Index of /api/storage/app/public/attachments/DEMOGARAGEDOOR/notesfiles
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 12820_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4691_[0,0] Devlinc ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 2268_Michael Mazur ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 2265_Michael Mazur ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 1838_C&M Glass Servi..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 12798_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 1831_C&M Glass Servi..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10424_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13354_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6099_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4578_[0,0] Devlinc ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6084_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6079_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6073_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6050_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8722_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10297_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8721_Gilberts Home I..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11902_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10883_Doorolla Ltd J..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10880_Doorolla Ltd J..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11899_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13294_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13289_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13275_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13261_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10256_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13259_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13257_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13246_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13233_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10730_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10134_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10133_Devlinc Ltd T/ | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10132_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10110_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10016_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10010_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13211_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13192_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13182_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13181_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8675_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8673_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8669_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8050_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8647_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8639_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8048_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8042_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 133_Chargepoint Inst..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 5660_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 5659_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 130_Chargepoint Inst..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 5656_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 5654_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 1457_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 1454_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 1455_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 1452_[0,0] S Terry -..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8556_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 5637_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 7169_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8539_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8536_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8531_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10498_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 10497_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 9991_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 9990_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 9983_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 7872_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11811_Devlinc Ltd T/ | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 7853_Michael Mazur ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 7849_Michael Mazur ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 1266_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4891_Contex Builders..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 2188_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 1258_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 1655_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 1653_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 9921_Devlinc Ltd T/ | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6013_Contex Builders..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 7109_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 7104_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 7103_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 5419_Gilberts Home I..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11715_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11713_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11711_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11708_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11704_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11703_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 9827_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11699_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4138_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4137_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4128_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4124_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8332_Garage Doors 24..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8330_Garage Doors 24..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 8326_Garage Doors 24..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11202_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4120_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4117_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 12255_Gilberts Home ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4110_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 12249_Gilberts Home ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 9749_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4107_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4104_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 7006_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6999_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6995_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4102_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11190_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6991_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6980_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6973_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 2821_[0,0] Devlinc ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 12211_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6967_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6965_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 12204_Devlinc Ltd T/ | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 9746_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 12202_Devlinc Ltd T/ | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 5902_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 9744_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 9740_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 3304_[0,0] SW Trade..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 2797_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[ ]](/icons/layout.gif) | 9989_Derek Wright - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 9985_Taundry Doors W..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9972_Linda Gett - GE..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 9969_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9967_Taundry Doors W..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9964_NW Automatic Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9961_J Hallam Buildi..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 9955_Jonathan Mills ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 9950_DJB Home Improv..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9944_Ewan Robertson ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9563_Nicholas Custan..> | 2025-11-11 06:20 | 45K | |
![[ ]](/icons/layout.gif) | 9560_TH Installation..> | 2025-11-11 06:20 | 38K | |
![[ ]](/icons/layout.gif) | 8074_Dream Installat..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 8073_CWG Home Improv..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8072_Ronald Collins ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8071_Trevor Thirwell..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 8068_Trevor Thirwell..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8067_R Page Concrete..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8066_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8064_Mitchal Welberr..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8063_Mitchal Welberr..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9550_Norfolk Broads ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8060_Mitchal Welberr..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8058_Martin Layfield..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 8056_Martin Layfield..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8054_P & R Door Syst..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8053_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8052_East Anglia Rol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8045_Lidget Compton ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8044_The Lothian Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8043_The Lothian Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8039_The Lothian Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8028_Fortress Doors ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8027_J Brady Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8026_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7636_Colin Sweeney -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7635_Scotia Garage D..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7633_SDL Door Repair..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7632_Garage Door Rep..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 7631_The Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7622_Ian Callagham I..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7606_Jean-Michel Can..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7605_SW Trade Frames..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7604_Doorolla Ltd St..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7603_Hanney Glazed L..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7597_Chelmsford Roll..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7594_Chelmsford Roll..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7589_Swift Doors Ltd..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7588_Adrian Jackson ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 12910_Shutter Tech U..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 12909_Shutter Tech U..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7587_Smart Doors Hen..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7579_T D Rollerdoors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7574_Piper Window Sy..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7572_Piper Window Sy..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7566_Piper Window Sy..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 7537_Aspect Maintena..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 7529_Mark Perham Mar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7504_Rodney Ide Rodn..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7502_Rodney Ide Rodn..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7498_Andrew Reid And..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7497_Andrew Reid And..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7495_Andrew Reid And..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7493_Richard Horspoo..