layout.gif) | 13830_Ace Garage Doo..> | 2025-11-11 13:10 | 77K | |
![[ ]](/icons/layout.gif) | 17497_Dream Installa..> | 2025-11-20 10:01 | 77K | |
![[ ]](/icons/layout.gif) | 528_Access Door Serv..> | 2025-09-23 10:15 | 77K | |
![[ ]](/icons/layout.gif) | 3432_Replacement Gar..> | 2025-10-09 10:36 | 77K | |
![[ ]](/icons/layout.gif) | 3599_C & P Doors Cra..> | 2025-10-09 14:32 | 77K | |
![[ ]](/icons/layout.gif) | 4748_The Garage Door..> | 2025-10-14 14:54 | 77K | |
![[ ]](/icons/layout.gif) | 5746_AJ Trade Andrew..> | 2025-10-17 08:38 | 77K | |
![[ ]](/icons/layout.gif) | 17054_RH Doors & Shu..> | 2025-11-19 09:05 | 77K | |
![[ ]](/icons/layout.gif) | 17434_Replacement Ga..> | 2025-11-20 08:45 | 77K | |
![[ ]](/icons/layout.gif) | 252_Garage Door Solu..> | 2025-09-19 08:37 | 77K | |
![[ ]](/icons/layout.gif) | 7160_Ace Garage Door..> | 2025-10-22 15:56 | 77K | |
![[ ]](/icons/layout.gif) | 18529_Fortress Doors..> | 2025-11-24 10:39 | 77K | |
![[ ]](/icons/layout.gif) | 8073_CWG Home Improv..> | 2025-10-24 14:17 | 77K | |
![[ ]](/icons/layout.gif) | 9796_Fortress Doors ..> | 2025-10-30 12:41 | 77K | |
![[ ]](/icons/layout.gif) | 13225_Verdi Home Imp..> | 2025-11-10 11:09 | 77K | |
![[ ]](/icons/layout.gif) | 14272_Regal Windows ..> | 2025-11-12 08:17 | 77K | |
![[ ]](/icons/layout.gif) | 15668_Regal Windows ..> | 2025-11-14 15:02 | 77K | |
![[ ]](/icons/layout.gif) | 16704_Rhino Windows ..> | 2025-11-18 13:57 | 77K | |
![[ ]](/icons/layout.gif) | 1211_Rollermatic Gar..> | 2025-09-29 10:23 | 77K | |
![[ ]](/icons/layout.gif) | 1334_Elegant Windows..> | 2025-09-30 06:04 | 77K | |
![[ ]](/icons/layout.gif) | 1959_Replacement Gar..> | 2025-10-03 08:46 | 77K | |
![[ ]](/icons/layout.gif) | 8748_Chelmsford Roll..> | 2025-10-28 09:32 | 77K | |
![[ ]](/icons/layout.gif) | 9969_Chelmsford Roll..> | 2025-10-30 16:28 | 77K | |
![[ ]](/icons/layout.gif) | 14736_Doorolla Ltd S..> | 2025-11-12 16:31 | 77K | |
![[ ]](/icons/layout.gif) | 261_Eco Windows & Do..> | 2025-09-19 08:59 | 77K | |
![[ ]](/icons/layout.gif) | 527_Access Door Serv..> | 2025-09-23 10:10 | 77K | |
![[ ]](/icons/layout.gif) | 1232_Elevate Doors L..> | 2025-09-29 11:32 | 77K | |
![[ ]](/icons/layout.gif) | 3965_Fresh Frames Ry..> | 2025-10-10 14:19 | 77K | |
![[ ]](/icons/layout.gif) | 5153_Doorolla Ltd St..> | 2025-10-15 16:03 | 77K | |
![[ ]](/icons/layout.gif) | 6874_Piper Window Sy..> | 2025-10-22 10:13 | 77K | |
![[ ]](/icons/layout.gif) | 8129_Garage Door Sol..> | 2025-10-25 10:15 | 77K | |
![[ ]](/icons/layout.gif) | 8562_Custom Trade Sy..> | 2025-10-27 14:55 | 77K | |
![[ ]](/icons/layout.gif) | 9245_1st Choice Secu..> | 2025-10-29 09:04 | 77K | |
![[ ]](/icons/layout.gif) | 11866_Garage Doors 2..> | 2025-11-05 12:03 | 77K | |
![[ ]](/icons/layout.gif) | 14122_All Doors Repa..> | 2025-11-11 16:30 | 77K | |
![[ ]](/icons/layout.gif) | 18627_Ace Garage Doo..> | 2025-11-24 13:14 | 77K | |
![[ ]](/icons/layout.gif) | 5263_M. A. E. Window..> | 2025-10-16 09:18 | 77K | |
![[ ]](/icons/layout.gif) | 8027_J Brady Garage ..> | 2025-10-24 13:02 | 77K | |
![[ ]](/icons/layout.gif) | 8075_Ideal Industria..> | 2025-10-24 14:26 | 77K | |
![[ ]](/icons/layout.gif) | 8671_Custom Trade Sy..> | 2025-10-27 16:56 | 77K | |
![[ ]](/icons/layout.gif) | 18558_Ace Garage Doo..> | 2025-11-24 11:11 | 77K | |
![[ ]](/icons/layout.gif) | 1104_Gilberts Home I..> | 2025-09-26 15:31 | 77K | |
![[ ]](/icons/layout.gif) | 7997_Oakley Windows ..> | 2025-10-24 12:34 | 77K | |
![[ ]](/icons/layout.gif) | 8170_Fortress Doors ..> | 2025-10-27 08:24 | 77K | |
![[ ]](/icons/layout.gif) | 12812_Doorolla Ltd S..> | 2025-11-07 12:09 | 77K | |
![[ ]](/icons/layout.gif) | 13815_Dream Installa..> | 2025-11-11 12:09 | 77K | |
![[ ]](/icons/layout.gif) | 15801_Absolute Garag..> | 2025-11-17 08:46 | 77K | |
![[ ]](/icons/layout.gif) | 3153_Highlands Elect..> | 2025-10-08 13:25 | 77K | |
![[ ]](/icons/layout.gif) | 5661_Doorolla Ltd St..> | 2025-10-16 16:00 | 77K | |
![[ ]](/icons/layout.gif) | 5969_Go Garage Doors..> | 2025-10-17 14:02 | 77K | |
![[ ]](/icons/layout.gif) | 8857_C&M Glass Servi..> | 2025-10-28 11:24 | 77K | |
![[ ]](/icons/layout.gif) | 8860_C&M Glass Servi..> | 2025-10-28 11:24 | 77K | |
![[ ]](/icons/layout.gif) | 13768_Taundry Doors ..> | 2025-11-11 11:12 | 77K | |
![[ ]](/icons/layout.gif) | 13896_CRS Maintenanc..> | 2025-11-11 13:44 | 77K | |
![[ ]](/icons/layout.gif) | 13977_Verdi Home Imp..> | 2025-11-11 14:21 | 77K | |
![[ ]](/icons/layout.gif) | 18280_Windows Plus U..> | 2025-11-21 15:37 | 77K | |
![[ ]](/icons/layout.gif) | 7807_Elevate Doors L..> | 2025-10-24 08:58 | 77K | |
![[ ]](/icons/layout.gif) | 7966_J Brady Garage ..> | 2025-10-24 12:07 | 77K | |
![[ ]](/icons/layout.gif) | 8874_M. A. E. Window..> | 2025-10-28 11:44 | 77K | |
![[ ]](/icons/layout.gif) | 8880_M. A. E. Window..> | 2025-10-28 11:47 | 77K | |
![[ ]](/icons/layout.gif) | 9802_Serenade Home I..> | 2025-10-30 12:54 | 77K | |
![[ ]](/icons/layout.gif) | 14296_MNH Windows & ..> | 2025-11-12 08:45 | 77K | |
![[ ]](/icons/layout.gif) | 17448_Rollermatic Ga..> | 2025-11-20 09:06 | 77K | |
![[ ]](/icons/layout.gif) | 995_JWK Electrical L..> | 2025-09-26 09:44 | 77K | |
![[ ]](/icons/layout.gif) | 1664_MJS Installatio..> | 2025-10-01 15:24 | 77K | |
![[ ]](/icons/layout.gif) | 11904_Colin Adams Wi..> | 2025-11-05 12:45 | 77K | |
![[ ]](/icons/layout.gif) | 1284_Avon Automated ..> | 2025-09-29 14:12 | 77K | |
![[ ]](/icons/layout.gif) | 1337_Avon Automated ..> | 2025-09-30 06:26 | 77K | |
![[ ]](/icons/layout.gif) | 4224_Rollerdoors 24 ..> | 2025-10-13 11:58 | 77K | |
![[ ]](/icons/layout.gif) | 9255_1st Choice Secu..> | 2025-10-29 09:09 | 77K | |
![[ ]](/icons/layout.gif) | 16707_Rhino Windows ..> | 2025-11-18 14:01 | 77K | |
![[ ]](/icons/layout.gif) | 4940_Warnsham Window..> | 2025-10-15 12:07 | 77K | |
![[ ]](/icons/layout.gif) | 5995_CPS Custom Prop..> | 2025-10-17 15:07 | 77K | |
![[ ]](/icons/layout.gif) | 7737_Doors 4 Garages..> | 2025-10-24 07:59 | 77K | |
![[ ]](/icons/layout.gif) | 9663_Rollermatic Gar..> | 2025-10-30 09:52 | 77K | |
![[ ]](/icons/layout.gif) | 9765_Rollermatic Gar..> | 2025-10-30 11:53 | 77K | |
![[ ]](/icons/layout.gif) | 12077_Serenade Home ..> | 2025-11-05 16:14 | 77K | |
![[ ]](/icons/layout.gif) | 18335_Absolute Garag..> | 2025-11-22 10:07 | 77K | |
![[ ]](/icons/layout.gif) | 8672_Doors 4 Garages..> | 2025-10-27 16:58 | 77K | |
![[ ]](/icons/layout.gif) | 9773_Rollermatic Gar..> | 2025-10-30 12:01 | 77K | |
![[ ]](/icons/layout.gif) | 16095_Ross Garage Do..> | 2025-11-17 14:10 | 77K | |
![[ ]](/icons/layout.gif) | 16119_Ross Garage Do..> | 2025-11-17 14:50 | 77K | |
![[ ]](/icons/layout.gif) | 16850_Ace Garage Doo..> | 2025-11-18 16:11 | 77K | |
![[ ]](/icons/layout.gif) | 18273_Oakley Windows..> | 2025-11-21 15:26 | 77K | |
![[ ]](/icons/layout.gif) | 18357_Oakley Windows..> | 2025-11-22 11:35 | 77K | |
![[ ]](/icons/layout.gif) | 1122_East Anglia Rol..> | 2025-09-29 06:54 | 77K | |
![[ ]](/icons/layout.gif) | 10470_Chelmsford Rol..> | 2025-11-03 08:39 | 77K | |
![[ ]](/icons/layout.gif) | 14037_Dream Installa..> | 2025-11-11 15:21 | 77K | |
![[ ]](/icons/layout.gif) | 15697_Faith Home Imp..> | 2025-11-14 16:53 | 77K | |
![[ ]](/icons/layout.gif) | 17912_J Bowman Garag..> | 2025-11-21 08:47 | 77K | |
![[ ]](/icons/layout.gif) | 18485_1st Shield Dar..> | 2025-11-24 09:59 | 77K | |
![[ ]](/icons/layout.gif) | 3072_1st Choice Secu..> | 2025-10-08 10:56 | 77K | |
![[ ]](/icons/layout.gif) | 10379_J Bowman Garag..> | 2025-10-31 13:59 | 77K | |
![[ ]](/icons/layout.gif) | 12825_M. A. E. Windo..> | 2025-11-07 12:53 | 77K | |
![[ ]](/icons/layout.gif) | 12914_Rhino Windows ..> | 2025-11-08 11:40 | 77K | |
![[ ]](/icons/layout.gif) | 795_CPS - Custom Pro..> | 2025-09-24 15:40 | 77K | |
![[ ]](/icons/layout.gif) | 3090_Doors 4 Garages..> | 2025-10-08 11:58 | 77K | |
![[ ]](/icons/layout.gif) | 5484_Doors 4 Garages..> | 2025-10-16 13:42 | 77K | |
![[ ]](/icons/layout.gif) | 13202_Rhino Windows ..> | 2025-11-10 10:29 | 77K | |
![[ ]](/icons/layout.gif) | 8679_Norfolk Broads ..> | 2025-10-28 07:40 | 77K | |
![[ ]](/icons/layout.gif) | 10052_WADE WINDOWS I..> | 2025-10-31 08:31 | 77K | |
![[ ]](/icons/layout.gif) | 11776_Island Home Im..> | 2025-11-05 11:12 | 77K | |
![[ ]](/icons/layout.gif) | 11801_UK Door System..> | 2025-11-05 11:18 | 77K | |
![[ ]](/icons/layout.gif) | 1109_J Bowman Garage..> | 2025-09-26 15:46 | 77K | |
![[ ]](/icons/layout.gif) | 1658_Avon Automated ..> | 2025-10-01 15:04 | 77K | |
![[ ]](/icons/layout.gif) | 10014_Tru-Fit Windo..> | 2025-10-31 07:59 | 77K | |
![[ ]](/icons/layout.gif) | 12909_Shutter Tech U..> | 2025-11-07 16:58 | 77K | |
![[ ]](/icons/layout.gif) | 142_M. A. E. Windows..> | 2025-09-17 15:42 | 77K | |
![[ ]](/icons/layout.gif) | 1106_Rhino Windows A..> | 2025-09-26 15:37 | 77K | |
![[ ]](/icons/layout.gif) | 5645_Doors 4 Garages..> | 2025-10-16 15:30 | 77K | |
![[ ]](/icons/layout.gif) | 14387_DJB Home Impro..> | 2025-11-12 10:29 | 77K | |
![[ ]](/icons/layout.gif) | 805_Doors 4 Garages ..> | 2025-09-24 16:05 | 77K | |
![[ ]](/icons/layout.gif) | 1233_Wellingborough ..> | 2025-09-29 11:35 | 77K | |
![[ ]](/icons/layout.gif) | 1328_Cromer Garage D..> | 2025-09-29 15:41 | 77K | |
![[ ]](/icons/layout.gif) | 1469_Rollermatic Gar..> | 2025-09-30 15:32 | 77K | |
![[ ]](/icons/layout.gif) | 8164_Rhino Windows A..> | 2025-10-27 07:51 | 77K | |
![[ ]](/icons/layout.gif) | 10205_1st Choice Sec..> | 2025-10-31 11:18 | 77K | |
![[ ]](/icons/layout.gif) | 1475_M. A. E. Window..> | 2025-09-30 17:17 | 77K | |
![[ ]](/icons/layout.gif) | 2480_Scotia Garage D..> | 2025-10-06 14:15 | 77K | |
![[ ]](/icons/layout.gif) | 2546_Replacement Gar..> | 2025-10-06 17:00 | 77K | |
![[ ]](/icons/layout.gif) | 4854_Avon Automated ..> | 2025-10-15 09:11 | 77K | |
![[ ]](/icons/layout.gif) | 8067_R Page Concrete..> | 2025-10-24 14:01 | 77K | |
![[ ]](/icons/layout.gif) | 8213_J Brady Garage ..> | 2025-10-27 09:45 | 77K | |
![[ ]](/icons/layout.gif) | 8391_Admiral Home Im..> | 2025-10-27 12:20 | 77K | |
![[ ]](/icons/layout.gif) | 14546_Colin Adams Wi..> | 2025-11-12 12:15 | 77K | |
![[ ]](/icons/layout.gif) | 17918_J Bowman Garag..> | 2025-11-21 08:52 | 77K | |
![[ ]](/icons/layout.gif) | 3910_PB Doors Paul B..> | 2025-10-10 12:57 | 77K | |
![[ ]](/icons/layout.gif) | 8210_J Brady Garage ..> | 2025-10-27 09:42 | 77K | |
![[ ]](/icons/layout.gif) | 9666_Rollermatic Gar..> | 2025-10-30 09:59 | 77K | |
![[ ]](/icons/layout.gif) | 3195_Rhino Windows A..> | 2025-10-08 14:55 | 77K | |
![[ ]](/icons/layout.gif) | 7083_Rollermatic Gar..> | 2025-10-22 14:16 | 77K | |
![[ ]](/icons/layout.gif) | 8185_Rollermatic Gar..> | 2025-10-27 08:56 | 77K | |
![[ ]](/icons/layout.gif) | 8638_J Brady Garage ..> | 2025-10-27 16:11 | 77K | |
![[ ]](/icons/layout.gif) | 8653_Rollermatic Gar..> | 2025-10-27 16:28 | 77K | |
![[ ]](/icons/layout.gif) | 12788_Scotia Garage ..> | 2025-11-07 11:39 | 77K | |
![[ ]](/icons/layout.gif) | 15787_Eastern Frames..> | 2025-11-17 08:01 | 77K | |
![[ ]](/icons/layout.gif) | 15958_Rollermatic Ga..> | 2025-11-17 10:55 | 77K | |
![[ ]](/icons/layout.gif) | 2846_[0,0] DP Insta..> | 2025-10-07 17:37 | 77K | |
![[ ]](/icons/layout.gif) | 3087_Ecosse Garage D..> | 2025-10-08 11:54 | 77K | |
![[ ]](/icons/layout.gif) | 5120_C&M Glass Servi..> | 2025-10-15 15:38 | 77K | |
![[ ]](/icons/layout.gif) | 5278_M. A. E. Window..> | 2025-10-16 09:54 | 77K | |
![[ ]](/icons/layout.gif) | 8603_TND Garage Door..> | 2025-10-27 15:45 | 77K | |
![[ ]](/icons/layout.gif) | 15514_Doorflex Produ..> | 2025-11-14 13:23 | 77K | |
![[ ]](/icons/layout.gif) | 17853_All Door Engin..> | 2025-11-21 07:43 | 77K | |
![[ ]](/icons/layout.gif) | 240_Eco Windows & Do..> | 2025-09-19 07:09 | 77K | |
![[ ]](/icons/layout.gif) | 1216_All Door Engine..> | 2025-09-29 10:39 | 77K | |
![[ ]](/icons/layout.gif) | 1663_Absolute Garage..> | 2025-10-01 15:17 | 77K | |
![[ ]](/icons/layout.gif) | 4401_SDL Door Repair..> | 2025-10-13 15:38 | 77K | |
![[ ]](/icons/layout.gif) | 9525_Norfolk Broads ..> | 2025-10-29 16:21 | 77K | |
![[ ]](/icons/layout.gif) | 9550_Norfolk Broads ..> | 2025-10-29 16:49 | 77K | |
![[ ]](/icons/layout.gif) | 10384_J Bowman Garag..> | 2025-10-31 14:04 | 77K | |
![[ ]](/icons/layout.gif) | 10471_J Bowman Garag..> | 2025-11-03 08:40 | 77K | |
![[ ]](/icons/layout.gif) | 1791_Ace Garage Door..> | 2025-10-02 11:56 | 77K | |
![[ ]](/icons/layout.gif) | 4575_Elevate Doors L..> | 2025-10-14 11:40 | 77K | |
![[ ]](/icons/layout.gif) | 11068_Colin Adams Wi..> | 2025-11-04 07:53 | 77K | |
![[ ]](/icons/layout.gif) | 16123_Wellingborough..> | 2025-11-17 14:56 | 77K | |
![[ ]](/icons/layout.gif) | 16201_Wellingborough..> | 2025-11-17 16:15 | 77K | |
![[ ]](/icons/layout.gif) | 16647_Rollermatic Ga..> | 2025-11-18 13:20 | 77K | |
![[ ]](/icons/layout.gif) | 17089_RH Doors & Shu..> | 2025-11-19 09:51 | 77K | |
![[ ]](/icons/layout.gif) | 17151_Rollermatic Ga..> | 2025-11-19 11:12 | 77K | |
![[ ]](/icons/layout.gif) | 17440_Rollermatic Ga..> | 2025-11-20 08:53 | 77K | |
![[ ]](/icons/layout.gif) | 17928_J Bowman Garag..> | 2025-11-21 08:55 | 77K | |
![[ ]](/icons/layout.gif) | 1587_[0,0] Turners ..> | 2025-10-01 11:09 | 77K | |
![[ ]](/icons/layout.gif) | 7954_Millcourt Prope..> | 2025-10-24 11:53 | 77K | |
![[ ]](/icons/layout.gif) | 11848_Scotia Garage ..> | 2025-11-05 11:55 | 77K | |
![[ ]](/icons/layout.gif) | 14865_Tilehurst Home..> | 2025-11-13 09:52 | 77K | |
![[ ]](/icons/layout.gif) | 16014_The Garage Doo..> | 2025-11-17 12:01 | 77K | |
![[ ]](/icons/layout.gif) | 7168_T D Rollerdoors..> | 2025-10-23 06:27 | 77K | |
![[ ]](/icons/layout.gif) | 5588_Chelmsford Roll..> | 2025-10-16 14:27 | 77K | |
![[ ]](/icons/layout.gif) | 8026_Rollermatic Gar..> | 2025-10-24 12:59 | 77K | |
![[ ]](/icons/layout.gif) | 8211_Rollermatic Gar..> | 2025-10-27 09:44 | 77K | |
![[ ]](/icons/layout.gif) | 14297_Elegant Window..> | 2025-11-12 08:50 | 77K | |
![[ ]](/icons/layout.gif) | 15355_Heavy Metal En..> | 2025-11-14 09:46 | 77K | |
![[ ]](/icons/layout.gif) | 151_Garage Door Solu..> | 2025-09-17 16:37 | 77K | |
![[ ]](/icons/layout.gif) | 260_Eco Windows & Do..> | 2025-09-19 08:53 | 77K | |
![[ ]](/icons/layout.gif) | 5608_Chelmsford Roll..> | 2025-10-16 14:45 | 77K | |
![[ ]](/icons/layout.gif) | 5822_Chelmsford Roll..> | 2025-10-17 10:54 | 77K | |
![[ ]](/icons/layout.gif) | 8019_Gilberts Home I..> | 2025-10-24 12:52 | 77K | |
![[ ]](/icons/layout.gif) | 15671_Barry Whitehea..> | 2025-11-14 15:20 | 77K | |
![[ ]](/icons/layout.gif) | 16250_Barry Whitehea..> | 2025-11-18 07:56 | 77K | |
![[ ]](/icons/layout.gif) | 1078_AAES Electrical..> | 2025-09-26 13:23 | 77K | |
![[ ]](/icons/layout.gif) | 1194_J Bowman Garage..> | 2025-09-29 09:35 | 77K | |
![[ ]](/icons/layout.gif) | 1203_Rollermatic Gar..> | 2025-09-29 09:53 | 77K | |
![[ ]](/icons/layout.gif) | 7760_Avon Automated ..> | 2025-10-24 08:33 | 77K | |
![[ ]](/icons/layout.gif) | 15746_M. A. E. Windo..> | 2025-11-15 13:03 | 77K | |
![[ ]](/icons/layout.gif) | 18450_Chelmsford Rol..> | 2025-11-24 08:55 | 77K | |
![[ ]](/icons/layout.gif) | 12012_Chelmsford Rol..> | 2025-11-05 14:46 | 77K | |
![[ ]](/icons/layout.gif) | 9950_DJB Home Improv..> | 2025-10-30 16:09 | 77K | |
![[ ]](/icons/layout.gif) | 11030_DJB Home Impro..> | 2025-11-03 16:27 | 77K | |
![[ ]](/icons/layout.gif) | 11718_Avon Automated..> | 2025-11-05 10:25 | 77K | |
![[ ]](/icons/layout.gif) | 14772_MNH Windows & ..> | 2025-11-13 08:46 | 77K | |
![[ ]](/icons/layout.gif) | 17105_P & R Door Sys..> | 2025-11-19 10:21 | 77K | |
![[ ]](/icons/layout.gif) | 6884_Doors 4 You Ltd..> | 2025-10-22 10:37 | 77K | |
![[ ]](/icons/layout.gif) | 10482_Chelmsford Rol..> | 2025-11-03 08:51 | 77K | |
![[ ]](/icons/layout.gif) | 14123_Securi-Doors S..> | 2025-11-11 16:36 | 77K | |
![[ ]](/icons/layout.gif) | 15984_Sargent & Powe..> | 2025-11-17 11:35 | 77K | |
![[ ]](/icons/layout.gif) | 514_Roll Right Garag..> | 2025-09-23 08:41 | 77K | |
![[ ]](/icons/layout.gif) | 1056_Access Door Ser..> | 2025-09-26 13:00 | 77K | |
![[ ]](/icons/layout.gif) | 1213_Rollermatic Gar..> | 2025-09-29 10:25 | 77K | |
![[ ]](/icons/layout.gif) | 6101_East Anglia Rol..> | 2025-10-20 09:26 | 77K | |
![[ ]](/icons/layout.gif) | 6946_East Anglia Rol..> | 2025-10-22 12:16 | 77K | |
![[ ]](/icons/layout.gif) | 7631_The Garage Door..> | 2025-10-23 15:34 | 77K | |
![[ ]](/icons/layout.gif) | 14203_The Garage Doo..> | 2025-11-12 07:50 | 77K | |
![[ ]](/icons/layout.gif) | 16015_The Garage Doo..> | 2025-11-17 12:03 | 77K | |
![[ ]](/icons/layout.gif) | 1039_Avon Automated ..> | 2025-09-26 12:16 | 77K | |
![[ ]](/icons/layout.gif) | 9529_Absolute Garage..> | 2025-10-29 16:24 | 77K | |
![[ ]](/icons/layout.gif) | 12856_CRS Maintenanc..> | 2025-11-07 14:10 | 77K | |
![[ ]](/icons/layout.gif) | 12929_Elevate Doors ..> | 2025-11-08 15:13 | 77K | |
![[ ]](/icons/layout.gif) | 14480_The Garage Doo..> | 2025-11-12 11:42 | 77K | |
![[ ]](/icons/layout.gif) | 14684_Adams Industri..> | 2025-11-12 15:29 | 77K | |
![[ ]](/icons/layout.gif) | 512_Roll Right Garag..> | 2025-09-23 08:35 | 77K | |
![[ ]](/icons/layout.gif) | 1088_Access Door Ser..> | 2025-09-26 14:33 | 77K | |
![[ ]](/icons/layout.gif) | 4166_Ace Garage Door..> | 2025-10-13 10:52 | 77K | |
![[ ]](/icons/layout.gif) | 10491_Chelmsford Rol..> | 2025-11-03 09:01 | 77K | |
![[ ]](/icons/layout.gif) | 15268_Chelmsford Rol..> | 2025-11-14 08:40 | 77K | |
![[ ]](/icons/layout.gif) | 15911_Hadrian Joiner..> | 2025-11-17 10:22 | 77K | |
![[ ]](/icons/layout.gif) | 2841_Fixed Abode Gar..> | 2025-10-07 16:03 | 77K | |
![[ ]](/icons/layout.gif) | 5261_Fixed Abode Gar..> | 2025-10-16 09:15 | 77K | |
![[ ]](/icons/layout.gif) | 11394_Wellingborough..> | 2025-11-04 13:46 | 77K | |
![[ ]](/icons/layout.gif) | 15366_TCR Sussex Ltd..> | 2025-11-14 10:15 | 77K | |
![[ ]](/icons/layout.gif) | 17886_Avon Automated..> | 2025-11-21 08:14 | 77K | |
![[ ]](/icons/layout.gif) | 4115_Windowcraft Des..> | 2025-10-13 09:56 | 77K | |
![[ ]](/icons/layout.gif) | 4415_Ace Garage Door..> | 2025-10-14 06:50 | 77K | |
![[ ]](/icons/layout.gif) | 5277_Enlightened Sol..> | 2025-10-16 09:47 | 77K | |
![[ ]](/icons/layout.gif) | 7702_SW Trade Frames..> | 2025-10-24 07:24 | 77K | |
![[ ]](/icons/layout.gif) | 14682_Adams Industri..> | 2025-11-12 15:27 | 77K | |
![[ ]](/icons/layout.gif) | 15794_Absolute Garag..> | 2025-11-17 08:36 | 77K | |
![[ ]](/icons/layout.gif) | 17473_Warnsham Windo..> | 2025-11-20 09:23 | 77K | |
![[ ]](/icons/layout.gif) | 2552_M. A. E. Window..> | 2025-10-07 06:58 | 77K | |
![[ ]](/icons/layout.gif) | 5272_Enlightened Sol..> | 2025-10-16 09:39 | 77K | |
![[ ]](/icons/layout.gif) | 13694_Replacement Ga..> | 2025-11-11 10:08 | 77K | |
![[ ]](/icons/layout.gif) | 14525_Elevate Doors ..> | 2025-11-12 12:05 | 77K | |
![[ ]](/icons/layout.gif) | 14846_Adams Industri..> | 2025-11-13 09:47 | 77K | |
![[ ]](/icons/layout.gif) | 18115_Scotia Garage ..> | 2025-11-21 11:34 | 77K | |
![[ ]](/icons/layout.gif) | 8368_CWG Home Improv..> | 2025-10-27 12:05 | 77K | |
![[ ]](/icons/layout.gif) | 12572_UK Door System..> | 2025-11-06 16:42 | 77K | |
![[ ]](/icons/layout.gif) | 13170_East Anglia Ro..> | 2025-11-10 09:48 | 77K | |
![[ ]](/icons/layout.gif) | 686_Ross Garage Door..> | 2025-09-24 08:53 | 77K | |
![[ ]](/icons/layout.gif) | 3841_Eastern Frames ..> | 2025-10-10 12:21 | 77K | |
![[ ]](/icons/layout.gif) | 8676_Doors 4 Garages..> | 2025-10-27 17:03 | 77K | |
![[ ]](/icons/layout.gif) | 8677_Doors 4 Garages..> | 2025-10-27 17:06 | 77K | |
![[ ]](/icons/layout.gif) | 11050_RDM Engineerin..> | 2025-11-04 07:38 | 77K | |
![[ ]](/icons/layout.gif) | 18341_Absolute Garag..> | 2025-11-22 10:30 | 77K | |
![[ ]](/icons/layout.gif) | 4910_Danbury Garage ..> | 2025-10-15 10:59 | 77K | |
![[ ]](/icons/layout.gif) | 17958_Rollermatic Ga..> | 2025-11-21 09:09 | 77K | |
![[ ]](/icons/layout.gif) | 6148_Midland Garage ..> | 2025-10-20 10:55 | 77K | |
![[ ]](/icons/layout.gif) | 3278_TH Installation..> | 2025-10-09 07:00 | 77K | |
![[ ]](/icons/layout.gif) | 9144_CPS Custom Prop..> | 2025-10-29 08:25 | 77K | |
![[ ]](/icons/layout.gif) | 16049_Reklaw WF11 0F..> | 2025-11-17 13:16 | 77K | |
![[ ]](/icons/layout.gif) | 16121_Wellingborough..> | 2025-11-17 14:55 | 77K | |
![[ ]](/icons/layout.gif) | 16203_Wellingborough..> | 2025-11-17 16:17 | 77K | |
![[ ]](/icons/layout.gif) | 17811_DP Installatio..> | 2025-11-20 16:51 | 77K | |
![[ ]](/icons/layout.gif) | 2700_MJS Installatio..> | 2025-10-07 10:57 | 77K | |
![[ ]](/icons/layout.gif) | 4126_[0,0] Andy Sedd..> | 2025-10-13 10:08 | 77K | |
![[ ]](/icons/layout.gif) | 8496_Highlands Elect..> | 2025-10-27 13:48 | 77K | |
![[ ]](/icons/layout.gif) | 17961_Rollermatic Ga..> | 2025-11-21 09:12 | 77K | |
![[ ]](/icons/layout.gif) | 5431_Avon Automated ..> | 2025-10-16 12:51 | 77K | |
![[ ]](/icons/layout.gif) | 5994_CPS Custom Prop..> | 2025-10-17 15:07 | 77K | |
![[ ]](/icons/layout.gif) | 9147_Adams Industria..> | 2025-10-29 08:32 | 77K | |
![[ ]](/icons/layout.gif) | 490_Roll Right Garag..> | 2025-09-23 07:51 | 77K | |
![[ ]](/icons/layout.gif) | 3980_M. A. E. Window..> | 2025-10-10 15:39 | 77K | |
![[ ]](/icons/layout.gif) | 8196_P & R Door Syst..> | 2025-10-27 09:24 | 77K | |
![[ ]](/icons/layout.gif) | 8202_Rollermatic Gar..> | 2025-10-27 09:31 | 77K | |
![[ ]](/icons/layout.gif) | 12870_Norfolk Roller..> | 2025-11-07 14:56 | 77K | |
![[ ]](/icons/layout.gif) | 14604_Rhino Windows ..> | 2025-11-12 13:37 | 77K | |
![[ ]](/icons/layout.gif) | 17990_Go Garage Door..> | 2025-11-21 09:37 | 77K | |
![[ ]](/icons/layout.gif) | 8960_Warnsham Window..> | 2025-10-28 13:51 | 77K | |
![[ ]](/icons/layout.gif) | 17229_Elevate Doors ..> | 2025-11-19 12:39 | 77K | |
![[ ]](/icons/layout.gif) | 3340_[0,0] Derek Lar..> | 2025-10-09 08:44 | 77K | |
![[ ]](/icons/layout.gif) | 11192_Warnsham Windo..> | 2025-11-04 11:11 | 77K | |
![[ ]](/icons/layout.gif) | 13775_Securi-Doors S..> | 2025-11-11 11:16 | 77K | |
![[ ]](/icons/layout.gif) | 868_Garage Door Repa..> | 2025-09-25 11:57 | 77K | |
![[ ]](/icons/layout.gif) | 1101_Doors 4 Garages..> | 2025-09-26 15:24 | 77K | |
![[ ]](/icons/layout.gif) | 1252_AAES Electrical..> | 2025-09-29 12:55 | 77K | |
![[ ]](/icons/layout.gif) | 4427_Garage Door Sol..> | 2025-10-14 07:52 | 77K | |
![[ ]](/icons/layout.gif) | 8173_Fortress Doors ..> | 2025-10-27 08:36 | 77K | |
![[ ]](/icons/layout.gif) | 16490_Chelmsford Rol..> | 2025-11-18 10:23 | 77K | |
![[ ]](/icons/layout.gif) | 17711_Ace Garage Doo..> | 2025-11-20 15:13 | 77K | |
![[ ]](/icons/layout.gif) | 18041_Ace Garage Doo..> | 2025-11-21 10:27 | 77K | |
![[ ]](/icons/layout.gif) | 1435_[0,0] SDL Door..> | 2025-09-30 13:45 | 77K | |
![[ ]](/icons/layout.gif) | 2715_Rollermatic Gar..> | 2025-10-07 11:28 | 77K | |
![[ ]](/icons/layout.gif) | 6367_AOS Outdoor Kit..> | 2025-10-20 15:07 | 77K | |
![[ ]](/icons/layout.gif) | 9806_Roll Right Gara..> | 2025-10-30 13:09 | 77K | |
![[ ]](/icons/layout.gif) | 15270_J Brady Garage..> | 2025-11-14 08:41 | 77K | |
![[ ]](/icons/layout.gif) | 6811_JDL Plumbing Jo..> | 2025-10-22 08:54 | 77K | |
![[ ]](/icons/layout.gif) | 9259_Doors 4 You Ltd..> | 2025-10-29 09:13 | 77K | |
![[ ]](/icons/layout.gif) | 9341_Garage Door Sol..> | 2025-10-29 11:59 | 77K | |
![[ ]](/icons/layout.gif) | 16122_Wellingborough..> | 2025-11-17 14:56 | 77K | |
![[ ]](/icons/layout.gif) | 16202_Wellingborough..> | 2025-11-17 16:16 | 77K | |
![[ ]](/icons/layout.gif) | 17207_NTRAP NR11 7NZ..> | 2025-11-19 11:59 | 77K | |
![[ ]](/icons/layout.gif) | 533_Garage Door Repa..> | 2025-09-23 10:31 | 77K | |
![[ ]](/icons/layout.gif) | 759_Garage Door Repa..> | 2025-09-24 13:09 | 77K | |
![[ ]](/icons/layout.gif) | 5127_The Garage Door..> | 2025-10-15 15:42 | 77K | |
![[ ]](/icons/layout.gif) | 15047_SDS (Isle Of M..> | 2025-11-13 13:52 | 77K | |
![[ ]](/icons/layout.gif) | 15696_Heavy Metal En..> | 2025-11-14 16:49 | 77K | |
![[ ]](/icons/layout.gif) | 16428_Millcourt Prop..> | 2025-11-18 09:33 | 77K | |
![[ ]](/icons/layout.gif) | 5121_The Garage Door..> | 2025-10-15 15:38 | 77K | |
![[ ]](/icons/layout.gif) | 13827_Tru-Fit Windo..> | 2025-11-11 12:27 | 77K | |
![[ ]](/icons/layout.gif) | 1102_Elevate Doors L..> | 2025-09-26 15:28 | 77K | |
![[ ]](/icons/layout.gif) | 2710_Ideal Industria..> | 2025-10-07 11:19 | 77K | |
![[ ]](/icons/layout.gif) | 3250_Ideal Industria..> | 2025-10-08 17:15 | 77K | |
![[ ]](/icons/layout.gif) | 13316_Go Garage Door..> | 2025-11-10 12:55 | 77K | |
![[ ]](/icons/layout.gif) | 18562_Thomas Andrew ..> | 2025-11-24 11:24 | 77K | |
![[ ]](/icons/layout.gif) | 5074_Rollermatic Gar..> | 2025-10-15 15:06 | 77K | |
![[ ]](/icons/layout.gif) | 15160_SDL Door Repai..> | 2025-11-13 17:00 | 77K | |
![[ ]](/icons/layout.gif) | 1004_Highlands Elect..> | 2025-09-26 10:51 | 77K | |
![[ ]](/icons/layout.gif) | 2273_Ideal Industria..> | 2025-10-06 10:20 | 77K | |
![[ ]](/icons/layout.gif) | 3196_Rhino Windows A..> | 2025-10-08 15:07 | 77K | |
![[ ]](/icons/layout.gif) | 5366_Avon Automated ..> | 2025-10-16 11:59 | 77K | |
![[ ]](/icons/layout.gif) | 5824_Absolute Garage..> | 2025-10-17 10:55 | 77K | |
![[ ]](/icons/layout.gif) | 5828_Absolute Garage..> | 2025-10-17 11:00 | 77K | |
![[ ]](/icons/layout.gif) | 12079_Chelmsford Rol..> | 2025-11-05 16:17 | 77K | |
![[ ]](/icons/layout.gif) | 17986_MNH Windows & ..> | 2025-11-21 09:31 | 77K | |
![[ ]](/icons/layout.gif) | 2264_Absolute Garage..> | 2025-10-06 10:04 | 77K | |
![[ ]](/icons/layout.gif) | 3619_Elevate Doors L..> | 2025-10-09 15:05 | 77K | |
![[ ]](/icons/layout.gif) | 17884_Monmouthshire ..> | 2025-11-21 08:04 | 77K | |
![[ ]](/icons/layout.gif) | 2839_Elevate Doors L..> | 2025-10-07 15:59 | 77K | |
![[ ]](/icons/layout.gif) | 18454_Chelmsford Rol..> | 2025-11-24 09:00 | 77K | |
![[ ]](/icons/layout.gif) | 2550_Windowcraft Des..> | 2025-10-07 06:56 | 77K | |
![[ ]](/icons/layout.gif) | 6905_A.S.M Windows L..> | 2025-10-22 11:07 | 77K | |
![[ ]](/icons/layout.gif) | 10709_RDM Engineerin..> | 2025-11-03 11:19 | 77K | |
![[ ]](/icons/layout.gif) | 12264_Chelmsford Rol..> | 2025-11-06 11:21 | 77K | |
![[ ]](/icons/layout.gif) | 17979_Warnsham Windo..> | 2025-11-21 09:20 | 77K | |
![[ ]](/icons/layout.gif) | 6924_A Complete Wind..> | 2025-10-22 11:38 | 77K | |
![[ ]](/icons/layout.gif) | 7766_Taundry Doors W..> | 2025-10-24 08:40 | 77K | |
![[ ]](/icons/layout.gif) | 7901_Enlightened Sol..> | 2025-10-24 10:29 | 77K | |
![[ ]](/icons/layout.gif) | 12088_Rollermatic Ga..> | 2025-11-05 16:42 | 77K | |
![[ ]](/icons/layout.gif) | 15690_DP Installatio..> | 2025-11-14 16:10 | 77K | |
![[ ]](/icons/layout.gif) | 516_M & S Home Insta..> | 2025-09-23 08:44 | 77K | |
![[ ]](/icons/layout.gif) | 2349_Windowcraft Des..> | 2025-10-06 11:36 | 77K | |
![[ ]](/icons/layout.gif) | 6138_B&B Electrical ..> | 2025-10-20 10:28 | 77K | |
![[ ]](/icons/layout.gif) | 12863_J Bowman Garag..> | 2025-11-07 14:25 | 77K | |
![[ ]](/icons/layout.gif) | 17472_PDL Fabricatio..> | 2025-11-20 09:22 | 77K | |
![[ ]](/icons/layout.gif) | 8012_J Brady Garage ..> | 2025-10-24 12:44 | 77K | |
![[ ]](/icons/layout.gif) | 18515_EcoGlaze Group..> | 2025-11-24 10:08 | 77K | |
![[ ]](/icons/layout.gif) | 1220_Ross Garage Doo..> | 2025-09-29 11:00 | 77K | |
![[ ]](/icons/layout.gif) | 2835_P & R Door Syst..> | 2025-10-07 15:36 | 77K | |
![[ ]](/icons/layout.gif) | 8138_Ace Garage Door..> | 2025-10-25 11:12 | 77K | |
![[ ]](/icons/layout.gif) | 9967_Taundry Doors W..> | 2025-10-30 16:25 | 77K | |
![[ ]](/icons/layout.gif) | 11048_T D Rollerdoor..> | 2025-11-04 07:11 | 77K | |
![[ ]](/icons/layout.gif) | 852_Heavy Metal Engi..> | 2025-09-25 10:35 | 77K | |
![[ ]](/icons/layout.gif) | 991_J Brady Garage D..> | 2025-09-26 08:51 | 77K | |
![[ ]](/icons/layout.gif) | 1462_The Lothian Gar..> | 2025-09-30 15:10 | 77K | |
![[ ]](/icons/layout.gif) | 6096_B&B Electrical ..> | 2025-10-20 09:05 | 77K | |
![[ ]](/icons/layout.gif) | 9515_Absolute Garage..> | 2025-10-29 16:08 | 77K | |
![[ ]](/icons/layout.gif) | 13166_Norfolk Roller..> | 2025-11-10 09:43 | 77K | |
![[ ]](/icons/layout.gif) | 14570_Adams Industri..> | 2025-11-12 12:53 | 77K | |
![[ ]](/icons/layout.gif) | 17386_EcoGlaze Group..> | 2025-11-19 16:24 | 77K | |
![[ ]](/icons/layout.gif) | 9714_Roll Right Gara..> | 2025-10-30 10:41 | 77K | |
![[ ]](/icons/layout.gif) | 15691_A Complete Win..> | 2025-11-14 16:11 | 77K | |
![[ ]](/icons/layout.gif) | 1790_Elegant Windows..> | 2025-10-02 11:39 | 77K | |
![[ ]](/icons/layout.gif) | 9803_Roll Right Gara..> | 2025-10-30 13:01 | 77K | |
![[ ]](/icons/layout.gif) | 6882_Garage Door Sol..> | 2025-10-22 10:29 | 77K | |
![[ ]](/icons/layout.gif) | 6418_Go Garage Doors..> | 2025-10-21 08:46 | 77K | |
![[ ]](/icons/layout.gif) | 7907_Wellingborough ..> | 2025-10-24 10:45 | 77K | |
![[ ]](/icons/layout.gif) | 8435_Wellingborough ..> | 2025-10-27 13:20 | 77K | |
![[ ]](/icons/layout.gif) | 8437_Wellingborough ..> | 2025-10-27 13:21 | 77K | |
![[ ]](/icons/layout.gif) | 13361_Eastern Frames..> | 2025-11-10 14:04 | 77K | |
![[ ]](/icons/layout.gif) | 17471_PDL Fabricatio..> | 2025-11-20 09:20 | 77K | |
![[ ]](/icons/layout.gif) | 18543_Rollermatic Ga..> | 2025-11-24 10:57 | 77K | |
![[ ]](/icons/layout.gif) | 9805_Roll Right Gara..> | 2025-10-30 13:03 | 77K | |
![[ ]](/icons/layout.gif) | 5809_Windowcraft Des..> | 2025-10-17 10:30 | 77K | |
![[ ]](/icons/layout.gif) | 14277_Elegant Window..> | 2025-11-12 08:25 | 77K | |
![[ ]](/icons/layout.gif) | 6467_Go Garage Doors..> | 2025-10-21 10:35 | 77K | |
![[ ]](/icons/layout.gif) | 9695_Roll Right Gara..> | 2025-10-30 10:14 | 77K | |
![[ ]](/icons/layout.gif) | 15751_T D Rollerdoor..> | 2025-11-17 07:09 | 77K | |
![[ ]](/icons/layout.gif) | 16245_T D Rollerdoor..> | 2025-11-18 07:06 | 77K | |
![[ ]](/icons/layout.gif) | 6926_Rollermatic Gar..> | 2025-10-22 11:46 | 77K | |
![[ ]](/icons/layout.gif) | 10011_Tru-Fit Windo..> | 2025-10-31 07:53 | 77K | |
![[ ]](/icons/layout.gif) | 15201_Adams Industri..> | 2025-11-14 07:47 | 77K | |
![[ ]](/icons/layout.gif) | 15737_T D Rollerdoor..> | 2025-11-15 12:36 | 77K | |
![[ ]](/icons/layout.gif) | 16666_M. A. E. Windo..> | 2025-11-18 13:40 | 77K | |
![[ ]](/icons/layout.gif) | 17767_Wellingborough..> | 2025-11-20 16:02 | 77K | |
![[ ]](/icons/layout.gif) | 1003_Highlands Elect..> | 2025-09-26 10:48 | 77K | |
![[ ]](/icons/layout.gif) | 2775_Ideal Industria..> | 2025-10-07 13:41 | 77K | |
![[ ]](/icons/layout.gif) | 3714_Ideal Industria..> | 2025-10-10 08:16 | 77K | |
![[ ]](/icons/layout.gif) | 17766_Wellingborough..> | 2025-11-20 16:02 | 77K | |
![[ ]](/icons/layout.gif) | 2553_Elegant Windows..> | 2025-10-07 07:04 | 77K | |
![[ ]](/icons/layout.gif) | 8141_Beaver Plastic ..> | 2025-10-25 11:18 | 77K | |
![[ ]](/icons/layout.gif) | 6232_Elevate Doors L..> | 2025-10-20 13:04 | 77K | |
![[ ]](/icons/layout.gif) | 18267_NTRAP NR11 7NZ..> | 2025-11-21 15:03 | 77K | |
![[ ]](/icons/layout.gif) | 13319_Go Garage Door..> | 2025-11-10 12:58 | 77K | |
![[ ]](/icons/layout.gif) | 13604_East Anglia Ro..> | 2025-11-11 08:39 | 77K | |
![[ ]](/icons/layout.gif) | 137_Warnsham Windows..> | 2025-09-17 15:32 | 77K | |
![[ ]](/icons/layout.gif) | 2716_Rollermatic Gar..> | 2025-10-07 11:30 | 77K | |
![[ ]](/icons/layout.gif) | 6142_Midland Garage ..> | 2025-10-20 10:49 | 77K | |
![[ ]](/icons/layout.gif) | 12231_Avon Automated..> | 2025-11-06 10:43 | 77K | |
![[ ]](/icons/layout.gif) | 12961_TH Installatio..> | 2025-11-10 07:18 | 77K | |
![[ ]](/icons/layout.gif) | 3620_[0,0] Mark Perh..> | 2025-10-09 15:05 | 77K | |
![[ ]](/icons/layout.gif) | 9985_Taundry Doors W..> | 2025-10-30 16:54 | 77K | |
![[ ]](/icons/layout.gif) | 9511_Go Garage Doors..> | 2025-10-29 15:55 | 77K | |
![[ ]](/icons/layout.gif) | 9696_Roll Right Gara..> | 2025-10-30 10:22 | 77K | |
![[ ]](/icons/layout.gif) | 781_Gallagher Mainte..> | 2025-09-24 14:48 | 77K | |
![[ ]](/icons/layout.gif) | 958_Ace Garage Doors..> | 2025-09-26 07:27 | 77K | |
![[ ]](/icons/layout.gif) | 1095_Herts & Essex G..> | 2025-09-26 15:04 | 77K | |
![[ ]](/icons/layout.gif) | 17078_Wellingborough..> | 2025-11-19 09:27 | 77K | |
![[ ]](/icons/layout.gif) | 17765_Wellingborough..> | 2025-11-20 16:01 | 77K | |
![[ ]](/icons/layout.gif) | 8664_Avon Automated ..> | 2025-10-27 16:43 | 77K | |
![[ ]](/icons/layout.gif) | 13362_Eastern Frames..> | 2025-11-10 14:07 | 77K | |
![[ ]](/icons/layout.gif) | 15113_M. A. E. Windo..> | 2025-11-13 15:50 | 77K | |
![[ ]](/icons/layout.gif) | 7178_Beaver Plastic ..> | 2025-10-23 07:25 | 77K | |
![[ ]](/icons/layout.gif) | 15800_SDS (Isle Of M..> | 2025-11-17 08:43 | 77K | |
![[ ]](/icons/layout.gif) | 17888_The Lothian Ga..> | 2025-11-21 08:26 | 77K | |
![[ ]](/icons/layout.gif) | 13692_Wellingborough..> | 2025-11-11 10:08 | 77K | |
![[ ]](/icons/layout.gif) | 9501_Go Garage Doors..> | 2025-10-29 15:46 | 77K | |
![[ ]](/icons/layout.gif) | 8149_Shutter Tech UK..> | 2025-10-25 11:38 | 77K | |
![[ ]](/icons/layout.gif) | 11246_EcoGlaze Group..> | 2025-11-04 11:49 | 77K | |
![[ ]](/icons/layout.gif) | 8043_The Lothian Gar..> | 2025-10-24 13:21 | 77K | |
![[ ]](/icons/layout.gif) | 14109_UK Door System..> | 2025-11-11 16:18 | 77K | |
![[ ]](/icons/layout.gif) | 2236_Rollermatic Gar..> | 2025-10-06 08:41 | 77K | |
![[ ]](/icons/layout.gif) | 9355_Garage Door Sol..> | 2025-10-29 12:25 | 77K | |
![[ ]](/icons/layout.gif) | 7406_Elevate Doors L..> | 2025-10-23 11:46 | 77K | |
![[ ]](/icons/layout.gif) | 18445_Avon Automated..> | 2025-11-24 08:49 | 77K | |
![[ ]](/icons/layout.gif) | 6731_NW Automatic Do..> | 2025-10-22 07:32 | 77K | |
![[ ]](/icons/layout.gif) | 8604_Chelmsford Roll..> | 2025-10-27 15:50 | 77K | |
![[ ]](/icons/layout.gif) | 9757_M. A. E. Window..> | 2025-10-30 11:45 | 77K | |
![[ ]](/icons/layout.gif) | 16065_Hadrian Joiner..> | 2025-11-17 13:21 | 77K | |
![[ ]](/icons/layout.gif) | 6132_Fortress Doors ..> | 2025-10-20 10:12 | 77K | |
![[ ]](/icons/layout.gif) | 6880_Avon Automated ..> | 2025-10-22 10:26 | 77K | |
![[ ]](/icons/layout.gif) | 12571_EcoGlaze Group..> | 2025-11-06 16:42 | 77K | |
![[ ]](/icons/layout.gif) | 18281_Windows Plus U..> | 2025-11-21 15:38 | 77K | |
![[ ]](/icons/layout.gif) | 9436_Taundry Doors W..> | 2025-10-29 14:34 | 77K | |
![[ ]](/icons/layout.gif) | 18340_Go Garage Door..> | 2025-11-22 10:19 | 77K | |
![[ ]](/icons/layout.gif) | 8565_AOS Outdoor Kit..> | 2025-10-27 14:57 | 77K | |
![[ ]](/icons/layout.gif) | 6727_NW Automatic Do..> | 2025-10-22 07:27 | 77K | |
![[ ]](/icons/layout.gif) | 6857_Absolute Garage..> | 2025-10-22 10:06 | 77K | |
![[ ]](/icons/layout.gif) | 7959_Taundry Doors W..> | 2025-10-24 12:05 | 77K | |
![[ ]](/icons/layout.gif) | 9358_Taundry Doors W..> | 2025-10-29 12:53 | 77K | |
![[ ]](/icons/layout.gif) | 13989_Piper Window S..> | 2025-11-11 14:33 | 77K | |
![[ ]](/icons/layout.gif) | 11215_Oakley Windows..> | 2025-11-04 11:37 | 77K | |
![[ ]](/icons/layout.gif) | 12855_CRS Maintenanc..> | 2025-11-07 14:04 | 77K | |
![[ ]](/icons/layout.gif) | 8144_Garage Door Sol..> | 2025-10-25 11:30 | 77K | |
![[ ]](/icons/layout.gif) | 18619_Oakley Windows..> | 2025-11-24 12:24 | 77K | |
![[ ]](/icons/layout.gif) | 17081_Wellingborough..> | 2025-11-19 09:33 | 77K | |
![[ ]](/icons/layout.gif) | 10979_Garage Door So..> | 2025-11-03 15:40 | 77K | |
![[ ]](/icons/layout.gif) | 18556_Rollermatic Ga..> | 2025-11-24 11:06 | 77K | |
![[ ]](/icons/layout.gif) | 14831_The Lothian Ga..> | 2025-11-13 09:33 | 77K | |
![[ ]](/icons/layout.gif) | 8044_The Lothian Gar..> | 2025-10-24 13:21 | 77K | |
![[ ]](/icons/layout.gif) | 12068_The Lothian Ga..> | 2025-11-05 15:56 | 77K | |
![[ ]](/icons/layout.gif) | 329_Ideal Industrial..> | 2025-09-19 14:49 | 77K | |
![[ ]](/icons/layout.gif) | 7269_Garage Door Sol..> | 2025-10-23 10:14 | 77K | |
![[ ]](/icons/layout.gif) | 7981_Heavy Metal Eng..> | 2025-10-24 12:28 | 77K | |
![[ ]](/icons/layout.gif) | 8654_Avon Automated ..> | 2025-10-27 16:32 | 77K | |
![[ ]](/icons/layout.gif) | 9357_Garage Door Sol..> | 2025-10-29 12:48 | 77K | |
![[ ]](/icons/layout.gif) | 12226_Ideal Industri..> | 2025-11-06 10:29 | 77K | |
![[ ]](/icons/layout.gif) | 8550_Heavy Metal Eng..> | 2025-10-27 14:42 | 77K | |
![[ ]](/icons/layout.gif) | 15694_Tru-Fit Window..> | 2025-11-14 16:35 | 77K | |
![[ ]](/icons/layout.gif) | 3720_Garage Door Sol..> | 2025-10-10 08:29 | 77K | |
![[ ]](/icons/layout.gif) | 13315_MCR Building M..> | 2025-11-10 12:47 | 77K | |
![[ ]](/icons/layout.gif) | 15688_Tru-Fit Window..> | 2025-11-14 15:54 | 77K | |
![[ ]](/icons/layout.gif) | 9839_M. A. E. Window..> | 2025-10-30 13:40 | 77K | |
![[ ]](/icons/layout.gif) | 13122_Tru-Fit Window..> | 2025-11-10 09:13 | 77K | |
![[ ]](/icons/layout.gif) | 5482_Absolute Garage..> | 2025-10-16 13:40 | 77K | |
![[ ]](/icons/layout.gif) | 2661_Elegant Windows..> | 2025-10-07 09:50 | 77K | |
![[ ]](/icons/layout.gif) | 8133_Garage Door Sol..> | 2025-10-25 10:57 | 77K | |
![[ ]](/icons/layout.gif) | 4093_The Lothian Gar..> | 2025-10-13 09:13 | 77K | |
![[ ]](/icons/layout.gif) | 13967_Go Garage Door..> | 2025-11-11 14:14 | 77K | |
![[ ]](/icons/layout.gif) | 4278_Chelmsford Roll..> | 2025-10-13 13:10 | 77K | |
![[ ]](/icons/layout.gif) | 5960_Go Garage Doors..> | 2025-10-17 13:58 | 77K | |
![[ ]](/icons/layout.gif) | 12234_Avon Automated..> | 2025-11-06 10:46 | 77K | |
![[ ]](/icons/layout.gif) | 18443_Gilberts Home ..> | 2025-11-24 08:41 | 77K | |
![[ ]](/icons/layout.gif) | 3649_Ace Garage Door..> | 2025-10-09 17:00 | 77K | |
![[ ]](/icons/layout.gif) | 8635_Heavy Metal Eng..> | 2025-10-27 16:11 | 77K | |
![[ ]](/icons/layout.gif) | 8039_The Lothian Gar..> | 2025-10-24 13:11 | 77K | |
![[ ]](/icons/layout.gif) | 1468_The Lothian Gar..> | 2025-09-30 15:30 | 77K | |
![[ ]](/icons/layout.gif) | 5971_Absolute Garage..> | 2025-10-17 14:12 | 77K | |
![[ ]](/icons/layout.gif) | 3302_Highlands Elect..> | 2025-10-09 07:45 | 77K | |
![[ ]](/icons/layout.gif) | 4402_SDL Door Repair..> | 2025-10-13 15:38 | 77K | |
![[ ]](/icons/layout.gif) | 5662_The Lothian Gar..> | 2025-10-16 16:00 | 77K | |
![[ ]](/icons/layout.gif) | 10982_Garage Door So..> | 2025-11-03 15:43 | 77K | |
![[ ]](/icons/layout.gif) | 11500_Garage Door So..> | 2025-11-04 16:06 | 77K | |
![[ ]](/icons/layout.gif) | 10437_Garage Door So..> | 2025-11-03 07:51 | 77K | |
![[ ]](/icons/layout.gif) | 13918_Go Garage Door..> | 2025-11-11 14:01 | 77K | |
![[ ]](/icons/layout.gif) | 1470_Rollermatic Gar..> | 2025-09-30 15:32 | 77K | |
![[ ]](/icons/layout.gif) | 10436_Wellingborough..> | 2025-11-03 07:43 | 77K | |
![[ ]](/icons/layout.gif) | 1202_The Lothian Gar..> | 2025-09-29 09:49 | 77K | |
![[ ]](/icons/layout.gif) | 10441_Windowcraft De..> | 2025-11-03 08:03 | 77K | |
![[ ]](/icons/layout.gif) | 14641_M. A. E. Windo..> | 2025-11-12 14:32 | 77K | |
![[ ]](/icons/layout.gif) | 9927_Replacement Gar..> | 2025-10-30 15:23 | 77K | |
![[ ]](/icons/layout.gif) | 17894_The Lothian Ga..> | 2025-11-21 08:30 | 77K | |
![[ ]](/icons/layout.gif) | 15266_Norfolk Roller..> | 2025-11-14 08:39 | 77K | |
![[ ]](/icons/layout.gif) | 15699_Tru-Fit Window..> | 2025-11-14 16:59 | 77K | |
![[ ]](/icons/layout.gif) | 4094_The Lothian Gar..> | 2025-10-13 09:20 | 77K | |
![[ ]](/icons/layout.gif) | 10427_NW Automatic D..> | 2025-10-31 16:13 | 77K | |
![[ ]](/icons/layout.gif) | 7669_Wellingborough ..> | 2025-10-24 06:51 | 77K | |
![[ ]](/icons/layout.gif) | 473_Elevate Doors Lt..> | 2025-09-23 07:25 | 77K | |
![[ ]](/icons/layout.gif) | 52_Fix My Garage Doo..> | 2025-09-15 08:40 | 77K | |
![[ ]](/icons/layout.gif) | 1382_Ezi-Dor Ltd Tra..> | 2025-09-30 10:21 | 77K | |
![[ ]](/icons/layout.gif) | 12060_Garage Door So..> | 2025-11-05 15:34 | 77K | |
![[ ]](/icons/layout.gif) | 17230_Elevate Doors ..> | 2025-11-19 12:40 | 77K | |
![[ ]](/icons/layout.gif) | 14370_Chelmsford Rol..> | 2025-11-12 09:51 | 77K | |
![[ ]](/icons/layout.gif) | 8636_Cerromar Soluti..> | 2025-10-27 16:11 | 77K | |
![[ ]](/icons/layout.gif) | 13660_Wellingborough..> | 2025-11-11 09:58 | 77K | |
![[ ]](/icons/layout.gif) | 13682_Wellingborough..> | 2025-11-11 10:05 | 77K | |
![[ ]](/icons/layout.gif) | 12906_DP Installatio..> | 2025-11-07 16:55 | 77K | |
![[ ]](/icons/layout.gif) | 15726_DP Installatio..> | 2025-11-15 11:57 | 77K | |
![[ ]](/icons/layout.gif) | 6610_Avon Automated ..> | 2025-10-21 14:40 | 77K | |
![[ ]](/icons/layout.gif) | 9510_WRM Constructio..> | 2025-10-29 15:55 | 77K | |
![[ ]](/icons/layout.gif) | 6090_Highlands Elect..> | 2025-10-20 09:00 | 77K | |
![[ ]](/icons/layout.gif) | 6437_Highlands Elect..> | 2025-10-21 09:19 | 77K | |
![[ ]](/icons/layout.gif) | 6461_Highlands Elect..> | 2025-10-21 10:30 | 77K | |
![[TXT]](/icons/text.gif) | 41704_Quentin Nichol..> | 2026-02-09 13:23 | 77K | |
![[ ]](/icons/layout.gif) | 1674_Prime Shutters ..> | 2025-10-01 15:41 | 78K | |
![[ ]](/icons/layout.gif) | 1212_[0,0] Andrew Wa..> | 2025-09-29 10:24 | 78K | |
![[ ]](/icons/layout.gif) | 2953_[0,0] Nicola Ha..> | 2025-10-08 09:39 | 78K | |
![[ ]](/icons/layout.gif) | 3239_[0,0] Nicola Ha..> | 2025-10-08 16:22 | 78K | |
![[ ]](/icons/layout.gif) | 2649_[0,0] Peter Bot..> | 2025-10-07 09:39 | 78K | |
![[ ]](/icons/layout.gif) | 7329_Shutter Tech UK..> | 2025-10-23 11:04 | 78K | |
![[ ]](/icons/layout.gif) | 7348_Shutter Tech UK..> | 2025-10-23 11:15 | 78K | |
![[ ]](/icons/layout.gif) | 13829_Shutter Tech U..> | 2025-11-11 12:54 | 78K | |
![[ ]](/icons/layout.gif) | 15087_Oakley Windows..> | 2025-11-13 15:15 | 78K | |
![[ ]](/icons/layout.gif) | 3625_Ace Garage Door..> | 2025-10-09 15:18 | 78K | |
![[ ]](/icons/layout.gif) | 17804_John McCaw - M..> | 2025-11-20 16:38 | 78K | |
![[ ]](/icons/layout.gif) | 4112_[0,0] Jason Wal..> | 2025-10-13 09:49 | 78K | |
![[ ]](/icons/layout.gif) | 326_Doorolla S Terry..> | 2025-09-19 14:39 | 78K | |
![[ ]](/icons/layout.gif) | 11274_Oakley Windows..> | 2025-11-04 12:12 | 78K | |
![[ ]](/icons/layout.gif) | 2784_[0,0] Martin Ta..> | 2025-10-07 14:07 | 78K | |
![[ ]](/icons/layout.gif) | 2786_[0,0] Martin Ta..> | 2025-10-07 14:24 | 78K | |
![[ ]](/icons/layout.gif) | 4230_Garage Doors No..> | 2025-10-13 12:23 | 78K | |
![[ ]](/icons/layout.gif) | 11717_Tech HQ Dean B..> | 2025-11-05 10:24 | 78K | |
![[ ]](/icons/layout.gif) | 12907_Shutter Tech U..> | 2025-11-07 16:57 | 78K | |
![[ ]](/icons/layout.gif) | 12910_Shutter Tech U..> | 2025-11-07 16:59 | 78K | |
![[ ]](/icons/layout.gif) | 1402_Prime Shutters ..> | 2025-09-30 11:48 | 78K | |
![[ ]](/icons/layout.gif) | 8166_Oakley Windows ..> | 2025-10-27 08:12 | 78K | |
![[ ]](/icons/layout.gif) | 2286_[0,0] Andrew Ho..> | 2025-10-06 10:42 | 78K | |
![[ ]](/icons/layout.gif) | 1514_[0,0] Jason Wal..> | 2025-10-01 07:33 | 78K | |
![[ ]](/icons/layout.gif) | 1384_3 Counties (San..> | 2025-09-30 10:24 | 78K | |
![[ ]](/icons/layout.gif) | 5146_Rollermatic Gar..> | 2025-10-15 15:54 | 78K | |
![[ ]](/icons/layout.gif) | 6827_Alps Home Impro..> | 2025-10-22 09:14 | 78K | |
![[ ]](/icons/layout.gif) | 1119_3 Counties (San..> | 2025-09-29 06:39 | 78K | |
![[ ]](/icons/layout.gif) | 5643_M. B. Bells Ltd..> | 2025-10-16 15:25 | 78K | |
![[ ]](/icons/layout.gif) | 4764_Beltinge Glazin..> | 2025-10-14 15:14 | 78K | |
![[ ]](/icons/layout.gif) | 3163_Elevate Doors L..> | 2025-10-08 13:49 | 78K | |
![[ ]](/icons/layout.gif) | 12247_Tech HQ Dean B..> | 2025-11-06 11:07 | 78K | |
![[ ]](/icons/layout.gif) | 16074_JJ Secure Door..> | 2025-11-17 13:34 | 78K | |
![[ ]](/icons/layout.gif) | 12829_Chelmsford Rol..> | 2025-11-07 13:11 | 78K | |
![[ ]](/icons/layout.gif) | 3953_PB Doors Paul B..> | 2025-10-10 13:55 | 78K | |
![[ ]](/icons/layout.gif) | 1480_St Helens Upvc ..> | 2025-09-30 17:54 | 78K | |
![[ ]](/icons/layout.gif) | 3836_[0,0] Chelmsfo..> | 2025-10-10 12:13 | 78K | |
![[ ]](/icons/layout.gif) | 3151_Elevate Doors L..> | 2025-10-08 13:16 | 78K | |
![[ ]](/icons/layout.gif) | 17104_Oakley Windows..> | 2025-11-19 10:21 | 78K | |
![[ ]](/icons/layout.gif) | 17817_Mac Automation..> | 2025-11-20 17:06 | 78K | |
![[ ]](/icons/layout.gif) | 17824_Mac Automation..> | 2025-11-20 17:14 | 78K | |
![[ ]](/icons/layout.gif) | 5151_T D Rollerdoors..> | 2025-10-15 15:56 | 78K | |
![[ ]](/icons/layout.gif) | 801_NW Automatic Doo..> | 2025-09-24 15:53 | 78K | |
![[ ]](/icons/layout.gif) | 6576_Elevate Doors L..> | 2025-10-21 13:22 | 78K | |
![[ ]](/icons/layout.gif) | 13806_Ace Garage Doo..> | 2025-11-11 12:00 | 78K | |
![[ ]](/icons/layout.gif) | 706_C&M Glass Servic..> | 2025-09-24 10:18 | 78K | |
![[ ]](/icons/layout.gif) | 11095_T D Rollerdoor..> | 2025-11-04 08:37 | 78K | |
![[ ]](/icons/layout.gif) | 11046_Windowcraft De..> | 2025-11-03 16:51 | 78K | |
![[ ]](/icons/layout.gif) | 1108_Jurassic Doors ..> | 2025-09-26 15:43 | 78K | |
![[ ]](/icons/layout.gif) | 12554_Summit Securit..> | 2025-11-06 16:02 | 78K | |
![[ ]](/icons/layout.gif) | 4799_[0,0] James Tur..> | 2025-10-14 15:56 | 78K | |
![[ ]](/icons/layout.gif) | 6239_Elevate Doors L..> | 2025-10-20 13:11 | 78K | |
![[ ]](/icons/layout.gif) | 720_C&M Glass Servic..> | 2025-09-24 10:54 | 78K | |
![[ ]](/icons/layout.gif) | 7632_Garage Door Rep..> | 2025-10-23 15:35 | 78K | |
![[ ]](/icons/layout.gif) | 16513_JJ Secure Door..> | 2025-11-18 10:57 | 78K | |
![[ ]](/icons/layout.gif) | 8207_Garage Door Rep..> | 2025-10-27 09:39 | 78K | |
![[ ]](/icons/layout.gif) | 7193_Warnsham Window..> | 2025-10-23 07:55 | 78K | |
![[ ]](/icons/layout.gif) | 17009_Doorolla Ltd S..> | 2025-11-19 08:27 | 78K | |
![[ ]](/icons/layout.gif) | 13584_Rollerdoors 24..> | 2025-11-11 08:19 | 78K | |
![[ ]](/icons/layout.gif) | 18598_Rollermatic Ga..> | 2025-11-24 11:55 | 78K | |
![[ ]](/icons/layout.gif) | 5282_M. A. E. Window..> | 2025-10-16 09:59 | 78K | |
![[ ]](/icons/layout.gif) | 10196_PB Doors Paul ..> | 2025-10-31 11:11 | 78K | |
![[ ]](/icons/layout.gif) | 3708_Elevate Doors L..> | 2025-10-10 07:47 | 78K | |
![[ ]](/icons/layout.gif) | 15121_M. A. E. Windo..> | 2025-11-13 15:57 | 78K | |
![[ ]](/icons/layout.gif) | 2567_[0,0] Nathan Wa..> | 2025-10-07 07:46 | 78K | |
![[ ]](/icons/layout.gif) | 12568_Windowcraft De..> | 2025-11-06 16:34 | 78K | |
![[ ]](/icons/layout.gif) | 13094_Windowcraft De..> | 2025-11-10 08:24 | 78K | |
![[ ]](/icons/layout.gif) | 13096_Windowcraft De..> | 2025-11-10 08:27 | 78K | |
![[ ]](/icons/layout.gif) | 13297_Omnia Build & ..> | 2025-11-10 12:08 | 78K | |
![[ ]](/icons/layout.gif) | 11506_Windowcraft De..> | 2025-11-04 16:15 | 78K | |
![[ ]](/icons/layout.gif) | 15725_Gilberts Home ..> | 2025-11-15 11:46 | 78K | |
![[ ]](/icons/layout.gif) | 510_Roll Right Garag..> | 2025-09-23 08:28 | 78K | |
![[ ]](/icons/layout.gif) | 4066_East Anglia Rol..> | 2025-10-13 08:38 | 78K | |
![[ ]](/icons/layout.gif) | 14731_Gilberts Home ..> | 2025-11-12 16:17 | 78K | |
![[ ]](/icons/layout.gif) | 15297_Chelmsford Rol..> | 2025-11-14 09:02 | 78K | |
![[ ]](/icons/layout.gif) | 1408_Swift Doors Ltd..> | 2025-09-30 12:25 | 78K | |
![[ ]](/icons/layout.gif) | 1418_Swift Doors Ltd..> | 2025-09-30 13:11 | 78K | |
![[ ]](/icons/layout.gif) | 1112_Swift Doors Ltd..> | 2025-09-26 15:54 | 78K | |
![[ ]](/icons/layout.gif) | 15086_P & R Door Sys..> | 2025-11-13 15:08 | 78K | |
![[ ]](/icons/layout.gif) | 15730_P & R Door Sys..> | 2025-11-15 12:04 | 78K | |
![[ ]](/icons/layout.gif) | 5754_Chelmsford Roll..> | 2025-10-17 08:49 | 78K | |
![[ ]](/icons/layout.gif) | 498_Roll Right Garag..> | 2025-09-23 08:09 | 78K | |
![[ ]](/icons/layout.gif) | 2718_Elevate Doors L..> | 2025-10-07 11:51 | 78K | |
![[ ]](/icons/layout.gif) | 9107_Rising Group Lt..> | 2025-10-28 16:19 | 78K | |
![[ ]](/icons/layout.gif) | 9117_Rising Group Lt..> | 2025-10-28 16:37 | 78K | |
![[ ]](/icons/layout.gif) | 14693_P & R Door Sys..> | 2025-11-12 15:41 | 78K | |
![[ ]](/icons/layout.gif) | 9473_Rising Group Lt..> | 2025-10-29 15:02 | 78K | |
![[ ]](/icons/layout.gif) | 5257_Rollerdoors 24 ..> | 2025-10-16 09:11 | 78K | |
![[ ]](/icons/layout.gif) | 8105_A Complete Wind..> | 2025-10-24 14:56 | 78K | |
![[ ]](/icons/layout.gif) | 9938_A Complete Wind..> | 2025-10-30 15:43 | 78K | |
![[ ]](/icons/layout.gif) | 3986_Bijan Fouladfga..> | 2025-10-10 16:06 | 78K | |
![[ ]](/icons/layout.gif) | 16075_JJ Secure Door..> | 2025-11-17 13:37 | 78K | |
![[ ]](/icons/layout.gif) | 6388_Eclipse Doors D..> | 2025-10-21 07:03 | 78K | |
![[ ]](/icons/layout.gif) | 3709_Elevate Doors L..> | 2025-10-10 08:00 | 78K | |
![[ ]](/icons/layout.gif) | 8074_Dream Installat..> | 2025-10-24 14:17 | 78K | |
![[ ]](/icons/layout.gif) | 8500_Dream Installat..> | 2025-10-27 13:55 | 78K | |
![[ ]](/icons/layout.gif) | 8501_Dream Installat..> | 2025-10-27 13:55 | 78K | |
![[ ]](/icons/layout.gif) | 4150_Swift Doors Ltd..> | 2025-10-13 10:38 | 78K | |
![[ ]](/icons/layout.gif) | 13719_J Brady Garage..> | 2025-11-11 10:25 | 78K | |
![[ ]](/icons/layout.gif) | 5494_Oakley Windows ..> | 2025-10-16 13:51 | 78K | |
![[ ]](/icons/layout.gif) | 18459_Aldous Electri..> | 2025-11-24 09:12 | 78K | |
![[ ]](/icons/layout.gif) | 1201_The Lothian Gar..> | 2025-09-29 09:44 | 78K | |
![[ ]](/icons/layout.gif) | 4944_AM Shutters Mo..> | 2025-10-15 12:19 | 78K | |
![[ ]](/icons/layout.gif) | 10430_Ace Garage Doo..> | 2025-10-31 16:38 | 78K | |
![[ ]](/icons/layout.gif) | 4935_[0,0] James Tur..> | 2025-10-15 11:38 | 78K | |
![[ ]](/icons/layout.gif) | 5880_[0,0] Allan Ste..> | 2025-10-17 12:04 | 78K | |
![[ ]](/icons/layout.gif) | 2475_The Lothian Gar..> | 2025-10-06 14:03 | 78K | |
![[ ]](/icons/layout.gif) | 4934_[0,0] James Tur..> | 2025-10-15 11:36 | 78K | |
![[ ]](/icons/layout.gif) | 8398_NW Automatic Do..> | 2025-10-27 12:50 | 78K | |
![[ ]](/icons/layout.gif) | 4798_[0,0] James Tur..> | 2025-10-14 15:55 | 78K | |
![[ ]](/icons/layout.gif) | 14837_The Lothian Ga..> | 2025-11-13 09:43 | 78K | |
![[ ]](/icons/layout.gif) | 12894_South Atlantic..> | 2025-11-07 16:01 | 78K | |
![[ ]](/icons/layout.gif) | 5667_Doorolla Ltd St..> | 2025-10-16 16:04 | 78K | |
![[ ]](/icons/layout.gif) | 5665_Doorolla Ltd St..> | 2025-10-16 16:03 | 78K | |
![[ ]](/icons/layout.gif) | 5663_Doorolla Ltd St..> | 2025-10-16 16:01 | 78K | |
![[ ]](/icons/layout.gif) | 6087_David Mann - Ex..> | 2025-10-20 08:59 | 78K | |
![[ ]](/icons/layout.gif) | 6667_WINDOW WIZE LTD..> | 2025-10-21 15:30 | 78K | |
![[ ]](/icons/layout.gif) | 7858_Eastern Frames ..> | 2025-10-24 09:19 | 78K | |
![[ ]](/icons/layout.gif) | 12503_Ian Sanderson ..> | 2025-11-06 15:36 | 78K | |
![[ ]](/icons/layout.gif) | 4919_Birchley Homes ..> | 2025-10-15 11:11 | 78K | |
![[ ]](/icons/layout.gif) | 4943_Elevate Doors L..> | 2025-10-15 12:17 | 78K | |
![[ ]](/icons/layout.gif) | 6948_C & P Doors Cra..> | 2025-10-22 12:17 | 78K | |
![[ ]](/icons/layout.gif) | 7866_Michael Mazur M..> | 2025-10-24 09:22 | 78K | |
![[ ]](/icons/layout.gif) | 800_Hanney Glazed Lt..> | 2025-09-24 15:53 | 78K | |
![[ ]](/icons/layout.gif) | 1298_G A K Developme..> | 2025-09-29 14:40 | 78K | |
![[ ]](/icons/layout.gif) | 9716_G A K Developme..> | 2025-10-30 10:42 | 78K | |
![[ ]](/icons/layout.gif) | 1637_Regal Windows L..> | 2025-10-01 14:37 | 78K | |
![[ ]](/icons/layout.gif) | 17285_CWD Improvemen..> | 2025-11-19 14:16 | 79K | |
![[ ]](/icons/layout.gif) | 53_Fix My Garage Doo..> | 2025-09-15 08:41 | 79K | |
![[ ]](/icons/layout.gif) | 13821_CWD Improvemen..> | 2025-11-11 12:21 | 79K | |
![[ ]](/icons/layout.gif) | 13837_CWD Improvemen..> | 2025-11-11 13:19 | 79K | |
![[ ]](/icons/layout.gif) | 3976_Evans & Fry Ltd..> | 2025-10-10 15:06 | 79K | |
![[ ]](/icons/layout.gif) | 4140_Evans & Fry Ltd..> | 2025-10-13 10:27 | 79K | |
![[ ]](/icons/layout.gif) | 3931_Evans & Fry Ltd..> | 2025-10-10 13:38 | 79K | |
![[ ]](/icons/layout.gif) | 9231_CWD Improvement..> | 2025-10-29 08:50 | 79K | |
![[ ]](/icons/layout.gif) | 5287_Fortress Doors ..> | 2025-10-16 10:14 | 79K | |
![[ ]](/icons/layout.gif) | 1782_Chelmsford Roll..> | 2025-10-02 11:05 | 79K | |
![[ ]](/icons/layout.gif) | 4845_L G Glazing Ltd..> | 2025-10-15 08:59 | 79K | |
![[ ]](/icons/layout.gif) | 4801_Bijan Fouladfga..> | 2025-10-15 06:10 | 79K | |
![[ ]](/icons/layout.gif) | 16838_Adams Industri..> | 2025-11-18 15:54 | 79K | |
![[ ]](/icons/layout.gif) | 15187_Adams Industri..> | 2025-11-14 07:43 | 79K | |
![[ ]](/icons/layout.gif) | 15153_WRM Constructi..> | 2025-11-13 16:56 | 79K | |
![[ ]](/icons/layout.gif) | 15080_WRM Constructi..> | 2025-11-13 14:57 | 79K | |
![[ ]](/icons/layout.gif) | 15979_PB Doors Paul ..> | 2025-11-17 11:23 | 79K | |
![[ ]](/icons/layout.gif) | 10906_Ace Garage Doo..> | 2025-11-03 14:40 | 79K | |
![[ ]](/icons/layout.gif) | 4776_PB Doors Paul B..> | 2025-10-14 15:39 | 79K | |
![[ ]](/icons/layout.gif) | 4822_Ace Garage Door..> | 2025-10-15 08:09 | 79K | |
![[ ]](/icons/layout.gif) | 4894_PGD Doors Ltd S..> | 2025-10-15 10:02 | 79K | |
![[ ]](/icons/layout.gif) | 15706_South Atlantic..> | 2025-11-15 10:56 | 79K | |
![[ ]](/icons/layout.gif) | 14142_L G Glazing Lt..> | 2025-11-11 16:46 | 82K | |
![[ ]](/icons/layout.gif) | 13588_L G Glazing Lt..> | 2025-11-11 08:23 | 82K | |
![[ ]](/icons/layout.gif) | 14121_L G Glazing Lt..> | 2025-11-11 16:29 | 82K | |
![[ ]](/icons/layout.gif) | 12893_Mowbrey Partne..> | 2025-11-07 15:56 | 82K | |
![[ ]](/icons/layout.gif) | 65416_Reklaw Doors L..> | 2026-04-14 08:49 | 82K | |
![[ ]](/icons/layout.gif) | 69875_ThermoGreen Lt..> | 2026-04-24 09:17 | 82K | |
![[ ]](/icons/layout.gif) | 66967_EcoGlaze Group..> | 2026-04-17 08:03 | 82K | |
![[ ]](/icons/layout.gif) | 64058_Stanair Indust..> | 2026-04-09 10:51 | 82K | |
![[ ]](/icons/layout.gif) | 70255_T D Rollerdoor..> | 2026-04-24 15:24 | 82K | |
![[ ]](/icons/layout.gif) | 5671_Sargent & Powel..> | 2025-10-16 16:19 | 82K | |
![[ ]](/icons/layout.gif) | 69880_Rollermatic Ga..> | 2026-04-24 09:20 | 82K | |
![[ ]](/icons/layout.gif) | 65929_J Brady Garage..> | 2026-04-15 06:49 | 82K | |
![[ ]](/icons/layout.gif) | 64857_DT Services Lt..> | 2026-04-13 08:07 | 82K | |
![[ ]](/icons/layout.gif) | 66363_JJ Secure Door..> | 2026-04-15 15:05 | 82K | |
![[ ]](/icons/layout.gif) | 69543_Ecosse Garage ..> | 2026-04-23 13:25 | 82K | |
![[ ]](/icons/layout.gif) | 67887_MoBs Electrica..> | 2026-04-20 13:51 | 82K | |
![[ ]](/icons/layout.gif) | 65779_Digby Services..> | 2026-04-14 14:18 | 82K | |
![[ ]](/icons/layout.gif) | 62870_Digby Services..> | 2026-04-07 11:05 | 82K | |
![[ ]](/icons/layout.gif) | 64806_LD Doors Lewis..> | 2026-04-13 06:31 | 82K | |
![[ ]](/icons/layout.gif) | 69817_1st Shield Dar..> | 2026-04-24 08:35 | 82K | |
![[ ]](/icons/layout.gif) | 69821_1st Shield Dar..> | 2026-04-24 08:38 | 82K | |
![[ ]](/icons/layout.gif) | 69140_M & S Home Ins..> | 2026-04-22 14:36 | 82K | |
![[ ]](/icons/layout.gif) | 70253_C Marl Systems..> | 2026-04-24 15:11 | 82K | |
![[ ]](/icons/layout.gif) | 65485_Bloomfield Hom..> | 2026-04-14 10:07 | 82K | |
![[ ]](/icons/layout.gif) | 68309_EZ2OWN Ltd Pau..> | 2026-04-21 09:50 | 82K | |
![[ ]](/icons/layout.gif) | 64740_Niche Interior..> | 2026-04-10 15:17 | 82K | |
![[ ]](/icons/layout.gif) | 66763_DT Services Lt..> | 2026-04-16 12:46 | 82K | |
![[ ]](/icons/layout.gif) | 70156_Glazebright Gr..> | 2026-04-24 14:32 | 82K | |
![[ ]](/icons/layout.gif) | 62352_Ace Garage Doo..> | 2026-04-02 12:49 | 82K | |
![[ ]](/icons/layout.gif) | 68233_Cambridge Wind..> | 2026-04-21 09:05 | 82K | |
![[ ]](/icons/layout.gif) | 68236_Cambridge Wind..> | 2026-04-21 09:06 | 82K | |
![[ ]](/icons/layout.gif) | 62314_Absolute Garag..> | 2026-04-02 11:42 | 82K | |
![[ ]](/icons/layout.gif) | 67873_Cash Building ..> | 2026-04-20 13:39 | 82K | |
![[ ]](/icons/layout.gif) | 68877_Michael Mazur ..> | 2026-04-22 09:10 | 82K | |
![[ ]](/icons/layout.gif) | 63298_RM INSTALLS Ri..> | 2026-04-08 07:01 | 82K | |
![[ ]](/icons/layout.gif) | 64067_T & G Home Imp..> | 2026-04-09 11:02 | 82K | |
![[ ]](/icons/layout.gif) | 66840_Digby Services..> | 2026-04-16 14:03 | 82K | |
![[ ]](/icons/layout.gif) | 67301_Go Direct Door..> | 2026-04-17 13:09 | 82K | |
![[ ]](/icons/layout.gif) | 64816_IAmDoors Ltd S..> | 2026-04-13 07:11 | 82K | |
![[ ]](/icons/layout.gif) | 69010_Go Direct Door..> | 2026-04-22 12:24 | 82K | |
![[ ]](/icons/layout.gif) | 69763_HTH Developmen..> | 2026-04-24 07:44 | 82K | |
![[ ]](/icons/layout.gif) | 69899_J Brady Garage..> | 2026-04-24 09:34 | 82K | |
![[ ]](/icons/layout.gif) | 69546_Ecosse Garage ..> | 2026-04-23 13:29 | 82K | |
![[ ]](/icons/layout.gif) | 65290_CPS Custom Pro..> | 2026-04-13 16:04 | 82K | |
![[ ]](/icons/layout.gif) | 67252_Regal Windows ..> | 2026-04-17 12:36 | 82K | |
![[ ]](/icons/layout.gif) | 69884_Absolute Garag..> | 2026-04-24 09:21 | 82K | |
![[ ]](/icons/layout.gif) | 64120_DJB Home Impro..> | 2026-04-09 12:56 | 82K | |
![[ ]](/icons/layout.gif) | 68246_Ecosse Garage ..> | 2026-04-21 09:18 | 82K | |
![[ ]](/icons/layout.gif) | 67297_CWG Home Impro..> | 2026-04-17 13:05 | 82K | |
![[ ]](/icons/layout.gif) | 66980_CWG Home Impro..> | 2026-04-17 08:42 | 82K | |
![[ ]](/icons/layout.gif) | 62315_Absolute Garag..> | 2026-04-02 11:42 | 82K | |
![[ ]](/icons/layout.gif) | 69863_Rollermatic Ga..> | 2026-04-24 09:04 | 83K | |
![[ ]](/icons/layout.gif) | 69281_Go Direct Door..> | 2026-04-23 07:46 | 83K | |
![[ ]](/icons/layout.gif) | 69433_Phil & Dan Pro..> | 2026-04-23 11:05 | 83K | |
![[ ]](/icons/layout.gif) | 68897_L & C Bracey L..> | 2026-04-22 09:43 | 83K | |
![[ ]](/icons/layout.gif) | 69790_Wellingborough..> | 2026-04-24 08:16 | 83K | |
![[ ]](/icons/layout.gif) | 69792_Wellingborough..> | 2026-04-24 08:20 | 83K | |
![[ ]](/icons/layout.gif) | 65978_Easy-Roll Ben ..> | 2026-04-15 07:59 | 83K | |
![[ ]](/icons/layout.gif) | 66729_JJ Secure Door..> | 2026-04-16 12:29 | 83K | |
![[ ]](/icons/layout.gif) | 62712_RM INSTALLS Ri..> | 2026-04-07 08:53 | 83K | |
![[ ]](/icons/layout.gif) | 62709_RM INSTALLS Ri..> | 2026-04-07 08:52 | 83K | |
![[ ]](/icons/layout.gif) | 62717_RM INSTALLS Ri..> | 2026-04-07 08:57 | 83K | |
![[ ]](/icons/layout.gif) | 68024_LNR Door Solut..> | 2026-04-20 15:44 | 83K | |
![[ ]](/icons/layout.gif) | 64770_Scotia Garage ..> | 2026-04-10 16:04 | 83K | |
![[ ]](/icons/layout.gif) | 63264_RM INSTALLS Ri..> | 2026-04-08 06:34 | 83K | |
![[ ]](/icons/layout.gif) | 65781_Digby Services..> | 2026-04-14 14:18 | 84K | |
![[ ]](/icons/layout.gif) | 69133_Digby Services..> | 2026-04-22 14:32 | 84K | |
![[ ]](/icons/layout.gif) | 65874_Rolladoor NR9 ..> | 2026-04-14 15:36 | 84K | |
![[ ]](/icons/layout.gif) | 7691_Boombastic Door..> | 2025-08-14 13:42 | 86K | |
![[ ]](/icons/layout.gif) | 10447_Ian Sanderson ..> | 2025-11-03 08:11 | 86K | |
![[ ]](/icons/layout.gif) | 8163_Ian Sanderson E..> | 2025-10-27 07:48 | 86K | |
![[ ]](/icons/layout.gif) | 4868_C & P Doors Cra..> | 2025-10-15 09:38 | 86K | |
![[ ]](/icons/layout.gif) | 8839_Avon Automated ..> | 2025-10-28 11:11 | 86K | |
![[ ]](/icons/layout.gif) | 10734_Windowcraft De..> | 2025-11-03 11:35 | 86K | |
![[ ]](/icons/layout.gif) | 7693_The Lothian Gar..> | 2025-08-14 13:55 | 86K | |
![[ ]](/icons/layout.gif) | 7546_Terry Pratchet ..> | 2025-07-31 09:47 | 111K | |
![[ ]](/icons/layout.gif) | 30213_Garage Door Ma..> | 2026-01-05 14:14 | 111K | |
![[ ]](/icons/layout.gif) | 7547_Terry Pratchet ..> | 2025-07-31 09:48 | 111K | |
![[ ]](/icons/layout.gif) | 7548_Terry Pratchet ..> | 2025-07-31 09:49 | 111K | |
![[ ]](/icons/layout.gif) | 7628_Blaster Garage ..> | 2025-08-01 17:02 | 111K | |
![[ ]](/icons/layout.gif) | 7700_Blobby Garage D..> | 2025-08-15 10:57 | 111K | |
![[ ]](/icons/layout.gif) | 7695_Blaster Garage ..> | 2025-08-14 13:59 | 111K | |
![[ ]](/icons/layout.gif) | 7692_The Lothian Gar..> | 2025-08-14 13:51 | 112K | |
![[ ]](/icons/layout.gif) | 7694_The Lothian Gar..> | 2025-08-14 13:57 | 112K | |
![[ ]](/icons/layout.gif) | 29851_Open And Shut ..> | 2026-01-02 14:52 | 112K | |
![[ ]](/icons/layout.gif) | 27580_SDS (Isle Of M..> | 2025-12-17 16:51 | 112K | |
![[ ]](/icons/layout.gif) | 29848_Open And Shut ..> | 2026-01-02 14:49 | 112K | |
![[ ]](/icons/layout.gif) | 23364_Grant Tilley G..> | 2025-12-05 10:16 | 112K | |
![[ ]](/icons/layout.gif) | 25104_Doorflex Produ..> | 2025-12-11 12:38 | 112K | |
![[ ]](/icons/layout.gif) | 25371_SDS (Isle Of M..> | 2025-12-12 08:19 | 112K | |
![[ ]](/icons/layout.gif) | 24800_M. A. E. Windo..> | 2025-12-10 16:03 | 112K | |
![[ ]](/icons/layout.gif) | 32394_EZ2OWN Ltd Pau..> | 2026-01-12 13:46 | 112K | |
![[ ]](/icons/layout.gif) | 27536_PB Doors Paul ..> | 2025-12-17 15:46 | 112K | |
![[ ]](/icons/layout.gif) | 25105_Doorflex Produ..> | 2025-12-11 12:53 | 112K | |
![[ ]](/icons/layout.gif) | 27165_LNR Door Solut..> | 2025-12-17 08:19 | 112K | |
![[ ]](/icons/layout.gif) | 22984_Warnsham Windo..> | 2025-12-04 14:22 | 112K | |
![[ ]](/icons/layout.gif) | 33098_Camberley Wind..> | 2026-01-14 10:17 | 112K | |
![[ ]](/icons/layout.gif) | 32935_Starlite Home ..> | 2026-01-13 15:40 | 112K | |
![[ ]](/icons/layout.gif) | 32395_EZ2OWN Ltd Pau..> | 2026-01-12 13:46 | 112K | |
![[ ]](/icons/layout.gif) | 20901_Ross Garage Do..> | 2025-11-28 12:28 | 112K | |
![[ ]](/icons/layout.gif) | 23923_1st Shield Dar..> | 2025-12-08 14:31 | 112K | |
![[ ]](/icons/layout.gif) | 32370_Nix Building S..> | 2026-01-12 11:41 | 112K | |
![[ ]](/icons/layout.gif) | 22893_Jurassic Doors..> | 2025-12-04 12:22 | 112K | |
![[ ]](/icons/layout.gif) | 25106_Doorflex Produ..> | 2025-12-11 12:54 | 112K | |
![[ ]](/icons/layout.gif) | 21764_Piper Window S..> | 2025-12-02 09:54 | 112K | |
![[ ]](/icons/layout.gif) | 21817_WINDOW WIZE LT..> | 2025-12-02 11:04 | 112K | |
![[ ]](/icons/layout.gif) | 23043_St Helens UPVC..> | 2025-12-04 15:05 | 112K | |
![[ ]](/icons/layout.gif) | 33094_Camberley Wind..> | 2026-01-14 10:14 | 112K | |
![[ ]](/icons/layout.gif) | 32928_Oakley Windows..> | 2026-01-13 15:26 | 112K | |
![[ ]](/icons/layout.gif) | 20291_Robbie Simpson..> | 2025-11-27 11:33 | 112K | |
![[ ]](/icons/layout.gif) | 27125_Hanney Glazed ..> | 2025-12-16 16:59 | 112K | |
![[ ]](/icons/layout.gif) | 18762_Elevate Doors ..> | 2025-11-24 15:25 | 112K | |
![[ ]](/icons/layout.gif) | 20284_Wall Garage Do..> | 2025-11-27 11:28 | 112K | |
![[ ]](/icons/layout.gif) | 22878_Swift Doors Lt..> | 2025-12-04 12:16 | 112K | |
![[ ]](/icons/layout.gif) | 29863_Open And Shut ..> | 2026-01-02 15:10 | 112K | |
![[ ]](/icons/layout.gif) | 22985_Warnsham Windo..> | 2025-12-04 14:22 | 112K | |
![[ ]](/icons/layout.gif) | 31000_Nix Building S..> | 2026-01-07 08:43 | 112K | |
![[ ]](/icons/layout.gif) | 24703_Tim Fix Garage..> | 2025-12-10 12:15 | 112K | |
![[ ]](/icons/layout.gif) | 30063_Rolladoor NR9 ..> | 2026-01-05 11:18 | 112K | |
![[ ]](/icons/layout.gif) | 30806_Hamilton Const..> | 2026-01-06 14:14 | 112K | |
![[ ]](/icons/layout.gif) | 24404_NW Automatic D..> | 2025-12-09 12:54 | 112K | |
![[ ]](/icons/layout.gif) | 30813_Hamilton Const..> | 2026-01-06 14:18 | 112K | |
![[ ]](/icons/layout.gif) | 23524_WADE WINDOWS I..> | 2025-12-05 14:59 | 112K | |
![[ ]](/icons/layout.gif) | 21148_J Brady Garage..> | 2025-12-01 08:51 | 112K | |
![[ ]](/icons/layout.gif) | 19932_Chelmsford Rol..> | 2025-11-26 13:41 | 112K | |
![[ ]](/icons/layout.gif) | 22887_Heavy Metal En..> | 2025-12-04 12:20 | 112K | |
![[ ]](/icons/layout.gif) | 22901_PB Doors Paul ..> | 2025-12-04 12:27 | 112K | |
![[ ]](/icons/layout.gif) | 31256_D & E Windows ..> | 2026-01-07 16:24 | 112K | |
![[ ]](/icons/layout.gif) | 32741_Titan Garage D..> | 2026-01-13 11:45 | 112K | |
![[ ]](/icons/layout.gif) | 32390_UK Rollerdoors..> | 2026-01-12 13:24 | 112K | |
![[ ]](/icons/layout.gif) | 22597_Warnsham Windo..> | 2025-12-03 15:29 | 112K | |
![[ ]](/icons/layout.gif) | 32443_EZ2OWN Ltd Pau..> | 2026-01-12 16:09 | 112K | |
![[ ]](/icons/layout.gif) | 18715_TH Installatio..> | 2025-11-24 14:18 | 112K | |
![[ ]](/icons/layout.gif) | 29734_Windows Plus U..> | 2026-01-02 11:34 | 112K | |
![[ ]](/icons/layout.gif) | 24180_Jason's Carpen..> | 2025-12-09 09:16 | 112K | |
![[ ]](/icons/layout.gif) | 26618_SDS (Isle Of M..> | 2025-12-16 07:41 | 112K | |
![[ ]](/icons/layout.gif) | 33105_Camberley Wind..> | 2026-01-14 10:30 | 112K | |
![[ ]](/icons/layout.gif) | 33110_Fortress Doors..> | 2026-01-14 10:37 | 112K | |
![[ ]](/icons/layout.gif) | 23486_ThermoGreen Lt..> | 2025-12-05 14:18 | 112K | |
![[ ]](/icons/layout.gif) | 24715_Elevate Doors ..> | 2025-12-10 12:49 | 112K | |
![[ ]](/icons/layout.gif) | 30670_Wall Garage Do..> | 2026-01-06 11:41 | 112K | |
![[ ]](/icons/layout.gif) | 32922_Easyroll Garag..> | 2026-01-13 15:00 | 112K | |
![[ ]](/icons/layout.gif) | 30056_Garage Door Re..> | 2026-01-05 10:50 | 112K | |
![[ ]](/icons/layout.gif) | 29993_J Brady Garage..> | 2026-01-05 08:55 | 112K | |
![[ ]](/icons/layout.gif) | 29938_Thetford Glass..> | 2026-01-05 08:24 | 112K | |
![[ ]](/icons/layout.gif) | 30535_Tru-Fit Windo..> | 2026-01-06 09:42 | 112K | |
![[ ]](/icons/layout.gif) | 23303_Garage Doors N..> | 2025-12-05 09:12 | 112K | |
![[ ]](/icons/layout.gif) | 24615_Windows Plus U..> | 2025-12-10 08:28 | 112K | |
![[ ]](/icons/layout.gif) | 30647_Avon Automated..> | 2026-01-06 11:24 | 112K | |
![[ ]](/icons/layout.gif) | 19088_Garage Door Re..> | 2025-11-25 12:26 | 112K | |
![[ ]](/icons/layout.gif) | 23999_Excellent Ltd ..> | 2025-12-09 07:43 | 112K | |
![[ ]](/icons/layout.gif) | 30925_ThermoGreen Lt..> | 2026-01-06 15:46 | 112K | |
![[ ]](/icons/layout.gif) | 27528_Herts & Essex ..> | 2025-12-17 15:35 | 112K | |
![[ ]](/icons/layout.gif) | 32375_WADE WINDOWS I..> | 2026-01-12 12:09 | 112K | |
![[ ]](/icons/layout.gif) | 27130_Dream Installa..> | 2025-12-17 07:31 | 112K | |
![[ ]](/icons/layout.gif) | 18982_Doorolla Ltd S..> | 2025-11-25 09:24 | 112K | |
![[ ]](/icons/layout.gif) | 27782_Elevate Doors ..> | 2025-12-18 11:51 | 112K | |
![[ ]](/icons/layout.gif) | 30829_SW Trade Frame..> | 2026-01-06 14:24 | 112K | |
![[ ]](/icons/layout.gif) | 19922_Chelmsford Rol..> | 2025-11-26 13:05 | 112K | |
![[ ]](/icons/layout.gif) | 19923_Chelmsford Rol..> | 2025-11-26 13:07 | 112K | |
![[ ]](/icons/layout.gif) | 28488_Norfolk Broads..> | 2025-12-22 09:51 | 112K | |
![[ ]](/icons/layout.gif) | 32863_Reputation Win..> | 2026-01-13 13:28 | 112K | |
![[ ]](/icons/layout.gif) | 29251_The Lothian Ga..> | 2025-12-24 11:28 | 112K | |
![[ ]](/icons/layout.gif) | 20553_Essex Prestige..> | 2025-11-27 16:24 | 112K | |
![[ ]](/icons/layout.gif) | 21549_The Lothian Ga..> | 2025-12-01 16:26 | 112K | |
![[ ]](/icons/layout.gif) | 26790_Wiltshire Gara..> | 2025-12-16 11:23 | 112K | |
![[ ]](/icons/layout.gif) | 28368_Norfolk Broads..> | 2025-12-19 15:23 | 112K | |
![[ ]](/icons/layout.gif) | 33104_Camberley Wind..> | 2026-01-14 10:28 | 112K | |
![[ ]](/icons/layout.gif) | 25779_The Lothian Ga..> | 2025-12-12 15:24 | 112K | |
![[ ]](/icons/layout.gif) | 23837_Michael Scott ..> | 2025-12-08 12:06 | 112K | |
![[ ]](/icons/layout.gif) | 32784_Titan Garage D..> | 2026-01-13 12:27 | 112K | |
![[ ]](/icons/layout.gif) | 33066_Absolute Garag..> | 2026-01-14 09:33 | 112K | |
![[ ]](/icons/layout.gif) | 23122_Chelmsford Rol..> | 2025-12-04 15:31 | 112K | |
![[ ]](/icons/layout.gif) | 30859_Rollermatic Ga..> | 2026-01-06 15:12 | 112K | |
![[ ]](/icons/layout.gif) | 32962_MNH Windows & ..> | 2026-01-13 16:42 | 112K | |
![[ ]](/icons/layout.gif) | 20817_MG Securical L..> | 2025-11-28 11:07 | 112K | |
![[ ]](/icons/layout.gif) | 22376_EB1 Limited Ro..> | 2025-12-03 11:36 | 112K | |
![[ ]](/icons/layout.gif) | 30993_Fortress Doors..> | 2026-01-07 08:29 | 112K | |
![[ ]](/icons/layout.gif) | 29245_Ecosse Garage ..> | 2025-12-24 11:14 | 112K | |
![[ ]](/icons/layout.gif) | 27038_DP Installatio..> | 2025-12-16 15:47 | 112K | |
![[ ]](/icons/layout.gif) | 27039_DP Installatio..> | 2025-12-16 15:49 | 112K | |
![[ ]](/icons/layout.gif) | 33107_MNH Windows & ..> | 2026-01-14 10:34 | 112K | |
![[ ]](/icons/layout.gif) | 18766_Warnsham Windo..> | 2025-11-24 15:32 | 112K | |
![[ ]](/icons/layout.gif) | 29219_T D Rollerdoor..> | 2025-12-24 08:19 | 112K | |
![[ ]](/icons/layout.gif) | 26469_Bryan Thompson..> | 2025-12-15 14:01 | 112K | |
![[ ]](/icons/layout.gif) | 26514_Rollermatic Ga..> | 2025-12-15 15:28 | 112K | |
![[ ]](/icons/layout.gif) | 20767_Oakley Windows..> | 2025-11-28 10:34 | 112K | |
![[ ]](/icons/layout.gif) | 18844_Ideal Industri..> | 2025-11-24 17:02 | 112K | |
![[ ]](/icons/layout.gif) | 33134_Glenhurst Door..> | 2026-01-14 11:02 | 112K | |
![[ ]](/icons/layout.gif) | 30921_MW Property Ma..> | 2026-01-06 15:40 | 112K | |
![[ ]](/icons/layout.gif) | 31800_Prestige Windo..> | 2026-01-08 15:43 | 112K | |
![[ ]](/icons/layout.gif) | 23040_The Lothian Ga..> | 2025-12-04 14:59 | 112K | |
![[ ]](/icons/layout.gif) | 27508_The Lothian Ga..> | 2025-12-17 15:06 | 112K | |
![[ ]](/icons/layout.gif) | 21509_M. A. E. Windo..> | 2025-12-01 15:13 | 112K | |
![[ ]](/icons/layout.gif) | 19627_Danbury Garage..> | 2025-11-26 08:19 | 112K | |
![[ ]](/icons/layout.gif) | 18733_Easyroll Garag..> | 2025-11-24 14:34 | 112K | |
![[ ]](/icons/layout.gif) | 32762_M. A. E. Windo..> | 2026-01-13 12:08 | 112K | |
![[ ]](/icons/layout.gif) | 19227_Hadrian Joiner..> | 2025-11-25 13:40 | 112K | |
![[ ]](/icons/layout.gif) | 21874_Rollermatic Ga..> | 2025-12-02 11:26 | 112K | |
![[ ]](/icons/layout.gif) | 30945_Ross Garage Do..> | 2026-01-06 16:09 | 112K | |
![[ ]](/icons/layout.gif) | 30757_The Lothian Ga..> | 2026-01-06 12:44 | 112K | |
![[ ]](/icons/layout.gif) | 21851_Absolute Garag..> | 2025-12-02 11:13 | 112K | |
![[ ]](/icons/layout.gif) | 32981_Wokingham Glaz..> | 2026-01-14 08:12 | 112K | |
![[ ]](/icons/layout.gif) | 32937_Wokingham Glaz..> | 2026-01-13 15:43 | 112K | |
![[ ]](/icons/layout.gif) | 25211_Rollermatic Ga..> | 2025-12-11 15:41 | 112K | |
![[ ]](/icons/layout.gif) | 19695_J Brady Garage..> | 2025-11-26 09:04 | 112K | |
![[ ]](/icons/layout.gif) | 22055_The Lothian Ga..> | 2025-12-02 14:07 | 112K | |
![[ ]](/icons/layout.gif) | 27124_Wokingham Glaz..> | 2025-12-16 16:55 | 112K | |
![[ ]](/icons/layout.gif) | 22193_UK Rollerdoors..> | 2025-12-02 16:24 | 112K | |
![[ ]](/icons/layout.gif) | 25214_Dream Installa..> | 2025-12-11 15:46 | 112K | |
![[ ]](/icons/layout.gif) | 21802_UK Rollerdoors..> | 2025-12-02 10:51 | 112K | |
![[ ]](/icons/layout.gif) | 19715_J Brady Garage..> | 2025-11-26 09:26 | 112K | |
![[ ]](/icons/layout.gif) | 24879_Barry Eckland ..> | 2025-12-10 16:49 | 112K | |
![[ ]](/icons/layout.gif) | 22598_Warnsham Windo..> | 2025-12-03 15:29 | 112K | |
![[ ]](/icons/layout.gif) | 23757_Fortress Doors..> | 2025-12-08 10:48 | 112K | |
![[ ]](/icons/layout.gif) | 31805_Moran Windows ..> | 2026-01-08 15:51 | 112K | |
![[ ]](/icons/layout.gif) | 23911_Cromer Garage ..> | 2025-12-08 14:15 | 112K | |
![[ ]](/icons/layout.gif) | 24716_Elevate Doors ..> | 2025-12-10 12:49 | 112K | |
![[ ]](/icons/layout.gif) | 22979_Rollermatic Ga..> | 2025-12-04 14:15 | 112K | |
![[ ]](/icons/layout.gif) | 27883_Proud 2 Fix Ma..> | 2025-12-18 13:45 | 112K | |
![[ ]](/icons/layout.gif) | 30434_Eastern Frames..> | 2026-01-05 16:56 | 112K | |
![[ ]](/icons/layout.gif) | 19706_J Brady Garage..> | 2025-11-26 09:16 | 112K | |
![[ ]](/icons/layout.gif) | 25797_The Lothian Ga..> | 2025-12-12 15:38 | 112K | |
![[ ]](/icons/layout.gif) | 24691_Ecosse Garage ..> | 2025-12-10 11:37 | 112K | |
![[ ]](/icons/layout.gif) | 30085_Thomas Bui - A..> | 2026-01-05 11:38 | 112K | |
![[ ]](/icons/layout.gif) | 22017_J Brady Garage..> | 2025-12-02 13:11 | 112K | |
![[ ]](/icons/layout.gif) | 27115_Rollermatic Ga..> | 2025-12-16 16:50 | 112K | |
![[ ]](/icons/layout.gif) | 22211_MMKR Home Impr..> | 2025-12-02 16:47 | 112K | |
![[ ]](/icons/layout.gif) | 30143_SW Trade Frame..> | 2026-01-05 12:38 | 112K | |
![[ ]](/icons/layout.gif) | 21552_The Lothian Ga..> | 2025-12-01 16:32 | 112K | |
![[ ]](/icons/layout.gif) | 32931_Hanney Glazed ..> | 2026-01-13 15:35 | 112K | |
![[ ]](/icons/layout.gif) | 21649_Prestige Windo..> | 2025-12-02 08:00 | 112K | |
![[ ]](/icons/layout.gif) | 18767_Warnsham Windo..> | 2025-11-24 15:32 | 112K | |
![[ ]](/icons/layout.gif) | 25305_East Anglia Ro..> | 2025-12-11 16:30 | 112K | |
![[ ]](/icons/layout.gif) | 21782_Rollermatic Ga..> | 2025-12-02 10:13 | 112K | |
![[ ]](/icons/layout.gif) | 30562_WMS Projects S..> | 2026-01-06 09:49 | 112K | |
![[ ]](/icons/layout.gif) | 30922_MW Property Ma..> | 2026-01-06 15:40 | 112K | |
![[ ]](/icons/layout.gif) | 19984_The Lothian Ga..> | 2025-11-26 14:35 | 112K | |
![[ ]](/icons/layout.gif) | 19986_The Lothian Ga..> | 2025-11-26 14:36 | 112K | |
![[ ]](/icons/layout.gif) | 21135_Rollermatic Ga..> | 2025-12-01 08:31 | 112K | |
![[ ]](/icons/layout.gif) | 22920_East Anglia Ro..> | 2025-12-04 12:56 | 112K | |
![[ ]](/icons/layout.gif) | 19632_J Brady Garage..> | 2025-11-26 08:24 | 112K | |
![[ ]](/icons/layout.gif) | 23163_J Brady Garage..> | 2025-12-04 16:29 | 112K | |
![[ ]](/icons/layout.gif) | 30500_Eastern Frames..> | 2026-01-06 09:11 | 112K | |
![[ ]](/icons/layout.gif) | 31111_Sigma Doors & ..> | 2026-01-07 11:52 | 112K | |
![[ ]](/icons/layout.gif) | 21668_SW Trade Frame..> | 2025-12-02 08:21 | 112K | |
![[ ]](/icons/layout.gif) | 20444_Northants Gara..> | 2025-11-27 13:58 | 112K | |
![[ ]](/icons/layout.gif) | 20486_Northants Gara..> | 2025-11-27 15:12 | 112K | |
![[ ]](/icons/layout.gif) | 27095_Eden Propertie..> | 2025-12-16 16:40 | 112K | |
![[ ]](/icons/layout.gif) | 33073_Wokingham Glaz..> | 2026-01-14 09:36 | 112K | |
![[ ]](/icons/layout.gif) | 31875_Avon Automated..> | 2026-01-09 08:23 | 112K | |
![[ ]](/icons/layout.gif) | 31734_Avon Automated..> | 2026-01-08 15:01 | 112K | |
![[ ]](/icons/layout.gif) | 31228_Norfolk Broads..> | 2026-01-07 15:12 | 112K | |
![[ ]](/icons/layout.gif) | 32456_Prestige Windo..> | 2026-01-12 16:30 | 112K | |
![[ ]](/icons/layout.gif) | 25221_The Lothian Ga..> | 2025-12-11 15:53 | 112K | |
![[ ]](/icons/layout.gif) | 29789_Gilberts Home ..> | 2026-01-02 13:06 | 112K | |
![[ ]](/icons/layout.gif) | 24251_Doors 4 You Lt..> | 2025-12-09 10:52 | 112K | |
![[ ]](/icons/layout.gif) | 18759_Elevate Doors ..> | 2025-11-24 15:23 | 112K | |
![[ ]](/icons/layout.gif) | 19598_Breendon Carpe..> | 2025-11-26 07:43 | 113K | |
![[ ]](/icons/layout.gif) | 23963_UK Rollerdoors..> | 2025-12-08 15:45 | 113K | |
![[ ]](/icons/layout.gif) | 24027_UK Rollerdoors..> | 2025-12-09 08:12 | 113K | |
![[ ]](/icons/layout.gif) | 31259_Harry Curtis -..> | 2026-01-07 16:34 | 113K | |
![[ ]](/icons/layout.gif) | 32492_Adams Industri..> | 2026-01-13 07:51 | 114K | |
![[ ]](/icons/layout.gif) | 24742_J Brady Garage..> | 2025-12-10 13:42 | 114K | |
![[ ]](/icons/layout.gif) | 22436_Clic Garage Do..> | 2025-12-03 13:11 | 114K | |
![[ ]](/icons/layout.gif) | 22093_J Brady Garage..> | 2025-12-02 14:45 | 114K | |
![[ ]](/icons/layout.gif) | 31924_J Brady Garage..> | 2026-01-09 09:14 | 114K | |
![[ ]](/icons/layout.gif) | 30140_UK Rollerdoors..> | 2026-01-05 12:25 | 114K | |
![[ ]](/icons/layout.gif) | 30238_UK Rollerdoors..> | 2026-01-05 14:32 | 115K | |
![[ ]](/icons/layout.gif) | 61654_June Overett -..> | 2026-04-01 08:31 | 115K | |
![[ ]](/icons/layout.gif) | 39345_S.Cosgrove Ste..> | 2026-02-02 15:27 | 115K | |
![[ ]](/icons/layout.gif) | 57027_Ezi-Dor Ltd Tr..> | 2026-03-19 15:12 | 115K | |
![[ ]](/icons/layout.gif) | 46614_Go Direct Door..> | 2026-02-20 11:43 | 115K | |
![[ ]](/icons/layout.gif) | 60340_William Pritch..> | 2026-03-30 07:11 | 115K | |
![[ ]](/icons/layout.gif) | 60418_NBC Commercial..> | 2026-03-30 08:30 | 115K | |
![[ ]](/icons/layout.gif) | 65705_Wall Garage Do..> | 2026-04-14 13:12 | 115K | |
![[ ]](/icons/layout.gif) | 49708_Pro-Door Ltd P..> | 2026-03-02 12:37 | 115K | |
![[ ]](/icons/layout.gif) | 60503_Tilak Sharma -..> | 2026-03-30 10:36 | 115K | |
![[ ]](/icons/layout.gif) | 54536_Thetford Glass..> | 2026-03-13 07:58 | 115K | |
![[ ]](/icons/layout.gif) | 65772_Serenade Home ..> | 2026-04-14 14:10 | 115K | |
![[ ]](/icons/layout.gif) | 70002_All About Door..> | 2026-04-24 11:02 | 115K | |
![[ ]](/icons/layout.gif) | 64650_Profascia Delr..> | 2026-04-10 13:17 | 115K | |
![[ ]](/icons/layout.gif) | 49678_Lynne Young - ..> | 2026-03-02 12:02 | 115K | |
![[ ]](/icons/layout.gif) | 51165_T D Rollerdoor..> | 2026-03-05 08:10 | 115K | |
![[ ]](/icons/layout.gif) | 39047_CWD Improvemen..> | 2026-01-30 16:23 | 115K | |
![[ ]](/icons/layout.gif) | 43741_TPS Gates & Do..> | 2026-02-13 15:25 | 115K | |
![[ ]](/icons/layout.gif) | 45094_Lockdown Rolle..> | 2026-02-17 16:41 | 115K | |
![[ ]](/icons/layout.gif) | 48635_Taundry Doors ..> | 2026-02-26 14:16 | 115K | |
![[ ]](/icons/layout.gif) | 43377_T D Rollerdoor..> | 2026-02-13 07:39 | 115K | |
![[ ]](/icons/layout.gif) | 59674_CWD Improvemen..> | 2026-03-26 13:52 | 115K | |
![[ ]](/icons/layout.gif) | 68682_TPS Gates & Do..> | 2026-04-21 14:27 | 115K | |
![[ ]](/icons/layout.gif) | 57965_Grant Tilley G..> | 2026-03-23 11:24 | 115K | |
![[ ]](/icons/layout.gif) | 68450_Dave North - M..> | 2026-04-21 12:14 | 115K | |
![[ ]](/icons/layout.gif) | 63064_Wall Garage Do..> | 2026-04-07 13:48 | 115K | |
![[ ]](/icons/layout.gif) | 60397_TH Installatio..> | 2026-03-30 08:13 | 115K | |
![[ ]](/icons/layout.gif) | 35441_Ideal Industri..> | 2026-01-21 07:44 | 115K | |
![[ ]](/icons/layout.gif) | 57364_Absolute Garag..> | 2026-03-20 10:55 | 115K | |
![[ ]](/icons/layout.gif) | 51149_D H Gates And ..> | 2026-03-05 08:03 | 115K | |
![[ ]](/icons/layout.gif) | 67409_CPS Custom Pro..> | 2026-04-17 15:43 | 115K | |
![[ ]](/icons/layout.gif) | 62441_AJ Trade Andre..> | 2026-04-02 13:29 | 115K | |
![[ ]](/icons/layout.gif) | 66881_Eaton Park Win..> | 2026-04-16 15:11 | 115K | |
![[ ]](/icons/layout.gif) | 37793_R B Installati..> | 2026-01-28 09:27 | 115K | |
![[ ]](/icons/layout.gif) | 33962_profascia Delr..> | 2026-01-15 16:01 | 115K | |
![[ ]](/icons/layout.gif) | 49014_Keith Worboys ..> | 2026-02-27 10:14 | 115K | |
![[ ]](/icons/layout.gif) | 39902_Coles Building..> | 2026-02-03 12:06 | 115K | |
![[ ]](/icons/layout.gif) | 37290_Tara Garage Do..> | 2026-01-27 08:31 | 115K | |
![[ ]](/icons/layout.gif) | 36204_Northants Gara..> | 2026-01-22 16:09 | 115K | |
![[ ]](/icons/layout.gif) | 64894_SDS (Isle Of M..> | 2026-04-13 08:39 | 115K | |
![[ ]](/icons/layout.gif) | 42216_Keith Worboys ..> | 2026-02-10 11:39 | 115K | |
![[ ]](/icons/layout.gif) | 68095_Howlett Garage..> | 2026-04-21 07:22 | 115K | |
![[ ]](/icons/layout.gif) | 41118_Coles Building..> | 2026-02-05 16:58 | 115K | |
![[ ]](/icons/layout.gif) | 68264_UK Rollerdoors..> | 2026-04-21 09:40 | 115K | |
![[ ]](/icons/layout.gif) | 69501_Essex Prestige..> | 2026-04-23 12:29 | 115K | |
![[ ]](/icons/layout.gif) | 40611_Roller 2 You (..> | 2026-02-04 16:02 | 115K | |
![[ ]](/icons/layout.gif) | 40943_Tudor Design M..> | 2026-02-05 12:15 | 115K | |
![[ ]](/icons/layout.gif) | 63851_Garage Door So..> | 2026-04-09 07:38 | 115K | |
![[ ]](/icons/layout.gif) | 35810_Hanney Glazed ..> | 2026-01-21 14:56 | 115K | |
![[ ]](/icons/layout.gif) | 47672_Keith Worboys ..> | 2026-02-24 12:58 | 115K | |
![[ ]](/icons/layout.gif) | 57513_Darren Woodall..> | 2026-03-20 13:52 | 115K | |
![[ ]](/icons/layout.gif) | 40951_Tudor Design M..> | 2026-02-05 12:40 | 115K | |
![[ ]](/icons/layout.gif) | 63882_Wall Garage Do..> | 2026-04-09 08:14 | 115K | |
![[ ]](/icons/layout.gif) | 36725_SDS (Isle Of M..> | 2026-01-23 16:57 | 115K | |
![[ ]](/icons/layout.gif) | 38554_Nigel Bruce - ..> | 2026-01-29 15:08 | 115K | |
![[ ]](/icons/layout.gif) | 35142_Fortress Doors..> | 2026-01-20 11:59 | 115K | |
![[ ]](/icons/layout.gif) | 63594_Ecosse Garage ..> | 2026-04-08 12:51 | 115K | |
![[ ]](/icons/layout.gif) | 56650_Go Direct Door..> | 2026-03-19 08:14 | 115K | |
![[ ]](/icons/layout.gif) | 39777_S.Cosgrove Ste..> | 2026-02-03 10:27 | 115K | |
![[ ]](/icons/layout.gif) | 51738_Jurassic Doors..> | 2026-03-06 07:31 | 115K | |
![[ ]](/icons/layout.gif) | 41569_Coles Building..> | 2026-02-09 10:10 | 115K | |
![[ ]](/icons/layout.gif) | 57038_Ezi-Dor Ltd Tr..> | 2026-03-19 15:25 | 115K | |
![[ ]](/icons/layout.gif) | 58233_Ace Garage Doo..> | 2026-03-23 16:55 | 115K | |
![[ ]](/icons/layout.gif) | 65177_Ace Garage Doo..> | 2026-04-13 12:57 | 115K | |
![[ ]](/icons/layout.gif) | 50773_Welbeck Shutte..> | 2026-03-04 10:57 | 115K | |
![[ ]](/icons/layout.gif) | 35590_Fortress Doors..> | 2026-01-21 10:22 | 115K | |
![[ ]](/icons/layout.gif) | 36672_Absolute Garag..> | 2026-01-23 15:25 | 115K | |
![[ ]](/icons/layout.gif) | 60364_UK Rollerdoors..> | 2026-03-30 07:35 | 115K | |
![[ ]](/icons/layout.gif) | 66349_Profascia Delr..> | 2026-04-15 14:48 | 115K | |
![[ ]](/icons/layout.gif) | 38889_Wall Garage Do..> | 2026-01-30 12:03 | 115K | |
![[ ]](/icons/layout.gif) | 33462_Alps Home Impr..> | 2026-01-15 07:33 | 115K | |
![[ ]](/icons/layout.gif) | 35869_Fortress Doors..> | 2026-01-21 16:43 | 115K | |
![[ ]](/icons/layout.gif) | 54926_Spa Roller Doo..> | 2026-03-13 14:26 | 115K | |
![[ ]](/icons/layout.gif) | 58099_Fortress Doors..> | 2026-03-23 13:43 | 115K | |
![[ ]](/icons/layout.gif) | 35783_SDS (Isle Of M..> | 2026-01-21 14:04 | 115K | |
![[ ]](/icons/layout.gif) | 35784_SDS (Isle Of M..> | 2026-01-21 14:08 | 115K | |
![[ ]](/icons/layout.gif) | 37929_Wiltshire Gara..> | 2026-01-28 12:28 | 115K | |
![[ ]](/icons/layout.gif) | 52742_NJL Pattison L..> | 2026-03-09 15:01 | 115K | |
![[ ]](/icons/layout.gif) | 67781_EZ2OWN Ltd Pau..> | 2026-04-20 11:07 | 115K | |
![[ ]](/icons/layout.gif) | 52506_JM Doors Jon B..> | 2026-03-09 11:08 | 115K | |
![[ ]](/icons/layout.gif) | 68651_C Marl Systems..> | 2026-04-21 13:56 | 115K | |
![[ ]](/icons/layout.gif) | 33960_profascia Delr..> | 2026-01-15 15:57 | 115K | |
![[ ]](/icons/layout.gif) | 39068_Garage Door So..> | 2026-01-30 17:01 | 115K | |
![[ ]](/icons/layout.gif) | 65474_T D Rollerdoor..> | 2026-04-14 09:55 | 115K | |
![[ ]](/icons/layout.gif) | 58262_NJL Pattison L..> | 2026-03-24 08:04 | 115K | |
![[ ]](/icons/layout.gif) | 57749_Fortress Doors..> | 2026-03-23 08:57 | 115K | |
![[ ]](/icons/layout.gif) | 39904_Coles Building..> | 2026-02-03 12:09 | 115K | |
![[ ]](/icons/layout.gif) | 35668_Custom Trade S..> | 2026-01-21 11:53 | 115K | |
![[ ]](/icons/layout.gif) | 41425_Coles Building..> | 2026-02-06 14:30 | 115K | |
![[ ]](/icons/layout.gif) | 42105_Garage Door So..> | 2026-02-10 09:58 | 115K | |
![[ ]](/icons/layout.gif) | 50002_SDS (Isle Of M..> | 2026-03-02 17:02 | 115K | |
![[ ]](/icons/layout.gif) | 39067_Ecosse Garage ..> | 2026-01-30 16:50 | 115K | |
![[ ]](/icons/layout.gif) | 35306_Jurassic Doors..> | 2026-01-20 15:23 | 115K | |
![[ ]](/icons/layout.gif) | 41482_SW Trade Frame..> | 2026-02-06 16:57 | 115K | |
![[ ]](/icons/layout.gif) | 39785_Ecosse Garage ..> | 2026-02-03 10:31 | 115K | |
![[ ]](/icons/layout.gif) | 63066_Wall Garage Do..> | 2026-04-07 13:48 | 115K | |
![[ ]](/icons/layout.gif) | 58121_D E Bliss Buil..> | 2026-03-23 14:23 | 115K | |
![[ ]](/icons/layout.gif) | 47360_EcoGlaze Group..> | 2026-02-23 16:53 | 115K | |
![[ ]](/icons/layout.gif) | 40542_Eastern Frames..> | 2026-02-04 14:33 | 115K | |
![[ ]](/icons/layout.gif) | 38938_Elevate Doors ..> | 2026-01-30 13:57 | 115K | |
![[ ]](/icons/layout.gif) | 54896_Mint Glazing N..> | 2026-03-13 14:18 | 115K | |
![[ ]](/icons/layout.gif) | 66631_Secure Entranc..> | 2026-04-16 11:31 | 115K | |
![[ ]](/icons/layout.gif) | 48010_Liam Johnson -..> | 2026-02-25 09:32 | 115K | |
![[ ]](/icons/layout.gif) | 54770_Doorolla Ltd S..> | 2026-03-13 12:39 | 115K | |
![[ ]](/icons/layout.gif) | 64481_M. A. E. Windo..> | 2026-04-10 10:14 | 115K | |
![[ ]](/icons/layout.gif) | 35938_Keith Worboys ..> | 2026-01-22 09:50 | 115K | |
![[ ]](/icons/layout.gif) | 36973_Squeaky Clean ..> | 2026-01-26 12:40 | 115K | |
![[ ]](/icons/layout.gif) | 66493_Open And Shut ..> | 2026-04-16 08:20 | 115K | |
![[ ]](/icons/layout.gif) | 51293_Chelmsford Rol..> | 2026-03-05 09:56 | 115K | |
![[ ]](/icons/layout.gif) | 66357_Profascia Delr..> | 2026-04-15 14:57 | 115K | |
![[ ]](/icons/layout.gif) | 50004_Aplas Windows ..> | 2026-03-02 17:06 | 115K | |
![[ ]](/icons/layout.gif) | 50834_Aplas Windows ..> | 2026-03-04 12:02 | 115K | |
![[ ]](/icons/layout.gif) | 53086_Go Direct Door..> | 2026-03-10 09:49 | 115K | |
![[ ]](/icons/layout.gif) | 58387_Ace Garage Doo..> | 2026-03-24 09:46 | 115K | |
![[ ]](/icons/layout.gif) | 61990_Fortress Doors..> | 2026-04-01 14:14 | 115K | |
![[ ]](/icons/layout.gif) | 51966_Doors 4 Garage..> | 2026-03-06 10:48 | 115K | |
![[ ]](/icons/layout.gif) | 63160_Wall Garage Do..> | 2026-04-07 14:49 | 115K | |
![[ ]](/icons/layout.gif) | 34275_Northumberland..> | 2026-01-16 13:00 | 115K | |
![[ ]](/icons/layout.gif) | 58478_Profascia Delr..> | 2026-03-24 10:54 | 115K | |
![[ ]](/icons/layout.gif) | 38053_Eclipse Doors ..> | 2026-01-28 14:23 | 115K | |
![[ ]](/icons/layout.gif) | 49966_Easy-Roll Ben ..> | 2026-03-02 16:24 | 115K | |
![[ ]](/icons/layout.gif) | 35607_Elevate Doors ..> | 2026-01-21 11:22 | 115K | |
![[ ]](/icons/layout.gif) | 65226_SDS (Isle Of M..> | 2026-04-13 14:22 | 115K | |
![[ ]](/icons/layout.gif) | 34269_The Lothian Ga..> | 2026-01-16 12:08 | 115K | |
![[ ]](/icons/layout.gif) | 34293_Thetford Glass..> | 2026-01-16 13:37 | 115K | |
![[ ]](/icons/layout.gif) | 36723_Hanney Glazed ..> | 2026-01-23 16:54 | 115K | |
![[ ]](/icons/layout.gif) | 52067_Elite Glazing ..> | 2026-03-06 12:27 | 115K | |
![[ ]](/icons/layout.gif) | 66351_Profascia Delr..> | 2026-04-15 14:51 | 115K | |
![[ ]](/icons/layout.gif) | 34025_Titan Garage D..> | 2026-01-16 07:35 | 115K | |
![[ ]](/icons/layout.gif) | 57679_Fortress Doors..> | 2026-03-20 16:46 | 115K | |
![[ ]](/icons/layout.gif) | 35546_Rollermatic Ga..> | 2026-01-21 09:36 | 115K | |
![[ ]](/icons/layout.gif) | 68082_LNR Door Solut..> | 2026-04-21 07:14 | 115K | |
![[ ]](/icons/layout.gif) | 47714_Serenade Home ..> | 2026-02-24 14:12 | 115K | |
![[ ]](/icons/layout.gif) | 46092_Scotia Garage ..> | 2026-02-19 12:24 | 115K | |
![[ ]](/icons/layout.gif) | 42440_Go Direct Door..> | 2026-02-11 08:23 | 115K | |
![[ ]](/icons/layout.gif) | 68430_SDS (Isle Of M..> | 2026-04-21 11:38 | 115K | |
![[ ]](/icons/layout.gif) | 56473_Serenade Home ..> | 2026-03-18 13:54 | 115K | |
![[ ]](/icons/layout.gif) | 62989_Rolladoor NR9 ..> | 2026-04-07 12:53 | 115K | |
![[ ]](/icons/layout.gif) | 65357_Doorolla Ltd S..> | 2026-04-14 07:54 | 115K | |
![[ ]](/icons/layout.gif) | 57251_Fortress Doors..> | 2026-03-20 09:31 | 115K | |
![[ ]](/icons/layout.gif) | 59842_Michael Mazur ..> | 2026-03-26 16:53 | 115K | |
![[ ]](/icons/layout.gif) | 52231_Elite Glazing ..> | 2026-03-06 14:58 | 115K | |
![[ ]](/icons/layout.gif) | 60175_The Lothian Ga..> | 2026-03-27 12:54 | 115K | |
![[ ]](/icons/layout.gif) | 35014_Fortress Doors..> | 2026-01-20 10:04 | 115K | |
![[ ]](/icons/layout.gif) | 36464_Chelmsford Rol..> | 2026-01-23 11:17 | 115K | |
![[ ]](/icons/layout.gif) | 59142_Ross Garage Do..> | 2026-03-25 12:46 | 115K | |
![[ ]](/icons/layout.gif) | 50358_Absolute Garag..> | 2026-03-03 14:35 | 115K | |
![[ ]](/icons/layout.gif) | 58132_JJ Secure Door..> | 2026-03-23 14:43 | 115K | |
![[ ]](/icons/layout.gif) | 54728_Optimum Doors ..> | 2026-03-13 11:38 | 115K | |
![[ ]](/icons/layout.gif) | 66369_The Lothian Ga..> | 2026-04-15 15:17 | 115K | |
![[ ]](/icons/layout.gif) | 39812_Eric Mallis Jo..> | 2026-02-03 10:53 | 115K | |
![[ ]](/icons/layout.gif) | 65335_Ezi-Dor Ltd Tr..> | 2026-04-14 07:29 | 115K | |
![[ ]](/icons/layout.gif) | 54960_Thetford Glass..> | 2026-03-13 14:41 | 115K | |
![[ ]](/icons/layout.gif) | 39783_SDS (Isle Of M..> | 2026-02-03 10:29 | 115K | |
![[ ]](/icons/layout.gif) | 56206_Roll Right Gar..> | 2026-03-18 10:19 | 115K | |
![[ ]](/icons/layout.gif) | 36122_Reputation Win..> | 2026-01-22 13:03 | 115K | |
![[ ]](/icons/layout.gif) | 40442_Wiltshire Gara..> | 2026-02-04 12:06 | 115K | |
![[ ]](/icons/layout.gif) | 41578_New Forest Rol..> | 2026-02-09 10:24 | 115K | |
![[ ]](/icons/layout.gif) | 69629_Smart Home Ent..> | 2026-04-23 14:51 | 115K | |
![[ ]](/icons/layout.gif) | 37282_Tara Garage Do..> | 2026-01-27 08:24 | 115K | |
![[ ]](/icons/layout.gif) | 62263_Ecosse Garage ..> | 2026-04-02 10:32 | 115K | |
![[ ]](/icons/layout.gif) | 43506_Midlands Secur..> | 2026-02-13 09:37 | 115K | |
![[ ]](/icons/layout.gif) | 55332_Wall Garage Do..> | 2026-03-16 13:32 | 115K | |
![[ ]](/icons/layout.gif) | 52665_Clic Garage Do..> | 2026-03-09 13:38 | 115K | |
![[ ]](/icons/layout.gif) | 38549_ASM Windows Ad..> | 2026-01-29 14:42 | 115K | |
![[ ]](/icons/layout.gif) | 44352_Roll Right Gar..> | 2026-02-16 16:11 | 115K | |
![[ ]](/icons/layout.gif) | 42361_Clic Garage Do..> | 2026-02-10 15:36 | 115K | |
![[ ]](/icons/layout.gif) | 54535_ThermoGreen Lt..> | 2026-03-13 07:58 | 115K | |
![[ ]](/icons/layout.gif) | 68856_CPS Custom Pro..> | 2026-04-22 08:50 | 115K | |
![[ ]](/icons/layout.gif) | 33637_Eclipse Doors ..> | 2026-01-15 10:03 | 115K | |
![[ ]](/icons/layout.gif) | 63318_Clic Garage Do..> | 2026-04-08 07:39 | 115K | |
![[ ]](/icons/layout.gif) | 33191_Reputation Win..> | 2026-01-14 11:49 | 115K | |
![[ ]](/icons/layout.gif) | 37293_Tara Garage Do..> | 2026-01-27 08:35 | 115K | |
![[ ]](/icons/layout.gif) | 54871_Mead Property ..> | 2026-03-13 14:10 | 115K | |
![[ ]](/icons/layout.gif) | 54982_Mead Property ..> | 2026-03-13 15:29 | 115K | |
![[ ]](/icons/layout.gif) | 42996_Hanney Glazed ..> | 2026-02-12 11:05 | 115K | |
![[ ]](/icons/layout.gif) | 49061_Ace Garage Doo..> | 2026-02-27 11:26 | 115K | |
![[ ]](/icons/layout.gif) | 51209_Tru-Fit Window..> | 2026-03-05 08:43 | 115K | |
![[ ]](/icons/layout.gif) | 51252_Tru-Fit Window..> | 2026-03-05 09:34 | 115K | |
![[ ]](/icons/layout.gif) | 53398_Tru-Fit Window..> | 2026-03-10 14:45 | 115K | |
![[ ]](/icons/layout.gif) | 41685_Garage Doors 2..> | 2026-02-09 12:34 | 115K | |
![[ ]](/icons/layout.gif) | 43530_CPS Custom Pro..> | 2026-02-13 09:55 | 115K | |
![[ ]](/icons/layout.gif) | 42429_Direct Trade P..> | 2026-02-11 08:01 | 115K | |
![[ ]](/icons/layout.gif) | 39506_Eclipse Doors ..> | 2026-02-02 16:52 | 115K | |
![[ ]](/icons/layout.gif) | 59185_Fortress Doors..> | 2026-03-25 13:26 | 115K | |
![[ ]](/icons/layout.gif) | 38915_Everbright Win..> | 2026-01-30 13:07 | 115K | |
![[ ]](/icons/layout.gif) | 40603_CWD Improvemen..> | 2026-02-04 15:56 | 115K | |
![[ ]](/icons/layout.gif) | 61049_IAmDoors Ltd S..> | 2026-03-31 09:30 | 115K | |
![[ ]](/icons/layout.gif) | 63470_PB Doors Paul ..> | 2026-04-08 10:01 | 115K | |
![[ ]](/icons/layout.gif) | 68913_LNR Door Solut..> | 2026-04-22 10:08 | 115K | |
![[ ]](/icons/layout.gif) | 53183_R B Installati..> | 2026-03-10 11:48 | 115K | |
![[ ]](/icons/layout.gif) | 53911_Go Direct Door..> | 2026-03-11 14:24 | 115K | |
![[ ]](/icons/layout.gif) | 69178_The Lothian Ga..> | 2026-04-22 15:38 | 115K | |
![[ ]](/icons/layout.gif) | 23555_East Anglia Ro..> | 2025-12-05 15:50 | 115K | |
![[ ]](/icons/layout.gif) | 36828_Eagle Property..> | 2026-01-26 09:50 | 115K | |
![[ ]](/icons/layout.gif) | 50340_My Garage Door..> | 2026-03-03 14:11 | 115K | |
![[ ]](/icons/layout.gif) | 38846_ThermoGreen Lt..> | 2026-01-30 11:21 | 115K | |
![[ ]](/icons/layout.gif) | 54629_Go Direct Door..> | 2026-03-13 09:41 | 115K | |
![[ ]](/icons/layout.gif) | 38022_Dream Installa..> | 2026-01-28 13:53 | 115K | |
![[ ]](/icons/layout.gif) | 52259_CPS Custom Pro..> | 2026-03-06 16:19 | 115K | |
![[ ]](/icons/layout.gif) | 53847_SDS (Isle Of M..> | 2026-03-11 12:38 | 115K | |
![[ ]](/icons/layout.gif) | 64105_Doors 4 Garage..> | 2026-04-09 12:40 | 115K | |
![[ ]](/icons/layout.gif) | 62294_Excellent Ltd ..> | 2026-04-02 11:14 | 115K | |
![[ ]](/icons/layout.gif) | 66167_SDS (Isle Of M..> | 2026-04-15 10:20 | 115K | |
![[ ]](/icons/layout.gif) | 66227_SDS (Isle Of M..> | 2026-04-15 11:50 | 115K | |
![[ ]](/icons/layout.gif) | 33679_UK Rollerdoors..> | 2026-01-15 10:49 | 115K | |
![[ ]](/icons/layout.gif) | 50890_Elite Garage D..> | 2026-03-04 13:26 | 115K | |
![[ ]](/icons/layout.gif) | 37151_Camberley Wind..> | 2026-01-26 15:16 | 115K | |
![[ ]](/icons/layout.gif) | 57678_P & R Door Sys..> | 2026-03-20 16:43 | 115K | |
![[ ]](/icons/layout.gif) | 35790_Starlite Home ..> | 2026-01-21 14:14 | 115K | |
![[ ]](/icons/layout.gif) | 49207_Wall Garage Do..> | 2026-02-27 14:39 | 115K | |
![[ ]](/icons/layout.gif) | 63106_Norfolk Broads..> | 2026-04-07 13:57 | 115K | |
![[ ]](/icons/layout.gif) | 57671_T D Rollerdoor..> | 2026-03-20 16:30 | 115K | |
![[ ]](/icons/layout.gif) | 46577_Eclipse Doors ..> | 2026-02-20 11:04 | 115K | |
![[ ]](/icons/layout.gif) | 51959_SB Joinery Ste..> | 2026-03-06 10:45 | 115K | |
![[ ]](/icons/layout.gif) | 55174_JM Doors Jon B..> | 2026-03-16 09:38 | 115K | |
![[ ]](/icons/layout.gif) | 58201_Grant Tilley G..> | 2026-03-23 16:23 | 115K | |
![[ ]](/icons/layout.gif) | 36459_Willow Builder..> | 2026-01-23 11:12 | 115K | |
![[ ]](/icons/layout.gif) | 61708_C & P Doors Cr..> | 2026-04-01 09:21 | 115K | |
![[ ]](/icons/layout.gif) | 64731_Bespoke Oak An..> | 2026-04-10 14:59 | 115K | |
![[ ]](/icons/layout.gif) | 34366_M. A. E. Windo..> | 2026-01-16 15:17 | 115K | |
![[ ]](/icons/layout.gif) | 40515_Adams Industri..> | 2026-02-04 13:52 | 115K | |
![[ ]](/icons/layout.gif) | 45288_Go Direct Door..> | 2026-02-18 08:25 | 115K | |
![[ ]](/icons/layout.gif) | 46053_Fit & Fix Wind..> | 2026-02-19 11:16 | 115K | |
![[ ]](/icons/layout.gif) | 61705_C & P Doors Cr..> | 2026-04-01 09:19 | 115K | |
![[ ]](/icons/layout.gif) | 62728_Doorolla Ltd S..> | 2026-04-07 09:03 | 115K | |
![[ ]](/icons/layout.gif) | 35239_Open And Shut ..> | 2026-01-20 14:36 | 115K | |
![[ ]](/icons/layout.gif) | 41355_Richard Horspo..> | 2026-02-06 12:11 | 115K | |
![[ ]](/icons/layout.gif) | 50376_Thrigby Hall W..> | 2026-03-03 15:32 | 115K | |
![[ ]](/icons/layout.gif) | 66024_SDS (Isle Of M..> | 2026-04-15 08:31 | 115K | |
![[ ]](/icons/layout.gif) | 66226_SDS (Isle Of M..> | 2026-04-15 11:49 | 115K | |
![[ ]](/icons/layout.gif) | 69746_Fortress Doors..> | 2026-04-24 07:33 | 115K | |
![[ ]](/icons/layout.gif) | 55877_Elite Glazing ..> | 2026-03-17 14:06 | 115K | |
![[ ]](/icons/layout.gif) | 67649_Fortress Doors..> | 2026-04-20 09:34 | 115K | |
![[ ]](/icons/layout.gif) | 34492_Fortress Doors..> | 2026-01-19 09:23 | 115K | |
![[ ]](/icons/layout.gif) | 61347_St Helens Upvc..> | 2026-03-31 12:49 | 115K | |
![[ ]](/icons/layout.gif) | 61851_Wall Garage Do..> | 2026-04-01 11:42 | 115K | |
![[ ]](/icons/layout.gif) | 34430_UK Rollerdoors..> | 2026-01-19 07:50 | 115K | |
![[ ]](/icons/layout.gif) | 39985_Wiltshire Gara..> | 2026-02-03 13:34 | 115K | |
![[ ]](/icons/layout.gif) | 68844_Harry Curtis H..> | 2026-04-22 08:42 | 115K | |
![[ ]](/icons/layout.gif) | 61424_NBC Commercial..> | 2026-03-31 13:34 | 115K | |
![[ ]](/icons/layout.gif) | 37734_R B Installati..> | 2026-01-28 07:39 | 115K | |
![[ ]](/icons/layout.gif) | 45001_Secure Entranc..> | 2026-02-17 14:28 | 115K | |
![[ ]](/icons/layout.gif) | 60899_Rollermatic Ga..> | 2026-03-30 16:02 | 115K | |
![[ ]](/icons/layout.gif) | 35377_Fortress Doors..> | 2026-01-20 16:09 | 115K | |
![[ ]](/icons/layout.gif) | 57892_M. A. E. Windo..> | 2026-03-23 10:42 | 115K | |
![[ ]](/icons/layout.gif) | 62897_Go Direct Door..> | 2026-04-07 11:35 | 115K | |
![[ ]](/icons/layout.gif) | 66212_Elite Glazing ..> | 2026-04-15 11:24 | 115K | |
![[ ]](/icons/layout.gif) | 36216_M & S Home Ins..> | 2026-01-22 16:36 | 115K | |
![[ ]](/icons/layout.gif) | 37791_R B Installati..> | 2026-01-28 09:20 | 115K | |
![[ ]](/icons/layout.gif) | 51415_T D Rollerdoor..> | 2026-03-05 11:45 | 115K | |
![[ ]](/icons/layout.gif) | 51421_T D Rollerdoor..> | 2026-03-05 11:50 | 115K | |
![[ ]](/icons/layout.gif) | 52256_Highlands Elec..> | 2026-03-06 16:11 | 115K | |
![[ ]](/icons/layout.gif) | 56579_M. A. E. Windo..> | 2026-03-18 16:13 | 115K | |
![[ ]](/icons/layout.gif) | 58223_Wall Garage Do..> | 2026-03-23 16:48 | 115K | |
![[ ]](/icons/layout.gif) | 59139_MJS Installati..> | 2026-03-25 12:34 | 115K | |
![[ ]](/icons/layout.gif) | 60096_The Lothian Ga..> | 2026-03-27 11:57 | 115K | |
![[ ]](/icons/layout.gif) | 37158_Camberley Wind..> | 2026-01-26 15:18 | 115K | |
![[ ]](/icons/layout.gif) | 50091_C&J Contractor..> | 2026-03-03 09:07 | 115K | |
![[ ]](/icons/layout.gif) | 50882_Open And Shut ..> | 2026-03-04 13:19 | 115K | |
![[ ]](/icons/layout.gif) | 66348_Profascia Delr..> | 2026-04-15 14:44 | 115K | |
![[ ]](/icons/layout.gif) | 67136_Eaton Park Win..> | 2026-04-17 10:34 | 115K | |
![[ ]](/icons/layout.gif) | 68803_Electricity & ..> | 2026-04-22 07:46 | 115K | |
![[ ]](/icons/layout.gif) | 47166_Lockdown Rolle..> | 2026-02-23 15:13 | 115K | |
![[ ]](/icons/layout.gif) | 60950_TH Installatio..> | 2026-03-31 08:37 | 115K | |
![[ ]](/icons/layout.gif) | 50225_C&J Contractor..> | 2026-03-03 11:23 | 115K | |
![[ ]](/icons/layout.gif) | 54145_C&J Contractor..> | 2026-03-12 10:40 | 115K | |
![[ ]](/icons/layout.gif) | 33485_J Brady Garage..> | 2026-01-15 08:31 | 115K | |
![[ ]](/icons/layout.gif) | 59206_Wiltshire Gara..> | 2026-03-25 13:46 | 115K | |
![[ ]](/icons/layout.gif) | 35479_Fortress Doors..> | 2026-01-21 08:32 | 115K | |
![[ ]](/icons/layout.gif) | 41721_Hanney Glazed ..> | 2026-02-09 13:45 | 115K | |
![[ ]](/icons/layout.gif) | 50859_M. A. E. Windo..> | 2026-03-04 13:01 | 115K | |
![[ ]](/icons/layout.gif) | 69442_The Garage Doo..> | 2026-04-23 11:15 | 115K | |
![[ ]](/icons/layout.gif) | 69802_Right Choice M..> | 2026-04-24 08:25 | 115K | |
![[ ]](/icons/layout.gif) | 52583_Rollermatic Ga..> | 2026-03-09 11:53 | 115K | |
![[ ]](/icons/layout.gif) | 68892_Fortress Doors..> | 2026-04-22 09:31 | 115K | |
![[ ]](/icons/layout.gif) | 59335_All About Door..> | 2026-03-26 08:44 | 115K | |
![[ ]](/icons/layout.gif) | 65819_The Lothian Ga..> | 2026-04-14 14:37 | 115K | |
![[ ]](/icons/layout.gif) | 66880_The Lothian Ga..> | 2026-04-16 15:11 | 115K | |
![[ ]](/icons/layout.gif) | 39816_Eric Mallis Jo..> | 2026-02-03 10:59 | 115K | |
![[ ]](/icons/layout.gif) | 39396_P & R Door Sys..> | 2026-02-02 15:56 | 115K | |
![[ ]](/icons/layout.gif) | 48631_Windowcraft De..> | 2026-02-26 14:12 | 115K | |
![[ ]](/icons/layout.gif) | 48637_Windowcraft De..> | 2026-02-26 14:18 | 115K | |
![[ ]](/icons/layout.gif) | 65581_Keith Worboys ..> | 2026-04-14 11:51 | 115K | |
![[ ]](/icons/layout.gif) | 33457_Gilberts Home ..> | 2026-01-14 16:57 | 115K | |
![[ ]](/icons/layout.gif) | 42220_Keith Worboys ..> | 2026-02-10 11:48 | 115K | |
![[ ]](/icons/layout.gif) | 35436_Fortress Doors..> | 2026-01-21 07:29 | 115K | |
![[ ]](/icons/layout.gif) | 35940_Danbury Garage..> | 2026-01-22 09:53 | 115K | |
![[ ]](/icons/layout.gif) | 37554_Camberley Wind..> | 2026-01-27 13:53 | 115K | |
![[ ]](/icons/layout.gif) | 37930_Wall Garage Do..> | 2026-01-28 12:35 | 115K | |
![[ ]](/icons/layout.gif) | 44214_Fortress Doors..> | 2026-02-16 14:11 | 115K | |
![[ ]](/icons/layout.gif) | 50683_Roller Doors 2..> | 2026-03-04 09:52 | 115K | |
![[ ]](/icons/layout.gif) | 50910_D Thurston Bui..> | 2026-03-04 13:51 | 115K | |
![[ ]](/icons/layout.gif) | 41491_Jurassic Doors..> | 2026-02-09 08:07 | 115K | |
![[ ]](/icons/layout.gif) | 41686_Admiral Home I..> | 2026-02-09 12:37 | 115K | |
![[ ]](/icons/layout.gif) | 41986_Jurassic Doors..> | 2026-02-10 07:36 | 115K | |
![[ ]](/icons/layout.gif) | 60921_Avon Automated..> | 2026-03-31 07:33 | 115K | |
![[ ]](/icons/layout.gif) | 69490_Essex Prestige..> | 2026-04-23 12:11 | 115K | |
![[ ]](/icons/layout.gif) | 43623_Ideal Industri..> | 2026-02-13 12:04 | 115K | |
![[ ]](/icons/layout.gif) | 69435_SDS Services E..> | 2026-04-23 11:11 | 115K | |
![[ ]](/icons/layout.gif) | 55848_Avon Automated..> | 2026-03-17 13:50 | 115K | |
![[ ]](/icons/layout.gif) | 62081_The Lothian Ga..> | 2026-04-02 07:04 | 115K | |
![[ ]](/icons/layout.gif) | 65304_Doorolla Ltd S..> | 2026-04-14 07:08 | 115K | |
![[ ]](/icons/layout.gif) | 50450_P & R Door Sys..> | 2026-03-03 16:39 | 115K | |
![[ ]](/icons/layout.gif) | 45732_Elite Glazing ..> | 2026-02-18 14:26 | 115K | |
![[ ]](/icons/layout.gif) | 49035_Warnsham Windo..> | 2026-02-27 10:50 | 115K | |
![[ ]](/icons/layout.gif) | 55036_Gilberts Home ..> | 2026-03-13 16:28 | 115K | |
![[ ]](/icons/layout.gif) | 55783_Oakley Windows..> | 2026-03-17 12:01 | 115K | |
![[ ]](/icons/layout.gif) | 57663_T D Rollerdoor..> | 2026-03-20 16:13 | 115K | |
![[ ]](/icons/layout.gif) | 57073_Read Technolog..> | 2026-03-19 16:04 | 115K | |
![[ ]](/icons/layout.gif) | 42058_Fortress Doors..> | 2026-02-10 09:36 | 115K | |
![[ ]](/icons/layout.gif) | 43206_Norfolk Broads..> | 2026-02-12 15:18 | 115K | |
![[ ]](/icons/layout.gif) | 60218_WADE WINDOWS I..> | 2026-03-27 13:54 | 115K | |
![[ ]](/icons/layout.gif) | 62075_The Lothian Ga..> | 2026-04-02 06:59 | 115K | |
![[ ]](/icons/layout.gif) | 62735_The Lothian Ga..> | 2026-04-07 09:16 | 115K | |
![[ ]](/icons/layout.gif) | 63161_Norfolk Broads..> | 2026-04-07 14:50 | 115K | |
![[ ]](/icons/layout.gif) | 39733_Hanney Glazed ..> | 2026-02-03 10:01 | 115K | |
![[ ]](/icons/layout.gif) | 42292_The Lothian Ga..> | 2026-02-10 13:14 | 115K | |
![[ ]](/icons/layout.gif) | 38111_Fortress Doors..> | 2026-01-28 16:06 | 115K | |
![[ ]](/icons/layout.gif) | 50527_Danbury Garage..> | 2026-03-04 08:14 | 115K | |
![[ ]](/icons/layout.gif) | 66325_The Lothian Ga..> | 2026-04-15 14:26 | 115K | |
![[ ]](/icons/layout.gif) | 34214_Proud 2 Fix Ma..> | 2026-01-16 10:19 | 115K | |
![[ ]](/icons/layout.gif) | 63169_AJ Trade Andre..> | 2026-04-07 15:00 | 115K | |
![[ ]](/icons/layout.gif) | 63555_Ross Garage Do..> | 2026-04-08 12:05 | 115K | |
![[ ]](/icons/layout.gif) | 36116_J Brady Garage..> | 2026-01-22 12:32 | 115K | |
![[ ]](/icons/layout.gif) | 45445_Coles Building..> | 2026-02-18 09:13 | 115K | |
![[ ]](/icons/layout.gif) | 55524_Jurassic Doors..> | 2026-03-16 15:38 | 115K | |
![[ ]](/icons/layout.gif) | 53755_Warnsham Windo..> | 2026-03-11 11:05 | 115K | |
![[ ]](/icons/layout.gif) | 56154_Replacement Ga..> | 2026-03-18 08:43 | 115K | |
![[ ]](/icons/layout.gif) | 66305_The Lothian Ga..> | 2026-04-15 13:53 | 115K | |
![[ ]](/icons/layout.gif) | 38586_The Lothian Ga..> | 2026-01-29 16:07 | 115K | |
![[ ]](/icons/layout.gif) | 40732_SDS (Isle Of M..> | 2026-02-05 09:06 | 115K | |
![[ ]](/icons/layout.gif) | 42851_Roll Right Gar..> | 2026-02-12 07:48 | 115K | |
![[ ]](/icons/layout.gif) | 60078_Wall Garage Do..> | 2026-03-27 11:24 | 115K | |
![[ ]](/icons/layout.gif) | 65848_Fortress Doors..> | 2026-04-14 14:52 | 115K | |
![[ ]](/icons/layout.gif) | 54740_Rollermatic Ga..> | 2026-03-13 11:46 | 115K | |
![[ ]](/icons/layout.gif) | 39664_The Lothian Ga..> | 2026-02-03 09:20 | 115K | |
![[ ]](/icons/layout.gif) | 50685_Ross Garage Do..> | 2026-03-04 09:55 | 115K | |
![[ ]](/icons/layout.gif) | 62358_The Lothian Ga..> | 2026-04-02 12:53 | 115K | |
![[ ]](/icons/layout.gif) | 39536_J & B Engineer..> | 2026-02-03 07:52 | 115K | |
![[ ]](/icons/layout.gif) | 36968_Squeaky Clean ..> | 2026-01-26 12:34 | 115K | |
![[ ]](/icons/layout.gif) | 52157_Madog Roller D..> | 2026-03-06 14:06 | 115K | |
![[ ]](/icons/layout.gif) | 69942_Wanstall Ltd. ..> | 2026-04-24 10:11 | 115K | |
![[ ]](/icons/layout.gif) | 39837_J & B Engineer..> | 2026-02-03 11:15 | 115K | |
![[ ]](/icons/layout.gif) | 51589_Hanney Glazed ..> | 2026-03-05 14:31 | 115K | |
![[ ]](/icons/layout.gif) | 49443_LNR Door Solut..> | 2026-03-02 09:23 | 115K | |
![[ ]](/icons/layout.gif) | 40139_Hanney Glazed ..> | 2026-02-03 16:17 | 115K | |
![[ ]](/icons/layout.gif) | 48744_Norfolk Broads..> | 2026-02-26 16:37 | 115K | |
![[ ]](/icons/layout.gif) | 60375_Tilehurst Home..> | 2026-03-30 07:51 | 115K | |
![[ ]](/icons/layout.gif) | 64999_Roller Doors 2..> | 2026-04-13 09:52 | 115K | |
![[ ]](/icons/layout.gif) | 47414_The Lothian Ga..> | 2026-02-24 08:32 | 115K | |
![[ ]](/icons/layout.gif) | 61822_Rollermatic Ga..> | 2026-04-01 11:14 | 115K | |
![[ ]](/icons/layout.gif) | 41022_South Atlantic..> | 2026-02-05 14:22 | 115K | |
![[ ]](/icons/layout.gif) | 48640_The Lothian Ga..> | 2026-02-26 14:21 | 115K | |
![[ ]](/icons/layout.gif) | 47456_The Lothian Ga..> | 2026-02-24 09:36 | 115K | |
![[ ]](/icons/layout.gif) | 63722_Fortress Doors..> | 2026-04-08 14:46 | 115K | |
![[ ]](/icons/layout.gif) | 48702_WADE WINDOWS I..> | 2026-02-26 15:44 | 115K | |
![[ ]](/icons/layout.gif) | 63524_Chelmsford Rol..> | 2026-04-08 11:01 | 115K | |
![[ ]](/icons/layout.gif) | 36763_J Brady Garage..> | 2026-01-26 08:33 | 115K | |
![[ ]](/icons/layout.gif) | 40220_Keith Worboys ..> | 2026-02-03 17:09 | 115K | |
![[ ]](/icons/layout.gif) | 66336_The Lothian Ga..> | 2026-04-15 14:38 | 115K | |
![[ ]](/icons/layout.gif) | 35797_St Helens Upvc..> | 2026-01-21 14:30 | 115K | |
![[ ]](/icons/layout.gif) | 40536_Keith Worboys ..> | 2026-02-04 14:27 | 115K | |
![[ ]](/icons/layout.gif) | 53526_Fortress Doors..> | 2026-03-11 07:38 | 115K | |
![[ ]](/icons/layout.gif) | 55553_ADL Door Servi..> | 2026-03-16 16:08 | 115K | |
![[ ]](/icons/layout.gif) | 69510_C Marl Systems..> | 2026-04-23 12:42 | 115K | |
![[ ]](/icons/layout.gif) | 38302_Garage Door So..> | 2026-01-29 10:34 | 115K | |
![[ ]](/icons/layout.gif) | 36671_Dream Installa..> | 2026-01-23 15:25 | 115K | |
![[ ]](/icons/layout.gif) | 42420_UK Rollerdoors..> | 2026-02-10 16:56 | 115K | |
![[ ]](/icons/layout.gif) | 52342_Dream Installa..> | 2026-03-09 08:25 | 115K | |
![[ ]](/icons/layout.gif) | 57677_CPS Custom Pro..> | 2026-03-20 16:37 | 115K | |
![[ ]](/icons/layout.gif) | 46883_Wall Garage Do..> | 2026-02-20 15:46 | 115K | |
![[ ]](/icons/layout.gif) | 56003_Fortress Doors..> | 2026-03-17 15:42 | 115K | |
![[ ]](/icons/layout.gif) | 58100_Fortress Doors..> | 2026-03-23 13:44 | 115K | |
![[ ]](/icons/layout.gif) | 59191_Thomas Andrew ..> | 2026-03-25 13:36 | 115K | |
![[ ]](/icons/layout.gif) | 67293_Garage Door So..> | 2026-04-17 12:58 | 115K | |
![[ ]](/icons/layout.gif) | 42418_SW Trade Frame..> | 2026-02-10 16:55 | 115K | |
![[ ]](/icons/layout.gif) | 50021_Gilberts Home ..> | 2026-03-03 08:14 | 115K | |
![[ ]](/icons/layout.gif) | 36831_Eagle Property..> | 2026-01-26 09:52 | 115K | |
![[ ]](/icons/layout.gif) | 44015_Avon Automated..> | 2026-02-16 10:47 | 115K | |
![[ ]](/icons/layout.gif) | 52255_Highlands Elec..> | 2026-03-06 16:07 | 115K | |
![[ ]](/icons/layout.gif) | 57953_NBG Doors Nick..> | 2026-03-23 11:19 | 115K | |
![[ ]](/icons/layout.gif) | 33587_Garage Door So..> | 2026-01-15 09:53 | 115K | |
![[ ]](/icons/layout.gif) | 44096_Ecosse Garage ..> | 2026-02-16 11:50 | 115K | |
![[ ]](/icons/layout.gif) | 48152_Douglas Ward -..> | 2026-02-25 13:21 | 115K | |
![[ ]](/icons/layout.gif) | 59974_Somerglaze Win..> | 2026-03-27 09:34 | 115K | |
![[ ]](/icons/layout.gif) | 61575_East Anglia Ro..> | 2026-04-01 06:44 | 115K | |
![[ ]](/icons/layout.gif) | 37497_Tru-Fit Window..> | 2026-01-27 12:21 | 115K | |
![[ ]](/icons/layout.gif) | 52439_J Brady Garage..> | 2026-03-09 09:54 | 115K | |
![[ ]](/icons/layout.gif) | 42369_Clic Garage Do..> | 2026-02-10 15:45 | 115K | |
![[ ]](/icons/layout.gif) | 49029_Warnsham Windo..> | 2026-02-27 10:40 | 115K | |
![[ ]](/icons/layout.gif) | 59925_East Anglia Ro..> | 2026-03-27 08:43 | 115K | |
![[ ]](/icons/layout.gif) | 39641_Fortress Doors..> | 2026-02-03 08:56 | 115K | |
![[ ]](/icons/layout.gif) | 55926_CPS Custom Pro..> | 2026-03-17 14:47 | 115K | |
![[ ]](/icons/layout.gif) | 62734_The Lothian Ga..> | 2026-04-07 09:16 | 115K | |
![[ ]](/icons/layout.gif) | 63944_Wall Garage Do..> | 2026-04-09 08:28 | 115K | |
![[ ]](/icons/layout.gif) | 47910_Norfolk Roller..> | 2026-02-24 17:02 | 115K | |
![[ ]](/icons/layout.gif) | 47458_The Lothian Ga..> | 2026-02-24 09:39 | 115K | |
![[ ]](/icons/layout.gif) | 59066_Warnsham Windo..> | 2026-03-25 11:04 | 115K | |
![[ ]](/icons/layout.gif) | 52587_Jurassic Doors..> | 2026-03-09 12:11 | 115K | |
![[ ]](/icons/layout.gif) | 34777_Elevate Doors ..> | 2026-01-19 15:06 | 115K | |
![[ ]](/icons/layout.gif) | 59326_The Lothian Ga..> | 2026-03-26 08:40 | 115K | |
![[ ]](/icons/layout.gif) | 55183_Ross Garage Do..> | 2026-03-16 09:47 | 115K | |
![[ ]](/icons/layout.gif) | 35687_Custom Trade S..> | 2026-01-21 12:03 | 115K | |
![[ ]](/icons/layout.gif) | 70205_Tru-Fit Window..> | 2026-04-24 14:47 | 115K | |
![[ ]](/icons/layout.gif) | 68011_Dream Installa..> | 2026-04-20 15:29 | 115K | |
![[ ]](/icons/layout.gif) | 39663_The Lothian Ga..> | 2026-02-03 09:19 | 115K | |
![[ ]](/icons/layout.gif) | 54771_Open And Shut ..> | 2026-03-13 12:55 | 115K | |
![[ ]](/icons/layout.gif) | 33742_Hanney Glazed ..> | 2026-01-15 12:07 | 115K | |
![[ ]](/icons/layout.gif) | 57549_Open And Shut ..> | 2026-03-20 14:39 | 115K | |
![[ ]](/icons/layout.gif) | 50646_Roller Doors 2..> | 2026-03-04 09:21 | 115K | |
![[ ]](/icons/layout.gif) | 66908_Rising Group L..> | 2026-04-16 16:08 | 115K | |
![[ ]](/icons/layout.gif) | 36012_Jurassic Doors..> | 2026-01-22 11:02 | 115K | |
![[ ]](/icons/layout.gif) | 36761_Hanney Glazed ..> | 2026-01-26 08:33 | 115K | |
![[ ]](/icons/layout.gif) | 55222_Secured Door &..> | 2026-03-16 10:09 | 115K | |
![[ ]](/icons/layout.gif) | 56655_Go Direct Door..> | 2026-03-19 08:19 | 115K | |
![[ ]](/icons/layout.gif) | 43392_Chelmsford Rol..> | 2026-02-13 08:00 | 115K | |
![[ ]](/icons/layout.gif) | 57068_Open And Shut ..> | 2026-03-19 15:56 | 115K | |
![[ ]](/icons/layout.gif) | 34776_Elevate Doors ..> | 2026-01-19 15:05 | 115K | |
![[ ]](/icons/layout.gif) | 42365_Garage Door So..> | 2026-02-10 15:39 | 115K | |
![[ ]](/icons/layout.gif) | 42049_The Lothian Ga..> | 2026-02-10 09:27 | 115K | |
![[ ]](/icons/layout.gif) | 42206_The Lothian Ga..> | 2026-02-10 11:30 | 115K | |
![[ ]](/icons/layout.gif) | 42217_The Lothian Ga..> | 2026-02-10 11:39 | 115K | |
![[ ]](/icons/layout.gif) | 63540_The Lothian Ga..> | 2026-04-08 11:25 | 115K | |
![[ ]](/icons/layout.gif) | 66635_The Lothian Ga..> | 2026-04-16 11:37 | 115K | |
![[ ]](/icons/layout.gif) | 48255_Ideal Industri..> | 2026-02-25 16:54 | 115K | |
![[ ]](/icons/layout.gif) | 50278_Wall Garage Do..> | 2026-03-03 12:18 | 115K | |
![[ ]](/icons/layout.gif) | 66230_SDS (Isle Of M..> | 2026-04-15 11:54 | 115K | |
![[ ]](/icons/layout.gif) | 50492_Fortress Doors..> | 2026-03-04 08:03 | 115K | |
![[ ]](/icons/layout.gif) | 62020_Avon Automated..> | 2026-04-01 15:41 | 115K | |
![[ ]](/icons/layout.gif) | 35140_Doors 4 You Lt..> | 2026-01-20 11:58 | 115K | |
![[ ]](/icons/layout.gif) | 38074_Wiltshire Gara..> | 2026-01-28 14:59 | 115K | |
![[ ]](/icons/layout.gif) | 58446_The Lothian Ga..> | 2026-03-24 10:29 | 115K | |
![[ ]](/icons/layout.gif) | 33575_Garage Door So..> | 2026-01-15 09:50 | 115K | |
![[ ]](/icons/layout.gif) | 43760_A Complete Win..> | 2026-02-13 16:36 | 115K | |
![[ ]](/icons/layout.gif) | 44350_Coles Building..> | 2026-02-16 16:07 | 115K | |
![[ ]](/icons/layout.gif) | 57335_Roller Doors 2..> | 2026-03-20 10:18 | 115K | |
![[ ]](/icons/layout.gif) | 61509_Gilberts Home ..> | 2026-03-31 15:15 | 115K | |
![[ ]](/icons/layout.gif) | 62886_Go Direct Door..> | 2026-04-07 11:24 | 115K | |
![[ ]](/icons/layout.gif) | 69757_Field Design A..> | 2026-04-24 07:40 | 115K | |
![[ ]](/icons/layout.gif) | 34965_Excellent Ltd ..> | 2026-01-20 08:49 | 115K | |
![[ ]](/icons/layout.gif) | 64240_Danbury Garage..> | 2026-04-09 16:00 | 115K | |
![[ ]](/icons/layout.gif) | 53162_Fortress Doors..> | 2026-03-10 11:19 | 115K | |
![[ ]](/icons/layout.gif) | 70033_Secure Entranc..> | 2026-04-24 11:56 | 115K | |
![[ ]](/icons/layout.gif) | 40219_Keith Worboys ..> | 2026-02-03 17:05 | 115K | |
![[ ]](/icons/layout.gif) | 42840_Go Direct Door..> | 2026-02-11 16:55 | 115K | |
![[ ]](/icons/layout.gif) | 61898_Rolladoor NR9 ..> | 2026-04-01 12:24 | 115K | |
![[ ]](/icons/layout.gif) | 37933_The Window And..> | 2026-01-28 12:43 | 115K | |
![[ ]](/icons/layout.gif) | 58979_Go Direct Door..> | 2026-03-25 10:00 | 115K | |
![[ ]](/icons/layout.gif) | 64425_Eastern Frames..> | 2026-04-10 08:52 | 115K | |
![[ ]](/icons/layout.gif) | 64441_Ace Garage Doo..> | 2026-04-10 09:00 | 115K | |
![[ ]](/icons/layout.gif) | 41850_Avon Automated..> | 2026-02-09 15:43 | 115K | |
![[ ]](/icons/layout.gif) | 42575_Kinsley - KINS..> | 2026-02-11 10:08 | 115K | |
![[ ]](/icons/layout.gif) | 61706_Fortress Doors..> | 2026-04-01 09:19 | 115K | |
![[ ]](/icons/layout.gif) | 37532_Jurassic Doors..> | 2026-01-27 13:09 | 115K | |
![[ ]](/icons/layout.gif) | 42750_MW Property Ma..> | 2026-02-11 13:33 | 115K | |
![[ ]](/icons/layout.gif) | 62204_Roll Right Gar..> | 2026-04-02 09:17 | 115K | |
![[ ]](/icons/layout.gif) | 56626_Elite Glazing ..> | 2026-03-19 07:48 | 115K | |
![[ ]](/icons/layout.gif) | 46255_Bryan Thompson..> | 2026-02-19 15:52 | 115K | |
![[ ]](/icons/layout.gif) | 53259_J Bowman Garag..> | 2026-03-10 12:55 | 115K | |
![[ ]](/icons/layout.gif) | 40217_Keith Worboys ..> | 2026-02-03 17:00 | 115K | |
![[ ]](/icons/layout.gif) | 55102_Southern Conse..> | 2026-03-16 08:47 | 115K | |
![[ ]](/icons/layout.gif) | 56621_East Anglia Ro..> | 2026-03-19 07:35 | 115K | |
![[ ]](/icons/layout.gif) | 64116_Avon Automated..> | 2026-04-09 12:47 | 115K | |
![[ ]](/icons/layout.gif) | 64137_Avon Automated..> | 2026-04-09 13:44 | 115K | |
![[ ]](/icons/layout.gif) | 42812_Hanney Glazed ..> | 2026-02-11 16:11 | 115K | |
![[ ]](/icons/layout.gif) | 37515_East Anglia Ro..> | 2026-01-27 12:39 | 115K | |
![[ ]](/icons/layout.gif) | 39838_Eclipse Doors ..> | 2026-02-03 11:16 | 115K | |
![[ ]](/icons/layout.gif) | 43250_Regal Windows ..> | 2026-02-12 15:58 | 115K | |
![[ ]](/icons/layout.gif) | 66578_Avon Automated..> | 2026-04-16 10:41 | 115K | |
![[ ]](/icons/layout.gif) | 63543_The Lothian Ga..> | 2026-04-08 11:26 | 115K | |
![[ ]](/icons/layout.gif) | 50331_Thrigby Hall W..> | 2026-03-03 13:57 | 115K | |
![[ ]](/icons/layout.gif) | 57545_Avon Automated..> | 2026-03-20 14:30 | 115K | |
![[ ]](/icons/layout.gif) | 57668_Aplas Windows ..> | 2026-03-20 16:25 | 115K | |
![[ ]](/icons/layout.gif) | 37241_East Anglia Ro..> | 2026-01-26 16:31 | 115K | |
![[ ]](/icons/layout.gif) | 37519_East Anglia Ro..> | 2026-01-27 12:48 | 115K | |
![[ ]](/icons/layout.gif) | 44097_Ecosse Garage ..> | 2026-02-16 11:50 | 115K | |
![[ ]](/icons/layout.gif) | 52257_Highlands Elec..> | 2026-03-06 16:13 | 115K | |
![[ ]](/icons/layout.gif) | 39998_Haines Homes C..> | 2026-02-03 13:50 | 115K | |
![[ ]](/icons/layout.gif) | 42498_Smart Doors Ca..> | 2026-02-11 09:12 | 115K | |
![[ ]](/icons/layout.gif) | 42857_Smart Doors Ca..> | 2026-02-12 07:55 | 115K | |
![[ ]](/icons/layout.gif) | 67287_Garage Door So..> | 2026-04-17 12:57 | 115K | |
![[ ]](/icons/layout.gif) | 62519_J Brady Garage..> | 2026-04-02 16:03 | 115K | |
![[ ]](/icons/layout.gif) | 64645_Avon Automated..> | 2026-04-10 13:12 | 115K | |
![[ ]](/icons/layout.gif) | 38688_Gilberts Home ..> | 2026-01-30 09:11 | 115K | |
![[ ]](/icons/layout.gif) | 47566_Norfolk Broads..> | 2026-02-24 11:03 | 115K | |
![[ ]](/icons/layout.gif) | 53662_Tru-Fit Window..> | 2026-03-11 09:19 | 115K | |
![[ ]](/icons/layout.gif) | 61064_Profascia Delr..> | 2026-03-31 10:10 | 115K | |
![[ ]](/icons/layout.gif) | 42982_Garage Door So..> | 2026-02-12 10:46 | 115K | |
![[ ]](/icons/layout.gif) | 64732_All Doors Repa..> | 2026-04-10 14:59 | 115K | |
![[ ]](/icons/layout.gif) | 56636_Elite Glazing ..> | 2026-03-19 07:52 | 115K | |
![[ ]](/icons/layout.gif) | 64233_Danbury Garage..> | 2026-04-09 15:45 | 115K | |
![[ ]](/icons/layout.gif) | 67030_The Lothian Ga..> | 2026-04-17 09:35 | 115K | |
![[ ]](/icons/layout.gif) | 35929_Dream Installa..> | 2026-01-22 09:22 | 115K | |
![[ ]](/icons/layout.gif) | 39131_Avon Automated..> | 2026-02-02 09:27 | 115K | |
![[ ]](/icons/layout.gif) | 40022_Elevate Doors ..> | 2026-02-03 14:22 | 115K | |
![[ ]](/icons/layout.gif) | 41661_The Lothian Ga..> | 2026-02-09 11:39 | 115K | |
![[ ]](/icons/layout.gif) | 42010_The Lothian Ga..> | 2026-02-10 08:16 | 115K | |
![[ ]](/icons/layout.gif) | 42205_The Lothian Ga..> | 2026-02-10 11:29 | 115K | |
![[ ]](/icons/layout.gif) | 42224_The Lothian Ga..> | 2026-02-10 11:49 | 115K | |
![[ ]](/icons/layout.gif) | 43552_Rollermatic Ga..> | 2026-02-13 10:29 | 115K | |
![[ ]](/icons/layout.gif) | 67948_The Lothian Ga..> | 2026-04-20 14:38 | 115K | |
![[ ]](/icons/layout.gif) | 35925_Avon Automated..> | 2026-01-22 09:15 | 115K | |
![[ ]](/icons/layout.gif) | 45524_The Lothian Ga..> | 2026-02-18 10:11 | 115K | |
![[ ]](/icons/layout.gif) | 63240_Wall Garage Do..> | 2026-04-07 15:36 | 115K | |
![[ ]](/icons/layout.gif) | 36176_JCHI Ltd James..> | 2026-01-22 15:12 | 115K | |
![[ ]](/icons/layout.gif) | 60951_Oakley Windows..> | 2026-03-31 08:38 | 115K | |
![[ ]](/icons/layout.gif) | 50491_Fortress Doors..> | 2026-03-04 07:56 | 115K | |
![[ ]](/icons/layout.gif) | 68431_SDS (Isle Of M..> | 2026-04-21 11:41 | 115K | |
![[ ]](/icons/layout.gif) | 61763_C & P Doors Cr..> | 2026-04-01 09:38 | 115K | |
![[ ]](/icons/layout.gif) | 61934_Go Direct Door..> | 2026-04-01 13:00 | 115K | |
![[ ]](/icons/layout.gif) | 33231_John Bayley Bu..> | 2026-01-14 13:34 | 115K | |
![[ ]](/icons/layout.gif) | 39862_Everbright Win..> | 2026-02-03 11:29 | 115K | |
![[ ]](/icons/layout.gif) | 41082_Haines Homes C..> | 2026-02-05 15:45 | 115K | |
![[ ]](/icons/layout.gif) | 46874_Wall Garage Do..> | 2026-02-20 15:29 | 115K | |
![[ ]](/icons/layout.gif) | 35230_Eastern Frames..> | 2026-01-20 14:28 | 115K | |
![[ ]](/icons/layout.gif) | 52432_Roche Commerci..> | 2026-03-09 09:42 | 115K | |
![[ ]](/icons/layout.gif) | 62794_The Lothian Ga..> | 2026-04-07 10:18 | 115K | |
![[ ]](/icons/layout.gif) | 37885_Starlite Home ..> | 2026-01-28 11:29 | 115K | |
![[ ]](/icons/layout.gif) | 62361_Excellent Ltd ..> | 2026-04-02 12:55 | 115K | |
![[ ]](/icons/layout.gif) | 38594_Thomas Andrew ..> | 2026-01-29 16:26 | 115K | |
![[ ]](/icons/layout.gif) | 61570_The Lothian Ga..> | 2026-04-01 06:40 | 115K | |
![[ ]](/icons/layout.gif) | 38280_Wall Garage Do..> | 2026-01-29 10:18 | 115K | |
![[ ]](/icons/layout.gif) | 65111_Proud 2 Fix Ma..> | 2026-04-13 11:44 | 115K | |
![[ ]](/icons/layout.gif) | 69185_The Lothian Ga..> | 2026-04-22 15:46 | 115K | |
![[ ]](/icons/layout.gif) | 39250_SDS (Isle Of M..> | 2026-02-02 12:13 | 115K | |
![[ ]](/icons/layout.gif) | 56664_Oakley Windows..> | 2026-03-19 08:32 | 115K | |