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7478_Ian Callagham I..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7475_Ian Callagham I..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7461_Scott Curie - S..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7454_Dave Cordell Da..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7422_Alan Stirling A..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7419_Alan Stirling A..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7418_Jurassic Doors ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7416_Jurassic Doors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7414_Ideal Industria..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7413_Prorenovate Ian..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7412_Norfolk Roller ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7410_Fortress Doors ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7409_JM Doors Jon Bu..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 7408_JM Doors Jon Bu..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 7407_All Doors Repai..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7406_Elevate Doors L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7405_All Doors Repai..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7404_All Doors Repai..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7395_Garage Door Sol..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7394_Garage Door Sol..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7393_Garage Door Sol..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7392_Dream Installat..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7391_Dream Installat..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7390_Dream Installat..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7389_Cara Luff - Car..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7383_Stewart Paul St..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7379_Lyn Wright - Ly..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7377_East Anglia Rol..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7368_Paul Kinsman - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7351_Salim Al-Khalil..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7348_Shutter Tech UK..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 7337_Trevor Dousfiel..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7335_Trevor Dousfiel..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7332_Trevor Dousfiel..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 345_Ideal Industrial..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 344_Ideal Industrial..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 338_Wokingham Glazin..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 337_Hanney Glazed Lt..> | 2025-11-11 06:20 | 16K | |
![[ ]](/icons/layout.gif) | 334_Andy Green - GRE..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 329_Ideal Industrial..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 328_Doorolla S Terry..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 326_Doorolla S Terry..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 322_A J Cope Builder..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 321_A J Cope Builder..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 318_Ideal Industrial..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 312_Doorolla S Terry..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 311_Doorolla S Terry..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 309_J Brady Garage D..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 308_J Brady Garage D..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 306_Doors 4 You Ltd ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 305_Doors 4 You Ltd ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 304_SW Trade Frames ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 302_Prime Shutters L..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 287_Hanney Glazed Lt..> | 2025-11-11 06:20 | 14K | |
![[ ]](/icons/layout.gif) | 286_Fortress_Doors A..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 285_Fortress_Doors A..> | 2025-11-11 06:20 | 15K | |
![[ ]](/icons/layout.gif) | 283_My Garage Door S..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 276_Eco Windows & Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 275_Optimum Doors Vl..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 272_P & R Door Syste..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 270_P & R Door Syste..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 269_Garage Door Solu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12908_Shutter Tech U..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12907_Shutter Tech U..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 12906_DP Installatio..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12905_Oakley Windows..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12904_Garage Door An..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 12903_Lindsey Jeavon..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12902_Lindsey Jeavon..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 12898_Verdi Home Imp..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12897_Norfolk Broads..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12896_Verdi Home Imp..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12895_WADE WINDOWS I..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12894_South Atlantic..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 12893_Mowbrey Partne..> | 2025-11-11 06:20 | 82K | |
![[ ]](/icons/layout.gif) | 12885_Fortress Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12884_Entador System..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12883_Doorflex Produ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12881_Doorflex Produ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12880_Doorflex Produ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12878_Doorflex Produ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9943_Ewan Robertson ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9940_Ewan Robertson ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9938_A Complete Wind..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 9935_J Hallam Buildi..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9548_Bart Gardener -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9545_J Brady Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9532_T D Rollerdoors..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9531_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9529_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7329_Shutter Tech UK..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 267_Garage Door Solu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12874_L G Glazing Lt..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 12872_L G Glazing Lt..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12583_Tony Dovey Ton..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9934_J Hallam Buildi..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9931_All Door Engine..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9930_Robert Bak - BA..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 9927_Replacement Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9924_My Garage Door ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9920_Robert Bak - BA..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9919_Robert Bak - BA..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9528_SW Trade Frames..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9525_Norfolk Broads ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9521_Joshua Mossop -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 9517_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9515_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9511_Go Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9510_WRM Constructio..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9501_Go Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7328_Scotia Garage D..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9494_Martin Layfield..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 9489_Mac Automation ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9488_PB Doors Paul B..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9485_Rollermatic Gar..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9474_Gilberts Home I..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9473_Rising Group Lt..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 9468_Jonathan Mills ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9467_Jonathan Mills ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 9463_Easy-Roll Camer..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9459_Rollermatic Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9457_Rollermatic Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9454_Linda Gett - GE..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9436_Taundry Doors W..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9415_J Bowman Garage..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9412_Rollerdoors 24 ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9400_Shutter Tech UK..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9386_Ben Jones - JON..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 9385_Shutter Tech UK..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9371_Tucker Glass - ..> | 2025-11-11 06:20 | 38K | |
![[ ]](/icons/layout.gif) | 9365_Elevate Doors L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9364_Windoworld Tayl..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9363_Windoworld Tayl..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9360_Windoworld Tayl..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9358_Taundry Doors W..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9357_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9356_C Marl Systems ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9355_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9348_Gary Edgar - ED..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9346_Gary Edgar - ED..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9345_Gary Edgar - ED..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9341_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9328_TH Installation..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9323_CPS Custom Prop..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9320_CPS Custom Prop..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9316_SW Trade Frames..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9313_Jean-Michel Can..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9312_Matthew Richard..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9311_Roger Fox - FOX..> | 2025-11-11 06:20 | 36K | |
![[ ]](/icons/layout.gif) | 9308_Roger Fox - FOX..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9307_Colin Sweeney -..> | 2025-11-11 06:20 | 120K | |
![[DIR]](/icons/folder.gif) | 8818_Avon Automated ..> | 2025-11-11 06:20 | - | |
![[ ]](/icons/layout.gif) | 12079_Chelmsford Rol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12077_Serenade Home ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7324_Scotia Garage D..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7323_Aspect Maintena..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7322_Aspect Maintena..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 7317_Aspect Maintena..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 7269_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7265_Michael Straker..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7263_Michael Straker..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7262_Cyril Ralphs - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7261_Cyril Ralphs - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7237_AMP Carpentry A..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7235_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7230_Go Garage Doors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7225_Roll Right Gara..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 7224_Joshua Mossop -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7215_Joshua Mossop -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7212_Roll Right Gara..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7210_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7203_Ben Lovell - LO..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7200_Eclipse Doors D..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7196_Fortress Doors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7195_Fortress Doors ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12582_L & C Bracey L..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12581_L & C Bracey L..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12577_Fortress Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12572_UK Door System..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12094_The Lothian Ga..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7399_Garage Door Sol..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7193_Warnsham Window..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 7192_SW Trade Frames..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7190_SW Trade Frames..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7180_Beaver Plastic ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7178_Beaver Plastic ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7168_T D Rollerdoors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7167_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7166_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7165_Gary Ungless - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7164_Gary Ungless - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7160_Ace Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7159_Garage Doors 24..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7158_Garage Doors 24..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7152_Open And Shut D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7139_C&M Glass Servi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7131_Garage Doors 24..> | 2025-11-11 06:20 | 15K | |