![[ ]](/icons/layout.gif) | 53527_Fortress Doors..> | 2026-03-11 07:39 | 115K | |
![[ ]](/icons/layout.gif) | 61644_The Lothian Ga..> | 2026-04-01 08:21 | 115K | |
![[ ]](/icons/layout.gif) | 34003_The Lothian Ga..> | 2026-01-15 17:03 | 115K | |
![[ ]](/icons/layout.gif) | 62998_Rolladoor NR9 ..> | 2026-04-07 12:56 | 115K | |
![[ ]](/icons/layout.gif) | 63367_Admiral Home I..> | 2026-04-08 08:30 | 115K | |
![[ ]](/icons/layout.gif) | 53418_J Brady Garage..> | 2026-03-10 15:29 | 115K | |
![[ ]](/icons/layout.gif) | 66794_Rhino Windows ..> | 2026-04-16 13:27 | 115K | |
![[ ]](/icons/layout.gif) | 53743_J Bowman Garag..> | 2026-03-11 10:43 | 115K | |
![[ ]](/icons/layout.gif) | 57013_D Thurston Bui..> | 2026-03-19 14:40 | 115K | |
![[ ]](/icons/layout.gif) | 37174_Danbury Garage..> | 2026-01-26 15:33 | 115K | |
![[ ]](/icons/layout.gif) | 48849_Gilberts Home ..> | 2026-02-27 07:57 | 115K | |
![[ ]](/icons/layout.gif) | 52614_Wall Garage Do..> | 2026-03-09 12:36 | 115K | |
![[ ]](/icons/layout.gif) | 34384_The Lothian Ga..> | 2026-01-16 16:08 | 115K | |
![[ ]](/icons/layout.gif) | 42179_John Bayley Bu..> | 2026-02-10 11:02 | 115K | |
![[ ]](/icons/layout.gif) | 50202_Danbury Garage..> | 2026-03-03 11:14 | 115K | |
![[ ]](/icons/layout.gif) | 65175_J Brady Garage..> | 2026-04-13 12:55 | 115K | |
![[ ]](/icons/layout.gif) | 44301_The Lothian Ga..> | 2026-02-16 15:34 | 115K | |
![[ ]](/icons/layout.gif) | 53733_Garage Door Au..> | 2026-03-11 10:30 | 115K | |
![[ ]](/icons/layout.gif) | 34969_J Brady Garage..> | 2026-01-20 08:57 | 115K | |
![[ ]](/icons/layout.gif) | 38562_The Lothian Ga..> | 2026-01-29 15:36 | 115K | |
![[ ]](/icons/layout.gif) | 48524_Oakley Windows..> | 2026-02-26 12:07 | 115K | |
![[ ]](/icons/layout.gif) | 56599_J Brady Garage..> | 2026-03-18 16:51 | 115K | |
![[ ]](/icons/layout.gif) | 39835_Clic Garage Do..> | 2026-02-03 11:12 | 115K | |
![[ ]](/icons/layout.gif) | 39666_The Lothian Ga..> | 2026-02-03 09:20 | 115K | |
![[ ]](/icons/layout.gif) | 41629_Keith Worboys ..> | 2026-02-09 11:10 | 115K | |
![[ ]](/icons/layout.gif) | 46373_The Lothian Ga..> | 2026-02-20 08:08 | 115K | |
![[ ]](/icons/layout.gif) | 53531_Fortress Doors..> | 2026-03-11 07:43 | 115K | |
![[ ]](/icons/layout.gif) | 46907_The Lothian Ga..> | 2026-02-20 16:33 | 115K | |
![[ ]](/icons/layout.gif) | 56790_Norfolk Doors ..> | 2026-03-19 10:42 | 115K | |
![[ ]](/icons/layout.gif) | 56792_Norfolk Doors ..> | 2026-03-19 10:42 | 115K | |
![[ ]](/icons/layout.gif) | 53765_Garage Door Au..> | 2026-03-11 11:14 | 115K | |
![[ ]](/icons/layout.gif) | 64234_All Door Engin..> | 2026-04-09 15:49 | 115K | |
![[ ]](/icons/layout.gif) | 56564_Norfolk Broads..> | 2026-03-18 15:57 | 115K | |
![[ ]](/icons/layout.gif) | 57057_Absolute Garag..> | 2026-03-19 15:49 | 115K | |
![[ ]](/icons/layout.gif) | 64498_East Anglia Ro..> | 2026-04-10 11:15 | 115K | |
![[ ]](/icons/layout.gif) | 64571_Admiral Home I..> | 2026-04-10 12:39 | 115K | |
![[ ]](/icons/layout.gif) | 49779_Norfolk Broads..> | 2026-03-02 14:15 | 115K | |
![[ ]](/icons/layout.gif) | 58222_Wall Garage Do..> | 2026-03-23 16:47 | 115K | |
![[ ]](/icons/layout.gif) | 48379_Cromer Garage ..> | 2026-02-26 10:33 | 115K | |
![[ ]](/icons/layout.gif) | 67416_Fortress Doors..> | 2026-04-17 15:52 | 115K | |
![[ ]](/icons/layout.gif) | 49412_SDS (Isle Of M..> | 2026-03-02 08:48 | 115K | |
![[ ]](/icons/layout.gif) | 58465_Camlen Fabrica..> | 2026-03-24 10:40 | 115K | |
![[ ]](/icons/layout.gif) | 49256_The Lothian Ga..> | 2026-02-27 15:53 | 115K | |
![[ ]](/icons/layout.gif) | 47463_PB Doors Paul ..> | 2026-02-24 09:49 | 115K | |
![[ ]](/icons/layout.gif) | 43556_Kevin Gibson -..> | 2026-02-13 10:38 | 115K | |
![[ ]](/icons/layout.gif) | 33732_Ross Garage Do..> | 2026-01-15 11:58 | 115K | |
![[ ]](/icons/layout.gif) | 63349_Avon Automated..> | 2026-04-08 08:12 | 115K | |
![[ ]](/icons/layout.gif) | 42045_The Lothian Ga..> | 2026-02-10 09:10 | 115K | |
![[ ]](/icons/layout.gif) | 42327_The Garage Doo..> | 2026-02-10 14:42 | 115K | |
![[ ]](/icons/layout.gif) | 48533_NTRAP NR11 7NZ..> | 2026-02-26 12:29 | 115K | |
![[ ]](/icons/layout.gif) | 67374_Avon Automated..> | 2026-04-17 14:40 | 115K | |
![[ ]](/icons/layout.gif) | 53663_Tru-Fit Window..> | 2026-03-11 09:19 | 115K | |
![[ ]](/icons/layout.gif) | 36520_Warnsham Windo..> | 2026-01-23 12:21 | 115K | |
![[ ]](/icons/layout.gif) | 41974_Avon Automated..> | 2026-02-09 16:46 | 115K | |
![[ ]](/icons/layout.gif) | 61150_SDS (Isle Of M..> | 2026-03-31 10:49 | 115K | |
![[ ]](/icons/layout.gif) | 53933_Eclipse Doors ..> | 2026-03-11 15:19 | 115K | |
![[ ]](/icons/layout.gif) | 63353_Avon Automated..> | 2026-04-08 08:14 | 115K | |
![[ ]](/icons/layout.gif) | 38075_East Anglia Ro..> | 2026-01-28 14:59 | 115K | |
![[ ]](/icons/layout.gif) | 41077_Haines Homes C..> | 2026-02-05 15:41 | 115K | |
![[ ]](/icons/layout.gif) | 35396_The Lothian Ga..> | 2026-01-20 16:26 | 115K | |
![[ ]](/icons/layout.gif) | 52369_Ideal Industri..> | 2026-03-09 08:56 | 115K | |
![[ ]](/icons/layout.gif) | 57734_Oakley Windows..> | 2026-03-23 08:43 | 115K | |
![[ ]](/icons/layout.gif) | 36511_Warnsham Windo..> | 2026-01-23 12:11 | 115K | |
![[ ]](/icons/layout.gif) | 34810_GDS Garage Doo..> | 2026-01-19 16:09 | 115K | |
![[ ]](/icons/layout.gif) | 64572_Admiral Home I..> | 2026-04-10 12:40 | 115K | |
![[ ]](/icons/layout.gif) | 37559_Camberley Wind..> | 2026-01-27 14:04 | 115K | |
![[ ]](/icons/layout.gif) | 35926_The Lothian Ga..> | 2026-01-22 09:18 | 115K | |
![[ ]](/icons/layout.gif) | 52358_Hanney Glazed ..> | 2026-03-09 08:43 | 115K | |
![[ ]](/icons/layout.gif) | 41590_Keith Worboys ..> | 2026-02-09 10:46 | 115K | |
![[ ]](/icons/layout.gif) | 52368_Hanney Glazed ..> | 2026-03-09 08:55 | 115K | |
![[ ]](/icons/layout.gif) | 66645_M. A. E. Windo..> | 2026-04-16 11:53 | 115K | |
![[ ]](/icons/layout.gif) | 59279_Jurassic Doors..> | 2026-03-25 15:41 | 115K | |
![[ ]](/icons/layout.gif) | 47469_PB Doors Paul ..> | 2026-02-24 10:00 | 115K | |
![[ ]](/icons/layout.gif) | 55784_Fortress Doors..> | 2026-03-17 12:01 | 115K | |
![[ ]](/icons/layout.gif) | 41673_The Lothian Ga..> | 2026-02-09 12:25 | 115K | |
![[ ]](/icons/layout.gif) | 69720_M. A. E. Windo..> | 2026-04-24 06:52 | 116K | |
![[ ]](/icons/layout.gif) | 20010_Elevate Doors ..> | 2025-11-26 15:54 | 116K | |
![[ ]](/icons/layout.gif) | 46454_Wall Garage Do..> | 2026-02-20 09:24 | 116K | |
![[ ]](/icons/layout.gif) | 68038_Fortress Doors..> | 2026-04-20 15:59 | 116K | |
![[ ]](/icons/layout.gif) | 50368_Pukka 1 Bobby ..> | 2026-03-03 14:58 | 116K | |
![[ ]](/icons/layout.gif) | 69378_Direct Trade P..> | 2026-04-23 09:31 | 116K | |
![[ ]](/icons/layout.gif) | 42427_Direct Trade P..> | 2026-02-11 07:57 | 116K | |
![[ ]](/icons/layout.gif) | 59264_Roll Right Gar..> | 2026-03-25 15:14 | 116K | |
![[ ]](/icons/layout.gif) | 37410_Tru-Fit Window..> | 2026-01-27 11:19 | 116K | |
![[ ]](/icons/layout.gif) | 49975_WADE WINDOWS I..> | 2026-03-02 16:39 | 116K | |
![[ ]](/icons/layout.gif) | 41227_Tru-Fit Window..> | 2026-02-06 09:34 | 116K | |
![[ ]](/icons/layout.gif) | 65268_Norfolk Exteri..> | 2026-04-13 15:22 | 116K | |
![[ ]](/icons/layout.gif) | 55038_The Lothian Ga..> | 2026-03-13 16:41 | 116K | |
![[ ]](/icons/layout.gif) | 56577_The Lothian Ga..> | 2026-03-18 16:07 | 116K | |
![[ ]](/icons/layout.gif) | 38553_Starlite Home ..> | 2026-01-29 15:08 | 116K | |
![[ ]](/icons/layout.gif) | 38561_The Lothian Ga..> | 2026-01-29 15:32 | 116K | |
![[ ]](/icons/layout.gif) | 64687_The Lothian Ga..> | 2026-04-10 13:39 | 116K | |
![[ ]](/icons/layout.gif) | 65831_The Lothian Ga..> | 2026-04-14 14:41 | 116K | |
![[ ]](/icons/layout.gif) | 56524_The Lothian Ga..> | 2026-03-18 15:16 | 116K | |
![[ ]](/icons/layout.gif) | 66499_The Lothian Ga..> | 2026-04-16 08:28 | 116K | |
![[ ]](/icons/layout.gif) | 61491_Nottingham Spe..> | 2026-03-31 14:53 | 116K | |
![[ ]](/icons/layout.gif) | 55559_The Lothian Ga..> | 2026-03-16 16:26 | 116K | |
![[ ]](/icons/layout.gif) | 33527_The Lothian Ga..> | 2026-01-15 09:35 | 116K | |
![[ ]](/icons/layout.gif) | 58510_SDS (Isle Of M..> | 2026-03-24 12:20 | 116K | |
![[ ]](/icons/layout.gif) | 34560_Harry Curtis -..> | 2026-01-19 10:45 | 117K | |
![[ ]](/icons/layout.gif) | 61465_Titan Garage D..> | 2026-03-31 14:19 | 117K | |
![[ ]](/icons/layout.gif) | 9108_Joshua Mossop -..> | 2025-10-28 16:21 | 117K | |
![[ ]](/icons/layout.gif) | 64493_Go Direct Door..> | 2026-04-10 11:02 | 117K | |
![[ ]](/icons/layout.gif) | 56438_Nottingham Spe..> | 2026-03-18 13:25 | 118K | |
![[ ]](/icons/layout.gif) | 68464_Go Direct Door..> | 2026-04-21 12:28 | 118K | |
![[ ]](/icons/layout.gif) | 57564_WADE WINDOWS I..> | 2026-03-20 14:47 | 118K | |
![[ ]](/icons/layout.gif) | 54460_Grafton Ventur..> | 2026-03-12 16:35 | 118K | |
![[ ]](/icons/layout.gif) | 41435_The Lothian Ga..> | 2026-02-06 14:52 | 119K | |
![[ ]](/icons/layout.gif) | 38560_The Lothian Ga..> | 2026-01-29 15:28 | 119K | |
![[ ]](/icons/layout.gif) | 38559_The Lothian Ga..> | 2026-01-29 15:24 | 119K | |
![[ ]](/icons/layout.gif) | 58247_Elevate Doors ..> | 2026-03-24 07:52 | 119K | |
![[ ]](/icons/layout.gif) | 39874_Elevate Doors ..> | 2026-02-03 11:50 | 119K | |
![[ ]](/icons/layout.gif) | 4496_Oscar Okortonta..> | 2025-10-14 09:38 | 120K | |
![[ ]](/icons/layout.gif) | 14834_Matt Smith - S..> | 2025-11-13 09:41 | 120K | |
![[ ]](/icons/layout.gif) | 5442_John Easton - E..> | 2025-10-16 13:01 | 120K | |
![[ ]](/icons/layout.gif) | 3213_John Neale - NE..> | 2025-10-08 15:28 | 120K | |
![[ ]](/icons/layout.gif) | 10809_James Wilde - ..> | 2025-11-03 12:42 | 120K | |
![[ ]](/icons/layout.gif) | 14556_Vincent Beech ..> | 2025-11-12 12:25 | 120K | |
![[ ]](/icons/layout.gif) | 1641_Ian Ross Ross -..> | 2025-10-01 14:45 | 120K | |
![[ ]](/icons/layout.gif) | 3593_John Neale - NE..> | 2025-10-09 14:13 | 120K | |
![[ ]](/icons/layout.gif) | 4499_Oscar Okoronta ..> | 2025-10-14 09:50 | 120K | |
![[ ]](/icons/layout.gif) | 6344_Tobias Cripps -..> | 2025-10-20 14:25 | 120K | |
![[ ]](/icons/layout.gif) | 11410_Julian Dick - ..> | 2025-11-04 14:06 | 120K | |
![[ ]](/icons/layout.gif) | 4542_Carl Hayfield -..> | 2025-10-14 10:30 | 120K | |
![[ ]](/icons/layout.gif) | 4745_Carl Hayfield -..> | 2025-10-14 14:39 | 120K | |
![[ ]](/icons/layout.gif) | 1338_Jon .. - ..JO00..> | 2025-09-30 06:33 | 120K | |
![[ ]](/icons/layout.gif) | 10996_Peter Stemp - ..> | 2025-11-03 15:56 | 120K | |
![[ ]](/icons/layout.gif) | 1778_Jon .. - ..JO00..> | 2025-10-02 10:53 | 120K | |
![[ ]](/icons/layout.gif) | 4728_Ian Lamonby - L..> | 2025-10-14 14:20 | 120K | |
![[ ]](/icons/layout.gif) | 2472_Atul Malkar - M..> | 2025-10-06 13:58 | 120K | |
![[ ]](/icons/layout.gif) | 4495_Tom Carter - CA..> | 2025-10-14 09:25 | 120K | |
![[ ]](/icons/layout.gif) | 4219_John Sheppard -..> | 2025-10-13 11:39 | 120K | |
![[ ]](/icons/layout.gif) | 7705_Michael Straker..> | 2025-10-24 07:28 | 120K | |
![[ ]](/icons/layout.gif) | 12903_Lindsey Jeavon..> | 2025-11-07 16:42 | 120K | |
![[ ]](/icons/layout.gif) | 4411_PlumbRight Dave..> | 2025-10-13 15:57 | 120K | |
![[ ]](/icons/layout.gif) | 6369_Houston - HOUS0..> | 2025-10-20 15:21 | 120K | |
![[ ]](/icons/layout.gif) | 3157_Cooper - COOP00..> | 2025-10-08 13:34 | 120K | |
![[ ]](/icons/layout.gif) | 1111_Andy Knight - K..> | 2025-09-26 15:53 | 120K | |
![[ ]](/icons/layout.gif) | 4544_Sean K - KSEA00..> | 2025-10-14 10:31 | 120K | |
![[ ]](/icons/layout.gif) | 4608_Sean K - KSEA00..> | 2025-10-14 12:45 | 120K | |
![[ ]](/icons/layout.gif) | 8646_Jian Ming - MIN..> | 2025-10-27 16:19 | 120K | |
![[ ]](/icons/layout.gif) | 2338_MR Mosin - MOSI..> | 2025-10-06 11:21 | 120K | |
![[ ]](/icons/layout.gif) | 5493_Jim OBrien - OB..> | 2025-10-16 13:50 | 120K | |
![[ ]](/icons/layout.gif) | 12242_Paul Cooper - ..> | 2025-11-06 10:59 | 120K | |
![[ ]](/icons/layout.gif) | 10819_James Wilde - ..> | 2025-11-03 12:57 | 120K | |
![[ ]](/icons/layout.gif) | 5348_Roger Fox - FOX..> | 2025-10-16 11:40 | 120K | |
![[ ]](/icons/layout.gif) | 8250_Mark Budden - B..> | 2025-10-27 10:59 | 120K | |
![[ ]](/icons/layout.gif) | 8945_Mark Budden - B..> | 2025-10-28 13:40 | 120K | |
![[ ]](/icons/layout.gif) | 7606_Jean-Michel Can..> | 2025-10-23 14:39 | 120K | |
![[ ]](/icons/layout.gif) | 2507_Gigg Singh - SI..> | 2025-10-06 15:38 | 120K | |
![[ ]](/icons/layout.gif) | 2842_Gigg Singh - SI..> | 2025-10-07 16:04 | 120K | |
![[ ]](/icons/layout.gif) | 2843_Gigg Singh - SI..> | 2025-10-07 16:05 | 120K | |
![[ ]](/icons/layout.gif) | 9106_Jack Scrivens -..> | 2025-10-28 16:11 | 120K | |
![[ ]](/icons/layout.gif) | 4621_Sean Kiely - KS..> | 2025-10-14 12:55 | 120K | |
![[ ]](/icons/layout.gif) | 3618_Elaine Hurley -..> | 2025-10-09 15:03 | 120K | |
![[ ]](/icons/layout.gif) | 2224_Gareth Shepherd..> | 2025-10-06 08:07 | 120K | |
![[ ]](/icons/layout.gif) | 10535_Izzed Izet - I..> | 2025-11-03 09:42 | 120K | |
![[ ]](/icons/layout.gif) | 4051_Tom Cliffen - T..> | 2025-10-13 08:14 | 120K | |
![[ ]](/icons/layout.gif) | 8403_Damien Lobb - L..> | 2025-10-27 13:09 | 120K | |
![[ ]](/icons/layout.gif) | 1449_Paul Withers - ..> | 2025-09-30 14:27 | 120K | |
![[ ]](/icons/layout.gif) | 3422_Ken Ingram - IN..> | 2025-10-09 10:17 | 120K | |
![[ ]](/icons/layout.gif) | 9104_Jack Scrivens -..> | 2025-10-28 16:05 | 120K | |
![[ ]](/icons/layout.gif) | 13998_Mark Thornboro..> | 2025-11-11 14:46 | 120K | |
![[ ]](/icons/layout.gif) | 874_Nature's Design ..> | 2025-09-25 12:15 | 120K | |
![[ ]](/icons/layout.gif) | 580_Steve Broughton ..> | 2025-09-23 13:40 | 120K | |
![[ ]](/icons/layout.gif) | 4253_PlumbRight Dave..> | 2025-10-13 12:47 | 120K | |
![[ ]](/icons/layout.gif) | 1820_Paul Withers - ..> | 2025-10-02 12:43 | 120K | |
![[ ]](/icons/layout.gif) | 3956_Paul Withers - ..> | 2025-10-10 14:05 | 120K | |
![[ ]](/icons/layout.gif) | 3928_Paul Withers - ..> | 2025-10-10 13:33 | 120K | |
![[ ]](/icons/layout.gif) | 3929_Paul Withers - ..> | 2025-10-10 13:35 | 120K | |
![[ ]](/icons/layout.gif) | 9600_Harrold Knight ..> | 2025-10-30 08:42 | 120K | |
![[ ]](/icons/layout.gif) | 10428_Barbara Ebanks..> | 2025-10-31 16:29 | 120K | |
![[ ]](/icons/layout.gif) | 12002_Phillip Speakm..> | 2025-11-05 14:33 | 120K | |
![[ ]](/icons/layout.gif) | 12641_Jamie Goodman ..> | 2025-11-07 08:38 | 120K | |
![[ ]](/icons/layout.gif) | 3602_Neef Neil MacDo..> | 2025-10-09 14:33 | 120K | |
![[ ]](/icons/layout.gif) | 7636_Colin Sweeney -..> | 2025-10-23 15:51 | 120K | |
![[ ]](/icons/layout.gif) | 5152_Andy Beresford ..> | 2025-10-15 16:01 | 120K | |
![[ ]](/icons/layout.gif) | 2656_Andrew Hodges -..> | 2025-10-07 09:46 | 120K | |
![[ ]](/icons/layout.gif) | 7165_Gary Ungless - ..> | 2025-10-22 16:01 | 120K | |
![[ ]](/icons/layout.gif) | 1043_B - B0000001 - ..> | 2025-09-26 12:34 | 120K | |
![[ ]](/icons/layout.gif) | 1222_B - B0000001 - ..> | 2025-09-29 11:12 | 120K | |
![[ ]](/icons/layout.gif) | 10868_Peter Harper -..> | 2025-11-03 13:57 | 120K | |
![[ ]](/icons/layout.gif) | 1205_David Price - P..> | 2025-09-29 10:17 | 120K | |
![[ ]](/icons/layout.gif) | 1279_David Price - P..> | 2025-09-29 13:54 | 120K | |
![[ ]](/icons/layout.gif) | 12504_Michael Jennin..> | 2025-11-06 15:37 | 120K | |
![[ ]](/icons/layout.gif) | 14571_Adam Reed - RE..> | 2025-11-12 12:56 | 120K | |
![[ ]](/icons/layout.gif) | 10857_Kevin Grosveno..> | 2025-11-03 13:46 | 120K | |
![[ ]](/icons/layout.gif) | 6076_Jon Taylor - ....> | 2025-10-20 08:43 | 120K | |
![[ ]](/icons/layout.gif) | 1671_Anton Mirosnits..> | 2025-10-01 15:38 | 120K | |
![[ ]](/icons/layout.gif) | 2233_Tahmid Kamal - ..> | 2025-10-06 08:41 | 120K | |
![[ ]](/icons/layout.gif) | 7215_Joshua Mossop -..> | 2025-10-23 08:52 | 120K | |
![[ ]](/icons/layout.gif) | 629_Ian Smith - SMIT..> | 2025-09-23 16:37 | 120K | |
![[ ]](/icons/layout.gif) | 11024_Peter Stemp - ..> | 2025-11-03 16:19 | 120K | |
![[ ]](/icons/layout.gif) | 4462_Elliott Mills -..> | 2025-10-14 08:40 | 120K | |
![[ ]](/icons/layout.gif) | 9260_Linda Gett - GE..> | 2025-10-29 09:14 | 120K | |
![[ ]](/icons/layout.gif) | 9454_Linda Gett - GE..> | 2025-10-29 14:49 | 120K | |
![[ ]](/icons/layout.gif) | 7706_Michael Straker..> | 2025-10-24 07:29 | 120K | |
![[ ]](/icons/layout.gif) | 1727_Antony Rowe - R..> | 2025-10-02 07:10 | 120K | |
![[ ]](/icons/layout.gif) | 5193_Christina Beame..> | 2025-10-16 07:15 | 120K | |
![[ ]](/icons/layout.gif) | 921_Alan Davis - DAV..> | 2025-09-25 14:43 | 120K | |
![[ ]](/icons/layout.gif) | 1221_Alan Davis - DA..> | 2025-09-29 11:05 | 120K | |
![[ ]](/icons/layout.gif) | 3347_Gareth Shepherd..> | 2025-10-09 08:52 | 120K | |
![[ ]](/icons/layout.gif) | 3379_Gareth Shepherd..> | 2025-10-09 09:23 | 120K | |
![[ ]](/icons/layout.gif) | 3447_Anton Mirosnits..> | 2025-10-09 10:58 | 120K | |
![[ ]](/icons/layout.gif) | 643_Flavio Arruda - ..> | 2025-09-24 07:28 | 120K | |
![[ ]](/icons/layout.gif) | 9234_Neil Hudd - HUD..> | 2025-10-29 08:51 | 120K | |
![[ ]](/icons/layout.gif) | 2205_Greg Brett - BR..> | 2025-10-06 07:17 | 120K | |
![[ ]](/icons/layout.gif) | 5262_Andy Knowles - ..> | 2025-10-16 09:16 | 120K | |
![[ ]](/icons/layout.gif) | 2178_Mick Maye - MAY..> | 2025-10-03 14:40 | 120K | |
![[ ]](/icons/layout.gif) | 668_Neil Ward - WARD..> | 2025-09-24 08:05 | 120K | |
![[ ]](/icons/layout.gif) | 815_Neil Ward - WARD..> | 2025-09-25 07:54 | 120K | |
![[ ]](/icons/layout.gif) | 3174_Cooper - COOP00..> | 2025-10-08 13:52 | 120K | |
![[ ]](/icons/layout.gif) | 9866_Andrew Boylett ..> | 2025-10-30 14:15 | 120K | |
![[ ]](/icons/layout.gif) | 13571_Darren Anthony..> | 2025-11-11 07:59 | 120K | |
![[ ]](/icons/layout.gif) | 99_Karen Price - PRI..> | 2025-09-17 09:13 | 120K | |
![[ ]](/icons/layout.gif) | 3245_Deri Evans - EV..> | 2025-10-08 16:51 | 120K | |
![[ ]](/icons/layout.gif) | 4377_Ray Bailey - BA..> | 2025-10-13 15:02 | 120K | |
![[ ]](/icons/layout.gif) | 648_Stuart Lorimer -..> | 2025-09-24 07:37 | 120K | |
![[ ]](/icons/layout.gif) | 2282_Deri Evans - EV..> | 2025-10-06 10:38 | 120K | |
![[ ]](/icons/layout.gif) | 4936_Ebtech Engineer..> | 2025-10-15 11:58 | 120K | |
![[ ]](/icons/layout.gif) | 5490_Ricky Foulgar -..> | 2025-10-16 13:48 | 120K | |
![[ ]](/icons/layout.gif) | 3776_Mary Eim - EIMM..> | 2025-10-10 10:39 | 120K | |
![[ ]](/icons/layout.gif) | 4378_Simeon Lloyd - ..> | 2025-10-13 15:02 | 120K | |
![[ ]](/icons/layout.gif) | 8056_Martin Layfield..> | 2025-10-24 13:50 | 120K | |
![[ ]](/icons/layout.gif) | 3168_Suddon - SUDD00..> | 2025-10-08 13:50 | 120K | |
![[ ]](/icons/layout.gif) | 2693_Andrew Hodges -..> | 2025-10-07 10:42 | 120K | |
![[ ]](/icons/layout.gif) | 677_Adrian Jackson -..> | 2025-09-24 08:28 | 120K | |
![[ ]](/icons/layout.gif) | 3480_Jakub Samp - SA..> | 2025-10-09 12:04 | 120K | |
![[ ]](/icons/layout.gif) | 8020_Martin Snell - ..> | 2025-10-24 12:53 | 120K | |
![[ ]](/icons/layout.gif) | 1675_AMK Gatwick - A..> | 2025-10-01 15:46 | 120K | |
![[ ]](/icons/layout.gif) | 2674_Javeed Sandia -..> | 2025-10-07 10:00 | 120K | |
![[ ]](/icons/layout.gif) | 10135_Mark Budden - ..> | 2025-10-31 09:47 | 120K | |
![[ ]](/icons/layout.gif) | 659_Gary Reynolds - ..> | 2025-09-24 07:50 | 120K | |
![[ ]](/icons/layout.gif) | 934_Adrian Jackson -..> | 2025-09-25 15:07 | 120K | |
![[ ]](/icons/layout.gif) | 946_Adrian Jackson -..> | 2025-09-25 15:51 | 120K | |
![[ ]](/icons/layout.gif) | 999_Alex Hope - HOPE..> | 2025-09-26 10:24 | 120K | |
![[ ]](/icons/layout.gif) | 1466_Nathan Edmondso..> | 2025-09-30 15:24 | 120K | |
![[ ]](/icons/layout.gif) | 1958_Nathan Edmondso..> | 2025-10-03 08:44 | 120K | |
![[ ]](/icons/layout.gif) | 1972_Nathan Edmondso..> | 2025-10-03 09:36 | 120K | |
![[ ]](/icons/layout.gif) | 3369_William Radford..> | 2025-10-09 09:11 | 120K | |
![[ ]](/icons/layout.gif) | 7753_Jean-Michel Can..> | 2025-10-24 08:13 | 120K | |
![[ ]](/icons/layout.gif) | 4914_Carl Hayfield -..> | 2025-10-15 11:02 | 120K | |
![[ ]](/icons/layout.gif) | 6621_Andrew Newcombe..> | 2025-10-21 14:53 | 120K | |
![[ ]](/icons/layout.gif) | 1445_David Ball - BA..> | 2025-09-30 14:20 | 120K | |
![[ ]](/icons/layout.gif) | 1746_Simon Wood - WO..> | 2025-10-02 07:49 | 120K | |
![[ ]](/icons/layout.gif) | 13414_Darren Thompso..> | 2025-11-10 15:28 | 120K | |
![[ ]](/icons/layout.gif) | 3417_[0,0] Peter Urq..> | 2025-10-09 10:07 | 120K | |
![[ ]](/icons/layout.gif) | 8986_Bart Gardener -..> | 2025-10-28 14:17 | 120K | |
![[ ]](/icons/layout.gif) | 674_Bob Ewins - EWIN..> | 2025-09-24 08:08 | 120K | |
![[ ]](/icons/layout.gif) | 814_Bob Ewins - EWIN..> | 2025-09-25 07:47 | 120K | |
![[ ]](/icons/layout.gif) | 3624_Nikki Sabatini ..> | 2025-10-09 15:18 | 120K | |
![[ ]](/icons/layout.gif) | 2358_Samuel Hockaday..> | 2025-10-06 11:56 | 120K | |
![[ ]](/icons/layout.gif) | 3161_Vincent Cross -..> | 2025-10-08 13:45 | 120K | |
![[ ]](/icons/layout.gif) | 4712_Sean Kiely - KS..> | 2025-10-14 13:38 | 120K | |
![[ ]](/icons/layout.gif) | 12134_Colin Barrow -..> | 2025-11-06 09:15 | 120K | |
![[ ]](/icons/layout.gif) | 647_[0,0] Stuart Lor..> | 2025-09-24 07:32 | 120K | |
![[ ]](/icons/layout.gif) | 2260_Nigel Bramley -..> | 2025-10-06 10:00 | 120K | |
![[ ]](/icons/layout.gif) | 627_Pardeep Chahal -..> | 2025-09-23 16:23 | 120K | |
![[ ]](/icons/layout.gif) | 1472_Michael Rogers ..> | 2025-09-30 15:37 | 120K | |
![[ ]](/icons/layout.gif) | 262_TJS Maintenance ..> | 2025-09-19 09:03 | 120K | |
![[ ]](/icons/layout.gif) | 943_Elliott Clark - ..> | 2025-09-25 15:47 | 120K | |
![[ ]](/icons/layout.gif) | 2469_Jon Taylor - ....> | 2025-10-06 13:36 | 120K | |
![[ ]](/icons/layout.gif) | 3074_Jon Taylor - ....> | 2025-10-08 11:05 | 120K | |
![[ ]](/icons/layout.gif) | 3160_Simon Absalom -..> | 2025-10-08 13:41 | 120K | |
![[ ]](/icons/layout.gif) | 4423_Jon Taylor - ....> | 2025-10-14 07:42 | 120K | |
![[ ]](/icons/layout.gif) | 8841_Paul Busby Paul..> | 2025-10-28 11:13 | 120K | |
![[ ]](/icons/layout.gif) | 10510_James Irons - ..> | 2025-11-03 09:30 | 120K | |
![[ ]](/icons/layout.gif) | 3804_Kaz Suleman - S..> | 2025-10-10 11:19 | 120K | |
![[ ]](/icons/layout.gif) | 8849_Paul Busby Paul..> | 2025-10-28 11:17 | 120K | |
![[ ]](/icons/layout.gif) | 10679_Lee Langley - ..> | 2025-11-03 10:55 | 120K | |
![[ ]](/icons/layout.gif) | 13847_PJ.Munn Darren..> | 2025-11-11 13:23 | 120K | |
![[ ]](/icons/layout.gif) | 1409_Arron Locke - L..> | 2025-09-30 12:27 | 120K | |
![[ ]](/icons/layout.gif) | 3005_Andrew Hodges -..> | 2025-10-08 10:04 | 120K | |
![[ ]](/icons/layout.gif) | 8068_Trevor Thirwell..> | 2025-10-24 14:04 | 120K | |
![[ ]](/icons/layout.gif) | 9468_Jonathan Mills ..> | 2025-10-29 14:56 | 120K | |
![[ ]](/icons/layout.gif) | 12402_Izzed Izet - I..> | 2025-11-06 12:55 | 120K | |
![[ ]](/icons/layout.gif) | 5161_Robert Vinney -..> | 2025-10-16 07:02 | 120K | |
![[ ]](/icons/layout.gif) | 5251_Robert Vinney -..> | 2025-10-16 09:02 | 120K | |
![[ ]](/icons/layout.gif) | 2252_James Macmorlan..> | 2025-10-06 09:38 | 120K | |
![[ ]](/icons/layout.gif) | 560_Steve Hubbard - ..> | 2025-09-23 12:02 | 120K | |
![[ ]](/icons/layout.gif) | 5849_Oakley Bates - ..> | 2025-10-17 11:35 | 120K | |
![[ ]](/icons/layout.gif) | 3671_Anton Mirosnits..> | 2025-10-10 06:40 | 120K | |
![[ ]](/icons/layout.gif) | 9313_Jean-Michel Can..> | 2025-10-29 10:45 | 120K | |
![[ ]](/icons/layout.gif) | 1323_Dilwyn Morgan -..> | 2025-09-29 15:29 | 120K | |
![[ ]](/icons/layout.gif) | 3401_Mark Prevost - ..> | 2025-10-09 09:40 | 120K | |
![[ ]](/icons/layout.gif) | 6070_Elaine Hurley -..> | 2025-10-20 08:30 | 120K | |
![[ ]](/icons/layout.gif) | 7337_Trevor Dousfiel..> | 2025-10-23 11:09 | 120K | |
![[ ]](/icons/layout.gif) | 5155_Andrew Sharples..> | 2025-10-15 16:09 | 120K | |
![[ ]](/icons/layout.gif) | 10310_Robert Bak - B..> | 2025-10-31 12:15 | 120K | |
![[ ]](/icons/layout.gif) | 9920_Robert Bak - BA..> | 2025-10-30 14:57 | 120K | |
![[ ]](/icons/layout.gif) | 5423_Rafael Fernande..> | 2025-10-16 12:49 | 120K | |
![[ ]](/icons/layout.gif) | 4586_Andy Knowles - ..> | 2025-10-14 12:19 | 120K | |
![[ ]](/icons/layout.gif) | 9548_Bart Gardener -..> | 2025-10-29 16:46 | 120K | |
![[ ]](/icons/layout.gif) | 3799_Mark Shaw - SHA..> | 2025-10-10 11:08 | 120K | |
![[ ]](/icons/layout.gif) | 13828_Alex Butler - ..> | 2025-11-11 12:46 | 120K | |
![[ ]](/icons/layout.gif) | 3738_Ken Ingram - IN..> | 2025-10-10 08:58 | 120K | |
![[ ]](/icons/layout.gif) | 4210_Elaine Hurley -..> | 2025-10-13 11:22 | 120K | |
![[ ]](/icons/layout.gif) | 10168_Bart Gardener ..> | 2025-10-31 10:41 | 120K | |
![[ ]](/icons/layout.gif) | 8898_Andrew Newcombe..> | 2025-10-28 12:04 | 120K | |
![[ ]](/icons/layout.gif) | 12937_Mark Warner - ..> | 2025-11-10 07:08 | 120K | |
![[ ]](/icons/layout.gif) | 2363_Samuel Hockaday..> | 2025-10-06 11:57 | 120K | |
![[ ]](/icons/layout.gif) | 3144_Carl Carnell - ..> | 2025-10-08 13:07 | 120K | |
![[ ]](/icons/layout.gif) | 5946_Sean Kiely - KS..> | 2025-10-17 13:51 | 120K | |
![[ ]](/icons/layout.gif) | 663_David Kirby - KI..> | 2025-09-24 07:52 | 120K | |
![[ ]](/icons/layout.gif) | 820_David Kirby - KI..> | 2025-09-25 08:00 | 120K | |
![[ ]](/icons/layout.gif) | 875_James Radford - ..> | 2025-09-25 12:24 | 120K | |
![[ ]](/icons/layout.gif) | 3959_Paul Withers - ..> | 2025-10-10 14:12 | 120K | |
![[ ]](/icons/layout.gif) | 8161_Mark Garrod - M..> | 2025-10-25 11:58 | 120K | |
![[ ]](/icons/layout.gif) | 1090_John Nicholson ..> | 2025-09-26 14:36 | 120K | |
![[ ]](/icons/layout.gif) | 4287_David Jenkinson..> | 2025-10-13 13:15 | 120K | |
![[ ]](/icons/layout.gif) | 834_Greig Matthewson..> | 2025-09-25 08:57 | 120K | |
![[ ]](/icons/layout.gif) | 12930_Charlie Dune-A..> | 2025-11-08 15:18 | 120K | |
![[ ]](/icons/layout.gif) | 676_Greig Matthewson..> | 2025-09-24 08:21 | 120K | |
![[ ]](/icons/layout.gif) | 9078_Matt Head - HEA..> | 2025-10-28 15:37 | 120K | |
![[ ]](/icons/layout.gif) | 9903_Derek Wright - ..> | 2025-10-30 14:47 | 120K | |
![[ ]](/icons/layout.gif) | 7475_Ian Callagham I..> | 2025-10-23 12:24 | 120K | |
![[ ]](/icons/layout.gif) | 2543_Nikki Sabatini ..> | 2025-10-06 16:33 | 120K | |
![[ ]](/icons/layout.gif) | 2149_Lewis Davison -..> | 2025-10-03 13:43 | 120K | |
![[ ]](/icons/layout.gif) | 7892_Paul Busby Paul..> | 2025-10-24 10:12 | 120K | |
![[ ]](/icons/layout.gif) | 556_Stuart Challinor..> | 2025-09-23 11:56 | 120K | |
![[ ]](/icons/layout.gif) | 2197_Neil Plumridge ..> | 2025-10-05 09:55 | 120K | |
![[ ]](/icons/layout.gif) | 5237_All Aspects Con..> | 2025-10-16 08:52 | 120K | |
![[ ]](/icons/layout.gif) | 11153_Jonathan Mills..> | 2025-11-04 10:08 | 120K | |
![[ ]](/icons/layout.gif) | 12011_Phillip Speakm..> | 2025-11-05 14:43 | 120K | |
![[ ]](/icons/layout.gif) | 3265_Nikki Sabatini ..> | 2025-10-08 20:06 | 120K | |
![[ ]](/icons/layout.gif) | 3604_Peter Gilbery -..> | 2025-10-09 14:40 | 120K | |
![[ ]](/icons/layout.gif) | 7263_Michael Straker..> | 2025-10-23 10:06 | 120K | |
![[ ]](/icons/layout.gif) | 7454_Dave Cordell Da..> | 2025-10-23 12:13 | 120K | |
![[ ]](/icons/layout.gif) | 8577_Matthew Richard..> | 2025-10-27 15:21 | 120K | |
![[ ]](/icons/layout.gif) | 8998_WJM Cars Willia..> | 2025-10-28 14:21 | 120K | |
![[ ]](/icons/layout.gif) | 2597_Javeed Sandia -..> | 2025-10-07 08:56 | 120K | |
![[ ]](/icons/layout.gif) | 5935_Trevor Dousfiel..> | 2025-10-17 13:39 | 120K | |
![[ ]](/icons/layout.gif) | 6028_Trevor Dousfiel..> | 2025-10-20 07:34 | 120K | |
![[ ]](/icons/layout.gif) | 11015_Michael Rogers..> | 2025-11-03 16:13 | 120K | |
![[ ]](/icons/layout.gif) | 10629_Ian Davies - D..> | 2025-11-03 10:02 | 120K | |
![[ ]](/icons/layout.gif) | 12444_Lee Langley - ..> | 2025-11-06 13:35 | 120K | |
![[ ]](/icons/layout.gif) | 2698_Drinkwater - DR..> | 2025-10-07 10:46 | 120K | |
![[ ]](/icons/layout.gif) | 3632_Nikki Sabatini ..> | 2025-10-09 15:27 | 120K | |
![[ ]](/icons/layout.gif) | 5474_Jay Dale - Jay ..> | 2025-10-16 13:26 | 120K | |
![[ ]](/icons/layout.gif) | 10753_Damien Lobb - ..> | 2025-11-03 11:54 | 120K | |
![[ ]](/icons/layout.gif) | 4348_Simon Barker - ..> | 2025-10-13 14:36 | 120K | |
![[ ]](/icons/layout.gif) | 5792_Elegant Windows..> | 2025-10-17 10:14 | 120K | |
![[ ]](/icons/layout.gif) | 7862_Colin Sweeney -..> | 2025-10-24 09:22 | 120K | |
![[ ]](/icons/layout.gif) | 1906_Gordon Knight -..> | 2025-10-02 15:40 | 120K | |
![[ ]](/icons/layout.gif) | 2571_Mark Riggal Ele..> | 2025-10-07 07:59 | 120K | |
![[ ]](/icons/layout.gif) | 4157_Anton Mirosnits..> | 2025-10-13 10:43 | 120K | |
![[ ]](/icons/layout.gif) | 2223_Greg Brett - BR..> | 2025-10-06 08:04 | 120K | |
![[ ]](/icons/layout.gif) | 1708_Gordon Knight -..> | 2025-10-02 07:00 | 120K | |
![[ ]](/icons/layout.gif) | 1951_Gordon Knight -..> | 2025-10-03 08:31 | 120K | |
![[ ]](/icons/layout.gif) | 10404_Knowles Brothe..> | 2025-10-31 15:28 | 120K | |
![[ ]](/icons/layout.gif) | 10442_Knowles Brothe..> | 2025-11-03 08:08 | 120K | |
![[ ]](/icons/layout.gif) | 4976_Sam Pitchford -..> | 2025-10-15 12:45 | 120K | |
![[ ]](/icons/layout.gif) | 12682_Robert Bak - B..> | 2025-11-07 09:12 | 120K | |
![[ ]](/icons/layout.gif) | 7961_LT Carpentry Le..> | 2025-10-24 12:06 | 120K | |
![[ ]](/icons/layout.gif) | 7495_Andrew Reid And..> | 2025-10-23 12:40 | 120K | |
![[ ]](/icons/layout.gif) | 11117_IBuild Mark In..> | 2025-11-04 09:06 | 120K | |
![[ ]](/icons/layout.gif) | 7422_Alan Stirling A..> | 2025-10-23 12:03 | 120K | |
![[ ]](/icons/layout.gif) | 3770_Stephen McDermo..> | 2025-10-10 10:17 | 120K | |
![[ ]](/icons/layout.gif) | 4391_Stephen McDermo..> | 2025-10-13 15:19 | 120K | |
![[ ]](/icons/layout.gif) | 14113_Paul Leo - ORD..> | 2025-11-11 16:22 | 120K | |
![[ ]](/icons/layout.gif) | 10701_Matt Head - HE..> | 2025-11-03 11:11 | 120K | |
![[ ]](/icons/layout.gif) | 7502_Rodney Ide Rodn..> | 2025-10-23 12:48 | 120K | |
![[ ]](/icons/layout.gif) | 12412_Barbara Ebanks..> | 2025-11-06 13:08 | 120K | |
![[ ]](/icons/layout.gif) | 3699_Gareth Shepherd..> | 2025-10-10 07:35 | 120K | |
![[ ]](/icons/layout.gif) | 9312_Matthew Richard..> | 2025-10-29 10:44 | 120K | |
![[ ]](/icons/layout.gif) | 10399_Matthew Richar..> | 2025-10-31 15:12 | 120K | |
![[ ]](/icons/layout.gif) | 4303_David Heckford ..> | 2025-10-13 13:28 | 120K | |
![[ ]](/icons/layout.gif) | 2218_David Bracken -..> | 2025-10-06 07:59 | 120K | |
![[ ]](/icons/layout.gif) | 5876_Geoff Holloway ..> | 2025-10-17 12:01 | 120K | |
![[ ]](/icons/layout.gif) | 9307_Colin Sweeney -..> | 2025-10-29 10:21 | 120K | |
![[ ]](/icons/layout.gif) | 1467_Edmund Walaszek..> | 2025-09-30 15:26 | 120K | |
![[ ]](/icons/layout.gif) | 4733_Stephen Haygart..> | 2025-10-14 14:28 | 120K | |
![[ ]](/icons/layout.gif) | 7622_Ian Callagham I..> | 2025-10-23 15:02 | 120K | |
![[ ]](/icons/layout.gif) | 14763_Zbigniew Tomic..> | 2025-11-13 08:36 | 120K | |
![[ ]](/icons/layout.gif) | 14649_Zbigniew Tomic..> | 2025-11-12 14:36 | 120K | |
![[ ]](/icons/layout.gif) | 6082_Sam Pitchford -..> | 2025-10-20 08:48 | 120K | |
![[ ]](/icons/layout.gif) | 2861_Daniel Jackson ..> | 2025-10-08 07:47 | 120K | |
![[ ]](/icons/layout.gif) | 3018_Daniel Jackson ..> | 2025-10-08 10:09 | 120K | |
![[ ]](/icons/layout.gif) | 12761_Gillian Adams ..> | 2025-11-07 10:55 | 120K | |
![[ ]](/icons/layout.gif) | 12802_Gillian Adams ..> | 2025-11-07 12:01 | 120K | |
![[ ]](/icons/layout.gif) | 1257_Wayne Bingley -..> | 2025-09-29 13:05 | 120K | |
![[ ]](/icons/layout.gif) | 12566_Gillian Adams ..> | 2025-11-06 16:33 | 120K | |
![[ ]](/icons/layout.gif) | 1591_John Barker - J..> | 2025-10-01 12:28 | 120K | |
![[ ]](/icons/layout.gif) | 9935_J Hallam Buildi..> | 2025-10-30 15:36 | 120K | |
![[ ]](/icons/layout.gif) | 3657_Simon Knight - ..> | 2025-10-09 20:44 | 120K | |
![[ ]](/icons/layout.gif) | 3242_James Macmorlan..> | 2025-10-08 16:48 | 120K | |
![[ ]](/icons/layout.gif) | 5988_Neil Patching -..> | 2025-10-17 15:04 | 120K | |
![[ ]](/icons/layout.gif) | 12606_Bradley Hine-R..> | 2025-11-07 07:45 | 120K | |
![[ ]](/icons/layout.gif) | 8571_Robert Curucu -..> | 2025-10-27 15:12 | 120K | |
![[ ]](/icons/layout.gif) | 11140_Martyn Cox - M..> | 2025-11-04 09:46 | 120K | |
![[ ]](/icons/layout.gif) | 11508_Martyn Cox - M..> | 2025-11-04 16:25 | 120K | |
![[ ]](/icons/layout.gif) | 3233_Daniel Jackson ..> | 2025-10-08 16:12 | 120K | |
![[ ]](/icons/layout.gif) | 3758_Daniel Jackson ..> | 2025-10-10 09:39 | 120K | |
![[ ]](/icons/layout.gif) | 3171_Suddon - SUDD00..> | 2025-10-08 13:51 | 120K | |
![[ ]](/icons/layout.gif) | 4390_Ralph English -..> | 2025-10-13 15:12 | 120K | |
![[ ]](/icons/layout.gif) | 13396_Nathanael Cicc..> | 2025-11-10 14:53 | 120K | |
![[ ]](/icons/layout.gif) | 6094_Stephen Haygart..> | 2025-10-20 09:04 | 120K | |
![[ ]](/icons/layout.gif) | 8692_Geoff Holloway ..> | 2025-10-28 08:00 | 120K | |
![[ ]](/icons/layout.gif) | 8296_Dad Property Ma..> | 2025-10-27 11:30 | 120K | |
![[ ]](/icons/layout.gif) | 13311_Bradley Hine-R..> | 2025-11-10 12:43 | 120K | |
![[ ]](/icons/layout.gif) | 12419_Martyn Cox - M..> | 2025-11-06 13:15 | 120K | |
![[ ]](/icons/layout.gif) | 12425_Martyn Cox - M..> | 2025-11-06 13:17 | 120K | |
![[ ]](/icons/layout.gif) | 3035_Mark Riggal Ele..> | 2025-10-08 10:26 | 120K | |
![[ ]](/icons/layout.gif) | 3775_Stephen Fairbro..> | 2025-10-10 10:29 | 120K | |
![[ ]](/icons/layout.gif) | 2939_David Read - Dw..> | 2025-10-08 09:05 | 120K | |
![[ ]](/icons/layout.gif) | 14351_Christopher Ho..> | 2025-11-12 09:37 | 120K | |
![[ ]](/icons/layout.gif) | 5360_Harley Lorence ..> | 2025-10-16 11:53 | 120K | |
![[ ]](/icons/layout.gif) | 5936_Trevor Dousfiel..> | 2025-10-17 13:39 | 120K | |
![[ ]](/icons/layout.gif) | 14136_Hunn Security ..> | 2025-11-11 16:42 | 120K | |
![[ ]](/icons/layout.gif) | 11118_IBuild Mark In..> | 2025-11-04 09:06 | 120K | |
![[ ]](/icons/layout.gif) | 14651_Zbigniew Tomic..> | 2025-11-12 14:36 | 120K | |
![[ ]](/icons/layout.gif) | 11141_Martyn Cox - M..> | 2025-11-04 09:47 | 120K | |
![[ ]](/icons/layout.gif) | 14410_Glynn Banks - ..> | 2025-11-12 10:56 | 120K | |
![[ ]](/icons/layout.gif) | 54017_Grafton Ventur..> | 2026-03-12 08:29 | 121K | |
![[ ]](/icons/layout.gif) | 9386_Ben Jones - JON..> | 2025-10-29 13:55 | 121K | |
![[ ]](/icons/layout.gif) | 11026_Geoff - GEOF00..> | 2025-11-03 16:24 | 121K | |
![[ ]](/icons/layout.gif) | 12054_Paul Watkins -..> | 2025-11-05 15:29 | 121K | |
![[ ]](/icons/layout.gif) | 971_Andrew Stibbs - ..> | 2025-09-26 08:27 | 121K | |
![[ ]](/icons/layout.gif) | 1000_Craig Skinner -..> | 2025-09-26 10:29 | 121K | |
![[ ]](/icons/layout.gif) | 2767_James Howard - ..> | 2025-10-07 13:17 | 121K | |
![[ ]](/icons/layout.gif) | 2791_James Howard - ..> | 2025-10-07 14:38 | 121K | |
![[ ]](/icons/layout.gif) | 58268_Elevate Doors ..> | 2026-03-24 08:10 | 121K | |
![[ ]](/icons/layout.gif) | 10398_Paul Watkins -..> | 2025-10-31 15:11 | 121K | |
![[ ]](/icons/layout.gif) | 8433_Damien Lobb - L..> | 2025-10-27 13:20 | 121K | |
![[ ]](/icons/layout.gif) | 12439_Paul Watkins -..> | 2025-11-06 13:33 | 121K | |
![[ ]](/icons/layout.gif) | 625_Neil McDonald - ..> | 2025-09-23 16:10 | 121K | |
![[ ]](/icons/layout.gif) | 13425_Lewis Ward - W..> | 2025-11-10 16:09 | 121K | |
![[ ]](/icons/layout.gif) | 9247_Nicholas Custan..> | 2025-10-29 09:05 | 121K | |
![[ ]](/icons/layout.gif) | 1107_Craig Skinner -..> | 2025-09-26 15:41 | 121K | |
![[ ]](/icons/layout.gif) | 1440_Craig Skinner -..> | 2025-09-30 13:57 | 121K | |
![[ ]](/icons/layout.gif) | 623_Neil McDonald - ..> | 2025-09-23 16:07 | 121K | |
![[ ]](/icons/layout.gif) | 2467_Mel Bexley - BE..> | 2025-10-06 13:31 | 121K | |
![[ ]](/icons/layout.gif) | 223_Andy Devine - DE..> | 2025-09-18 16:30 | 121K | |
![[ ]](/icons/layout.gif) | 1376_Andrew Stibbs -..> | 2025-09-30 10:02 | 121K | |
![[ ]](/icons/layout.gif) | 5037_Craig Gulley Ha..> | 2025-10-15 14:00 | 121K | |
![[ ]](/icons/layout.gif) | 1750_Glen Layfield -..> | 2025-10-02 07:59 | 122K | |
![[ ]](/icons/layout.gif) | 5636_Antony Tilston ..> | 2025-10-16 15:16 | 122K | |
![[ ]](/icons/layout.gif) | 6020_Antony Tilston ..> | 2025-10-20 07:21 | 122K | |
![[ ]](/icons/layout.gif) | 5005_Mark Shaw - SHA..> | 2025-10-15 13:24 | 122K | |
![[ ]](/icons/layout.gif) | 5006_Mark Shaw - SHA..> | 2025-10-15 13:25 | 122K | |
![[ ]](/icons/layout.gif) | 4990_PlumbRight Dave..> | 2025-10-15 12:58 | 122K | |
![[ ]](/icons/layout.gif) | 4985_Adrian Michael ..> | 2025-10-15 12:54 | 122K | |
![[ ]](/icons/layout.gif) | 5970_Stephen Fairbro..> | 2025-10-17 14:12 | 122K | |
![[ ]](/icons/layout.gif) | 10402_Oliver Pilgers..> | 2025-10-31 15:20 | 122K | |
![[ ]](/icons/layout.gif) | 10429_Oliver Pilgers..> | 2025-10-31 16:34 | 122K | |
![[ ]](/icons/layout.gif) | 10433_Oliver Pilgers..> | 2025-10-31 16:46 | 123K | |
![[ ]](/icons/layout.gif) | 10522_Oliver Pilgers..> | 2025-11-03 09:36 | 123K | |
![[ ]](/icons/layout.gif) | 4968_PlumbRight Dave..> | 2025-10-15 12:39 | 123K | |
![[ ]](/icons/layout.gif) | 42446_Kinsley - KINS..> | 2026-02-11 08:28 | 125K | |
![[ ]](/icons/layout.gif) | 22284_Rob Percival -..> | 2025-12-03 08:54 | 132K | |
![[ ]](/icons/layout.gif) | 22418_Bob Viney - VI..> | 2025-12-03 12:38 | 135K | |
![[ ]](/icons/layout.gif) | 18959_Roly Dawson - ..> | 2025-11-25 08:45 | 135K | |
![[ ]](/icons/layout.gif) | 29893_Glen Mcarthur ..> | 2026-01-02 15:34 | 135K | |
![[ ]](/icons/layout.gif) | 29470_Anthony Earl -..> | 2025-12-30 09:06 | 135K | |
![[ ]](/icons/layout.gif) | 30092_Bob Harvey - H..> | 2026-01-05 11:49 | 135K | |
![[ ]](/icons/layout.gif) | 28734_Paul Booth - B..> | 2025-12-22 15:44 | 135K | |
![[ ]](/icons/layout.gif) | 21300_Martin Belsey ..> | 2025-12-01 10:43 | 135K | |
![[ ]](/icons/layout.gif) | 29662_Mrs Davey - DA..> | 2026-01-02 09:09 | 135K | |
![[ ]](/icons/layout.gif) | 27819_Sg Motor Servi..> | 2025-12-18 12:33 | 135K | |
![[ ]](/icons/layout.gif) | 22419_Bob Viney - VI..> | 2025-12-03 12:39 | 135K | |
![[ ]](/icons/layout.gif) | 30075_Edward Goldsmi..> | 2026-01-05 11:24 | 135K | |
![[ ]](/icons/layout.gif) | 29461_Diane Pearson ..> | 2025-12-30 08:48 | 135K | |
![[ ]](/icons/layout.gif) | 30124_Jason Peck - P..> | 2026-01-05 12:08 | 135K | |
![[ ]](/icons/layout.gif) | 26911_Phil Atkins - ..> | 2025-12-16 13:29 | 135K | |
![[ ]](/icons/layout.gif) | 30169_Jerry Warner -..> | 2026-01-05 13:12 | 135K | |
![[ ]](/icons/layout.gif) | 42127_Louise Pettitt..> | 2026-02-10 10:25 | 135K | |
![[ ]](/icons/layout.gif) | 62741_William Kirby ..> | 2026-04-07 09:27 | 135K | |
![[ ]](/icons/layout.gif) | 25732_Jamie Davies -..> | 2025-12-12 14:19 | 135K | |
![[ ]](/icons/layout.gif) | 24681_Stephen Cooper..> | 2025-12-10 10:47 | 135K | |
![[ ]](/icons/layout.gif) | 19279_Alan Patterson..> | 2025-11-25 14:24 | 135K | |
![[ ]](/icons/layout.gif) | 27261_John Slimmers ..> | 2025-12-17 09:50 | 135K | |
![[ ]](/icons/layout.gif) | 30228_Eric Hill - HI..> | 2026-01-05 14:22 | 135K | |
![[ ]](/icons/layout.gif) | 30427_Neil Frost - F..> | 2026-01-05 16:47 | 135K | |
![[ ]](/icons/layout.gif) | 22916_Trevor Doherty..> | 2025-12-04 12:50 | 135K | |
![[ ]](/icons/layout.gif) | 19328_Aaron French -..> | 2025-11-25 15:11 | 135K | |
![[ ]](/icons/layout.gif) | 22432_Stewart Walton..> | 2025-12-03 13:03 | 135K | |
![[ ]](/icons/layout.gif) | 22886_Dianne Milling..> | 2025-12-04 12:19 | 135K | |
![[ ]](/icons/layout.gif) | 29314_Alan Wood - OR..> | 2025-12-29 08:22 | 135K | |
![[ ]](/icons/layout.gif) | 25002_George Catto -..> | 2025-12-11 10:06 | 135K | |
![[ ]](/icons/layout.gif) | 29256_Chris Terry - ..> | 2025-12-29 07:37 | 135K | |
![[ ]](/icons/layout.gif) | 26421_Jonathan Dunn ..> | 2025-12-15 13:25 | 135K | |
![[ ]](/icons/layout.gif) | 21800_Paul Stimpson ..> | 2025-12-02 10:49 | 135K | |
![[ ]](/icons/layout.gif) | 32717_Stuart Lee - O..> | 2026-01-13 11:33 | 135K | |
![[ ]](/icons/layout.gif) | 30604_Martin Miles -..> | 2026-01-06 10:39 | 135K | |
![[ ]](/icons/layout.gif) | 20262_Gavin Battle -..> | 2025-11-27 11:08 | 135K | |
![[ ]](/icons/layout.gif) | 23735_Kevin Grosveno..> | 2025-12-08 10:23 | 135K | |
![[ ]](/icons/layout.gif) | 27684_Roy Dunn - DUN..> | 2025-12-18 09:48 | 135K | |
![[ ]](/icons/layout.gif) | 21887_Russell Steven..> | 2025-12-02 11:42 | 135K | |
![[ ]](/icons/layout.gif) | 26505_Brian Gent - G..> | 2025-12-15 15:20 | 135K | |
![[ ]](/icons/layout.gif) | 19931_Jonathan Mills..> | 2025-11-26 13:40 | 135K | |
![[ ]](/icons/layout.gif) | 29263_Peter Ashworth..> | 2025-12-29 07:42 | 135K | |
![[ ]](/icons/layout.gif) | 30944_Alan Faircloug..> | 2026-01-06 16:08 | 135K | |
![[ ]](/icons/layout.gif) | 25175_Darren Mitchel..> | 2025-12-11 14:05 | 135K | |
![[ ]](/icons/layout.gif) | 30134_John Black - B..> | 2026-01-05 12:16 | 135K | |
![[ ]](/icons/layout.gif) | 23296_Graham Bradley..> | 2025-12-05 09:03 | 135K | |
![[ ]](/icons/layout.gif) | 32702_John Bignell -..> | 2026-01-13 11:27 | 135K | |
![[ ]](/icons/layout.gif) | 29269_Andrew Armstro..> | 2025-12-29 07:46 | 135K | |
![[ ]](/icons/layout.gif) | 21856_UK Rollerdoors..> | 2025-12-02 11:18 | 135K | |
![[ ]](/icons/layout.gif) | 22848_Michael Townse..> | 2025-12-04 11:50 | 135K | |
![[ ]](/icons/layout.gif) | 31153_Singh Goldy - ..> | 2026-01-07 13:36 | 135K | |
![[ ]](/icons/layout.gif) | 23278_Paddock Builde..> | 2025-12-05 08:58 | 135K | |
![[ ]](/icons/layout.gif) | 30111_Jones - JONE00..> | 2026-01-05 11:58 | 135K | |
![[ ]](/icons/layout.gif) | 22396_John Clark - O..> | 2025-12-03 11:58 | 135K | |
![[ ]](/icons/layout.gif) | 20302_Peter House - ..> | 2025-11-27 11:45 | 135K | |
![[ ]](/icons/layout.gif) | 31039_Peter Callis -..> | 2026-01-07 09:38 | 135K | |
![[ ]](/icons/layout.gif) | 32688_Justin Finn - ..> | 2026-01-13 11:18 | 135K | |
![[ ]](/icons/layout.gif) | 29102_Harry Renshaw-..> | 2025-12-23 14:16 | 135K | |
![[ ]](/icons/layout.gif) | 31049_Andrew Hammond..> | 2026-01-07 09:53 | 135K | |
![[ ]](/icons/layout.gif) | 28601_Gavin Shea - O..> | 2025-12-22 12:47 | 135K | |
![[ ]](/icons/layout.gif) | 32327_Danny Andrews ..> | 2026-01-12 10:49 | 135K | |
![[ ]](/icons/layout.gif) | 28608_Roger Thorpe -..> | 2025-12-22 12:51 | 135K | |
![[ ]](/icons/layout.gif) | 29326_Andrew Walker ..> | 2025-12-29 08:30 | 135K | |
![[ ]](/icons/layout.gif) | 30028_Christine Barr..> | 2026-01-05 09:45 | 135K | |
![[ ]](/icons/layout.gif) | 24765_Robert Blunt -..> | 2025-12-10 14:08 | 135K | |
![[ ]](/icons/layout.gif) | 25020_Andy Duncan - ..> | 2025-12-11 10:29 | 135K | |
![[ ]](/icons/layout.gif) | 32170_Peter Callis -..> | 2026-01-09 16:13 | 135K | |
![[ ]](/icons/layout.gif) | 19062_Simon Herbert ..> | 2025-11-25 11:36 | 135K | |
![[ ]](/icons/layout.gif) | 29037_Martin Camble ..> | 2025-12-23 12:30 | 135K | |
![[ ]](/icons/layout.gif) | 28706_Craig Cooper -..> | 2025-12-22 14:46 | 135K | |
![[ ]](/icons/layout.gif) | 29320_John Duncan - ..> | 2025-12-29 08:26 | 135K | |
![[ ]](/icons/layout.gif) | 21331_Ronald Collin ..> | 2025-12-01 11:53 | 135K | |
![[ ]](/icons/layout.gif) | 31032_Peter Gojka - ..> | 2026-01-07 09:28 | 135K | |
![[ ]](/icons/layout.gif) | 24389_ARC Limited Jo..> | 2025-12-09 12:18 | 135K | |
![[ ]](/icons/layout.gif) | 29846_Richard Bird -..> | 2026-01-02 14:45 | 135K | |
![[ ]](/icons/layout.gif) | 32667_Michael Mazur ..> | 2026-01-13 11:03 | 135K | |
![[ ]](/icons/layout.gif) | 32402_Paul Samuels -..> | 2026-01-12 14:06 | 136K | |
![[ ]](/icons/layout.gif) | 22337_Audrey Walker ..> | 2025-12-03 10:04 | 136K | |
![[ ]](/icons/layout.gif) | 23472_Jack Valentine..> | 2025-12-05 13:55 | 136K | |
![[ ]](/icons/layout.gif) | 30371_Benjamin Walsh..> | 2026-01-05 16:20 | 136K | |
![[ ]](/icons/layout.gif) | 23310_Icicle Service..> | 2025-12-05 09:18 | 136K | |
![[ ]](/icons/layout.gif) | 20313_John Horsley -..> | 2025-11-27 11:52 | 136K | |
![[ ]](/icons/layout.gif) | 29045_Smiths Electri..> | 2025-12-23 12:34 | 136K | |
![[ ]](/icons/layout.gif) | 20282_Andrew Staplef..> | 2025-11-27 11:24 | 136K | |
![[ ]](/icons/layout.gif) | 25510_Graham Barnett..> | 2025-12-12 11:15 | 136K | |
![[ ]](/icons/layout.gif) | 31053_John Anderson ..> | 2026-01-07 10:00 | 136K | |
![[ ]](/icons/layout.gif) | 32693_Guy Barker - O..> | 2026-01-13 11:21 | 136K | |
![[ ]](/icons/layout.gif) | 32740_Mark Guyler - ..> | 2026-01-13 11:44 | 136K | |
![[ ]](/icons/layout.gif) | 26445_Daniel Davies ..> | 2025-12-15 13:40 | 136K | |
![[ ]](/icons/layout.gif) | 30180_Marcin Mordak ..> | 2026-01-05 13:30 | 136K | |
![[ ]](/icons/layout.gif) | 23870_Mick Massey - ..> | 2025-12-08 13:02 | 136K | |
![[ ]](/icons/layout.gif) | 31444_James Smith - ..> | 2026-01-08 08:59 | 136K | |
![[ ]](/icons/layout.gif) | 31307_Paul Pringle -..> | 2026-01-08 07:57 | 136K | |
![[ ]](/icons/layout.gif) | 22688_Gary Wooldridg..> | 2025-12-04 08:36 | 136K | |
![[ ]](/icons/layout.gif) | 19019_Timea Horvath ..> | 2025-11-25 10:47 | 136K | |
![[ ]](/icons/layout.gif) | 19357_Timea Horvath ..> | 2025-11-25 15:36 | 136K | |
![[ ]](/icons/layout.gif) | 32155_Sam Oliver - E..> | 2026-01-09 15:50 | 136K | |
![[ ]](/icons/layout.gif) | 32157_Sam Oliver - E..> | 2026-01-09 15:50 | 136K | |
![[ ]](/icons/layout.gif) | 32156_Sam Oliver - E..> | 2026-01-09 15:50 | 136K | |
![[ ]](/icons/layout.gif) | 28392_Iain Bint - BI..> | 2025-12-19 16:37 | 137K | |
![[ ]](/icons/layout.gif) | 27747_Andrew Hobson ..> | 2025-12-18 11:30 | 137K | |
![[ ]](/icons/layout.gif) | 28466_Andrew Hobson ..> | 2025-12-22 09:09 | 137K | |
![[ ]](/icons/layout.gif) | 23157_Keith Williets..> | 2025-12-04 16:10 | 138K | |
![[ ]](/icons/layout.gif) | 36140_Colin Lambert ..> | 2026-01-22 13:39 | 138K | |
![[ ]](/icons/layout.gif) | 36160_Kim Kimee - KI..> | 2026-01-22 14:04 | 138K | |
![[ ]](/icons/layout.gif) | 45553_Rowland Tompki..> | 2026-02-18 11:22 | 138K | |
![[ ]](/icons/layout.gif) | 41920_Mark Leeming -..> | 2026-02-09 16:28 | 138K | |
![[ ]](/icons/layout.gif) | 42329_Clive Benjamin..> | 2026-02-10 14:43 | 138K | |
![[ ]](/icons/layout.gif) | 47794_Ron Wells - WE..> | 2026-02-24 15:56 | 138K | |
![[ ]](/icons/layout.gif) | 42939_Hale - HALE000..> | 2026-02-12 09:24 | 138K | |
![[ ]](/icons/layout.gif) | 57322_M Wood - WOOD0..> | 2026-03-20 09:57 | 138K | |
![[ ]](/icons/layout.gif) | 35120_Tony Williams ..> | 2026-01-20 11:30 | 138K | |
![[ ]](/icons/layout.gif) | 36450_Rob Watson - W..> | 2026-01-23 11:10 | 138K | |
![[ ]](/icons/layout.gif) | 34569_Adam Downing -..> | 2026-01-19 10:47 | 138K | |
![[ ]](/icons/layout.gif) | 67520_Ash Sterland -..> | 2026-04-20 08:08 | 138K | |
![[ ]](/icons/layout.gif) | 50763_Javid Choudhri..> | 2026-03-04 10:51 | 138K | |
![[ ]](/icons/layout.gif) | 41648_Aki Ahmed - AH..> | 2026-02-09 11:24 | 138K | |
![[ ]](/icons/layout.gif) | 44172_Alex Baraona -..> | 2026-02-16 13:37 | 138K | |
![[ ]](/icons/layout.gif) | 36799_Phillip Simmon..> | 2026-01-26 09:24 | 138K | |
![[ ]](/icons/layout.gif) | 70049_David Locke - ..> | 2026-04-24 12:19 | 138K | |
![[ ]](/icons/layout.gif) | 34633_Bart Gardener ..> | 2026-01-19 11:33 | 138K | |
![[ ]](/icons/layout.gif) | 34362_Trevor Rolfe -..> | 2026-01-16 15:06 | 138K | |
![[ ]](/icons/layout.gif) | 48391_Alan Brignull ..> | 2026-02-26 10:39 | 138K | |
![[ ]](/icons/layout.gif) | 62911_Phillip Cooper..> | 2026-04-07 12:02 | 138K | |
![[ ]](/icons/layout.gif) | 40657_Lee Newman - N..> | 2026-02-04 16:55 | 138K | |
![[ ]](/icons/layout.gif) | 63461_Tindall - TIND..> | 2026-04-08 09:53 | 138K | |
![[ ]](/icons/layout.gif) | 45064_Colin Scott - ..> | 2026-02-17 16:01 | 138K | |
![[ ]](/icons/layout.gif) | 39861_Dave Ellis - E..> | 2026-02-03 11:29 | 138K | |
![[ ]](/icons/layout.gif) | 59323_Steve Heyes - ..> | 2026-03-26 08:33 | 138K | |
![[ ]](/icons/layout.gif) | 33996_John Quinsee -..> | 2026-01-15 16:49 | 138K | |
![[ ]](/icons/layout.gif) | 33998_John Quinsee -..> | 2026-01-15 16:50 | 138K | |
![[ ]](/icons/layout.gif) | 51056_Steve McGuire ..> | 2026-03-04 16:15 | 138K | |
![[ ]](/icons/layout.gif) | 44911_Danny Baker - ..> | 2026-02-17 13:28 | 138K | |
![[ ]](/icons/layout.gif) | 41273_Tony Scott - S..> | 2026-02-06 10:35 | 138K | |
![[ ]](/icons/layout.gif) | 44345_Marc Loppas - ..> | 2026-02-16 16:05 | 138K | |
![[ ]](/icons/layout.gif) | 63134_James Newman -..> | 2026-04-07 14:24 | 138K | |
![[ ]](/icons/layout.gif) | 60897_Paul Sheridan ..> | 2026-03-30 16:00 | 138K | |
![[ ]](/icons/layout.gif) | 35962_Milne - Straps..> | 2026-01-22 10:16 | 138K | |
![[ ]](/icons/layout.gif) | 67511_Samuel Wood - ..> | 2026-04-20 08:04 | 138K | |
![[ ]](/icons/layout.gif) | 64439_Peter Ormerod ..> | 2026-04-10 08:59 | 138K | |
![[ ]](/icons/layout.gif) | 46483_Clive Bennett ..> | 2026-02-20 09:58 | 138K | |
![[ ]](/icons/layout.gif) | 49373_Leigh Mitchell..> | 2026-03-02 08:41 | 138K | |
![[ ]](/icons/layout.gif) | 53918_Peter Constabl..> | 2026-03-11 14:27 | 138K | |
![[ ]](/icons/layout.gif) | 35541_Archard - ARCH..> | 2026-01-21 09:29 | 138K | |
![[ ]](/icons/layout.gif) | 36852_Dan Prior - PR..> | 2026-01-26 10:12 | 138K | |
![[ ]](/icons/layout.gif) | 69581_Brian King - K..> | 2026-04-23 13:54 | 138K | |
![[ ]](/icons/layout.gif) | 40714_James Commons ..> | 2026-02-05 08:31 | 138K | |
![[ ]](/icons/layout.gif) | 44133_Jack Paul - In..> | 2026-02-16 12:23 | 138K | |
![[ ]](/icons/layout.gif) | 39918_S Lekhi - Lekh..> | 2026-02-03 12:18 | 138K | |
![[ ]](/icons/layout.gif) | 49470_Peter Sayer - ..> | 2026-03-02 09:34 | 138K | |
![[ ]](/icons/layout.gif) | 33493_Michael Parker..> | 2026-01-15 08:33 | 138K | |
![[ ]](/icons/layout.gif) | 45933_Stephen Savory..> | 2026-02-19 09:02 | 138K | |
![[ ]](/icons/layout.gif) | 48479_John Pirrie - ..> | 2026-02-26 11:27 | 138K | |
![[ ]](/icons/layout.gif) | 61498_John Cullen - ..> | 2026-03-31 14:59 | 138K | |
![[ ]](/icons/layout.gif) | 66169_Ann Clegg - Si..> | 2026-04-15 10:23 | 138K | |
![[ ]](/icons/layout.gif) | 58419_Gary Reynolds ..> | 2026-03-24 10:08 | 138K | |
![[ ]](/icons/layout.gif) | 37167_VIP Bin Cleani..> | 2026-01-26 15:26 | 138K | |
![[ ]](/icons/layout.gif) | 68253_Dharmin Mandal..> | 2026-04-21 09:30 | 138K | |
![[ ]](/icons/layout.gif) | 34535_Michael Nevin ..> | 2026-01-19 10:21 | 138K | |
![[ ]](/icons/layout.gif) | 51652_Douglas Wright..> | 2026-03-05 16:00 | 138K | |
![[ ]](/icons/layout.gif) | 34706_Duffy - DUFF00..> | 2026-01-19 13:31 | 138K | |
![[ ]](/icons/layout.gif) | 47730_Barnes - Door ..> | 2026-02-24 14:38 | 138K | |
![[ ]](/icons/layout.gif) | 36443_Mark Styles - ..> | 2026-01-23 11:07 | 138K | |
![[ ]](/icons/layout.gif) | 36713_Daniel Davies ..> | 2026-01-23 16:30 | 138K | |
![[ ]](/icons/layout.gif) | 43987_Jennifer Thorn..> | 2026-02-16 10:31 | 138K | |
![[ ]](/icons/layout.gif) | 41640_Ewan Clarke - ..> | 2026-02-09 11:21 | 138K | |
![[ ]](/icons/layout.gif) | 47488_Ian Mayor-Smit..> | 2026-02-24 10:07 | 138K | |
![[ ]](/icons/layout.gif) | 50651_Jo Fenton - FE..> | 2026-03-04 09:22 | 138K | |
![[ ]](/icons/layout.gif) | 52489_Stuart Parker ..> | 2026-03-09 10:50 | 138K | |
![[ ]](/icons/layout.gif) | 65448_Ian Weller - W..> | 2026-04-14 09:07 | 138K | |
![[ ]](/icons/layout.gif) | 53104_Tim Parker - P..> | 2026-03-10 10:26 | 138K | |
![[ ]](/icons/layout.gif) | 34371_Keith Butler -..> | 2026-01-16 15:23 | 138K | |
![[ ]](/icons/layout.gif) | 41652_David Harries ..> | 2026-02-09 11:27 | 138K | |
![[ ]](/icons/layout.gif) | 45610_Mark Ghent - H..> | 2026-02-18 12:17 | 138K | |
![[ ]](/icons/layout.gif) | 33288_Greg Soanes - ..> | 2026-01-14 14:18 | 138K | |
![[ ]](/icons/layout.gif) | 39191_Mike White - W..> | 2026-02-02 11:01 | 138K | |
![[ ]](/icons/layout.gif) | 41633_Scott Brader -..> | 2026-02-09 11:13 | 138K | |
![[ ]](/icons/layout.gif) | 63550_Mullen - MULL0..> | 2026-04-08 11:47 | 138K | |
![[ ]](/icons/layout.gif) | 67822_Jon Shepherd -..> | 2026-04-20 12:32 | 138K | |
![[ ]](/icons/layout.gif) | 69528_Jody Baxer - B..> | 2026-04-23 13:01 | 138K | |
![[ ]](/icons/layout.gif) | 44748_Paul Fitzgibbo..> | 2026-02-17 10:39 | 138K | |
![[ ]](/icons/layout.gif) | 40405_Peter Lewis - ..> | 2026-02-04 11:33 | 138K | |
![[ ]](/icons/layout.gif) | 68260_David Perkins ..> | 2026-04-21 09:35 | 138K | |
![[ ]](/icons/layout.gif) | 49911_Darren Newbold..> | 2026-03-02 16:02 | 138K | |
![[ ]](/icons/layout.gif) | 38350_Kevin Heaver -..> | 2026-01-29 11:00 | 138K | |
![[ ]](/icons/layout.gif) | 41615_Matt Pulman - ..> | 2026-02-09 11:03 | 138K | |
![[ ]](/icons/layout.gif) | 43852_Chris Sheppard..> | 2026-02-16 09:16 | 138K | |
![[ ]](/icons/layout.gif) | 60980_William Heardl..> | 2026-03-31 08:54 | 138K | |
![[ ]](/icons/layout.gif) | 49546_Steve Kirk - K..> | 2026-03-02 10:33 | 138K | |
![[ ]](/icons/layout.gif) | 60599_Andy Page - Ex..> | 2026-03-30 12:53 | 138K | |
![[ ]](/icons/layout.gif) | 69803_Marc Sutton - ..> | 2026-04-24 08:26 | 138K | |
![[ ]](/icons/layout.gif) | 48710_Victor Gooding..> | 2026-02-26 15:47 | 138K | |
![[ ]](/icons/layout.gif) | 41266_Jakub Pilarski..> | 2026-02-06 10:28 | 138K | |
![[ ]](/icons/layout.gif) | 42798_Martin Hewlett..> | 2026-02-11 15:29 | 138K | |
![[ ]](/icons/layout.gif) | 55473_Peter Davis - ..> | 2026-03-16 14:25 | 138K | |
![[ ]](/icons/layout.gif) | 45563_Derek Read - G..> | 2026-02-18 11:36 | 138K | |
![[ ]](/icons/layout.gif) | 52205_Charles Thomps..> | 2026-03-06 14:48 | 138K | |
![[ ]](/icons/layout.gif) | 43474_Nicole Richmon..> | 2026-02-13 09:15 | 138K | |
![[ ]](/icons/layout.gif) | 46953_Jason Martin -..> | 2026-02-23 09:33 | 138K | |
![[ ]](/icons/layout.gif) | 47162_Donna Dixon - ..> | 2026-02-23 15:08 | 138K | |
![[ ]](/icons/layout.gif) | 58968_Martyn Edmisto..> | 2026-03-25 09:53 | 138K | |
![[ ]](/icons/layout.gif) | 33705_Ian Lister - I..> | 2026-01-15 11:09 | 139K | |
![[ ]](/icons/layout.gif) | 36186_David Gummer -..> | 2026-01-22 15:16 | 139K | |
![[ ]](/icons/layout.gif) | 41624_Paul Taylor - ..> | 2026-02-09 11:09 | 139K | |
![[ ]](/icons/layout.gif) | 51344_Steven Cole - ..> | 2026-03-05 10:38 | 139K | |
![[ ]](/icons/layout.gif) | 65432_Margaret Yates..> | 2026-04-14 08:59 | 139K | |
![[ ]](/icons/layout.gif) | 33822_Justin Finn - ..> | 2026-01-15 14:03 | 139K | |
![[ ]](/icons/layout.gif) | 38311_Voyce - Motor ..> | 2026-01-29 10:35 | 139K | |
![[ ]](/icons/layout.gif) | 60440_Daniel Bowes- ..> | 2026-03-30 08:50 | 139K | |
![[ ]](/icons/layout.gif) | 67961_Tim Elms - Rep..> | 2026-04-20 14:48 | 139K | |
![[ ]](/icons/layout.gif) | 69291_Andrew Billing..> | 2026-04-23 07:51 | 139K | |
![[ ]](/icons/layout.gif) | 43183_Chris Sheppard..> | 2026-02-12 14:48 | 139K | |
![[ ]](/icons/layout.gif) | 34365_Trevor Rolfe -..> | 2026-01-16 15:06 | 139K | |
![[ ]](/icons/layout.gif) | 53315_John Harding -..> | 2026-03-10 13:48 | 139K | |
![[ ]](/icons/layout.gif) | 35542_Archard - ARCH..> | 2026-01-21 09:29 | 139K | |
![[ ]](/icons/layout.gif) | 34172_CWD Improvemen..> | 2026-01-16 09:30 | 139K | |
![[ ]](/icons/layout.gif) | 61193_Eyeview Soluti..> | 2026-03-31 11:22 | 139K | |
![[ ]](/icons/layout.gif) | 45919_Alan Bailey - ..> | 2026-02-19 08:38 | 139K | |
![[ ]](/icons/layout.gif) | 42233_Scott Tatham -..> | 2026-02-10 11:58 | 139K | |
![[ ]](/icons/layout.gif) | 35638_Kinsley - REME..> | 2026-01-21 11:39 | 139K | |
![[ ]](/icons/layout.gif) | 46984_Chris Turner -..> | 2026-02-23 10:05 | 139K | |
![[ ]](/icons/layout.gif) | 63158_Mark Bateman -..> | 2026-04-07 14:43 | 139K | |
![[ ]](/icons/layout.gif) | 63135_James Newman -..> | 2026-04-07 14:25 | 139K | |
![[ ]](/icons/layout.gif) | 67385_Lisa Muller - ..> | 2026-04-17 14:51 | 139K | |
![[ ]](/icons/layout.gif) | 61214_Andrew Owen - ..> | 2026-03-31 12:02 | 139K | |
![[ ]](/icons/layout.gif) | 66813_Lawrie Hudson ..> | 2026-04-16 13:45 | 139K | |
![[ ]](/icons/layout.gif) | 48665_Phil Nicholson..> | 2026-02-26 14:50 | 139K | |
![[ ]](/icons/layout.gif) | 64080_Steve Metcalfe..> | 2026-04-09 11:30 | 139K | |
![[ ]](/icons/layout.gif) | 42544_Frank Han - Re..> | 2026-02-11 09:48 | 139K | |
![[ ]](/icons/layout.gif) | 58336_Paul Jenkins -..> | 2026-03-24 09:05 | 139K | |
![[ ]](/icons/layout.gif) | 37169_VIP Bin Cleani..> | 2026-01-26 15:27 | 139K | |
![[ ]](/icons/layout.gif) | 53690_Matthew Hunt -..> | 2026-03-11 09:42 | 139K | |
![[ ]](/icons/layout.gif) | 41517_Brian Higgins ..> | 2026-02-09 08:40 | 139K | |
![[ ]](/icons/layout.gif) | 58090_Roy Good - Pho..> | 2026-03-23 13:36 | 139K | |
![[ ]](/icons/layout.gif) | 53383_Neil Sherry - ..> | 2026-03-10 14:29 | 139K | |
![[ ]](/icons/layout.gif) | 59719_Jonathan Simmo..> | 2026-03-26 14:58 | 139K | |
![[ ]](/icons/layout.gif) | 57670_William Kirby ..> | 2026-03-20 16:28 | 139K | |
![[ ]](/icons/layout.gif) | 48104_Michael Hider ..> | 2026-02-25 11:34 | 139K | |
![[ ]](/icons/layout.gif) | 60332_Roger Price - ..> | 2026-03-27 16:37 | 139K | |
![[ ]](/icons/layout.gif) | 41779_Gary Scott - S..> | 2026-02-09 14:47 | 139K | |
![[ ]](/icons/layout.gif) | 67719_David JACOB - ..> | 2026-04-20 09:58 | 139K | |
![[ ]](/icons/layout.gif) | 58928_Peter Harris -..> | 2026-03-25 09:22 | 139K | |
![[ ]](/icons/layout.gif) | 69668_Simon Burley -..> | 2026-04-23 15:38 | 139K | |
![[ ]](/icons/layout.gif) | 41560_Janet Brown - ..> | 2026-02-09 09:49 | 139K | |
![[ ]](/icons/layout.gif) | 36029_Jamie Brown - ..> | 2026-01-22 11:11 | 139K | |
![[ ]](/icons/layout.gif) | 66021_Stephen Saywel..> | 2026-04-15 08:31 | 139K | |
![[ ]](/icons/layout.gif) | 34684_Ben Bradbury -..> | 2026-01-19 12:44 | 139K | |
![[ ]](/icons/layout.gif) | 67924_Justin Sheppar..> | 2026-04-20 14:22 | 139K | |
![[ ]](/icons/layout.gif) | 57473_STORME CrossFi..> | 2026-03-20 12:48 | 140K | |
![[ ]](/icons/layout.gif) | 16867_Joshua Mason -..> | 2025-11-18 16:18 | 145K | |
![[ ]](/icons/layout.gif) | 30181_Asif - ASIF000..> | 2026-01-05 13:31 | 145K | |
![[ ]](/icons/layout.gif) | 32489_Richard Hanlon..> | 2026-01-13 07:31 | 145K | |
![[ ]](/icons/layout.gif) | 24872_Matthew Bill -..> | 2025-12-10 16:32 | 145K | |
![[ ]](/icons/layout.gif) | 24884_Matthew Bill -..> | 2025-12-10 16:51 | 145K | |
![[ ]](/icons/layout.gif) | 24887_Matthew Bill -..> | 2025-12-10 16:52 | 145K | |
![[ ]](/icons/layout.gif) | 24888_Matthew Bill -..> | 2025-12-10 16:54 | 145K | |
![[ ]](/icons/layout.gif) | 31696_Stuart Lee - R..> | 2026-01-08 13:44 | 145K | |
![[ ]](/icons/layout.gif) | 30936_Alan Faircloug..> | 2026-01-06 15:56 | 145K | |
![[ ]](/icons/layout.gif) | 32490_Richard Hanlon..> | 2026-01-13 07:32 | 145K | |
![[ ]](/icons/layout.gif) | 21806_Peter Lewis - ..> | 2025-12-02 10:55 | 145K | |
![[ ]](/icons/layout.gif) | 30039_Peter Callis -..> | 2026-01-05 10:08 | 145K | |
![[ ]](/icons/layout.gif) | 27318_Danny Andrews ..> | 2025-12-17 10:50 | 145K | |
![[ ]](/icons/layout.gif) | 17107_Joshua Mason -..> | 2025-11-19 10:26 | 145K | |
![[ ]](/icons/layout.gif) | 24803_Davis - DAVI00..> | 2025-12-10 16:14 | 145K | |
![[ ]](/icons/layout.gif) | 30438_Paul Bates - B..> | 2026-01-05 17:04 | 145K | |
![[ ]](/icons/layout.gif) | 16883_David Wright -..> | 2025-11-18 16:39 | 145K | |
![[ ]](/icons/layout.gif) | 31715_Stuart Lee - R..> | 2026-01-08 14:08 | 145K | |
![[ ]](/icons/layout.gif) | 16663_Scott Webster ..> | 2025-11-18 13:37 | 145K | |
![[ ]](/icons/layout.gif) | 16696_Scott Webster ..> | 2025-11-18 13:51 | 145K | |