![[ ]](/icons/layout.gif) | 7130_Garage Doors 24..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7129_Garage Doors 24..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7117_Shutter Tech UK..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7113_Ace Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7112_Spa Roller Door..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7110_Garage Doors 24..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7102_[0,0] Derek Lar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7101_Bev Daniels - B..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7100_Bev Daniels - B..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7095_[0,0] Derek Lar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7090_A.S.M Windows L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7088_Maureen Bell - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12088_Rollermatic Ga..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12083_Garage Doors 2..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7087_Maureen Bell - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7083_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7081_Oakley Windows ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7054_Fortress Doors ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7046_RP Manufacturin..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7043_RP Manufacturin..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7020_Fortress Doors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7016_Doorolla Ltd S ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7013_Doorolla Ltd S ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7009_Alps Home Impro..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7007_Alps Home Impro..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6987_Doorolla Ltd S ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12062_Garage Door So..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12061_Garage Door So..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12060_Garage Door So..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6984_Doorolla Ltd S ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6977_Doorolla Ltd S ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6696_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6691_Elevate Doors L..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6667_WINDOW WIZE LTD..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 6665_WINDOW WIZE LTD..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6664_WINDOW WIZE LTD..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6630_Rollermatic Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6629_Rollermatic Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6627_Rollermatic Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6624_Andrew Newcombe..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 6622_P & R Door Syst..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6621_Andrew Newcombe..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 6619_P & R Door Syst..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6618_P & R Door Syst..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6616_Rollermatic Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6615_Rollermatic Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6613_Rollermatic Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6610_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6608_M Scott - Viney..> | 2025-11-11 06:20 | 42K | |
![[ ]](/icons/layout.gif) | 6606_NTRAP NR11 7NZ ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6604_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6601_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6600_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6597_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6590_Glenhurst Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6576_Elevate Doors L..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 12571_EcoGlaze Group..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12568_Windowcraft De..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 12566_Gillian Adams ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12565_Gillian Adams ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 12562_Eastern Frames..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12561_Barbara Baker ..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 12554_Summit Securit..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 12553_Warnsham Windo..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12552_Warnsham Windo..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12522_Andy Jarvis - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12521_Andy Jarvis - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12520_Andy Jarvis - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12512_Ian Sanderson ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12507_Ian Sanderson ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12504_Michael Jennin..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12503_Ian Sanderson ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 12474_Barbara Baker ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 12471_C&M Glass Serv..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12444_Lee Langley - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12443_Adam Thompson ..> | 2025-11-11 06:20 | 36K | |
![[ ]](/icons/layout.gif) | 12439_Paul Watkins -..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 12425_Martyn Cox - M..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12424_Martyn Cox - M..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 12422_Martyn Cox - M..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 12419_Martyn Cox - M..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12418_Martyn Cox - M..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 12059_Fortress Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12054_Paul Watkins -..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 12047_peter Heywood ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12041_Fortress Doors..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12039_Fortress Doors..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 12037_Fortress Doors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12035_Fortress Doors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12030_Fortress Doors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12028_Fortress Doors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12026_Fortress Doors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12023_G B Installati..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12022_G B Installati..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 12012_Chelmsford Rol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12011_Phillip Speakm..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12009_Phillip Speakm..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 12002_Phillip Speakm..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 11996_East Anglia Ro..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11979_Chiltern Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11517_Eastern Frames..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11515_WADE WINDOWS I..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11513_WADE WINDOWS I..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11512_Martyn Cox - M..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 11509_Martyn Cox - M..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 11508_Martyn Cox - M..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 11506_Windowcraft De..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 11504_Adam Thompson ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11503_Adam Thompson ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11502_Adam Thompson ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11500_Garage Door So..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 151_Garage Door Solu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 150_Ace Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 149_[0,0] Jason Walk..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 148_[0,0] Jason Walk..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 146_1st Shield Darre..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 145_M. A. E. Windows..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 144_Smart Doors Henr..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 142_M. A. E. Windows..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 137_Warnsham Windows..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 135_Doorolla Ltd Ste..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 134_[0,0] James Turn..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 132_John Williams - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 129_Cromer Garage Do..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 128_Cromer Garage Do..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 127_Rosie - ROSI0001..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 124_Garage Doors 247..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 123_Garage Doors 247..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 121_1st Shield Darre..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 120_Rosie - ROSI0001..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 117_1st Shield Darre..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 116_PDl Fabrications..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 115_PDl Fabrications..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 112_Harpers Door Spe..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6567_M. A. E. Window..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 346_M. A. E. Windows..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 111_[0,0] Steve Terr..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 109_Norfolk Roller D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 108_[0,0] Steve Terr..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 101_Karen Price - PR..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 99_Karen Price - PRI..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 97_Doors 4 Garages L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 95_Harpers Door Spec..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12074_UK Rollerdoors..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12073_UK Rollerdoors..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12068_The Lothian Ga..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12065_Avon Automated..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11046_Windowcraft De..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 11042_Rollermatic Ga..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6564_M. A. E. Window..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 6509_Roll Right Gara..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6470_Danbury Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6469_Go Garage Doors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6467_Go Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6466_Highlands Elect..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6465_Highlands Elect..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 6461_Highlands Elect..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6460_Highlands Elect..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 6449_Garage Doors 24..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6437_Highlands Elect..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6423_Phil Page Phil ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6418_Go Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6407_Beaver Plastic ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6405_Beaver Plastic ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6403_Danielle Milwar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6402_Garage DoorMan ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6399_Garage DoorMan ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6396_SW Trade Frames..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6393_Mark Perham Mar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6379_BBA Development..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6378_Shutter Tech UK..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 6376_All About Doors..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 6373_Beaver Soluitio..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6372_R L Roller Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6369_Houston - HOUS0..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 6367_AOS Outdoor Kit..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6361_UK Rollerdoors ..> | 2025-11-11 06:20 | 39K | |
![[ ]](/icons/layout.gif) | 11040_Rollermatic Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11038_Norfolk Broads..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9295_Automated Entry..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6388_Eclipse Doors D..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 6360_R L Roller Door..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6359_R L Roller Door..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 6355_Tobias Cripps -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 6344_Tobias Cripps -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 6014_Norfolk Broads ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6012_AMP Carpentry A..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6010_AMP Carpentry A..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6009_Nuvo Windows Pa..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 6008_Nuvo Windows Pa..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 6007_Nuvo Windows Pa..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6006_Fortress Doors ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6005_Lexicus Develop..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6004_Lexicus Develop..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6001_Lexicus Develop..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5999_AS Industrial D..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5998_AS Industrial D..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5996_East Anglia Rol..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5995_CPS Custom Prop..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5994_CPS Custom Prop..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5993_Neil Patching -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5671_Sargent & Powel..> | 2025-11-11 06:20 | 82K | |
![[ ]](/icons/layout.gif) | 5670_Go Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5669_Go Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5668_All Door Engine..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5667_Doorolla Ltd St..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5665_Doorolla Ltd St..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5664_John Cuthbertso..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5663_Doorolla Ltd St..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5662_The Lothian Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5661_Doorolla Ltd St..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5655_CWD Improvement..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5653_[0,0] Lui Field..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 5652_[0,0] Lui Field..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 12064_Charlie Sander..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8678_Doors 4 Garages..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8677_Doors 4 Garages..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8676_Doors 4 Garages..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8672_Doors 4 Garages..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8671_Custom Trade Sy..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8664_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8663_TPS Gates & Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8662_Edward Denston ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8659_Edward Denston ..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 8655_Able Garage Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8654_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8653_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5651_All About Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5648_G B Installatio..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5646_Doors 4 Garages..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5645_Doors 4 Garages..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5643_M. B. Bells Ltd..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5642_Shaun Craft - C..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5636_Antony Tilston ..> | 2025-11-11 06:20 | 122K | |
![[ ]](/icons/layout.gif) | 5632_All Door Engine..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5627_Norfolk Broads ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5619_Eastern Frames ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5608_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5595_Gordon Renfrew ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5588_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5549_Michael Mazur ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5501_J Brady Garage ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5497_S R W Services ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5494_Oakley Windows ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5493_Jim OBrien - OB..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5490_Ricky Foulgar -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5487_Hadrian Joinery..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 5485_Doors 4 Garages..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5484_Doors 4 Garages..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5482_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5481_J Bowman Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5477_Absolute Garage..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5476_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5474_Jay Dale - Jay ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5451_Shaun Craft - C..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5450_Proud 2 Fix Mat..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5445_John Easton - E..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5442_John Easton - E..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5440_Harley Lorence ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5436_Shaun Craft - C..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5433_Eclipse Doors D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5431_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5429_Rafael Fernande..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5428_Rafael Fernande..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5427_Rafael Fernande..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5423_Rafael Fernande..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5417_Paul Withers - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5415_C&M Glass Servi..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5412_C&M Glass Servi..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 5409_Christina Beame..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5408_Alps Home Impro..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5407_Alps Home Impro..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5402_Alps Home Impro..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5393_Andy Beresford ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5383_UK Rollerdoors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5382_UK Rollerdoors ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5378_Ben Lovell - LO..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5377_Ben Lovell - LO..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9293_Automated Entry..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9270_Matt Head - HEA..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9267_CPS - Custom Pr..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9266_ASSW Ltd BS10 7..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9265_Linda Gett - GE..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9264_ASSW Ltd BS10 7..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9261_Elevate Doors L..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9260_Linda Gett - GE..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9259_Doors 4 You Ltd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9255_1st Choice Secu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9254_1st Choice Secu..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9253_Neil Hudd - HUD..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9252_Nicholas Custan..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9251_UK Rollerdoors ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 5374_Ben Lovell - LO..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5372_Andy Knowles - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5367_Ryan Hawley - H..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5366_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5363_Ryan Hawley - H..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5362_Ryan Hawley - H..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5360_Harley Lorence ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5359_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5358_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5354_A J Cope Builde..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5351_A J Cope Builde..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5350_A J Cope Builde..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5348_Roger Fox - FOX..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5347_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5346_Mick Walklate W..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5345_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5335_All Door Engine..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5334_All Door Engine..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5316_Ian Lamonby - L..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5305_Avon Automated ..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 5297_Doorolla Ltd St..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5288_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5287_Fortress Doors ..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 5285_Enlightened Sol..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 5282_M. A. E. Window..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5281_Robert Vinney -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5278_M. A. E. Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5277_Enlightened Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5276_Gerald McIntyre..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5274_Gerald McIntyre..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5272_Enlightened Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5266_M. A. E. Window..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5263_M. A. E. Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5262_Andy Knowles - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5261_Fixed Abode Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5260_Fixed Abode Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5259_Rollerdoors 24 ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 5257_Rollerdoors 24 ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5252_Robert Vinney -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5251_Robert Vinney -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5237_All Aspects Con..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5236_All Aspects Con..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5233_Windowology Ltd..