![[ ]](/icons/layout.gif) | 30207_Jack Jones - J..> | 2026-01-05 14:13 | 145K | |
![[ ]](/icons/layout.gif) | 31737_Brian Curtis -..> | 2026-01-08 15:03 | 145K | |
![[ ]](/icons/layout.gif) | 32384_Luke Postle - ..> | 2026-01-12 13:24 | 145K | |
![[ ]](/icons/layout.gif) | 27947_Carl Carnell -..> | 2025-12-18 15:37 | 145K | |
![[ ]](/icons/layout.gif) | 31876_Russell Hudson..> | 2026-01-09 08:28 | 145K | |
![[ ]](/icons/layout.gif) | 25597_Joe Barker - B..> | 2025-12-12 12:40 | 145K | |
![[ ]](/icons/layout.gif) | 29246_Becky Muldoon ..> | 2025-12-24 11:17 | 145K | |
![[ ]](/icons/layout.gif) | 32392_Luke Postle - ..> | 2026-01-12 13:32 | 145K | |
![[ ]](/icons/layout.gif) | 14952_Mark Riggal El..> | 2025-11-13 11:33 | 145K | |
![[ ]](/icons/layout.gif) | 18821_Rob Stafford -..> | 2025-11-24 16:35 | 145K | |
![[ ]](/icons/layout.gif) | 23681_Natalie Ibrhin..> | 2025-12-08 09:43 | 145K | |
![[ ]](/icons/layout.gif) | 15474_David Gilson -..> | 2025-11-14 12:18 | 145K | |
![[ ]](/icons/layout.gif) | 32966_Joe Barker - B..> | 2026-01-14 07:24 | 145K | |
![[ ]](/icons/layout.gif) | 27948_Colin Davidson..> | 2025-12-18 15:37 | 145K | |
![[ ]](/icons/layout.gif) | 15013_Darren Haynes ..> | 2025-11-13 13:07 | 145K | |
![[ ]](/icons/layout.gif) | 15496_David Gilson -..> | 2025-11-14 13:01 | 145K | |
![[ ]](/icons/layout.gif) | 18463_Sunny Sidhu - ..> | 2025-11-24 09:23 | 145K | |
![[ ]](/icons/layout.gif) | 23669_Emlyn Roberts ..> | 2025-12-08 09:23 | 145K | |
![[ ]](/icons/layout.gif) | 23686_Emlyn Roberts ..> | 2025-12-08 09:47 | 145K | |
![[ ]](/icons/layout.gif) | 15469_David Gilson -..> | 2025-11-14 12:12 | 145K | |
![[ ]](/icons/layout.gif) | 18116_Kerry Allen - ..> | 2025-11-21 11:35 | 145K | |
![[ ]](/icons/layout.gif) | 18230_Kerry Allen - ..> | 2025-11-21 14:16 | 145K | |
![[ ]](/icons/layout.gif) | 25749_Grant Gillen -..> | 2025-12-12 14:50 | 145K | |
![[ ]](/icons/layout.gif) | 32060_John Rodemark ..> | 2026-01-09 13:08 | 145K | |
![[ ]](/icons/layout.gif) | 31964_Paul Wise - WI..> | 2026-01-09 10:33 | 145K | |
![[ ]](/icons/layout.gif) | 32127_Paul Wise - WI..> | 2026-01-09 14:57 | 145K | |
![[ ]](/icons/layout.gif) | 15983_Cybaman Techno..> | 2025-11-17 11:26 | 145K | |
![[ ]](/icons/layout.gif) | 31215_Nigel Jeffrey ..> | 2026-01-07 14:40 | 145K | |
![[ ]](/icons/layout.gif) | 32493_Mike Coombs - ..> | 2026-01-13 07:57 | 145K | |
![[ ]](/icons/layout.gif) | 32830_Mike Coombs - ..> | 2026-01-13 12:58 | 145K | |
![[ ]](/icons/layout.gif) | 25833_Jervis Jervis ..> | 2025-12-12 16:42 | 145K | |
![[ ]](/icons/layout.gif) | 30845_Ian George - G..> | 2026-01-06 14:47 | 145K | |
![[ ]](/icons/layout.gif) | 18086_Wayne Mcintosh..> | 2025-11-21 11:00 | 145K | |
![[ ]](/icons/layout.gif) | 18184_Steve McFarlan..> | 2025-11-21 13:03 | 145K | |
![[ ]](/icons/layout.gif) | 30287_Carol Plumley ..> | 2026-01-05 15:09 | 145K | |
![[ ]](/icons/layout.gif) | 32382_Kamil Puzdrows..> | 2026-01-12 12:39 | 145K | |
![[ ]](/icons/layout.gif) | 32177_Ricky Cresswel..> | 2026-01-09 16:45 | 145K | |
![[ ]](/icons/layout.gif) | 17058_Dell Home Impr..> | 2025-11-19 09:09 | 145K | |
![[ ]](/icons/layout.gif) | 30449_Luke Gatesy - ..> | 2026-01-06 07:53 | 145K | |
![[ ]](/icons/layout.gif) | 32020_Neil Robertson..> | 2026-01-09 11:57 | 145K | |
![[ ]](/icons/layout.gif) | 32452_Neil Robertson..> | 2026-01-12 16:21 | 145K | |
![[ ]](/icons/layout.gif) | 15135_Iurii Derkach ..> | 2025-11-13 16:24 | 145K | |
![[ ]](/icons/layout.gif) | 32474_Neil Robertson..> | 2026-01-12 16:56 | 145K | |
![[ ]](/icons/layout.gif) | 30952_Ian George - G..> | 2026-01-06 16:27 | 145K | |
![[ ]](/icons/layout.gif) | 30076_Robert Smith -..> | 2026-01-05 11:29 | 145K | |
![[ ]](/icons/layout.gif) | 18609_Steve McFarlan..> | 2025-11-24 12:08 | 145K | |
![[ ]](/icons/layout.gif) | 17067_Ceta Group Ltd..> | 2025-11-19 09:11 | 145K | |
![[ ]](/icons/layout.gif) | 18611_Steve McFarlan..> | 2025-11-24 12:12 | 145K | |
![[ ]](/icons/layout.gif) | 23652_Mick Massey - ..> | 2025-12-08 09:06 | 145K | |
![[ ]](/icons/layout.gif) | 15125_Iurii Derkach ..> | 2025-11-13 16:05 | 145K | |
![[ ]](/icons/layout.gif) | 26213_Daniel Davies ..> | 2025-12-15 09:38 | 145K | |
![[ ]](/icons/layout.gif) | 32393_Luke Postle - ..> | 2026-01-12 13:33 | 145K | |
![[ ]](/icons/layout.gif) | 31224_Direct Trade P..> | 2026-01-07 15:01 | 145K | |
![[ ]](/icons/layout.gif) | 23671_Matt Solomon -..> | 2025-12-08 09:26 | 145K | |
![[ ]](/icons/layout.gif) | 23673_Matt Solomon -..> | 2025-12-08 09:27 | 145K | |
![[ ]](/icons/layout.gif) | 17069_Ceta Group Ltd..> | 2025-11-19 09:16 | 145K | |
![[ ]](/icons/layout.gif) | 15127_Iurii Derkach ..> | 2025-11-13 16:09 | 145K | |
![[ ]](/icons/layout.gif) | 15130_Iurii Derkach ..> | 2025-11-13 16:11 | 145K | |
![[ ]](/icons/layout.gif) | 22100_Matthew Robins..> | 2025-12-02 14:55 | 145K | |
![[ ]](/icons/layout.gif) | 18253_Ceta Group Ltd..> | 2025-11-21 14:42 | 145K | |
![[ ]](/icons/layout.gif) | 20795_Neil - NEIL000..> | 2025-11-28 10:49 | 145K | |
![[ ]](/icons/layout.gif) | 32500_Mike Coombs - ..> | 2026-01-13 08:02 | 145K | |
![[ ]](/icons/layout.gif) | 32831_Mike Coombs - ..> | 2026-01-13 12:59 | 145K | |
![[ ]](/icons/layout.gif) | 16725_Scott Webster ..> | 2025-11-18 14:25 | 145K | |
![[ ]](/icons/layout.gif) | 18967_Matthew Bursle..> | 2025-11-25 08:55 | 145K | |
![[ ]](/icons/layout.gif) | 18035_Jamie Shires -..> | 2025-11-21 10:21 | 145K | |
![[ ]](/icons/layout.gif) | 29899_Woollard - WOO..> | 2026-01-02 15:51 | 145K | |
![[ ]](/icons/layout.gif) | 32576_Neal Prescott ..> | 2026-01-13 09:05 | 145K | |
![[ ]](/icons/layout.gif) | 31916_Russell Hudson..> | 2026-01-09 09:05 | 145K | |
![[ ]](/icons/layout.gif) | 16082_Dowse - DOWS00..> | 2025-11-17 13:49 | 145K | |
![[ ]](/icons/layout.gif) | 29377_Becky Muldoon ..> | 2025-12-29 11:19 | 145K | |
![[ ]](/icons/layout.gif) | 29630_Becky Muldoon ..> | 2026-01-02 08:29 | 145K | |
![[ ]](/icons/layout.gif) | 23765_Daniel Hunt - ..> | 2025-12-08 10:55 | 145K | |
![[ ]](/icons/layout.gif) | 16066_Louis Martin -..> | 2025-11-17 13:23 | 145K | |
![[ ]](/icons/layout.gif) | 16100_David Gregory ..> | 2025-11-17 14:17 | 145K | |
![[ ]](/icons/layout.gif) | 27432_Percy Thumwood..> | 2025-12-17 13:29 | 145K | |
![[ ]](/icons/layout.gif) | 27968_Percy Thumwood..> | 2025-12-18 16:05 | 145K | |
![[ ]](/icons/layout.gif) | 24079_Paul Abel - AB..> | 2025-12-09 08:58 | 145K | |
![[ ]](/icons/layout.gif) | 30465_Shaun Butler -..> | 2026-01-06 08:20 | 145K | |
![[ ]](/icons/layout.gif) | 17214_Steven Trim - ..> | 2025-11-19 12:02 | 145K | |
![[ ]](/icons/layout.gif) | 24187_Philip Ward - ..> | 2025-12-09 09:33 | 145K | |
![[ ]](/icons/layout.gif) | 16875_Ian Bilks - RD..> | 2025-11-18 16:27 | 145K | |
![[ ]](/icons/layout.gif) | 17032_Ian Bilks - RD..> | 2025-11-19 08:47 | 145K | |
![[ ]](/icons/layout.gif) | 19082_James Rankin -..> | 2025-11-25 12:17 | 145K | |
![[ ]](/icons/layout.gif) | 15663_M T Atkinson -..> | 2025-11-14 14:49 | 145K | |
![[ ]](/icons/layout.gif) | 15856_Kieran Hayes -..> | 2025-11-17 09:26 | 145K | |
![[ ]](/icons/layout.gif) | 16008_Simon Stewart ..> | 2025-11-17 11:54 | 145K | |
![[ ]](/icons/layout.gif) | 20819_Alistair Culsh..> | 2025-11-28 11:08 | 145K | |
![[ ]](/icons/layout.gif) | 31251_Woollard - WOO..> | 2026-01-07 16:08 | 145K | |
![[ ]](/icons/layout.gif) | 24419_Mark Braybrook..> | 2025-12-09 13:55 | 145K | |
![[ ]](/icons/layout.gif) | 23731_Ermal Mula - M..> | 2025-12-08 10:18 | 145K | |
![[ ]](/icons/layout.gif) | 25161_Rob Warman - O..> | 2025-12-11 13:53 | 145K | |
![[ ]](/icons/layout.gif) | 16628_Chris Snowdon ..> | 2025-11-18 12:42 | 145K | |
![[ ]](/icons/layout.gif) | 18469_Sean Gilfillan..> | 2025-11-24 09:41 | 145K | |
![[ ]](/icons/layout.gif) | 15807_Alex Diaconu -..> | 2025-11-17 09:00 | 145K | |
![[ ]](/icons/layout.gif) | 16037_Alex Diaconu -..> | 2025-11-17 12:46 | 145K | |
![[ ]](/icons/layout.gif) | 16138_Denys Cole - C..> | 2025-11-17 15:30 | 145K | |
![[ ]](/icons/layout.gif) | 16517_Denys Cole - C..> | 2025-11-18 10:59 | 145K | |
![[ ]](/icons/layout.gif) | 23183_Neil Stevens -..> | 2025-12-04 17:49 | 145K | |
![[ ]](/icons/layout.gif) | 23584_David Crowder ..> | 2025-12-05 16:48 | 145K | |
![[ ]](/icons/layout.gif) | 15065_Denys Cole - C..> | 2025-11-13 14:32 | 145K | |
![[ ]](/icons/layout.gif) | 22855_Neil Stevens -..> | 2025-12-04 11:57 | 145K | |
![[ ]](/icons/layout.gif) | 17712_Jordan Barker ..> | 2025-11-20 15:14 | 145K | |
![[ ]](/icons/layout.gif) | 30472_Gary Harvey - ..> | 2026-01-06 08:36 | 145K | |
![[ ]](/icons/layout.gif) | 21377_Arturo Chichon..> | 2025-12-01 12:19 | 145K | |
![[ ]](/icons/layout.gif) | 32461_Neal Prescott ..> | 2026-01-12 16:41 | 145K | |
![[ ]](/icons/layout.gif) | 24526_Daniel Donohoe..> | 2025-12-09 16:25 | 145K | |
![[ ]](/icons/layout.gif) | 31108_Owen Ingram - ..> | 2026-01-07 11:46 | 145K | |
![[ ]](/icons/layout.gif) | 32137_Ricky Cresswel..> | 2026-01-09 15:37 | 145K | |
![[ ]](/icons/layout.gif) | 20923_Alistair Culsh..> | 2025-11-28 13:36 | 145K | |
![[ ]](/icons/layout.gif) | 29967_Fiona Hitchcoc..> | 2026-01-05 08:45 | 145K | |
![[ ]](/icons/layout.gif) | 16050_Andy Porter - ..> | 2025-11-17 13:16 | 145K | |
![[ ]](/icons/layout.gif) | 28085_Percy Thumwood..> | 2025-12-19 08:39 | 145K | |
![[ ]](/icons/layout.gif) | 30795_Luke Gates - G..> | 2026-01-06 13:56 | 145K | |
![[ ]](/icons/layout.gif) | 17772_Dell Home Impr..> | 2025-11-20 16:05 | 145K | |
![[ ]](/icons/layout.gif) | 32450_Matt Huckle - ..> | 2026-01-12 16:20 | 145K | |
![[ ]](/icons/layout.gif) | 32491_Matt Huckle - ..> | 2026-01-13 07:38 | 145K | |
![[ ]](/icons/layout.gif) | 30760_Luke Gatesy - ..> | 2026-01-06 13:01 | 145K | |
![[ ]](/icons/layout.gif) | 20681_Gibbons - GIBB..> | 2025-11-28 09:17 | 145K | |
![[ ]](/icons/layout.gif) | 29500_Kate Husband -..> | 2025-12-31 12:37 | 145K | |
![[ ]](/icons/layout.gif) | 19323_Ian Dilks - RD..> | 2025-11-25 15:08 | 145K | |
![[ ]](/icons/layout.gif) | 19699_Ian Dilks - RD..> | 2025-11-26 09:08 | 145K | |
![[ ]](/icons/layout.gif) | 26558_Matthew Kimber..> | 2025-12-15 16:06 | 145K | |
![[ ]](/icons/layout.gif) | 32320_Sue Lincoln - ..> | 2026-01-12 10:23 | 145K | |
![[ ]](/icons/layout.gif) | 15140_Iurii Derkach ..> | 2025-11-13 16:29 | 145K | |
![[ ]](/icons/layout.gif) | 15814_Iurii Derkach ..> | 2025-11-17 09:11 | 145K | |
![[ ]](/icons/layout.gif) | 28616_Jamie Brown - ..> | 2025-12-22 13:13 | 145K | |
![[ ]](/icons/layout.gif) | 28955_Paul Cooper - ..> | 2025-12-23 10:19 | 145K | |
![[ ]](/icons/layout.gif) | 14988_Go Eco Green P..> | 2025-11-13 12:07 | 145K | |
![[ ]](/icons/layout.gif) | 19317_Ian Bilks - RD..> | 2025-11-25 15:03 | 145K | |
![[ ]](/icons/layout.gif) | 28736_Gary Frost - F..> | 2025-12-22 16:06 | 145K | |
![[ ]](/icons/layout.gif) | 18634_Raven Fire And..> | 2025-11-24 13:29 | 145K | |
![[ ]](/icons/layout.gif) | 22942_Andy Willis - ..> | 2025-12-04 13:39 | 145K | |
![[ ]](/icons/layout.gif) | 32458_James Dixon - ..> | 2026-01-12 16:33 | 145K | |
![[ ]](/icons/layout.gif) | 31960_Tony Swaine - ..> | 2026-01-09 10:17 | 145K | |
![[ ]](/icons/layout.gif) | 32914_Mike Coombs - ..> | 2026-01-13 14:50 | 145K | |
![[ ]](/icons/layout.gif) | 18298_Kerry Allen - ..> | 2025-11-21 16:00 | 145K | |
![[ ]](/icons/layout.gif) | 31208_Ionut Sanducu ..> | 2026-01-07 14:05 | 145K | |
![[ ]](/icons/layout.gif) | 31253_James Morrison..> | 2026-01-07 16:12 | 145K | |
![[ ]](/icons/layout.gif) | 16812_Charlie Dune-A..> | 2025-11-18 15:41 | 145K | |
![[ ]](/icons/layout.gif) | 18352_Andrew Rowley ..> | 2025-11-22 10:52 | 145K | |
![[ ]](/icons/layout.gif) | 18819_Alex Diaconu -..> | 2025-11-24 16:29 | 145K | |
![[ ]](/icons/layout.gif) | 31298_Scott Tatham -..> | 2026-01-08 07:20 | 145K | |
![[ ]](/icons/layout.gif) | 16832_Harrold Knight..> | 2025-11-18 15:49 | 145K | |
![[ ]](/icons/layout.gif) | 20539_Shaun Hilton -..> | 2025-11-27 16:18 | 145K | |
![[ ]](/icons/layout.gif) | 31561_Ian George - G..> | 2026-01-08 11:01 | 145K | |
![[ ]](/icons/layout.gif) | 32808_Lisa Scattergo..> | 2026-01-13 12:48 | 145K | |
![[ ]](/icons/layout.gif) | 19002_Julian Clarke ..> | 2025-11-25 10:06 | 145K | |
![[ ]](/icons/layout.gif) | 20574_Sam Capone - H..> | 2025-11-27 16:51 | 145K | |
![[ ]](/icons/layout.gif) | 20580_Sam Capone - H..> | 2025-11-27 16:57 | 145K | |
![[ ]](/icons/layout.gif) | 24218_Emlyn Roberts ..> | 2025-12-09 10:20 | 145K | |
![[ ]](/icons/layout.gif) | 30336_Carol Plumley ..> | 2026-01-05 16:01 | 145K | |
![[ ]](/icons/layout.gif) | 31802_Michael Harris..> | 2026-01-08 15:46 | 145K | |
![[ ]](/icons/layout.gif) | 23489_Liam Paddick -..> | 2025-12-05 14:20 | 145K | |
![[ ]](/icons/layout.gif) | 24439_Liam Paddick -..> | 2025-12-09 14:17 | 145K | |
![[ ]](/icons/layout.gif) | 29647_Kate Husband -..> | 2026-01-02 08:44 | 145K | |
![[ ]](/icons/layout.gif) | 27621_Liam Bradly - ..> | 2025-12-18 08:36 | 145K | |
![[ ]](/icons/layout.gif) | 21561_Thomas Hartley..> | 2025-12-01 16:39 | 145K | |
![[ ]](/icons/layout.gif) | 21582_Thomas Hartley..> | 2025-12-01 16:46 | 145K | |
![[ ]](/icons/layout.gif) | 21596_Thomas Hartley..> | 2025-12-01 16:51 | 145K | |
![[ ]](/icons/layout.gif) | 27341_Matthew Kimber..> | 2025-12-17 11:14 | 145K | |
![[ ]](/icons/layout.gif) | 69128_Stephan Potter..> | 2026-04-22 14:31 | 145K | |
![[ ]](/icons/layout.gif) | 18242_Ceta Group Ltd..> | 2025-11-21 14:38 | 145K | |
![[ ]](/icons/layout.gif) | 21270_Charlie Swift ..> | 2025-12-01 10:15 | 145K | |
![[ ]](/icons/layout.gif) | 24224_Matt Solomon -..> | 2025-12-09 10:35 | 145K | |
![[ ]](/icons/layout.gif) | 31420_James Oldfield..> | 2026-01-08 08:41 | 145K | |
![[ ]](/icons/layout.gif) | 20584_Gareth Cripps ..> | 2025-11-27 17:03 | 145K | |
![[ ]](/icons/layout.gif) | 21051_James Gill - J..> | 2025-11-28 16:40 | 145K | |
![[ ]](/icons/layout.gif) | 21217_James Gill - J..> | 2025-12-01 09:40 | 145K | |
![[ ]](/icons/layout.gif) | 23691_Matthew Robins..> | 2025-12-08 09:55 | 145K | |
![[ ]](/icons/layout.gif) | 32902_John Kendrick ..> | 2026-01-13 14:17 | 145K | |
![[ ]](/icons/layout.gif) | 20312_Alison Wohlfor..> | 2025-11-27 11:51 | 145K | |
![[ ]](/icons/layout.gif) | 23920_Andy Willis - ..> | 2025-12-08 14:29 | 145K | |
![[ ]](/icons/layout.gif) | 18466_Andrew Bullen ..> | 2025-11-24 09:33 | 145K | |
![[ ]](/icons/layout.gif) | 26760_Liam Bradly - ..> | 2025-12-16 10:49 | 145K | |
![[ ]](/icons/layout.gif) | 23161_Dan Corrigall ..> | 2025-12-04 16:18 | 145K | |
![[ ]](/icons/layout.gif) | 31332_Lindsey Wallis..> | 2026-01-08 08:12 | 145K | |
![[ ]](/icons/layout.gif) | 24535_Greenlands Con..> | 2025-12-09 16:34 | 145K | |
![[ ]](/icons/layout.gif) | 26702_Matthew Kimber..> | 2025-12-16 09:44 | 145K | |
![[ ]](/icons/layout.gif) | 18999_Simon Hockley ..> | 2025-11-25 10:05 | 145K | |
![[ ]](/icons/layout.gif) | 27305_Anthony Kirk -..> | 2025-12-17 10:42 | 145K | |
![[ ]](/icons/layout.gif) | 21492_Graham Gibbons..> | 2025-12-01 14:43 | 145K | |
![[ ]](/icons/layout.gif) | 18995_Joe Davis - OR..> | 2025-11-25 10:00 | 145K | |
![[ ]](/icons/layout.gif) | 29375_Leo Darling - ..> | 2025-12-29 11:13 | 145K | |
![[ ]](/icons/layout.gif) | 20322_Peter Urquhart..> | 2025-11-27 11:55 | 145K | |
![[ ]](/icons/layout.gif) | 30058_Streamline Hom..> | 2026-01-05 11:02 | 145K | |
![[ ]](/icons/layout.gif) | 30518_Streamline Hom..> | 2026-01-06 09:26 | 145K | |
![[ ]](/icons/layout.gif) | 20578_Matthew Bursle..> | 2025-11-27 16:54 | 145K | |
![[ ]](/icons/layout.gif) | 60039_Jacob Woodhous..> | 2026-03-27 10:46 | 145K | |
![[ ]](/icons/layout.gif) | 17261_Zbigniew Tomic..> | 2025-11-19 13:40 | 145K | |
![[ ]](/icons/layout.gif) | 19615_RLP Robert Pay..> | 2025-11-26 08:12 | 145K | |
![[ ]](/icons/layout.gif) | 31738_Dean Cameron -..> | 2026-01-08 15:05 | 145K | |
![[ ]](/icons/layout.gif) | 18478_Andrew Bullen ..> | 2025-11-24 09:54 | 145K | |
![[ ]](/icons/layout.gif) | 23749_Steve McFarlan..> | 2025-12-08 10:30 | 145K | |
![[ ]](/icons/layout.gif) | 18348_Darren Haynes ..> | 2025-11-22 10:47 | 145K | |
![[ ]](/icons/layout.gif) | 32732_Andrew Woolsto..> | 2026-01-13 11:42 | 145K | |
![[ ]](/icons/layout.gif) | 19901_Darren Haynes ..> | 2025-11-26 11:54 | 145K | |
![[ ]](/icons/layout.gif) | 20029_Darren Haynes ..> | 2025-11-26 16:30 | 145K | |
![[ ]](/icons/layout.gif) | 27823_James Walker -..> | 2025-12-18 12:52 | 145K | |
![[ ]](/icons/layout.gif) | 21456_Darren Haynes ..> | 2025-12-01 13:47 | 145K | |
![[ ]](/icons/layout.gif) | 32448_Graham Parrott..> | 2026-01-12 16:20 | 145K | |
![[ ]](/icons/layout.gif) | 15072_Matthew Green ..> | 2025-11-13 14:48 | 145K | |
![[ ]](/icons/layout.gif) | 26746_Stan Annis - S..> | 2025-12-16 10:37 | 145K | |
![[ ]](/icons/layout.gif) | 31746_Robert Smith -..> | 2026-01-08 15:14 | 145K | |
![[ ]](/icons/layout.gif) | 31703_William Wright..> | 2026-01-08 13:57 | 145K | |
![[ ]](/icons/layout.gif) | 41005_Zdena Murgacov..> | 2026-02-05 13:56 | 145K | |
![[ ]](/icons/layout.gif) | 27161_Alex George - ..> | 2025-12-17 08:16 | 145K | |
![[ ]](/icons/layout.gif) | 27336_John Wilson - ..> | 2025-12-17 11:01 | 145K | |
![[ ]](/icons/layout.gif) | 26662_David Gilson -..> | 2025-12-16 09:03 | 145K | |
![[ ]](/icons/layout.gif) | 27155_Christopher Th..> | 2025-12-17 08:03 | 145K | |
![[ ]](/icons/layout.gif) | 23779_Dan Corrigall ..> | 2025-12-08 11:06 | 145K | |
![[ ]](/icons/layout.gif) | 23478_Philip Drakele..> | 2025-12-05 14:09 | 145K | |
![[ ]](/icons/layout.gif) | 23171_Philip Drakele..> | 2025-12-04 16:41 | 145K | |
![[ ]](/icons/layout.gif) | 24948_Matthew Robins..> | 2025-12-11 09:28 | 145K | |
![[ ]](/icons/layout.gif) | 21490_Peter Urquhart..> | 2025-12-01 14:40 | 145K | |
![[ ]](/icons/layout.gif) | 16629_Chris Snowdon ..> | 2025-11-18 12:42 | 145K | |
![[ ]](/icons/layout.gif) | 26915_David Gilson -..> | 2025-12-16 13:38 | 145K | |
![[ ]](/icons/layout.gif) | 31127_Streamline Hom..> | 2026-01-07 12:45 | 145K | |
![[ ]](/icons/layout.gif) | 31257_Tom Collins - ..> | 2026-01-07 16:28 | 145K | |
![[ ]](/icons/layout.gif) | 31263_Streamline Hom..> | 2026-01-07 16:52 | 145K | |
![[ ]](/icons/layout.gif) | 23361_Philip Drakele..> | 2025-12-05 10:10 | 145K | |
![[ ]](/icons/layout.gif) | 30087_Lisa Scattergo..> | 2026-01-05 11:44 | 145K | |
![[ ]](/icons/layout.gif) | 28581_Lisa Scattergo..> | 2025-12-22 12:14 | 145K | |
![[ ]](/icons/layout.gif) | 32462_Neal Prescott ..> | 2026-01-12 16:41 | 145K | |
![[ ]](/icons/layout.gif) | 15066_Denys Cole - C..> | 2025-11-13 14:32 | 145K | |
![[ ]](/icons/layout.gif) | 29948_Lisa Scattergo..> | 2026-01-05 08:33 | 145K | |
![[ ]](/icons/layout.gif) | 15810_CH Develoments..> | 2025-11-17 09:05 | 145K | |
![[ ]](/icons/layout.gif) | 15816_CH Develoments..> | 2025-11-17 09:14 | 145K | |
![[ ]](/icons/layout.gif) | 32505_Graham Parrott..> | 2026-01-13 08:11 | 145K | |
![[ ]](/icons/layout.gif) | 24647_Neil Taylor - ..> | 2025-12-10 09:22 | 145K | |
![[ ]](/icons/layout.gif) | 31804_Michael Harris..> | 2026-01-08 15:47 | 145K | |
![[ ]](/icons/layout.gif) | 27299_Christopher Th..> | 2025-12-17 10:23 | 145K | |
![[ ]](/icons/layout.gif) | 32451_Matt Huckle - ..> | 2026-01-12 16:21 | 145K | |
![[ ]](/icons/layout.gif) | 29501_Kate Husband -..> | 2025-12-31 12:37 | 145K | |
![[ ]](/icons/layout.gif) | 32459_James Dixon - ..> | 2026-01-12 16:33 | 145K | |
![[ ]](/icons/layout.gif) | 31961_Tony Swaine - ..> | 2026-01-09 10:17 | 145K | |
![[ ]](/icons/layout.gif) | 32915_Mike Coombs - ..> | 2026-01-13 14:50 | 145K | |
![[ ]](/icons/layout.gif) | 19052_AMJ. Building ..> | 2025-11-25 11:20 | 145K | |
![[ ]](/icons/layout.gif) | 15141_Iurii Derkach ..> | 2025-11-13 16:29 | 145K | |
![[ ]](/icons/layout.gif) | 14989_Go Eco Green P..> | 2025-11-13 12:07 | 145K | |
![[ ]](/icons/layout.gif) | 31962_Tony Swaine - ..> | 2026-01-09 10:17 | 145K | |
![[ ]](/icons/layout.gif) | 31113_Stewart Armstr..> | 2026-01-07 11:58 | 145K | |
![[ ]](/icons/layout.gif) | 31478_Duane Snelling..> | 2026-01-08 09:13 | 145K | |
![[ ]](/icons/layout.gif) | 31803_Michael Harris..> | 2026-01-08 15:46 | 145K | |
![[ ]](/icons/layout.gif) | 19125_Mike Smith - O..> | 2025-11-25 13:14 | 145K | |
![[ ]](/icons/layout.gif) | 31299_Scott Tatham -..> | 2026-01-08 07:20 | 145K | |
![[ ]](/icons/layout.gif) | 21185_Paul Jones - O..> | 2025-12-01 09:17 | 145K | |
![[ ]](/icons/layout.gif) | 16131_CH Develoments..> | 2025-11-17 15:20 | 145K | |
![[ ]](/icons/layout.gif) | 32903_John Kendrick ..> | 2026-01-13 14:17 | 145K | |
![[ ]](/icons/layout.gif) | 21444_Mike Smith - O..> | 2025-12-01 13:36 | 145K | |
![[ ]](/icons/layout.gif) | 32449_Graham Parrott..> | 2026-01-12 16:20 | 145K | |
![[ ]](/icons/layout.gif) | 19618_RLP Robert Pay..> | 2025-11-26 08:13 | 145K | |
![[ ]](/icons/layout.gif) | 32733_Andrew Woolsto..> | 2026-01-13 11:42 | 145K | |
![[ ]](/icons/layout.gif) | 31747_Robert Smith -..> | 2026-01-08 15:15 | 145K | |
![[ ]](/icons/layout.gif) | 15812_CH Develoments..> | 2025-11-17 09:09 | 145K | |
![[ ]](/icons/layout.gif) | 30192_Phil Monday - ..> | 2026-01-05 13:55 | 146K | |
![[ ]](/icons/layout.gif) | 26622_Alex Hutchison..> | 2025-12-16 07:45 | 146K | |
![[ ]](/icons/layout.gif) | 18565_Craig Weston -..> | 2025-11-24 11:25 | 146K | |
![[ ]](/icons/layout.gif) | 31820_Julian .. - ....> | 2026-01-08 16:45 | 146K | |
![[ ]](/icons/layout.gif) | 31963_Julian .. - ....> | 2026-01-09 10:23 | 146K | |
![[ ]](/icons/layout.gif) | 18575_Craig Weston -..> | 2025-11-24 11:35 | 146K | |
![[ ]](/icons/layout.gif) | 19292_Ben Rye - RYEB..> | 2025-11-25 14:35 | 146K | |
![[ ]](/icons/layout.gif) | 29935_Craig Hustwayt..> | 2026-01-05 08:23 | 146K | |
![[ ]](/icons/layout.gif) | 29933_Craig Hustwayt..> | 2026-01-05 08:19 | 146K | |
![[ ]](/icons/layout.gif) | 17717_Adam Lodge - L..> | 2025-11-20 15:28 | 146K | |
![[ ]](/icons/layout.gif) | 31672_Alex Millar - ..> | 2026-01-08 13:18 | 146K | |
![[ ]](/icons/layout.gif) | 30305_Alex Millar - ..> | 2026-01-05 15:37 | 146K | |
![[ ]](/icons/layout.gif) | 30182_Asif - ASIF000..> | 2026-01-05 13:37 | 146K | |
![[ ]](/icons/layout.gif) | 18473_Ben Rye - RYEB..> | 2025-11-24 09:44 | 146K | |
![[ ]](/icons/layout.gif) | 22339_Dominique Barr..> | 2025-12-03 10:12 | 146K | |
![[ ]](/icons/layout.gif) | 30252_Neil - NEIL000..> | 2026-01-05 14:53 | 146K | |
![[ ]](/icons/layout.gif) | 22345_Dominique Barr..> | 2025-12-03 10:39 | 146K | |
![[ ]](/icons/layout.gif) | 30298_Phil Monday - ..> | 2026-01-05 15:26 | 146K | |
![[ ]](/icons/layout.gif) | 21531_Dominique Barr..> | 2025-12-01 15:48 | 146K | |
![[ ]](/icons/layout.gif) | 17233_Robert Moore -..> | 2025-11-19 12:49 | 146K | |
![[ ]](/icons/layout.gif) | 30369_Neil Robertson..> | 2026-01-05 16:20 | 146K | |
![[ ]](/icons/layout.gif) | 30450_Neil Robertson..> | 2026-01-06 07:55 | 146K | |
![[ ]](/icons/layout.gif) | 16389_Owen Atkinson ..> | 2025-11-18 09:13 | 146K | |
![[ ]](/icons/layout.gif) | 19315_Ian Gourley Tr..> | 2025-11-25 15:02 | 146K | |
![[ ]](/icons/layout.gif) | 16552_Owen Atkinson ..> | 2025-11-18 11:14 | 146K | |
![[ ]](/icons/layout.gif) | 15495_Robin Staff - ..> | 2025-11-14 12:53 | 146K | |
![[ ]](/icons/layout.gif) | 32032_Lee Ingold - I..> | 2026-01-09 12:19 | 146K | |
![[ ]](/icons/layout.gif) | 32383_Damien Lobb - ..> | 2026-01-12 13:23 | 146K | |
![[ ]](/icons/layout.gif) | 23980_Josh Satturley..> | 2025-12-08 16:33 | 146K | |
![[ ]](/icons/layout.gif) | 18579_Craig Weston -..> | 2025-11-24 11:38 | 146K | |
![[ ]](/icons/layout.gif) | 19262_Ben Rye - RYEB..> | 2025-11-25 14:13 | 146K | |
![[ ]](/icons/layout.gif) | 19303_Ben Rye - RYEB..> | 2025-11-25 14:45 | 146K | |
![[ ]](/icons/layout.gif) | 18001_Adam Lodge - L..> | 2025-11-21 09:53 | 146K | |
![[ ]](/icons/layout.gif) | 32233_Craig Hustwayt..> | 2026-01-12 08:38 | 146K | |
![[ ]](/icons/layout.gif) | 19316_Ian Gourley Tr..> | 2025-11-25 15:02 | 146K | |
![[ ]](/icons/layout.gif) | 19333_Craig Weston -..> | 2025-11-25 15:23 | 146K | |
![[ ]](/icons/layout.gif) | 16034_Lewis Ward - W..> | 2025-11-17 12:45 | 146K | |
![[ ]](/icons/layout.gif) | 31687_Alex Millar - ..> | 2026-01-08 13:27 | 146K | |
![[ ]](/icons/layout.gif) | 16234_James Bentley ..> | 2025-11-17 16:52 | 146K | |
![[ ]](/icons/layout.gif) | 18537_Patrick Banks ..> | 2025-11-24 10:49 | 146K | |
![[ ]](/icons/layout.gif) | 18557_Patrick Banks ..> | 2025-11-24 11:07 | 146K | |
![[ ]](/icons/layout.gif) | 17876_Patrick Banks ..> | 2025-11-21 07:58 | 146K | |
![[ ]](/icons/layout.gif) | 28324_Iain Bint - BI..> | 2025-12-19 14:42 | 146K | |
![[ ]](/icons/layout.gif) | 32379_Ian Toner - TO..> | 2026-01-12 12:34 | 146K | |
![[ ]](/icons/layout.gif) | 16592_Owen Atkinson ..> | 2025-11-18 12:00 | 146K | |
![[ ]](/icons/layout.gif) | 16142_Robin Staff - ..> | 2025-11-17 15:34 | 146K | |
![[ ]](/icons/layout.gif) | 16642_Paul Watkins -..> | 2025-11-18 13:18 | 146K | |
![[ ]](/icons/layout.gif) | 21506_Colin Cottrell..> | 2025-12-01 15:00 | 146K | |
![[ ]](/icons/layout.gif) | 21476_Ian Gourley Tr..> | 2025-12-01 14:19 | 146K | |
![[ ]](/icons/layout.gif) | 19304_Ben Rye - RYEB..> | 2025-11-25 14:45 | 146K | |
![[ ]](/icons/layout.gif) | 22254_Colin Cottrell..> | 2025-12-03 08:23 | 146K | |
![[ ]](/icons/layout.gif) | 16143_Robin Staff - ..> | 2025-11-17 15:35 | 147K | |
![[ ]](/icons/layout.gif) | 23143_Willow Builder..> | 2025-12-04 15:59 | 147K | |
![[ ]](/icons/layout.gif) | 32380_Ian Toner - TO..> | 2026-01-12 12:34 | 147K | |
![[ ]](/icons/layout.gif) | 32381_Ian Toner - TO..> | 2026-01-12 12:34 | 147K | |
![[ ]](/icons/layout.gif) | 23795_Willow Builder..> | 2025-12-08 11:20 | 147K | |
![[ ]](/icons/layout.gif) | 23939_1st Shield Dar..> | 2025-12-08 14:42 | 147K | |
![[ ]](/icons/layout.gif) | 30620_NTRAP NR11 7NZ..> | 2026-01-06 11:01 | 147K | |
![[ ]](/icons/layout.gif) | 21194_Ross Garage Do..> | 2025-12-01 09:26 | 147K | |
![[ ]](/icons/layout.gif) | 18446_Geoff - GEOF00..> | 2025-11-24 08:51 | 147K | |
![[ ]](/icons/layout.gif) | 15698_Matt Benning -..> | 2025-11-14 16:54 | 147K | |
![[ ]](/icons/layout.gif) | 19356_Kirsty Wood - ..> | 2025-11-25 15:35 | 147K | |
![[ ]](/icons/layout.gif) | 21913_Steve Jackson ..> | 2025-12-02 11:57 | 148K | |
![[ ]](/icons/layout.gif) | 31071_Louise James -..> | 2026-01-07 10:18 | 148K | |
![[ ]](/icons/layout.gif) | 23477_Steve Jackson ..> | 2025-12-05 14:00 | 148K | |
![[ ]](/icons/layout.gif) | 42831_Ewan - CLAR001..> | 2026-02-11 16:33 | 148K | |
![[ ]](/icons/layout.gif) | 62928_Neil Wright - ..> | 2026-04-07 12:07 | 148K | |
![[ ]](/icons/layout.gif) | 58108_Katy Gilhooly ..> | 2026-03-23 13:58 | 148K | |
![[ ]](/icons/layout.gif) | 38043_John Wilson - ..> | 2026-01-28 14:07 | 148K | |
![[ ]](/icons/layout.gif) | 47703_Ron Wells - St..> | 2026-02-24 13:56 | 148K | |
![[ ]](/icons/layout.gif) | 42886_Danny Baker - ..> | 2026-02-12 08:44 | 148K | |
![[ ]](/icons/layout.gif) | 54567_Andrew Loizou ..> | 2026-03-13 08:21 | 148K | |
![[ ]](/icons/layout.gif) | 49651_Bernard Rice -..> | 2026-03-02 11:41 | 148K | |
![[ ]](/icons/layout.gif) | 34641_John Tuplin - ..> | 2026-01-19 11:39 | 148K | |
![[ ]](/icons/layout.gif) | 45043_Adam Hodge - S..> | 2026-02-17 15:31 | 148K | |
![[ ]](/icons/layout.gif) | 48371_James Fairbair..> | 2026-02-26 10:13 | 148K | |
![[ ]](/icons/layout.gif) | 52940_Neary - Endloc..> | 2026-03-10 08:16 | 148K | |
![[ ]](/icons/layout.gif) | 40144_Gareth William..> | 2026-02-03 16:21 | 148K | |
![[ ]](/icons/layout.gif) | 63099_Hibberd Matt -..> | 2026-04-07 13:54 | 148K | |
![[ ]](/icons/layout.gif) | 58214_Katy Gilhooly ..> | 2026-03-23 16:37 | 148K | |
![[ ]](/icons/layout.gif) | 55299_Peter Davis - ..> | 2026-03-16 13:07 | 148K | |
![[ ]](/icons/layout.gif) | 59414_Peter Rayment ..> | 2026-03-26 10:02 | 148K | |
![[ ]](/icons/layout.gif) | 58204_Peter Graham -..> | 2026-03-23 16:27 | 148K | |
![[ ]](/icons/layout.gif) | 53516_Pearson - PEAR..> | 2026-03-10 16:49 | 148K | |
![[ ]](/icons/layout.gif) | 54040_James Hall - L..> | 2026-03-12 09:01 | 148K | |
![[ ]](/icons/layout.gif) | 60604_Jibk Limited, ..> | 2026-03-30 12:55 | 148K | |
![[ ]](/icons/layout.gif) | 69276_Andrew Billing..> | 2026-04-23 07:36 | 148K | |
![[ ]](/icons/layout.gif) | 36547_Peter Clark - ..> | 2026-01-23 12:59 | 148K | |
![[ ]](/icons/layout.gif) | 47146_Donna Dixon - ..> | 2026-02-23 14:43 | 148K | |
![[ ]](/icons/layout.gif) | 67256_Paul Thomas - ..> | 2026-04-17 12:38 | 148K | |
![[ ]](/icons/layout.gif) | 67417_Paul Thomas - ..> | 2026-04-17 15:53 | 148K | |
![[ ]](/icons/layout.gif) | 65245_Nigel Thompson..> | 2026-04-13 14:49 | 148K | |
![[ ]](/icons/layout.gif) | 37869_Mike Rutter - ..> | 2026-01-28 11:10 | 148K | |
![[ ]](/icons/layout.gif) | 42325_Hugh O'Reilly ..> | 2026-02-10 14:33 | 148K | |
![[ ]](/icons/layout.gif) | 69012_John Walter Co..> | 2026-04-22 12:30 | 148K | |
![[ ]](/icons/layout.gif) | 42324_Frank O'Reilly..> | 2026-02-10 14:32 | 148K | |
![[ ]](/icons/layout.gif) | 66476_Jacqui Graham ..> | 2026-04-16 07:46 | 148K | |
![[ ]](/icons/layout.gif) | 67859_John Morland G..> | 2026-04-20 13:30 | 148K | |
![[ ]](/icons/layout.gif) | 59799_James Fairbair..> | 2026-03-26 15:59 | 148K | |
![[ ]](/icons/layout.gif) | 48747_Kevan Martin -..> | 2026-02-26 16:40 | 148K | |
![[ ]](/icons/layout.gif) | 61618_Jules Moynan -..> | 2026-04-01 07:44 | 148K | |
![[ ]](/icons/layout.gif) | 44629_VIP Bin Cleani..> | 2026-02-17 09:25 | 148K | |
![[ ]](/icons/layout.gif) | 34100_Richard Hanlon..> | 2026-01-16 08:32 | 148K | |
![[ ]](/icons/layout.gif) | 44715_MD Development..> | 2026-02-17 10:21 | 148K | |
![[ ]](/icons/layout.gif) | 49663_Bernard Rice -..> | 2026-03-02 11:48 | 148K | |
![[ ]](/icons/layout.gif) | 55979_Eyeview Soluti..> | 2026-03-17 15:15 | 148K | |
![[ ]](/icons/layout.gif) | 42326_Frank Han - Re..> | 2026-02-10 14:34 | 148K | |
![[ ]](/icons/layout.gif) | 51981_Prestige Elect..> | 2026-03-06 11:26 | 148K | |
![[ ]](/icons/layout.gif) | 69173_Brian Stoddart..> | 2026-04-22 15:32 | 148K | |
![[ ]](/icons/layout.gif) | 51108_Paul Mooring -..> | 2026-03-04 17:01 | 148K | |
![[ ]](/icons/layout.gif) | 44827_John Wilson - ..> | 2026-02-17 12:43 | 148K | |
![[ ]](/icons/layout.gif) | 69375_Greg Goulding ..> | 2026-04-23 09:09 | 148K | |
![[ ]](/icons/layout.gif) | 42609_Nathan Smyth -..> | 2026-02-11 10:59 | 148K | |
![[ ]](/icons/layout.gif) | 49757_Stephen Edward..> | 2026-03-02 14:09 | 148K | |
![[ ]](/icons/layout.gif) | 45623_Rowland Tompki..> | 2026-02-18 12:49 | 148K | |
![[ ]](/icons/layout.gif) | 51596_Greg Jarka - J..> | 2026-03-05 14:35 | 148K | |
![[ ]](/icons/layout.gif) | 51690_Greg Jarka - J..> | 2026-03-05 16:55 | 148K | |
![[ ]](/icons/layout.gif) | 60309_Katy Gilhooly ..> | 2026-03-27 14:56 | 148K | |
![[ ]](/icons/layout.gif) | 45058_Adam Hodge - S..> | 2026-02-17 15:54 | 148K | |
![[ ]](/icons/layout.gif) | 66235_Antony Thompso..> | 2026-04-15 12:03 | 148K | |
![[ ]](/icons/layout.gif) | 58234_Andy Towser - ..> | 2026-03-23 16:56 | 148K | |
![[ ]](/icons/layout.gif) | 58497_Andy Towser - ..> | 2026-03-24 11:37 | 148K | |
![[ ]](/icons/layout.gif) | 52045_James Newman -..> | 2026-03-06 12:03 | 148K | |
![[ ]](/icons/layout.gif) | 46083_Ian Pearson Lo..> | 2026-02-19 12:07 | 148K | |
![[ ]](/icons/layout.gif) | 50233_Tim Burton - B..> | 2026-03-03 11:35 | 148K | |
![[ ]](/icons/layout.gif) | 65050_Hibberd Matt -..> | 2026-04-13 10:38 | 148K | |
![[ ]](/icons/layout.gif) | 59416_Peter Rayment ..> | 2026-03-26 10:10 | 148K | |
![[ ]](/icons/layout.gif) | 66059_Edward Smith -..> | 2026-04-15 08:59 | 148K | |
![[ ]](/icons/layout.gif) | 56899_Tony Welsh - W..> | 2026-03-19 11:46 | 148K | |
![[ ]](/icons/layout.gif) | 60548_Stephen Maguir..> | 2026-03-30 11:27 | 148K | |
![[ ]](/icons/layout.gif) | 35861_Paula Morle - ..> | 2026-01-21 16:17 | 148K | |
![[ ]](/icons/layout.gif) | 45854_Josh West - WE..> | 2026-02-18 16:22 | 148K | |
![[ ]](/icons/layout.gif) | 57865_Terry Welsh - ..> | 2026-03-23 10:27 | 148K | |
![[ ]](/icons/layout.gif) | 34225_M Bonner - BON..> | 2026-01-16 10:35 | 148K | |
![[ ]](/icons/layout.gif) | 40201_Pete Ormerod -..> | 2026-02-03 16:42 | 148K | |
![[ ]](/icons/layout.gif) | 44380_Josh West - WE..> | 2026-02-16 16:47 | 148K | |
![[ ]](/icons/layout.gif) | 54988_Stephen Foster..> | 2026-03-13 15:29 | 148K | |
![[ ]](/icons/layout.gif) | 68616_Brian Stoddart..> | 2026-04-21 13:30 | 148K | |
![[ ]](/icons/layout.gif) | 48441_Nigel Chapman ..> | 2026-02-26 10:48 | 148K | |
![[ ]](/icons/layout.gif) | 36019_Jamie Brown - ..> | 2026-01-22 11:07 | 148K | |
![[ ]](/icons/layout.gif) | 46963_Jonathan Mumfo..> | 2026-02-23 09:48 | 148K | |
![[ ]](/icons/layout.gif) | 65152_Stephen Boyle ..> | 2026-04-13 12:23 | 148K | |
![[ ]](/icons/layout.gif) | 45621_Keith - KEIT00..> | 2026-02-18 12:28 | 148K | |
![[ ]](/icons/layout.gif) | 62770_Paul Burns - B..> | 2026-04-07 09:50 | 148K | |
![[ ]](/icons/layout.gif) | 39503_John Cerosola ..> | 2026-02-02 16:48 | 148K | |
![[ ]](/icons/layout.gif) | 39631_Amikalauskas -..> | 2026-02-03 08:41 | 148K | |
![[ ]](/icons/layout.gif) | 39502_Ian Wyett - WY..> | 2026-02-02 16:45 | 148K | |
![[ ]](/icons/layout.gif) | 35525_Snart - SNAR00..> | 2026-01-21 09:09 | 148K | |
![[ ]](/icons/layout.gif) | 69278_Steve Heyes - ..> | 2026-04-23 07:42 | 148K | |
![[ ]](/icons/layout.gif) | 60683_Gary Matthews ..> | 2026-03-30 14:05 | 148K | |
![[ ]](/icons/layout.gif) | 63715_Joe Madden - M..> | 2026-04-08 14:43 | 148K | |
![[ ]](/icons/layout.gif) | 62575_Joanne Harris ..> | 2026-04-07 07:23 | 148K | |
![[ ]](/icons/layout.gif) | 40203_Pete Ormerod -..> | 2026-02-03 16:46 | 148K | |
![[ ]](/icons/layout.gif) | 56945_John Connelly ..> | 2026-03-19 13:07 | 148K | |
![[ ]](/icons/layout.gif) | 63265_Joanne Harris ..> | 2026-04-08 06:36 | 148K | |
![[ ]](/icons/layout.gif) | 62212_Joanne Harris ..> | 2026-04-02 09:25 | 148K | |
![[ ]](/icons/layout.gif) | 62797_Casian B - BCA..> | 2026-04-07 10:30 | 148K | |
![[ ]](/icons/layout.gif) | 60490_John Connelly ..> | 2026-03-30 10:12 | 148K | |
![[ ]](/icons/layout.gif) | 57506_Mike Daly - DA..> | 2026-03-20 13:46 | 148K | |
![[ ]](/icons/layout.gif) | 70256_Dipak Shah - S..> | 2026-04-24 15:24 | 148K | |
![[ ]](/icons/layout.gif) | 60448_Andy Ceely - C..> | 2026-03-30 09:08 | 148K | |
![[ ]](/icons/layout.gif) | 38690_Phillip Speakm..> | 2026-01-30 09:12 | 148K | |
![[ ]](/icons/layout.gif) | 33797_Ben Bradbury -..> | 2026-01-15 13:40 | 148K | |
![[ ]](/icons/layout.gif) | 37297_Simon Cole - C..> | 2026-01-27 08:44 | 148K | |
![[ ]](/icons/layout.gif) | 42023_Rod Gillan - G..> | 2026-02-10 08:28 | 148K | |
![[ ]](/icons/layout.gif) | 58679_Paul Bryan - B..> | 2026-03-24 14:31 | 148K | |
![[ ]](/icons/layout.gif) | 69261_Neil Wright - ..> | 2026-04-23 07:21 | 148K | |
![[ ]](/icons/layout.gif) | 46915_Mike Fox - FOX..> | 2026-02-20 16:57 | 148K | |
![[ ]](/icons/layout.gif) | 59379_Paul Bryan - B..> | 2026-03-26 09:25 | 148K | |
![[ ]](/icons/layout.gif) | 64071_Joe Madden - M..> | 2026-04-09 11:13 | 148K | |
![[ ]](/icons/layout.gif) | 36094_James Pullen -..> | 2026-01-22 12:08 | 148K | |
![[ ]](/icons/layout.gif) | 36151_James Pullen -..> | 2026-01-22 13:59 | 148K | |
![[ ]](/icons/layout.gif) | 36206_James Pullen -..> | 2026-01-22 16:13 | 148K | |
![[ ]](/icons/layout.gif) | 36215_James Pullen -..> | 2026-01-22 16:27 | 148K | |
![[ ]](/icons/layout.gif) | 68436_Tompkins - TOM..> | 2026-04-21 12:00 | 148K | |
![[ ]](/icons/layout.gif) | 35777_John Rodemark ..> | 2026-01-21 13:57 | 148K | |
![[ ]](/icons/layout.gif) | 33207_Kawa Abdullah ..> | 2026-01-14 12:37 | 148K | |
![[ ]](/icons/layout.gif) | 50840_Stephen Parry ..> | 2026-03-04 12:15 | 148K | |
![[ ]](/icons/layout.gif) | 64401_James Sephton ..> | 2026-04-10 08:26 | 148K | |
![[ ]](/icons/layout.gif) | 33209_Kawa Abdullah ..> | 2026-01-14 12:56 | 148K | |
![[ ]](/icons/layout.gif) | 53776_James Newman -..> | 2026-03-11 11:31 | 148K | |
![[ ]](/icons/layout.gif) | 37521_James Whyte - ..> | 2026-01-27 12:50 | 148K | |
![[ ]](/icons/layout.gif) | 39270_Amikalauskas -..> | 2026-02-02 13:10 | 148K | |
![[ ]](/icons/layout.gif) | 40989_Amikalauskas -..> | 2026-02-05 13:34 | 148K | |
![[ ]](/icons/layout.gif) | 48462_Nigel Chapman ..> | 2026-02-26 10:53 | 148K | |
![[ ]](/icons/layout.gif) | 54742_Andy King - KI..> | 2026-03-13 11:47 | 148K | |
![[ ]](/icons/layout.gif) | 45880_VIP Bin Cleani..> | 2026-02-19 08:07 | 148K | |
![[ ]](/icons/layout.gif) | 57121_Stuart Foster ..> | 2026-03-20 07:44 | 148K | |
![[ ]](/icons/layout.gif) | 39046_John murphy - ..> | 2026-01-30 16:17 | 148K | |
![[ ]](/icons/layout.gif) | 51772_Greg Jarka - J..> | 2026-03-06 08:14 | 148K | |
![[ ]](/icons/layout.gif) | 51824_Greg Jarka - J..> | 2026-03-06 09:04 | 148K | |
![[ ]](/icons/layout.gif) | 34764_Martin Stone -..> | 2026-01-19 14:46 | 148K | |
![[ ]](/icons/layout.gif) | 48344_Mark Budden - ..> | 2026-02-26 09:20 | 148K | |
![[ ]](/icons/layout.gif) | 49955_Joe Symons - S..> | 2026-03-02 16:17 | 148K | |
![[ ]](/icons/layout.gif) | 51418_Mark Budden - ..> | 2026-03-05 11:48 | 148K | |
![[ ]](/icons/layout.gif) | 56295_Mark Budden - ..> | 2026-03-18 11:35 | 148K | |
![[ ]](/icons/layout.gif) | 46275_Jack Scrivens ..> | 2026-02-19 16:33 | 148K | |
![[ ]](/icons/layout.gif) | 64878_Gordan Morris ..> | 2026-04-13 08:27 | 148K | |
![[ ]](/icons/layout.gif) | 67760_Paul Burns - B..> | 2026-04-20 10:44 | 148K | |
![[ ]](/icons/layout.gif) | 52486_Matt Hales - H..> | 2026-03-09 10:50 | 148K | |
![[ ]](/icons/layout.gif) | 56120_Hamada Aqlan -..> | 2026-03-17 16:56 | 148K | |
![[ ]](/icons/layout.gif) | 57832_Stephen Maguir..> | 2026-03-23 09:57 | 148K | |
![[ ]](/icons/layout.gif) | 67970_Roger Price - ..> | 2026-04-20 14:55 | 148K | |
![[ ]](/icons/layout.gif) | 42797_Bob Peer - PEE..> | 2026-02-11 15:29 | 148K | |
![[ ]](/icons/layout.gif) | 63178_Hannah Yui - Y..> | 2026-04-07 15:14 | 148K | |
![[ ]](/icons/layout.gif) | 35970_Kevin Laflin -..> | 2026-01-22 10:32 | 148K | |
![[ ]](/icons/layout.gif) | 54638_Paul Austin - ..> | 2026-03-13 09:53 | 148K | |
![[ ]](/icons/layout.gif) | 57906_Paul Austin - ..> | 2026-03-23 10:49 | 148K | |
![[ ]](/icons/layout.gif) | 41570_Richard Ashley..> | 2026-02-09 10:11 | 148K | |
![[ ]](/icons/layout.gif) | 43740_Andrew Keen - ..> | 2026-02-13 15:15 | 148K | |
![[ ]](/icons/layout.gif) | 36709_John Hooley - ..> | 2026-01-23 16:19 | 148K | |
![[ ]](/icons/layout.gif) | 55512_Mark Baker - B..> | 2026-03-16 15:30 | 148K | |
![[ ]](/icons/layout.gif) | 55833_Stephan Potter..> | 2026-03-17 13:25 | 148K | |
![[ ]](/icons/layout.gif) | 62144_Max Hewitt - H..> | 2026-04-02 08:03 | 148K | |
![[ ]](/icons/layout.gif) | 40541_Sam Sam - SAMS..> | 2026-02-04 14:29 | 148K | |
![[ ]](/icons/layout.gif) | 69517_Steve West - W..> | 2026-04-23 12:50 | 148K | |
![[ ]](/icons/layout.gif) | 66178_Stuart Badkin ..> | 2026-04-15 10:48 | 148K | |
![[ ]](/icons/layout.gif) | 68631_Stephan Potter..> | 2026-04-21 13:42 | 148K | |
![[ ]](/icons/layout.gif) | 55971_Paul Woodward ..> | 2026-03-17 15:00 | 148K | |
![[ ]](/icons/layout.gif) | 66015_Andrew Grant -..> | 2026-04-15 08:27 | 148K | |
![[ ]](/icons/layout.gif) | 69006_Stephan Potter..> | 2026-04-22 12:08 | 148K | |
![[ ]](/icons/layout.gif) | 69009_Stephan Potter..> | 2026-04-22 12:22 | 148K | |
![[ ]](/icons/layout.gif) | 62498_Mark Mayhew - ..> | 2026-04-02 14:58 | 148K | |
![[ ]](/icons/layout.gif) | 46681_Jonathan Mumfo..> | 2026-02-20 12:20 | 148K | |
![[ ]](/icons/layout.gif) | 57527_Martin Letting..> | 2026-03-20 14:15 | 148K | |
![[ ]](/icons/layout.gif) | 59339_Jacob Woodhous..> | 2026-03-26 08:46 | 148K | |
![[ ]](/icons/layout.gif) | 64063_Tyler Allen - ..> | 2026-04-09 11:01 | 148K | |
![[ ]](/icons/layout.gif) | 65051_John Sheppard ..> | 2026-04-13 10:41 | 148K | |
![[ ]](/icons/layout.gif) | 66185_Richard Clark ..> | 2026-04-15 11:02 | 148K | |
![[ ]](/icons/layout.gif) | 46960_Jonathan Mumfo..> | 2026-02-23 09:46 | 148K | |
![[ ]](/icons/layout.gif) | 57355_Andy Hobson - ..> | 2026-03-20 10:39 | 148K | |
![[ ]](/icons/layout.gif) | 34766_Martin Stone -..> | 2026-01-19 14:48 | 148K | |
![[ ]](/icons/layout.gif) | 67801_Aaron Bloomfie..> | 2026-04-20 11:51 | 148K | |
![[ ]](/icons/layout.gif) | 69398_Paul Shelton -..> | 2026-04-23 10:11 | 148K | |
![[ ]](/icons/layout.gif) | 45582_Derek Hutchins..> | 2026-02-18 12:00 | 148K | |
![[ ]](/icons/layout.gif) | 34220_Peter Lewis - ..> | 2026-01-16 10:27 | 148K | |
![[ ]](/icons/layout.gif) | 67739_John Lewis - L..> | 2026-04-20 10:13 | 148K | |
![[ ]](/icons/layout.gif) | 70004_Leighton Ross ..> | 2026-04-24 11:08 | 148K | |
![[ ]](/icons/layout.gif) | 59796_James Fairbair..> | 2026-03-26 15:56 | 148K | |
![[ ]](/icons/layout.gif) | 70016_Leighton Ross ..> | 2026-04-24 11:29 | 148K | |
![[ ]](/icons/layout.gif) | 66019_Andrew Grant -..> | 2026-04-15 08:30 | 148K | |
![[ ]](/icons/layout.gif) | 67679_Lewis Pearce -..> | 2026-04-20 09:49 | 148K | |
![[ ]](/icons/layout.gif) | 64519_Mark Bowater -..> | 2026-04-10 11:57 | 148K | |
![[ ]](/icons/layout.gif) | 67982_Lewis Pearce -..> | 2026-04-20 15:04 | 148K | |
![[ ]](/icons/layout.gif) | 68538_Paul Cooper - ..> | 2026-04-21 13:15 | 148K | |
![[ ]](/icons/layout.gif) | 47140_Asa Herbert - ..> | 2026-02-23 14:23 | 148K | |
![[ ]](/icons/layout.gif) | 47823_David Neale - ..> | 2026-02-24 16:16 | 148K | |
![[ ]](/icons/layout.gif) | 55034_Jack Jones - R..> | 2026-03-13 16:20 | 148K | |
![[ ]](/icons/layout.gif) | 59296_Albert - ALBE0..> | 2026-03-25 16:05 | 148K | |
![[ ]](/icons/layout.gif) | 68008_Steven Barnsle..> | 2026-04-20 15:19 | 148K | |
![[ ]](/icons/layout.gif) | 51320_Richard Smee -..> | 2026-03-05 10:13 | 148K | |
![[ ]](/icons/layout.gif) | 64844_DT Services Lt..> | 2026-04-13 07:54 | 148K | |
![[ ]](/icons/layout.gif) | 63247_Sam Cowling - ..> | 2026-04-07 15:50 | 148K | |
![[ ]](/icons/layout.gif) | 50043_Neil Bush - Ne..> | 2026-03-03 08:36 | 148K | |
![[ ]](/icons/layout.gif) | 66390_Eduardo Pestan..> | 2026-04-15 16:05 | 148K | |
![[ ]](/icons/layout.gif) | 67824_Aaron Bloomfie..> | 2026-04-20 12:34 | 148K | |
![[ ]](/icons/layout.gif) | 68049_Sam Cowling - ..> | 2026-04-21 06:58 | 148K | |
![[ ]](/icons/layout.gif) | 49971_Ron Foster - F..> | 2026-03-02 16:26 | 148K | |
![[ ]](/icons/layout.gif) | 34790_Daniel Forsdik..> | 2026-01-19 15:34 | 148K | |
![[ ]](/icons/layout.gif) | 58708_Stewart Pearso..> | 2026-03-24 14:54 | 148K | |
![[ ]](/icons/layout.gif) | 63537_Adam Couzens -..> | 2026-04-08 11:17 | 148K | |
![[ ]](/icons/layout.gif) | 64659_Derek Jardine ..> | 2026-04-10 13:22 | 148K | |
![[ ]](/icons/layout.gif) | 66090_Robert Tricket..> | 2026-04-15 09:41 | 148K | |
![[ ]](/icons/layout.gif) | 57005_James Bolsolve..> | 2026-03-19 14:30 | 148K | |
![[ ]](/icons/layout.gif) | 69082_Luke Haddy - H..> | 2026-04-22 13:22 | 148K | |
![[ ]](/icons/layout.gif) | 42576_Nick Staley - ..> | 2026-02-11 10:09 | 148K | |
![[ ]](/icons/layout.gif) | 42588_Nick Staley - ..> | 2026-02-11 10:30 | 148K | |
![[ ]](/icons/layout.gif) | 39324_William Simmon..> | 2026-02-02 14:10 | 148K | |
![[ ]](/icons/layout.gif) | 63460_Josh Ward - WA..> | 2026-04-08 09:53 | 148K | |
![[ ]](/icons/layout.gif) | 61989_Grant Millar -..> | 2026-04-01 14:07 | 148K | |
![[ ]](/icons/layout.gif) | 63687_Adam Couzens -..> | 2026-04-08 14:17 | 148K | |
![[ ]](/icons/layout.gif) | 63551_Josh Ward - WA..> | 2026-04-08 11:55 | 148K | |
![[ ]](/icons/layout.gif) | 64215_Blackhawk Secu..> | 2026-04-09 15:24 | 148K | |
![[ ]](/icons/layout.gif) | 66381_Eduardo Pestan..> | 2026-04-15 15:36 | 148K | |
![[ ]](/icons/layout.gif) | 36714_John Hooley - ..> | 2026-01-23 16:32 | 148K | |
![[ ]](/icons/layout.gif) | 70257_Dipak Shah - S..> | 2026-04-24 15:26 | 148K | |
![[ ]](/icons/layout.gif) | 69518_Electratech So..> | 2026-04-23 12:53 | 148K | |
![[ ]](/icons/layout.gif) | 66293_John Walsh - R..> | 2026-04-15 13:16 | 148K | |
![[ ]](/icons/layout.gif) | 41330_Uk Car Panels ..> | 2026-02-06 11:25 | 148K | |
![[ ]](/icons/layout.gif) | 55035_Jack Jones - R..> | 2026-03-13 16:22 | 148K | |
![[ ]](/icons/layout.gif) | 38918_Custom Timber ..> | 2026-01-30 13:10 | 148K | |
![[ ]](/icons/layout.gif) | 65183_Anson Moniz - ..> | 2026-04-13 13:09 | 148K | |
![[ ]](/icons/layout.gif) | 50290_Tim Burton - B..> | 2026-03-03 12:57 | 148K | |
![[ ]](/icons/layout.gif) | 52876_Stephen Shaw -..> | 2026-03-09 16:39 | 148K | |
![[ ]](/icons/layout.gif) | 69519_Electratech So..> | 2026-04-23 12:55 | 148K | |
![[ ]](/icons/layout.gif) | 49263_Stuart Ladbroo..> | 2026-02-27 15:58 | 148K | |
![[ ]](/icons/layout.gif) | 59574_Jacob Woodhous..> | 2026-03-26 11:33 | 148K | |
![[ ]](/icons/layout.gif) | 59651_Jacob Woodhous..> | 2026-03-26 13:23 | 148K | |
![[ ]](/icons/layout.gif) | 60178_DTM Carpenters..> | 2026-03-27 13:06 | 148K | |
![[ ]](/icons/layout.gif) | 29497_Jamie Stubbs -..> | 2025-12-31 12:35 | 148K | |
![[ ]](/icons/layout.gif) | 50898_Stuart Burch -..> | 2026-03-04 13:29 | 148K | |
![[ ]](/icons/layout.gif) | 59521_Jacob Woodhous..> | 2026-03-26 10:53 | 148K | |
![[ ]](/icons/layout.gif) | 44292_John Stelmasia..> | 2026-02-16 15:24 | 148K | |
![[ ]](/icons/layout.gif) | 48129_Urban Installa..> | 2026-02-25 12:07 | 148K | |
![[ ]](/icons/layout.gif) | 43988_Stephen Price ..> | 2026-02-16 10:33 | 148K | |
![[ ]](/icons/layout.gif) | 69631_Steve Sage - S..> | 2026-04-23 14:59 | 148K | |
![[ ]](/icons/layout.gif) | 44020_Stephen Price ..> | 2026-02-16 10:50 | 148K | |
![[ ]](/icons/layout.gif) | 59380_Paul Bryan - B..> | 2026-03-26 09:26 | 148K | |
![[ ]](/icons/layout.gif) | 60851_Lucia Hudova -..> | 2026-03-30 15:27 | 148K | |
![[ ]](/icons/layout.gif) | 64073_Joe Madden - M..> | 2026-04-09 11:19 | 148K | |
![[ ]](/icons/layout.gif) | 60556_Barry Wilson -..> | 2026-03-30 11:56 | 148K | |
![[ ]](/icons/layout.gif) | 46690_Gary Linney - ..> | 2026-02-20 12:44 | 148K | |
![[ ]](/icons/layout.gif) | 45851_Brown - BROW00..> | 2026-02-18 16:16 | 148K | |
![[ ]](/icons/layout.gif) | 44655_Gary Linney - ..> | 2026-02-17 09:43 | 148K | |
![[ ]](/icons/layout.gif) | 46689_Gary Linney - ..> | 2026-02-20 12:41 | 148K | |
![[ ]](/icons/layout.gif) | 56487_STORME CrossFi..> | 2026-03-18 14:22 | 148K | |
![[ ]](/icons/layout.gif) | 38917_Custom Timber ..> | 2026-01-30 13:09 | 148K | |
![[ ]](/icons/layout.gif) | 47161_Tom Morris - $..> | 2026-02-23 15:05 | 148K | |
![[ ]](/icons/layout.gif) | 53037_Gary Burrell -..> | 2026-03-10 09:21 | 148K | |
![[ ]](/icons/layout.gif) | 67648_John Barker - ..> | 2026-04-20 09:25 | 148K | |
![[ ]](/icons/layout.gif) | 48346_Mark Budden - ..> | 2026-02-26 09:24 | 148K | |
![[ ]](/icons/layout.gif) | 36063_James Whyte - ..> | 2026-01-22 11:36 | 148K | |
![[ ]](/icons/layout.gif) | 44654_Jack Taylor - ..> | 2026-02-17 09:43 | 148K | |
![[ ]](/icons/layout.gif) | 57876_Terry Welsh - ..> | 2026-03-23 10:33 | 148K | |
![[ ]](/icons/layout.gif) | 67966_John Barker - ..> | 2026-04-20 14:53 | 148K | |
![[ ]](/icons/layout.gif) | 68439_John Barker - ..> | 2026-04-21 12:06 | 148K | |
![[ ]](/icons/layout.gif) | 45029_M Bonner - BON..> | 2026-02-17 15:23 | 148K | |
![[ ]](/icons/layout.gif) | 58445_Kyle Barrowcli..> | 2026-03-24 10:29 | 148K | |
![[ ]](/icons/layout.gif) | 36066_James Whyte - ..> | 2026-01-22 11:38 | 148K | |
![[ ]](/icons/layout.gif) | 58493_Kyle Barrowcli..> | 2026-03-24 11:23 | 148K | |
![[ ]](/icons/layout.gif) | 39630_Derek Macdonal..> | 2026-02-03 08:41 | 148K | |
![[ ]](/icons/layout.gif) | 39509_John Cerosola ..> | 2026-02-02 16:53 | 148K | |
![[ ]](/icons/layout.gif) | 55913_Lee Masters - ..> | 2026-03-17 14:37 | 148K | |
![[ ]](/icons/layout.gif) | 58822_Andy Towser - ..> | 2026-03-24 16:33 | 148K | |
![[ ]](/icons/layout.gif) | 33346_Graham Mills -..> | 2026-01-14 15:14 | 148K | |
![[ ]](/icons/layout.gif) | 59841_Len Fletcher -..> | 2026-03-26 16:50 | 148K | |
![[ ]](/icons/layout.gif) | 29656_Jamie Stubbs -..> | 2026-01-02 09:07 | 148K | |
![[ ]](/icons/layout.gif) | 61582_Ionut Sanducu ..> | 2026-04-01 07:07 | 148K | |
![[ ]](/icons/layout.gif) | 35147_M D J Develope..> | 2026-01-20 12:10 | 148K | |
![[ ]](/icons/layout.gif) | 41122_James Hinton -..> | 2026-02-06 07:27 | 148K | |
![[ ]](/icons/layout.gif) | 43509_Keith Pearson ..> | 2026-02-13 09:38 | 148K | |
![[ ]](/icons/layout.gif) | 29884_Jamie Stubbs -..> | 2026-01-02 15:25 | 148K | |
![[ ]](/icons/layout.gif) | 51451_Stephen Edward..> | 2026-03-05 12:25 | 148K | |
![[ ]](/icons/layout.gif) | 67234_Tim Bassett - ..> | 2026-04-17 12:19 | 148K | |
![[ ]](/icons/layout.gif) | 35981_Joe Barker - B..> | 2026-01-22 10:47 | 148K | |
![[ ]](/icons/layout.gif) | 62226_Hannah Beats -..> | 2026-04-02 09:44 | 148K | |
![[ ]](/icons/layout.gif) | 64705_Joe Madden - M..> | 2026-04-10 14:17 | 148K | |
![[ ]](/icons/layout.gif) | 48081_John Pallot - ..> | 2026-02-25 11:01 | 148K | |
![[ ]](/icons/layout.gif) | 40211_Pete Ormerod -..> | 2026-02-03 16:51 | 148K | |
![[ ]](/icons/layout.gif) | 35703_Stuart Biggs -..> | 2026-01-21 12:59 | 148K | |
![[ ]](/icons/layout.gif) | 66163_John Sheppard ..> | 2026-04-15 10:08 | 148K | |
![[ ]](/icons/layout.gif) | 41671_Gary Dingwall ..> | 2026-02-09 12:16 | 148K | |
![[ ]](/icons/layout.gif) | 63754_Ian Smith - SM..> | 2026-04-08 15:20 | 148K | |
![[ ]](/icons/layout.gif) | 40885_Dennis Millier..> | 2026-02-05 11:01 | 148K | |
![[ ]](/icons/layout.gif) | 44444_Lewis Taylor -..> | 2026-02-17 08:08 | 148K | |
![[ ]](/icons/layout.gif) | 63710_Matthew Law - ..> | 2026-04-08 14:40 | 148K | |
![[ ]](/icons/layout.gif) | 41478_Ffruythau Penc..> | 2026-02-06 16:32 | 148K | |
![[ ]](/icons/layout.gif) | 47444_Alex Ford - FO..> | 2026-02-24 09:24 | 148K | |
![[ ]](/icons/layout.gif) | 51475_Tom Morris - M..> | 2026-03-05 13:23 | 148K | |
![[ ]](/icons/layout.gif) | 46828_Gordon Kerr - ..> | 2026-02-20 14:38 | 148K | |
![[ ]](/icons/layout.gif) | 65590_Lee Tigwell - ..> | 2026-04-14 12:11 | 148K | |
![[ ]](/icons/layout.gif) | 61538_John Connelly ..> | 2026-03-31 15:57 | 148K | |
![[ ]](/icons/layout.gif) | 53679_David Pearson ..> | 2026-03-11 09:35 | 148K | |
![[ ]](/icons/layout.gif) | 48301_John Pallot - ..> | 2026-02-26 08:35 | 148K | |
![[ ]](/icons/layout.gif) | 65071_Joanne Harris ..> | 2026-04-13 11:10 | 148K | |
![[ ]](/icons/layout.gif) | 35603_Paul Birnie - ..> | 2026-01-21 11:15 | 148K | |
![[ ]](/icons/layout.gif) | 53071_Neil Pothecary..> | 2026-03-10 09:34 | 148K | |
![[ ]](/icons/layout.gif) | 33182_A Miles Buildi..> | 2026-01-14 11:41 | 148K | |
![[ ]](/icons/layout.gif) | 40099_James Morton -..> | 2026-02-03 15:42 | 148K | |
![[ ]](/icons/layout.gif) | 41858_Richard Ashley..> | 2026-02-09 15:55 | 148K | |
![[ ]](/icons/layout.gif) | 46894_Josh West - WE..> | 2026-02-20 15:58 | 148K | |
![[ ]](/icons/layout.gif) | 66889_John Summerfie..> | 2026-04-16 15:38 | 148K | |
![[ ]](/icons/layout.gif) | 41695_Harriet Beck -..> | 2026-02-09 13:11 | 148K | |
![[ ]](/icons/layout.gif) | 43973_The Paul Barke..> | 2026-02-16 10:11 | 148K | |
![[ ]](/icons/layout.gif) | 55017_Andy King - KI..> | 2026-03-13 15:54 | 148K | |
![[ ]](/icons/layout.gif) | 60362_Paul Bryan - B..> | 2026-03-30 07:31 | 148K | |
![[ ]](/icons/layout.gif) | 47807_Adi Smith - SM..> | 2026-02-24 16:12 | 148K | |
![[ ]](/icons/layout.gif) | 52870_Terry Hallett ..> | 2026-03-09 16:28 | 148K | |
![[ ]](/icons/layout.gif) | 60843_James Fairbair..> | 2026-03-30 15:24 | 148K | |
![[ ]](/icons/layout.gif) | 47655_Keith - Keith ..> | 2026-02-24 12:31 | 148K | |
![[ ]](/icons/layout.gif) | 55864_Christopher Ha..> | 2026-03-17 13:59 | 148K | |
![[ ]](/icons/layout.gif) | 59959_Neil Porteous ..> | 2026-03-27 09:25 | 148K | |
![[ ]](/icons/layout.gif) | 51321_Richard Smee -..> | 2026-03-05 10:13 | 148K | |
![[ ]](/icons/layout.gif) | 64754_Karl Southern ..> | 2026-04-10 15:35 | 148K | |
![[ ]](/icons/layout.gif) | 67839_Billy Cook - C..> | 2026-04-20 13:01 | 148K | |
![[ ]](/icons/layout.gif) | 36205_James Pullen -..> | 2026-01-22 16:13 | 148K | |
![[ ]](/icons/layout.gif) | 68196_Aaran Trew - T..> | 2026-04-21 08:27 | 148K | |
![[ ]](/icons/layout.gif) | 60640_Mark Budden - ..> | 2026-03-30 13:25 | 148K | |
![[ ]](/icons/layout.gif) | 49221_Mike Fox - FOX..> | 2026-02-27 15:09 | 148K | |
![[ ]](/icons/layout.gif) | 57255_Mark Ellis - E..> | 2026-03-20 09:34 | 148K | |
![[ ]](/icons/layout.gif) | 64715_R And R Servic..> | 2026-04-10 14:29 | 148K | |
![[ ]](/icons/layout.gif) | 58153_Nick Plumb - O..> | 2026-03-23 15:07 | 148K | |
![[ ]](/icons/layout.gif) | 59213_ANDREW WALKER ..> | 2026-03-25 13:50 | 148K | |
![[ ]](/icons/layout.gif) | 61775_Marc Sutton - ..> | 2026-04-01 10:15 | 148K | |
![[ ]](/icons/layout.gif) | 68420_Aaran Trew - T..> | 2026-04-21 11:29 | 148K | |
![[ ]](/icons/layout.gif) | 68422_Aaran Trew - T..> | 2026-04-21 11:35 | 148K | |
![[ ]](/icons/layout.gif) | 39521_John Cerosola ..> | 2026-02-03 07:37 | 148K | |
![[ ]](/icons/layout.gif) | 56572_Lee Masters - ..> | 2026-03-18 16:02 | 148K | |
![[ ]](/icons/layout.gif) | 67888_Paul Farrelly ..> | 2026-04-20 13:51 | 148K | |
![[ ]](/icons/layout.gif) | 58180_Paul Austin - ..> | 2026-03-23 15:47 | 148K | |
![[ ]](/icons/layout.gif) | 62580_Max Hewitt - H..> | 2026-04-07 07:35 | 148K | |
![[ ]](/icons/layout.gif) | 67242_Ryan Baxter - ..> | 2026-04-17 12:23 | 148K | |
![[ ]](/icons/layout.gif) | 67903_George Berridg..> | 2026-04-20 14:01 | 148K | |
![[ ]](/icons/layout.gif) | 68971_Alan Bryant - ..> | 2026-04-22 11:16 | 148K | |
![[ ]](/icons/layout.gif) | 68973_Alan Bryant - ..> | 2026-04-22 11:17 | 148K | |
![[ ]](/icons/layout.gif) | 58232_Paul Petrie - ..> | 2026-03-23 16:54 | 148K | |
![[ ]](/icons/layout.gif) | 60938_Mark Baker - B..> | 2026-03-31 08:10 | 148K | |
![[ ]](/icons/layout.gif) | 61561_Mark Baker - B..> | 2026-04-01 06:29 | 148K | |
![[ ]](/icons/layout.gif) | 62393_Mark Mayhew - ..> | 2026-04-02 13:12 | 148K | |
![[ ]](/icons/layout.gif) | 63171_Mark Mayhew - ..> | 2026-04-07 15:01 | 148K | |
![[ ]](/icons/layout.gif) | 49367_Miriam Miriam ..> | 2026-03-02 08:40 | 148K | |
![[ ]](/icons/layout.gif) | 51686_Andy Page - An..> | 2026-03-05 16:53 | 148K | |
![[ ]](/icons/layout.gif) | 56568_Hamada Aqlan -..> | 2026-03-18 15:59 | 148K | |
![[ ]](/icons/layout.gif) | 64200_Gary Thom - TH..> | 2026-04-09 15:14 | 148K | |
![[ ]](/icons/layout.gif) | 64203_Gary Thom - TH..> | 2026-04-09 15:16 | 148K | |
![[ ]](/icons/layout.gif) | 52117_Mark Ellis - E..> | 2026-03-06 13:44 | 148K | |
![[ ]](/icons/layout.gif) | 43857_Keith Northeas..> | 2026-02-16 09:25 | 148K | |
![[ ]](/icons/layout.gif) | 69531_Steve West - W..> | 2026-04-23 13:04 | 148K | |
![[ ]](/icons/layout.gif) | 37356_Joe Barker - B..> | 2026-01-27 09:57 | 148K | |
![[ ]](/icons/layout.gif) | 42532_Sam Murrie - M..> | 2026-02-11 09:39 | 148K | |
![[ ]](/icons/layout.gif) | 62246_Hannah Beats -..> | 2026-04-02 10:02 | 148K | |
![[ ]](/icons/layout.gif) | 63180_John Robson - ..> | 2026-04-07 15:15 | 148K | |
![[ ]](/icons/layout.gif) | 44913_Shaw - SHAW000..> | 2026-02-17 13:30 | 148K | |
![[ ]](/icons/layout.gif) | 49994_Harry Smith - ..> | 2026-03-02 16:55 | 148K | |
![[ ]](/icons/layout.gif) | 52717_Clint Davies -..> | 2026-03-09 14:35 | 148K | |
![[ ]](/icons/layout.gif) | 33335_James Austin -..> | 2026-01-14 15:00 | 148K | |
![[ ]](/icons/layout.gif) | 33778_David Jenkinso..> | 2026-01-15 12:56 | 148K | |
![[ ]](/icons/layout.gif) | 40218_Craig Reid - R..> | 2026-02-03 17:02 | 148K | |
![[ ]](/icons/layout.gif) | 41539_Harriet Beck -..> | 2026-02-09 09:18 | 148K | |
![[ ]](/icons/layout.gif) | 58191_Clive Bailey -..> | 2026-03-23 16:07 | 148K | |
![[ ]](/icons/layout.gif) | 64208_Ian Smith - SM..> | 2026-04-09 15:18 | 148K | |
![[ ]](/icons/layout.gif) | 59236_Bill Mitchell ..> | 2026-03-25 14:28 | 148K | |
![[ ]](/icons/layout.gif) | 67858_Alyn Udy - UDY..> | 2026-04-20 13:19 | 148K | |
![[ ]](/icons/layout.gif) | 53667_Bradley Sincla..> | 2026-03-11 09:21 | 148K | |
![[ ]](/icons/layout.gif) | 64220_Tyler Allen - ..> | 2026-04-09 15:28 | 148K | |
![[ ]](/icons/layout.gif) | 35339_Bone - BONE000..> | 2026-01-20 15:30 | 148K | |
![[ ]](/icons/layout.gif) | 37157_Gary Mead - ME..> | 2026-01-26 15:18 | 148K | |
![[ ]](/icons/layout.gif) | 50206_George Baker -..> | 2026-03-03 11:17 | 148K | |
![[ ]](/icons/layout.gif) | 58872_Matthew Collin..> | 2026-03-25 08:34 | 148K | |
![[ ]](/icons/layout.gif) | 34163_Dave Crabtree ..> | 2026-01-16 09:23 | 148K | |
![[ ]](/icons/layout.gif) | 40205_Craig Reid - R..> | 2026-02-03 16:48 | 148K | |
![[ ]](/icons/layout.gif) | 49295_Michael Toon -..> | 2026-02-27 16:40 | 148K | |
![[ ]](/icons/layout.gif) | 67962_Joe Senior - S..> | 2026-04-20 14:49 | 148K | |
![[ ]](/icons/layout.gif) | 35834_Ian Frazer - K..> | 2026-01-21 15:46 | 148K | |
![[ ]](/icons/layout.gif) | 36684_Gary Mead - ME..> | 2026-01-23 15:43 | 148K | |
![[ ]](/icons/layout.gif) | 56153_Payne - PAYN00..> | 2026-03-18 08:42 | 148K | |
![[ ]](/icons/layout.gif) | 58578_John Gibb - GI..> | 2026-03-24 13:41 | 148K | |
![[ ]](/icons/layout.gif) | 69339_Collin Pickeri..> | 2026-04-23 08:25 | 148K | |
![[ ]](/icons/layout.gif) | 69346_Collin Pickeri..> | 2026-04-23 08:38 | 148K | |
![[ ]](/icons/layout.gif) | 41562_Jon Durrant - ..> | 2026-02-09 09:52 | 148K | |
![[ ]](/icons/layout.gif) | 66491_Richard Clark ..> | 2026-04-16 08:17 | 148K | |
![[ ]](/icons/layout.gif) | 66492_Richard Clark ..> | 2026-04-16 08:17 | 148K | |
![[ ]](/icons/layout.gif) | 38834_A Long - Monty..> | 2026-01-30 10:52 | 148K | |
![[ ]](/icons/layout.gif) | 41089_James Morton -..> | 2026-02-05 15:56 | 148K | |
![[ ]](/icons/layout.gif) | 69141_Eco EnerG Solu..> | 2026-04-22 14:37 | 148K | |
![[ ]](/icons/layout.gif) | 33598_Dave Crabtree ..> | 2026-01-15 09:56 | 148K | |
![[ ]](/icons/layout.gif) | 52851_Argo Gauld - G..> | 2026-03-09 16:14 | 148K | |
![[ ]](/icons/layout.gif) | 53322_Terry Hallett ..> | 2026-03-10 13:54 | 148K | |
![[ ]](/icons/layout.gif) | 69157_Sarah Lolley -..> | 2026-04-22 15:10 | 148K | |
![[ ]](/icons/layout.gif) | 69160_Sarah Lolley -..> | 2026-04-22 15:13 | 148K | |
![[ ]](/icons/layout.gif) | 55501_Ben Sparrow - ..> | 2026-03-16 14:57 | 148K | |
![[ ]](/icons/layout.gif) | 66988_Pete Butcher -..> | 2026-04-17 08:56 | 148K | |
![[ ]](/icons/layout.gif) | 67323_Mike Fox - Owe..> | 2026-04-17 13:33 | 148K | |
![[ ]](/icons/layout.gif) | 41179_Adrian Hollowa..> | 2026-02-06 08:15 | 148K | |
![[ ]](/icons/layout.gif) | 46259_Jacob Burton -..> | 2026-02-19 16:03 | 148K | |
![[ ]](/icons/layout.gif) | 35379_Julie Wrigth -..> | 2026-01-20 16:11 | 148K | |
![[ ]](/icons/layout.gif) | 45735_Derek Hutchins..> | 2026-02-18 14:27 | 148K | |
![[ ]](/icons/layout.gif) | 50918_Patrick Crossl..> | 2026-03-04 14:00 | 148K | |
![[ ]](/icons/layout.gif) | 60482_Pmd LTD - PMDL..> | 2026-03-30 10:03 | 148K | |
![[ ]](/icons/layout.gif) | 67844_Chris Ball - B..> | 2026-04-20 13:07 | 148K | |
![[ ]](/icons/layout.gif) | 55043_Simon Marshall..> | 2026-03-13 16:49 | 148K | |
![[ ]](/icons/layout.gif) | 33507_Tommy - Tommym..> | 2026-01-15 08:47 | 148K | |
![[ ]](/icons/layout.gif) | 51472_Wayne Mitchell..> | 2026-03-05 13:18 | 148K | |