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 5228_Norfolk Broads ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5222_Windowology Ltd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5217_Windowology Ltd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5215_Simon Piggin Si..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5211_C&M Glass Servi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5155_Andrew Sharples..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5153_Doorolla Ltd St..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9248_UK Rollerdoors ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9247_Nicholas Custan..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 9245_1st Choice Secu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9242_1st Choice Secu..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9241_SW Trade Frames..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9235_Bart Gardener -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9234_Neil Hudd - HUD..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9231_CWD Improvement..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 9147_Adams Industria..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9144_CPS Custom Prop..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9140_Roll Right Gara..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9138_Mark Perham Mar..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9135_M. A. E. Window..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9133_Regal Windows P..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9132_Robert Curucu -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9131_M. A. E. Window..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 5193_Christina Beame..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5190_Christina Beame..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5163_Robert Vinney -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5152_Andy Beresford ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5151_T D Rollerdoors..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5149_PlumbRight Dave..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5146_Rollermatic Gar..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5134_All Doors Repai..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5132_Pioneer Doors K..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5131_Ebtech Engineer..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 11036_Rollermatic Ga..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11034_Rollermatic Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11032_Rollermatic Ga..> | 2025-11-11 06:20 | 40K | |
![[ ]](/icons/layout.gif) | 11031_The Lothian Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11030_DJB Home Impro..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11028_The Lothian Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11026_Geoff - GEOF00..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 11025_Peter Stemp - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 11024_Peter Stemp - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 11020_Secure Entranc..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11017_Michael Rogers..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 11016_Michael Rogers..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 11015_Michael Rogers..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 11013_Alan Dobson - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11012_Alan Dobson - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11009_Alan Dobson - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5160_Pioneer Doors K..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5127_The Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5124_Ross Garage Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5121_The Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5120_C&M Glass Servi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5118_B&B Electrical ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5116_Ross Garage Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5114_Carl Hayfield -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5104_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5083_Doorolla Ltd St..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5074_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5052_C&M Glass Servi..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5051_C&M Glass Servi..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5048_Norfolk Broads ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5047_Norfolk Broads ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5159_Pioneer Doors K..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5045_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5039_Craig Gulley Ha..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5038_Craig Gulley Ha..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 3660_Simon Knight - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3659_Simon Knight - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3658_Simon Knight - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3657_Simon Knight - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3649_Ace Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3648_SDS (Isle Of Ma..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3647_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 3645_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3641_Creagorry Motor..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3640_Creagorry Motor..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3639_Creagorry Motor..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3632_Nikki Sabatini ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3629_Richard Stockbr..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3625_Ace Garage Door..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 3624_Nikki Sabatini ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3620_[0,0] Mark Perh..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3619_Elevate Doors L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3618_Elaine Hurley -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3617_MJS Installatio..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3615_MJS Installatio..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3613_Oakley Windows ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3610_Simon Knight - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3607_Simon Knight - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3606_Peter Gilbery -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3605_Peter Gilbery -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3604_Peter Gilbery -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3603_[0,0] Matt Gilm..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3602_Neef Neil MacDo..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3601_Neef Neil MacDo..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3599_C & P Doors Cra..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3598_[0,0] Matt Gilm..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3597_[0,0] Custom Sy..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3594_[0,0] Matt Gilm..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3593_John Neale - NE..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3592_[0,0] Steve Ter..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3591_Warsash Windows..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3590_J Brady Garage ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 3588_C&M Glass Servi..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 3585_Jakub Samp - SA..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3582_J Brady Garage ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3581_[0,0] Steve Ter..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3580_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3575_[0,0] Steve Ter..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3574_J Brady Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 3570_Windoworld Tayl..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3567_[0,0] Steve Ter..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3565_[0,0] Nicola Ha..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3562_[0,0] Jason Wal..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 2846_[0,0] DP Insta..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2845_All Door Engine..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2844_[0,0] Restaric..> | 2025-11-11 06:20 | 38K | |
![[ ]](/icons/layout.gif) | 2843_Gigg Singh - SI..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2842_Gigg Singh - SI..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2841_Fixed Abode Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2840_[0,0] Victoria ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2839_Elevate Doors L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2838_Matt Smith - Jo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2835_P & R Door Syst..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2819_[0,0] Nicola Ha..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2816_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2813_[0,0] Craig Mar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2812_Richard Stockbr..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2811_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2809_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2807_Doors 4 You. Pa..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2806_[0,0] Peter Bot..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2804_Garage Door Rep..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2803_Doors 4 You. Pa..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2801_C&M Glass Servi..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2799_J Brady Garage ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2796_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2795_The Lothian Gar..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 2793_[0,0] Steve Ben..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 2791_James Howard - ..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 2790_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2789_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2788_Matt Smith - Jo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2787_[0,0] Steve Ben..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 2786_[0,0] Martin Ta..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 2784_[0,0] Martin Ta..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 2782_Elevate Doors L..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 2779_[0,0] SW Trade..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2775_Ideal Industria..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2186_Eclipse Doors D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2185_[0,0] Thompson..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2184_[0,0] Wayne Gil..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2182_Mick Maye - MAY..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2181_Mick Maye - MAY..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2178_Mick Maye - MAY..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2177_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2175_Rhino Windows A..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2173_[0,0] Mike Brow..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2172_Maureen Bell - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2171_All Doors Repai..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2166_Jon Taylor - ....> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2162_Barker - BARK00..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2158_[0,0] Jason Wal..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2157_Martin Meechan ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2153_Lewis Davison -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2149_Lewis Davison -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2145_Kenneth Rowley ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2144_Kenneth Rowley ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2134_[0,0] Chelmsfo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2133_[0,0] Peter Bot..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2132_[0,0] Steve Ter..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2130_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2129_[0,0] Peter Bot..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2128_Guy Hubbard Dou..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2127_Palms Construct..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 13430_Eclipse Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13429_Darren Thompso..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 8021_Fortress Doors ..> | 2025-11-11 06:20 | 15K | |
![[ ]](/icons/layout.gif) | 8020_Martin Snell - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8019_Gilberts Home I..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8017_Roll Right Gara..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8015_Go Garage Doors..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8012_J Brady Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8010_Fixed Abode Gar..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 8008_M. B. Bells Ltd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8005_Cromer Garage D..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8002_Cromer Garage D..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7998_J Brady Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7997_Oakley Windows ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7990_Ace Garage Door..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7981_Heavy Metal Eng..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2772_Hanney Glazed L..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2768_Nick Garlick - ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2126_Palms Construct..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2123_Palms Construct..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2122_[0,0] Neil Pric..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 2109_Timothy Noakes ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2108_Timothy Noakes ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2104_Timothy Noakes ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2102_Lionel Mewton -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2101_Lionel Mewton -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7968_Taundry Doors W..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7966_J Brady Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7964_LT Carpentry Le..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7961_LT Carpentry Le..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7959_Taundry Doors W..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7954_Millcourt Prope..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7941_Elevate Doors L..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7933_Ross Garage Doo..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7929_Ross Garage Doo..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7925_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7924_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7918_Garage Door Rep..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7917_Garage Door Rep..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7916_P & R Door Syst..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7914_Garage Door Rep..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7912_Ian Smith - SMI..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7910_Ricky Foulgar -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7909_Ross Garage Doo..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7907_Wellingborough ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7906_Harley Lorence ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7903_Ross Garage Doo..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9127_Cromer Garage D..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9125_P & R Door Syst..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9121_SW Trade Frames..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9117_Rising Group Lt..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 8927_Paul Busby Paul..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 8925_My Garage Door ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 8922_My Garage Door ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8920_EcoGlaze Group ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8919_EcoGlaze Group ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 8917_EcoGlaze Group ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8906_WINDOW WIZE LTD..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8902_EcoGlaze Group ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8901_EcoGlaze Group ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8898_Andrew Newcombe..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8896_B&B Electrical ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8895_B&B Electrical ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8880_M. A. E. Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8874_M. A. E. Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8867_Dream Installat..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8860_C&M Glass Servi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8857_C&M Glass Servi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8849_Paul Busby Paul..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8848_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8847_Paul Busby Paul..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 8841_Paul Busby Paul..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8839_Avon Automated ..> | 2025-11-11 06:20 | 86K | |
![[ ]](/icons/layout.gif) | 8835_JDL Plumbing Jo..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8833_JDL Plumbing Jo..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8827_Prorenovate Ian..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8826_Prorenovate Ian..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 7901_Enlightened Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7900_Gerald McIntyre..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7892_Paul Busby Paul..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7891_Paul Busby Paul..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7887_Smart Doors Hen..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7883_DPS Building Se..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7882_DPS Building Se..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7876_AM Shutters Ste..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7875_AM Shutters Ste..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 7874_AM Shutters Ste..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 7873_Ace Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7871_AM Shutters Ste..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7870_1st Shield Darr..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 7869_Michael Mazur M..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7868_Michael Mazur M..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7867_Colin Sweeney -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7866_Michael Mazur M..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 7863_Colin Sweeney -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7862_Colin Sweeney -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7860_Heavy Metal Eng..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7859_Ffenestri Amlwc..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7858_Eastern Frames ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 7857_Do Not Use 1 Ma..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7856_Do Not Use 1 Ma..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7855_NW Automatic Do..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7854_NW Automatic Do..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8823_Ross Garage Doo..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8822_Ross Garage Doo..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8817_Roger Fox - FOX..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8811_Wellingborough ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8810_Wellingborough ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 8809_Wellingborough ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8794_Doorolla Ltd S ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8786_Elevate Doors L..> | 2025-11-11 06:20 | 17K | |
![[ ]](/icons/layout.gif) | 8783_Fortress Doors ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8781_J Brady Garage ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8779_Do Not Use Jame..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8774_J Brady Garage ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8773_J Brady Garage ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8770_J Brady Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8769_J Brady Garage ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8748_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8743_Avon Automated ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8739_AM Shutters Ste..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8719_Regal Windows P..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8717_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8705_Ideal Industria..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8701_Ray Woodruff - ..> | 2025-11-11 06:20 | 36K | |
![[ ]](/icons/layout.gif) | 8698_1st Shield Darr..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8696_P & R Door Syst..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8694_Joshua Mossop -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 8692_Geoff Holloway ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8690_Jurassic Doors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8688_Fixed Abode Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8685_Fixed Abode Gar..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8679_Norfolk Broads ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6316_Shutter Tech UK..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6315_East Anglia Rol..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6292_Shutter Tech UK..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6287_M Scott - Viney..> | 2025-11-11 06:20 | 42K | |
![[ ]](/icons/layout.gif) | 6280_M Scott - Geoff..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6243_1st Shield Darr..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6239_Elevate Doors L..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 6232_Elevate Doors L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6225_M Scott - Glenn..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6221_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6220_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6216_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6215_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6214_M Scott - Geoff..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6209_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6207_M Scott - Tom +..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6203_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6201_M Scott - Viney..> | 2025-11-11 06:20 | 41K | |
![[ ]](/icons/layout.gif) | 6200_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6197_M Scott - Pete ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6196_J Brady Garage ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6194_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6188_Rhino Windows A..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6161_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6157_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6154_Highlands Elect..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6148_Midland Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6142_Midland Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6141_Mark Perham Mar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6139_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6138_B&B Electrical ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8649_AOS Outdoor Kit..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8646_Jian Ming - MIN..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 6136_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6134_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6133_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6132_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6126_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6123_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6114_Warnsham Window..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6108_All About Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6101_East Anglia Rol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6097_Stephen Haygart..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 6096_B&B Electrical ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6094_Stephen Haygart..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 6090_Highlands Elect..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6087_David Mann - Ex..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 6082_Sam Pitchford -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 6076_Jon Taylor - ....> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 6070_Elaine Hurley -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 6065_J Brady Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6062_[0,0] Dean Bark..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6057_Antony Tilston ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 6056_Antony Tilston ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 6047_Custom Trade Sy..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6038_Affordable Lock..> | 2025-11-11 06:20 | 38K | |