![[ ]](/icons/layout.gif) | 55286_Simon Marshall..> | 2026-03-16 12:37 | 148K | |
![[ ]](/icons/layout.gif) | 69408_Paul Shelton -..> | 2026-04-23 10:28 | 148K | |
![[ ]](/icons/layout.gif) | 37392_Gary Mead - ME..> | 2026-01-27 10:48 | 148K | |
![[ ]](/icons/layout.gif) | 38629_John Rodemark ..> | 2026-01-30 07:35 | 148K | |
![[ ]](/icons/layout.gif) | 50907_Kevin Hill - H..> | 2026-03-04 13:45 | 148K | |
![[ ]](/icons/layout.gif) | 50908_Kevin Hill - H..> | 2026-03-04 13:45 | 148K | |
![[ ]](/icons/layout.gif) | 65614_Jonathan Isaac..> | 2026-04-14 12:22 | 148K | |
![[ ]](/icons/layout.gif) | 65674_David Bruntnel..> | 2026-04-14 12:43 | 148K | |
![[ ]](/icons/layout.gif) | 65860_David Bruntnel..> | 2026-04-14 15:11 | 148K | |
![[ ]](/icons/layout.gif) | 65861_David Bruntnel..> | 2026-04-14 15:12 | 148K | |
![[ ]](/icons/layout.gif) | 41072_Aurimas Mikala..> | 2026-02-05 15:36 | 148K | |
![[ ]](/icons/layout.gif) | 42825_Bob Peer - PEE..> | 2026-02-11 16:19 | 148K | |
![[ ]](/icons/layout.gif) | 43752_Bob Peer - PEE..> | 2026-02-13 16:01 | 148K | |
![[ ]](/icons/layout.gif) | 52000_Saul Pochin - ..> | 2026-03-06 11:36 | 148K | |
![[ ]](/icons/layout.gif) | 52009_Greg Jarka - J..> | 2026-03-06 11:40 | 148K | |
![[ ]](/icons/layout.gif) | 33214_Kawa Abdullah ..> | 2026-01-14 13:02 | 148K | |
![[ ]](/icons/layout.gif) | 41237_Tim Palmer - W..> | 2026-02-06 09:55 | 148K | |
![[ ]](/icons/layout.gif) | 41506_Paul Mooney - ..> | 2026-02-09 08:29 | 148K | |
![[ ]](/icons/layout.gif) | 67776_Stephen Elliso..> | 2026-04-20 11:01 | 148K | |
![[ ]](/icons/layout.gif) | 33841_Marc Nebbett -..> | 2026-01-15 14:28 | 148K | |
![[ ]](/icons/layout.gif) | 37382_A Long - Monty..> | 2026-01-27 10:29 | 148K | |
![[ ]](/icons/layout.gif) | 56923_Paul Hazel - H..> | 2026-03-19 12:11 | 148K | |
![[ ]](/icons/layout.gif) | 67329_Carl O'grady -..> | 2026-04-17 13:35 | 148K | |
![[ ]](/icons/layout.gif) | 68215_Steven Barbsle..> | 2026-04-21 08:33 | 148K | |
![[ ]](/icons/layout.gif) | 68433_Aaran Trew - T..> | 2026-04-21 11:53 | 148K | |
![[ ]](/icons/layout.gif) | 64745_Stuart Merrima..> | 2026-04-10 15:25 | 148K | |
![[ ]](/icons/layout.gif) | 66444_Ross Mcconvill..> | 2026-04-16 07:27 | 148K | |
![[ ]](/icons/layout.gif) | 52828_Andrew Woolsto..> | 2026-03-09 15:44 | 148K | |
![[ ]](/icons/layout.gif) | 57469_Jackie Tinknel..> | 2026-03-20 12:44 | 148K | |
![[ ]](/icons/layout.gif) | 67921_Aaron Bloomfie..> | 2026-04-20 14:20 | 148K | |
![[ ]](/icons/layout.gif) | 43977_Myles Reuben -..> | 2026-02-16 10:13 | 148K | |
![[ ]](/icons/layout.gif) | 44190_Myles Reuben -..> | 2026-02-16 13:50 | 148K | |
![[ ]](/icons/layout.gif) | 52935_Cameron Ridler..> | 2026-03-10 07:44 | 148K | |
![[ ]](/icons/layout.gif) | 67740_Neil Hanafin -..> | 2026-04-20 10:13 | 148K | |
![[ ]](/icons/layout.gif) | 57097_Paul Hazell - ..> | 2026-03-19 16:44 | 148K | |
![[ ]](/icons/layout.gif) | 57328_Paul Hazell - ..> | 2026-03-20 10:06 | 148K | |
![[ ]](/icons/layout.gif) | 64670_Danny Carter -..> | 2026-04-10 13:26 | 148K | |
![[ ]](/icons/layout.gif) | 53484_Andy Page - An..> | 2026-03-10 16:22 | 148K | |
![[ ]](/icons/layout.gif) | 35353_Toby McNally -..> | 2026-01-20 15:48 | 148K | |
![[ ]](/icons/layout.gif) | 47226_Asa Herbert - ..> | 2026-02-23 15:52 | 148K | |
![[ ]](/icons/layout.gif) | 53150_Richard Davies..> | 2026-03-10 11:05 | 148K | |
![[ ]](/icons/layout.gif) | 41217_John Rodemark ..> | 2026-02-06 09:08 | 148K | |
![[ ]](/icons/layout.gif) | 43866_Keith Northeas..> | 2026-02-16 09:29 | 148K | |
![[ ]](/icons/layout.gif) | 44217_Matthew Place ..> | 2026-02-16 14:15 | 148K | |
![[ ]](/icons/layout.gif) | 44376_Paul Collins -..> | 2026-02-16 16:34 | 148K | |
![[ ]](/icons/layout.gif) | 44920_Keith Northeas..> | 2026-02-17 13:38 | 148K | |
![[ ]](/icons/layout.gif) | 45890_Keith Northeas..> | 2026-02-19 08:24 | 148K | |
![[ ]](/icons/layout.gif) | 64524_Danny Carter -..> | 2026-04-10 11:58 | 148K | |
![[ ]](/icons/layout.gif) | 65347_Steve Binns - ..> | 2026-04-14 07:43 | 148K | |
![[ ]](/icons/layout.gif) | 68853_Stuart Badkin ..> | 2026-04-22 08:48 | 148K | |
![[ ]](/icons/layout.gif) | 53934_Clint Davies -..> | 2026-03-11 15:23 | 148K | |
![[ ]](/icons/layout.gif) | 53943_Clint Davies -..> | 2026-03-11 15:38 | 148K | |
![[ ]](/icons/layout.gif) | 53944_Clint Davies -..> | 2026-03-11 15:38 | 148K | |
![[ ]](/icons/layout.gif) | 61163_Michael Penman..> | 2026-03-31 11:00 | 148K | |
![[ ]](/icons/layout.gif) | 66505_Jack Groom - G..> | 2026-04-16 08:36 | 148K | |
![[ ]](/icons/layout.gif) | 34208_James Austin -..> | 2026-01-16 10:04 | 148K | |
![[ ]](/icons/layout.gif) | 66224_Harold Blades ..> | 2026-04-15 11:42 | 148K | |
![[ ]](/icons/layout.gif) | 35103_Paul Wise - WI..> | 2026-01-20 11:25 | 148K | |
![[ ]](/icons/layout.gif) | 47151_Sara Colton - ..> | 2026-02-23 14:49 | 148K | |
![[ ]](/icons/layout.gif) | 50967_D Smith - SMIT..> | 2026-03-04 15:27 | 148K | |
![[ ]](/icons/layout.gif) | 57021_Paul Collins -..> | 2026-03-19 14:50 | 148K | |
![[ ]](/icons/layout.gif) | 68048_Paul Burns - B..> | 2026-04-21 06:41 | 148K | |
![[ ]](/icons/layout.gif) | 65006_Derek Jardine ..> | 2026-04-13 09:57 | 148K | |
![[ ]](/icons/layout.gif) | 67384_Claire Poxon -..> | 2026-04-17 14:51 | 148K | |
![[ ]](/icons/layout.gif) | 34871_Julian Hughes ..> | 2026-01-19 17:06 | 148K | |
![[ ]](/icons/layout.gif) | 46974_Anthony Bendon..> | 2026-02-23 09:56 | 148K | |
![[ ]](/icons/layout.gif) | 70216_Collin Pickeri..> | 2026-04-24 14:52 | 148K | |
![[ ]](/icons/layout.gif) | 37150_Ian Fraser - K..> | 2026-01-26 15:14 | 148K | |
![[ ]](/icons/layout.gif) | 59385_Martin Letting..> | 2026-03-26 09:35 | 148K | |
![[ ]](/icons/layout.gif) | 63774_Jonathon Gardn..> | 2026-04-08 15:44 | 148K | |
![[ ]](/icons/layout.gif) | 69126_Stephan Potter..> | 2026-04-22 14:30 | 148K | |
![[ ]](/icons/layout.gif) | 35075_Julian Hughes ..> | 2026-01-20 10:56 | 148K | |
![[ ]](/icons/layout.gif) | 35188_Julian Hughes ..> | 2026-01-20 13:56 | 148K | |
![[ ]](/icons/layout.gif) | 42271_Jon Durrant - ..> | 2026-02-10 12:36 | 148K | |
![[ ]](/icons/layout.gif) | 42733_Stuart Morgan ..> | 2026-02-11 13:12 | 148K | |
![[ ]](/icons/layout.gif) | 42861_Stuart Morgan ..> | 2026-02-12 08:07 | 148K | |
![[ ]](/icons/layout.gif) | 42868_Stuart Morgan ..> | 2026-02-12 08:15 | 148K | |
![[ ]](/icons/layout.gif) | 43000_Stuart Morgan ..> | 2026-02-12 11:14 | 148K | |
![[ ]](/icons/layout.gif) | 36539_Ian Fraser - K..> | 2026-01-23 12:43 | 148K | |
![[ ]](/icons/layout.gif) | 42284_Jon Durrant - ..> | 2026-02-10 13:00 | 148K | |
![[ ]](/icons/layout.gif) | 48755_Kevan Martin -..> | 2026-02-26 16:49 | 148K | |
![[ ]](/icons/layout.gif) | 49996_Kevan Martin -..> | 2026-03-02 16:59 | 148K | |
![[ ]](/icons/layout.gif) | 34476_Cornel Pavel -..> | 2026-01-19 08:53 | 148K | |
![[ ]](/icons/layout.gif) | 36198_Ian Frazer - K..> | 2026-01-22 15:57 | 148K | |
![[ ]](/icons/layout.gif) | 36416_Ian Frazer - K..> | 2026-01-23 10:42 | 148K | |
![[ ]](/icons/layout.gif) | 43081_Myles Reuben -..> | 2026-02-12 12:23 | 148K | |
![[ ]](/icons/layout.gif) | 45658_Barry White - ..> | 2026-02-18 13:55 | 148K | |
![[ ]](/icons/layout.gif) | 63837_Adam Couzens -..> | 2026-04-09 07:26 | 148K | |
![[ ]](/icons/layout.gif) | 34297_Garry Houghton..> | 2026-01-16 13:44 | 148K | |
![[ ]](/icons/layout.gif) | 35392_Garry Houghton..> | 2026-01-20 16:18 | 148K | |
![[ ]](/icons/layout.gif) | 36226_Garry Houghton..> | 2026-01-22 16:46 | 148K | |
![[ ]](/icons/layout.gif) | 41144_David Pearson ..> | 2026-02-06 07:45 | 148K | |
![[ ]](/icons/layout.gif) | 65809_Gary Bernardo ..> | 2026-04-14 14:32 | 148K | |
![[ ]](/icons/layout.gif) | 38219_Zdena Murgacov..> | 2026-01-29 09:11 | 148K | |
![[ ]](/icons/layout.gif) | 48762_Carl Herring -..> | 2026-02-26 17:02 | 148K | |
![[ ]](/icons/layout.gif) | 59239_Bill Mitchell ..> | 2026-03-25 14:29 | 148K | |
![[ ]](/icons/layout.gif) | 66568_David Campbell..> | 2026-04-16 10:04 | 148K | |
![[ ]](/icons/layout.gif) | 69769_Todd Pugh - PU..> | 2026-04-24 07:50 | 148K | |
![[ ]](/icons/layout.gif) | 41332_Uk Car Panels ..> | 2026-02-06 11:29 | 148K | |
![[ ]](/icons/layout.gif) | 54163_James Newman -..> | 2026-03-12 10:53 | 148K | |
![[ ]](/icons/layout.gif) | 59809_Ian Hutchison ..> | 2026-03-26 16:08 | 148K | |
![[ ]](/icons/layout.gif) | 59921_Ian Hutchison ..> | 2026-03-27 08:35 | 148K | |
![[ ]](/icons/layout.gif) | 36119_Will Brown - K..> | 2026-01-22 12:39 | 148K | |
![[ ]](/icons/layout.gif) | 36897_Alan Middledit..> | 2026-01-26 11:02 | 148K | |
![[ ]](/icons/layout.gif) | 33308_Neal Prescott ..> | 2026-01-14 14:41 | 148K | |
![[ ]](/icons/layout.gif) | 42703_Adrian Hollowa..> | 2026-02-11 13:05 | 148K | |
![[ ]](/icons/layout.gif) | 34867_Tommy - Tommym..> | 2026-01-19 16:56 | 148K | |
![[ ]](/icons/layout.gif) | 42087_James Hall - S..> | 2026-02-10 09:52 | 148K | |
![[ ]](/icons/layout.gif) | 44371_James Pullen -..> | 2026-02-16 16:24 | 148K | |
![[ ]](/icons/layout.gif) | 36658_Ian Fraser - K..> | 2026-01-23 15:10 | 148K | |
![[ ]](/icons/layout.gif) | 42253_Stuart Morgan ..> | 2026-02-10 12:23 | 148K | |
![[ ]](/icons/layout.gif) | 43101_Stuart Morgan ..> | 2026-02-12 13:18 | 148K | |
![[ ]](/icons/layout.gif) | 51602_georgina Dalby..> | 2026-03-05 14:48 | 148K | |
![[ ]](/icons/layout.gif) | 54706_Stephen Potter..> | 2026-03-13 10:56 | 148K | |
![[ ]](/icons/layout.gif) | 67395_John Walsh - R..> | 2026-04-17 14:58 | 148K | |
![[ ]](/icons/layout.gif) | 66331_Gary Bernardo ..> | 2026-04-15 14:32 | 148K | |
![[ ]](/icons/layout.gif) | 38650_Jack Sowerby -..> | 2026-01-30 07:56 | 148K | |
![[ ]](/icons/layout.gif) | 47131_Edward Lawson ..> | 2026-02-23 14:02 | 148K | |
![[ ]](/icons/layout.gif) | 35134_CT Constructio..> | 2026-01-20 11:42 | 148K | |
![[ ]](/icons/layout.gif) | 38033_James Davey - ..> | 2026-01-28 14:01 | 148K | |
![[ ]](/icons/layout.gif) | 50953_Mark Pinckney ..> | 2026-03-04 14:43 | 148K | |
![[ ]](/icons/layout.gif) | 55042_Harrold Knight..> | 2026-03-13 16:49 | 148K | |
![[ ]](/icons/layout.gif) | 61381_Blakemore Cons..> | 2026-03-31 13:09 | 148K | |
![[ ]](/icons/layout.gif) | 63295_Keith White - ..> | 2026-04-08 06:59 | 148K | |
![[ ]](/icons/layout.gif) | 29498_Jamie Stubbs -..> | 2025-12-31 12:35 | 148K | |
![[ ]](/icons/layout.gif) | 57178_John Payne - P..> | 2026-03-20 08:25 | 148K | |
![[ ]](/icons/layout.gif) | 67353_Andrew Grant -..> | 2026-04-17 13:58 | 148K | |
![[ ]](/icons/layout.gif) | 68715_Steven Bardsle..> | 2026-04-21 14:59 | 148K | |
![[ ]](/icons/layout.gif) | 50582_Neil Bush - Ne..> | 2026-03-04 08:34 | 148K | |
![[ ]](/icons/layout.gif) | 55320_Mark Wilson - ..> | 2026-03-16 13:17 | 148K | |
![[ ]](/icons/layout.gif) | 55575_Mark Wilson - ..> | 2026-03-17 07:07 | 148K | |
![[ ]](/icons/layout.gif) | 64743_Pawel Wolf - P..> | 2026-04-10 15:18 | 148K | |
![[ ]](/icons/layout.gif) | 56562_John Payne - P..> | 2026-03-18 15:55 | 148K | |
![[ ]](/icons/layout.gif) | 47537_Alan Macdonald..> | 2026-02-24 10:33 | 148K | |
![[ ]](/icons/layout.gif) | 39613_David Stuart -..> | 2026-02-03 08:24 | 148K | |
![[ ]](/icons/layout.gif) | 61406_Blakemore Cons..> | 2026-03-31 13:25 | 148K | |
![[ ]](/icons/layout.gif) | 67392_Sam Pritcher -..> | 2026-04-17 14:55 | 148K | |
![[ ]](/icons/layout.gif) | 67455_Sam Pritcher -..> | 2026-04-20 07:07 | 148K | |
![[ ]](/icons/layout.gif) | 69640_Steve Sage - S..> | 2026-04-23 15:19 | 148K | |
![[ ]](/icons/layout.gif) | 44707_James Pullen -..> | 2026-02-17 10:13 | 148K | |
![[ ]](/icons/layout.gif) | 41209_Nathan Sudwort..> | 2026-02-06 08:54 | 148K | |
![[ ]](/icons/layout.gif) | 47901_David Neale - ..> | 2026-02-24 16:43 | 148K | |
![[ ]](/icons/layout.gif) | 50672_William Pritch..> | 2026-03-04 09:38 | 148K | |
![[ ]](/icons/layout.gif) | 51424_Richard Smee -..> | 2026-03-05 11:53 | 148K | |
![[ ]](/icons/layout.gif) | 63790_C F F Milsom -..> | 2026-04-08 15:58 | 148K | |
![[ ]](/icons/layout.gif) | 63791_C F F Milsom -..> | 2026-04-08 16:00 | 148K | |
![[ ]](/icons/layout.gif) | 49250_Roy Clark - Ro..> | 2026-02-27 15:39 | 148K | |
![[ ]](/icons/layout.gif) | 55012_jez wright - O..> | 2026-03-13 15:43 | 148K | |
![[ ]](/icons/layout.gif) | 67949_Sam Pritcher -..> | 2026-04-20 14:39 | 148K | |
![[ ]](/icons/layout.gif) | 44893_Calum Skinner ..> | 2026-02-17 13:23 | 148K | |
![[ ]](/icons/layout.gif) | 63955_Cameron Grant ..> | 2026-04-09 08:48 | 148K | |
![[ ]](/icons/layout.gif) | 49707_Roy Clark - Ro..> | 2026-03-02 12:27 | 148K | |
![[ ]](/icons/layout.gif) | 53038_Gary Burrell -..> | 2026-03-10 09:21 | 148K | |
![[ ]](/icons/layout.gif) | 40525_Kirk Bond - BO..> | 2026-02-04 14:15 | 148K | |
![[ ]](/icons/layout.gif) | 49451_Roy Clark - Ro..> | 2026-03-02 09:26 | 148K | |
![[ ]](/icons/layout.gif) | 65703_Sam Matthew Po..> | 2026-04-14 13:03 | 148K | |
![[ ]](/icons/layout.gif) | 35568_Eric Fleming -..> | 2026-01-21 09:59 | 148K | |
![[ ]](/icons/layout.gif) | 39510_John Cerosola ..> | 2026-02-02 16:54 | 148K | |
![[ ]](/icons/layout.gif) | 55358_Mark Bowles - ..> | 2026-03-16 13:44 | 148K | |
![[ ]](/icons/layout.gif) | 57049_John Payne - P..> | 2026-03-19 15:35 | 148K | |
![[ ]](/icons/layout.gif) | 49974_Graham Matthew..> | 2026-03-02 16:33 | 148K | |
![[ ]](/icons/layout.gif) | 49982_Kevin Witton -..> | 2026-03-02 16:46 | 148K | |
![[ ]](/icons/layout.gif) | 40093_Jamie Hesketh ..> | 2026-02-03 15:38 | 148K | |
![[ ]](/icons/layout.gif) | 41985_Richard Ashley..> | 2026-02-10 07:19 | 148K | |
![[ ]](/icons/layout.gif) | 64834_Nikolaos Anton..> | 2026-04-13 07:43 | 148K | |
![[ ]](/icons/layout.gif) | 37166_Simon Kirk - K..> | 2026-01-26 15:24 | 148K | |
![[ ]](/icons/layout.gif) | 37792_Simon Kirk - K..> | 2026-01-28 09:27 | 148K | |
![[ ]](/icons/layout.gif) | 38158_Jamie Hesketh ..> | 2026-01-29 07:27 | 148K | |
![[ ]](/icons/layout.gif) | 46692_Gary Linney - ..> | 2026-02-20 12:50 | 148K | |
![[ ]](/icons/layout.gif) | 60611_Barry Wilson -..> | 2026-03-30 12:58 | 148K | |
![[ ]](/icons/layout.gif) | 34696_Thomas Felipe ..> | 2026-01-19 13:12 | 148K | |
![[ ]](/icons/layout.gif) | 37384_Luke Hawkins -..> | 2026-01-27 10:39 | 148K | |
![[ ]](/icons/layout.gif) | 39029_Total Control ..> | 2026-01-30 15:46 | 148K | |
![[ ]](/icons/layout.gif) | 51446_Lynn Cox - ORD..> | 2026-03-05 12:16 | 148K | |
![[ ]](/icons/layout.gif) | 67457_Prashant Karke..> | 2026-04-20 07:10 | 148K | |
![[ ]](/icons/layout.gif) | 35588_Connor Lewis -..> | 2026-01-21 10:20 | 148K | |
![[ ]](/icons/layout.gif) | 37940_Bob Rutherford..> | 2026-01-28 12:58 | 148K | |
![[ ]](/icons/layout.gif) | 39995_David Stuart -..> | 2026-02-03 13:46 | 148K | |
![[ ]](/icons/layout.gif) | 40684_Brite Binu - B..> | 2026-02-05 07:30 | 148K | |
![[ ]](/icons/layout.gif) | 44630_VIP Bin Cleani..> | 2026-02-17 09:25 | 148K | |
![[ ]](/icons/layout.gif) | 34434_Neil Robertson..> | 2026-01-19 07:56 | 148K | |
![[ ]](/icons/layout.gif) | 34984_Neil Robertson..> | 2026-01-20 09:22 | 148K | |
![[ ]](/icons/layout.gif) | 45023_Lee Cocker - C..> | 2026-02-17 14:59 | 148K | |
![[ ]](/icons/layout.gif) | 49455_Jake Skipper -..> | 2026-03-02 09:28 | 148K | |
![[ ]](/icons/layout.gif) | 62227_Hannah Beats -..> | 2026-04-02 09:44 | 148K | |
![[ ]](/icons/layout.gif) | 38226_Zdena Murgacov..> | 2026-01-29 09:14 | 148K | |
![[ ]](/icons/layout.gif) | 38231_Zdena Murgacov..> | 2026-01-29 09:26 | 148K | |
![[ ]](/icons/layout.gif) | 38667_Zdena Murgacov..> | 2026-01-30 08:40 | 148K | |
![[ ]](/icons/layout.gif) | 41008_Zdena Murgacov..> | 2026-02-05 13:59 | 148K | |
![[ ]](/icons/layout.gif) | 41011_Zdena Murgacov..> | 2026-02-05 14:02 | 148K | |
![[ ]](/icons/layout.gif) | 41016_Zdena Murgacov..> | 2026-02-05 14:09 | 148K | |
![[ ]](/icons/layout.gif) | 35986_Julie Wrigth -..> | 2026-01-22 10:49 | 148K | |
![[ ]](/icons/layout.gif) | 37146_Julie Wrigth -..> | 2026-01-26 15:01 | 148K | |
![[ ]](/icons/layout.gif) | 35004_Brian Cook - O..> | 2026-01-20 09:53 | 148K | |
![[ ]](/icons/layout.gif) | 42310_Uk Car Panels ..> | 2026-02-10 13:44 | 148K | |
![[ ]](/icons/layout.gif) | 43073_Uk Car Panels ..> | 2026-02-12 12:14 | 148K | |
![[ ]](/icons/layout.gif) | 66281_Blackhawk Secu..> | 2026-04-15 13:01 | 148K | |
![[ ]](/icons/layout.gif) | 36294_Will Brown - K..> | 2026-01-23 09:28 | 148K | |
![[ ]](/icons/layout.gif) | 47775_Sara Colton - ..> | 2026-02-24 15:32 | 148K | |
![[ ]](/icons/layout.gif) | 56545_Cheryl Lewis -..> | 2026-03-18 15:35 | 148K | |
![[ ]](/icons/layout.gif) | 67862_Ryan Varley - ..> | 2026-04-20 13:33 | 148K | |
![[ ]](/icons/layout.gif) | 39332_William Simmon..> | 2026-02-02 14:34 | 148K | |
![[ ]](/icons/layout.gif) | 47103_Dominic Savage..> | 2026-02-23 13:15 | 148K | |
![[ ]](/icons/layout.gif) | 36350_John Payne - O..> | 2026-01-23 10:10 | 148K | |
![[ ]](/icons/layout.gif) | 45942_Mark Haviland ..> | 2026-02-19 09:07 | 148K | |
![[ ]](/icons/layout.gif) | 47096_Robert Rovetto..> | 2026-02-23 13:08 | 148K | |
![[ ]](/icons/layout.gif) | 36086_Andrew Marshal..> | 2026-01-22 11:59 | 148K | |
![[ ]](/icons/layout.gif) | 36283_Andrew Marshal..> | 2026-01-23 09:14 | 148K | |
![[ ]](/icons/layout.gif) | 37523_Luke Hawkins -..> | 2026-01-27 12:51 | 148K | |
![[ ]](/icons/layout.gif) | 39357_William Simmon..> | 2026-02-02 15:42 | 148K | |
![[ ]](/icons/layout.gif) | 64221_Tyler Allen - ..> | 2026-04-09 15:28 | 148K | |
![[ ]](/icons/layout.gif) | 37376_Luke Hawkins -..> | 2026-01-27 10:23 | 148K | |
![[ ]](/icons/layout.gif) | 35118_Cornel Pavel -..> | 2026-01-20 11:29 | 148K | |
![[ ]](/icons/layout.gif) | 58226_CPS Ltd Pawel ..> | 2026-03-23 16:50 | 148K | |
![[ ]](/icons/layout.gif) | 63814_Jonathon Gardn..> | 2026-04-09 06:46 | 148K | |
![[ ]](/icons/layout.gif) | 35124_Neil Robertson..> | 2026-01-20 11:37 | 148K | |
![[ ]](/icons/layout.gif) | 49830_Paul Mitchell ..> | 2026-03-02 14:40 | 148K | |
![[ ]](/icons/layout.gif) | 61857_Kenan Hill - H..> | 2026-04-01 12:02 | 148K | |
![[ ]](/icons/layout.gif) | 66221_John Sheppard ..> | 2026-04-15 11:36 | 148K | |
![[ ]](/icons/layout.gif) | 34627_Colin Macdonal..> | 2026-01-19 11:31 | 148K | |
![[ ]](/icons/layout.gif) | 34686_Colin Macdonal..> | 2026-01-19 12:49 | 148K | |
![[ ]](/icons/layout.gif) | 34687_Colin Macdonal..> | 2026-01-19 12:50 | 148K | |
![[ ]](/icons/layout.gif) | 47092_Allen Bogacki ..> | 2026-02-23 12:28 | 148K | |
![[ ]](/icons/layout.gif) | 61589_Josh Glossop -..> | 2026-04-01 07:18 | 148K | |
![[ ]](/icons/layout.gif) | 35704_Stuart Biggs -..> | 2026-01-21 12:59 | 148K | |
![[ ]](/icons/layout.gif) | 35847_Julie Wrigth -..> | 2026-01-21 15:52 | 148K | |
![[ ]](/icons/layout.gif) | 42776_Falcon Windows..> | 2026-02-11 14:32 | 148K | |
![[ ]](/icons/layout.gif) | 38788_Gary Jones - P..> | 2026-01-30 10:39 | 148K | |
![[ ]](/icons/layout.gif) | 42360_James Hall - S..> | 2026-02-10 15:24 | 148K | |
![[ ]](/icons/layout.gif) | 63950_Petru Chificia..> | 2026-04-09 08:38 | 148K | |
![[ ]](/icons/layout.gif) | 69092_Luke Haddy - H..> | 2026-04-22 13:32 | 148K | |
![[ ]](/icons/layout.gif) | 35374_Micheal Joyce ..> | 2026-01-20 16:04 | 148K | |
![[ ]](/icons/layout.gif) | 42276_Chris Smith - ..> | 2026-02-10 12:48 | 148K | |
![[ ]](/icons/layout.gif) | 44151_Paul O'Neill -..> | 2026-02-16 12:44 | 148K | |
![[ ]](/icons/layout.gif) | 69372_Jonathan Wareh..> | 2026-04-23 09:08 | 148K | |
![[ ]](/icons/layout.gif) | 33514_Micheal Joyce ..> | 2026-01-15 09:06 | 148K | |
![[ ]](/icons/layout.gif) | 44024_Stephen Price ..> | 2026-02-16 10:51 | 148K | |
![[ ]](/icons/layout.gif) | 50007_Graham Matthew..> | 2026-03-02 17:20 | 148K | |
![[ ]](/icons/layout.gif) | 61535_Neil Porteous ..> | 2026-03-31 15:52 | 148K | |
![[ ]](/icons/layout.gif) | 65911_Sam Matthew Po..> | 2026-04-15 06:25 | 148K | |
![[ ]](/icons/layout.gif) | 41696_Harriet Beck -..> | 2026-02-09 13:11 | 148K | |
![[ ]](/icons/layout.gif) | 34869_Nicole Richmon..> | 2026-01-19 17:00 | 148K | |
![[ ]](/icons/layout.gif) | 49309_Andrew Fox - O..> | 2026-02-27 16:59 | 148K | |
![[ ]](/icons/layout.gif) | 69866_Michael George..> | 2026-04-24 09:06 | 148K | |
![[ ]](/icons/layout.gif) | 33756_Nicole Richmon..> | 2026-01-15 12:17 | 148K | |
![[ ]](/icons/layout.gif) | 65868_Nikolaos Anton..> | 2026-04-14 15:17 | 148K | |
![[ ]](/icons/layout.gif) | 67401_Nikolaos Anton..> | 2026-04-17 15:08 | 148K | |
![[ ]](/icons/layout.gif) | 56571_Hamada Aqlan -..> | 2026-03-18 16:00 | 148K | |
![[ ]](/icons/layout.gif) | 68003_Lewis Pearce -..> | 2026-04-20 15:16 | 148K | |
![[ ]](/icons/layout.gif) | 34146_Micheal Joyce ..> | 2026-01-16 09:09 | 148K | |
![[ ]](/icons/layout.gif) | 44000_The Paul Barke..> | 2026-02-16 10:43 | 148K | |
![[ ]](/icons/layout.gif) | 33263_Ricky Cresswel..> | 2026-01-14 13:55 | 148K | |
![[ ]](/icons/layout.gif) | 49133_John Pallot - ..> | 2026-02-27 13:42 | 148K | |
![[ ]](/icons/layout.gif) | 53844_Daniel Waybour..> | 2026-03-11 12:36 | 148K | |
![[ ]](/icons/layout.gif) | 67904_George Berridg..> | 2026-04-20 14:04 | 148K | |
![[ ]](/icons/layout.gif) | 51107_RC Site Servic..> | 2026-03-04 17:00 | 148K | |
![[ ]](/icons/layout.gif) | 59316_Kyle Barrowcli..> | 2026-03-26 08:19 | 148K | |
![[ ]](/icons/layout.gif) | 34802_Ann Kiley - An..> | 2026-01-19 15:47 | 148K | |
![[ ]](/icons/layout.gif) | 33336_James Austin -..> | 2026-01-14 15:00 | 148K | |
![[ ]](/icons/layout.gif) | 64199_Jordan Kinghor..> | 2026-04-09 15:11 | 148K | |
![[ ]](/icons/layout.gif) | 33818_Ricky Cresswel..> | 2026-01-15 13:58 | 148K | |
![[ ]](/icons/layout.gif) | 51430_Michael Toon -..> | 2026-03-05 11:56 | 148K | |
![[ ]](/icons/layout.gif) | 52399_Kevin Hill - O..> | 2026-03-09 09:08 | 148K | |
![[ ]](/icons/layout.gif) | 50208_George Baker -..> | 2026-03-03 11:17 | 148K | |
![[ ]](/icons/layout.gif) | 39043_The Safety Sup..> | 2026-01-30 15:57 | 148K | |
![[ ]](/icons/layout.gif) | 60690_Adam Reynolds ..> | 2026-03-30 14:24 | 148K | |
![[ ]](/icons/layout.gif) | 66332_Jonathan Isaac..> | 2026-04-15 14:34 | 148K | |
![[ ]](/icons/layout.gif) | 35132_Ann Kiley - An..> | 2026-01-20 11:41 | 148K | |
![[ ]](/icons/layout.gif) | 36661_Andrew Marshal..> | 2026-01-23 15:13 | 148K | |
![[ ]](/icons/layout.gif) | 69095_Mike Ancell - ..> | 2026-04-22 13:43 | 148K | |
![[ ]](/icons/layout.gif) | 66894_Brian Wallace ..> | 2026-04-16 15:48 | 148K | |
![[ ]](/icons/layout.gif) | 38196_Dave Barnett -..> | 2026-01-29 08:32 | 148K | |
![[ ]](/icons/layout.gif) | 40626_Dave Barnett -..> | 2026-02-04 16:20 | 148K | |
![[ ]](/icons/layout.gif) | 33515_A Miles Buildi..> | 2026-01-15 09:06 | 148K | |
![[ ]](/icons/layout.gif) | 33283_A Miles Buildi..> | 2026-01-14 14:02 | 148K | |
![[ ]](/icons/layout.gif) | 60808_Katy Gilhooly ..> | 2026-03-30 15:07 | 148K | |
![[ ]](/icons/layout.gif) | 57426_Derek Coward -..> | 2026-03-20 11:52 | 148K | |
![[ ]](/icons/layout.gif) | 69422_David Squibb -..> | 2026-04-23 10:57 | 148K | |
![[ ]](/icons/layout.gif) | 47508_Chris Hodge - ..> | 2026-02-24 10:16 | 148K | |
![[ ]](/icons/layout.gif) | 36706_Julian Hughes ..> | 2026-01-23 16:10 | 148K | |
![[ ]](/icons/layout.gif) | 62505_Gary Linney - ..> | 2026-04-02 15:21 | 148K | |
![[ ]](/icons/layout.gif) | 36541_Ian Fraser - K..> | 2026-01-23 12:43 | 148K | |
![[ ]](/icons/layout.gif) | 33471_A Miles Buildi..> | 2026-01-15 08:02 | 148K | |
![[ ]](/icons/layout.gif) | 36166_Julian Hughes ..> | 2026-01-22 14:27 | 148K | |
![[ ]](/icons/layout.gif) | 36169_Julian Hughes ..> | 2026-01-22 14:43 | 148K | |
![[ ]](/icons/layout.gif) | 35343_Julian Hughes ..> | 2026-01-20 15:34 | 148K | |
![[ ]](/icons/layout.gif) | 38160_Jamie Hesketh ..> | 2026-01-29 07:28 | 148K | |
![[ ]](/icons/layout.gif) | 35765_Jonathan Foste..> | 2026-01-21 13:33 | 148K | |
![[ ]](/icons/layout.gif) | 35459_Connor Lewis -..> | 2026-01-21 08:14 | 148K | |
![[ ]](/icons/layout.gif) | 36540_Ian Fraser - K..> | 2026-01-23 12:43 | 148K | |
![[ ]](/icons/layout.gif) | 42285_Jon Durrant - ..> | 2026-02-10 13:01 | 148K | |
![[ ]](/icons/layout.gif) | 63838_Adam Couzens -..> | 2026-04-09 07:27 | 148K | |
![[ ]](/icons/layout.gif) | 35460_Connor Lewis -..> | 2026-01-21 08:14 | 148K | |
![[ ]](/icons/layout.gif) | 35876_Julian Hughes ..> | 2026-01-22 07:37 | 148K | |
![[ ]](/icons/layout.gif) | 59810_Ian Hutchison ..> | 2026-03-26 16:08 | 148K | |
![[ ]](/icons/layout.gif) | 60676_David Mattrave..> | 2026-03-30 13:51 | 148K | |
![[ ]](/icons/layout.gif) | 47114_Jacob Burton -..> | 2026-02-23 13:36 | 148K | |
![[ ]](/icons/layout.gif) | 35135_CT Constructio..> | 2026-01-20 11:42 | 148K | |
![[ ]](/icons/layout.gif) | 35136_CT Constructio..> | 2026-01-20 11:43 | 148K | |
![[ ]](/icons/layout.gif) | 69641_Steve Sage - S..> | 2026-04-23 15:19 | 148K | |
![[ ]](/icons/layout.gif) | 61632_Max Hewitt - H..> | 2026-04-01 08:01 | 148K | |
![[ ]](/icons/layout.gif) | 58834_Simon Marshall..> | 2026-03-24 16:49 | 148K | |
![[ ]](/icons/layout.gif) | 59289_Simon Marshall..> | 2026-03-25 15:53 | 148K | |
![[ ]](/icons/layout.gif) | 69498_Steve West - W..> | 2026-04-23 12:22 | 148K | |
![[ ]](/icons/layout.gif) | 38159_Jamie Hesketh ..> | 2026-01-29 07:27 | 148K | |
![[ ]](/icons/layout.gif) | 67298_Derek Marney -..> | 2026-04-17 13:05 | 148K | |
![[ ]](/icons/layout.gif) | 42820_Chiltern Compl..> | 2026-02-11 16:15 | 148K | |
![[ ]](/icons/layout.gif) | 42277_Chris Smith - ..> | 2026-02-10 12:49 | 148K | |
![[ ]](/icons/layout.gif) | 44002_The Paul Barke..> | 2026-02-16 10:44 | 148K | |
![[ ]](/icons/layout.gif) | 68249_Sam Cowling - ..> | 2026-04-21 09:25 | 148K | |
![[ ]](/icons/layout.gif) | 44005_The Paul Barke..> | 2026-02-16 10:44 | 149K | |
![[ ]](/icons/layout.gif) | 65221_Stephen Boyle ..> | 2026-04-13 14:10 | 149K | |
![[ ]](/icons/layout.gif) | 59011_Bullco Ltd Luk..> | 2026-03-25 10:56 | 149K | |
![[ ]](/icons/layout.gif) | 60715_Pmd LTD - PMDL..> | 2026-03-30 14:45 | 149K | |
![[ ]](/icons/layout.gif) | 63304_Mark Mayhew - ..> | 2026-04-08 07:16 | 149K | |
![[ ]](/icons/layout.gif) | 60537_Michael Penman..> | 2026-03-30 10:50 | 149K | |
![[ ]](/icons/layout.gif) | 60531_Martin Letting..> | 2026-03-30 10:47 | 149K | |
![[ ]](/icons/layout.gif) | 67318_Derek Marney -..> | 2026-04-17 13:27 | 149K | |
![[ ]](/icons/layout.gif) | 61982_Crawford Storr..> | 2026-04-01 13:54 | 149K | |
![[ ]](/icons/layout.gif) | 68723_John Barker - ..> | 2026-04-21 15:09 | 149K | |
![[ ]](/icons/layout.gif) | 61988_MHS Ltd Stephe..> | 2026-04-01 14:01 | 149K | |
![[ ]](/icons/layout.gif) | 69253_ELS PESTANA LT..> | 2026-04-23 07:03 | 149K | |
![[ ]](/icons/layout.gif) | 18740_Kirsty Wood - ..> | 2025-11-24 14:40 | 149K | |
![[ ]](/icons/layout.gif) | 34240_Hubert - HUBE0..> | 2026-01-16 11:12 | 149K | |
![[ ]](/icons/layout.gif) | 54748_Mark Robertson..> | 2026-03-13 11:59 | 149K | |
![[ ]](/icons/layout.gif) | 54966_Mark Robertson..> | 2026-03-13 14:52 | 149K | |
![[ ]](/icons/layout.gif) | 61838_Abhinav Bandi ..> | 2026-04-01 11:30 | 149K | |
![[ ]](/icons/layout.gif) | 35806_Laura Murphy -..> | 2026-01-21 14:43 | 149K | |
![[ ]](/icons/layout.gif) | 61233_Ashley King - ..> | 2026-03-31 12:25 | 149K | |
![[ ]](/icons/layout.gif) | 41415_Callum Clark -..> | 2026-02-06 14:12 | 149K | |
![[ ]](/icons/layout.gif) | 39229_Stephen Chambe..> | 2026-02-02 11:50 | 149K | |
![[ ]](/icons/layout.gif) | 38105_Steve - STEV00..> | 2026-01-28 15:58 | 149K | |
![[ ]](/icons/layout.gif) | 38161_Steve - STEV00..> | 2026-01-29 07:46 | 149K | |
![[ ]](/icons/layout.gif) | 45048_Isocount UK Lt..> | 2026-02-17 15:45 | 149K | |
![[ ]](/icons/layout.gif) | 45052_Isocount UK Lt..> | 2026-02-17 15:51 | 149K | |
![[ ]](/icons/layout.gif) | 56529_Neil Taylor - ..> | 2026-03-18 15:31 | 149K | |
![[ ]](/icons/layout.gif) | 45046_Mark Knutton -..> | 2026-02-17 15:33 | 149K | |
![[ ]](/icons/layout.gif) | 38607_Tim Lewis - LE..> | 2026-01-29 16:47 | 149K | |
![[ ]](/icons/layout.gif) | 33290_Julian Jarvis ..> | 2026-01-14 14:20 | 149K | |
![[ ]](/icons/layout.gif) | 59121_Bill Mitchell ..> | 2026-03-25 12:04 | 149K | |
![[ ]](/icons/layout.gif) | 56523_Ben Cussons - ..> | 2026-03-18 15:16 | 149K | |
![[ ]](/icons/layout.gif) | 38732_Steve Wattridg..> | 2026-01-30 09:41 | 149K | |
![[ ]](/icons/layout.gif) | 47198_Bill Ford - FO..> | 2026-02-23 15:41 | 149K | |
![[ ]](/icons/layout.gif) | 39075_Steve Wattridg..> | 2026-02-02 07:54 | 149K | |
![[ ]](/icons/layout.gif) | 54964_Frank Brogan -..> | 2026-03-13 14:45 | 149K | |
![[ ]](/icons/layout.gif) | 54963_Frank Brogan -..> | 2026-03-13 14:44 | 149K | |
![[ ]](/icons/layout.gif) | 37944_Lewis Robinson..> | 2026-01-28 13:08 | 149K | |
![[ ]](/icons/layout.gif) | 57778_James Parry - ..> | 2026-03-23 09:18 | 149K | |
![[ ]](/icons/layout.gif) | 58882_Gzim Sufa - RO..> | 2026-03-25 08:43 | 149K | |
![[ ]](/icons/layout.gif) | 53963_Bill Mitchell ..> | 2026-03-11 16:09 | 149K | |
![[ ]](/icons/layout.gif) | 33836_Paul Brookes -..> | 2026-01-15 14:21 | 149K | |
![[ ]](/icons/layout.gif) | 65223_Gareth William..> | 2026-04-13 14:12 | 149K | |
![[ ]](/icons/layout.gif) | 37736_Richard - RICH..> | 2026-01-28 08:11 | 149K | |
![[ ]](/icons/layout.gif) | 53809_Dan Gardiner -..> | 2026-03-11 12:02 | 149K | |
![[ ]](/icons/layout.gif) | 55976_Exe Signs Zoe ..> | 2026-03-17 15:07 | 149K | |
![[ ]](/icons/layout.gif) | 69163_Angus Raine - ..> | 2026-04-22 15:18 | 149K | |
![[ ]](/icons/layout.gif) | 69900_Angus Raine - ..> | 2026-04-24 09:35 | 149K | |
![[ ]](/icons/layout.gif) | 47364_Bill Ford - FO..> | 2026-02-23 17:05 | 149K | |
![[ ]](/icons/layout.gif) | 61786_Abhinav Bandi ..> | 2026-04-01 10:31 | 149K | |
![[ ]](/icons/layout.gif) | 57475_Richard Hallam..> | 2026-03-20 13:00 | 149K | |
![[ ]](/icons/layout.gif) | 61907_Abhinav Bandi ..> | 2026-04-01 12:32 | 149K | |
![[ ]](/icons/layout.gif) | 38018_Laura Murphy -..> | 2026-01-28 13:51 | 149K | |
![[ ]](/icons/layout.gif) | 41476_Callum Clark -..> | 2026-02-06 16:19 | 149K | |
![[ ]](/icons/layout.gif) | 33482_Lee Ingold - I..> | 2026-01-15 08:26 | 149K | |
![[ ]](/icons/layout.gif) | 45079_Mark Knutton -..> | 2026-02-17 16:24 | 149K | |
![[ ]](/icons/layout.gif) | 36099_Hubert Oginski..> | 2026-01-22 12:10 | 149K | |
![[ ]](/icons/layout.gif) | 51109_Mike Powles - ..> | 2026-03-04 17:06 | 149K | |
![[ ]](/icons/layout.gif) | 39822_Stephen Chambe..> | 2026-02-03 11:02 | 149K | |
![[ ]](/icons/layout.gif) | 33378_Julian Jarvis ..> | 2026-01-14 15:50 | 149K | |
![[ ]](/icons/layout.gif) | 36917_Nigel Chapman ..> | 2026-01-26 11:42 | 149K | |
![[ ]](/icons/layout.gif) | 45813_Isocount UK Lt..> | 2026-02-18 15:11 | 149K | |
![[ ]](/icons/layout.gif) | 58841_Kyle Barrowcli..> | 2026-03-25 07:07 | 149K | |
![[ ]](/icons/layout.gif) | 57779_James Parry - ..> | 2026-03-23 09:21 | 149K | |
![[ ]](/icons/layout.gif) | 35145_Alan Rees - Al..> | 2026-01-20 12:07 | 150K | |
![[ ]](/icons/layout.gif) | 56182_Gary Austin - ..> | 2026-03-18 09:37 | 150K | |
![[ ]](/icons/layout.gif) | 42756_Nigel Cole - R..> | 2026-02-11 13:42 | 150K | |
![[ ]](/icons/layout.gif) | 58936_Gzim Sufa - RO..> | 2026-03-25 09:24 | 150K | |
![[ ]](/icons/layout.gif) | 61534_Gzim Sufa - RO..> | 2026-03-31 15:45 | 150K | |
![[ ]](/icons/layout.gif) | 61908_Abhinav Bandi ..> | 2026-04-01 12:32 | 150K | |
![[ ]](/icons/layout.gif) | 65025_R Hood Builder..> | 2026-04-13 10:14 | 150K | |
![[ ]](/icons/layout.gif) | 33899_Paul Brookes -..> | 2026-01-15 15:01 | 150K | |
![[ ]](/icons/layout.gif) | 35375_Paul Brookes -..> | 2026-01-20 16:07 | 150K | |
![[ ]](/icons/layout.gif) | 69913_Angus Raine - ..> | 2026-04-24 09:55 | 150K | |
![[ ]](/icons/layout.gif) | 45100_Mark Knutton -..> | 2026-02-17 17:06 | 150K | |
![[ ]](/icons/layout.gif) | 59292_Ben Cussons - ..> | 2026-03-25 16:00 | 150K | |
![[ ]](/icons/layout.gif) | 52270_Mike Powles - ..> | 2026-03-06 16:37 | 150K | |
![[ ]](/icons/layout.gif) | 40531_Lewis Robinson..> | 2026-02-04 14:22 | 150K | |
![[ ]](/icons/layout.gif) | 64084_R Hood Builder..> | 2026-04-09 11:49 | 150K | |
![[ ]](/icons/layout.gif) | 37028_Alan Rees - Al..> | 2026-01-26 13:28 | 150K | |
![[ ]](/icons/layout.gif) | 36919_Nigel Chapman ..> | 2026-01-26 11:46 | 150K | |
![[ ]](/icons/layout.gif) | 36920_Nigel Chapman ..> | 2026-01-26 11:47 | 150K | |
![[ ]](/icons/layout.gif) | 36971_Nigel Chapman ..> | 2026-01-26 12:38 | 150K | |
![[ ]](/icons/layout.gif) | 40007_Graham Wells -..> | 2026-02-03 14:01 | 150K | |
![[ ]](/icons/layout.gif) | 34202_Lee Ingold - I..> | 2026-01-16 09:48 | 150K | |
![[ ]](/icons/layout.gif) | 68753_Des Cole - COL..> | 2026-04-21 16:09 | 150K | |
![[ ]](/icons/layout.gif) | 65343_R Hood Builder..> | 2026-04-14 07:41 | 150K | |
![[ ]](/icons/layout.gif) | 66371_R Hood Builder..> | 2026-04-15 15:21 | 150K | |
![[ ]](/icons/layout.gif) | 67360_R Hood Builder..> | 2026-04-17 14:14 | 150K | |
![[ ]](/icons/layout.gif) | 51870_Seaview Buildi..> | 2026-03-06 09:56 | 150K | |
![[ ]](/icons/layout.gif) | 33148_Paul Yathmouri..> | 2026-01-14 11:09 | 150K | |
![[ ]](/icons/layout.gif) | 58828_Ben Cussons - ..> | 2026-03-24 16:39 | 150K | |
![[ ]](/icons/layout.gif) | 33972_David Ellis - ..> | 2026-01-15 16:10 | 150K | |
![[ ]](/icons/layout.gif) | 57474_STORME CrossFi..> | 2026-03-20 12:54 | 150K | |
![[ ]](/icons/layout.gif) | 23771_Ian Ross Ross ..> | 2025-12-08 10:59 | 150K | |
![[ ]](/icons/layout.gif) | 28816_Secure Entranc..> | 2025-12-23 07:59 | 150K | |
![[ ]](/icons/layout.gif) | 29687_Greg Bearsley ..> | 2026-01-02 10:26 | 150K | |
![[ ]](/icons/layout.gif) | 27422_Madog Roller D..> | 2025-12-17 12:53 | 150K | |
![[ ]](/icons/layout.gif) | 20569_Chiltern Doors..> | 2025-11-27 16:49 | 150K | |
![[ ]](/icons/layout.gif) | 20581_MnK Windows K..> | 2025-11-27 17:00 | 150K | |
![[ ]](/icons/layout.gif) | 27421_Doors 4 You Lt..> | 2025-12-17 12:42 | 150K | |
![[ ]](/icons/layout.gif) | 28818_Secure Entranc..> | 2025-12-23 08:07 | 150K | |
![[ ]](/icons/layout.gif) | 32611_PB Doors Paul ..> | 2026-01-13 09:39 | 150K | |
![[ ]](/icons/layout.gif) | 30247_Greg Bearsley ..> | 2026-01-05 14:49 | 150K | |
![[ ]](/icons/layout.gif) | 19746_Rollerdoors 24..> | 2025-11-26 10:20 | 150K | |
![[ ]](/icons/layout.gif) | 23971_SW Trade Frame..> | 2025-12-08 16:11 | 150K | |
![[ ]](/icons/layout.gif) | 29999_Doors 4 You Lt..> | 2026-01-05 09:07 | 150K | |
![[ ]](/icons/layout.gif) | 19722_Fortress Doors..> | 2025-11-26 09:46 | 150K | |
![[ ]](/icons/layout.gif) | 24502_Verdi Home Imp..> | 2025-12-09 16:02 | 150K | |
![[ ]](/icons/layout.gif) | 23897_Ross Garage Do..> | 2025-12-08 14:10 | 150K | |
![[ ]](/icons/layout.gif) | 28386_Absolute Garag..> | 2025-12-19 16:31 | 150K | |
![[ ]](/icons/layout.gif) | 30968_NW Automatic D..> | 2026-01-07 08:00 | 150K | |
![[ ]](/icons/layout.gif) | 30224_Rising Group L..> | 2026-01-05 14:18 | 150K | |
![[ ]](/icons/layout.gif) | 19042_Avon Automated..> | 2025-11-25 10:59 | 150K | |
![[ ]](/icons/layout.gif) | 19760_JA B79 8RW - B..> | 2025-11-26 10:48 | 150K | |
![[ ]](/icons/layout.gif) | 31556_LNR Door Solut..> | 2026-01-08 10:54 | 150K | |
![[ ]](/icons/layout.gif) | 18851_Laura White - ..> | 2025-11-25 07:22 | 150K | |
![[ ]](/icons/layout.gif) | 29952_Rollermatic Ga..> | 2026-01-05 08:39 | 150K | |
![[ ]](/icons/layout.gif) | 30404_Garage Doors 2..> | 2026-01-05 16:32 | 150K | |
![[ ]](/icons/layout.gif) | 30354_Rising Group L..> | 2026-01-05 16:10 | 150K | |
![[ ]](/icons/layout.gif) | 23492_M. B. Bells Lt..> | 2025-12-05 14:24 | 150K | |
![[ ]](/icons/layout.gif) | 19514_Apollo Glass L..> | 2025-11-25 16:44 | 150K | |
![[ ]](/icons/layout.gif) | 29992_Collins - COLL..> | 2026-01-05 08:53 | 150K | |
![[ ]](/icons/layout.gif) | 31571_Adams Industri..> | 2026-01-08 11:09 | 150K | |
![[ ]](/icons/layout.gif) | 30144_Marcus Akid - ..> | 2026-01-05 12:40 | 150K | |
![[ ]](/icons/layout.gif) | 31119_Garage Doors 2..> | 2026-01-07 12:09 | 150K | |
![[ ]](/icons/layout.gif) | 33033_Chelmsford Rol..> | 2026-01-14 09:05 | 150K | |
![[ ]](/icons/layout.gif) | 30114_Marcus Akid - ..> | 2026-01-05 12:00 | 150K | |
![[ ]](/icons/layout.gif) | 30969_Gilberts Home ..> | 2026-01-07 08:06 | 150K | |
![[ ]](/icons/layout.gif) | 28382_Paul Atkinson ..> | 2025-12-19 15:50 | 150K | |
![[ ]](/icons/layout.gif) | 30484_Thetford Glass..> | 2026-01-06 08:53 | 150K | |
![[ ]](/icons/layout.gif) | 19330_Ross Garage Do..> | 2025-11-25 15:18 | 150K | |
![[ ]](/icons/layout.gif) | 19990_TCR Sussex Ltd..> | 2025-11-26 14:49 | 150K | |
![[ ]](/icons/layout.gif) | 29777_PB Doors Paul ..> | 2026-01-02 12:39 | 150K | |
![[ ]](/icons/layout.gif) | 23728_Phil Page Phil..> | 2025-12-08 10:14 | 150K | |
![[ ]](/icons/layout.gif) | 27249_Fortress Doors..> | 2025-12-17 09:41 | 150K | |
![[ ]](/icons/layout.gif) | 32410_Serenade Home ..> | 2026-01-12 14:41 | 150K | |
![[ ]](/icons/layout.gif) | 26167_CM Doors Chay ..> | 2025-12-15 08:24 | 150K | |
![[ ]](/icons/layout.gif) | 18822_TCR Sussex Ltd..> | 2025-11-24 16:35 | 150K | |
![[ ]](/icons/layout.gif) | 20488_Harry Curtis -..> | 2025-11-27 15:18 | 150K | |
![[ ]](/icons/layout.gif) | 20495_Harry Curtis -..> | 2025-11-27 15:33 | 150K | |
![[ ]](/icons/layout.gif) | 23853_Martin JOinery..> | 2025-12-08 12:16 | 150K | |
![[ ]](/icons/layout.gif) | 24442_ASM Windows B..> | 2025-12-09 14:25 | 150K | |
![[ ]](/icons/layout.gif) | 28407_Birchley Homes..> | 2025-12-22 08:27 | 150K | |
![[ ]](/icons/layout.gif) | 19919_Martin JOinery..> | 2025-11-26 12:47 | 150K | |
![[ ]](/icons/layout.gif) | 24219_Shane Goulden ..> | 2025-12-09 10:25 | 150K | |
![[ ]](/icons/layout.gif) | 22011_Nuvo Windows P..> | 2025-12-02 12:45 | 150K | |
![[ ]](/icons/layout.gif) | 18718_TCR Sussex Ltd..> | 2025-11-24 14:20 | 150K | |
![[ ]](/icons/layout.gif) | 21627_James King - N..> | 2025-12-02 07:46 | 150K | |
![[ ]](/icons/layout.gif) | 28997_Glen McNulty -..> | 2025-12-23 11:00 | 150K | |
![[ ]](/icons/layout.gif) | 25432_Replacement Ga..> | 2025-12-12 09:10 | 150K | |
![[ ]](/icons/layout.gif) | 24786_Replacement Ga..> | 2025-12-10 15:44 | 150K | |
![[ ]](/icons/layout.gif) | 30827_Paul Atkinson ..> | 2026-01-06 14:22 | 150K | |
![[ ]](/icons/layout.gif) | 31072_Harry Curtis -..> | 2026-01-07 10:18 | 150K | |
![[ ]](/icons/layout.gif) | 32045_Phil Page Phil..> | 2026-01-09 12:55 | 150K | |
![[ ]](/icons/layout.gif) | 25163_RJW Building L..> | 2025-12-11 13:55 | 150K | |
![[ ]](/icons/layout.gif) | 32046_Phil Page Phil..> | 2026-01-09 12:58 | 150K | |
![[ ]](/icons/layout.gif) | 23588_Michael Mazur ..> | 2025-12-05 17:01 | 150K | |
![[ ]](/icons/layout.gif) | 26158_CM Doors Chay ..> | 2025-12-15 08:06 | 150K | |
![[ ]](/icons/layout.gif) | 30152_Replacement Ga..> | 2026-01-05 13:01 | 150K | |
![[ ]](/icons/layout.gif) | 19383_Grant Tilley G..> | 2025-11-25 15:54 | 150K | |
![[ ]](/icons/layout.gif) | 28481_Birchley Homes..> | 2025-12-22 09:34 | 150K | |
![[ ]](/icons/layout.gif) | 18775_Shutter Tech U..> | 2025-11-24 15:48 | 150K | |
![[ ]](/icons/layout.gif) | 23984_Regal Windows ..> | 2025-12-08 16:39 | 150K | |
![[ ]](/icons/layout.gif) | 29836_Fortress Doors..> | 2026-01-02 14:27 | 150K | |
![[ ]](/icons/layout.gif) | 22259_Oakley Windows..> | 2025-12-03 08:26 | 150K | |
![[ ]](/icons/layout.gif) | 24529_G B Installati..> | 2025-12-09 16:27 | 150K | |
![[ ]](/icons/layout.gif) | 24915_G B Installati..> | 2025-12-11 09:07 | 150K | |
![[ ]](/icons/layout.gif) | 26174_TH Installatio..> | 2025-12-15 08:33 | 150K | |
![[ ]](/icons/layout.gif) | 30677_Thetford Glass..> | 2026-01-06 11:46 | 150K | |
![[ ]](/icons/layout.gif) | 21168_AJ Trade Andre..> | 2025-12-01 09:08 | 150K | |
![[ ]](/icons/layout.gif) | 32042_Jacob Bourne -..> | 2026-01-09 12:38 | 150K | |
![[ ]](/icons/layout.gif) | 21547_Doors 4 You. P..> | 2025-12-01 16:18 | 150K | |
![[ ]](/icons/layout.gif) | 28405_UK Rollerdoors..> | 2025-12-22 08:22 | 150K | |
![[ ]](/icons/layout.gif) | 31910_TPS Gates & Do..> | 2026-01-09 08:59 | 150K | |
![[ ]](/icons/layout.gif) | 19251_Anthony Garth ..> | 2025-11-25 13:58 | 150K | |
![[ ]](/icons/layout.gif) | 22361_JJ Secure Door..> | 2025-12-03 11:11 | 150K | |
![[ ]](/icons/layout.gif) | 25424_G & H Windows ..> | 2025-12-12 08:56 | 150K | |
![[ ]](/icons/layout.gif) | 31511_Windoors Harol..> | 2026-01-08 09:58 | 150K | |
![[ ]](/icons/layout.gif) | 32081_Phil Page Phil..> | 2026-01-09 13:50 | 150K | |
![[ ]](/icons/layout.gif) | 27884_Phil Page Phil..> | 2025-12-18 13:49 | 150K | |
![[ ]](/icons/layout.gif) | 31903_TPS Gates & Do..> | 2026-01-09 08:55 | 150K | |
![[ ]](/icons/layout.gif) | 30000_AJ Trade Andre..> | 2026-01-05 09:10 | 150K | |
![[ ]](/icons/layout.gif) | 30955_L G Glazing Lt..> | 2026-01-07 07:49 | 150K | |
![[ ]](/icons/layout.gif) | 21171_Ceta Group Ltd..> | 2025-12-01 09:12 | 150K | |
![[ ]](/icons/layout.gif) | 22641_EcoGlaze Group..> | 2025-12-04 07:40 | 150K | |
![[ ]](/icons/layout.gif) | 23960_CWD Improvemen..> | 2025-12-08 15:04 | 150K | |
![[ ]](/icons/layout.gif) | 20775_Avon Automated..> | 2025-11-28 10:40 | 150K | |
![[ ]](/icons/layout.gif) | 25834_Entador System..> | 2025-12-12 16:44 | 150K | |
![[ ]](/icons/layout.gif) | 30098_Custom Access ..> | 2026-01-05 11:51 | 150K | |
![[ ]](/icons/layout.gif) | 31139_Bryan Thompson..> | 2026-01-07 13:24 | 150K | |
![[ ]](/icons/layout.gif) | 33142_Ideal Industri..> | 2026-01-14 11:07 | 150K | |
![[ ]](/icons/layout.gif) | 19636_Doors And Gate..> | 2025-11-26 08:24 | 150K | |
![[ ]](/icons/layout.gif) | 20730_EcoGlaze Group..> | 2025-11-28 10:02 | 150K | |
![[ ]](/icons/layout.gif) | 25816_Avon Automated..> | 2025-12-12 16:15 | 150K | |
![[ ]](/icons/layout.gif) | 32121_Oakley Windows..> | 2026-01-09 14:46 | 150K | |
![[ ]](/icons/layout.gif) | 32753_Terry Barker -..> | 2026-01-13 12:01 | 150K | |
![[ ]](/icons/layout.gif) | 20731_Garage Door Se..> | 2025-11-28 10:03 | 150K | |
![[ ]](/icons/layout.gif) | 32938_P & R Door Sys..> | 2026-01-13 15:46 | 150K | |
![[ ]](/icons/layout.gif) | 22295_Elevate Doors ..> | 2025-12-03 09:09 | 150K | |
![[ ]](/icons/layout.gif) | 24492_Doors 4 Garage..> | 2025-12-09 15:45 | 150K | |
![[ ]](/icons/layout.gif) | 27427_CWD Improvemen..> | 2025-12-17 13:12 | 150K | |
![[ ]](/icons/layout.gif) | 30064_Custom Access ..> | 2026-01-05 11:19 | 150K | |
![[ ]](/icons/layout.gif) | 20657_Ceta Group Ltd..> | 2025-11-28 08:36 | 150K | |
![[ ]](/icons/layout.gif) | 21469_Elevate Doors ..> | 2025-12-01 14:06 | 150K | |
![[ ]](/icons/layout.gif) | 22628_JJ Secure Door..> | 2025-12-03 16:53 | 150K | |
![[ ]](/icons/layout.gif) | 23962_CWD Improvemen..> | 2025-12-08 15:23 | 150K | |
![[ ]](/icons/layout.gif) | 30570_Marcus Akid - ..> | 2026-01-06 09:53 | 150K | |
![[ ]](/icons/layout.gif) | 19290_Shutter Tech U..> | 2025-11-25 14:31 | 150K | |
![[ ]](/icons/layout.gif) | 25183_CWD Improvemen..> | 2025-12-11 14:44 | 150K | |
![[ ]](/icons/layout.gif) | 26678_Thomas Andrew ..> | 2025-12-16 09:29 | 150K | |
![[ ]](/icons/layout.gif) | 19713_Fortress Doors..> | 2025-11-26 09:23 | 150K | |
![[ ]](/icons/layout.gif) | 23639_Mowbrey Partne..> | 2025-12-08 08:50 | 150K | |
![[ ]](/icons/layout.gif) | 18979_John Mayhew Jo..> | 2025-11-25 09:16 | 150K | |
![[ ]](/icons/layout.gif) | 24467_Lidget Compton..> | 2025-12-09 15:02 | 150K | |
![[ ]](/icons/layout.gif) | 21032_Rising Group L..> | 2025-11-28 15:55 | 150K | |
![[ ]](/icons/layout.gif) | 27926_Chelmsford Rol..> | 2025-12-18 14:51 | 150K | |
![[ ]](/icons/layout.gif) | 30469_Oakley Windows..> | 2026-01-06 08:28 | 150K | |
![[ ]](/icons/layout.gif) | 30482_Oakley Windows..> | 2026-01-06 08:51 | 150K | |
![[ ]](/icons/layout.gif) | 32612_PB Doors Paul ..> | 2026-01-13 09:44 | 150K | |
![[ ]](/icons/layout.gif) | 18852_Laura White - ..> | 2025-11-25 07:22 | 150K | |
![[ ]](/icons/layout.gif) | 20766_Avon Automated..> | 2025-11-28 10:33 | 150K | |
![[ ]](/icons/layout.gif) | 33074_Terry Barker -..> | 2026-01-14 09:41 | 150K | |
![[ ]](/icons/layout.gif) | 20653_Doors 4 Garage..> | 2025-11-28 08:29 | 150K | |
![[ ]](/icons/layout.gif) | 28051_G & H Windows ..> | 2025-12-19 08:14 | 150K | |
![[ ]](/icons/layout.gif) | 22385_Cerromar Solut..> | 2025-12-03 11:47 | 150K | |
![[ ]](/icons/layout.gif) | 30516_P & R Door Sys..> | 2026-01-06 09:20 | 150K | |
![[ ]](/icons/layout.gif) | 19940_Able Garage Do..> | 2025-11-26 13:54 | 150K | |
![[ ]](/icons/layout.gif) | 20418_ASSW Ltd BS10 ..> | 2025-11-27 12:30 | 150K | |
![[ ]](/icons/layout.gif) | 22332_Dream Installa..> | 2025-12-03 09:51 | 150K | |
![[ ]](/icons/layout.gif) | 22412_JJ Secure Door..> | 2025-12-03 12:29 | 150K | |
![[ ]](/icons/layout.gif) | 29565_Fortress Doors..> | 2026-01-02 08:13 | 150K | |
![[ ]](/icons/layout.gif) | 29682_Fortress Doors..> | 2026-01-02 10:04 | 150K | |
![[ ]](/icons/layout.gif) | 33086_Fortress Doors..> | 2026-01-14 10:03 | 150K | |
![[ ]](/icons/layout.gif) | 20141_WADE WINDOWS I..> | 2025-11-27 09:20 | 150K | |
![[ ]](/icons/layout.gif) | 22053_The Lothian Ga..> | 2025-12-02 13:59 | 150K | |
![[ ]](/icons/layout.gif) | 23594_R L Roller Doo..> | 2025-12-08 08:08 | 150K | |
![[ ]](/icons/layout.gif) | 23704_Fortress Doors..> | 2025-12-08 10:05 | 150K | |
![[ ]](/icons/layout.gif) | 24595_Fortress Doors..> | 2025-12-10 07:33 | 150K | |
![[ ]](/icons/layout.gif) | 32360_Dream Installa..> | 2026-01-12 11:13 | 150K | |
![[ ]](/icons/layout.gif) | 30291_Kris Jones Kri..> | 2026-01-05 15:14 | 150K | |
![[ ]](/icons/layout.gif) | 30758_Eclipse Doors ..> | 2026-01-06 12:44 | 150K | |
![[ ]](/icons/layout.gif) | 31226_CWD Improvemen..> | 2026-01-07 15:10 | 150K | |
![[ ]](/icons/layout.gif) | 32333_Oakley Windows..> | 2026-01-12 11:00 | 150K | |
![[ ]](/icons/layout.gif) | 33082_Fortress Doors..> | 2026-01-14 09:56 | 150K | |
![[ ]](/icons/layout.gif) | 23866_Brightside Kit..> | 2025-12-08 12:48 | 150K | |
![[ ]](/icons/layout.gif) | 28394_Doorolla Ltd S..> | 2025-12-19 16:52 | 150K | |
![[ ]](/icons/layout.gif) | 31010_Go Garage Door..> | 2026-01-07 09:02 | 150K | |
![[ ]](/icons/layout.gif) | 19107_Keswick Develo..> | 2025-11-25 12:54 | 150K | |
![[ ]](/icons/layout.gif) | 19366_Doorflex Produ..> | 2025-11-25 15:46 | 150K | |
![[ ]](/icons/layout.gif) | 23697_Fortress Doors..> | 2025-12-08 10:00 | 150K | |
![[ ]](/icons/layout.gif) | 21633_Avon Automated..> | 2025-12-02 07:56 | 150K | |
![[ ]](/icons/layout.gif) | 22933_EcoGlaze Group..> | 2025-12-04 13:23 | 150K | |
![[ ]](/icons/layout.gif) | 21030_Cotswold Conse..> | 2025-11-28 15:53 | 150K | |
![[ ]](/icons/layout.gif) | 24440_CWD Improvemen..> | 2025-12-09 14:22 | 150K | |
![[ ]](/icons/layout.gif) | 30533_Custom Access ..> | 2026-01-06 09:38 | 150K | |
![[ ]](/icons/layout.gif) | 20479_St Helens Upvc..> | 2025-11-27 14:54 | 150K | |
![[ ]](/icons/layout.gif) | 20480_St Helens Upvc..> | 2025-11-27 14:55 | 150K | |
![[ ]](/icons/layout.gif) | 27546_SDS (Isle Of M..> | 2025-12-17 16:26 | 150K | |
![[ ]](/icons/layout.gif) | 30094_Kris Jones Kri..> | 2026-01-05 11:50 | 150K | |
![[ ]](/icons/layout.gif) | 31154_P & R Door Sys..> | 2026-01-07 13:39 | 150K | |
![[ ]](/icons/layout.gif) | 32132_Proud 2 Fix Ma..> | 2026-01-09 15:24 | 150K | |
![[ ]](/icons/layout.gif) | 32891_CWD Improvemen..> | 2026-01-13 13:59 | 150K | |
![[ ]](/icons/layout.gif) | 18636_Ace Garage Doo..> | 2025-11-24 13:32 | 150K | |
![[ ]](/icons/layout.gif) | 21529_Fortress Doors..> | 2025-12-01 15:41 | 150K | |
![[ ]](/icons/layout.gif) | 22311_Fortress Doors..> | 2025-12-03 09:29 | 150K | |
![[ ]](/icons/layout.gif) | 30530_Serenade Home ..> | 2026-01-06 09:35 | 150K | |
![[ ]](/icons/layout.gif) | 21652_Avon Automated..> | 2025-12-02 08:04 | 150K | |
![[ ]](/icons/layout.gif) | 32321_Thomas Andrew ..> | 2026-01-12 10:26 | 150K | |
![[ ]](/icons/layout.gif) | 33081_Simon Chase Do..> | 2026-01-14 09:54 | 150K | |
![[ ]](/icons/layout.gif) | 25179_Eclipse Doors ..> | 2025-12-11 14:23 | 150K | |
![[ ]](/icons/layout.gif) | 32681_Thomas Andrew ..> | 2026-01-13 11:11 | 150K | |
![[ ]](/icons/layout.gif) | 32810_Sigma Doors & ..> | 2026-01-13 12:48 | 150K | |
![[ ]](/icons/layout.gif) | 23644_Mowbrey Partne..> | 2025-12-08 08:55 | 150K | |
![[ ]](/icons/layout.gif) | 24288_Regal Windows ..> | 2025-12-09 11:19 | 150K | |
![[ ]](/icons/layout.gif) | 32065_Elevate Doors ..> | 2026-01-09 13:21 | 150K | |
![[ ]](/icons/layout.gif) | 32152_Proud 2 Fix Ma..> | 2026-01-09 15:47 | 150K | |
![[ ]](/icons/layout.gif) | 32445_Automated Acce..> | 2026-01-12 16:18 | 150K | |
![[ ]](/icons/layout.gif) | 18988_Dream Installa..> | 2025-11-25 09:35 | 150K | |
![[ ]](/icons/layout.gif) | 24780_J Brady Garage..> | 2025-12-10 15:34 | 150K | |
![[ ]](/icons/layout.gif) | 28302_Fortress Doors..> | 2025-12-19 14:34 | 150K | |
![[ ]](/icons/layout.gif) | 19301_Shutter Tech U..> | 2025-11-25 14:44 | 150K | |
![[ ]](/icons/layout.gif) | 23656_BBA Developmen..> | 2025-12-08 09:09 | 150K | |
![[ ]](/icons/layout.gif) | 32797_Sigma Doors & ..> | 2026-01-13 12:44 | 150K | |
![[ ]](/icons/layout.gif) | 19477_Doorflex Produ..> | 2025-11-25 16:29 | 150K | |
![[ ]](/icons/layout.gif) | 20655_Chelmsford Rol..> | 2025-11-28 08:35 | 150K | |
![[ ]](/icons/layout.gif) | 23581_The Lothian Ga..> | 2025-12-05 16:34 | 150K | |
![[ ]](/icons/layout.gif) | 23666_P & R Door Sys..> | 2025-12-08 09:22 | 150K | |
![[ ]](/icons/layout.gif) | 25208_Herts & Essex ..> | 2025-12-11 15:34 | 150K | |
![[ ]](/icons/layout.gif) | 20484_AJ Trade Andre..> | 2025-11-27 15:08 | 150K | |
![[ ]](/icons/layout.gif) | 20857_Doorolla Ltd S..> | 2025-11-28 11:54 | 150K | |
![[ ]](/icons/layout.gif) | 20980_Cotswold Conse..> | 2025-11-28 15:25 | 150K | |
![[ ]](/icons/layout.gif) | 21543_BBA Developmen..> | 2025-12-01 16:08 | 150K | |
![[ ]](/icons/layout.gif) | 23662_P & R Door Sys..> | 2025-12-08 09:16 | 150K | |
![[ ]](/icons/layout.gif) | 19604_Doorflex Produ..> | 2025-11-26 07:52 | 150K | |
![[ ]](/icons/layout.gif) | 21154_MJS Installati..> | 2025-12-01 08:54 | 150K | |
![[ ]](/icons/layout.gif) | 22638_EcoGlaze Group..> | 2025-12-04 07:29 | 150K | |
![[ ]](/icons/layout.gif) | 29732_Avon Automated..> | 2026-01-02 11:30 | 150K | |
![[ ]](/icons/layout.gif) | 32624_Scotia Garage ..> | 2026-01-13 10:38 | 150K | |
![[ ]](/icons/layout.gif) | 19998_AM Shutters St..> | 2025-11-26 15:42 | 150K | |
![[ ]](/icons/layout.gif) | 22541_Fortress Doors..> | 2025-12-03 13:59 | 150K | |
![[ ]](/icons/layout.gif) | 23188_J Brady Garage..> | 2025-12-05 07:48 | 150K | |
![[ ]](/icons/layout.gif) | 18655_Dream Installa..> | 2025-11-24 13:51 | 150K | |
![[ ]](/icons/layout.gif) | 25463_Warsash Window..> | 2025-12-12 10:33 | 150K | |
![[ ]](/icons/layout.gif) | 32597_Eclipse Doors ..> | 2026-01-13 09:16 | 150K | |
![[ ]](/icons/layout.gif) | 21472_BBA Developmen..> | 2025-12-01 14:16 | 150K | |
![[ ]](/icons/layout.gif) | 31819_J Brady Garage..> | 2026-01-08 16:42 | 150K | |
![[ ]](/icons/layout.gif) | 32563_Jurassic Doors..> | 2026-01-13 08:54 | 150K | |
![[ ]](/icons/layout.gif) | 21040_Rising Group L..> | 2025-11-28 16:13 | 150K | |
![[ ]](/icons/layout.gif) | 21542_Fortress Doors..> | 2025-12-01 16:05 | 150K | |
![[ ]](/icons/layout.gif) | 21548_Fortress Doors..> | 2025-12-01 16:22 | 150K | |
![[ ]](/icons/layout.gif) | 22326_Fortress Doors..> | 2025-12-03 09:40 | 150K | |
![[ ]](/icons/layout.gif) | 26481_Solidfix Home ..> | 2025-12-15 14:15 | 150K | |
![[ ]](/icons/layout.gif) | 30849_Wellingborough..> | 2026-01-06 15:03 | 150K | |
![[ ]](/icons/layout.gif) | 20616_Warnsham Windo..> | 2025-11-28 08:02 | 150K | |
![[ ]](/icons/layout.gif) | 23182_The Handyman C..> | 2025-12-04 17:04 | 150K | |
![[ ]](/icons/layout.gif) | 27121_Whitburn Joine..> | 2025-12-16 16:52 | 150K | |
![[ ]](/icons/layout.gif) | 30561_Marcus Akid - ..> | 2026-01-06 09:49 | 150K | |
![[ ]](/icons/layout.gif) | 31102_Rhino Windows ..> | 2026-01-07 11:10 | 150K | |
![[ ]](/icons/layout.gif) | 31869_Ace Garage Doo..> | 2026-01-09 08:04 | 150K | |
![[ ]](/icons/layout.gif) | 32250_Ace Garage Doo..> | 2026-01-12 09:04 | 150K | |
![[ ]](/icons/layout.gif) | 30802_Wiltshire Gara..> | 2026-01-06 14:07 | 150K | |
![[ ]](/icons/layout.gif) | 21631_Fortress Doors..> | 2025-12-02 07:47 | 150K | |
![[ ]](/icons/layout.gif) | 23124_Proud 2 Fix Ma..> | 2025-12-04 15:37 | 150K | |
![[ ]](/icons/layout.gif) | 23567_Doorolla Ltd S..> | 2025-12-05 15:51 | 150K | |
![[ ]](/icons/layout.gif) | 25752_Solidfix Home ..> | 2025-12-12 14:55 | 150K | |
![[ ]](/icons/layout.gif) | 32114_CWD Improvemen..> | 2026-01-09 14:40 | 150K | |
![[ ]](/icons/layout.gif) | 32173_Go Garage Door..> | 2026-01-09 16:18 | 150K | |
![[ ]](/icons/layout.gif) | 32620_Scotia Garage ..> | 2026-01-13 10:34 | 150K | |
![[ ]](/icons/layout.gif) | 27377_Entador System..> | 2025-12-17 11:20 | 150K | |
![[ ]](/icons/layout.gif) | 30658_Oakley Windows..> | 2026-01-06 11:34 | 150K | |
![[ ]](/icons/layout.gif) | 31816_Shutter Tech U..> | 2026-01-08 16:32 | 150K | |
![[ ]](/icons/layout.gif) | 19346_Keswick Develo..> | 2025-11-25 15:31 | 150K | |
![[ ]](/icons/layout.gif) | 20833_Doorolla Ltd S..> | 2025-11-28 11:28 | 150K | |
![[ ]](/icons/layout.gif) | 24506_Evans Building..> | 2025-12-09 16:08 | 150K | |
![[ ]](/icons/layout.gif) | 24774_J Brady Garage..> | 2025-12-10 15:15 | 150K | |
![[ ]](/icons/layout.gif) | 28611_Windowcraft De..> | 2025-12-22 13:06 | 150K | |
![[ ]](/icons/layout.gif) | 30644_CWG Home Impro..> | 2026-01-06 11:20 | 150K | |
![[ ]](/icons/layout.gif) | 32970_Wiltshire Gara..> | 2026-01-14 07:51 | 150K | |
![[ ]](/icons/layout.gif) | 19253_EcoGlaze Group..> | 2025-11-25 13:59 | 150K | |
![[ ]](/icons/layout.gif) | 19991_TCR Sussex Ltd..> | 2025-11-26 14:50 | 150K | |
![[ ]](/icons/layout.gif) | 23874_Brightside Kit..> | 2025-12-08 13:15 | 150K | |
![[ ]](/icons/layout.gif) | 28149_Whitburn Joine..> | 2025-12-19 10:37 | 150K | |
![[ ]](/icons/layout.gif) | 19322_Scotia Garage ..> | 2025-11-25 15:06 | 150K | |
![[ ]](/icons/layout.gif) | 18816_1st Shield Dar..> | 2025-11-24 16:27 | 150K | |
![[ ]](/icons/layout.gif) | 23579_The Lothian Ga..> | 2025-12-05 16:19 | 150K | |
![[ ]](/icons/layout.gif) | 32899_Wiltshire Gara..> | 2026-01-13 14:12 | 150K | |
![[ ]](/icons/layout.gif) | 32908_Entador System..> | 2026-01-13 14:36 | 150K | |
![[ ]](/icons/layout.gif) | 21287_Fortress Doors..> | 2025-12-01 10:33 | 150K | |
![[ ]](/icons/layout.gif) | 24804_Doors 4 Garage..> | 2025-12-10 16:14 | 150K | |
![[ ]](/icons/layout.gif) | 32887_Avon Automated..> | 2026-01-13 13:55 | 150K | |
![[ ]](/icons/layout.gif) | 39926_My Garage Door..> | 2026-02-03 12:22 | 150K | |
![[ ]](/icons/layout.gif) | 24444_Taundry Doors ..> | 2025-12-09 14:29 | 150K | |
![[ ]](/icons/layout.gif) | 18683_Faith Home Imp..> | 2025-11-24 14:05 | 150K | |
![[ ]](/icons/layout.gif) | 24504_Evans Building..> | 2025-12-09 16:07 | 150K | |
![[ ]](/icons/layout.gif) | 29012_Doors Shutters..> | 2025-12-23 11:33 | 150K | |
![[ ]](/icons/layout.gif) | 31077_Elevate Doors ..> | 2026-01-07 10:21 | 150K | |
![[ ]](/icons/layout.gif) | 21036_Cotswold Conse..> | 2025-11-28 16:02 | 150K | |
![[ ]](/icons/layout.gif) | 30542_Tru-Fit Windo..> | 2026-01-06 09:46 | 150K | |
![[ ]](/icons/layout.gif) | 24796_M. A. E. Windo..> | 2025-12-10 16:00 | 150K | |
![[ ]](/icons/layout.gif) | 27829_Go Garage Door..> | 2025-12-18 13:24 | 150K | |
![[ ]](/icons/layout.gif) | 32442_Ace Garage Doo..> | 2026-01-12 16:08 | 150K | |
![[ ]](/icons/layout.gif) | 21158_Elegant Window..> | 2025-12-01 09:01 | 150K | |
![[ ]](/icons/layout.gif) | 21303_Avon Automated..> | 2025-12-01 10:48 | 150K | |
![[ ]](/icons/layout.gif) | 23578_Doorolla Ltd S..> | 2025-12-05 16:04 | 150K | |
![[ ]](/icons/layout.gif) | 52816_Liam Walker - ..> | 2026-03-09 15:35 | 150K | |
![[ ]](/icons/layout.gif) | 20565_Eclipse Doors ..> | 2025-11-27 16:43 | 150K | |
![[ ]](/icons/layout.gif) | 23647_Mowbrey Partne..> | 2025-12-08 09:01 | 150K | |
![[ ]](/icons/layout.gif) | 20742_S Warrender El..> | 2025-11-28 10:15 | 150K | |
![[ ]](/icons/layout.gif) | 21519_Fortress Doors..> | 2025-12-01 15:34 | 150K | |
![[ ]](/icons/layout.gif) | 22309_Fortress Doors..> | 2025-12-03 09:25 | 150K | |
![[ ]](/icons/layout.gif) | 31400_Doors Shutters..> | 2026-01-08 08:32 | 150K | |
![[ ]](/icons/layout.gif) | 19252_Anthony Garth ..> | 2025-11-25 13:58 | 150K | |
![[ ]](/icons/layout.gif) | 19909_EcoGlaze Group..> | 2025-11-26 12:08 | 150K | |
![[ ]](/icons/layout.gif) | 20172_J Brady Garage..> | 2025-11-27 09:54 | 150K | |
![[ ]](/icons/layout.gif) | 21697_Windowcraft De..> | 2025-12-02 08:51 | 150K | |
![[ ]](/icons/layout.gif) | 30060_M. A. E. Windo..> | 2026-01-05 11:14 | 150K | |
![[ ]](/icons/layout.gif) | 30421_Garage Door An..> | 2026-01-05 16:43 | 150K | |
![[ ]](/icons/layout.gif) | 31411_Doors Shutters..> | 2026-01-08 08:36 | 150K | |
![[ ]](/icons/layout.gif) | 32174_Wellingborough..> | 2026-01-09 16:27 | 150K | |
![[ ]](/icons/layout.gif) | 33038_Entador System..> | 2026-01-14 09:07 | 150K | |
![[ ]](/icons/layout.gif) | 33128_Rollerdoors 24..> | 2026-01-14 10:57 | 150K | |
![[ ]](/icons/layout.gif) | 19011_Replacement Ga..> | 2025-11-25 10:30 | 150K | |
![[ ]](/icons/layout.gif) | 24195_Doors 4 You Lt..> | 2025-12-09 09:49 | 150K | |
![[ ]](/icons/layout.gif) | 24197_Doors 4 You Lt..> | 2025-12-09 09:51 | 150K | |
![[ ]](/icons/layout.gif) | 23783_The Lothian Ga..> | 2025-12-08 11:07 | 150K | |
![[ ]](/icons/layout.gif) | 25138_Evans Building..> | 2025-12-11 13:16 | 150K | |
![[ ]](/icons/layout.gif) | 20556_Eastern Frames..> | 2025-11-27 16:29 | 150K | |
![[ ]](/icons/layout.gif) | 26462_DP Installatio..> | 2025-12-15 13:52 | 150K | |
![[ ]](/icons/layout.gif) | 27825_Warnsham Windo..> | 2025-12-18 13:01 | 150K | |
![[ ]](/icons/layout.gif) | 27113_Oakley Windows..> | 2025-12-16 16:48 | 150K | |
![[ ]](/icons/layout.gif) | 24778_J Brady Garage..> | 2025-12-10 15:22 | 150K | |
![[ ]](/icons/layout.gif) | 20762_Elegant Window..> | 2025-11-28 10:25 | 150K | |
![[ ]](/icons/layout.gif) | 32987_Rollermatic Ga..> | 2026-01-14 08:19 | 150K | |
![[ ]](/icons/layout.gif) | 32549_Chelmsford Rol..> | 2026-01-13 08:50 | 150K | |
![[ ]](/icons/layout.gif) | 31695_Bryan Thompson..> | 2026-01-08 13:38 | 150K | |
![[ ]](/icons/layout.gif) | 22841_Rollermatic Ga..> | 2025-12-04 11:34 | 150K | |
![[ ]](/icons/layout.gif) | 23622_EcoGlaze Group..> | 2025-12-08 08:38 | 150K | |
![[ ]](/icons/layout.gif) | 31904_TPS Gates & Do..> | 2026-01-09 08:55 | 150K | |
![[ ]](/icons/layout.gif) | 20154_Replacement Ga..> | 2025-11-27 09:37 | 150K | |
![[ ]](/icons/layout.gif) | 31453_Rhino Windows ..> | 2026-01-08 09:09 | 150K | |
![[ ]](/icons/layout.gif) | 32098_Elevate Doors ..> | 2026-01-09 14:14 | 150K | |
![[ ]](/icons/layout.gif) | 19293_Wellingborough..> | 2025-11-25 14:38 | 150K | |
![[ ]](/icons/layout.gif) | 30844_Stapletons Loc..> | 2026-01-06 14:44 | 150K | |
![[ ]](/icons/layout.gif) | 20705_Rhino Windows ..> | 2025-11-28 09:35 | 150K | |
![[ ]](/icons/layout.gif) | 22714_Dream Installa..> | 2025-12-04 08:57 | 150K | |
![[ ]](/icons/layout.gif) | 30451_Go Garage Door..> | 2026-01-06 08:03 | 150K | |
![[ ]](/icons/layout.gif) | 32952_P & R Door Sys..> | 2026-01-13 16:11 | 150K | |
![[ ]](/icons/layout.gif) | 32998_Rollermatic Ga..> | 2026-01-14 08:24 | 150K | |
![[ ]](/icons/layout.gif) | 28234_Ideal Industri..> | 2025-12-19 12:12 | 150K | |
![[ ]](/icons/layout.gif) | 28242_Ideal Industri..> | 2025-12-19 12:22 | 150K | |
![[ ]](/icons/layout.gif) | 31136_Chelmsford Rol..> | 2026-01-07 13:15 | 150K | |
![[ ]](/icons/layout.gif) | 20101_Doors 4 Garage..> | 2025-11-27 08:30 | 150K | |
![[ ]](/icons/layout.gif) | 22252_Avon Automated..> | 2025-12-03 08:20 | 150K | |
![[ ]](/icons/layout.gif) | 31424_Hanney Glazed ..> | 2026-01-08 08:44 | 150K | |
![[ ]](/icons/layout.gif) | 30146_SW Trade Frame..> | 2026-01-05 12:40 | 150K | |
![[ ]](/icons/layout.gif) | 32954_All Door Engin..> | 2026-01-13 16:18 | 150K | |
![[ ]](/icons/layout.gif) | 20554_Eastern Frames..> | 2025-11-27 16:24 | 150K | |
![[ ]](/icons/layout.gif) | 20851_Doorolla Ltd S..> | 2025-11-28 11:49 | 150K | |
![[ ]](/icons/layout.gif) | 30645_Rollermatic Ga..> | 2026-01-06 11:21 | 150K | |
![[ ]](/icons/layout.gif) | 31024_Go Garage Door..> | 2026-01-07 09:23 | 150K | |
![[ ]](/icons/layout.gif) | 32980_Rollermatic Ga..> | 2026-01-14 08:10 | 150K | |
![[ ]](/icons/layout.gif) | 21338_NBG Doors Nick..> | 2025-12-01 11:59 | 150K | |
![[ ]](/icons/layout.gif) | 24537_Chelmsford Rol..> | 2025-12-09 16:40 | 150K | |
![[ ]](/icons/layout.gif) | 32793_Wokingham Glaz..> | 2026-01-13 12:37 | 150K | |
![[ ]](/icons/layout.gif) | 32795_Wokingham Glaz..> | 2026-01-13 12:40 | 150K | |
![[ ]](/icons/layout.gif) | 24434_EcoGlaze Group..> | 2025-12-09 14:04 | 150K | |
![[ ]](/icons/layout.gif) | 23961_Garage Door So..> | 2025-12-08 15:10 | 150K | |
![[ ]](/icons/layout.gif) | 28549_Elevate Doors ..> | 2025-12-22 11:39 | 150K | |
![[ ]](/icons/layout.gif) | 20037_Window Repair ..> | 2025-11-26 16:52 | 150K | |
![[ ]](/icons/layout.gif) | 21453_Doors 4 Garage..> | 2025-12-01 13:41 | 150K | |
![[ ]](/icons/layout.gif) | 22234_Heavy Metal En..> | 2025-12-03 07:18 | 150K | |
![[ ]](/icons/layout.gif) | 31110_Garage Doors 2..> | 2026-01-07 11:48 | 150K | |
![[ ]](/icons/layout.gif) | 20182_The Lothian Ga..> | 2025-11-27 10:05 | 150K | |
![[ ]](/icons/layout.gif) | 19047_Eastern Frames..> | 2025-11-25 11:06 | 150K | |
![[ ]](/icons/layout.gif) | 24794_Fortress Doors..> | 2025-12-10 15:57 | 150K | |
![[ ]](/icons/layout.gif) | 25107_Elevate Doors ..> | 2025-12-11 13:01 | 150K | |
![[ ]](/icons/layout.gif) | 30374_Garage Doors 2..> | 2026-01-05 16:25 | 150K | |
![[ ]](/icons/layout.gif) | 33028_P & R Door Sys..> | 2026-01-14 09:01 | 150K | |
![[ ]](/icons/layout.gif) | 30661_Elite Glazing ..> | 2026-01-06 11:35 | 150K | |
![[ ]](/icons/layout.gif) | 23531_Chelmsford Rol..> | 2025-12-05 15:28 | 150K | |
![[ ]](/icons/layout.gif) | 21328_NBG Doors Nick..> | 2025-12-01 11:46 | 150K | |
![[ ]](/icons/layout.gif) | 23461_Next Generatio..> | 2025-12-05 12:49 | 150K | |
![[ ]](/icons/layout.gif) | 31595_Wellingborough..> | 2026-01-08 11:31 | 150K | |
![[ ]](/icons/layout.gif) | 31814_Wellingborough..> | 2026-01-08 16:26 | 150K | |
![[ ]](/icons/layout.gif) | 20039_Window Repair ..> | 2025-11-26 16:55 | 150K | |
![[ ]](/icons/layout.gif) | 30808_Moran Windows ..> | 2026-01-06 14:15 | 150K | |
![[ ]](/icons/layout.gif) | 33060_Absolute Garag..> | 2026-01-14 09:25 | 150K | |
![[ ]](/icons/layout.gif) | 21461_Garage Door So..> | 2025-12-01 13:52 | 150K | |
![[ ]](/icons/layout.gif) | 31033_Go Garage Door..> | 2026-01-07 09:33 | 150K | |
![[ ]](/icons/layout.gif) | 31120_Garage Doors 2..> | 2026-01-07 12:15 | 150K | |
![[ ]](/icons/layout.gif) | 33050_Wokingham Glaz..> | 2026-01-14 09:18 | 150K | |
![[ ]](/icons/layout.gif) | 31099_Go Garage Door..> | 2026-01-07 10:42 | 150K | |
![[ ]](/icons/layout.gif) | 32175_Doors 4 You Lt..> | 2026-01-09 16:42 | 150K | |
![[ ]](/icons/layout.gif) | 32978_Replacement Ga..> | 2026-01-14 07:55 | 150K | |
![[ ]](/icons/layout.gif) | 26163_Chelmsford Rol..> | 2025-12-15 08:14 | 150K | |
![[ ]](/icons/layout.gif) | 31243_Wellingborough..> | 2026-01-07 15:45 | 150K | |
![[ ]](/icons/layout.gif) | 32178_Chelmsford Rol..> | 2026-01-09 16:55 | 150K | |
![[ ]](/icons/layout.gif) | 31103_Rhino Windows ..> | 2026-01-07 11:17 | 150K | |
![[ ]](/icons/layout.gif) | 32447_Replacement Ga..> | 2026-01-12 16:19 | 150K | |
![[ ]](/icons/layout.gif) | 32743_Herts & Essex ..> | 2026-01-13 11:46 | 150K | |
![[ ]](/icons/layout.gif) | 22851_Rollermatic Ga..> | 2025-12-04 11:52 | 150K | |
![[ ]](/icons/layout.gif) | 21160_Scotia Garage ..> | 2025-12-01 09:02 | 150K | |
![[ ]](/icons/layout.gif) | 26328_L W Bennion Bu..> | 2025-12-15 12:49 | 150K | |
![[ ]](/icons/layout.gif) | 33099_Camberley Wind..> | 2026-01-14 10:21 | 150K | |
![[ ]](/icons/layout.gif) | 19550_Cartwright Win..> | 2025-11-25 17:02 | 150K | |
![[ ]](/icons/layout.gif) | 22024_CPS Custom Pro..> | 2025-12-02 13:16 | 150K | |
![[ ]](/icons/layout.gif) | 32892_CWD Improvemen..> | 2026-01-13 14:00 | 150K | |
![[ ]](/icons/layout.gif) | 33049_Go Direct Door..> | 2026-01-14 09:17 | 150K | |
![[ ]](/icons/layout.gif) | 20927_Scotia Garage ..> | 2025-11-28 13:39 | 150K | |
![[ ]](/icons/layout.gif) | 23752_The Lothian Ga..> | 2025-12-08 10:42 | 150K | |
![[ ]](/icons/layout.gif) | 32022_J Brady Garage..> | 2026-01-09 12:00 | 150K | |
![[ ]](/icons/layout.gif) | 29114_J Brady Garage..> | 2025-12-23 14:28 | 150K | |
![[ ]](/icons/layout.gif) | 32548_Go Garage Door..> | 2026-01-13 08:49 | 150K | |
![[ ]](/icons/layout.gif) | 28287_Rollermatic Ga..> | 2025-12-19 14:28 | 150K | |
![[ ]](/icons/layout.gif) | 31104_Rhino Windows ..> | 2026-01-07 11:27 | 150K | |
![[ ]](/icons/layout.gif) | 27088_Warnsham Windo..> | 2025-12-16 16:33 | 150K | |
![[ ]](/icons/layout.gif) | 30302_Warnsham Windo..> | 2026-01-05 15:31 | 150K | |
![[ ]](/icons/layout.gif) | 31532_M. A. E. Windo..> | 2026-01-08 10:37 | 150K | |
![[ ]](/icons/layout.gif) | 30812_Moran Windows ..> | 2026-01-06 14:18 | 150K | |
![[ ]](/icons/layout.gif) | 30820_Moran Windows ..> | 2026-01-06 14:19 | 150K | |
![[ ]](/icons/layout.gif) | 33040_Go Direct Door..> | 2026-01-14 09:08 | 150K | |
![[ ]](/icons/layout.gif) | 30853_M. A. E. Windo..> | 2026-01-06 15:07 | 150K | |
![[ ]](/icons/layout.gif) | 31101_Rhino Windows ..> | 2026-01-07 11:01 | 150K | |
![[ ]](/icons/layout.gif) | 32754_Terry Barker -..> | 2026-01-13 12:02 | 150K | |
![[ ]](/icons/layout.gif) | 20084_Wellingborough..> | 2025-11-27 08:18 | 150K | |
![[ ]](/icons/layout.gif) | 20561_Eastern Frames..> | 2025-11-27 16:39 | 150K | |
![[ ]](/icons/layout.gif) | 31622_Warnsham Windo..> | 2026-01-08 12:05 | 150K | |
![[ ]](/icons/layout.gif) | 31868_Windowcraft De..> | 2026-01-09 07:59 | 150K | |
![[ ]](/icons/layout.gif) | 32940_P & R Door Sys..> | 2026-01-13 15:47 | 150K | |
![[ ]](/icons/layout.gif) | 32941_P & R Door Sys..> | 2026-01-13 15:47 | 150K | |
![[ ]](/icons/layout.gif) | 23775_The Lothian Ga..> | 2025-12-08 11:02 | 150K | |
![[ ]](/icons/layout.gif) | 24518_Avon Automated..> | 2025-12-09 16:15 | 150K | |
![[ ]](/icons/layout.gif) | 25789_The Lothian Ga..> | 2025-12-12 15:30 | 150K | |
![[ ]](/icons/layout.gif) | 22590_Garage Door So..> | 2025-12-03 14:52 | 150K | |
![[ ]](/icons/layout.gif) | 29241_Securi-Doors S..> | 2025-12-24 09:46 | 150K | |
![[ ]](/icons/layout.gif) | 24438_Oakmont Door S..> | 2025-12-09 14:16 | 150K | |
![[ ]](/icons/layout.gif) | 27773_Elevate Doors ..> | 2025-12-18 11:40 | 150K | |
![[ ]](/icons/layout.gif) | 19859_EcoGlaze Group..> | 2025-11-26 11:52 | 150K | |
![[ ]](/icons/layout.gif) | 20610_J Bowman Garag..> | 2025-11-28 07:50 | 150K | |
![[ ]](/icons/layout.gif) | 26325_L W Bennion Bu..> | 2025-12-15 12:47 | 150K | |
![[ ]](/icons/layout.gif) | 31799_Moran Windows ..> | 2026-01-08 15:41 | 150K | |
![[ ]](/icons/layout.gif) | 23646_Chelmsford Rol..> | 2025-12-08 08:58 | 150K | |
![[ ]](/icons/layout.gif) | 22909_East Anglia Ro..> | 2025-12-04 12:42 | 150K | |
![[ ]](/icons/layout.gif) | 24408_East Anglia Ro..> | 2025-12-09 13:03 | 150K | |
![[ ]](/icons/layout.gif) | 25304_Fortress Doors..> | 2025-12-11 16:26 | 150K | |
![[ ]](/icons/layout.gif) | 32610_Chelmsford Rol..> | 2026-01-13 09:28 | 150K | |
![[ ]](/icons/layout.gif) | 26645_SDS (Isle Of M..> | 2025-12-16 08:23 | 150K | |
![[ ]](/icons/layout.gif) | 25318_Rhino Windows ..> | 2025-12-11 16:50 | 150K | |
![[ ]](/icons/layout.gif) | 20191_The Lothian Ga..> | 2025-11-27 10:18 | 151K | |
![[ ]](/icons/layout.gif) | 28477_Chelmsford Rol..> | 2025-12-22 09:24 | 151K | |
![[ ]](/icons/layout.gif) | 24542_Go Garage Door..> | 2025-12-09 16:53 | 151K | |
![[ ]](/icons/layout.gif) | 31503_Windoors Harol..> | 2026-01-08 09:46 | 151K | |
![[ ]](/icons/layout.gif) | 20186_The Lothian Ga..> | 2025-11-27 10:10 | 151K | |
![[ ]](/icons/layout.gif) | 19936_Elevate Doors ..> | 2025-11-26 13:45 | 151K | |
![[ ]](/icons/layout.gif) | 20127_SDL DOOR REPAI..> | 2025-11-27 08:57 | 151K | |
![[ ]](/icons/layout.gif) | 21674_Eclipse Doors ..> | 2025-12-02 08:30 | 151K | |
![[ ]](/icons/layout.gif) | 32214_The Lothian Ga..> | 2026-01-12 08:16 | 151K | |
![[ ]](/icons/layout.gif) | 20652_Oakley Windows..> | 2025-11-28 08:25 | 151K | |
![[ ]](/icons/layout.gif) | 28716_Rollermatic Ga..> | 2025-12-22 14:55 | 151K | |
![[ ]](/icons/layout.gif) | 33092_Camberley Wind..> | 2026-01-14 10:11 | 151K | |
![[ ]](/icons/layout.gif) | 25477_CPS Custom Pro..> | 2025-12-12 10:48 | 151K | |
![[ ]](/icons/layout.gif) | 29906_Chelmsford Rol..> | 2026-01-02 16:38 | 151K | |
![[ ]](/icons/layout.gif) | 18637_Ace Garage Doo..> | 2025-11-24 13:32 | 151K | |
![[ ]](/icons/layout.gif) | 22632_Cerromar Solut..> | 2025-12-04 07:16 | 151K | |
![[ ]](/icons/layout.gif) | 31517_LNR Door Solut..> | 2026-01-08 10:16 | 151K | |
![[ ]](/icons/layout.gif) | 20437_Wellingborough..> | 2025-11-27 13:43 | 151K | |
![[ ]](/icons/layout.gif) | 32153_Proud 2 Fix Ma..> | 2026-01-09 15:47 | 151K | |
![[ ]](/icons/layout.gif) | 18989_Dream Installa..> | 2025-11-25 09:36 | 151K | |
![[ ]](/icons/layout.gif) | 28531_Elevate Doors ..> | 2025-12-22 11:02 | 151K | |
![[ ]](/icons/layout.gif) | 33124_Warnsham Windo..> | 2026-01-14 10:49 | 151K | |
![[ ]](/icons/layout.gif) | 31615_Avon Automated..> | 2026-01-08 11:57 | 151K | |
![[ ]](/icons/layout.gif) | 34779_RnR Home Impro..> | 2026-01-19 15:10 | 151K | |
![[ ]](/icons/layout.gif) | 30466_Adams Industri..> | 2026-01-06 08:25 | 151K | |
![[ ]](/icons/layout.gif) | 27040_Garage Door So..> | 2025-12-16 15:51 | 151K | |
![[ ]](/icons/layout.gif) | 22413_Elevate Doors ..> | 2025-12-03 12:30 | 151K | |
![[ ]](/icons/layout.gif) | 23118_Secured Door &..> | 2025-12-04 15:30 | 151K | |
![[ ]](/icons/layout.gif) | 23186_Secured Door &..> | 2025-12-05 07:38 | 151K | |
![[ ]](/icons/layout.gif) | 30358_L & C Bracey L..> | 2026-01-05 16:12 | 151K | |
![[ ]](/icons/layout.gif) | 22928_M. A. E. Windo..> | 2025-12-04 13:13 | 151K | |
![[ ]](/icons/layout.gif) | 26860_Charles Brown ..> | 2025-12-16 13:07 | 151K | |
![[ ]](/icons/layout.gif) | 31826_Wellingborough..> | 2026-01-08 16:54 | 151K | |
![[ ]](/icons/layout.gif) | 23431_Garage Door Re..> | 2025-12-05 11:25 | 151K | |
![[ ]](/icons/layout.gif) | 28737_Rollermatic Ga..> | 2025-12-22 16:11 | 151K | |
![[ ]](/icons/layout.gif) | 23398_Garage Door Re..> | 2025-12-05 11:08 | 151K | |
![[ ]](/icons/layout.gif) | 28070_The Lothian Ga..> | 2025-12-19 08:25 | 151K | |
![[ ]](/icons/layout.gif) | 20623_Rollermatic Ga..> | 2025-11-28 08:10 | 151K | |
![[ ]](/icons/layout.gif) | 31603_Wellingborough..> | 2026-01-08 11:43 | 151K | |
![[ ]](/icons/layout.gif) | 27045_Dream Installa..> | 2025-12-16 16:03 | 151K | |
![[ ]](/icons/layout.gif) | 21139_Chelmsford Rol..> | 2025-12-01 08:38 | 151K | |
![[ ]](/icons/layout.gif) | 30791_Ideal Industri..> | 2026-01-06 13:51 | 151K | |
![[ ]](/icons/layout.gif) | 23172_M. A. E. Windo..> | 2025-12-04 16:44 | 151K | |
![[ ]](/icons/layout.gif) | 26258_Norfolk & Norw..> | 2025-12-15 10:41 | 151K | |
![[ ]](/icons/layout.gif) | 31252_Adams Industri..> | 2026-01-07 16:11 | 151K | |
![[ ]](/icons/layout.gif) | 21510_Warnsham Windo..> | 2025-12-01 15:20 | 151K | |
![[ ]](/icons/layout.gif) | 19049_Elevate Doors ..> | 2025-11-25 11:18 | 151K | |
![[ ]](/icons/layout.gif) | 27990_Garage Door So..> | 2025-12-18 16:31 | 151K | |
![[ ]](/icons/layout.gif) | 30185_AM Shutters St..> | 2026-01-05 13:44 | 151K | |
![[ ]](/icons/layout.gif) | 33091_Camberley Wind..> | 2026-01-14 10:11 | 151K | |
![[ ]](/icons/layout.gif) | 28076_The Lothian Ga..> | 2025-12-19 08:33 | 151K | |
![[ ]](/icons/layout.gif) | 27156_Garage Door So..> | 2025-12-17 08:06 | 151K | |
![[ ]](/icons/layout.gif) | 20373_The Lothian Ga..> | 2025-11-27 11:58 | 151K | |
![[ ]](/icons/layout.gif) | 30184_AM Shutters St..> | 2026-01-05 13:41 | 151K | |
![[ ]](/icons/layout.gif) | 30809_Moran Windows ..> | 2026-01-06 14:16 | 151K | |
![[ ]](/icons/layout.gif) | 21463_Garage Door So..> | 2025-12-01 13:54 | 151K | |
![[ ]](/icons/layout.gif) | 31801_Moran Windows ..> | 2026-01-08 15:43 | 151K | |
![[ ]](/icons/layout.gif) | 47583_Wall Garage Do..> | 2026-02-24 11:30 | 151K | |
![[ ]](/icons/layout.gif) | 27792_The Lothian Ga..> | 2025-12-18 12:01 | 151K | |
![[ ]](/icons/layout.gif) | 31254_Windowcraft De..> | 2026-01-07 16:14 | 151K | |
![[ ]](/icons/layout.gif) | 19067_J Brady Garage..> | 2025-11-25 11:41 | 151K | |
![[ ]](/icons/layout.gif) | 32796_Wokingham Glaz..> | 2026-01-13 12:40 | 151K | |
![[ ]](/icons/layout.gif) | 30463_AM Shutters St..> | 2026-01-06 08:15 | 151K | |
![[ ]](/icons/layout.gif) | 32794_Wokingham Glaz..> | 2026-01-13 12:37 | 151K | |
![[ ]](/icons/layout.gif) | 20454_EcoGlaze Group..> | 2025-11-27 14:09 | 151K | |
![[ ]](/icons/layout.gif) | 31812_Future Proof H..> | 2026-01-08 16:21 | 151K | |
![[ ]](/icons/layout.gif) | 32176_Doors 4 You Lt..> | 2026-01-09 16:42 | 151K | |
![[ ]](/icons/layout.gif) | 27105_SDL DOOR REPAI..> | 2025-12-16 16:43 | 151K | |
![[ ]](/icons/layout.gif) | 22732_3 Counties (Sa..> | 2025-12-04 09:12 | 151K | |
![[ ]](/icons/layout.gif) | 62954_Martina Connor..> | 2026-04-07 12:25 | 151K | |
![[ ]](/icons/layout.gif) | 31020_Fortress Doors..> | 2026-01-07 09:17 | 151K | |
![[ ]](/icons/layout.gif) | 20187_The Lothian Ga..> | 2025-11-27 10:10 | 151K | |
![[ ]](/icons/layout.gif) | 21052_Doorolla Ltd S..> | 2025-11-28 16:54 | 151K | |
![[ ]](/icons/layout.gif) | 21053_Doorolla Ltd S..> | 2025-11-28 16:57 | 151K | |
![[ ]](/icons/layout.gif) | 21190_Doorolla Ltd S..> | 2025-12-01 09:22 | 151K | |
![[ ]](/icons/layout.gif) | 23582_East Anglia Ro..> | 2025-12-05 16:43 | 151K | |
![[ ]](/icons/layout.gif) | 23800_East Anglia Ro..> | 2025-12-08 11:24 | 151K | |
![[ ]](/icons/layout.gif) | 24385_Rollermatic Ga..> | 2025-12-09 12:17 | 151K | |
![[ ]](/icons/layout.gif) | 44602_SW Trade Frame..> | 2026-02-17 09:10 | 151K | |
![[ ]](/icons/layout.gif) | 19557_Cartwright Win..> | 2025-11-25 17:03 | 151K | |
![[ ]](/icons/layout.gif) | 47230_Jamie Hales - ..> | 2026-02-23 15:54 | 151K | |
![[ ]](/icons/layout.gif) | 68660_Phil Perks - A..> | 2026-04-21 14:08 | 151K | |
![[ ]](/icons/layout.gif) | 68676_Phil Perks - A..> | 2026-04-21 14:24 | 151K | |
![[ ]](/icons/layout.gif) | 21550_Chelmsford Rol..> | 2025-12-01 16:26 | 151K | |
![[ ]](/icons/layout.gif) | 62961_Martina Connor..> | 2026-04-07 12:33 | 151K | |
![[ ]](/icons/layout.gif) | 63850_Martina Connor..> | 2026-04-09 07:37 | 151K | |
![[ ]](/icons/layout.gif) | 65235_Martina Connor..> | 2026-04-13 14:38 | 151K | |
![[ ]](/icons/layout.gif) | 55074_Mark Robertson..> | 2026-03-16 07:53 | 151K | |
![[ ]](/icons/layout.gif) | 63855_Martina Connor..> | 2026-04-09 07:41 | 151K | |
![[ ]](/icons/layout.gif) | 20706_Rhino Windows ..> | 2025-11-28 09:35 | 151K | |
![[ ]](/icons/layout.gif) | 20022_AM Shutters St..> | 2025-11-26 16:28 | 151K | |
![[ ]](/icons/layout.gif) | 20030_AM Shutters St..> | 2025-11-26 16:32 | 151K | |
![[ ]](/icons/layout.gif) | 20018_AM Shutters St..> | 2025-11-26 16:14 | 151K | |
![[ ]](/icons/layout.gif) | 26852_Toby Foster-Gr..> | 2025-12-16 12:40 | 151K | |
![[ ]](/icons/layout.gif) | 28701_UK Rollerdoors..> | 2025-12-22 14:41 | 152K | |
![[ ]](/icons/layout.gif) | 32000_TPS Gates & Do..> | 2026-01-09 11:41 | 152K | |
![[ ]](/icons/layout.gif) | 32907_TPS Gates & Do..> | 2026-01-13 14:26 | 152K | |
![[ ]](/icons/layout.gif) | 32942_TPS Gates & Do..> | 2026-01-13 15:49 | 152K | |
![[ ]](/icons/layout.gif) | 25014_ASSW Ltd BS10 ..> | 2025-12-11 10:19 | 152K | |
![[ ]](/icons/layout.gif) | 26652_UK Rollerdoors..> | 2025-12-16 08:31 | 152K | |
![[ ]](/icons/layout.gif) | 21508_UK Rollerdoors..> | 2025-12-01 15:07 | 152K | |
![[ ]](/icons/layout.gif) | 28425_Toby Foster-Gr..> | 2025-12-22 08:42 | 152K | |
![[ ]](/icons/layout.gif) | 32951_TPS Gates & Do..> | 2026-01-13 16:06 | 152K | |
![[ ]](/icons/layout.gif) | 24185_LNR Door Solut..> | 2025-12-09 09:26 | 152K | |
![[ ]](/icons/layout.gif) | 27953_Chelmsford Rol..> | 2025-12-18 15:47 | 152K | |
![[ ]](/icons/layout.gif) | 32585_ASSW Ltd BS10 ..> | 2026-01-13 09:09 | 152K | |
![[ ]](/icons/layout.gif) | 20632_TPS Gates & Do..> | 2025-11-28 08:13 | 152K | |
![[ ]](/icons/layout.gif) | 24538_Fortress Doors..> | 2025-12-09 16:49 | 152K | |
![[ ]](/icons/layout.gif) | 30951_Barry Eckland ..> | 2026-01-06 16:25 | 152K | |
![[ ]](/icons/layout.gif) | 22472_Fortress Doors..> | 2025-12-03 13:51 | 152K | |
![[ ]](/icons/layout.gif) | 19611_Cambridge Wind..> | 2025-11-26 08:07 | 152K | |
![[ ]](/icons/layout.gif) | 21295_Fortress Doors..> | 2025-12-01 10:40 | 152K | |
![[ ]](/icons/layout.gif) | 30838_Barry Eckland ..> | 2026-01-06 14:43 | 152K | |
![[ ]](/icons/layout.gif) | 30825_Barry Eckland ..> | 2026-01-06 14:22 | 152K | |
![[ ]](/icons/layout.gif) | 23712_Fortress Doors..> | 2025-12-08 10:09 | 152K | |
![[ ]](/icons/layout.gif) | 32477_JM Doors Jon B..> | 2026-01-12 17:00 | 152K | |
![[ ]](/icons/layout.gif) | 27917_Oakley Windows..> | 2025-12-18 14:39 | 152K | |
![[ ]](/icons/layout.gif) | 26674_LNR Door Solut..> | 2025-12-16 09:28 | 152K | |
![[ ]](/icons/layout.gif) | 27092_Oakley Windows..> | 2025-12-16 16:38 | 152K | |
![[ ]](/icons/layout.gif) | 33090_Camberley Wind..> | 2026-01-14 10:11 | 152K | |
![[ ]](/icons/layout.gif) | 19006_Replacement Ga..> | 2025-11-25 10:25 | 152K | |
![[ ]](/icons/layout.gif) | 31591_Replacement Ga..> | 2026-01-08 11:26 | 152K | |
![[ ]](/icons/layout.gif) | 21465_Windowcraft De..> | 2025-12-01 13:59 | 152K | |
![[ ]](/icons/layout.gif) | 32929_TPS Gates & Do..> | 2026-01-13 15:32 | 152K | |
![[ ]](/icons/layout.gif) | 26809_Linton's Doors..> | 2025-12-16 11:30 | 152K | |
![[ ]](/icons/layout.gif) | 27179_Mowbrey Partne..> | 2025-12-17 08:38 | 152K | |
![[ ]](/icons/layout.gif) | 28798_SDS (Isle Of M..> | 2025-12-23 07:37 | 152K | |
![[ ]](/icons/layout.gif) | 20489_SDS (Isle Of M..> | 2025-11-27 15:23 | 152K | |
![[ ]](/icons/layout.gif) | 32711_J Brady Garage..> | 2026-01-13 11:31 | 152K | |
![[ ]](/icons/layout.gif) | 30786_Barry Eckland ..> | 2026-01-06 13:40 | 152K | |
![[ ]](/icons/layout.gif) | 20659_SDS (Isle Of M..> | 2025-11-28 08:51 | 152K | |
![[ ]](/icons/layout.gif) | 28585_SDS (Isle Of M..> | 2025-12-22 12:19 | 152K | |
![[ ]](/icons/layout.gif) | 27958_Dream Installa..> | 2025-12-18 15:58 | 152K | |
![[ ]](/icons/layout.gif) | 28621_SDS (Isle Of M..> | 2025-12-22 13:16 | 152K | |
![[ ]](/icons/layout.gif) | 33084_J Brady Garage..> | 2026-01-14 10:03 | 152K | |
![[ ]](/icons/layout.gif) | 24450_Oakmont Door S..> | 2025-12-09 14:40 | 152K | |
![[ ]](/icons/layout.gif) | 31087_FR Wilkinson &..> | 2026-01-07 10:32 | 152K | |
![[ ]](/icons/layout.gif) | 19138_Oakley Windows..> | 2025-11-25 13:31 | 152K | |
![[ ]](/icons/layout.gif) | 22572_Oakley Windows..> | 2025-12-03 14:26 | 152K | |
![[ ]](/icons/layout.gif) | 20165_Elevate Doors ..> | 2025-11-27 09:49 | 152K | |
![[ ]](/icons/layout.gif) | 23176_Rising Group L..> | 2025-12-04 17:00 | 152K | |
![[ ]](/icons/layout.gif) | 32478_JM Doors Jon B..> | 2026-01-12 17:00 | 152K | |
![[ ]](/icons/layout.gif) | 30857_3 Counties (Sa..> | 2026-01-06 15:12 | 152K | |
![[ ]](/icons/layout.gif) | 31489_Go Garage Door..> | 2026-01-08 09:30 | 152K | |
![[ ]](/icons/layout.gif) | 24399_Rollermatic Ga..> | 2025-12-09 12:24 | 152K | |
![[ ]](/icons/layout.gif) | 26811_Linton's Doors..> | 2025-12-16 11:31 | 152K | |
![[ ]](/icons/layout.gif) | 23887_Elevate Doors ..> | 2025-12-08 13:55 | 152K | |
![[ ]](/icons/layout.gif) | 27035_Norfolk Broads..> | 2025-12-16 15:39 | 152K | |
![[ ]](/icons/layout.gif) | 31817_Windowcraft De..> | 2026-01-08 16:32 | 152K | |
![[ ]](/icons/layout.gif) | 24144_CWD Improvemen..> | 2025-12-09 09:08 | 153K | |
![[ ]](/icons/layout.gif) | 57067_NTRAP NR11 7NZ..> | 2026-03-19 15:56 | 153K | |
![[ ]](/icons/layout.gif) | 31012_Dial Delopment..> | 2026-01-07 09:04 | 153K | |
![[ ]](/icons/layout.gif) | 23435_Illy Refurbish..> | 2025-12-05 11:27 | 153K | |
![[ ]](/icons/layout.gif) | 23976_Avon Automated..> | 2025-12-08 16:23 | 153K | |
![[ ]](/icons/layout.gif) | 30584_Manor Projects..> | 2026-01-06 10:15 | 153K | |
![[ ]](/icons/layout.gif) | 36231_Tony Dovey Ton..> | 2026-01-22 17:08 | 153K | |
![[ ]](/icons/layout.gif) | 35501_Rollerdoors 24..> | 2026-01-21 08:44 | 153K | |
![[ ]](/icons/layout.gif) | 37835_Doors 4 Garage..> | 2026-01-28 10:38 | 153K | |
![[ ]](/icons/layout.gif) | 43245_Doors 4 Garage..> | 2026-02-12 15:48 | 153K | |
![[ ]](/icons/layout.gif) | 35544_Rollermatic Ga..> | 2026-01-21 09:32 | 153K | |
![[ ]](/icons/layout.gif) | 37874_Doors 4 Garage..> | 2026-01-28 11:17 | 153K | |
![[ ]](/icons/layout.gif) | 37902_Doors 4 Garage..> | 2026-01-28 12:16 | 153K | |
![[ ]](/icons/layout.gif) | 38492_Doors 4 Garage..> | 2026-01-29 14:02 | 153K | |
![[ ]](/icons/layout.gif) | 61231_EcoGlaze Group..> | 2026-03-31 12:21 | 153K | |
![[ ]](/icons/layout.gif) | 33407_Adam Hayes - H..> | 2026-01-14 16:24 | 153K | |
![[ ]](/icons/layout.gif) | 60933_Doorolla Ltd S..> | 2026-03-31 08:01 | 153K | |
![[ ]](/icons/layout.gif) | 38602_Karl Stevens -..> | 2026-01-29 16:41 | 153K | |
![[ ]](/icons/layout.gif) | 48201_Garalex Roller..> | 2026-02-25 14:41 | 153K | |
![[ ]](/icons/layout.gif) | 39905_Terry Barker -..> | 2026-02-03 12:09 | 153K | |
![[ ]](/icons/layout.gif) | 38400_Karl Stevens -..> | 2026-01-29 11:35 | 153K | |
![[ ]](/icons/layout.gif) | 38558_Karl Stevens -..> | 2026-01-29 15:15 | 153K | |
![[ ]](/icons/layout.gif) | 40014_Doors Shutters..> | 2026-02-03 14:11 | 153K | |
![[ ]](/icons/layout.gif) | 37743_Terry Barker -..> | 2026-01-28 08:23 | 153K | |
![[ ]](/icons/layout.gif) | 58098_Fortress Doors..> | 2026-03-23 13:43 | 153K | |
![[ ]](/icons/layout.gif) | 40334_Terry Barker -..> | 2026-02-04 09:57 | 153K | |
![[ ]](/icons/layout.gif) | 49664_UK Door System..> | 2026-03-02 11:49 | 153K | |
![[ ]](/icons/layout.gif) | 37212_JJ Secure Door..> | 2026-01-26 15:47 | 153K | |
![[ ]](/icons/layout.gif) | 35282_Jurassic Doors..> | 2026-01-20 14:59 | 153K | |
![[ ]](/icons/layout.gif) | 49773_UK Door System..> | 2026-03-02 14:12 | 153K | |
![[ ]](/icons/layout.gif) | 57039_Doors 4 You Lt..> | 2026-03-19 15:25 | 153K | |
![[ ]](/icons/layout.gif) | 60934_Doorolla Ltd S..> | 2026-03-31 08:02 | 153K | |
![[ ]](/icons/layout.gif) | 41979_PB Doors Paul ..> | 2026-02-09 16:53 | 153K | |
![[ ]](/icons/layout.gif) | 33963_Adams Industri..> | 2026-01-15 16:01 | 153K | |
![[ ]](/icons/layout.gif) | 49713_MG Securical L..> | 2026-03-02 13:03 | 153K | |
![[ ]](/icons/layout.gif) | 49352_Replacement Ga..> | 2026-03-02 08:32 | 153K | |
![[ ]](/icons/layout.gif) | 47911_East Anglia Ro..> | 2026-02-24 17:03 | 153K | |
![[ ]](/icons/layout.gif) | 41976_PB Doors Paul ..> | 2026-02-09 16:50 | 153K | |
![[ ]](/icons/layout.gif) | 49453_LNR Door Solut..> | 2026-03-02 09:27 | 153K | |
![[ ]](/icons/layout.gif) | 61461_AM Shutters St..> | 2026-03-31 14:02 | 153K | |
![[ ]](/icons/layout.gif) | 37270_Rollermatic Ga..> | 2026-01-27 07:51 | 153K | |
![[ ]](/icons/layout.gif) | 43563_Jurassic Doors..> | 2026-02-13 10:58 | 153K | |
![[ ]](/icons/layout.gif) | 44723_Jurassic Doors..> | 2026-02-17 10:28 | 153K | |
![[ ]](/icons/layout.gif) | 55829_Chelmsford Rol..> | 2026-03-17 12:50 | 153K | |
![[ ]](/icons/layout.gif) | 55472_AM Shutters St..> | 2026-03-16 14:25 | 153K | |
![[ ]](/icons/layout.gif) | 50274_J Brady Garage..> | 2026-03-03 12:10 | 153K | |
![[ ]](/icons/layout.gif) | 33593_Garage Door So..> | 2026-01-15 09:55 | 153K | |
![[ ]](/icons/layout.gif) | 48460_PB Doors Paul ..> | 2026-02-26 10:52 | 153K | |
![[ ]](/icons/layout.gif) | 48941_Thetford Glass..> | 2026-02-27 08:53 | 153K | |
![[ ]](/icons/layout.gif) | 44281_Joe Cross - An..> | 2026-02-16 14:55 | 153K | |
![[ ]](/icons/layout.gif) | 39621_MM Doors Micha..> | 2026-02-03 08:32 | 153K | |
![[ ]](/icons/layout.gif) | 35284_Avon Automated..> | 2026-01-20 15:14 | 153K | |
![[ ]](/icons/layout.gif) | 35294_Avon Automated..> | 2026-01-20 15:18 | 153K | |
![[ ]](/icons/layout.gif) | 60183_WADE WINDOWS I..> | 2026-03-27 13:13 | 153K | |
![[ ]](/icons/layout.gif) | 38164_Fortress Doors..> | 2026-01-29 08:06 | 153K | |
![[ ]](/icons/layout.gif) | 52743_Fortress Doors..> | 2026-03-09 15:01 | 153K | |
![[ ]](/icons/layout.gif) | 35015_JA B79 8RW - W..> | 2026-01-20 10:07 | 153K | |
![[ ]](/icons/layout.gif) | 39906_Terry Barker -..> | 2026-02-03 12:10 | 153K | |
![[ ]](/icons/layout.gif) | 40458_Elevate Doors ..> | 2026-02-04 12:25 | 153K | |
![[ ]](/icons/layout.gif) | 46648_R W Windows W..> | 2026-02-20 12:01 | 153K | |
![[ ]](/icons/layout.gif) | 42339_Eaton Park Win..> | 2026-02-10 14:59 | 153K | |
![[ ]](/icons/layout.gif) | 48123_Reece Brookes ..> | 2026-02-25 12:02 | 153K | |
![[ ]](/icons/layout.gif) | 35422_Fortress Doors..> | 2026-01-20 16:53 | 153K | |
![[ ]](/icons/layout.gif) | 60047_The Lothian Ga..> | 2026-03-27 10:54 | 153K | |
![[ ]](/icons/layout.gif) | 49849_DSC Glazing - ..> | 2026-03-02 14:52 | 153K | |
![[ ]](/icons/layout.gif) | 60660_Thomas Andrew ..> | 2026-03-30 13:44 | 153K | |
![[ ]](/icons/layout.gif) | 61487_Avon Automated..> | 2026-03-31 14:46 | 153K | |
![[ ]](/icons/layout.gif) | 38064_Ben Coxhill - ..> | 2026-01-28 14:45 | 153K | |
![[ ]](/icons/layout.gif) | 46902_Doorolla Ltd S..> | 2026-02-20 16:22 | 153K | |
![[ ]](/icons/layout.gif) | 46452_Thetford Glass..> | 2026-02-20 09:21 | 153K | |
![[ ]](/icons/layout.gif) | 45460_Simon Chase Do..> | 2026-02-18 09:21 | 153K | |
![[ ]](/icons/layout.gif) | 45497_Simon Chase Do..> | 2026-02-18 09:36 | 153K | |
![[ ]](/icons/layout.gif) | 66538_DT Services Lt..> | 2026-04-16 09:03 | 153K | |
![[ ]](/icons/layout.gif) | 40580_MM Doors Micha..> | 2026-02-04 15:44 | 153K | |
![[ ]](/icons/layout.gif) | 50071_Eastern Frames..> | 2026-03-03 09:01 | 153K | |
![[ ]](/icons/layout.gif) | 46450_Glen McNulty -..> | 2026-02-20 09:20 | 153K | |
![[ ]](/icons/layout.gif) | 33964_Doorflex Produ..> | 2026-01-15 16:02 | 153K | |
![[ ]](/icons/layout.gif) | 60005_Thomas Andrew ..> | 2026-03-27 10:26 | 153K | |
![[ ]](/icons/layout.gif) | 46451_Glen McNulty -..> | 2026-02-20 09:21 | 153K | |
![[ ]](/icons/layout.gif) | 56164_UK Rollerdoors..> | 2026-03-18 09:12 | 153K | |
![[ ]](/icons/layout.gif) | 61021_NTRAP NR11 7NZ..> | 2026-03-31 09:13 | 153K | |
![[ ]](/icons/layout.gif) | 46903_Marcus Akid - ..> | 2026-02-20 16:22 | 153K | |
![[ ]](/icons/layout.gif) | 39330_Replacement Ga..> | 2026-02-02 14:26 | 153K | |
![[ ]](/icons/layout.gif) | 46711_Marcus Akid - ..> | 2026-02-20 13:19 | 153K | |
![[ ]](/icons/layout.gif) | 33714_SDL DOOR REPAI..> | 2026-01-15 11:25 | 153K | |
![[ ]](/icons/layout.gif) | 36519_Tony Dovey Ton..> | 2026-01-23 12:21 | 153K | |
![[ ]](/icons/layout.gif) | 39123_EcoGlaze Group..> | 2026-02-02 09:19 | 153K | |
![[ ]](/icons/layout.gif) | 48017_1st Choice Sec..> | 2026-02-25 09:34 | 153K | |
![[ ]](/icons/layout.gif) | 35800_A-Louis (trade..> | 2026-01-21 14:36 | 153K | |
![[ ]](/icons/layout.gif) | 43844_AM Shutters St..> | 2026-02-16 09:10 | 153K | |
![[ ]](/icons/layout.gif) | 50955_NTRAP NR11 7NZ..> | 2026-03-04 15:14 | 153K | |
![[ ]](/icons/layout.gif) | 40615_MM Doors Micha..> | 2026-02-04 16:03 | 153K | |
![[ ]](/icons/layout.gif) | 61449_Doors 4 Garage..> | 2026-03-31 13:46 | 153K | |
![[ ]](/icons/layout.gif) | 34734_Phil Page Phil..> | 2026-01-19 14:03 | 153K | |
![[ ]](/icons/layout.gif) | 38052_Ben Coxhill - ..> | 2026-01-28 14:21 | 153K | |
![[ ]](/icons/layout.gif) | 38494_1st Shield Dar..> | 2026-01-29 14:07 | 153K | |
![[ ]](/icons/layout.gif) | 50412_Garage Doors 2..> | 2026-03-03 16:14 | 153K | |
![[ ]](/icons/layout.gif) | 56162_AWC Contractor..> | 2026-03-18 09:08 | 153K | |
![[ ]](/icons/layout.gif) | 33801_Eclipse Doors ..> | 2026-01-15 13:44 | 153K | |
![[ ]](/icons/layout.gif) | 38803_EcoGlaze Group..> | 2026-01-30 10:44 | 153K | |
![[ ]](/icons/layout.gif) | 33176_Simon Chase Do..> | 2026-01-14 11:34 | 153K | |
![[ ]](/icons/layout.gif) | 43699_Doorolla Ltd S..> | 2026-02-13 14:04 | 153K | |
![[ ]](/icons/layout.gif) | 43157_Nathan Sudwort..> | 2026-02-12 14:31 | 153K | |
![[ ]](/icons/layout.gif) | 36229_Tony Dovey Ton..> | 2026-01-22 17:01 | 153K | |
![[ ]](/icons/layout.gif) | 39655_AWC Contractor..> | 2026-02-03 09:13 | 153K | |
![[ ]](/icons/layout.gif) | 49827_Karl Jones - A..> | 2026-03-02 14:39 | 153K | |
![[ ]](/icons/layout.gif) | 52253_All Doors Repa..> | 2026-03-06 15:57 | 153K | |
![[ ]](/icons/layout.gif) | 52276_All Doors Repa..> | 2026-03-06 16:53 | 153K | |
![[ ]](/icons/layout.gif) | 43070_AM Shutters St..> | 2026-02-12 12:10 | 153K | |
![[ ]](/icons/layout.gif) | 45515_Open And Shut ..> | 2026-02-18 09:56 | 153K | |
![[ ]](/icons/layout.gif) | 48258_OGD Ltd Steve ..> | 2026-02-25 17:02 | 153K | |
![[ ]](/icons/layout.gif) | 41483_Tony Dovey Ton..> | 2026-02-06 16:58 | 153K | |
![[ ]](/icons/layout.gif) | 59660_MnK Windows Ma..> | 2026-03-26 13:39 | 153K | |
![[ ]](/icons/layout.gif) | 60852_Digby Services..> | 2026-03-30 15:29 | 153K | |
![[ ]](/icons/layout.gif) | 38513_1st Shield Dar..> | 2026-01-29 14:18 | 153K | |
![[ ]](/icons/layout.gif) | 58101_Fortress Doors..> | 2026-03-23 13:44 | 153K | |
![[ ]](/icons/layout.gif) | 46270_NTRAP NR11 7NZ..> | 2026-02-19 16:08 | 153K | |
![[ ]](/icons/layout.gif) | 40152_Mtmworks Wayne..> | 2026-02-03 16:25 | 153K | |
![[ ]](/icons/layout.gif) | 53961_Open And Shut ..> | 2026-03-11 16:01 | 153K | |
![[ ]](/icons/layout.gif) | 56347_AWC Contractor..> | 2026-03-18 12:14 | 153K | |
![[ ]](/icons/layout.gif) | 33295_1st Shield Dar..> | 2026-01-14 14:23 | 154K | |
![[ ]](/icons/layout.gif) | 38144_JJ Secure Door..> | 2026-01-28 16:40 | 154K | |
![[ ]](/icons/layout.gif) | 39086_EcoGlaze Group..> | 2026-02-02 08:17 | 154K | |
![[ ]](/icons/layout.gif) | 47934_Wanstall Ltd. ..> | 2026-02-25 08:32 | 154K | |
![[ ]](/icons/layout.gif) | 53820_C Marl Systems..> | 2026-03-11 12:21 | 154K | |
![[ ]](/icons/layout.gif) | 39369_Oakley Windows..> | 2026-02-02 15:47 | 154K | |
![[ ]](/icons/layout.gif) | 61395_John Medford -..> | 2026-03-31 13:20 | 154K | |
![[ ]](/icons/layout.gif) | 42421_TPS Gates & Do..> | 2026-02-10 17:00 | 154K | |
![[ ]](/icons/layout.gif) | 48756_Adams Roller S..> | 2026-02-26 16:51 | 154K | |
![[ ]](/icons/layout.gif) | 52990_RepairMyGarage..> | 2026-03-10 08:55 | 154K | |
![[ ]](/icons/layout.gif) | 55491_Nuvo Windows P..> | 2026-03-16 14:37 | 154K | |
![[ ]](/icons/layout.gif) | 55856_Eaton Park Win..> | 2026-03-17 13:56 | 154K | |
![[ ]](/icons/layout.gif) | 60853_Digby Services..> | 2026-03-30 15:32 | 154K | |
![[ ]](/icons/layout.gif) | 35502_Avon Automated..> | 2026-01-21 08:44 | 154K | |
![[ ]](/icons/layout.gif) | 37808_Adams Industri..> | 2026-01-28 09:59 | 154K | |
![[ ]](/icons/layout.gif) | 42947_Nathan Sudwort..> | 2026-02-12 09:35 | 154K | |
![[ ]](/icons/layout.gif) | 35238_Gordon and Son..> | 2026-01-20 14:36 | 154K | |
![[ ]](/icons/layout.gif) | 37367_L G Glazing Lt..> | 2026-01-27 10:14 | 154K | |
![[ ]](/icons/layout.gif) | 49259_Kieran Warner ..> | 2026-02-27 15:55 | 154K | |
![[ ]](/icons/layout.gif) | 36230_Tony Dovey Ton..> | 2026-01-22 17:05 | 154K | |
![[ ]](/icons/layout.gif) | 38131_JJ Secure Door..> | 2026-01-28 16:36 | 154K | |
![[ ]](/icons/layout.gif) | 59996_Brownsec Gary ..> | 2026-03-27 10:15 | 154K | |
![[ ]](/icons/layout.gif) | 60001_Brownsec Gary ..> | 2026-03-27 10:18 | 154K | |
![[ ]](/icons/layout.gif) | 42424_TPS Gates & Do..> | 2026-02-11 07:46 | 154K | |
![[ ]](/icons/layout.gif) | 39110_S.Cosgrove Ste..> | 2026-02-02 08:56 | 154K | |
![[ ]](/icons/layout.gif) | 46417_EcoGlaze Group..> | 2026-02-20 08:56 | 154K | |
![[ ]](/icons/layout.gif) | 49015_Oakley Windows..> | 2026-02-27 10:18 | 154K | |
![[ ]](/icons/layout.gif) | 36887_WGH Developmen..> | 2026-01-26 10:51 | 154K | |
![[ ]](/icons/layout.gif) | 48110_Eastern Frames..> | 2026-02-25 11:41 | 154K | |
![[ ]](/icons/layout.gif) | 33317_1st Shield Dar..> | 2026-01-14 14:47 | 154K | |
![[ ]](/icons/layout.gif) | 55515_Rolladoor NR9 ..> | 2026-03-16 15:32 | 154K | |
![[ ]](/icons/layout.gif) | 59227_MnK Windows Ma..> | 2026-03-25 14:17 | 154K | |
![[ ]](/icons/layout.gif) | 41479_Tony Dovey Ton..> | 2026-02-06 16:56 | 154K | |
![[ ]](/icons/layout.gif) | 37897_Oakley Windows..> | 2026-01-28 12:03 | 154K | |
![[ ]](/icons/layout.gif) | 37935_Liam Walker - ..> | 2026-01-28 12:53 | 154K | |
![[ ]](/icons/layout.gif) | 46488_Window Tec Lee..> | 2026-02-20 10:00 | 154K | |
![[ ]](/icons/layout.gif) | 49857_Rolladoor NR9 ..> | 2026-03-02 15:28 | 154K | |
![[ ]](/icons/layout.gif) | 33707_Replacement Ga..> | 2026-01-15 11:15 | 154K | |
![[ ]](/icons/layout.gif) | 38832_EcoGlaze Group..> | 2026-01-30 10:52 | 154K | |
![[ ]](/icons/layout.gif) | 44828_Phil Page Phil..> | 2026-02-17 12:48 | 154K | |
![[ ]](/icons/layout.gif) | 45921_Simon Taylor -..> | 2026-02-19 08:45 | 154K | |
![[ ]](/icons/layout.gif) | 48014_1st Choice Sec..> | 2026-02-25 09:33 | 154K | |
![[ ]](/icons/layout.gif) | 39723_EcoGlaze Group..> | 2026-02-03 09:52 | 154K | |
![[ ]](/icons/layout.gif) | 52351_Oakley Windows..> | 2026-03-09 08:32 | 154K | |
![[ ]](/icons/layout.gif) | 37205_JJ Secure Door..> | 2026-01-26 15:40 | 154K | |
![[ ]](/icons/layout.gif) | 38204_M. A. E. Windo..> | 2026-01-29 09:03 | 154K | |
![[ ]](/icons/layout.gif) | 44285_Eclipse Doors ..> | 2026-02-16 15:13 | 154K | |
![[ ]](/icons/layout.gif) | 44335_Eclipse Doors ..> | 2026-02-16 15:57 | 154K | |
![[ ]](/icons/layout.gif) | 60327_R W Windows W..> | 2026-03-27 16:05 | 154K | |
![[ ]](/icons/layout.gif) | 61197_Oakley Windows..> | 2026-03-31 11:24 | 154K | |
![[ ]](/icons/layout.gif) | 33298_1st Shield Dar..> | 2026-01-14 14:26 | 154K | |
![[ ]](/icons/layout.gif) | 55562_Doors 4 You Lt..> | 2026-03-16 16:35 | 154K | |
![[ ]](/icons/layout.gif) | 35448_Grant Tilley G..> | 2026-01-21 07:50 | 154K | |
![[ ]](/icons/layout.gif) | 37095_Rhino Windows ..> | 2026-01-26 14:02 | 154K | |
![[ ]](/icons/layout.gif) | 38893_Oakley Windows..> | 2026-01-30 12:12 | 154K | |
![[ ]](/icons/layout.gif) | 40757_Bridgford Inte..> | 2026-02-05 09:49 | 154K | |
![[ ]](/icons/layout.gif) | 52709_Oakley Windows..> | 2026-03-09 14:26 | 154K | |
![[ ]](/icons/layout.gif) | 37525_JJ Secure Door..> | 2026-01-27 12:58 | 154K | |
![[ ]](/icons/layout.gif) | 41339_Doorolla Ltd S..> | 2026-02-06 11:46 | 154K | |
![[ ]](/icons/layout.gif) | 51568_Karl Jones - A..> | 2026-03-05 14:09 | 154K | |
![[ ]](/icons/layout.gif) | 35942_Hanney Glazed ..> | 2026-01-22 10:03 | 154K | |
![[ ]](/icons/layout.gif) | 39134_EcoGlaze Group..> | 2026-02-02 09:27 | 154K | |
![[ ]](/icons/layout.gif) | 45093_OGD Ltd Steve ..> | 2026-02-17 16:40 | 154K | |
![[ ]](/icons/layout.gif) | 48335_Doors 4 Garage..> | 2026-02-26 08:51 | 154K | |
![[ ]](/icons/layout.gif) | 51664_Design & Build..> | 2026-03-05 16:19 | 154K | |
![[ ]](/icons/layout.gif) | 54267_Rollermatic Ga..> | 2026-03-12 14:08 | 154K | |
![[ ]](/icons/layout.gif) | 34606_My Garage Door..> | 2026-01-19 11:08 | 154K | |
![[ ]](/icons/layout.gif) | 34896_PB Doors Paul ..> | 2026-01-20 07:46 | 154K | |
![[ ]](/icons/layout.gif) | 40034_Mtmworks Wayne..> | 2026-02-03 14:41 | 154K | |
![[ ]](/icons/layout.gif) | 47172_Spa Roller Doo..> | 2026-02-23 15:28 | 154K | |
![[ ]](/icons/layout.gif) | 47317_All Doors Repa..> | 2026-02-23 16:10 | 154K | |
![[ ]](/icons/layout.gif) | 36526_Tony Dovey Ton..> | 2026-01-23 12:23 | 154K | |
![[ ]](/icons/layout.gif) | 46867_ThermoGreen Lt..> | 2026-02-20 15:21 | 154K | |
![[ ]](/icons/layout.gif) | 50921_RepairMyGarage..> | 2026-03-04 14:01 | 154K | |
![[ ]](/icons/layout.gif) | 56518_Simon Piggin P..> | 2026-03-18 15:10 | 154K | |
![[ ]](/icons/layout.gif) | 34897_PB Doors Paul ..> | 2026-01-20 07:52 | 154K | |
![[ ]](/icons/layout.gif) | 34959_PB Doors Paul ..> | 2026-01-20 08:38 | 154K | |
![[ ]](/icons/layout.gif) | 39347_Mowbrey Partne..> | 2026-02-02 15:29 | 154K | |
![[ ]](/icons/layout.gif) | 50339_J Brady Garage..> | 2026-03-03 14:09 | 154K | |
![[ ]](/icons/layout.gif) | 58131_S R W Services..> | 2026-03-23 14:35 | 154K | |
![[ ]](/icons/layout.gif) | 34732_TWS Automation..> | 2026-01-19 13:50 | 154K | |
![[ ]](/icons/layout.gif) | 38807_EcoGlaze Group..> | 2026-01-30 10:45 | 154K | |
![[ ]](/icons/layout.gif) | 49251_Kieran Warner ..> | 2026-02-27 15:40 | 154K | |
![[ ]](/icons/layout.gif) | 49258_Kieran Warner ..> | 2026-02-27 15:55 | 154K | |
![[ ]](/icons/layout.gif) | 56536_Spa Roller Doo..> | 2026-03-18 15:32 | 154K | |
![[ ]](/icons/layout.gif) | 38333_Doors 4 You Lt..> | 2026-01-29 10:50 | 154K | |
![[ ]](/icons/layout.gif) | 39352_Mowbrey Partne..> | 2026-02-02 15:31 | 154K | |
![[ ]](/icons/layout.gif) | 44288_Eclipse Doors ..> | 2026-02-16 15:18 | 154K | |
![[ ]](/icons/layout.gif) | 53974_Eclipse Doors ..> | 2026-03-11 16:31 | 154K | |
![[ ]](/icons/layout.gif) | 58203_Mick Walklate ..> | 2026-03-23 16:24 | 154K | |
![[ ]](/icons/layout.gif) | 33995_All Doors Repa..> | 2026-01-15 16:49 | 154K | |
![[ ]](/icons/layout.gif) | 36631_L G Glazing Lt..> | 2026-01-23 14:17 | 154K | |
![[ ]](/icons/layout.gif) | 37681_Heavy Metal En..> | 2026-01-27 16:01 | 154K | |
![[ ]](/icons/layout.gif) | 64323_PDL Fabricatio..> | 2026-04-10 07:51 | 154K | |
![[ ]](/icons/layout.gif) | 40702_PDL Fabricatio..> | 2026-02-05 07:56 | 154K | |
![[ ]](/icons/layout.gif) | 48247_Garalex Roller..> | 2026-02-25 16:15 | 154K | |
![[ ]](/icons/layout.gif) | 53757_PDL Fabricatio..> | 2026-03-11 11:11 | 154K | |
![[ ]](/icons/layout.gif) | 56673_Michael Mazur ..> | 2026-03-19 08:41 | 154K | |
![[ ]](/icons/layout.gif) | 34596_Design & Build..> | 2026-01-19 11:04 | 154K | |
![[ ]](/icons/layout.gif) | 36289_Chelmsford Rol..> | 2026-01-23 09:21 | 154K | |
![[ ]](/icons/layout.gif) | 39122_Fortress Doors..> | 2026-02-02 09:18 | 154K | |
![[ ]](/icons/layout.gif) | 51432_All About Door..> | 2026-03-05 11:58 | 154K | |
![[ ]](/icons/layout.gif) | 55203_Dans Doors Dan..> | 2026-03-16 10:01 | 154K | |
![[ ]](/icons/layout.gif) | 60637_T D Rollerdoor..> | 2026-03-30 13:24 | 154K | |
![[ ]](/icons/layout.gif) | 40261_Mtmworks Wayne..> | 2026-02-04 08:26 | 154K | |
![[ ]](/icons/layout.gif) | 52269_Doorolla Ltd S..> | 2026-03-06 16:36 | 154K | |
![[ ]](/icons/layout.gif) | 35340_Grant Tilley G..> | 2026-01-20 15:32 | 154K | |
![[ ]](/icons/layout.gif) | 36288_Chelmsford Rol..> | 2026-01-23 09:16 | 154K | |
![[ ]](/icons/layout.gif) | 40505_WADE WINDOWS I..> | 2026-02-04 13:28 | 154K | |
![[ ]](/icons/layout.gif) | 50652_Design & Build..> | 2026-03-04 09:22 | 154K | |
![[ ]](/icons/layout.gif) | 58759_Enlightened So..> | 2026-03-24 15:38 | 154K | |
![[ ]](/icons/layout.gif) | 38895_Oakley Windows..> | 2026-01-30 12:14 | 154K | |
![[ ]](/icons/layout.gif) | 39417_Oakley Windows..> | 2026-02-02 16:02 | 154K | |
![[ ]](/icons/layout.gif) | 43746_Serenade Home ..> | 2026-02-13 15:40 | 154K | |
![[ ]](/icons/layout.gif) | 36256_3 Brothers Bui..> | 2026-01-23 08:05 | 154K | |
![[ ]](/icons/layout.gif) | 49266_Kieran Warner ..> | 2026-02-27 16:01 | 154K | |
![[ ]](/icons/layout.gif) | 51434_All About Door..> | 2026-03-05 12:00 | 154K | |
![[ ]](/icons/layout.gif) | 35444_Absolute Garag..> | 2026-01-21 07:45 | 154K | |
![[ ]](/icons/layout.gif) | 36268_Go Direct Door..> | 2026-01-23 08:34 | 154K | |
![[ ]](/icons/layout.gif) | 37023_JJ Secure Door..> | 2026-01-26 13:21 | 154K | |
![[ ]](/icons/layout.gif) | 39811_Fortress Doors..> | 2026-02-03 10:48 | 154K | |
![[ ]](/icons/layout.gif) | 56410_MnK Windows Ma..> | 2026-03-18 12:49 | 154K | |
![[ ]](/icons/layout.gif) | 57440_Everbright Win..> | 2026-03-20 12:09 | 154K | |
![[ ]](/icons/layout.gif) | 58741_MM Doors Micha..> | 2026-03-24 15:32 | 154K | |
![[ ]](/icons/layout.gif) | 60840_Digby Services..> | 2026-03-30 15:22 | 154K | |
![[ ]](/icons/layout.gif) | 37223_PB Doors Paul ..> | 2026-01-26 16:10 | 154K | |
![[ ]](/icons/layout.gif) | 42858_Lazarenko LU2 ..> | 2026-02-12 07:57 | 154K | |
![[ ]](/icons/layout.gif) | 48357_CWD Improvemen..> | 2026-02-26 09:51 | 154K | |
![[ ]](/icons/layout.gif) | 54860_1st Shield Dar..> | 2026-03-13 14:00 | 154K | |
![[ ]](/icons/layout.gif) | 55274_Fix My Garage ..> | 2026-03-16 11:51 | 154K | |
![[ ]](/icons/layout.gif) | 36724_Fortress Doors..> | 2026-01-23 16:56 | 154K | |
![[ ]](/icons/layout.gif) | 43757_St Helens Upvc..> | 2026-02-13 16:31 | 154K | |
![[ ]](/icons/layout.gif) | 54657_All About Door..> | 2026-03-13 10:30 | 154K | |
![[ ]](/icons/layout.gif) | 54744_All About Door..> | 2026-03-13 11:51 | 154K | |
![[ ]](/icons/layout.gif) | 61579_Doors 4 You Lt..> | 2026-04-01 07:01 | 154K | |
![[ ]](/icons/layout.gif) | 37526_Bloomfield Hom..> | 2026-01-27 12:59 | 154K | |
![[ ]](/icons/layout.gif) | 51834_P & R Door Sys..> | 2026-03-06 09:28 | 154K | |
![[ ]](/icons/layout.gif) | 34054_L G Glazing Lt..> | 2026-01-16 07:44 | 154K | |
![[ ]](/icons/layout.gif) | 39556_Lazarenko LU2 ..> | 2026-02-03 07:58 | 154K | |
![[ ]](/icons/layout.gif) | 44603_MnK Windows K..> | 2026-02-17 09:10 | 154K | |
![[ ]](/icons/layout.gif) | 52340_Wightscape Tom..> | 2026-03-09 08:22 | 154K | |
![[ ]](/icons/layout.gif) | 52586_Faith Home Imp..> | 2026-03-09 12:09 | 154K | |
![[ ]](/icons/layout.gif) | 33368_Garage Doors 2..> | 2026-01-14 15:37 | 154K | |
![[ ]](/icons/layout.gif) | 33846_SDS (Isle Of M..> | 2026-01-15 14:34 | 154K | |
![[ ]](/icons/layout.gif) | 39325_Fortress Doors..> | 2026-02-02 14:16 | 154K | |
![[ ]](/icons/layout.gif) | 40079_RP Manufacturi..> | 2026-02-03 15:26 | 154K | |
![[ ]](/icons/layout.gif) | 44026_PB Doors Paul ..> | 2026-02-16 10:52 | 154K | |
![[ ]](/icons/layout.gif) | 49439_Thetford Glass..> | 2026-03-02 09:15 | 154K | |
![[ ]](/icons/layout.gif) | 50361_Oakley Windows..> | 2026-03-03 14:38 | 154K | |
![[ ]](/icons/layout.gif) | 55334_Thetford Glass..> | 2026-03-16 13:34 | 154K | |
![[ ]](/icons/layout.gif) | 58245_Fortress Doors..> | 2026-03-24 07:51 | 154K | |
![[ ]](/icons/layout.gif) | 35455_Rollermatic Ga..> | 2026-01-21 08:10 | 154K | |
![[ ]](/icons/layout.gif) | 36722_Fortress Doors..> | 2026-01-23 16:50 | 154K | |
![[ ]](/icons/layout.gif) | 41110_Bridgford Inte..> | 2026-02-05 16:39 | 154K | |
![[ ]](/icons/layout.gif) | 42501_Wokingham Glaz..> | 2026-02-11 09:13 | 154K | |
![[ ]](/icons/layout.gif) | 49244_Oakley Windows..> | 2026-02-27 15:38 | 154K | |
![[ ]](/icons/layout.gif) | 34393_Chiltern Doors..> | 2026-01-16 16:55 | 154K | |
![[ ]](/icons/layout.gif) | 38753_TH Installatio..> | 2026-01-30 09:57 | 154K | |
![[ ]](/icons/layout.gif) | 39516_Fortress Doors..> | 2026-02-02 17:12 | 154K | |
![[ ]](/icons/layout.gif) | 40065_Eclipse Doors ..> | 2026-02-03 15:16 | 154K | |
![[ ]](/icons/layout.gif) | 46906_Fortress Doors..> | 2026-02-20 16:30 | 154K | |
![[ ]](/icons/layout.gif) | 42254_Glenhurst Door..> | 2026-02-10 12:24 | 154K | |
![[ ]](/icons/layout.gif) | 50238_Doors 4 Garage..> | 2026-03-03 11:44 | 154K | |
![[ ]](/icons/layout.gif) | 58731_Fortress Doors..> | 2026-03-24 15:13 | 154K | |
![[ ]](/icons/layout.gif) | 37248_Fortress Doors..> | 2026-01-26 16:43 | 154K | |
![[ ]](/icons/layout.gif) | 37531_Ross Garage Do..> | 2026-01-27 13:06 | 154K | |
![[ ]](/icons/layout.gif) | 39141_Fortress Doors..> | 2026-02-02 09:39 | 154K | |
![[ ]](/icons/layout.gif) | 49993_Hanney Glazed ..> | 2026-03-02 16:53 | 154K | |
![[ ]](/icons/layout.gif) | 35514_Eclipse Doors ..> | 2026-01-21 08:56 | 154K | |
![[ ]](/icons/layout.gif) | 50689_Ross Garage Do..> | 2026-03-04 09:57 | 154K | |
![[ ]](/icons/layout.gif) | 51113_South East Lan..> | 2026-03-04 17:09 | 154K | |
![[ ]](/icons/layout.gif) | 55483_Nuvo Windows P..> | 2026-03-16 14:33 | 154K | |
![[ ]](/icons/layout.gif) | 33276_Thomas Andrew ..> | 2026-01-14 13:59 | 154K | |
![[ ]](/icons/layout.gif) | 33779_CWD Improvemen..> | 2026-01-15 13:01 | 154K | |
![[ ]](/icons/layout.gif) | 40019_Eclipse Paving..> | 2026-02-03 14:14 | 154K | |
![[ ]](/icons/layout.gif) | 40912_EcoGlaze Group..> | 2026-02-05 11:31 | 154K | |
![[ ]](/icons/layout.gif) | 41864_EcoGlaze Group..> | 2026-02-09 16:08 | 154K | |
![[ ]](/icons/layout.gif) | 61440_Eclipse Doors ..> | 2026-03-31 13:41 | 154K | |
![[ ]](/icons/layout.gif) | 62276_Woods And Sons..> | 2026-04-02 11:00 | 154K | |
![[ ]](/icons/layout.gif) | 62283_Woods And Sons..> | 2026-04-02 11:05 | 154K | |
![[ ]](/icons/layout.gif) | 64573_Window Tec Lee..> | 2026-04-10 12:41 | 154K | |
![[ ]](/icons/layout.gif) | 38508_1st Shield Dar..> | 2026-01-29 14:11 | 154K | |
![[ ]](/icons/layout.gif) | 50785_All Doors Repa..> | 2026-03-04 11:02 | 154K | |
![[ ]](/icons/layout.gif) | 61469_Jurassic Doors..> | 2026-03-31 14:23 | 154K | |
![[ ]](/icons/layout.gif) | 64064_T & G Home Imp..> | 2026-04-09 11:01 | 154K | |
![[ ]](/icons/layout.gif) | 35905_WADE WINDOWS I..> | 2026-01-22 08:53 | 154K | |
![[ ]](/icons/layout.gif) | 58125_Garage Doors 2..> | 2026-03-23 14:25 | 154K | |
![[ ]](/icons/layout.gif) | 58300_Fortress Doors..> | 2026-03-24 08:37 | 154K | |
![[ ]](/icons/layout.gif) | 33405_Eaton Park Win..> | 2026-01-14 16:23 | 154K | |
![[ ]](/icons/layout.gif) | 40633_Eaton Park Win..> | 2026-02-04 16:27 | 154K | |
![[ ]](/icons/layout.gif) | 48370_Replacement Ga..> | 2026-02-26 10:06 | 154K | |
![[ ]](/icons/layout.gif) | 55456_South Atlantic..> | 2026-03-16 14:15 | 154K | |
![[ ]](/icons/layout.gif) | 56411_MnK Windows Ma..> | 2026-03-18 12:52 | 154K | |
![[ ]](/icons/layout.gif) | 57454_Everbright Win..> | 2026-03-20 12:21 | 154K | |
![[ ]](/icons/layout.gif) | 43960_RnR Home Impro..> | 2026-02-16 09:51 | 154K | |
![[ ]](/icons/layout.gif) | 59675_PB Doors Paul ..> | 2026-03-26 13:53 | 154K | |
![[ ]](/icons/layout.gif) | 33765_Scotia Garage ..> | 2026-01-15 12:31 | 154K | |
![[ ]](/icons/layout.gif) | 33966_TH Installatio..> | 2026-01-15 16:06 | 154K | |
![[ ]](/icons/layout.gif) | 41448_Replacement Ga..> | 2026-02-06 15:24 | 154K | |
![[ ]](/icons/layout.gif) | 57914_Oakley Windows..> | 2026-03-23 10:54 | 154K | |
![[ ]](/icons/layout.gif) | 59723_Fortress Doors..> | 2026-03-26 15:12 | 154K | |
![[ ]](/icons/layout.gif) | 60250_Harpers Door S..> | 2026-03-27 14:09 | 154K | |
![[ ]](/icons/layout.gif) | 41693_Oakley Windows..> | 2026-02-09 13:01 | 154K | |
![[ ]](/icons/layout.gif) | 44358_Oakley Windows..> | 2026-02-16 16:15 | 154K | |
![[ ]](/icons/layout.gif) | 48340_Dream Installa..> | 2026-02-26 09:00 | 154K | |
![[ ]](/icons/layout.gif) | 52057_P & R Door Sys..> | 2026-03-06 12:20 | 154K | |
![[ ]](/icons/layout.gif) | 53591_Replacement Ga..> | 2026-03-11 08:52 | 154K | |
![[ ]](/icons/layout.gif) | 55612_Dans Doors Dan..> | 2026-03-17 08:07 | 154K | |
![[ ]](/icons/layout.gif) | 35425_Fortress Doors..> | 2026-01-20 16:56 | 154K | |
![[ ]](/icons/layout.gif) | 41764_Fortress Doors..> | 2026-02-09 14:28 | 154K | |
![[ ]](/icons/layout.gif) | 44597_EcoGlaze Group..> | 2026-02-17 09:03 | 154K | |
![[ ]](/icons/layout.gif) | 47107_Fortress Doors..> | 2026-02-23 13:24 | 154K | |
![[ ]](/icons/layout.gif) | 61147_Oakley Windows..> | 2026-03-31 10:47 | 154K | |
![[ ]](/icons/layout.gif) | 33980_EcoGlaze Group..> | 2026-01-15 16:23 | 154K | |
![[ ]](/icons/layout.gif) | 38379_Replacement Ga..> | 2026-01-29 11:15 | 154K | |
![[ ]](/icons/layout.gif) | 45837_Lidget Compton..> | 2026-02-18 16:05 | 154K | |
![[ ]](/icons/layout.gif) | 50316_Rising Group L..> | 2026-03-03 13:35 | 154K | |
![[ ]](/icons/layout.gif) | 50401_Dream Installa..> | 2026-03-03 15:56 | 154K | |
![[ ]](/icons/layout.gif) | 50727_Bursill Toby B..> | 2026-03-04 10:41 | 154K | |
![[ ]](/icons/layout.gif) | 55842_Eaton Park Win..> | 2026-03-17 13:47 | 154K | |
![[ ]](/icons/layout.gif) | 34745_CPS Custom Pro..> | 2026-01-19 14:28 | 154K | |
![[ ]](/icons/layout.gif) | 47905_Fortress Doors..> | 2026-02-24 16:47 | 154K | |
![[ ]](/icons/layout.gif) | 55551_Mick Walklate ..> | 2026-03-16 16:04 | 154K | |
![[ ]](/icons/layout.gif) | 56576_MnK Windows Ma..> | 2026-03-18 16:07 | 154K | |
![[ ]](/icons/layout.gif) | 60461_Herts & Essex ..> | 2026-03-30 09:17 | 154K | |
![[ ]](/icons/layout.gif) | 60981_Doors 4 Garage..> | 2026-03-31 08:55 | 154K | |
![[ ]](/icons/layout.gif) | 34388_Rollermatic Ga..> | 2026-01-16 16:30 | 154K | |
![[ ]](/icons/layout.gif) | 34646_AJ Trade Andre..> | 2026-01-19 11:41 | 154K | |
![[ ]](/icons/layout.gif) | 38200_Ace Garage Doo..> | 2026-01-29 08:46 | 154K | |
![[ ]](/icons/layout.gif) | 39354_Hanney Glazed ..> | 2026-02-02 15:32 | 154K | |
![[ ]](/icons/layout.gif) | 39517_Fortress Doors..> | 2026-02-02 17:30 | 154K | |
![[ ]](/icons/layout.gif) | 40664_PB Doors Paul ..> | 2026-02-04 17:01 | 154K | |
![[ ]](/icons/layout.gif) | 41225_Doorolla Ltd S..> | 2026-02-06 09:29 | 154K | |
![[ ]](/icons/layout.gif) | 48480_Fortress Doors..> | 2026-02-26 11:28 | 154K | |
![[ ]](/icons/layout.gif) | 50297_Oakley Windows..> | 2026-03-03 13:09 | 154K | |
![[ ]](/icons/layout.gif) | 52106_Barry Eckland ..> | 2026-03-06 13:34 | 154K | |
![[ ]](/icons/layout.gif) | 58755_Ross Garage Do..> | 2026-03-24 15:36 | 154K | |
![[ ]](/icons/layout.gif) | 37115_Calver Windows..> | 2026-01-26 14:15 | 154K | |
![[ ]](/icons/layout.gif) | 41228_Fortress Doors..> | 2026-02-06 09:37 | 154K | |
![[ ]](/icons/layout.gif) | 43411_Scotia Garage ..> | 2026-02-13 08:35 | 154K | |
![[ ]](/icons/layout.gif) | 48355_Doors 4 You Lt..> | 2026-02-26 09:47 | 154K | |
![[ ]](/icons/layout.gif) | 49104_Spa Roller Doo..> | 2026-02-27 12:34 | 154K | |
![[ ]](/icons/layout.gif) | 49656_K J N Garage D..> | 2026-03-02 11:45 | 154K | |
![[ ]](/icons/layout.gif) | 57540_Oakley Windows..> | 2026-03-20 14:22 | 154K | |
![[ ]](/icons/layout.gif) | 34797_My Garage Door..> | 2026-01-19 15:41 | 154K | |
![[ ]](/icons/layout.gif) | 35530_S R W Services..> | 2026-01-21 09:17 | 154K | |
![[ ]](/icons/layout.gif) | 36830_Windowcraft De..> | 2026-01-26 09:52 | 154K | |
![[ ]](/icons/layout.gif) | 52252_All Doors Repa..> | 2026-03-06 15:53 | 154K | |
![[ ]](/icons/layout.gif) | 59721_Fortress Doors..> | 2026-03-26 15:05 | 154K | |
![[ ]](/icons/layout.gif) | 33296_Jacob Bourne -..> | 2026-01-14 14:24 | 154K | |
![[ ]](/icons/layout.gif) | 40990_Bridgford Inte..> | 2026-02-05 13:37 | 154K | |
![[ ]](/icons/layout.gif) | 41212_Replacement Ga..> | 2026-02-06 09:01 | 154K | |
![[ ]](/icons/layout.gif) | 46871_Dream Installa..> | 2026-02-20 15:26 | 154K | |
![[ ]](/icons/layout.gif) | 48256_Dream Installa..> | 2026-02-25 16:56 | 154K | |
![[ ]](/icons/layout.gif) | 63834_Chelmsford Rol..> | 2026-04-09 07:21 | 154K | |
![[ ]](/icons/layout.gif) | 34828_Proud 2 Fix Ma..> | 2026-01-19 16:30 | 154K | |
![[ ]](/icons/layout.gif) | 36282_MG Securical L..> | 2026-01-23 09:02 | 154K | |
![[ ]](/icons/layout.gif) | 42319_The Garage Doo..> | 2026-02-10 14:13 | 154K | |
![[ ]](/icons/layout.gif) | 47367_Grant Tilley G..> | 2026-02-24 07:44 | 154K | |
![[ ]](/icons/layout.gif) | 49282_Regal Windows ..> | 2026-02-27 16:28 | 154K | |
![[ ]](/icons/layout.gif) | 54611_All About Door..> | 2026-03-13 09:25 | 154K | |
![[ ]](/icons/layout.gif) | 56575_MnK Windows Ma..> | 2026-03-18 16:06 | 154K | |
![[ ]](/icons/layout.gif) | 60661_Fortress Doors..> | 2026-03-30 13:45 | 154K | |
![[ ]](/icons/layout.gif) | 35805_T D Rollerdoor..> | 2026-01-21 14:41 | 154K | |
![[ ]](/icons/layout.gif) | 55558_Chiltern Doors..> | 2026-03-16 16:25 | 154K | |
![[ ]](/icons/layout.gif) | 56694_All About Door..> | 2026-03-19 08:58 | 154K | |
![[ ]](/icons/layout.gif) | 58140_AJ Trade Andre..> | 2026-03-23 14:50 | 154K | |
![[ ]](/icons/layout.gif) | 59604_Price NG34 7RQ..> | 2026-03-26 12:14 | 154K | |
![[ ]](/icons/layout.gif) | 61514_Woods And Sons..> | 2026-03-31 15:23 | 154K | |
![[ ]](/icons/layout.gif) | 33763_Evans Building..> | 2026-01-15 12:30 | 154K | |
![[ ]](/icons/layout.gif) | 33793_Chelmsford Rol..> | 2026-01-15 13:37 | 154K | |
![[ ]](/icons/layout.gif) | 34107_Glenhurst Door..> | 2026-01-16 08:42 | 154K | |
![[ ]](/icons/layout.gif) | 40267_Everbright Win..> | 2026-02-04 08:35 | 154K | |
![[ ]](/icons/layout.gif) | 45997_TPS Gates & Do..> | 2026-02-19 10:08 | 154K | |
![[ ]](/icons/layout.gif) | 48321_Fortress Doors..> | 2026-02-26 08:40 | 154K | |
![[ ]](/icons/layout.gif) | 57337_EcoGlaze Group..> | 2026-03-20 10:20 | 154K | |
![[ ]](/icons/layout.gif) | 62002_Fortress Doors..> | 2026-04-01 14:48 | 154K | |
![[ ]](/icons/layout.gif) | 44652_EcoGlaze Group..> | 2026-02-17 09:42 | 154K | |
![[ ]](/icons/layout.gif) | 47289_PB Doors Paul ..> | 2026-02-23 16:09 | 154K | |
![[ ]](/icons/layout.gif) | 48466_Replacement Ga..> | 2026-02-26 10:57 | 154K | |
![[ ]](/icons/layout.gif) | 56478_3 Counties (Sa..> | 2026-03-18 14:03 | 154K | |
![[ ]](/icons/layout.gif) | 56528_Oakley Windows..> | 2026-03-18 15:23 | 154K | |
![[ ]](/icons/layout.gif) | 57846_PB Doors Paul ..> | 2026-03-23 10:09 | 154K | |
![[ ]](/icons/layout.gif) | 60781_Oakley Windows..> | 2026-03-30 15:02 | 154K | |
![[ ]](/icons/layout.gif) | 60821_Doors Shutters..> | 2026-03-30 15:16 | 154K | |
![[ ]](/icons/layout.gif) | 61206_Fortress Doors..> | 2026-03-31 11:51 | 154K | |
![[ ]](/icons/layout.gif) | 37130_1st Shield Dar..> | 2026-01-26 14:31 | 154K | |
![[ ]](/icons/layout.gif) | 37441_J Bowman Garag..> | 2026-01-27 11:55 | 154K | |
![[ ]](/icons/layout.gif) | 42301_Harry Curtis H..> | 2026-02-10 13:22 | 154K | |
![[ ]](/icons/layout.gif) | 42843_South Atlantic..> | 2026-02-12 07:41 | 154K | |
![[ ]](/icons/layout.gif) | 60532_Oakley Windows..> | 2026-03-30 10:47 | 154K | |
![[ ]](/icons/layout.gif) | 61185_M & S Home Ins..> | 2026-03-31 11:18 | 154K | |
![[ ]](/icons/layout.gif) | 36130_Dream Installa..> | 2026-01-22 13:19 | 154K | |
![[ ]](/icons/layout.gif) | 42709_Scotia Garage ..> | 2026-02-11 13:07 | 154K | |
![[ ]](/icons/layout.gif) | 43755_Doors 4 Garage..> | 2026-02-13 16:22 | 154K | |
![[ ]](/icons/layout.gif) | 48521_Go Direct Door..> | 2026-02-26 11:59 | 154K | |
![[ ]](/icons/layout.gif) | 49421_Wall Garage Do..> | 2026-03-02 08:59 | 154K | |
![[ ]](/icons/layout.gif) | 50414_Rising Group L..> | 2026-03-03 16:20 | 154K | |
![[ ]](/icons/layout.gif) | 52704_CWD Improvemen..> | 2026-03-09 14:17 | 154K | |
![[ ]](/icons/layout.gif) | 54271_Proud 2 Fix Ma..> | 2026-03-12 14:12 | 154K | |
![[ ]](/icons/layout.gif) | 58842_MG Securical L..> | 2026-03-25 07:48 | 154K | |
![[ ]](/icons/layout.gif) | 61485_Fortress Doors..> | 2026-03-31 14:40 | 154K | |
![[ ]](/icons/layout.gif) | 35424_P & R Door Sys..> | 2026-01-20 16:54 | 154K | |
![[ ]](/icons/layout.gif) | 48469_Dream Installa..> | 2026-02-26 11:06 | 154K | |
![[ ]](/icons/layout.gif) | 54603_AJ Trade Andre..> | 2026-03-13 09:11 | 154K | |
![[ ]](/icons/layout.gif) | 60845_Digby Services..> | 2026-03-30 15:26 | 154K | |
![[ ]](/icons/layout.gif) | 36129_Ace Garage Doo..> | 2026-01-22 13:19 | 154K | |
![[ ]](/icons/layout.gif) | 36721_Fortress Doors..> | 2026-01-23 16:47 | 154K | |
![[ ]](/icons/layout.gif) | 47716_SGT Carpentry ..> | 2026-02-24 14:15 | 154K | |
![[ ]](/icons/layout.gif) | 47764_Fortress Doors..> | 2026-02-24 15:28 | 154K | |
![[ ]](/icons/layout.gif) | 50273_Oakley Windows..> | 2026-03-03 12:06 | 154K | |
![[ ]](/icons/layout.gif) | 55539_CWD Improvemen..> | 2026-03-16 15:54 | 154K | |
![[ ]](/icons/layout.gif) | 56526_Simon Piggin P..> | 2026-03-18 15:17 | 154K | |
![[ ]](/icons/layout.gif) | 68321_SW Trade Frame..> | 2026-04-21 09:55 | 154K | |
![[ ]](/icons/layout.gif) | 68355_SW Trade Frame..> | 2026-04-21 10:08 | 154K | |
![[ ]](/icons/layout.gif) | 35232_Ross Garage Do..> | 2026-01-20 14:31 | 154K | |
![[ ]](/icons/layout.gif) | 51778_EcoGlaze Group..> | 2026-03-06 08:24 | 154K | |
![[ ]](/icons/layout.gif) | 52752_ThermoGreen Lt..> | 2026-03-09 15:19 | 154K | |
![[ ]](/icons/layout.gif) | 56544_Spa Roller Doo..> | 2026-03-18 15:34 | 154K | |
![[ ]](/icons/layout.gif) | 57855_PB Doors Paul ..> | 2026-03-23 10:15 | 154K | |
![[ ]](/icons/layout.gif) | 67119_SW Trade Frame..> | 2026-04-17 10:27 | 154K | |
![[ ]](/icons/layout.gif) | 37339_Replacement Ga..> | 2026-01-27 09:44 | 154K | |
![[ ]](/icons/layout.gif) | 39119_Fortress Doors..> | 2026-02-02 09:11 | 154K | |
![[ ]](/icons/layout.gif) | 39513_Oakley Windows..> | 2026-02-02 16:56 | 154K | |
![[ ]](/icons/layout.gif) | 42702_Scotia Garage ..> | 2026-02-11 13:04 | 154K | |
![[ ]](/icons/layout.gif) | 52275_Replacement Ga..> | 2026-03-06 16:46 | 154K | |
![[ ]](/icons/layout.gif) | 55353_Eclipse Doors ..> | 2026-03-16 13:40 | 154K | |
![[ ]](/icons/layout.gif) | 57138_Secured Door &..> | 2026-03-20 08:12 | 154K | |
![[ ]](/icons/layout.gif) | 59766_Fortress Doors..> | 2026-03-26 15:51 | 154K | |
![[ ]](/icons/layout.gif) | 35824_All Doors Repa..> | 2026-01-21 15:33 | 154K | |
![[ ]](/icons/layout.gif) | 49342_Dream Installa..> | 2026-03-02 08:18 | 154K | |
![[ ]](/icons/layout.gif) | 50227_Bursill Toby B..> | 2026-03-03 11:28 | 154K | |
![[ ]](/icons/layout.gif) | 51105_3 Counties (Sa..> | 2026-03-04 16:56 | 154K | |
![[ ]](/icons/layout.gif) | 54472_Garage Door Se..> | 2026-03-12 16:45 | 154K | |
![[ ]](/icons/layout.gif) | 61243_EcoGlaze Group..> | 2026-03-31 12:30 | 154K | |
![[ ]](/icons/layout.gif) | 35471_Rollermatic Ga..> | 2026-01-21 08:24 | 154K | |
![[ ]](/icons/layout.gif) | 35953_Hanney Glazed ..> | 2026-01-22 10:11 | 154K | |
![[ ]](/icons/layout.gif) | 36977_Scotia Garage ..> | 2026-01-26 13:03 | 154K | |
![[ ]](/icons/layout.gif) | 39786_WADE WINDOWS I..> | 2026-02-03 10:31 | 154K | |
![[ ]](/icons/layout.gif) | 49311_Doors 4 Garage..> | 2026-02-27 17:06 | 154K | |
![[ ]](/icons/layout.gif) | 53938_SDS (Isle Of M..> | 2026-03-11 15:29 | 154K | |
![[ ]](/icons/layout.gif) | 34512_CPS Custom Pro..> | 2026-01-19 09:52 | 154K | |
![[ ]](/icons/layout.gif) | 35801_Go Direct Door..> | 2026-01-21 14:37 | 154K | |
![[ ]](/icons/layout.gif) | 39515_Fortress Doors..> | 2026-02-02 17:06 | 154K | |
![[ ]](/icons/layout.gif) | 41771_Fortress Doors..> | 2026-02-09 14:41 | 154K | |
![[ ]](/icons/layout.gif) | 43396_Excellent Ltd ..> | 2026-02-13 08:08 | 154K | |
![[ ]](/icons/layout.gif) | 45289_Go Direct Door..> | 2026-02-18 08:28 | 154K | |
![[ ]](/icons/layout.gif) | 49926_Fortress Doors..> | 2026-03-02 16:05 | 154K | |
![[ ]](/icons/layout.gif) | 55104_UK Ultra Doors..> | 2026-03-16 08:48 | 154K | |
![[ ]](/icons/layout.gif) | 58500_TPS Gates & Do..> | 2026-03-24 12:00 | 154K | |