![[ ]](/icons/layout.gif) | 6028_Trevor Dousfiel..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 6025_Michael Mazur M..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6021_[0,0] Dean Bark..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6020_Antony Tilston ..> | 2025-11-11 06:20 | 122K | |
![[ ]](/icons/layout.gif) | 8636_Cerromar Soluti..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8635_Heavy Metal Eng..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8627_Cerromar Soluti..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8611_Cerromar Soluti..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8604_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8603_TND Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8602_TND Garage Door..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8594_TH Installation..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8577_Matthew Richard..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8576_Matthew Richard..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 8572_Chiltern Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8571_Robert Curucu -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8570_Robert Curucu -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 8568_CWD Improvement..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 8567_J Brady Garage ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8566_Norfolk Broads ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8565_AOS Outdoor Kit..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8563_Custom Trade Sy..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8562_Custom Trade Sy..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8560_Custom Trade Sy..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6975_Protect Install..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11908_C&M Glass Serv..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10824_Alan Pattison ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10823_Alan Pattison ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8554_Go Garage Doors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8550_Heavy Metal Eng..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8546_Doors 4 You Ltd..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8545_Doors 4 You Ltd..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8542_C&M Glass Servi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8537_Tru-Fit Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8506_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8501_Dream Installat..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 8500_Dream Installat..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 8497_Highlands Elect..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8496_Highlands Elect..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8478_Mark Perham Mar..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 8437_Wellingborough ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8435_Wellingborough ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8433_Damien Lobb - L..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 8432_Secure Entrance..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8421_Michael Mazur M..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 8419_Michael Mazur M..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8403_Damien Lobb - L..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8400_NW Automatic Do..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8398_NW Automatic Do..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 8397_Pete McKeown In..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8396_James King - DE..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8394_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8391_Admiral Home Im..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8386_D Thurston Buil..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8384_D Thurston Buil..> | 2025-11-11 06:20 | 14K | |
![[ ]](/icons/layout.gif) | 8381_D Thurston Buil..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8380_D Thurston Buil..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8377_Ideal Industria..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8375_Ideal Industria..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8373_Metcalfe - METC..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8372_Metcalfe - METC..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8368_CWG Home Improv..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8365_Joe Round - ROU..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8364_Joe Round - ROU..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 8358_Kev Taylor - TA..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8355_Kev Taylor - TA..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5680_East Anglia Rol..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2656_Andrew Hodges -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2655_Ideal Industria..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2654_Andrew Hodges -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2650_Elegant Windows..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2649_[0,0] Peter Bot..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 2648_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2603_SDS (Isle Of Ma..> | 2025-11-11 06:20 | 16K | |
![[ ]](/icons/layout.gif) | 2597_Javeed Sandia -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2100_Lionel Mewton -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2057_[0,0] James Wal..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2055_[0,0] James Wal..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 90_Chelmsford Roller..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 89_Harpers Door Spec..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 82_[0,0] Jason Peaco..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 81_J Brady Garage Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 80_Harpers Door Spec..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 74_A Stackhouse Wind..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12870_Norfolk Roller..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12863_J Bowman Garag..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12861_Glenhurst Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12856_CRS Maintenanc..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12855_CRS Maintenanc..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12849_peter Heywood ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4415_Ace Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4412_[0,0] Jason Wal..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2596_Javeed Sandia -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2594_SDS (Isle Of Ma..> | 2025-11-11 06:20 | 14K | |
![[ ]](/icons/layout.gif) | 2582_UK Door Systems..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2580_Mark Riggal Ele..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2575_Mark Riggal Ele..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2574_Rhino Windows A..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2571_Mark Riggal Ele..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2567_[0,0] Nathan Wa..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 2553_Elegant Windows..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2552_M. A. E. Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2550_Windowcraft Des..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2549_Absolute Garage..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2547_Replacement Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2546_Replacement Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2545_Nikki Sabatini ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2544_Nikki Sabatini ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2543_Nikki Sabatini ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2542_Neil Plumridge ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2541_Neil Plumridge ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2540_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2539_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2534_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2533_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2531_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2530_[0,0] Steve Ter..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2529_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2528_[0,0] Steve Ter..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 2527_David Price - P..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2526_David Price - P..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2525_Scotia Garage D..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2518_Andrew Stibbs -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2517_Andrew Stibbs -..> | 2025-11-11 06:20 | 45K | |
![[ ]](/icons/layout.gif) | 2514_3 Brothers Buil..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2512_3 Brothers Buil..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2510_Replacement Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2507_Gigg Singh - SI..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2504_[0,0] Michael L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2501_[0,0] John Fowl..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2492_Absolute Garage..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2491_Garage Door Sol..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2481_The Lothian Gar..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 2480_Scotia Garage D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2479_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2476_Ivan McDermott ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2475_The Lothian Gar..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 2474_Ivan McDermott ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2472_Atul Malkar - M..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2470_Academy Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2469_Jon Taylor - ....> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2467_Mel Bexley - BE..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 2418_David Punt - PU..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 2406_Simon Dobson - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2405_Simon Dobson - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12842_M. A. E. Windo..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12841_RBC Electrical..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12834_Elevate Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12832_Mowbrey Partne..> | 2025-11-11 06:20 | 50K | |
![[ ]](/icons/layout.gif) | 12829_Chelmsford Rol..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 12827_M. A. E. Windo..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12825_M. A. E. Windo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12824_Hobbs - Straps..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12823_Hobbs - Straps..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12822_Hobbs - Straps..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12821_Hobbs - Straps..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12812_Doorolla Ltd S..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12805_Tony Dovey Ton..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12802_Gillian Adams ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12801_Chelmsford Rol..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12800_Chelmsford Rol..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12788_Scotia Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12787_T D Rollerdoor..> | 2025-11-11 06:20 | 15K | |
![[ ]](/icons/layout.gif) | 12786_T D Rollerdoor..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12783_MJS Installati..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12782_MJS Installati..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12779_Rollermatic Ga..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12777_Scotia Garage ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12775_Rollermatic Ga..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12772_The Lothian Ga..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 12770_The Lothian Ga..> | 2025-11-11 06:20 | 48K | |