![[ ]](/icons/layout.gif) | 58769_TPS Gates & Do..> | 2026-03-24 15:47 | 154K | |
![[ ]](/icons/layout.gif) | 61221_Cerromar Solut..> | 2026-03-31 12:16 | 154K | |
![[ ]](/icons/layout.gif) | 61483_Fortress Doors..> | 2026-03-31 14:31 | 154K | |
![[ ]](/icons/layout.gif) | 34237_St Helens Upvc..> | 2026-01-16 11:01 | 154K | |
![[ ]](/icons/layout.gif) | 34390_Rollermatic Ga..> | 2026-01-16 16:41 | 154K | |
![[ ]](/icons/layout.gif) | 37246_Fortress Doors..> | 2026-01-26 16:38 | 154K | |
![[ ]](/icons/layout.gif) | 39529_Manor Projects..> | 2026-02-03 07:49 | 154K | |
![[ ]](/icons/layout.gif) | 55972_P & R Door Sys..> | 2026-03-17 15:01 | 154K | |
![[ ]](/icons/layout.gif) | 60864_Fortress Doors..> | 2026-03-30 15:39 | 154K | |
![[ ]](/icons/layout.gif) | 61621_Doors 4 Garage..> | 2026-04-01 07:45 | 154K | |
![[ ]](/icons/layout.gif) | 38416_Rollermatic Ga..> | 2026-01-29 11:55 | 154K | |
![[ ]](/icons/layout.gif) | 39507_Ace Garage Doo..> | 2026-02-02 16:53 | 154K | |
![[ ]](/icons/layout.gif) | 42321_The Garage Doo..> | 2026-02-10 14:14 | 154K | |
![[ ]](/icons/layout.gif) | 55085_Fortress Doors..> | 2026-03-16 08:19 | 154K | |
![[ ]](/icons/layout.gif) | 59077_Thomas Andrew ..> | 2026-03-25 11:17 | 154K | |
![[ ]](/icons/layout.gif) | 38704_Precise Builde..> | 2026-01-30 09:25 | 154K | |
![[ ]](/icons/layout.gif) | 38706_Precise Builde..> | 2026-01-30 09:30 | 154K | |
![[ ]](/icons/layout.gif) | 40535_Lazarenko LU2 ..> | 2026-02-04 14:27 | 154K | |
![[ ]](/icons/layout.gif) | 41423_PGD Doors Ltd ..> | 2026-02-06 14:25 | 154K | |
![[ ]](/icons/layout.gif) | 44922_MnK Windows K..> | 2026-02-17 13:41 | 154K | |
![[ ]](/icons/layout.gif) | 50460_J Brady Garage..> | 2026-03-03 16:47 | 154K | |
![[ ]](/icons/layout.gif) | 53992_Serenade Home ..> | 2026-03-11 16:45 | 154K | |
![[ ]](/icons/layout.gif) | 55280_Serenade Home ..> | 2026-03-16 12:24 | 154K | |
![[ ]](/icons/layout.gif) | 56772_Garage Doors 2..> | 2026-03-19 10:15 | 154K | |
![[ ]](/icons/layout.gif) | 58103_Elevate Doors ..> | 2026-03-23 13:50 | 154K | |
![[ ]](/icons/layout.gif) | 59188_P & R Door Sys..> | 2026-03-25 13:33 | 154K | |
![[ ]](/icons/layout.gif) | 64535_Window Tec Lee..> | 2026-04-10 12:05 | 154K | |
![[ ]](/icons/layout.gif) | 39168_LDF Services (..> | 2026-02-02 10:28 | 154K | |
![[ ]](/icons/layout.gif) | 42135_CPS Custom Pro..> | 2026-02-10 10:31 | 154K | |
![[ ]](/icons/layout.gif) | 53946_WADE WINDOWS I..> | 2026-03-11 15:44 | 154K | |
![[ ]](/icons/layout.gif) | 54995_Eclipse Doors ..> | 2026-03-13 15:36 | 154K | |
![[ ]](/icons/layout.gif) | 55045_South Atlantic..> | 2026-03-13 16:55 | 154K | |
![[ ]](/icons/layout.gif) | 57444_EcoGlaze Group..> | 2026-03-20 12:12 | 154K | |
![[ ]](/icons/layout.gif) | 35430_TPS Gates & Do..> | 2026-01-21 07:18 | 154K | |
![[ ]](/icons/layout.gif) | 37127_Rhino Windows ..> | 2026-01-26 14:28 | 154K | |
![[ ]](/icons/layout.gif) | 41521_Wokingham Glaz..> | 2026-02-09 08:48 | 154K | |
![[ ]](/icons/layout.gif) | 43013_AJ Roller Shut..> | 2026-02-12 11:27 | 154K | |
![[ ]](/icons/layout.gif) | 43259_PB Doors Paul ..> | 2026-02-12 16:33 | 154K | |
![[ ]](/icons/layout.gif) | 46726_All Doors Repa..> | 2026-02-20 13:27 | 154K | |
![[ ]](/icons/layout.gif) | 58133_Wall Garage Do..> | 2026-03-23 14:44 | 154K | |
![[ ]](/icons/layout.gif) | 58758_Ross Garage Do..> | 2026-03-24 15:37 | 154K | |
![[ ]](/icons/layout.gif) | 61210_HTH Developmen..> | 2026-03-31 11:54 | 154K | |
![[ ]](/icons/layout.gif) | 61629_A.S.M Windows ..> | 2026-04-01 07:53 | 154K | |
![[ ]](/icons/layout.gif) | 38756_Dream Installa..> | 2026-01-30 10:05 | 154K | |
![[ ]](/icons/layout.gif) | 49316_P & R Door Sys..> | 2026-02-27 17:12 | 154K | |
![[ ]](/icons/layout.gif) | 56957_Scotia Garage ..> | 2026-03-19 13:37 | 154K | |
![[ ]](/icons/layout.gif) | 36841_Southwest Cons..> | 2026-01-26 10:06 | 154K | |
![[ ]](/icons/layout.gif) | 43510_Midlands Secur..> | 2026-02-13 09:38 | 154K | |
![[ ]](/icons/layout.gif) | 43653_CWD Improvemen..> | 2026-02-13 13:02 | 154K | |
![[ ]](/icons/layout.gif) | 47153_Midlands Secur..> | 2026-02-23 14:52 | 154K | |
![[ ]](/icons/layout.gif) | 48203_ASSW Ltd BS10 ..> | 2026-02-25 14:46 | 154K | |
![[ ]](/icons/layout.gif) | 49120_Piper Window S..> | 2026-02-27 13:25 | 154K | |
![[ ]](/icons/layout.gif) | 50294_Dream Installa..> | 2026-03-03 13:04 | 154K | |
![[ ]](/icons/layout.gif) | 52699_EcoGlaze Group..> | 2026-03-09 14:12 | 154K | |
![[ ]](/icons/layout.gif) | 53463_Garage Door Se..> | 2026-03-10 15:47 | 154K | |
![[ ]](/icons/layout.gif) | 33982_All Doors Repa..> | 2026-01-15 16:34 | 154K | |
![[ ]](/icons/layout.gif) | 42695_Able Garage Do..> | 2026-02-11 12:57 | 154K | |
![[ ]](/icons/layout.gif) | 43762_South Atlantic..> | 2026-02-13 16:47 | 154K | |
![[ ]](/icons/layout.gif) | 46923_J Galliott Bui..> | 2026-02-23 08:14 | 154K | |
![[ ]](/icons/layout.gif) | 49190_Piper Window S..> | 2026-02-27 14:14 | 154K | |
![[ ]](/icons/layout.gif) | 54716_CWD Improvemen..> | 2026-03-13 11:25 | 154K | |
![[ ]](/icons/layout.gif) | 55097_Fortress Doors..> | 2026-03-16 08:43 | 154K | |
![[ ]](/icons/layout.gif) | 61234_EcoGlaze Group..> | 2026-03-31 12:25 | 154K | |
![[ ]](/icons/layout.gif) | 36888_WGH Developmen..> | 2026-01-26 10:53 | 154K | |
![[ ]](/icons/layout.gif) | 37615_Serenade Home ..> | 2026-01-27 14:40 | 154K | |
![[ ]](/icons/layout.gif) | 38412_Rollermatic Ga..> | 2026-01-29 11:49 | 154K | |
![[ ]](/icons/layout.gif) | 39342_Chelmsford Rol..> | 2026-02-02 15:15 | 154K | |
![[ ]](/icons/layout.gif) | 41738_Glenhurst Door..> | 2026-02-09 14:00 | 154K | |
![[ ]](/icons/layout.gif) | 43749_Serenade Home ..> | 2026-02-13 15:50 | 154K | |
![[ ]](/icons/layout.gif) | 44363_PB Doors Paul ..> | 2026-02-16 16:19 | 154K | |
![[ ]](/icons/layout.gif) | 46406_P & R Door Sys..> | 2026-02-20 08:43 | 154K | |
![[ ]](/icons/layout.gif) | 46928_J Galliott Bui..> | 2026-02-23 08:33 | 154K | |
![[ ]](/icons/layout.gif) | 46934_J Galliott Bui..> | 2026-02-23 08:42 | 154K | |
![[ ]](/icons/layout.gif) | 55106_UK Ultra Doors..> | 2026-03-16 08:50 | 154K | |
![[ ]](/icons/layout.gif) | 55846_Eaton Park Win..> | 2026-03-17 13:50 | 154K | |
![[ ]](/icons/layout.gif) | 59767_Adams Industri..> | 2026-03-26 15:51 | 154K | |
![[ ]](/icons/layout.gif) | 59913_ADB Electrical..> | 2026-03-27 08:22 | 154K | |
![[ ]](/icons/layout.gif) | 60184_Oakley Windows..> | 2026-03-27 13:14 | 154K | |
![[ ]](/icons/layout.gif) | 34196_Rollermatic Ga..> | 2026-01-16 09:44 | 154K | |
![[ ]](/icons/layout.gif) | 40594_Windows Plus U..> | 2026-02-04 15:53 | 154K | |
![[ ]](/icons/layout.gif) | 42984_AJ Roller Shut..> | 2026-02-12 10:53 | 154K | |
![[ ]](/icons/layout.gif) | 43631_Ace Garage Doo..> | 2026-02-13 12:12 | 154K | |
![[ ]](/icons/layout.gif) | 50467_3 Counties (Sa..> | 2026-03-03 16:54 | 154K | |
![[ ]](/icons/layout.gif) | 50621_J Bowman Garag..> | 2026-03-04 09:04 | 154K | |
![[ ]](/icons/layout.gif) | 52053_EcoGlaze Group..> | 2026-03-06 12:11 | 154K | |
![[ ]](/icons/layout.gif) | 55479_South Atlantic..> | 2026-03-16 14:29 | 154K | |
![[ ]](/icons/layout.gif) | 33734_Jurassic Doors..> | 2026-01-15 11:58 | 154K | |
![[ ]](/icons/layout.gif) | 34735_Fortress Doors..> | 2026-01-19 14:04 | 154K | |
![[ ]](/icons/layout.gif) | 34811_Four Counties ..> | 2026-01-19 16:16 | 154K | |
![[ ]](/icons/layout.gif) | 35941_Hanney Glazed ..> | 2026-01-22 10:00 | 154K | |
![[ ]](/icons/layout.gif) | 37424_J Bowman Garag..> | 2026-01-27 11:46 | 154K | |
![[ ]](/icons/layout.gif) | 42850_Replacement Ga..> | 2026-02-12 07:48 | 154K | |
![[ ]](/icons/layout.gif) | 51662_SX Property Ma..> | 2026-03-05 16:12 | 154K | |
![[ ]](/icons/layout.gif) | 52083_Shrewsbury Des..> | 2026-03-06 13:18 | 154K | |
![[ ]](/icons/layout.gif) | 56520_Simon Piggin P..> | 2026-03-18 15:14 | 154K | |
![[ ]](/icons/layout.gif) | 58087_Ross Garage Do..> | 2026-03-23 13:35 | 154K | |
![[ ]](/icons/layout.gif) | 58730_Ross Garage Do..> | 2026-03-24 15:11 | 154K | |
![[ ]](/icons/layout.gif) | 58917_Garage Door Se..> | 2026-03-25 09:10 | 154K | |
![[ ]](/icons/layout.gif) | 35817_All Doors Repa..> | 2026-01-21 15:26 | 154K | |
![[ ]](/icons/layout.gif) | 37419_J Bowman Garag..> | 2026-01-27 11:41 | 154K | |
![[ ]](/icons/layout.gif) | 41586_S & D Property..> | 2026-02-09 10:38 | 154K | |
![[ ]](/icons/layout.gif) | 42806_South Atlantic..> | 2026-02-11 15:59 | 154K | |
![[ ]](/icons/layout.gif) | 50336_Summit Securit..> | 2026-03-03 14:04 | 154K | |
![[ ]](/icons/layout.gif) | 53176_3 Counties (Sa..> | 2026-03-10 11:37 | 154K | |
![[ ]](/icons/layout.gif) | 53621_Doors 4 You Lt..> | 2026-03-11 09:01 | 154K | |
![[ ]](/icons/layout.gif) | 39877_Rollermatic Ga..> | 2026-02-03 11:52 | 154K | |
![[ ]](/icons/layout.gif) | 42832_South Atlantic..> | 2026-02-11 16:42 | 154K | |
![[ ]](/icons/layout.gif) | 43014_AJ Roller Shut..> | 2026-02-12 11:28 | 154K | |
![[ ]](/icons/layout.gif) | 53324_Smart Building..> | 2026-03-10 14:00 | 154K | |
![[ ]](/icons/layout.gif) | 53546_Replacement Ga..> | 2026-03-11 08:10 | 154K | |
![[ ]](/icons/layout.gif) | 59722_Fortress Doors..> | 2026-03-26 15:08 | 154K | |
![[ ]](/icons/layout.gif) | 33885_CPS Custom Pro..> | 2026-01-15 14:53 | 154K | |
![[ ]](/icons/layout.gif) | 38198_Ace Garage Doo..> | 2026-01-29 08:43 | 154K | |
![[ ]](/icons/layout.gif) | 41377_PB Doors Paul ..> | 2026-02-06 12:59 | 154K | |
![[ ]](/icons/layout.gif) | 42282_Southwest Cons..> | 2026-02-10 13:00 | 154K | |
![[ ]](/icons/layout.gif) | 42548_J Brady Garage..> | 2026-02-11 09:57 | 154K | |
![[ ]](/icons/layout.gif) | 49260_Sussex Drivewa..> | 2026-02-27 15:55 | 154K | |
![[ ]](/icons/layout.gif) | 53386_Go Direct Door..> | 2026-03-10 14:33 | 154K | |
![[ ]](/icons/layout.gif) | 60197_Rollermatic Ga..> | 2026-03-27 13:30 | 154K | |
![[ ]](/icons/layout.gif) | 34145_Chelmsford Rol..> | 2026-01-16 09:08 | 154K | |
![[ ]](/icons/layout.gif) | 34385_Roll Right Gar..> | 2026-01-16 16:11 | 154K | |
![[ ]](/icons/layout.gif) | 41165_Replacement Ga..> | 2026-02-06 08:02 | 154K | |
![[ ]](/icons/layout.gif) | 43756_Dans Doors Dan..> | 2026-02-13 16:24 | 154K | |
![[ ]](/icons/layout.gif) | 45638_Scotia Garage ..> | 2026-02-18 13:23 | 154K | |
![[ ]](/icons/layout.gif) | 46376_Rolladoor NR9 ..> | 2026-02-20 08:11 | 154K | |
![[ ]](/icons/layout.gif) | 47398_Rollermatic Ga..> | 2026-02-24 08:20 | 154K | |
![[ ]](/icons/layout.gif) | 47783_Regal Windows ..> | 2026-02-24 15:46 | 154K | |
![[ ]](/icons/layout.gif) | 51407_GU2 Design And..> | 2026-03-05 11:36 | 154K | |
![[ ]](/icons/layout.gif) | 52411_Scotia Garage ..> | 2026-03-09 09:16 | 154K | |
![[ ]](/icons/layout.gif) | 54717_DP Windows Dar..> | 2026-03-13 11:28 | 154K | |
![[ ]](/icons/layout.gif) | 55843_Eclipse Doors ..> | 2026-03-17 13:48 | 154K | |
![[ ]](/icons/layout.gif) | 57468_Thomas Andrew ..> | 2026-03-20 12:37 | 154K | |
![[ ]](/icons/layout.gif) | 58996_Thomas Andrew ..> | 2026-03-25 10:42 | 154K | |
![[ ]](/icons/layout.gif) | 36490_3 Brothers Bui..> | 2026-01-23 11:43 | 154K | |
![[ ]](/icons/layout.gif) | 41507_ASSW Ltd BS10 ..> | 2026-02-09 08:30 | 154K | |
![[ ]](/icons/layout.gif) | 47278_P & R Door Sys..> | 2026-02-23 16:05 | 154K | |
![[ ]](/icons/layout.gif) | 48368_J Brady Garage..> | 2026-02-26 10:00 | 154K | |
![[ ]](/icons/layout.gif) | 50658_UK Rollerdoors..> | 2026-03-04 09:25 | 154K | |
![[ ]](/icons/layout.gif) | 52594_Dream Installa..> | 2026-03-09 12:14 | 154K | |
![[ ]](/icons/layout.gif) | 57244_Norfolk Doors ..> | 2026-03-20 09:17 | 154K | |
![[ ]](/icons/layout.gif) | 57517_J Galliott Bui..> | 2026-03-20 13:59 | 154K | |
![[ ]](/icons/layout.gif) | 61046_Ross Garage Do..> | 2026-03-31 09:29 | 154K | |
![[ ]](/icons/layout.gif) | 61055_Ross Garage Do..> | 2026-03-31 09:34 | 154K | |
![[ ]](/icons/layout.gif) | 36141_Entador System..> | 2026-01-22 13:45 | 154K | |
![[ ]](/icons/layout.gif) | 41465_ASSW Ltd BS10 ..> | 2026-02-06 15:42 | 154K | |
![[ ]](/icons/layout.gif) | 46502_Window Tec Lee..> | 2026-02-20 10:05 | 154K | |
![[ ]](/icons/layout.gif) | 46861_Dream Installa..> | 2026-02-20 15:17 | 154K | |
![[ ]](/icons/layout.gif) | 37148_Replacement Ga..> | 2026-01-26 15:13 | 154K | |
![[ ]](/icons/layout.gif) | 41411_Scotia Garage ..> | 2026-02-06 13:46 | 154K | |
![[ ]](/icons/layout.gif) | 47416_Doors 4 You Lt..> | 2026-02-24 08:38 | 154K | |
![[ ]](/icons/layout.gif) | 53561_Replacement Ga..> | 2026-03-11 08:25 | 154K | |
![[ ]](/icons/layout.gif) | 55277_Ace Garage Doo..> | 2026-03-16 12:10 | 154K | |
![[ ]](/icons/layout.gif) | 57429_Garage Door Se..> | 2026-03-20 11:54 | 154K | |
![[ ]](/icons/layout.gif) | 57433_Garage Door Se..> | 2026-03-20 12:01 | 154K | |
![[ ]](/icons/layout.gif) | 60541_Ace Garage Doo..> | 2026-03-30 11:02 | 154K | |
![[ ]](/icons/layout.gif) | 60918_Thomas Andrew ..> | 2026-03-31 07:25 | 154K | |
![[ ]](/icons/layout.gif) | 37680_Replacement Ga..> | 2026-01-27 16:00 | 154K | |
![[ ]](/icons/layout.gif) | 38401_Rollermatic Ga..> | 2026-01-29 11:38 | 154K | |
![[ ]](/icons/layout.gif) | 39296_Elevate Doors ..> | 2026-02-02 13:46 | 154K | |
![[ ]](/icons/layout.gif) | 42423_Clic Garage Do..> | 2026-02-11 07:45 | 154K | |
![[ ]](/icons/layout.gif) | 42994_AJ Roller Shut..> | 2026-02-12 10:56 | 154K | |
![[ ]](/icons/layout.gif) | 48160_Heavy Metal En..> | 2026-02-25 13:39 | 154K | |
![[ ]](/icons/layout.gif) | 53617_RP Manufacturi..> | 2026-03-11 09:01 | 154K | |
![[ ]](/icons/layout.gif) | 58697_Ace Garage Doo..> | 2026-03-24 14:46 | 154K | |
![[ ]](/icons/layout.gif) | 68762_SW Trade Frame..> | 2026-04-22 07:08 | 154K | |
![[ ]](/icons/layout.gif) | 34815_AJ Trade Andre..> | 2026-01-19 16:18 | 154K | |
![[ ]](/icons/layout.gif) | 34818_AJ Trade Andre..> | 2026-01-19 16:19 | 154K | |
![[ ]](/icons/layout.gif) | 34879_AJ Trade Andre..> | 2026-01-20 07:25 | 154K | |
![[ ]](/icons/layout.gif) | 36836_Eclipse Doors ..> | 2026-01-26 10:01 | 154K | |
![[ ]](/icons/layout.gif) | 40456_Avon Automated..> | 2026-02-04 12:23 | 154K | |
![[ ]](/icons/layout.gif) | 45291_RH Doors & Shu..> | 2026-02-18 08:30 | 154K | |
![[ ]](/icons/layout.gif) | 53929_Rollermatic Ga..> | 2026-03-11 15:05 | 154K | |
![[ ]](/icons/layout.gif) | 55666_ThermoGreen Lt..> | 2026-03-17 09:18 | 154K | |
![[ ]](/icons/layout.gif) | 56158_Chelmsford Rol..> | 2026-03-18 08:55 | 154K | |
![[ ]](/icons/layout.gif) | 60778_Chelmsford Rol..> | 2026-03-30 14:57 | 154K | |
![[ ]](/icons/layout.gif) | 33640_Replacement Ga..> | 2026-01-15 10:07 | 154K | |
![[ ]](/icons/layout.gif) | 40540_Ace Garage Doo..> | 2026-02-04 14:28 | 154K | |
![[ ]](/icons/layout.gif) | 46659_Garage Doors 2..> | 2026-02-20 12:12 | 154K | |
![[ ]](/icons/layout.gif) | 49953_M. A. E. Windo..> | 2026-03-02 16:16 | 154K | |
![[ ]](/icons/layout.gif) | 59138_Absolute Garag..> | 2026-03-25 12:33 | 154K | |
![[ ]](/icons/layout.gif) | 34394_Absolute Garag..> | 2026-01-16 16:56 | 154K | |
![[ ]](/icons/layout.gif) | 44438_RnR Home Impro..> | 2026-02-17 08:05 | 154K | |
![[ ]](/icons/layout.gif) | 46909_Rollermatic Ga..> | 2026-02-20 16:41 | 154K | |
![[ ]](/icons/layout.gif) | 46910_Rollermatic Ga..> | 2026-02-20 16:43 | 154K | |
![[ ]](/icons/layout.gif) | 46914_Rollermatic Ga..> | 2026-02-20 16:54 | 154K | |
![[ ]](/icons/layout.gif) | 50348_3 Counties (Sa..> | 2026-03-03 14:24 | 154K | |
![[ ]](/icons/layout.gif) | 55094_Fortress Doors..> | 2026-03-16 08:36 | 154K | |
![[ ]](/icons/layout.gif) | 57134_Rollermatic Ga..> | 2026-03-20 08:09 | 154K | |
![[ ]](/icons/layout.gif) | 59075_Bryan Thompson..> | 2026-03-25 11:15 | 154K | |
![[ ]](/icons/layout.gif) | 59964_ADB Electrical..> | 2026-03-27 09:30 | 154K | |
![[ ]](/icons/layout.gif) | 59988_Proud 2 Fix Ma..> | 2026-03-27 10:03 | 154K | |
![[ ]](/icons/layout.gif) | 34228_Replacement Ga..> | 2026-01-16 10:39 | 154K | |
![[ ]](/icons/layout.gif) | 34609_Harry Curtis H..> | 2026-01-19 11:10 | 154K | |
![[ ]](/icons/layout.gif) | 41460_ThermoGreen Lt..> | 2026-02-06 15:36 | 154K | |
![[ ]](/icons/layout.gif) | 50479_Rising Group L..> | 2026-03-04 07:40 | 154K | |
![[ ]](/icons/layout.gif) | 57482_MNH Windows & ..> | 2026-03-20 13:09 | 154K | |
![[ ]](/icons/layout.gif) | 43084_PB Doors Paul ..> | 2026-02-12 12:26 | 154K | |
![[ ]](/icons/layout.gif) | 55685_J Brady Garage..> | 2026-03-17 09:47 | 154K | |
![[ ]](/icons/layout.gif) | 55812_Rhino Windows ..> | 2026-03-17 12:10 | 154K | |
![[ ]](/icons/layout.gif) | 56472_Enlightened So..> | 2026-03-18 13:49 | 154K | |
![[ ]](/icons/layout.gif) | 57450_Clic Garage Do..> | 2026-03-20 12:20 | 154K | |
![[ ]](/icons/layout.gif) | 37226_Eclipse Doors ..> | 2026-01-26 16:14 | 154K | |
![[ ]](/icons/layout.gif) | 37663_Rhino Windows ..> | 2026-01-27 15:39 | 154K | |
![[ ]](/icons/layout.gif) | 37937_Liam Walker - ..> | 2026-01-28 12:53 | 154K | |
![[ ]](/icons/layout.gif) | 41221_ThermoGreen Lt..> | 2026-02-06 09:19 | 154K | |
![[ ]](/icons/layout.gif) | 43004_AJ Roller Shut..> | 2026-02-12 11:22 | 154K | |
![[ ]](/icons/layout.gif) | 44311_The Garage Doo..> | 2026-02-16 15:42 | 154K | |
![[ ]](/icons/layout.gif) | 48597_Rollermatic Ga..> | 2026-02-26 13:49 | 154K | |
![[ ]](/icons/layout.gif) | 54523_Replacement Ga..> | 2026-03-13 07:48 | 154K | |
![[ ]](/icons/layout.gif) | 34768_UK Door System..> | 2026-01-19 14:50 | 154K | |
![[ ]](/icons/layout.gif) | 40265_Windows Plus U..> | 2026-02-04 08:33 | 154K | |
![[ ]](/icons/layout.gif) | 46879_Chelmsford Rol..> | 2026-02-20 15:34 | 154K | |
![[ ]](/icons/layout.gif) | 46880_Chelmsford Rol..> | 2026-02-20 15:35 | 154K | |
![[ ]](/icons/layout.gif) | 53515_Absolute Garag..> | 2026-03-10 16:49 | 154K | |
![[ ]](/icons/layout.gif) | 57240_Adams Industri..> | 2026-03-20 09:12 | 154K | |
![[ ]](/icons/layout.gif) | 34281_Evans & Fry Lt..> | 2026-01-16 13:32 | 154K | |
![[ ]](/icons/layout.gif) | 38911_T & G Home Imp..> | 2026-01-30 12:33 | 154K | |
![[ ]](/icons/layout.gif) | 42114_T & G Home Imp..> | 2026-02-10 10:05 | 154K | |
![[ ]](/icons/layout.gif) | 46080_Colin Adams Wi..> | 2026-02-19 12:06 | 154K | |
![[ ]](/icons/layout.gif) | 50522_Danbury Garage..> | 2026-03-04 08:12 | 154K | |
![[ ]](/icons/layout.gif) | 56105_Rollermatic Ga..> | 2026-03-17 16:43 | 154K | |
![[ ]](/icons/layout.gif) | 60580_MIB Electrical..> | 2026-03-30 12:13 | 154K | |
![[ ]](/icons/layout.gif) | 35811_SDL DOOR REPAI..> | 2026-01-21 15:06 | 154K | |
![[ ]](/icons/layout.gif) | 37533_WADE WINDOWS I..> | 2026-01-27 13:09 | 154K | |
![[ ]](/icons/layout.gif) | 38851_Adams Industri..> | 2026-01-30 11:36 | 154K | |
![[ ]](/icons/layout.gif) | 40124_J Brady Garage..> | 2026-02-03 16:00 | 154K | |
![[ ]](/icons/layout.gif) | 45707_GU2 Design And..> | 2026-02-18 14:18 | 154K | |
![[ ]](/icons/layout.gif) | 46106_Ecosse Garage ..> | 2026-02-19 13:36 | 154K | |
![[ ]](/icons/layout.gif) | 51202_Wall Garage Do..> | 2026-03-05 08:36 | 154K | |
![[ ]](/icons/layout.gif) | 51629_Scotia Garage ..> | 2026-03-05 15:32 | 154K | |
![[ ]](/icons/layout.gif) | 54872_Elevate Doors ..> | 2026-03-13 14:10 | 154K | |
![[ ]](/icons/layout.gif) | 34355_UK Door System..> | 2026-01-16 15:05 | 154K | |
![[ ]](/icons/layout.gif) | 42808_Southwest Cons..> | 2026-02-11 16:01 | 154K | |
![[ ]](/icons/layout.gif) | 51148_CWG Home Impro..> | 2026-03-05 07:55 | 154K | |
![[ ]](/icons/layout.gif) | 57581_Scotia Garage ..> | 2026-03-20 15:35 | 154K | |
![[ ]](/icons/layout.gif) | 33313_Serenade Home ..> | 2026-01-14 14:46 | 154K | |
![[ ]](/icons/layout.gif) | 33781_Regal Windows ..> | 2026-01-15 13:01 | 154K | |
![[ ]](/icons/layout.gif) | 34821_RnR Home Impro..> | 2026-01-19 16:22 | 154K | |
![[ ]](/icons/layout.gif) | 37553_Chelmsford Rol..> | 2026-01-27 13:50 | 154K | |
![[ ]](/icons/layout.gif) | 46772_Chelmsford Rol..> | 2026-02-20 14:24 | 154K | |
![[ ]](/icons/layout.gif) | 48253_P & R Door Sys..> | 2026-02-25 16:53 | 154K | |
![[ ]](/icons/layout.gif) | 48456_J Brady Garage..> | 2026-02-26 10:50 | 154K | |
![[ ]](/icons/layout.gif) | 53331_Chelmsford Rol..> | 2026-03-10 14:05 | 154K | |
![[ ]](/icons/layout.gif) | 61997_Fortress Doors..> | 2026-04-01 14:37 | 154K | |
![[ ]](/icons/layout.gif) | 36985_Ace Garage Doo..> | 2026-01-26 13:05 | 154K | |
![[ ]](/icons/layout.gif) | 43091_Custom Trade S..> | 2026-02-12 12:58 | 154K | |
![[ ]](/icons/layout.gif) | 55098_UK Ultra Doors..> | 2026-03-16 08:45 | 154K | |
![[ ]](/icons/layout.gif) | 55650_Replacement Ga..> | 2026-03-17 08:51 | 154K | |
![[ ]](/icons/layout.gif) | 59704_Bespoke Living..> | 2026-03-26 14:22 | 154K | |
![[ ]](/icons/layout.gif) | 33337_The Garage Doo..> | 2026-01-14 15:00 | 154K | |
![[ ]](/icons/layout.gif) | 39001_Dream Installa..> | 2026-01-30 15:20 | 154K | |
![[ ]](/icons/layout.gif) | 39002_Dream Installa..> | 2026-01-30 15:21 | 154K | |
![[ ]](/icons/layout.gif) | 42093_Scotia Garage ..> | 2026-02-10 09:52 | 154K | |
![[ ]](/icons/layout.gif) | 46097_Scotia Garage ..> | 2026-02-19 12:53 | 154K | |
![[ ]](/icons/layout.gif) | 54376_P & R Door Sys..> | 2026-03-12 16:07 | 154K | |
![[ ]](/icons/layout.gif) | 54481_P & R Door Sys..> | 2026-03-12 16:58 | 154K | |
![[ ]](/icons/layout.gif) | 57458_Garage Door Se..> | 2026-03-20 12:23 | 154K | |
![[ ]](/icons/layout.gif) | 57460_Garage Door Se..> | 2026-03-20 12:26 | 154K | |
![[ ]](/icons/layout.gif) | 57659_Chelmsford Rol..> | 2026-03-20 16:10 | 154K | |
![[ ]](/icons/layout.gif) | 59197_Rhino Windows ..> | 2026-03-25 13:40 | 154K | |
![[ ]](/icons/layout.gif) | 61204_HTH Developmen..> | 2026-03-31 11:49 | 154K | |
![[ ]](/icons/layout.gif) | 34274_Rollermatic Ga..> | 2026-01-16 12:39 | 154K | |
![[ ]](/icons/layout.gif) | 41475_Ecosse Garage ..> | 2026-02-06 16:18 | 154K | |
![[ ]](/icons/layout.gif) | 43011_AJ Roller Shut..> | 2026-02-12 11:25 | 154K | |
![[ ]](/icons/layout.gif) | 46835_MNH Windows & ..> | 2026-02-20 14:42 | 154K | |
![[ ]](/icons/layout.gif) | 49743_Go Direct Door..> | 2026-03-02 13:51 | 154K | |
![[ ]](/icons/layout.gif) | 51790_Gilberts Home ..> | 2026-03-06 08:44 | 154K | |
![[ ]](/icons/layout.gif) | 54835_Rollermatic Ga..> | 2026-03-13 13:15 | 154K | |
![[ ]](/icons/layout.gif) | 55125_Adams Roller S..> | 2026-03-16 09:18 | 154K | |
![[ ]](/icons/layout.gif) | 59246_CWD Improvemen..> | 2026-03-25 14:43 | 154K | |
![[ ]](/icons/layout.gif) | 34259_Chelmsford Rol..> | 2026-01-16 11:48 | 154K | |
![[ ]](/icons/layout.gif) | 42545_UK Rollerdoors..> | 2026-02-11 09:49 | 154K | |
![[ ]](/icons/layout.gif) | 43271_Fortress Doors..> | 2026-02-12 16:57 | 154K | |
![[ ]](/icons/layout.gif) | 54863_Elevate Doors ..> | 2026-03-13 14:02 | 154K | |
![[ ]](/icons/layout.gif) | 56355_Chelmsford Rol..> | 2026-03-18 12:19 | 154K | |
![[ ]](/icons/layout.gif) | 36295_Chelmsford Rol..> | 2026-01-23 09:29 | 154K | |
![[ ]](/icons/layout.gif) | 37941_Danbury Garage..> | 2026-01-28 12:58 | 154K | |
![[ ]](/icons/layout.gif) | 44351_Thomas Andrew ..> | 2026-02-16 16:10 | 154K | |
![[ ]](/icons/layout.gif) | 48158_Go Direct Door..> | 2026-02-25 13:35 | 154K | |
![[ ]](/icons/layout.gif) | 52744_Evans Building..> | 2026-03-09 15:01 | 154K | |
![[ ]](/icons/layout.gif) | 60890_Rollermatic Ga..> | 2026-03-30 15:57 | 154K | |
![[ ]](/icons/layout.gif) | 36739_Pro-Frame Wind..> | 2026-01-26 08:13 | 154K | |
![[ ]](/icons/layout.gif) | 41439_Dream Installa..> | 2026-02-06 15:10 | 154K | |
![[ ]](/icons/layout.gif) | 42422_Clic Garage Do..> | 2026-02-10 17:02 | 154K | |
![[ ]](/icons/layout.gif) | 43759_Ace Garage Doo..> | 2026-02-13 16:35 | 154K | |
![[ ]](/icons/layout.gif) | 60479_Ace Garage Doo..> | 2026-03-30 10:00 | 154K | |
![[ ]](/icons/layout.gif) | 37746_Turners Roller..> | 2026-01-28 08:27 | 154K | |
![[ ]](/icons/layout.gif) | 40592_Manor Projects..> | 2026-02-04 15:51 | 154K | |
![[ ]](/icons/layout.gif) | 45624_T D Rollerdoor..> | 2026-02-18 12:56 | 154K | |
![[ ]](/icons/layout.gif) | 61176_Doors 4 You Lt..> | 2026-03-31 11:08 | 154K | |
![[ ]](/icons/layout.gif) | 61258_Avon Automated..> | 2026-03-31 12:35 | 154K | |
![[ ]](/icons/layout.gif) | 37552_Turners Roller..> | 2026-01-27 13:45 | 154K | |
![[ ]](/icons/layout.gif) | 37741_Turners Roller..> | 2026-01-28 08:18 | 154K | |
![[ ]](/icons/layout.gif) | 39341_J Brady Garage..> | 2026-02-02 15:07 | 154K | |
![[ ]](/icons/layout.gif) | 39962_PB Doors Paul ..> | 2026-02-03 13:07 | 154K | |
![[ ]](/icons/layout.gif) | 42347_Clic Garage Do..> | 2026-02-10 15:13 | 154K | |
![[ ]](/icons/layout.gif) | 49286_Evans Building..> | 2026-02-27 16:30 | 154K | |
![[ ]](/icons/layout.gif) | 50939_GU2 Design And..> | 2026-03-04 14:38 | 154K | |
![[ ]](/icons/layout.gif) | 57464_Clic Garage Do..> | 2026-03-20 12:30 | 154K | |
![[ ]](/icons/layout.gif) | 66941_Garage Makeove..> | 2026-04-17 07:42 | 154K | |
![[ ]](/icons/layout.gif) | 34718_UK Door System..> | 2026-01-19 13:41 | 154K | |
![[ ]](/icons/layout.gif) | 40052_Avon Automated..> | 2026-02-03 15:06 | 154K | |
![[ ]](/icons/layout.gif) | 44034_Bark Oak Build..> | 2026-02-16 11:05 | 154K | |
![[ ]](/icons/layout.gif) | 46649_Garage Doors 2..> | 2026-02-20 12:01 | 154K | |
![[ ]](/icons/layout.gif) | 56321_Rollermatic Ga..> | 2026-03-18 11:53 | 154K | |
![[ ]](/icons/layout.gif) | 56604_Julian Gallimo..> | 2026-03-18 16:54 | 154K | |
![[ ]](/icons/layout.gif) | 58911_Replacement Ga..> | 2026-03-25 09:02 | 154K | |
![[ ]](/icons/layout.gif) | 34352_Garage Doors 2..> | 2026-01-16 14:52 | 154K | |
![[ ]](/icons/layout.gif) | 35280_Garage Doors 2..> | 2026-01-20 14:58 | 154K | |
![[ ]](/icons/layout.gif) | 37227_CRBS Electrica..> | 2026-01-26 16:15 | 154K | |
![[ ]](/icons/layout.gif) | 39524_Adams Industri..> | 2026-02-03 07:47 | 154K | |
![[ ]](/icons/layout.gif) | 41477_Danbury Garage..> | 2026-02-06 16:30 | 154K | |
![[ ]](/icons/layout.gif) | 41501_Danbury Garage..> | 2026-02-09 08:21 | 154K | |
![[ ]](/icons/layout.gif) | 50325_J Brady Garage..> | 2026-03-03 13:46 | 154K | |
![[ ]](/icons/layout.gif) | 56126_J Brady Garage..> | 2026-03-18 07:40 | 154K | |
![[ ]](/icons/layout.gif) | 56594_Julian Gallimo..> | 2026-03-18 16:36 | 154K | |
![[ ]](/icons/layout.gif) | 58488_Ace Garage Doo..> | 2026-03-24 11:06 | 154K | |
![[ ]](/icons/layout.gif) | 60488_Ace Garage Doo..> | 2026-03-30 10:10 | 154K | |
![[ ]](/icons/layout.gif) | 35283_Avon Automated..> | 2026-01-20 15:01 | 154K | |
![[ ]](/icons/layout.gif) | 36538_AM Shutters M..> | 2026-01-23 12:42 | 154K | |
![[ ]](/icons/layout.gif) | 51835_M. A. E. Windo..> | 2026-03-06 09:28 | 154K | |
![[ ]](/icons/layout.gif) | 34778_Harry Curtis H..> | 2026-01-19 15:08 | 154K | |
![[ ]](/icons/layout.gif) | 34793_Harry Curtis H..> | 2026-01-19 15:40 | 154K | |
![[ ]](/icons/layout.gif) | 44283_Elevate Doors ..> | 2026-02-16 15:01 | 154K | |
![[ ]](/icons/layout.gif) | 49972_SX Property Ma..> | 2026-03-02 16:29 | 154K | |
![[ ]](/icons/layout.gif) | 53541_Emerald Garage..> | 2026-03-11 08:02 | 154K | |
![[ ]](/icons/layout.gif) | 55037_Wall Garage Do..> | 2026-03-13 16:32 | 154K | |
![[ ]](/icons/layout.gif) | 57413_Elevate Doors ..> | 2026-03-20 11:34 | 154K | |
![[ ]](/icons/layout.gif) | 60880_Rollermatic Ga..> | 2026-03-30 15:50 | 154K | |
![[ ]](/icons/layout.gif) | 48745_Norfolk Doors ..> | 2026-02-26 16:37 | 154K | |
![[ ]](/icons/layout.gif) | 51469_All About Door..> | 2026-03-05 13:11 | 154K | |
![[ ]](/icons/layout.gif) | 53404_J Bowman Garag..> | 2026-03-10 14:51 | 154K | |
![[ ]](/icons/layout.gif) | 55027_Wall Garage Do..> | 2026-03-13 16:13 | 154K | |
![[ ]](/icons/layout.gif) | 56886_Go Direct Door..> | 2026-03-19 11:23 | 154K | |
![[ ]](/icons/layout.gif) | 59241_East Anglia Ro..> | 2026-03-25 14:32 | 154K | |
![[ ]](/icons/layout.gif) | 60196_Rollermatic Ga..> | 2026-03-27 13:25 | 154K | |
![[ ]](/icons/layout.gif) | 61397_John Medford -..> | 2026-03-31 13:21 | 154K | |
![[ ]](/icons/layout.gif) | 36986_Scotia Garage ..> | 2026-01-26 13:05 | 154K | |
![[ ]](/icons/layout.gif) | 47124_BH Electrical ..> | 2026-02-23 13:45 | 154K | |
![[ ]](/icons/layout.gif) | 47366_Excellent Ltd ..> | 2026-02-24 07:25 | 154K | |
![[ ]](/icons/layout.gif) | 49036_RepairMyGarage..> | 2026-02-27 10:52 | 154K | |
![[ ]](/icons/layout.gif) | 49930_Fixed Abode Ga..> | 2026-03-02 16:05 | 154K | |
![[ ]](/icons/layout.gif) | 50016_T D Rollerdoor..> | 2026-03-03 08:01 | 154K | |
![[ ]](/icons/layout.gif) | 50889_Tru-Fit Window..> | 2026-03-04 13:26 | 154K | |
![[ ]](/icons/layout.gif) | 52721_Ace Garage Doo..> | 2026-03-09 14:39 | 154K | |
![[ ]](/icons/layout.gif) | 54788_Rollermatic Ga..> | 2026-03-13 13:07 | 154K | |
![[ ]](/icons/layout.gif) | 57123_Rollermatic Ga..> | 2026-03-20 07:49 | 154K | |
![[ ]](/icons/layout.gif) | 36863_Camberley Wind..> | 2026-01-26 10:34 | 154K | |
![[ ]](/icons/layout.gif) | 37242_Dream Installa..> | 2026-01-26 16:32 | 154K | |
![[ ]](/icons/layout.gif) | 40228_Avon Automated..> | 2026-02-04 07:48 | 154K | |
![[ ]](/icons/layout.gif) | 41192_Eastern Frames..> | 2026-02-06 08:27 | 154K | |
![[ ]](/icons/layout.gif) | 53317_Ace Garage Doo..> | 2026-03-10 13:52 | 154K | |
![[ ]](/icons/layout.gif) | 58238_J Galliott Bui..> | 2026-03-23 16:59 | 154K | |
![[ ]](/icons/layout.gif) | 60112_Southwest Cons..> | 2026-03-27 12:11 | 154K | |
![[ ]](/icons/layout.gif) | 35137_Elevate Doors ..> | 2026-01-20 11:52 | 154K | |
![[ ]](/icons/layout.gif) | 41093_Rhino Windows ..> | 2026-02-05 16:05 | 154K | |
![[ ]](/icons/layout.gif) | 57463_Rhino Windows ..> | 2026-03-20 12:29 | 154K | |
![[ ]](/icons/layout.gif) | 33692_Replacement Ga..> | 2026-01-15 10:57 | 154K | |
![[ ]](/icons/layout.gif) | 34387_Roll Right Gar..> | 2026-01-16 16:25 | 154K | |
![[ ]](/icons/layout.gif) | 38269_3 Counties (Sa..> | 2026-01-29 10:08 | 154K | |
![[ ]](/icons/layout.gif) | 38544_ASM Windows Ad..> | 2026-01-29 14:38 | 154K | |
![[ ]](/icons/layout.gif) | 43235_Danbury Garage..> | 2026-02-12 15:37 | 154K | |
![[ ]](/icons/layout.gif) | 45439_Evans Building..> | 2026-02-18 09:09 | 154K | |
![[ ]](/icons/layout.gif) | 46753_Excellent Ltd ..> | 2026-02-20 14:16 | 154K | |
![[ ]](/icons/layout.gif) | 46786_Wessex Industr..> | 2026-02-20 14:27 | 154K | |
![[ ]](/icons/layout.gif) | 47355_ASM Windows Ad..> | 2026-02-23 16:49 | 154K | |
![[ ]](/icons/layout.gif) | 51398_Wellingborough..> | 2026-03-05 11:30 | 154K | |
![[ ]](/icons/layout.gif) | 51632_Wellingborough..> | 2026-03-05 15:37 | 154K | |
![[ ]](/icons/layout.gif) | 53096_Oakley Windows..> | 2026-03-10 10:03 | 154K | |
![[ ]](/icons/layout.gif) | 57522_Absolute Garag..> | 2026-03-20 14:03 | 154K | |
![[ ]](/icons/layout.gif) | 57713_J Galliott Bui..> | 2026-03-23 08:20 | 154K | |
![[ ]](/icons/layout.gif) | 61065_Digby Services..> | 2026-03-31 10:11 | 154K | |
![[ ]](/icons/layout.gif) | 33356_The Garage Doo..> | 2026-01-14 15:24 | 154K | |
![[ ]](/icons/layout.gif) | 34657_Absolute Garag..> | 2026-01-19 11:52 | 154K | |
![[ ]](/icons/layout.gif) | 35807_Dream Installa..> | 2026-01-21 14:46 | 154K | |
![[ ]](/icons/layout.gif) | 46842_Ecosse Garage ..> | 2026-02-20 14:52 | 154K | |
![[ ]](/icons/layout.gif) | 51263_Roll Right Gar..> | 2026-03-05 09:40 | 154K | |
![[ ]](/icons/layout.gif) | 53156_J Brady Garage..> | 2026-03-10 11:07 | 154K | |
![[ ]](/icons/layout.gif) | 54866_Elevate Doors ..> | 2026-03-13 14:07 | 154K | |
![[ ]](/icons/layout.gif) | 56786_Go Direct Door..> | 2026-03-19 10:34 | 154K | |
![[ ]](/icons/layout.gif) | 59158_A.S.M Windows ..> | 2026-03-25 13:21 | 154K | |
![[ ]](/icons/layout.gif) | 34383_NBG Doors Nick..> | 2026-01-16 16:01 | 154K | |
![[ ]](/icons/layout.gif) | 35080_Go Direct Door..> | 2026-01-20 11:02 | 154K | |
![[ ]](/icons/layout.gif) | 38698_Adams Industri..> | 2026-01-30 09:20 | 154K | |
![[ ]](/icons/layout.gif) | 46419_Evans Building..> | 2026-02-20 08:59 | 154K | |
![[ ]](/icons/layout.gif) | 48021_MNH Windows & ..> | 2026-02-25 09:37 | 154K | |
![[ ]](/icons/layout.gif) | 56938_Wellingborough..> | 2026-03-19 12:21 | 154K | |
![[ ]](/icons/layout.gif) | 60489_Southwest Cons..> | 2026-03-30 10:11 | 154K | |
![[ ]](/icons/layout.gif) | 33244_Elevate Doors ..> | 2026-01-14 13:43 | 154K | |
![[ ]](/icons/layout.gif) | 34066_Replacement Ga..> | 2026-01-16 08:01 | 154K | |
![[ ]](/icons/layout.gif) | 34070_Replacement Ga..> | 2026-01-16 08:06 | 154K | |
![[ ]](/icons/layout.gif) | 35701_Pro-Frame Wind..> | 2026-01-21 12:53 | 154K | |
![[ ]](/icons/layout.gif) | 35860_Ace Garage Doo..> | 2026-01-21 16:16 | 154K | |
![[ ]](/icons/layout.gif) | 41782_M & S Home Ins..> | 2026-02-09 14:50 | 154K | |
![[ ]](/icons/layout.gif) | 51378_Window Repair ..> | 2026-03-05 11:11 | 154K | |
![[ ]](/icons/layout.gif) | 33435_UK Door System..> | 2026-01-14 16:46 | 154K | |
![[ ]](/icons/layout.gif) | 35972_Eclipse Doors ..> | 2026-01-22 10:36 | 154K | |
![[ ]](/icons/layout.gif) | 39572_ThermoGreen Lt..> | 2026-02-03 08:09 | 154K | |
![[ ]](/icons/layout.gif) | 40154_Mtmworks Wayne..> | 2026-02-03 16:25 | 154K | |
![[ ]](/icons/layout.gif) | 51828_Evans Building..> | 2026-03-06 09:20 | 154K | |
![[ ]](/icons/layout.gif) | 55114_Fortress Doors..> | 2026-03-16 09:09 | 154K | |
![[ ]](/icons/layout.gif) | 57416_Avon Automated..> | 2026-03-20 11:37 | 154K | |
![[ ]](/icons/layout.gif) | 38145_JJ Secure Door..> | 2026-01-28 16:40 | 154K | |
![[ ]](/icons/layout.gif) | 38389_Chelmsford Rol..> | 2026-01-29 11:24 | 154K | |
![[ ]](/icons/layout.gif) | 39348_Chelmsford Rol..> | 2026-02-02 15:29 | 154K | |
![[ ]](/icons/layout.gif) | 41437_Avon Automated..> | 2026-02-06 14:54 | 154K | |
![[ ]](/icons/layout.gif) | 51488_Anthony Floria..> | 2026-03-05 13:39 | 154K | |
![[ ]](/icons/layout.gif) | 57704_Fortress Doors..> | 2026-03-23 08:17 | 154K | |
![[ ]](/icons/layout.gif) | 59949_Doorolla Ltd S..> | 2026-03-27 09:16 | 154K | |
![[ ]](/icons/layout.gif) | 61499_Dream Installa..> | 2026-03-31 15:00 | 154K | |
![[ ]](/icons/layout.gif) | 61839_Dream Installa..> | 2026-04-01 11:36 | 154K | |
![[ ]](/icons/layout.gif) | 35481_J Brady Garage..> | 2026-01-21 08:33 | 154K | |
![[ ]](/icons/layout.gif) | 38606_Go Direct Door..> | 2026-01-29 16:43 | 154K | |
![[ ]](/icons/layout.gif) | 40513_Elevate Doors ..> | 2026-02-04 13:49 | 154K | |
![[ ]](/icons/layout.gif) | 57588_Rollermatic Ga..> | 2026-03-20 15:42 | 154K | |
![[ ]](/icons/layout.gif) | 58212_Avon Automated..> | 2026-03-23 16:35 | 154K | |
![[ ]](/icons/layout.gif) | 58553_MIB Electrical..> | 2026-03-24 13:06 | 154K | |
![[ ]](/icons/layout.gif) | 35437_Ace Garage Doo..> | 2026-01-21 07:39 | 154K | |
![[ ]](/icons/layout.gif) | 37416_T D Rollerdoor..> | 2026-01-27 11:31 | 154K | |
![[ ]](/icons/layout.gif) | 40138_Absolute Garag..> | 2026-02-03 16:13 | 154K | |
![[ ]](/icons/layout.gif) | 42481_Elevate Doors ..> | 2026-02-11 09:03 | 154K | |
![[ ]](/icons/layout.gif) | 42686_Elevate Doors ..> | 2026-02-11 12:24 | 154K | |
![[ ]](/icons/layout.gif) | 44232_Garage Door & ..> | 2026-02-16 14:23 | 154K | |
![[ ]](/icons/layout.gif) | 45602_T D Rollerdoor..> | 2026-02-18 12:14 | 154K | |
![[ ]](/icons/layout.gif) | 52425_Ecosse Garage ..> | 2026-03-09 09:33 | 154K | |
![[ ]](/icons/layout.gif) | 56783_A Complete Win..> | 2026-03-19 10:31 | 154K | |
![[ ]](/icons/layout.gif) | 33979_Regal Windows ..> | 2026-01-15 16:22 | 154K | |
![[ ]](/icons/layout.gif) | 38668_Avon Automated..> | 2026-01-30 08:40 | 154K | |
![[ ]](/icons/layout.gif) | 49348_Ecosse Garage ..> | 2026-03-02 08:27 | 154K | |
![[ ]](/icons/layout.gif) | 49741_Go Direct Door..> | 2026-03-02 13:46 | 154K | |
![[ ]](/icons/layout.gif) | 55083_Fortress Doors..> | 2026-03-16 08:10 | 154K | |
![[ ]](/icons/layout.gif) | 41374_Doorolla Ltd S..> | 2026-02-06 12:35 | 154K | |
![[ ]](/icons/layout.gif) | 44961_Rhino Windows ..> | 2026-02-17 13:58 | 154K | |
![[ ]](/icons/layout.gif) | 46905_Warnsham Windo..> | 2026-02-20 16:26 | 154K | |
![[ ]](/icons/layout.gif) | 48681_Evans Building..> | 2026-02-26 15:23 | 154K | |
![[ ]](/icons/layout.gif) | 48741_Evans Building..> | 2026-02-26 16:24 | 154K | |
![[ ]](/icons/layout.gif) | 54323_Julian Gallimo..> | 2026-03-12 15:06 | 154K | |
![[ ]](/icons/layout.gif) | 54590_J Brady Garage..> | 2026-03-13 08:53 | 154K | |
![[ ]](/icons/layout.gif) | 56596_Rhino Windows ..> | 2026-03-18 16:42 | 154K | |
![[ ]](/icons/layout.gif) | 37551_Chelmsford Rol..> | 2026-01-27 13:43 | 154K | |
![[ ]](/icons/layout.gif) | 37936_Liam Walker - ..> | 2026-01-28 12:53 | 154K | |
![[ ]](/icons/layout.gif) | 38762_Secure Entranc..> | 2026-01-30 10:21 | 154K | |
![[ ]](/icons/layout.gif) | 44499_CPS Custom Pro..> | 2026-02-17 08:28 | 154K | |
![[ ]](/icons/layout.gif) | 45794_All Door Engin..> | 2026-02-18 14:54 | 154K | |
![[ ]](/icons/layout.gif) | 45801_All Door Engin..> | 2026-02-18 14:55 | 154K | |
![[ ]](/icons/layout.gif) | 49113_Elevate Doors ..> | 2026-02-27 13:12 | 154K | |
![[ ]](/icons/layout.gif) | 49869_Go Direct Door..> | 2026-03-02 15:43 | 154K | |
![[ ]](/icons/layout.gif) | 50425_JA Electrical ..> | 2026-03-03 16:29 | 154K | |
![[ ]](/icons/layout.gif) | 51220_Serenade Home ..> | 2026-03-05 08:58 | 154K | |
![[ ]](/icons/layout.gif) | 51271_Serenade Home ..> | 2026-03-05 09:49 | 154K | |
![[ ]](/icons/layout.gif) | 55498_Wellingborough..> | 2026-03-16 14:44 | 154K | |
![[ ]](/icons/layout.gif) | 55755_Wellingborough..> | 2026-03-17 11:09 | 154K | |
![[ ]](/icons/layout.gif) | 56344_UK Rollerdoors..> | 2026-03-18 12:11 | 154K | |
![[ ]](/icons/layout.gif) | 48225_SGT Carpentry ..> | 2026-02-25 15:12 | 154K | |
![[ ]](/icons/layout.gif) | 58719_Garage Doors 2..> | 2026-03-24 15:00 | 154K | |
![[ ]](/icons/layout.gif) | 34182_Garage Door & ..> | 2026-01-16 09:33 | 154K | |
![[ ]](/icons/layout.gif) | 39978_Rollermatic Ga..> | 2026-02-03 13:24 | 154K | |
![[ ]](/icons/layout.gif) | 46606_Window Repair ..> | 2026-02-20 11:31 | 154K | |
![[ ]](/icons/layout.gif) | 49369_The Dalby Grou..> | 2026-03-02 08:40 | 154K | |
![[ ]](/icons/layout.gif) | 52932_AAES Electrica..> | 2026-03-10 07:35 | 154K | |
![[ ]](/icons/layout.gif) | 41029_First Call Shu..> | 2026-02-05 14:30 | 154K | |
![[ ]](/icons/layout.gif) | 41456_Replacement Ga..> | 2026-02-06 15:30 | 154K | |
![[ ]](/icons/layout.gif) | 43815_The Lothian Ga..> | 2026-02-16 08:51 | 154K | |
![[ ]](/icons/layout.gif) | 46913_Rollermatic Ga..> | 2026-02-20 16:52 | 154K | |
![[ ]](/icons/layout.gif) | 52878_Garage Makeove..> | 2026-03-09 16:40 | 154K | |
![[ ]](/icons/layout.gif) | 53843_Emerald Garage..> | 2026-03-11 12:34 | 154K | |
![[ ]](/icons/layout.gif) | 57483_Rhino Windows ..> | 2026-03-20 13:10 | 154K | |
![[ ]](/icons/layout.gif) | 60870_Faith Home Imp..> | 2026-03-30 15:42 | 154K | |
![[ ]](/icons/layout.gif) | 41340_Next Generatio..> | 2026-02-06 11:48 | 154K | |
![[ ]](/icons/layout.gif) | 42390_A.S.M Windows ..> | 2026-02-10 16:14 | 154K | |
![[ ]](/icons/layout.gif) | 55805_Windowology Lt..> | 2026-03-17 12:09 | 154K | |
![[ ]](/icons/layout.gif) | 56345_Faith Home Imp..> | 2026-03-18 12:11 | 154K | |
![[ ]](/icons/layout.gif) | 60423_Windowcraft De..> | 2026-03-30 08:34 | 154K | |
![[ ]](/icons/layout.gif) | 53928_Rollermatic Ga..> | 2026-03-11 15:01 | 154K | |
![[ ]](/icons/layout.gif) | 54325_Julian Gallimo..> | 2026-03-12 15:14 | 154K | |
![[ ]](/icons/layout.gif) | 54621_Go Direct Door..> | 2026-03-13 09:33 | 154K | |
![[ ]](/icons/layout.gif) | 59010_Chelmsford Rol..> | 2026-03-25 10:56 | 154K | |
![[ ]](/icons/layout.gif) | 59232_Avon Automated..> | 2026-03-25 14:20 | 154K | |
![[ ]](/icons/layout.gif) | 38132_JJ Secure Door..> | 2026-01-28 16:36 | 154K | |
![[ ]](/icons/layout.gif) | 44621_M & S Home Ins..> | 2026-02-17 09:21 | 154K | |
![[ ]](/icons/layout.gif) | 49865_P & R Door Sys..> | 2026-03-02 15:36 | 154K | |
![[ ]](/icons/layout.gif) | 52882_AAES Electrica..> | 2026-03-09 16:43 | 154K | |
![[ ]](/icons/layout.gif) | 53409_Fortress Doors..> | 2026-03-10 15:18 | 154K | |
![[ ]](/icons/layout.gif) | 53572_Replacement Ga..> | 2026-03-11 08:34 | 154K | |
![[ ]](/icons/layout.gif) | 57660_CPS Custom Pro..> | 2026-03-20 16:12 | 154K | |
![[ ]](/icons/layout.gif) | 58141_J Brady Garage..> | 2026-03-23 14:54 | 154K | |
![[ ]](/icons/layout.gif) | 38119_East Anglia Ro..> | 2026-01-28 16:20 | 154K | |
![[ ]](/icons/layout.gif) | 44459_AAES Electrica..> | 2026-02-17 08:18 | 154K | |
![[ ]](/icons/layout.gif) | 52866_AAES Electrica..> | 2026-03-09 16:26 | 154K | |
![[ ]](/icons/layout.gif) | 53159_J Brady Garage..> | 2026-03-10 11:17 | 154K | |
![[ ]](/icons/layout.gif) | 55602_Replacement Ga..> | 2026-03-17 08:04 | 154K | |
![[ ]](/icons/layout.gif) | 60329_Warnsham Windo..> | 2026-03-27 16:12 | 154K | |
![[ ]](/icons/layout.gif) | 62510_Weatherproof W..> | 2026-04-02 15:35 | 154K | |
![[ ]](/icons/layout.gif) | 65064_Windowcraft De..> | 2026-04-13 11:03 | 154K | |
![[ ]](/icons/layout.gif) | 33755_Chelmsford Rol..> | 2026-01-15 12:15 | 154K | |
![[ ]](/icons/layout.gif) | 37126_Elevate Doors ..> | 2026-01-26 14:27 | 154K | |
![[ ]](/icons/layout.gif) | 37198_Danbury Garage..> | 2026-01-26 15:35 | 154K | |
![[ ]](/icons/layout.gif) | 42624_Clic Garage Do..> | 2026-02-11 11:16 | 154K | |
![[ ]](/icons/layout.gif) | 51350_Wellingborough..> | 2026-03-05 10:40 | 154K | |
![[ ]](/icons/layout.gif) | 57447_Avon Automated..> | 2026-03-20 12:16 | 154K | |
![[ ]](/icons/layout.gif) | 60812_East Anglia Ro..> | 2026-03-30 15:09 | 154K | |
![[ ]](/icons/layout.gif) | 37094_Ace Garage Doo..> | 2026-01-26 13:59 | 154K | |
![[ ]](/icons/layout.gif) | 44791_Rhino Windows ..> | 2026-02-17 11:37 | 154K | |
![[ ]](/icons/layout.gif) | 50405_East Anglia Ro..> | 2026-03-03 16:06 | 154K | |
![[ ]](/icons/layout.gif) | 56128_MG Securical L..> | 2026-03-18 08:07 | 154K | |
![[ ]](/icons/layout.gif) | 57480_Norfolk Doors ..> | 2026-03-20 13:06 | 154K | |
![[ ]](/icons/layout.gif) | 34389_M. A. E. Windo..> | 2026-01-16 16:31 | 154K | |
![[ ]](/icons/layout.gif) | 39344_J Brady Garage..> | 2026-02-02 15:22 | 154K | |
![[ ]](/icons/layout.gif) | 50408_Dream Installa..> | 2026-03-03 16:11 | 154K | |
![[ ]](/icons/layout.gif) | 69587_Hanney Glazed ..> | 2026-04-23 14:17 | 154K | |
![[ ]](/icons/layout.gif) | 58227_Go Direct Door..> | 2026-03-23 16:51 | 154K | |
![[ ]](/icons/layout.gif) | 46853_3 Counties (Sa..> | 2026-02-20 15:00 | 154K | |
![[ ]](/icons/layout.gif) | 58026_Rhino Windows ..> | 2026-03-23 12:46 | 154K | |
![[ ]](/icons/layout.gif) | 60371_Windowcraft De..> | 2026-03-30 07:47 | 154K | |
![[ ]](/icons/layout.gif) | 42859_The Lothian Ga..> | 2026-02-12 08:04 | 154K | |
![[ ]](/icons/layout.gif) | 46052_Fit & Fix Wind..> | 2026-02-19 11:12 | 154K | |
![[ ]](/icons/layout.gif) | 50924_Rollermatic Ga..> | 2026-03-04 14:12 | 154K | |
![[ ]](/icons/layout.gif) | 51804_Adams Industri..> | 2026-03-06 08:51 | 154K | |
![[ ]](/icons/layout.gif) | 53166_J Brady Garage..> | 2026-03-10 11:32 | 154K | |
![[ ]](/icons/layout.gif) | 57797_Rhino Windows ..> | 2026-03-23 09:37 | 154K | |
![[ ]](/icons/layout.gif) | 57949_Rhino Windows ..> | 2026-03-23 11:15 | 154K | |
![[ ]](/icons/layout.gif) | 60860_Faith Home Imp..> | 2026-03-30 15:39 | 154K | |
![[ ]](/icons/layout.gif) | 63662_Windowcraft De..> | 2026-04-08 14:11 | 154K | |
![[ ]](/icons/layout.gif) | 38091_Go Direct Door..> | 2026-01-28 15:45 | 154K | |
![[ ]](/icons/layout.gif) | 38660_Secure Entranc..> | 2026-01-30 08:28 | 154K | |
![[ ]](/icons/layout.gif) | 44248_Go Direct Door..> | 2026-02-16 14:30 | 154K | |
![[ ]](/icons/layout.gif) | 47223_M. A. E. Windo..> | 2026-02-23 15:50 | 154K | |
![[ ]](/icons/layout.gif) | 47845_Future Proof H..> | 2026-02-24 16:29 | 154K | |
![[ ]](/icons/layout.gif) | 49274_Rollermatic Ga..> | 2026-02-27 16:14 | 154K | |
![[ ]](/icons/layout.gif) | 37052_Go Direct Door..> | 2026-01-26 13:43 | 154K | |
![[ ]](/icons/layout.gif) | 43076_Warnsham Windo..> | 2026-02-12 12:16 | 154K | |
![[ ]](/icons/layout.gif) | 49279_Rollermatic Ga..> | 2026-02-27 16:15 | 154K | |
![[ ]](/icons/layout.gif) | 55266_Wellingborough..> | 2026-03-16 11:40 | 154K | |
![[ ]](/icons/layout.gif) | 56264_Eaton Park Win..> | 2026-03-18 10:54 | 154K | |
![[ ]](/icons/layout.gif) | 58358_Wellingborough..> | 2026-03-24 09:22 | 154K | |
![[ ]](/icons/layout.gif) | 64322_PDL Fabricatio..> | 2026-04-10 07:51 | 154K | |
![[ ]](/icons/layout.gif) | 34224_Hadrian Joiner..> | 2026-01-16 10:32 | 154K | |
![[ ]](/icons/layout.gif) | 38714_Devon Door & L..> | 2026-01-30 09:37 | 154K | |
![[ ]](/icons/layout.gif) | 47060_Rollermatic Ga..> | 2026-02-23 11:53 | 154K | |
![[ ]](/icons/layout.gif) | 51294_SH PROPERTY MA..> | 2026-03-05 09:58 | 154K | |
![[ ]](/icons/layout.gif) | 53293_Replacement Ga..> | 2026-03-10 13:30 | 154K | |
![[ ]](/icons/layout.gif) | 43111_Warnsham Windo..> | 2026-02-12 13:41 | 154K | |
![[ ]](/icons/layout.gif) | 44386_Harpers Door S..> | 2026-02-16 17:02 | 154K | |
![[ ]](/icons/layout.gif) | 59984_J Brady Garage..> | 2026-03-27 09:53 | 154K | |
![[ ]](/icons/layout.gif) | 66952_Garage Makeove..> | 2026-04-17 07:52 | 154K | |
![[ ]](/icons/layout.gif) | 40158_Chelmsford Rol..> | 2026-02-03 16:26 | 154K | |
![[ ]](/icons/layout.gif) | 40703_PDL Fabricatio..> | 2026-02-05 07:58 | 154K | |
![[ ]](/icons/layout.gif) | 52430_Replacement Ga..> | 2026-03-09 09:39 | 154K | |
![[ ]](/icons/layout.gif) | 53758_PDL Fabricatio..> | 2026-03-11 11:12 | 154K | |
![[ ]](/icons/layout.gif) | 56690_Fortress Doors..> | 2026-03-19 08:50 | 154K | |
![[ ]](/icons/layout.gif) | 59683_Warnsham Windo..> | 2026-03-26 14:02 | 154K | |
![[ ]](/icons/layout.gif) | 35412_MNH Windows & ..> | 2026-01-20 16:39 | 154K | |
![[ ]](/icons/layout.gif) | 40704_PDL Fabricatio..> | 2026-02-05 07:59 | 154K | |
![[ ]](/icons/layout.gif) | 41512_Garage Door & ..> | 2026-02-09 08:37 | 154K | |
![[ ]](/icons/layout.gif) | 42535_Direct Trade P..> | 2026-02-11 09:40 | 154K | |
![[ ]](/icons/layout.gif) | 47133_Avon Automated..> | 2026-02-23 14:07 | 154K | |
![[ ]](/icons/layout.gif) | 54456_Chelmsford Rol..> | 2026-03-12 16:34 | 154K | |
![[ ]](/icons/layout.gif) | 58355_Wellingborough..> | 2026-03-24 09:20 | 154K | |
![[ ]](/icons/layout.gif) | 35127_Go Direct Door..> | 2026-01-20 11:40 | 154K | |
![[ ]](/icons/layout.gif) | 39378_Chelmsford Rol..> | 2026-02-02 15:49 | 154K | |
![[ ]](/icons/layout.gif) | 55543_Herts & Essex ..> | 2026-03-16 15:59 | 154K | |
![[ ]](/icons/layout.gif) | 35499_Eastern Frames..> | 2026-01-21 08:40 | 154K | |
![[ ]](/icons/layout.gif) | 50232_Mansouri Desig..> | 2026-03-03 11:34 | 154K | |
![[ ]](/icons/layout.gif) | 55625_Replacement Ga..> | 2026-03-17 08:32 | 154K | |
![[ ]](/icons/layout.gif) | 56200_Rollermatic Ga..> | 2026-03-18 09:59 | 154K | |
![[ ]](/icons/layout.gif) | 59357_Garage Doors 2..> | 2026-03-26 08:56 | 154K | |
![[ ]](/icons/layout.gif) | 35369_Eastern Frames..> | 2026-01-20 15:56 | 154K | |
![[ ]](/icons/layout.gif) | 36196_Elevate Doors ..> | 2026-01-22 15:53 | 154K | |
![[ ]](/icons/layout.gif) | 52884_Fixed Abode Ga..> | 2026-03-09 16:46 | 154K | |
![[ ]](/icons/layout.gif) | 60313_Pro-Frame Wind..> | 2026-03-27 15:26 | 154K | |
![[ ]](/icons/layout.gif) | 51857_Wessex Industr..> | 2026-03-06 09:44 | 154K | |
![[ ]](/icons/layout.gif) | 54766_Elevate Doors ..> | 2026-03-13 12:27 | 154K | |
![[ ]](/icons/layout.gif) | 56205_Rollermatic Ga..> | 2026-03-18 10:11 | 154K | |
![[ ]](/icons/layout.gif) | 39336_Chelmsford Rol..> | 2026-02-02 14:42 | 154K | |
![[ ]](/icons/layout.gif) | 43021_AJ Roller Shut..> | 2026-02-12 11:38 | 154K | |
![[ ]](/icons/layout.gif) | 49303_Happy Holdings..> | 2026-02-27 16:56 | 154K | |
![[ ]](/icons/layout.gif) | 59864_East Anglia Ro..> | 2026-03-27 07:40 | 154K | |
![[ ]](/icons/layout.gif) | 60207_Garage Door Re..> | 2026-03-27 13:42 | 154K | |
![[ ]](/icons/layout.gif) | 61566_J Brady Garage..> | 2026-04-01 06:36 | 154K | |
![[ ]](/icons/layout.gif) | 42345_Eaton Park Win..> | 2026-02-10 15:01 | 154K | |
![[ ]](/icons/layout.gif) | 43766_Doorolla Ltd S..> | 2026-02-16 07:58 | 154K | |
![[ ]](/icons/layout.gif) | 58218_CPS Custom Pro..> | 2026-03-23 16:40 | 154K | |
![[ ]](/icons/layout.gif) | 59848_DP Installatio..> | 2026-03-26 17:00 | 154K | |
![[ ]](/icons/layout.gif) | 46908_M. A. E. Windo..> | 2026-02-20 16:37 | 154K | |
![[ ]](/icons/layout.gif) | 47345_SW Trade Frame..> | 2026-02-23 16:36 | 154K | |
![[ ]](/icons/layout.gif) | 50680_Wellingborough..> | 2026-03-04 09:48 | 154K | |
![[ ]](/icons/layout.gif) | 54747_SW Trade Frame..> | 2026-03-13 11:59 | 154K | |
![[ ]](/icons/layout.gif) | 35059_Windowology Lt..> | 2026-01-20 10:44 | 154K | |
![[ ]](/icons/layout.gif) | 45639_3 Counties (Sa..> | 2026-02-18 13:23 | 154K | |
![[ ]](/icons/layout.gif) | 49742_Go Direct Door..> | 2026-03-02 13:49 | 154K | |
![[ ]](/icons/layout.gif) | 52056_Adams Industri..> | 2026-03-06 12:18 | 154K | |
![[ ]](/icons/layout.gif) | 57971_PJ Lockham Bui..> | 2026-03-23 11:35 | 154K | |
![[ ]](/icons/layout.gif) | 41111_Bridgford Inte..> | 2026-02-05 16:39 | 154K | |
![[ ]](/icons/layout.gif) | 43761_3 Counties (Sa..> | 2026-02-13 16:38 | 154K | |
![[ ]](/icons/layout.gif) | 45666_M. A. E. Windo..> | 2026-02-18 13:56 | 154K | |
![[ ]](/icons/layout.gif) | 47679_Wall Garage Do..> | 2026-02-24 13:21 | 154K | |
![[ ]](/icons/layout.gif) | 48205_Elevate Doors ..> | 2026-02-25 14:46 | 154K | |
![[ ]](/icons/layout.gif) | 49284_Regal Windows ..> | 2026-02-27 16:29 | 154K | |
![[ ]](/icons/layout.gif) | 49867_Go Direct Door..> | 2026-03-02 15:40 | 154K | |
![[ ]](/icons/layout.gif) | 57694_DP Installatio..> | 2026-03-23 08:11 | 154K | |
![[ ]](/icons/layout.gif) | 34333_Hadrian Joiner..> | 2026-01-16 14:15 | 154K | |
![[ ]](/icons/layout.gif) | 36833_Windowcraft De..> | 2026-01-26 09:56 | 154K | |
![[ ]](/icons/layout.gif) | 46774_Serenade Home ..> | 2026-02-20 14:24 | 154K | |
![[ ]](/icons/layout.gif) | 54471_Elevate Doors ..> | 2026-03-12 16:44 | 154K | |
![[ ]](/icons/layout.gif) | 61682_Doors 4 You Lt..> | 2026-04-01 08:56 | 154K | |
![[ ]](/icons/layout.gif) | 35812_SDL DOOR REPAI..> | 2026-01-21 15:08 | 154K | |
![[ ]](/icons/layout.gif) | 41114_Wellingborough..> | 2026-02-05 16:44 | 154K | |
![[ ]](/icons/layout.gif) | 50406_Adams Industri..> | 2026-03-03 16:09 | 154K | |
![[ ]](/icons/layout.gif) | 49514_East Anglia Ro..> | 2026-03-02 09:51 | 154K | |
![[ ]](/icons/layout.gif) | 56944_Julian Gallimo..> | 2026-03-19 13:07 | 154K | |
![[ ]](/icons/layout.gif) | 61507_Weatherproof W..> | 2026-03-31 15:12 | 154K | |
![[ ]](/icons/layout.gif) | 33760_Chelmsford Rol..> | 2026-01-15 12:26 | 154K | |
![[ ]](/icons/layout.gif) | 47590_Wall Garage Do..> | 2026-02-24 11:38 | 154K | |
![[ ]](/icons/layout.gif) | 57541_Wellingborough..> | 2026-03-20 14:23 | 154K | |
![[ ]](/icons/layout.gif) | 60259_Garage Door Au..> | 2026-03-27 14:21 | 154K | |
![[ ]](/icons/layout.gif) | 37889_SDL DOOR REPAI..> | 2026-01-28 11:36 | 154K | |
![[ ]](/icons/layout.gif) | 49984_Wellingborough..> | 2026-03-02 16:49 | 154K | |
![[ ]](/icons/layout.gif) | 49986_Wellingborough..> | 2026-03-02 16:50 | 154K | |
![[ ]](/icons/layout.gif) | 57543_Wellingborough..> | 2026-03-20 14:27 | 154K | |
![[ ]](/icons/layout.gif) | 62286_Woods And Sons..> | 2026-04-02 11:05 | 154K | |
![[ ]](/icons/layout.gif) | 34892_Doors 4 You Lt..> | 2026-01-20 07:38 | 154K | |
![[ ]](/icons/layout.gif) | 41865_Warnsham Windo..> | 2026-02-09 16:08 | 154K | |
![[ ]](/icons/layout.gif) | 44515_CPS Custom Pro..> | 2026-02-17 08:36 | 154K | |
![[ ]](/icons/layout.gif) | 46368_Warnsham Windo..> | 2026-02-20 08:01 | 154K | |
![[ ]](/icons/layout.gif) | 42482_M. A. E. Windo..> | 2026-02-11 09:03 | 154K | |
![[ ]](/icons/layout.gif) | 48716_Michael Mazur ..> | 2026-02-26 15:51 | 154K | |
![[ ]](/icons/layout.gif) | 50072_CPS Custom Pro..> | 2026-03-03 09:02 | 154K | |
![[ ]](/icons/layout.gif) | 47670_Ideal Industri..> | 2026-02-24 12:48 | 154K | |
![[ ]](/icons/layout.gif) | 42322_The Garage Doo..> | 2026-02-10 14:14 | 154K | |
![[ ]](/icons/layout.gif) | 43765_Go Direct Door..> | 2026-02-16 07:53 | 154K | |
![[ ]](/icons/layout.gif) | 58200_Eastern Frames..> | 2026-03-23 16:15 | 154K | |
![[ ]](/icons/layout.gif) | 48257_Ideal Industri..> | 2026-02-25 17:01 | 154K | |
![[ ]](/icons/layout.gif) | 48259_Ideal Industri..> | 2026-02-25 17:02 | 154K | |
![[ ]](/icons/layout.gif) | 50807_Wellingborough..> | 2026-03-04 11:14 | 154K | |
![[ ]](/icons/layout.gif) | 56343_Faith Home Imp..> | 2026-03-18 12:10 | 154K | |
![[ ]](/icons/layout.gif) | 35818_All Doors Repa..> | 2026-01-21 15:26 | 154K | |
![[ ]](/icons/layout.gif) | 42461_Rollermatic Ga..> | 2026-02-11 08:51 | 154K | |
![[ ]](/icons/layout.gif) | 35370_SDL DOOR REPAI..> | 2026-01-20 15:56 | 154K | |
![[ ]](/icons/layout.gif) | 46394_M. A. E. Windo..> | 2026-02-20 08:27 | 154K | |
![[ ]](/icons/layout.gif) | 58735_Go Direct Door..> | 2026-03-24 15:22 | 154K | |
![[ ]](/icons/layout.gif) | 50010_Wellingborough..> | 2026-03-03 07:43 | 154K | |
![[ ]](/icons/layout.gif) | 52087_Worcestershire..> | 2026-03-06 13:24 | 154K | |
![[ ]](/icons/layout.gif) | 56255_Eaton Park Win..> | 2026-03-18 10:51 | 154K | |
![[ ]](/icons/layout.gif) | 59224_Wall Garage Do..> | 2026-03-25 14:09 | 154K | |
![[ ]](/icons/layout.gif) | 36987_Go Direct Door..> | 2026-01-26 13:08 | 154K | |
![[ ]](/icons/layout.gif) | 39560_Harpers Door S..> | 2026-02-03 08:01 | 154K | |
![[ ]](/icons/layout.gif) | 54851_Wellingborough..> | 2026-03-13 13:42 | 154K | |
![[ ]](/icons/layout.gif) | 60194_Garage Door Au..> | 2026-03-27 13:20 | 154K | |
![[ ]](/icons/layout.gif) | 37696_Warnsham Windo..> | 2026-01-27 16:33 | 154K | |
![[ ]](/icons/layout.gif) | 39651_Go Direct Door..> | 2026-02-03 09:09 | 154K | |
![[ ]](/icons/layout.gif) | 41128_Gilberts Home ..> | 2026-02-06 07:31 | 154K | |
![[ ]](/icons/layout.gif) | 41669_Serenade Home ..> | 2026-02-09 12:10 | 154K | |
![[ ]](/icons/layout.gif) | 35515_Eclipse Doors ..> | 2026-01-21 08:56 | 154K | |
![[ ]](/icons/layout.gif) | 36208_Avon Automated..> | 2026-01-22 16:17 | 154K | |
![[ ]](/icons/layout.gif) | 44425_Gilberts Home ..> | 2026-02-17 07:56 | 154K | |
![[ ]](/icons/layout.gif) | 48577_BCH Loading Sy..> | 2026-02-26 13:26 | 154K | |
![[ ]](/icons/layout.gif) | 51114_South East Lan..> | 2026-03-04 17:09 | 154K | |
![[ ]](/icons/layout.gif) | 60283_Garage Door Au..> | 2026-03-27 14:40 | 154K | |
![[ ]](/icons/layout.gif) | 34528_Doors 4 You Lt..> | 2026-01-19 10:07 | 154K | |
![[ ]](/icons/layout.gif) | 51093_FV CONSERVATOR..> | 2026-03-04 16:52 | 154K | |
![[ ]](/icons/layout.gif) | 53903_Worcestershire..> | 2026-03-11 13:53 | 154K | |
![[ ]](/icons/layout.gif) | 57658_Wellingborough..> | 2026-03-20 16:04 | 154K | |
![[ ]](/icons/layout.gif) | 62277_Woods And Sons..> | 2026-04-02 11:00 | 154K | |
![[ ]](/icons/layout.gif) | 47704_Fortress Doors..> | 2026-02-24 13:58 | 154K | |
![[ ]](/icons/layout.gif) | 48676_SDS (Isle Of M..> | 2026-02-26 15:14 | 154K | |
![[ ]](/icons/layout.gif) | 43652_M. A. E. Windo..> | 2026-02-13 12:52 | 154K | |
![[ ]](/icons/layout.gif) | 49870_Go Direct Door..> | 2026-03-02 15:45 | 154K | |
![[ ]](/icons/layout.gif) | 44638_Greenhill Prop..> | 2026-02-17 09:31 | 154K | |
![[ ]](/icons/layout.gif) | 51695_Fixed Abode Ga..> | 2026-03-05 17:18 | 154K | |
![[ ]](/icons/layout.gif) | 60669_Thomas Andrew ..> | 2026-03-30 13:49 | 154K | |
![[ ]](/icons/layout.gif) | 40105_J Brady Garage..> | 2026-02-03 15:47 | 154K | |
![[ ]](/icons/layout.gif) | 42055_WRM Constructi..> | 2026-02-10 09:29 | 154K | |
![[ ]](/icons/layout.gif) | 36715_Go Direct Door..> | 2026-01-23 16:39 | 154K | |
![[ ]](/icons/layout.gif) | 49868_Go Direct Door..> | 2026-03-02 15:41 | 154K | |
![[ ]](/icons/layout.gif) | 50608_Warnsham Windo..> | 2026-03-04 08:58 | 154K | |
![[ ]](/icons/layout.gif) | 54479_M. A. E. Windo..> | 2026-03-12 16:52 | 154K | |
![[ ]](/icons/layout.gif) | 58659_PJ Lockham Bui..> | 2026-03-24 14:07 | 154K | |
![[ ]](/icons/layout.gif) | 36010_MJS Installati..> | 2026-01-22 10:56 | 154K | |
![[ ]](/icons/layout.gif) | 39340_Aldous Electri..> | 2026-02-02 14:58 | 154K | |
![[ ]](/icons/layout.gif) | 45682_M. A. E. Windo..> | 2026-02-18 14:03 | 154K | |
![[ ]](/icons/layout.gif) | 49285_Happy Holdings..> | 2026-02-27 16:29 | 154K | |
![[ ]](/icons/layout.gif) | 49310_UK Door System..> | 2026-02-27 17:04 | 154K | |
![[ ]](/icons/layout.gif) | 60318_Moran Windows ..> | 2026-03-27 15:38 | 154K | |
![[ ]](/icons/layout.gif) | 60822_Fortress Doors..> | 2026-03-30 15:16 | 154K | |
![[ ]](/icons/layout.gif) | 35531_S R W Services..> | 2026-01-21 09:17 | 154K | |
![[ ]](/icons/layout.gif) | 54865_All Door Engin..> | 2026-03-13 14:03 | 154K | |
![[ ]](/icons/layout.gif) | 55776_Avon Automated..> | 2026-03-17 11:35 | 154K | |
![[ ]](/icons/layout.gif) | 46920_Go Direct Door..> | 2026-02-20 17:05 | 154K | |
![[ ]](/icons/layout.gif) | 51669_FV CONSERVATOR..> | 2026-03-05 16:25 | 154K | |
![[ ]](/icons/layout.gif) | 34895_SDL DOOR REPAI..> | 2026-01-20 07:45 | 154K | |
![[ ]](/icons/layout.gif) | 35461_Avon Automated..> | 2026-01-21 08:14 | 154K | |
![[ ]](/icons/layout.gif) | 43725_Doorolla Ltd S..> | 2026-02-13 14:29 | 154K | |
![[ ]](/icons/layout.gif) | 57407_Wellingborough..> | 2026-03-20 11:19 | 154K | |
![[ ]](/icons/layout.gif) | 57411_Wellingborough..> | 2026-03-20 11:29 | 154K | |
![[ ]](/icons/layout.gif) | 57524_Wellingborough..> | 2026-03-20 14:05 | 154K | |
![[ ]](/icons/layout.gif) | 48330_Fortress Doors..> | 2026-02-26 08:47 | 154K | |
![[ ]](/icons/layout.gif) | 48722_SDS (Isle Of M..> | 2026-02-26 15:57 | 154K | |
![[ ]](/icons/layout.gif) | 49853_Avon Automated..> | 2026-03-02 15:17 | 154K | |
![[ ]](/icons/layout.gif) | 58145_Barry Eckland ..> | 2026-03-23 15:00 | 154K | |
![[ ]](/icons/layout.gif) | 43078_Warnsham Windo..> | 2026-02-12 12:19 | 154K | |
![[ ]](/icons/layout.gif) | 36980_Adams Industri..> | 2026-01-26 13:04 | 154K | |
![[ ]](/icons/layout.gif) | 47811_Go Direct Door..> | 2026-02-24 16:13 | 154K | |
![[ ]](/icons/layout.gif) | 48684_Ideal Industri..> | 2026-02-26 15:24 | 154K | |
![[ ]](/icons/layout.gif) | 57192_The Lothian Ga..> | 2026-03-20 08:30 | 154K | |
![[ ]](/icons/layout.gif) | 58298_Eastern Frames..> | 2026-03-24 08:32 | 154K | |
![[ ]](/icons/layout.gif) | 39099_The Lothian Ga..> | 2026-02-02 08:42 | 154K | |
![[ ]](/icons/layout.gif) | 42124_Warnsham Windo..> | 2026-02-10 10:21 | 154K | |
![[ ]](/icons/layout.gif) | 57378_Avon Automated..> | 2026-03-20 10:59 | 154K | |
![[ ]](/icons/layout.gif) | 58220_Eastern Frames..> | 2026-03-23 16:42 | 154K | |
![[ ]](/icons/layout.gif) | 60201_Rollermatic Ga..> | 2026-03-27 13:36 | 154K | |
![[ ]](/icons/layout.gif) | 60284_Thomas Andrew ..> | 2026-03-27 14:42 | 154K | |
![[ ]](/icons/layout.gif) | 44312_Garage Door So..> | 2026-02-16 15:42 | 154K | |
![[ ]](/icons/layout.gif) | 46271_FV CONSERVATOR..> | 2026-02-19 16:15 | 154K | |
![[ ]](/icons/layout.gif) | 55039_Go Direct Door..> | 2026-03-13 16:45 | 154K | |
![[ ]](/icons/layout.gif) | 60455_Elevate Doors ..> | 2026-03-30 09:11 | 154K | |
![[ ]](/icons/layout.gif) | 34391_Replacement Ga..> | 2026-01-16 16:47 | 154K | |
![[ ]](/icons/layout.gif) | 37524_SDL DOOR REPAI..> | 2026-01-27 12:51 | 154K | |
![[ ]](/icons/layout.gif) | 43792_The Lothian Ga..> | 2026-02-16 08:44 | 154K | |
![[ ]](/icons/layout.gif) | 44094_SDL DOOR REPAI..> | 2026-02-16 11:48 | 154K | |
![[ ]](/icons/layout.gif) | 36121_Avon Automated..> | 2026-01-22 12:58 | 154K | |
![[ ]](/icons/layout.gif) | 36161_Avon Automated..> | 2026-01-22 14:07 | 154K | |
![[ ]](/icons/layout.gif) | 36165_Avon Automated..> | 2026-01-22 14:20 | 154K | |
![[ ]](/icons/layout.gif) | 36716_Go Direct Door..> | 2026-01-23 16:42 | 154K | |
![[ ]](/icons/layout.gif) | 38325_Gilberts Home ..> | 2026-01-29 10:41 | 154K | |
![[ ]](/icons/layout.gif) | 39104_The Lothian Ga..> | 2026-02-02 08:51 | 154K | |
![[ ]](/icons/layout.gif) | 46273_FV CONSERVATOR..> | 2026-02-19 16:18 | 154K | |
![[ ]](/icons/layout.gif) | 47052_Go Direct Door..> | 2026-02-23 11:42 | 154K | |
![[ ]](/icons/layout.gif) | 47221_M. A. E. Windo..> | 2026-02-23 15:49 | 154K | |
![[ ]](/icons/layout.gif) | 60295_Rollermatic Ga..> | 2026-03-27 14:51 | 154K | |
![[ ]](/icons/layout.gif) | 35825_All Doors Repa..> | 2026-01-21 15:33 | 154K | |
![[ ]](/icons/layout.gif) | 44450_M. A. E. Windo..> | 2026-02-17 08:17 | 154K | |
![[ ]](/icons/layout.gif) | 35165_Go Direct Door..> | 2026-01-20 13:25 | 154K | |
![[ ]](/icons/layout.gif) | 53812_Garage Door So..> | 2026-03-11 12:07 | 154K | |
![[ ]](/icons/layout.gif) | 53813_Garage Door So..> | 2026-03-11 12:08 | 154K | |
![[ ]](/icons/layout.gif) | 55285_Garden Room Pr..> | 2026-03-16 12:35 | 154K | |
![[ ]](/icons/layout.gif) | 57202_The Lothian Ga..> | 2026-03-20 08:35 | 154K | |
![[ ]](/icons/layout.gif) | 36726_Go Direct Door..> | 2026-01-23 16:59 | 154K | |
![[ ]](/icons/layout.gif) | 40503_Oakley Windows..> | 2026-02-04 13:19 | 154K | |
![[ ]](/icons/layout.gif) | 39869_Go Direct Door..> | 2026-02-03 11:48 | 154K | |
![[ ]](/icons/layout.gif) | 42613_Garage Doors 2..> | 2026-02-11 11:06 | 154K | |
![[ ]](/icons/layout.gif) | 49272_The Lothian Ga..> | 2026-02-27 16:12 | 154K | |
![[ ]](/icons/layout.gif) | 49780_J Brady Garage..> | 2026-03-02 14:18 | 154K | |
![[ ]](/icons/layout.gif) | 50591_Fortress Doors..> | 2026-03-04 08:42 | 154K | |
![[ ]](/icons/layout.gif) | 37618_Future Constru..> | 2026-01-27 14:53 | 154K | |
![[ ]](/icons/layout.gif) | 43432_M. A. E. Windo..> | 2026-02-13 08:54 | 154K | |
![[ ]](/icons/layout.gif) | 47078_Eclipse Doors ..> | 2026-02-23 12:13 | 154K | |
![[ ]](/icons/layout.gif) | 53179_Garage Door So..> | 2026-03-10 11:39 | 154K | |
![[ ]](/icons/layout.gif) | 60927_The Lothian Ga..> | 2026-03-31 07:45 | 154K | |
![[ ]](/icons/layout.gif) | 42713_Regal Windows ..> | 2026-02-11 13:08 | 154K | |
![[ ]](/icons/layout.gif) | 46445_Ecosse Garage ..> | 2026-02-20 09:12 | 154K | |
![[ ]](/icons/layout.gif) | 46388_M. A. E. Windo..> | 2026-02-20 08:22 | 154K | |
![[ ]](/icons/layout.gif) | 48474_Fortress Doors..> | 2026-02-26 11:25 | 154K | |
![[ ]](/icons/layout.gif) | 50309_WRM Constructi..> | 2026-03-03 13:18 | 154K | |
![[ ]](/icons/layout.gif) | 55834_Go Direct Door..> | 2026-03-17 13:31 | 154K | |
![[ ]](/icons/layout.gif) | 41499_Chelmsford Rol..> | 2026-02-09 08:20 | 154K | |
![[ ]](/icons/layout.gif) | 57586_Regal Windows ..> | 2026-03-20 15:41 | 154K | |
![[ ]](/icons/layout.gif) | 37928_3 Counties (Sa..> | 2026-01-28 12:23 | 154K | |
![[ ]](/icons/layout.gif) | 39306_3 Counties (Sa..> | 2026-02-02 13:51 | 154K | |
![[ ]](/icons/layout.gif) | 40039_3 Counties (Sa..> | 2026-02-03 14:52 | 154K | |
![[ ]](/icons/layout.gif) | 40202_3 Counties (Sa..> | 2026-02-03 16:45 | 154K | |
![[ ]](/icons/layout.gif) | 57221_The Lothian Ga..> | 2026-03-20 08:45 | 154K | |
![[ ]](/icons/layout.gif) | 60174_The Lothian Ga..> | 2026-03-27 12:43 | 154K | |
![[ ]](/icons/layout.gif) | 35349_Adams Industri..> | 2026-01-20 15:43 | 154K | |
![[ ]](/icons/layout.gif) | 49981_WADE WINDOWS I..> | 2026-03-02 16:45 | 154K | |
![[ ]](/icons/layout.gif) | 52779_Automated Acce..> | 2026-03-09 15:28 | 154K | |
![[ ]](/icons/layout.gif) | 43650_Warnsham Windo..> | 2026-02-13 12:34 | 154K | |
![[ ]](/icons/layout.gif) | 46782_Gilberts Home ..> | 2026-02-20 14:27 | 154K | |
![[ ]](/icons/layout.gif) | 52746_Go Direct Door..> | 2026-03-09 15:14 | 154K | |
![[ ]](/icons/layout.gif) | 57437_Avon Automated..> | 2026-03-20 12:08 | 154K | |
![[ ]](/icons/layout.gif) | 41522_Wokingham Glaz..> | 2026-02-09 08:49 | 154K | |
![[ ]](/icons/layout.gif) | 57001_Moran Windows ..> | 2026-03-19 14:25 | 154K | |
![[ ]](/icons/layout.gif) | 60906_The Lothian Ga..> | 2026-03-31 06:42 | 154K | |
![[ ]](/icons/layout.gif) | 34812_Four Counties ..> | 2026-01-19 16:16 | 154K | |
![[ ]](/icons/layout.gif) | 38092_Rising Group L..> | 2026-01-28 15:46 | 154K | |
![[ ]](/icons/layout.gif) | 42628_SW Trade Frame..> | 2026-02-11 11:18 | 154K | |
![[ ]](/icons/layout.gif) | 44255_Eastern Frames..> | 2026-02-16 14:39 | 154K | |
![[ ]](/icons/layout.gif) | 49269_The Lothian Ga..> | 2026-02-27 16:05 | 154K | |
![[ ]](/icons/layout.gif) | 52413_Go Direct Door..> | 2026-03-09 09:17 | 154K | |
![[ ]](/icons/layout.gif) | 44208_Garage Door So..> | 2026-02-16 14:03 | 154K | |
![[ ]](/icons/layout.gif) | 53846_Garage Door So..> | 2026-03-11 12:38 | 154K | |
![[ ]](/icons/layout.gif) | 33439_UK Door System..> | 2026-01-14 16:47 | 154K | |
![[ ]](/icons/layout.gif) | 52075_M. A. E. Windo..> | 2026-03-06 13:07 | 154K | |
![[ ]](/icons/layout.gif) | 40462_Oakley Windows..> | 2026-02-04 13:08 | 154K | |
![[ ]](/icons/layout.gif) | 44320_Garage Door So..> | 2026-02-16 15:44 | 154K | |
![[ ]](/icons/layout.gif) | 33832_SW Trade Frame..> | 2026-01-15 14:17 | 154K | |
![[ ]](/icons/layout.gif) | 48142_East Anglia Ro..> | 2026-02-25 12:57 | 154K | |
![[ ]](/icons/layout.gif) | 56642_Eastern Frames..> | 2026-03-19 07:55 | 154K | |
![[ ]](/icons/layout.gif) | 52251_The Lothian Ga..> | 2026-03-06 15:50 | 154K | |
![[ ]](/icons/layout.gif) | 56646_Go Direct Door..> | 2026-03-19 08:07 | 154K | |
![[ ]](/icons/layout.gif) | 56649_Go Direct Door..> | 2026-03-19 08:12 | 154K | |
![[ ]](/icons/layout.gif) | 37821_Norfolk & Norw..> | 2026-01-28 10:15 | 154K | |
![[ ]](/icons/layout.gif) | 56404_Eastern Frames..> | 2026-03-18 12:27 | 154K | |
![[ ]](/icons/layout.gif) | 44800_Greenhill Prop..> | 2026-02-17 11:54 | 154K | |
![[ ]](/icons/layout.gif) | 34392_Doorolla Ltd S..> | 2026-01-16 16:48 | 154K | |
![[ ]](/icons/layout.gif) | 38128_East Anglia Ro..> | 2026-01-28 16:35 | 154K | |
![[ ]](/icons/layout.gif) | 36120_Oakley Windows..> | 2026-01-22 12:40 | 154K | |
![[ ]](/icons/layout.gif) | 45822_Avon Automated..> | 2026-02-18 15:37 | 154K | |
![[ ]](/icons/layout.gif) | 56570_Wellingborough..> | 2026-03-18 16:00 | 154K | |
![[ ]](/icons/layout.gif) | 37413_Go Direct Door..> | 2026-01-27 11:22 | 154K | |
![[ ]](/icons/layout.gif) | 54388_Gilberts Home ..> | 2026-03-12 16:11 | 154K | |
![[ ]](/icons/layout.gif) | 54394_Gilberts Home ..> | 2026-03-12 16:12 | 154K | |
![[ ]](/icons/layout.gif) | 49902_Ideal Industri..> | 2026-03-02 15:59 | 154K | |
![[ ]](/icons/layout.gif) | 60450_Kirsty Willis ..> | 2026-03-30 09:10 | 154K | |
![[ ]](/icons/layout.gif) | 52243_The Lothian Ga..> | 2026-03-06 15:39 | 154K | |
![[ ]](/icons/layout.gif) | 56622_Go Direct Door..> | 2026-03-19 07:43 | 154K | |
![[ ]](/icons/layout.gif) | 37051_The Lothian Ga..> | 2026-01-26 13:42 | 154K | |
![[ ]](/icons/layout.gif) | 42513_Warnsham Windo..> | 2026-02-11 09:22 | 154K | |
![[ ]](/icons/layout.gif) | 44659_SW Trade Frame..> | 2026-02-17 09:48 | 154K | |
![[ ]](/icons/layout.gif) | 44210_Garage Door So..> | 2026-02-16 14:07 | 154K | |
![[ ]](/icons/layout.gif) | 46736_Taundry Doors ..> | 2026-02-20 13:46 | 154K | |
![[ ]](/icons/layout.gif) | 55861_MRE Roller Shu..> | 2026-03-17 13:59 | 154K | |
![[ ]](/icons/layout.gif) | 41769_Norfolk Doors ..> | 2026-02-09 14:41 | 154K | |
![[ ]](/icons/layout.gif) | 54251_Elevate Doors ..> | 2026-03-12 13:50 | 154K | |
![[ ]](/icons/layout.gif) | 56643_Go Direct Door..> | 2026-03-19 07:57 | 154K | |
![[ ]](/icons/layout.gif) | 35063_Oakley Windows..> | 2026-01-20 10:45 | 154K | |
![[ ]](/icons/layout.gif) | 33693_Replacement Ga..> | 2026-01-15 10:57 | 154K | |
![[ ]](/icons/layout.gif) | 46735_Taundry Doors ..> | 2026-02-20 13:41 | 154K | |
![[ ]](/icons/layout.gif) | 46954_Greenhill Prop..> | 2026-02-23 09:35 | 154K | |
![[ ]](/icons/layout.gif) | 33251_Future Proof H..> | 2026-01-14 13:47 | 154K | |
![[ ]](/icons/layout.gif) | 54741_Garage Door Au..> | 2026-03-13 11:46 | 154K | |
![[ ]](/icons/layout.gif) | 35482_J Brady Garage..> | 2026-01-21 08:33 | 154K | |
![[ ]](/icons/layout.gif) | 37417_T D Rollerdoor..> | 2026-01-27 11:32 | 154K | |
![[ ]](/icons/layout.gif) | 41866_Warnsham Windo..> | 2026-02-09 16:08 | 154K | |
![[ ]](/icons/layout.gif) | 49415_J Brady Garage..> | 2026-03-02 08:51 | 154K | |
![[ ]](/icons/layout.gif) | 37178_Moran Windows ..> | 2026-01-26 15:33 | 154K | |
![[ ]](/icons/layout.gif) | 41474_Anthony Floria..> | 2026-02-06 15:59 | 154K | |
![[ ]](/icons/layout.gif) | 54461_Absolute Garag..> | 2026-03-12 16:37 | 154K | |
![[ ]](/icons/layout.gif) | 61926_Go Direct Door..> | 2026-04-01 12:57 | 154K | |
![[ ]](/icons/layout.gif) | 57484_Rhino Windows ..> | 2026-03-20 13:11 | 154K | |
![[ ]](/icons/layout.gif) | 43032_SDL DOOR REPAI..> | 2026-02-12 11:49 | 154K | |
![[ ]](/icons/layout.gif) | 38746_Tru-Fit Window..> | 2026-01-30 09:52 | 154K | |
![[ ]](/icons/layout.gif) | 35858_M. A. E. Windo..> | 2026-01-21 16:10 | 154K | |
![[ ]](/icons/layout.gif) | 54448_SDL DOOR REPAI..> | 2026-03-12 16:28 | 154K | |
![[ ]](/icons/layout.gif) | 46911_The Lothian Ga..> | 2026-02-20 16:48 | 154K | |
![[ ]](/icons/layout.gif) | 55858_MRE Roller Shu..> | 2026-03-17 13:57 | 154K | |
![[ ]](/icons/layout.gif) | 46742_All Door Engin..> | 2026-02-20 13:56 | 154K | |
![[ ]](/icons/layout.gif) | 49304_Happy Holdings..> | 2026-02-27 16:56 | 154K | |
![[ ]](/icons/layout.gif) | 61932_Go Direct Door..> | 2026-04-01 12:58 | 154K | |
![[ ]](/icons/layout.gif) | 54439_SDL DOOR REPAI..> | 2026-03-12 16:25 | 154K | |
![[ ]](/icons/layout.gif) | 55855_MRE Roller Shu..> | 2026-03-17 13:55 | 154K | |
![[ ]](/icons/layout.gif) | 59697_WADE WINDOWS I..> | 2026-03-26 14:16 | 154K | |
![[ ]](/icons/layout.gif) | 43726_Doorolla Ltd S..> | 2026-02-13 14:29 | 154K | |
![[ ]](/icons/layout.gif) | 54440_Avon Automated..> | 2026-03-12 16:26 | 154K | |
![[ ]](/icons/layout.gif) | 60297_Rollermatic Ga..> | 2026-03-27 14:52 | 154K | |
![[ ]](/icons/layout.gif) | 54454_SDL DOOR REPAI..> | 2026-03-12 16:30 | 154K | |
![[ ]](/icons/layout.gif) | 55850_MRE Roller Shu..> | 2026-03-17 13:51 | 154K | |
![[ ]](/icons/layout.gif) | 43651_Warnsham Windo..> | 2026-02-13 12:36 | 154K | |
![[ ]](/icons/layout.gif) | 63281_Digby Services..> | 2026-04-08 06:50 | 154K | |
![[ ]](/icons/layout.gif) | 62517_Oakley Windows..> | 2026-04-02 16:01 | 154K | |
![[ ]](/icons/layout.gif) | 55018_Avon Automated..> | 2026-03-13 15:55 | 154K | |
![[ ]](/icons/layout.gif) | 60547_Brownsec Gary ..> | 2026-03-30 11:26 | 154K | |
![[ ]](/icons/layout.gif) | 59847_Madog Roller D..> | 2026-03-26 16:57 | 154K | |
![[ ]](/icons/layout.gif) | 60696_Brownsec Gary ..> | 2026-03-30 14:29 | 154K | |
![[ ]](/icons/layout.gif) | 61580_Brownsec Gary ..> | 2026-04-01 07:01 | 154K | |
![[ ]](/icons/layout.gif) | 59688_Oakley Windows..> | 2026-03-26 14:11 | 154K | |
![[ ]](/icons/layout.gif) | 60903_J Brady Garage..> | 2026-03-30 16:08 | 154K | |
![[ ]](/icons/layout.gif) | 58027_Elevate Doors ..> | 2026-03-23 13:00 | 154K | |
![[ ]](/icons/layout.gif) | 63002_Thomas Andrew ..> | 2026-04-07 13:04 | 154K | |
![[ ]](/icons/layout.gif) | 58839_Roll Right Gar..> | 2026-03-24 16:56 | 154K | |
![[ ]](/icons/layout.gif) | 58481_Profascia Delr..> | 2026-03-24 10:59 | 154K | |
![[ ]](/icons/layout.gif) | 62520_J Brady Garage..> | 2026-04-02 16:04 | 154K | |
![[ ]](/icons/layout.gif) | 60338_Garage Door Au..> | 2026-03-27 16:56 | 154K | |
![[ ]](/icons/layout.gif) | 61808_Thomas Andrew ..> | 2026-04-01 11:01 | 154K | |
![[ ]](/icons/layout.gif) | 59076_Garage Doors 2..> | 2026-03-25 11:16 | 154K | |
![[ ]](/icons/layout.gif) | 58161_Go Direct Door..> | 2026-03-23 15:28 | 154K | |
![[ ]](/icons/layout.gif) | 59849_Go Direct Door..> | 2026-03-26 17:00 | 154K | |
![[ ]](/icons/layout.gif) | 59358_Go Direct Door..> | 2026-03-26 08:57 | 154K | |
![[ ]](/icons/layout.gif) | 61540_Rollermatic Ga..> | 2026-03-31 16:06 | 154K | |
![[ ]](/icons/layout.gif) | 47351_Clic Garage Do..> | 2026-02-23 16:39 | 154K | |
![[ ]](/icons/layout.gif) | 47984_Clic Garage Do..> | 2026-02-25 09:18 | 154K | |
![[ ]](/icons/layout.gif) | 47100_Clic Garage Do..> | 2026-02-23 13:12 | 154K | |
![[ ]](/icons/layout.gif) | 21660_Avon Automated..> | 2025-12-02 08:13 | 154K | |
![[ ]](/icons/layout.gif) | 36654_AM Shutters M..> | 2026-01-23 14:54 | 155K | |
![[ ]](/icons/layout.gif) | 36593_AM Shutters M..> | 2026-01-23 13:49 | 155K | |
![[ ]](/icons/layout.gif) | 49590_Terry Barker -..> | 2026-03-02 11:15 | 155K | |
![[ ]](/icons/layout.gif) | 66327_Singular Homes..> | 2026-04-15 14:31 | 155K | |
![[ ]](/icons/layout.gif) | 49454_Terry Barker -..> | 2026-03-02 09:28 | 155K | |
![[ ]](/icons/layout.gif) | 60989_NTRAP NR11 7NZ..> | 2026-03-31 09:03 | 155K | |
![[ ]](/icons/layout.gif) | 55044_Entador System..> | 2026-03-13 16:50 | 155K | |
![[ ]](/icons/layout.gif) | 55101_Phil Page Phil..> | 2026-03-16 08:47 | 155K | |
![[ ]](/icons/layout.gif) | 55622_Singular Homes..> | 2026-03-17 08:19 | 155K | |
![[ ]](/icons/layout.gif) | 51115_Windows Plus U..> | 2026-03-04 17:13 | 155K | |
![[ ]](/icons/layout.gif) | 42864_USFL Group Ada..> | 2026-02-12 08:08 | 155K | |
![[ ]](/icons/layout.gif) | 60826_Digby Services..> | 2026-03-30 15:19 | 155K | |
![[ ]](/icons/layout.gif) | 48737_Eclipse Doors ..> | 2026-02-26 16:17 | 155K | |
![[ ]](/icons/layout.gif) | 52069_Barry Eckland ..> | 2026-03-06 12:37 | 155K | |
![[ ]](/icons/layout.gif) | 55525_Garden Room Pr..> | 2026-03-16 15:39 | 155K | |
![[ ]](/icons/layout.gif) | 56595_Fortress Doors..> | 2026-03-18 16:41 | 155K | |
![[ ]](/icons/layout.gif) | 37536_Price NG34 7RQ..> | 2026-01-27 13:25 | 155K | |
![[ ]](/icons/layout.gif) | 33396_UK Rollerdoors..> | 2026-01-14 15:59 | 155K | |
![[ ]](/icons/layout.gif) | 55496_Garden Room Pr..> | 2026-03-16 14:39 | 155K | |
![[ ]](/icons/layout.gif) | 37761_Right Choice M..> | 2026-01-28 08:48 | 155K | |
![[ ]](/icons/layout.gif) | 57466_Entador System..> | 2026-03-20 12:33 | 155K | |
![[ ]](/icons/layout.gif) | 35864_Keith Worboys ..> | 2026-01-21 16:26 | 155K | |
![[ ]](/icons/layout.gif) | 45815_Elite Glazing ..> | 2026-02-18 15:15 | 155K | |
![[ ]](/icons/layout.gif) | 41636_Keith Worboys ..> | 2026-02-09 11:17 | 155K | |
![[ ]](/icons/layout.gif) | 33399_UK Door System..> | 2026-01-14 16:08 | 155K | |
![[ ]](/icons/layout.gif) | 57133_J & B Engineer..> | 2026-03-20 08:08 | 155K | |
![[ ]](/icons/layout.gif) | 60820_Digby Services..> | 2026-03-30 15:14 | 155K | |
![[ ]](/icons/layout.gif) | 37557_ASSW Ltd BS10 ..> | 2026-01-27 13:58 | 155K | |
![[ ]](/icons/layout.gif) | 52495_WADE WINDOWS I..> | 2026-03-09 10:56 | 155K | |
![[ ]](/icons/layout.gif) | 36733_Right Choice M..> | 2026-01-26 07:59 | 155K | |
![[ ]](/icons/layout.gif) | 42810_J Bowman Garag..> | 2026-02-11 16:07 | 155K | |
![[ ]](/icons/layout.gif) | 53966_1st Class Home..> | 2026-03-11 16:16 | 155K | |
![[ ]](/icons/layout.gif) | 54051_1st Class Home..> | 2026-03-12 09:23 | 155K | |
![[ ]](/icons/layout.gif) | 58176_Harry Curtis H..> | 2026-03-23 15:44 | 155K | |
![[ ]](/icons/layout.gif) | 60219_Doors 4 Garage..> | 2026-03-27 13:55 | 155K | |
![[ ]](/icons/layout.gif) | 55597_Rolladoor NR9 ..> | 2026-03-17 07:48 | 155K | |
![[ ]](/icons/layout.gif) | 38695_Summit Securit..> | 2026-01-30 09:18 | 155K | |
![[ ]](/icons/layout.gif) | 55591_Rolladoor NR9 ..> | 2026-03-17 07:42 | 155K | |
![[ ]](/icons/layout.gif) | 51195_EcoGlaze Group..> | 2026-03-05 08:30 | 155K | |
![[ ]](/icons/layout.gif) | 54284_Scotia Garage ..> | 2026-03-12 14:31 | 155K | |
![[ ]](/icons/layout.gif) | 38432_Rollermatic Ga..> | 2026-01-29 13:08 | 155K | |
![[ ]](/icons/layout.gif) | 57080_Ace Garage Doo..> | 2026-03-19 16:09 | 155K | |
![[ ]](/icons/layout.gif) | 60191_Doors 4 Garage..> | 2026-03-27 13:16 | 155K | |
![[ ]](/icons/layout.gif) | 35504_Proud 2 Fix Ma..> | 2026-01-21 08:46 | 155K | |
![[ ]](/icons/layout.gif) | 37611_PB Doors Paul ..> | 2026-01-27 14:29 | 155K | |
![[ ]](/icons/layout.gif) | 51383_Aldous Electri..> | 2026-03-05 11:21 | 155K | |
![[ ]](/icons/layout.gif) | 57776_Ace Garage Doo..> | 2026-03-23 09:13 | 155K | |
![[ ]](/icons/layout.gif) | 33776_Chelmsford Rol..> | 2026-01-15 12:51 | 155K | |
![[ ]](/icons/layout.gif) | 56209_Purple Violet ..> | 2026-03-18 10:33 | 155K | |
![[ ]](/icons/layout.gif) | 37899_Oakley Windows..> | 2026-01-28 12:09 | 155K | |
![[ ]](/icons/layout.gif) | 60828_Digby Services..> | 2026-03-30 15:20 | 155K | |
![[ ]](/icons/layout.gif) | 39343_Mowbrey Partne..> | 2026-02-02 15:21 | 155K | |
![[ ]](/icons/layout.gif) | 55569_Emerald Garage..> | 2026-03-16 16:47 | 155K | |
![[ ]](/icons/layout.gif) | 39501_LNR Door Solut..> | 2026-02-02 16:33 | 155K | |
![[ ]](/icons/layout.gif) | 33520_TPS Gates & Do..> | 2026-01-15 09:18 | 155K | |
![[ ]](/icons/layout.gif) | 59702_Go Direct Door..> | 2026-03-26 14:21 | 155K | |
![[ ]](/icons/layout.gif) | 60775_Proud 2 Fix Ma..> | 2026-03-30 14:52 | 155K | |
![[ ]](/icons/layout.gif) | 42401_Windowcraft De..> | 2026-02-10 16:25 | 155K | |
![[ ]](/icons/layout.gif) | 47143_Excellent Ltd ..> | 2026-02-23 14:31 | 155K | |
![[ ]](/icons/layout.gif) | 60427_FV CONSERVATOR..> | 2026-03-30 08:39 | 155K | |
![[ ]](/icons/layout.gif) | 43145_CPS Custom Pro..> | 2026-02-12 14:22 | 155K | |
![[ ]](/icons/layout.gif) | 50394_Eye Carpentry ..> | 2026-03-03 15:46 | 155K | |
![[ ]](/icons/layout.gif) | 36537_Garage Doors 2..> | 2026-01-23 12:40 | 155K | |
![[ ]](/icons/layout.gif) | 54876_Elevate Doors ..> | 2026-03-13 14:14 | 155K | |
![[ ]](/icons/layout.gif) | 34238_Chelmsford Rol..> | 2026-01-16 11:09 | 155K | |
![[ ]](/icons/layout.gif) | 33467_Doors 4 You. P..> | 2026-01-15 07:55 | 155K | |
![[ ]](/icons/layout.gif) | 41700_Windowcraft De..> | 2026-02-09 13:17 | 155K | |
![[ ]](/icons/layout.gif) | 41701_Windowcraft De..> | 2026-02-09 13:18 | 155K | |
![[ ]](/icons/layout.gif) | 56752_J Brady Garage..> | 2026-03-19 09:57 | 155K | |
![[ ]](/icons/layout.gif) | 33825_Elevate Doors ..> | 2026-01-15 14:06 | 155K | |
![[ ]](/icons/layout.gif) | 33727_Chelmsford Rol..> | 2026-01-15 11:53 | 155K | |
![[ ]](/icons/layout.gif) | 36666_Garage Doors 2..> | 2026-01-23 15:22 | 155K | |
![[ ]](/icons/layout.gif) | 36202_Excellent Ltd ..> | 2026-01-22 16:04 | 155K | |
![[ ]](/icons/layout.gif) | 61458_Chelmsford Rol..> | 2026-03-31 13:53 | 155K | |
![[ ]](/icons/layout.gif) | 36702_Elevate Doors ..> | 2026-01-23 15:57 | 155K | |
![[ ]](/icons/layout.gif) | 36662_Garage Doors 2..> | 2026-01-23 15:17 | 155K | |
![[ ]](/icons/layout.gif) | 60543_Ross Garage Do..> | 2026-03-30 11:07 | 155K | |
![[ ]](/icons/layout.gif) | 36838_Windowcraft De..> | 2026-01-26 10:01 | 155K | |
![[ ]](/icons/layout.gif) | 50904_Warnsham Windo..> | 2026-03-04 13:43 | 155K | |
![[ ]](/icons/layout.gif) | 33458_Doors 4 You. P..> | 2026-01-14 17:00 | 155K | |
![[ ]](/icons/layout.gif) | 52875_FV CONSERVATOR..> | 2026-03-09 16:39 | 155K | |
![[ ]](/icons/layout.gif) | 34273_Elevate Doors ..> | 2026-01-16 12:28 | 155K | |
![[ ]](/icons/layout.gif) | 42475_Rollermatic Ga..> | 2026-02-11 08:59 | 155K | |
![[ ]](/icons/layout.gif) | 34386_Roll Right Gar..> | 2026-01-16 16:20 | 155K | |
![[ ]](/icons/layout.gif) | 39264_Norfolk & Norw..> | 2026-02-02 12:48 | 155K | |
![[ ]](/icons/layout.gif) | 44287_Marble Constru..> | 2026-02-16 15:18 | 155K | |
![[ ]](/icons/layout.gif) | 48643_Windowcraft De..> | 2026-02-26 14:24 | 155K | |
![[ ]](/icons/layout.gif) | 53349_Chelmsford Rol..> | 2026-03-10 14:21 | 155K | |
![[ ]](/icons/layout.gif) | 44211_Marble Constru..> | 2026-02-16 14:09 | 155K | |
![[ ]](/icons/layout.gif) | 58248_All Door Engin..> | 2026-03-24 07:52 | 155K | |
![[ ]](/icons/layout.gif) | 44254_Marble Constru..> | 2026-02-16 14:34 | 155K | |
![[ ]](/icons/layout.gif) | 41262_Tru-Fit Window..> | 2026-02-06 10:27 | 155K | |
![[ ]](/icons/layout.gif) | 34656_New Forest Rol..> | 2026-01-19 11:51 | 155K | |
![[ ]](/icons/layout.gif) | 39964_LNR Door Solut..> | 2026-02-03 13:07 | 155K | |
![[ ]](/icons/layout.gif) | 43648_Garage Doors 2..> | 2026-02-13 12:29 | 155K | |
![[ ]](/icons/layout.gif) | 35871_Summit Securit..> | 2026-01-21 16:50 | 155K | |
![[ ]](/icons/layout.gif) | 59253_East Anglia Ro..> | 2026-03-25 14:57 | 155K | |
![[ ]](/icons/layout.gif) | 43738_Garage Doors 2..> | 2026-02-13 15:10 | 155K | |
![[ ]](/icons/layout.gif) | 55681_J Brady Garage..> | 2026-03-17 09:44 | 155K | |
![[ ]](/icons/layout.gif) | 36332_Chelmsford Rol..> | 2026-01-23 10:03 | 155K | |
![[ ]](/icons/layout.gif) | 47178_M. A. E. Windo..> | 2026-02-23 15:34 | 155K | |
![[ ]](/icons/layout.gif) | 37134_Elevate Doors ..> | 2026-01-26 14:40 | 155K | |
![[ ]](/icons/layout.gif) | 48638_Windowcraft De..> | 2026-02-26 14:21 | 155K | |
![[ ]](/icons/layout.gif) | 34142_The Lothian Ga..> | 2026-01-16 09:05 | 155K | |
![[ ]](/icons/layout.gif) | 35505_Proud 2 Fix Ma..> | 2026-01-21 08:46 | 155K | |
![[ ]](/icons/layout.gif) | 34799_Garage Door So..> | 2026-01-19 15:46 | 155K | |
![[ ]](/icons/layout.gif) | 52254_The Lothian Ga..> | 2026-03-06 15:58 | 155K | |
![[ ]](/icons/layout.gif) | 35994_J Brady Garage..> | 2026-01-22 10:53 | 155K | |
![[ ]](/icons/layout.gif) | 43049_SDL DOOR REPAI..> | 2026-02-12 11:58 | 155K | |
![[ ]](/icons/layout.gif) | 34798_Garage Door So..> | 2026-01-19 15:43 | 155K | |
![[ ]](/icons/layout.gif) | 43138_CPS Custom Pro..> | 2026-02-12 14:19 | 155K | |
![[ ]](/icons/layout.gif) | 59718_Go Direct Door..> | 2026-03-26 14:56 | 155K | |
![[ ]](/icons/layout.gif) | 38317_Garage Door So..> | 2026-01-29 10:37 | 155K | |
![[ ]](/icons/layout.gif) | 43141_CPS Custom Pro..> | 2026-02-12 14:20 | 155K | |
![[ ]](/icons/layout.gif) | 39966_LNR Door Solut..> | 2026-02-03 13:08 | 155K | |
![[ ]](/icons/layout.gif) | 56597_Rhino Windows ..> | 2026-03-18 16:48 | 155K | |
![[ ]](/icons/layout.gif) | 53351_Garage Door Au..> | 2026-03-10 14:22 | 155K | |
![[ ]](/icons/layout.gif) | 61459_Chelmsford Rol..> | 2026-03-31 13:54 | 155K | |
![[ ]](/icons/layout.gif) | 33460_Doors 4 You. P..> | 2026-01-14 17:00 | 155K | |
![[ ]](/icons/layout.gif) | 33461_Doors 4 You. P..> | 2026-01-14 17:01 | 155K | |
![[ ]](/icons/layout.gif) | 59716_Go Direct Door..> | 2026-03-26 14:50 | 155K | |
![[ ]](/icons/layout.gif) | 60931_The Lothian Ga..> | 2026-03-31 07:54 | 155K | |
![[ ]](/icons/layout.gif) | 43143_CPS Custom Pro..> | 2026-02-12 14:21 | 155K | |
![[ ]](/icons/layout.gif) | 56641_Go Direct Door..> | 2026-03-19 07:54 | 155K | |
![[ ]](/icons/layout.gif) | 63271_Digby Services..> | 2026-04-08 06:43 | 155K | |
![[ ]](/icons/layout.gif) | 61925_Go Direct Door..> | 2026-04-01 12:56 | 155K | |
![[ ]](/icons/layout.gif) | 58564_KJ Williams Ke..> | 2026-03-24 13:31 | 155K | |
![[ ]](/icons/layout.gif) | 60588_Doors 4 Garage..> | 2026-03-30 12:37 | 155K | |
![[ ]](/icons/layout.gif) | 62069_Doors 4 Garage..> | 2026-04-02 06:51 | 155K | |
![[ ]](/icons/layout.gif) | 40460_ASSW Ltd BS10 ..> | 2026-02-04 12:50 | 156K | |
![[ ]](/icons/layout.gif) | 50973_ASSW Ltd BS10 ..> | 2026-03-04 15:40 | 156K | |
![[ ]](/icons/layout.gif) | 40430_ASSW Ltd BS10 ..> | 2026-02-04 11:52 | 156K | |
![[ ]](/icons/layout.gif) | 53971_Eclipse Doors ..> | 2026-03-11 16:24 | 156K | |
![[ ]](/icons/layout.gif) | 58173_Juliff Homes L..> | 2026-03-23 15:42 | 156K | |
![[ ]](/icons/layout.gif) | 61464_Heavy Metal En..> | 2026-03-31 14:18 | 156K | |
![[ ]](/icons/layout.gif) | 52357_Horrax(amblesi..> | 2026-03-09 08:42 | 156K | |
![[ ]](/icons/layout.gif) | 49755_Fortress Doors..> | 2026-03-02 14:07 | 156K | |
![[ ]](/icons/layout.gif) | 58174_Juliff Homes L..> | 2026-03-23 15:42 | 156K | |
![[ ]](/icons/layout.gif) | 38464_Avon Automated..> | 2026-01-29 13:48 | 156K | |
![[ ]](/icons/layout.gif) | 37606_Avon Automated..> | 2026-01-27 14:19 | 156K | |
![[ ]](/icons/layout.gif) | 40431_ASSW Ltd BS10 ..> | 2026-02-04 11:52 | 156K | |
![[ ]](/icons/layout.gif) | 38465_Avon Automated..> | 2026-01-29 13:48 | 156K | |
![[ ]](/icons/layout.gif) | 56322_Go Direct Door..> | 2026-03-18 11:56 | 156K | |
![[ ]](/icons/layout.gif) | 56325_Go Direct Door..> | 2026-03-18 11:57 | 156K | |
![[ ]](/icons/layout.gif) | 40454_ASSW Ltd BS10 ..> | 2026-02-04 12:17 | 156K | |
![[ ]](/icons/layout.gif) | 61810_Heavy Metal En..> | 2026-04-01 11:03 | 156K | |
![[ ]](/icons/layout.gif) | 64748_Reklaw Doors L..> | 2026-04-10 15:29 | 156K | |
![[ ]](/icons/layout.gif) | 63328_EcoGlaze Group..> | 2026-04-08 07:51 | 156K | |
![[ ]](/icons/layout.gif) | 64771_ThermoGreen Lt..> | 2026-04-10 16:05 | 156K | |
![[ ]](/icons/layout.gif) | 63874_Stanair Indust..> | 2026-04-09 08:02 | 156K | |
![[ ]](/icons/layout.gif) | 65417_Reklaw Doors L..> | 2026-04-14 08:49 | 156K | |
![[ ]](/icons/layout.gif) | 69901_Wanstall Ltd. ..> | 2026-04-24 09:36 | 156K | |
![[ ]](/icons/layout.gif) | 63970_Stanair Indust..> | 2026-04-09 09:04 | 156K | |
![[ ]](/icons/layout.gif) | 65731_T D Rollerdoor..> | 2026-04-14 13:33 | 156K | |
![[ ]](/icons/layout.gif) | 63338_J Brady Garage..> | 2026-04-08 08:00 | 156K | |
![[ ]](/icons/layout.gif) | 64117_J Brady Garage..> | 2026-04-09 12:47 | 156K | |
![[ ]](/icons/layout.gif) | 69074_Elevate Doors ..> | 2026-04-22 12:48 | 156K | |
![[ ]](/icons/layout.gif) | 69174_Warnsham Windo..> | 2026-04-22 15:32 | 156K | |
![[ ]](/icons/layout.gif) | 66973_Secure Entranc..> | 2026-04-17 08:25 | 156K | |
![[ ]](/icons/layout.gif) | 63563_East Anglia Ro..> | 2026-04-08 12:34 | 156K | |
![[ ]](/icons/layout.gif) | 62805_1st Shield Dar..> | 2026-04-07 10:38 | 156K | |
![[ ]](/icons/layout.gif) | 64855_DT Services Lt..> | 2026-04-13 08:07 | 156K | |
![[ ]](/icons/layout.gif) | 70080_BG&S Steven No..> | 2026-04-24 13:06 | 156K | |
![[ ]](/icons/layout.gif) | 62391_Rollermatic Ga..> | 2026-04-02 13:09 | 157K | |
![[ ]](/icons/layout.gif) | 70047_DT Services Lt..> | 2026-04-24 12:17 | 157K | |
![[ ]](/icons/layout.gif) | 65036_Spa Roller Doo..> | 2026-04-13 10:30 | 157K | |
![[ ]](/icons/layout.gif) | 68384_Bryan Thompson..> | 2026-04-21 10:32 | 157K | |
![[ ]](/icons/layout.gif) | 69958_L G Glazing Lt..> | 2026-04-24 10:24 | 157K | |
![[ ]](/icons/layout.gif) | 65765_Open And Shut ..> | 2026-04-14 13:50 | 157K | |
![[ ]](/icons/layout.gif) | 64723_LD Doors Lewis..> | 2026-04-10 14:45 | 157K | |
![[ ]](/icons/layout.gif) | 65115_DT Services Lt..> | 2026-04-13 11:48 | 157K | |
![[ ]](/icons/layout.gif) | 65507_DT Services Lt..> | 2026-04-14 10:16 | 157K | |
![[ ]](/icons/layout.gif) | 65508_DT Services Lt..> | 2026-04-14 10:18 | 157K | |
![[ ]](/icons/layout.gif) | 64821_G & H Windows ..> | 2026-04-13 07:30 | 157K | |
![[ ]](/icons/layout.gif) | 64762_AM Shutters St..> | 2026-04-10 15:50 | 157K | |
![[ ]](/icons/layout.gif) | 65055_Sargent & Powe..> | 2026-04-13 10:47 | 157K | |
![[ ]](/icons/layout.gif) | 64551_M & S Home Ins..> | 2026-04-10 12:21 | 157K | |
![[ ]](/icons/layout.gif) | 67035_Four Counties ..> | 2026-04-17 09:41 | 157K | |
![[ ]](/icons/layout.gif) | 64749_Mick Walklate ..> | 2026-04-10 15:29 | 157K | |
![[ ]](/icons/layout.gif) | 64713_Cambridge Wind..> | 2026-04-10 14:29 | 157K | |
![[ ]](/icons/layout.gif) | 62807_1st Shield Dar..> | 2026-04-07 10:39 | 157K | |
![[ ]](/icons/layout.gif) | 64313_GR Home Soluti..> | 2026-04-10 07:34 | 157K | |
![[ ]](/icons/layout.gif) | 65652_1st Shield Dar..> | 2026-04-14 12:30 | 157K | |
![[ ]](/icons/layout.gif) | 67162_EcoGlaze Group..> | 2026-04-17 10:56 | 157K | |
![[ ]](/icons/layout.gif) | 64081_JJ Secure Door..> | 2026-04-09 11:37 | 157K | |
![[ ]](/icons/layout.gif) | 65601_Digby Services..> | 2026-04-14 12:18 | 157K | |
![[ ]](/icons/layout.gif) | 64733_Niche Interior..> | 2026-04-10 15:08 | 157K | |
![[ ]](/icons/layout.gif) | 66864_Cash Building ..> | 2026-04-16 14:52 | 157K | |
![[ ]](/icons/layout.gif) | 69984_J.hodson Const..> | 2026-04-24 10:34 | 157K | |
![[ ]](/icons/layout.gif) | 63429_Regal Windows ..> | 2026-04-08 09:10 | 157K | |
![[ ]](/icons/layout.gif) | 63444_1st Choice Sec..> | 2026-04-08 09:28 | 157K | |
![[ ]](/icons/layout.gif) | 63692_Oakley Windows..> | 2026-04-08 14:22 | 157K | |
![[ ]](/icons/layout.gif) | 67246_MoBs Electrica..> | 2026-04-17 12:25 | 157K | |
![[ ]](/icons/layout.gif) | 70172_Adams Roller S..> | 2026-04-24 14:37 | 157K | |
![[ ]](/icons/layout.gif) | 68685_WADE WINDOWS I..> | 2026-04-21 14:32 | 157K | |
![[ ]](/icons/layout.gif) | 62685_Digby Services..> | 2026-04-07 08:42 | 157K | |
![[ ]](/icons/layout.gif) | 69877_J Brady Garage..> | 2026-04-24 09:17 | 157K | |
![[ ]](/icons/layout.gif) | 65732_T D Rollerdoor..> | 2026-04-14 13:33 | 157K | |
![[ ]](/icons/layout.gif) | 65350_Anderson Desig..> | 2026-04-14 07:44 | 157K | |
![[ ]](/icons/layout.gif) | 65106_Michael Mazur ..> | 2026-04-13 11:31 | 157K | |
![[ ]](/icons/layout.gif) | 69620_Oakley Windows..> | 2026-04-23 14:47 | 157K | |
![[ ]](/icons/layout.gif) | 64755_Mick Walklate ..> | 2026-04-10 15:38 | 157K | |
![[ ]](/icons/layout.gif) | 62245_EZ2OWN Ltd Pau..> | 2026-04-02 09:59 | 157K | |
![[ ]](/icons/layout.gif) | 65193_Bloomfield Hom..> | 2026-04-13 13:32 | 157K | |
![[ ]](/icons/layout.gif) | 68870_Harry Curtis H..> | 2026-04-22 09:01 | 157K | |
![[ ]](/icons/layout.gif) | 68871_Harry Curtis H..> | 2026-04-22 09:05 | 157K | |
![[ ]](/icons/layout.gif) | 65866_P & R Door Sys..> | 2026-04-14 15:14 | 157K | |
![[ ]](/icons/layout.gif) | 66867_TPS Gates & Do..> | 2026-04-16 14:57 | 157K | |
![[ ]](/icons/layout.gif) | 67751_M & S Home Ins..> | 2026-04-20 10:36 | 157K | |
![[ ]](/icons/layout.gif) | 67499_Ecosse Garage ..> | 2026-04-20 07:53 | 157K | |
![[ ]](/icons/layout.gif) | 66595_Ace Garage Doo..> | 2026-04-16 10:57 | 157K | |
![[ ]](/icons/layout.gif) | 67652_Four Counties ..> | 2026-04-20 09:36 | 157K | |
![[ ]](/icons/layout.gif) | 70061_Glazebright Gr..> | 2026-04-24 12:35 | 157K | |
![[ ]](/icons/layout.gif) | 68664_Adams Industri..> | 2026-04-21 14:18 | 157K | |
![[ ]](/icons/layout.gif) | 68840_Garage Door Se..> | 2026-04-22 08:36 | 157K | |
![[ ]](/icons/layout.gif) | 62253_AM Shutters St..> | 2026-04-02 10:10 | 157K | |
![[ ]](/icons/layout.gif) | 62469_EZ2OWN Ltd Pau..> | 2026-04-02 13:48 | 157K | |
![[ ]](/icons/layout.gif) | 62514_Mint Glazing N..> | 2026-04-02 15:54 | 157K | |
![[ ]](/icons/layout.gif) | 65060_Sargent & Powe..> | 2026-04-13 10:56 | 157K | |
![[ ]](/icons/layout.gif) | 66798_Rising Group L..> | 2026-04-16 13:34 | 157K | |
![[ ]](/icons/layout.gif) | 64191_Design & Insta..> | 2026-04-09 14:56 | 157K | |
![[ ]](/icons/layout.gif) | 66954_Ecosse Garage ..> | 2026-04-17 07:55 | 157K | |
![[ ]](/icons/layout.gif) | 67885_MoBs Electrica..> | 2026-04-20 13:50 | 157K | |
![[ ]](/icons/layout.gif) | 67784_LNR Door Solut..> | 2026-04-20 11:09 | 157K | |
![[ ]](/icons/layout.gif) | 68434_WADE WINDOWS I..> | 2026-04-21 11:56 | 157K | |
![[ ]](/icons/layout.gif) | 68083_Fortress Doors..> | 2026-04-21 07:15 | 157K | |
![[ ]](/icons/layout.gif) | 65360_Pioneer Doors ..> | 2026-04-14 07:59 | 157K | |
![[ ]](/icons/layout.gif) | 66968_EcoGlaze Group..> | 2026-04-17 08:12 | 157K | |
![[ ]](/icons/layout.gif) | 67874_Oakley Windows..> | 2026-04-20 13:41 | 157K | |
![[ ]](/icons/layout.gif) | 67869_Cash Building ..> | 2026-04-20 13:39 | 157K | |
![[ ]](/icons/layout.gif) | 67418_Fortress Doors..> | 2026-04-17 15:56 | 157K | |
![[ ]](/icons/layout.gif) | 70055_Eaton Park Win..> | 2026-04-24 12:26 | 157K | |
![[ ]](/icons/layout.gif) | 64697_Scotia Garage ..> | 2026-04-10 13:59 | 157K | |
![[ ]](/icons/layout.gif) | 68752_CWD Improvemen..> | 2026-04-21 15:58 | 157K | |
![[ ]](/icons/layout.gif) | 63739_Fortress Doors..> | 2026-04-08 14:54 | 157K | |
![[ ]](/icons/layout.gif) | 63982_Fortress Doors..> | 2026-04-09 09:20 | 157K | |
![[ ]](/icons/layout.gif) | 67972_Jurassic Doors..> | 2026-04-20 14:57 | 157K | |
![[ ]](/icons/layout.gif) | 65593_Fortress Doors..> | 2026-04-14 12:13 | 157K | |
![[ ]](/icons/layout.gif) | 66848_Doors 4 You Lt..> | 2026-04-16 14:24 | 157K | |
![[ ]](/icons/layout.gif) | 66503_Anderson Desig..> | 2026-04-16 08:33 | 157K | |
![[ ]](/icons/layout.gif) | 69100_Regal Windows ..> | 2026-04-22 13:51 | 157K | |
![[ ]](/icons/layout.gif) | 68739_Trulight Warwi..> | 2026-04-21 15:33 | 157K | |
![[ ]](/icons/layout.gif) | 67011_Go Direct Door..> | 2026-04-17 09:09 | 157K | |
![[ ]](/icons/layout.gif) | 68417_Fortress Doors..> | 2026-04-21 11:19 | 157K | |
![[ ]](/icons/layout.gif) | 64455_Digby Services..> | 2026-04-10 09:46 | 157K | |
![[ ]](/icons/layout.gif) | 64460_Digby Services..> | 2026-04-10 09:52 | 157K | |
![[ ]](/icons/layout.gif) | 64820_Fortress Doors..> | 2026-04-13 07:28 | 157K | |
![[ ]](/icons/layout.gif) | 65542_Fortress Doors..> | 2026-04-14 10:59 | 157K | |
![[ ]](/icons/layout.gif) | 64756_Ecosse Garage ..> | 2026-04-10 15:43 | 157K | |
![[ ]](/icons/layout.gif) | 64815_Fortress Doors..> | 2026-04-13 07:11 | 157K | |
![[ ]](/icons/layout.gif) | 66861_Replacement Ga..> | 2026-04-16 14:42 | 157K | |
![[ ]](/icons/layout.gif) | 68770_Lidget Compton..> | 2026-04-22 07:23 | 157K | |
![[ ]](/icons/layout.gif) | 62782_T & G Home Imp..> | 2026-04-07 09:57 | 157K | |
![[ ]](/icons/layout.gif) | 64717_All Doors Repa..> | 2026-04-10 14:37 | 157K | |
![[ ]](/icons/layout.gif) | 68395_TPS Gates & Do..> | 2026-04-21 10:45 | 157K | |
![[ ]](/icons/layout.gif) | 68837_G & H Windows ..> | 2026-04-22 08:28 | 157K | |
![[ ]](/icons/layout.gif) | 67770_Doors 4 You Lt..> | 2026-04-20 10:53 | 157K | |
![[ ]](/icons/layout.gif) | 64741_Niche Interior..> | 2026-04-10 15:17 | 157K | |
![[ ]](/icons/layout.gif) | 65571_Taundry Doors ..> | 2026-04-14 11:28 | 157K | |
![[ ]](/icons/layout.gif) | 66306_Ross Garage Do..> | 2026-04-15 13:55 | 157K | |
![[ ]](/icons/layout.gif) | 64949_Howard Caine C..> | 2026-04-13 08:54 | 157K | |
![[ ]](/icons/layout.gif) | 67453_FV CONSERVATOR..> | 2026-04-20 06:54 | 157K | |
![[ ]](/icons/layout.gif) | 65406_Oakley Windows..> | 2026-04-14 08:44 | 157K | |
![[ ]](/icons/layout.gif) | 67833_Eclipse Doors ..> | 2026-04-20 12:55 | 157K | |
![[ ]](/icons/layout.gif) | 69138_M & S Home Ins..> | 2026-04-22 14:36 | 157K | |
![[ ]](/icons/layout.gif) | 63750_Harry Curtis H..> | 2026-04-08 15:08 | 157K | |
![[ ]](/icons/layout.gif) | 67356_Elevate Doors ..> | 2026-04-17 14:01 | 157K | |
![[ ]](/icons/layout.gif) | 67797_Elevate Doors ..> | 2026-04-20 11:25 | 157K | |
![[ ]](/icons/layout.gif) | 68733_Michael Mazur ..> | 2026-04-21 15:26 | 157K | |
![[ ]](/icons/layout.gif) | 68923_P & R Door Sys..> | 2026-04-22 10:20 | 157K | |
![[ ]](/icons/layout.gif) | 69482_Wellingborough..> | 2026-04-23 12:03 | 157K | |
![[ ]](/icons/layout.gif) | 67796_Elevate Doors ..> | 2026-04-20 11:25 | 157K | |
![[ ]](/icons/layout.gif) | 67841_Above And Beyo..> | 2026-04-20 13:01 | 157K | |
![[ ]](/icons/layout.gif) | 68718_1st Class Home..> | 2026-04-21 15:05 | 157K | |
![[ ]](/icons/layout.gif) | 69105_All Door Engin..> | 2026-04-22 13:57 | 157K | |
![[ ]](/icons/layout.gif) | 64719_All Doors Repa..> | 2026-04-10 14:42 | 157K | |
![[ ]](/icons/layout.gif) | 65776_Fortress Doors..> | 2026-04-14 14:13 | 157K | |
![[ ]](/icons/layout.gif) | 68429_Elevate Doors ..> | 2026-04-21 11:36 | 157K | |
![[ ]](/icons/layout.gif) | 64703_All Door Engin..> | 2026-04-10 14:16 | 157K | |
![[ ]](/icons/layout.gif) | 66423_Phil Page Phil..> | 2026-04-16 07:18 | 157K | |
![[ ]](/icons/layout.gif) | 68487_Four Counties ..> | 2026-04-21 12:47 | 157K | |
![[ ]](/icons/layout.gif) | 64765_P & R Door Sys..> | 2026-04-10 15:59 | 157K | |
![[ ]](/icons/layout.gif) | 65588_P & R Door Sys..> | 2026-04-14 12:09 | 157K | |
![[ ]](/icons/layout.gif) | 69654_SDS (Isle Of M..> | 2026-04-23 15:29 | 157K | |
![[ ]](/icons/layout.gif) | 66773_Doors Shutters..> | 2026-04-16 12:58 | 157K | |
![[ ]](/icons/layout.gif) | 69813_Eclipse Doors ..> | 2026-04-24 08:34 | 157K | |
![[ ]](/icons/layout.gif) | 64457_Digby Services..> | 2026-04-10 09:48 | 157K | |
![[ ]](/icons/layout.gif) | 67830_Eclipse Doors ..> | 2026-04-20 12:49 | 157K | |
![[ ]](/icons/layout.gif) | 66574_Fortress Doors..> | 2026-04-16 10:22 | 157K | |
![[ ]](/icons/layout.gif) | 63696_Pdean Homes Lt..> | 2026-04-08 14:24 | 157K | |
![[ ]](/icons/layout.gif) | 65367_Chelmsford Rol..> | 2026-04-14 08:14 | 157K | |
![[ ]](/icons/layout.gif) | 67404_Rollermatic Ga..> | 2026-04-17 15:17 | 157K | |
![[ ]](/icons/layout.gif) | 66180_Piper Window S..> | 2026-04-15 10:54 | 157K | |
![[ ]](/icons/layout.gif) | 66863_Replacement Ga..> | 2026-04-16 14:47 | 157K | |
![[ ]](/icons/layout.gif) | 68776_Lidget Compton..> | 2026-04-22 07:31 | 157K | |
![[ ]](/icons/layout.gif) | 68824_Replacement Ga..> | 2026-04-22 08:11 | 157K | |
![[ ]](/icons/layout.gif) | 66852_M & S Home Ins..> | 2026-04-16 14:35 | 157K | |
![[ ]](/icons/layout.gif) | 62586_Rollermatic Ga..> | 2026-04-07 07:43 | 157K | |
![[ ]](/icons/layout.gif) | 64123_Phil & Dan Pro..> | 2026-04-09 13:06 | 157K | |
![[ ]](/icons/layout.gif) | 67325_Fortress Doors..> | 2026-04-17 13:33 | 157K | |
![[ ]](/icons/layout.gif) | 69728_HTH Developmen..> | 2026-04-24 07:08 | 157K | |
![[ ]](/icons/layout.gif) | 68626_Rollermatic Ga..> | 2026-04-21 13:36 | 157K | |
![[ ]](/icons/layout.gif) | 65663_P & R Door Sys..> | 2026-04-14 12:35 | 157K | |
![[ ]](/icons/layout.gif) | 67393_Rollermatic Ga..> | 2026-04-17 14:57 | 157K | |
![[ ]](/icons/layout.gif) | 67472_Fortress Doors..> | 2026-04-20 07:29 | 157K | |
![[ ]](/icons/layout.gif) | 69673_SDS (Isle Of M..> | 2026-04-23 15:53 | 157K | |
![[ ]](/icons/layout.gif) | 63742_Fortress Doors..> | 2026-04-08 14:58 | 157K | |
![[ ]](/icons/layout.gif) | 66751_Taundry Doors ..> | 2026-04-16 12:39 | 157K | |
![[ ]](/icons/layout.gif) | 68842_Adams Industri..> | 2026-04-22 08:40 | 157K | |
![[ ]](/icons/layout.gif) | 65401_Serenade Home ..> | 2026-04-14 08:36 | 157K | |
![[ ]](/icons/layout.gif) | 67403_Fortress Doors..> | 2026-04-17 15:12 | 157K | |
![[ ]](/icons/layout.gif) | 67342_Garage Door Re..> | 2026-04-17 13:50 | 157K | |
![[ ]](/icons/layout.gif) | 66975_Chelmsford Rol..> | 2026-04-17 08:33 | 157K | |
![[ ]](/icons/layout.gif) | 68635_Rollermatic Ga..> | 2026-04-21 13:48 | 157K | |
![[ ]](/icons/layout.gif) | 67373_Rollermatic Ga..> | 2026-04-17 14:38 | 157K | |
![[ ]](/icons/layout.gif) | 66851_Replacement Ga..> | 2026-04-16 14:29 | 157K | |
![[ ]](/icons/layout.gif) | 68630_Rollermatic Ga..> | 2026-04-21 13:41 | 157K | |
![[ ]](/icons/layout.gif) | 66869_P & R Door Sys..> | 2026-04-16 15:03 | 157K | |
![[ ]](/icons/layout.gif) | 67361_Rollermatic Ga..> | 2026-04-17 14:18 | 157K | |
![[ ]](/icons/layout.gif) | 62265_P & R Door Sys..> | 2026-04-02 10:34 | 157K | |
![[ ]](/icons/layout.gif) | 66854_Replacement Ga..> | 2026-04-16 14:39 | 157K | |
![[ ]](/icons/layout.gif) | 62594_Rollermatic Ga..> | 2026-04-07 07:58 | 157K | |
![[ ]](/icons/layout.gif) | 67475_Rollermatic Ga..> | 2026-04-20 07:33 | 157K | |
![[ ]](/icons/layout.gif) | 64735_Bryan Thompson..> | 2026-04-10 15:15 | 157K | |
![[ ]](/icons/layout.gif) | 68900_Four Counties ..> | 2026-04-22 09:50 | 157K | |
![[ ]](/icons/layout.gif) | 63810_J Brady Garage..> | 2026-04-09 06:41 | 157K | |
![[ ]](/icons/layout.gif) | 64773_IAmDoors Ltd S..> | 2026-04-10 16:05 | 157K | |
![[ ]](/icons/layout.gif) | 69664_Eclipse Doors ..> | 2026-04-23 15:37 | 157K | |
![[ ]](/icons/layout.gif) | 68755_J Brady Garage..> | 2026-04-22 06:42 | 157K | |
![[ ]](/icons/layout.gif) | 63638_Go Direct Door..> | 2026-04-08 13:48 | 157K | |
![[ ]](/icons/layout.gif) | 65213_Everbright Win..> | 2026-04-13 13:50 | 157K | |
![[ ]](/icons/layout.gif) | 69846_Eclipse Doors ..> | 2026-04-24 08:50 | 157K | |
![[ ]](/icons/layout.gif) | 63604_DP Installatio..> | 2026-04-08 13:04 | 157K | |
![[ ]](/icons/layout.gif) | 65721_DP Installatio..> | 2026-04-14 13:31 | 157K | |
![[ ]](/icons/layout.gif) | 68810_Serenade Home ..> | 2026-04-22 07:57 | 157K | |
![[ ]](/icons/layout.gif) | 63934_Faith Home Imp..> | 2026-04-09 08:24 | 157K | |
![[ ]](/icons/layout.gif) | 64763_Replacement Ga..> | 2026-04-10 15:57 | 157K | |
![[ ]](/icons/layout.gif) | 62501_DJB Home Impro..> | 2026-04-02 15:16 | 157K | |
![[ ]](/icons/layout.gif) | 63174_Faith Home Imp..> | 2026-04-07 15:04 | 157K | |
![[ ]](/icons/layout.gif) | 64303_Go Direct Door..> | 2026-04-10 06:54 | 157K | |
![[ ]](/icons/layout.gif) | 62584_Rollermatic Ga..> | 2026-04-07 07:39 | 157K | |
![[ ]](/icons/layout.gif) | 64090_All Door Engin..> | 2026-04-09 12:09 | 157K | |
![[ ]](/icons/layout.gif) | 67153_Elevate Doors ..> | 2026-04-17 10:47 | 157K | |
![[ ]](/icons/layout.gif) | 66307_Cartwright Win..> | 2026-04-15 13:55 | 157K | |
![[ ]](/icons/layout.gif) | 66885_PGD Doors Ltd ..> | 2026-04-16 15:32 | 157K | |
![[ ]](/icons/layout.gif) | 67061_Avon Automated..> | 2026-04-17 10:10 | 157K | |
![[ ]](/icons/layout.gif) | 67335_Garage Door Re..> | 2026-04-17 13:42 | 157K | |
![[ ]](/icons/layout.gif) | 67402_Rollermatic Ga..> | 2026-04-17 15:11 | 157K | |
![[ ]](/icons/layout.gif) | 62316_Avon Automated..> | 2026-04-02 11:44 | 157K | |
![[ ]](/icons/layout.gif) | 69791_TPS Gates & Do..> | 2026-04-24 08:19 | 157K | |
![[ ]](/icons/layout.gif) | 67370_Rollermatic Ga..> | 2026-04-17 14:32 | 157K | |
![[ ]](/icons/layout.gif) | 62478_P & R Door Sys..> | 2026-04-02 14:38 | 157K | |
![[ ]](/icons/layout.gif) | 69431_Phil & Dan Pro..> | 2026-04-23 11:04 | 157K | |
![[ ]](/icons/layout.gif) | 65176_J Brady Garage..> | 2026-04-13 12:56 | 157K | |
![[ ]](/icons/layout.gif) | 65287_CPS Custom Pro..> | 2026-04-13 16:01 | 157K | |
![[ ]](/icons/layout.gif) | 66882_Chelmsford Rol..> | 2026-04-16 15:16 | 157K | |
![[ ]](/icons/layout.gif) | 67117_Chelmsford Rol..> | 2026-04-17 10:26 | 157K | |
![[ ]](/icons/layout.gif) | 64764_Rhino Windows ..> | 2026-04-10 15:58 | 157K | |
![[ ]](/icons/layout.gif) | 67200_Chelmsford Rol..> | 2026-04-17 11:34 | 157K | |
![[ ]](/icons/layout.gif) | 63270_Avon Automated..> | 2026-04-08 06:42 | 157K | |
![[ ]](/icons/layout.gif) | 63448_Regal Windows ..> | 2026-04-08 09:38 | 157K | |
![[ ]](/icons/layout.gif) | 64032_DJB Home Impro..> | 2026-04-09 10:42 | 157K | |
![[ ]](/icons/layout.gif) | 64289_East Anglia Ro..> | 2026-04-10 06:41 | 157K | |
![[ ]](/icons/layout.gif) | 65871_P & R Door Sys..> | 2026-04-14 15:29 | 157K | |
![[ ]](/icons/layout.gif) | 69733_Rollerdoors 24..> | 2026-04-24 07:13 | 157K | |
![[ ]](/icons/layout.gif) | 69806_Wellingborough..> | 2026-04-24 08:29 | 157K | |
![[ ]](/icons/layout.gif) | 63844_G & H Windows ..> | 2026-04-09 07:30 | 157K | |
![[ ]](/icons/layout.gif) | 66255_Avon Automated..> | 2026-04-15 12:28 | 157K | |
![[ ]](/icons/layout.gif) | 65415_CWG Home Impro..> | 2026-04-14 08:49 | 157K | |
![[ ]](/icons/layout.gif) | 66983_Replacement Ga..> | 2026-04-17 08:49 | 157K | |
![[ ]](/icons/layout.gif) | 65311_Chelmsford Rol..> | 2026-04-14 07:27 | 157K | |
![[ ]](/icons/layout.gif) | 67737_J Brady Garage..> | 2026-04-20 10:13 | 157K | |
![[ ]](/icons/layout.gif) | 63234_Highlands Elec..> | 2026-04-07 15:20 | 157K | |
![[ ]](/icons/layout.gif) | 68514_Garage Door Re..> | 2026-04-21 13:03 | 157K | |
![[ ]](/icons/layout.gif) | 67812_LNR Door Solut..> | 2026-04-20 12:21 | 157K | |
![[ ]](/icons/layout.gif) | 63858_Wellingborough..> | 2026-04-09 07:43 | 157K | |
![[ ]](/icons/layout.gif) | 62271_Chelmsford Rol..> | 2026-04-02 10:44 | 157K | |
![[ ]](/icons/layout.gif) | 67310_Elevate Doors ..> | 2026-04-17 13:20 | 157K | |
![[ ]](/icons/layout.gif) | 64817_Rollermatic Ga..> | 2026-04-13 07:19 | 157K | |
![[ ]](/icons/layout.gif) | 64778_Rhino Windows ..> | 2026-04-10 16:09 | 157K | |
![[ ]](/icons/layout.gif) | 67193_Elevate Doors ..> | 2026-04-17 11:29 | 157K | |
![[ ]](/icons/layout.gif) | 64774_Rhino Windows ..> | 2026-04-10 16:05 | 157K | |
![[ ]](/icons/layout.gif) | 63282_Garage Door & ..> | 2026-04-08 06:51 | 157K | |
![[ ]](/icons/layout.gif) | 64398_Thomas Andrew ..> | 2026-04-10 08:19 | 157K | |
![[ ]](/icons/layout.gif) | 64400_Thomas Andrew ..> | 2026-04-10 08:22 | 157K | |
![[ ]](/icons/layout.gif) | 63290_Highlands Elec..> | 2026-04-08 06:57 | 157K | |
![[ ]](/icons/layout.gif) | 67492_Rollermatic Ga..> | 2026-04-20 07:47 | 157K | |
![[ ]](/icons/layout.gif) | 67470_Fortress Doors..> | 2026-04-20 07:28 | 157K | |
![[ ]](/icons/layout.gif) | 64472_SDL DOOR REPAI..> | 2026-04-10 10:02 | 157K | |
![[ ]](/icons/layout.gif) | 68786_Rhino Windows ..> | 2026-04-22 07:36 | 157K | |
![[ ]](/icons/layout.gif) | 68789_Rhino Windows ..> | 2026-04-22 07:38 | 157K | |
![[ ]](/icons/layout.gif) | 62312_Chelmsford Rol..> | 2026-04-02 11:37 | 157K | |
![[ ]](/icons/layout.gif) | 63967_Fortress Doors..> | 2026-04-09 09:00 | 157K | |
![[ ]](/icons/layout.gif) | 66569_Fortress Doors..> | 2026-04-16 10:17 | 157K | |
![[ ]](/icons/layout.gif) | 68644_Avon Automated..> | 2026-04-21 13:51 | 157K | |
![[ ]](/icons/layout.gif) | 67465_Fortress Doors..> | 2026-04-20 07:20 | 157K | |
![[ ]](/icons/layout.gif) | 67993_P & R Door Sys..> | 2026-04-20 15:12 | 157K | |
![[ ]](/icons/layout.gif) | 69690_M. A. E. Windo..> | 2026-04-24 06:30 | 157K | |
![[ ]](/icons/layout.gif) | 68937_Eastern Frames..> | 2026-04-22 10:42 | 157K | |
![[ ]](/icons/layout.gif) | 68938_Eastern Frames..> | 2026-04-22 10:43 | 157K | |
![[ ]](/icons/layout.gif) | 63289_Garage Door & ..> | 2026-04-08 06:55 | 157K | |
![[ ]](/icons/layout.gif) | 65697_East Anglia Ro..> | 2026-04-14 12:53 | 157K | |
![[ ]](/icons/layout.gif) | 65699_East Anglia Ro..> | 2026-04-14 12:56 | 157K | |
![[ ]](/icons/layout.gif) | 67336_Go Direct Door..> | 2026-04-17 13:43 | 157K | |
![[ ]](/icons/layout.gif) | 68930_Eastern Frames..> | 2026-04-22 10:32 | 157K | |
![[ ]](/icons/layout.gif) | 64442_Garage Door So..> | 2026-04-10 09:07 | 157K | |
![[ ]](/icons/layout.gif) | 65291_M. A. E. Windo..> | 2026-04-14 06:51 | 157K | |
![[ ]](/icons/layout.gif) | 64469_SDL DOOR REPAI..> | 2026-04-10 09:59 | 157K | |
![[ ]](/icons/layout.gif) | 64383_All Doors Repa..> | 2026-04-10 08:08 | 157K | |
![[ ]](/icons/layout.gif) | 65574_Easy-Roll Ben ..> | 2026-04-14 11:38 | 157K | |
![[ ]](/icons/layout.gif) | 68463_Go Direct Door..> | 2026-04-21 12:27 | 157K | |
![[ ]](/icons/layout.gif) | 65394_Chelmsford Rol..> | 2026-04-14 08:25 | 157K | |
![[ ]](/icons/layout.gif) | 62476_East Anglia Ro..> | 2026-04-02 14:22 | 157K | |
![[ ]](/icons/layout.gif) | 64766_Rhino Windows ..> | 2026-04-10 16:02 | 157K | |
![[ ]](/icons/layout.gif) | 66966_Garage Door Au..> | 2026-04-17 08:02 | 157K | |
![[ ]](/icons/layout.gif) | 66598_Doorolla Ltd S..> | 2026-04-16 10:59 | 157K | |
![[ ]](/icons/layout.gif) | 67984_Eastern Frames..> | 2026-04-20 15:05 | 157K | |
![[ ]](/icons/layout.gif) | 69676_M. A. E. Windo..> | 2026-04-24 06:10 | 157K | |
![[ ]](/icons/layout.gif) | 68402_Eastern Frames..> | 2026-04-21 10:54 | 157K | |
![[ ]](/icons/layout.gif) | 70068_Danbury Garage..> | 2026-04-24 12:48 | 157K | |
![[ ]](/icons/layout.gif) | 68484_Doorolla Ltd S..> | 2026-04-21 12:45 | 157K | |
![[ ]](/icons/layout.gif) | 62472_East Anglia Ro..> | 2026-04-02 14:16 | 157K | |
![[ ]](/icons/layout.gif) | 65766_S Warrender El..> | 2026-04-14 13:51 | 157K | |
![[ ]](/icons/layout.gif) | 66036_The Lothian Ga..> | 2026-04-15 08:39 | 157K | |
![[ ]](/icons/layout.gif) | 68076_Warnsham Windo..> | 2026-04-21 07:13 | 157K | |
![[ ]](/icons/layout.gif) | 65947_Warnsham Windo..> | 2026-04-15 07:19 | 157K | |
![[ ]](/icons/layout.gif) | 65992_The Lothian Ga..> | 2026-04-15 08:09 | 157K | |
![[ ]](/icons/layout.gif) | 69795_Go Direct Door..> | 2026-04-24 08:23 | 157K | |
![[ ]](/icons/layout.gif) | 66067_The Lothian Ga..> | 2026-04-15 09:07 | 157K | |
![[ ]](/icons/layout.gif) | 65931_The Lothian Ga..> | 2026-04-15 07:06 | 157K | |
![[ ]](/icons/layout.gif) | 64963_Wellingborough..> | 2026-04-13 09:09 | 157K | |
![[ ]](/icons/layout.gif) | 65979_Easy-Roll Ben ..> | 2026-04-15 07:59 | 157K | |
![[ ]](/icons/layout.gif) | 69729_HTH Developmen..> | 2026-04-24 07:08 | 157K | |
![[ ]](/icons/layout.gif) | 67744_Go Direct Door..> | 2026-04-20 10:18 | 157K | |
![[ ]](/icons/layout.gif) | 65974_The Lothian Ga..> | 2026-04-15 07:54 | 157K | |
![[ ]](/icons/layout.gif) | 67456_The Lothian Ga..> | 2026-04-20 07:08 | 157K | |
![[ ]](/icons/layout.gif) | 68501_Doorolla Ltd S..> | 2026-04-21 12:57 | 157K | |
![[ ]](/icons/layout.gif) | 66786_Rhino Windows ..> | 2026-04-16 13:23 | 157K | |
![[ ]](/icons/layout.gif) | 69812_M. A. E. Windo..> | 2026-04-24 08:34 | 157K | |
![[ ]](/icons/layout.gif) | 69774_Go Direct Door..> | 2026-04-24 08:03 | 157K | |
![[ ]](/icons/layout.gif) | 69696_M. A. E. Windo..> | 2026-04-24 06:35 | 157K | |
![[ ]](/icons/layout.gif) | 66051_The Lothian Ga..> | 2026-04-15 08:50 | 157K | |
![[ ]](/icons/layout.gif) | 66013_The Lothian Ga..> | 2026-04-15 08:22 | 157K | |
![[ ]](/icons/layout.gif) | 65962_The Lothian Ga..> | 2026-04-15 07:36 | 157K | |
![[ ]](/icons/layout.gif) | 69683_M. A. E. Windo..> | 2026-04-24 06:20 | 157K | |
![[ ]](/icons/layout.gif) | 67454_The Lothian Ga..> | 2026-04-20 07:01 | 157K | |
![[ ]](/icons/layout.gif) | 65295_Doorolla Ltd S..> | 2026-04-14 06:58 | 157K | |
![[ ]](/icons/layout.gif) | 67741_J Brady Garage..> | 2026-04-20 10:14 | 157K | |
![[ ]](/icons/layout.gif) | 66283_Go Direct Door..> | 2026-04-15 13:03 | 157K | |
![[ ]](/icons/layout.gif) | 66401_Go Direct Door..> | 2026-04-16 06:18 | 157K | |
![[ ]](/icons/layout.gif) | 66267_Avon Automated..> | 2026-04-15 12:39 | 157K | |
![[ ]](/icons/layout.gif) | 67452_The Lothian Ga..> | 2026-04-20 06:50 | 157K | |
![[ ]](/icons/layout.gif) | 69739_M. A. E. Windo..> | 2026-04-24 07:15 | 157K | |
![[ ]](/icons/layout.gif) | 65950_The Lothian Ga..> | 2026-04-15 07:23 | 157K | |
![[ ]](/icons/layout.gif) | 68933_Eastern Frames..> | 2026-04-22 10:34 | 157K | |
![[ ]](/icons/layout.gif) | 63786_All About Door..> | 2026-04-08 15:54 | 157K | |
![[ ]](/icons/layout.gif) | 63071_Ideal Home Sol..> | 2026-04-07 13:50 | 157K | |
![[ ]](/icons/layout.gif) | 69699_M. A. E. Windo..> | 2026-04-24 06:36 | 157K | |
![[ ]](/icons/layout.gif) | 66092_Digby Services..> | 2026-04-15 09:42 | 157K | |
![[ ]](/icons/layout.gif) | 69588_Doors 4 Garage..> | 2026-04-23 14:18 | 157K | |
![[ ]](/icons/layout.gif) | 69011_Weatherproof W..> | 2026-04-22 12:25 | 157K | |
![[ ]](/icons/layout.gif) | 69472_C Marl Systems..> | 2026-04-23 11:52 | 157K | |
![[ ]](/icons/layout.gif) | 63236_Image Improvem..> | 2026-04-07 15:23 | 157K | |
![[ ]](/icons/layout.gif) | 65894_Cash Building ..> | 2026-04-14 16:02 | 157K | |
![[ ]](/icons/layout.gif) | 70003_C Marl Systems..> | 2026-04-24 11:08 | 157K | |
![[ ]](/icons/layout.gif) | 62896_ACE Roller Shu..> | 2026-04-07 11:32 | 157K | |
![[ ]](/icons/layout.gif) | 63749_Niche Interior..> | 2026-04-08 15:07 | 157K | |
![[ ]](/icons/layout.gif) | 67954_Go Direct Door..> | 2026-04-20 14:45 | 157K | |
![[ ]](/icons/layout.gif) | 62273_CWD Improvemen..> | 2026-04-02 10:56 | 157K | |
![[ ]](/icons/layout.gif) | 62243_Ace Garage Doo..> | 2026-04-02 09:55 | 157K | |
![[ ]](/icons/layout.gif) | 63377_GR Home Soluti..> | 2026-04-08 08:33 | 157K | |
![[ ]](/icons/layout.gif) | 62152_Chelmsford Rol..> | 2026-04-02 08:36 | 157K | |
![[ ]](/icons/layout.gif) | 62169_Chelmsford Rol..> | 2026-04-02 08:46 | 157K | |
![[ ]](/icons/layout.gif) | 68435_Go Direct Door..> | 2026-04-21 11:58 | 157K | |
![[ ]](/icons/layout.gif) | 63740_Niche Interior..> | 2026-04-08 14:55 | 157K | |
![[ ]](/icons/layout.gif) | 64099_Go Direct Door..> | 2026-04-09 12:35 | 157K | |
![[ ]](/icons/layout.gif) | 63522_Go Direct Door..> | 2026-04-08 10:57 | 157K | |
![[ ]](/icons/layout.gif) | 64734_Simon Piggin P..> | 2026-04-10 15:13 | 157K | |
![[ ]](/icons/layout.gif) | 62266_Ecosse Garage ..> | 2026-04-02 10:35 | 157K | |
![[ ]](/icons/layout.gif) | 62856_Go Direct Door..> | 2026-04-07 10:59 | 157K | |
![[ ]](/icons/layout.gif) | 63694_Pdean Homes Lt..> | 2026-04-08 14:23 | 157K | |
![[ ]](/icons/layout.gif) | 66730_JJ Secure Door..> | 2026-04-16 12:29 | 157K | |
![[ ]](/icons/layout.gif) | 67952_Go Direct Door..> | 2026-04-20 14:43 | 157K | |
![[ ]](/icons/layout.gif) | 69471_Go Direct Door..> | 2026-04-23 11:48 | 157K | |
![[ ]](/icons/layout.gif) | 63261_RM INSTALLS Ri..> | 2026-04-08 06:34 | 157K | |
![[ ]](/icons/layout.gif) | 64015_1st Shield Dar..> | 2026-04-09 10:04 | 157K | |
![[ ]](/icons/layout.gif) | 63526_Go Direct Door..> | 2026-04-08 11:03 | 157K | |
![[ ]](/icons/layout.gif) | 64772_Scotia Garage ..> | 2026-04-10 16:05 | 157K | |
![[ ]](/icons/layout.gif) | 41783_Will Simpson S..> | 2026-02-09 15:02 | 157K | |
![[ ]](/icons/layout.gif) | 41784_Will Simpson S..> | 2026-02-09 15:11 | 157K | |
![[ ]](/icons/layout.gif) | 41787_Will Simpson S..> | 2026-02-09 15:14 | 157K | |
![[ ]](/icons/layout.gif) | 67955_Ross Garage Do..> | 2026-04-20 14:46 | 157K | |
![[ ]](/icons/layout.gif) | 68744_Oakley Windows..> | 2026-04-21 15:40 | 157K | |
![[ ]](/icons/layout.gif) | 68863_CPS Custom Pro..> | 2026-04-22 08:54 | 157K | |
![[ ]](/icons/layout.gif) | 64126_Phil & Dan Pro..> | 2026-04-09 13:31 | 157K | |
![[ ]](/icons/layout.gif) | 69597_Doors 4 Garage..> | 2026-04-23 14:28 | 157K | |
![[ ]](/icons/layout.gif) | 64518_Fen-Bay Servic..> | 2026-04-10 11:45 | 157K | |
![[ ]](/icons/layout.gif) | 69186_Eastern Frames..> | 2026-04-22 15:46 | 157K | |
![[ ]](/icons/layout.gif) | 69198_Eastern Frames..> | 2026-04-22 15:53 | 157K | |
![[ ]](/icons/layout.gif) | 69188_Eastern Frames..> | 2026-04-22 15:49 | 157K | |
![[ ]](/icons/layout.gif) | 63518_Go Direct Door..> | 2026-04-08 10:53 | 157K | |
![[ ]](/icons/layout.gif) | 63520_Go Direct Door..> | 2026-04-08 10:54 | 157K | |
![[ ]](/icons/layout.gif) | 67194_Avon Automated..> | 2026-04-17 11:29 | 157K | |
![[ ]](/icons/layout.gif) | 41666_First Call Shu..> | 2026-02-09 11:58 | 157K | |
![[ ]](/icons/layout.gif) | 66838_Oakley Windows..> | 2026-04-16 14:01 | 158K | |
![[ ]](/icons/layout.gif) | 70254_BCH Loading Sy..> | 2026-04-24 15:17 | 158K | |
![[ ]](/icons/layout.gif) | 69007_NBC Commercial..> | 2026-04-22 12:14 | 158K | |
![[ ]](/icons/layout.gif) | 63239_Kenmar Propert..> | 2026-04-07 15:34 | 158K | |
![[ ]](/icons/layout.gif) | 69080_WADE WINDOWS I..> | 2026-04-22 13:16 | 158K | |
![[ ]](/icons/layout.gif) | 70081_BG&S Steven No..> | 2026-04-24 13:15 | 158K | |
![[ ]](/icons/layout.gif) | 65604_Digby Services..> | 2026-04-14 12:20 | 158K | |
![[ ]](/icons/layout.gif) | 62516_Dream Installa..> | 2026-04-02 15:59 | 158K | |
![[ ]](/icons/layout.gif) | 67408_Eclipse Doors ..> | 2026-04-17 15:40 | 158K | |
![[ ]](/icons/layout.gif) | 68654_Eclipse Doors ..> | 2026-04-21 13:57 | 158K | |
![[ ]](/icons/layout.gif) | 62578_Chiltern Doors..> | 2026-04-07 07:30 | 158K | |
![[ ]](/icons/layout.gif) | 65751_Rolladoor NR9 ..> | 2026-04-14 13:43 | 158K | |
![[ ]](/icons/layout.gif) | 63256_A.S.M Windows ..> | 2026-04-07 15:55 | 158K | |
![[ ]](/icons/layout.gif) | 67372_Jurassic Doors..> | 2026-04-17 14:37 | 158K | |
![[ ]](/icons/layout.gif) | 67802_Elevate Doors ..> | 2026-04-20 11:56 | 158K | |
![[ ]](/icons/layout.gif) | 40321_Bijan Fouladga..> | 2026-02-04 09:40 | 158K | |
![[ ]](/icons/layout.gif) | 69854_WADE WINDOWS I..> | 2026-04-24 09:00 | 158K | |
![[ ]](/icons/layout.gif) | 64124_Warnsham Windo..> | 2026-04-09 13:10 | 158K | |
![[ ]](/icons/layout.gif) | 70071_Scotia Garage ..> | 2026-04-24 12:52 | 158K | |
![[ ]](/icons/layout.gif) | 67410_CPS Custom Pro..> | 2026-04-17 15:44 | 158K | |
![[ ]](/icons/layout.gif) | 67010_Elevate Doors ..> | 2026-04-17 09:08 | 158K | |
![[ ]](/icons/layout.gif) | 69744_Rollermatic Ga..> | 2026-04-24 07:30 | 158K | |
![[ ]](/icons/layout.gif) | 65921_Go Direct Door..> | 2026-04-15 06:44 | 158K | |
![[ ]](/icons/layout.gif) | 64750_Go Direct Door..> | 2026-04-10 15:32 | 158K | |
![[ ]](/icons/layout.gif) | 66777_Rhino Windows ..> | 2026-04-16 13:09 | 158K | |
![[ ]](/icons/layout.gif) | 62506_Bristol's Door..> | 2026-04-02 15:30 | 158K | |
![[ ]](/icons/layout.gif) | 70000_All About Door..> | 2026-04-24 11:01 | 158K | |
![[ ]](/icons/layout.gif) | 68619_Digby Services..> | 2026-04-21 13:34 | 158K | |
![[ ]](/icons/layout.gif) | 66014_Securi-Doors S..> | 2026-04-15 08:22 | 158K | |
![[ ]](/icons/layout.gif) | 62884_Red River Corp..> | 2026-04-07 11:19 | 158K | |
![[ ]](/icons/layout.gif) | 69204_All Doors Repa..> | 2026-04-22 16:00 | 158K | |
![[ ]](/icons/layout.gif) | 65673_Highlands Elec..> | 2026-04-14 12:42 | 158K | |
![[ ]](/icons/layout.gif) | 41037_First Call Shu..> | 2026-02-05 14:35 | 158K | |
![[ ]](/icons/layout.gif) | 42005_Will Simpson S..> | 2026-02-10 08:11 | 158K | |
![[ ]](/icons/layout.gif) | 65775_Horrax(amblesi..> | 2026-04-14 14:13 | 159K | |
![[ ]](/icons/layout.gif) | 68460_Ace Garage Doo..> | 2026-04-21 12:24 | 159K | |
![[ ]](/icons/layout.gif) | 65895_Horrax(amblesi..> | 2026-04-14 16:08 | 159K | |
![[ ]](/icons/layout.gif) | 35187_Garage Door So..> | 2026-01-20 13:56 | 159K | |
![[ ]](/icons/layout.gif) | 41030_First Call Shu..> | 2026-02-05 14:30 | 159K | |
![[ ]](/icons/layout.gif) | 55624_All Door Engin..> | 2026-03-17 08:20 | 159K | |
![[ ]](/icons/layout.gif) | 38676_Avon Automated..> | 2026-01-30 08:53 | 160K | |
![[ ]](/icons/layout.gif) | 38682_Avon Automated..> | 2026-01-30 09:00 | 160K | |
![[ ]](/icons/layout.gif) | 38669_Avon Automated..> | 2026-01-30 08:47 | 160K | |
![[ ]](/icons/layout.gif) | 31479_Windowcraft De..> | 2026-01-08 09:13 | 160K | |
![[ ]](/icons/layout.gif) | 31607_Windowcraft De..> | 2026-01-08 11:48 | 160K | |
![[ ]](/icons/layout.gif) | 68754_Avon Automated..> | 2026-04-22 06:39 | 160K | |
![[ ]](/icons/layout.gif) | 51429_All About Door..> | 2026-03-05 11:55 | 160K | |
![[ ]](/icons/layout.gif) | 53752_First Call Shu..> | 2026-03-11 10:58 | 161K | |
![[ ]](/icons/layout.gif) | 55029_First Call Shu..> | 2026-03-13 16:17 | 161K | |
![[ ]](/icons/layout.gif) | 63765_Henry Summers ..> | 2026-04-08 15:30 | 162K | |
![[ ]](/icons/layout.gif) | 63989_Henry Summers ..> | 2026-04-09 09:25 | 163K | |
![[ ]](/icons/layout.gif) | 66244_Henry Summers ..> | 2026-04-15 12:15 | 163K | |
![[ ]](/icons/layout.gif) | 35416_Avon Automated..> | 2026-01-20 16:44 | 163K | |
![[ ]](/icons/layout.gif) | 35467_Avon Automated..> | 2026-01-21 08:19 | 163K | |
![[ ]](/icons/layout.gif) | 58908_Warnsham Windo..> | 2026-03-25 08:58 | 165K | |
![[ ]](/icons/layout.gif) | 58840_Warnsham Windo..> | 2026-03-24 17:01 | 165K | |
![[TXT]](/icons/text.gif) | 19038_Ian Church - C..> | 2025-11-25 10:56 | 604K | |
![[TXT]](/icons/text.gif) | 23580_The Lothian Ga..> | 2025-12-05 16:25 | 605K | |
![[TXT]](/icons/text.gif) | 62285_Windowcraft De..> | 2026-04-02 11:05 | 607K | |
![[IMG]](/icons/image2.gif) | 155321-IMG_5815.jpeg | 2025-11-03 15:53 | 2.2M | |
|