![[IMG]](/icons/image2.gif) | 155321-IMG_5815.jpeg | 2025-11-11 06:20 | 2.2M | |
![[ ]](/icons/layout.gif) | 12768_Ecosse Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12767_Ecosse Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12765_Ken Ingram - I..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 12764_Eclipse Doors ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12762_David Bracken ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 12761_Gillian Adams ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12758_Price NG34 7RQ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 12757_G A K Developm..> | 2025-11-11 06:20 | 22K | |
![[ ]](/icons/layout.gif) | 12741_Eclipse Doors ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12740_Eclipse Doors ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12738_Rollermatic Ga..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12736_Rollermatic Ga..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 12734_Rollermatic Ga..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12732_Colin Barrow -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 12729_Rollermatic Ga..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12725_Replacement Ga..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12723_Regal Windows ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12721_Drinkwater - D..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 12720_Gareth Shepher..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 12714_Scotia Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12706_C&M Glass Serv..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12704_Mr McArthur - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12699_Adam Thompson ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12691_Rollermatic Ga..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12686_Catherine Evan..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12683_Catherine Evan..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12682_Robert Bak - B..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12659_Hanney Glazed ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12641_Jamie Goodman ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12625_L G Glazing Lt..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12614_Garage Door An..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 12606_Bradley Hine-R..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10998_Rollermatic Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10996_Peter Stemp - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10995_Harrogate Home..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10993_Harrogate Home..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10989_Harrogate Home..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 10985_Elevate Doors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10984_Elevate Doors ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10982_Garage Door So..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10981_Garage Door So..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 10979_Garage Door So..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10978_Garage Door So..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 10976_Lewis - LEWI00..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10975_Lewis - LEWI00..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 10920_J Brady Garage..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10908_Ace Garage Doo..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 10906_Ace Garage Doo..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 10888_Ross Garage Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10869_Winspear - WIN..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10868_Peter Harper -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10860_Ross Garage Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10859_Phil Page Phil..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10858_Kevin Grosveno..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10857_Kevin Grosveno..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10855_Phil Page Phil..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10841_Will Baxter - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10840_Will Baxter - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10839_Will Baxter - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10833_Ashley Fieldho..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10832_Ashley Fieldho..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10831_Ashley Fieldho..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10825_Alan Pattison ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5037_Craig Gulley Ha..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 5027_Academy Windows..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 5010_Mark Shaw - SHA..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5006_Mark Shaw - SHA..> | 2025-11-11 06:20 | 122K | |
![[ ]](/icons/layout.gif) | 5005_Mark Shaw - SHA..> | 2025-11-11 06:20 | 122K | |
![[ ]](/icons/layout.gif) | 4999_Stephen Haygart..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4993_Adrian Michael ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4990_PlumbRight Dave..> | 2025-11-11 06:20 | 122K | |
![[ ]](/icons/layout.gif) | 4985_Adrian Michael ..> | 2025-11-11 06:20 | 122K | |
![[ ]](/icons/layout.gif) | 4979_Sam Pitchford -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4976_Sam Pitchford -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4969_Elliott Mills -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4968_PlumbRight Dave..> | 2025-11-11 06:20 | 123K | |
![[ ]](/icons/layout.gif) | 4962_Ralph English -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4960_Ralph English -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4949_Ray Clarke - CL..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4948_Ray Clarke - CL..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 4944_AM Shutters Mo..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4943_Elevate Doors L..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4940_Warnsham Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4936_Ebtech Engineer..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4935_[0,0] James Tur..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 6971_David Ball - BA..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5971_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4934_[0,0] James Tur..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4921_Ecosse Garage D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4919_Birchley Homes ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4917_Simon Barker - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4914_Carl Hayfield -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4912_All Door Engine..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2767_James Howard - ..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 2766_Custom Trade Sy..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2765_James Howard - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2756_Trevor Rolfe - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2755_Trevor Rolfe - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2751_Michael Mazur ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2749_[0,0] Jason Wal..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2748_Michael Mazur ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2736_[0,0] Wayne Gil..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2735_[0,0] James Wal..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2734_David Punt - PU..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2720_[0,0] Future Ke..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2719_[0,0] Future Ke..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2718_Elevate Doors L..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 2717_Tru-Fit Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2716_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2715_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2713_Rollermatic Gar..> | 2025-11-11 06:20 | 9.9K | |
![[ ]](/icons/layout.gif) | 2711_Ideal Industria..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2710_Ideal Industria..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2707_MJS Installatio..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2706_Zest Properties..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2704_[0,0] Will Purs..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2049_Dilwyn Morgan -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2046_Mick Moy Tyres ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2045_Mick Moy Tyres ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2041_[0,0] Paul Birk..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 2040_[0,0] Paul Birk..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2039_[0,0] Paul Birk..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 2035_[0,0] Marjan Ma..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2017_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1976_[0,0] Jason Wal..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1972_Nathan Edmondso..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1971_Jeffrey Everitt..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1970_Jeffrey Everitt..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1966_Replacement Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1964_Norfolk Roller ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1963_Replacement Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1959_Replacement Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1958_Nathan Edmondso..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1956_Mel Bexley - BE..> | 2025-11-11 06:20 | 45K | |
![[ ]](/icons/layout.gif) | 1951_Gordon Knight -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1950_Eclipse Doors D..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1945_[0,0] Wayne Gil..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1940_David Jenkinson..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1936_Drinkwater - DR..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1929_Windowcraft Des..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1928_M. A. E. Window..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1926_M. A. E. Window..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1923_Windowcraft Des..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8641_TPS Gates & Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2700_MJS Installatio..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2698_Drinkwater - DR..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2697_Andrew Hodges -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2693_Andrew Hodges -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2690_[0,0] Wayne Gil..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2682_PB Doors Paul B..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2678_Javeed Sandia -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2674_Javeed Sandia -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2673_SDS (Isle Of Ma..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2672_Richard Hoyle -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2671_Richard Hoyle -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2667_Richard Hoyle -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2664_Elegant Windows..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2662_Elegant Windows..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2661_Elegant Windows..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1338_Jon .. - ..JO00..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1337_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1336_1st 4 Outdoorso..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1335_[0,0] Travis Ad..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1334_Elegant Windows..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1333_ASM Windows Ada..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1332_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1331_Dave Edwards - ..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 1330_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1328_Cromer Garage D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1326_[0,0] Cammack ..> | 2025-11-11 06:20 | 52K | |
![[ ]](/icons/layout.gif) | 1323_Dilwyn Morgan -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1322_Easy-Roll Camer..> | 2025-11-11 06:20 | 38K | |
![[ ]](/icons/layout.gif) | 1321_Sam Eaton - EAT..> | 2025-11-11 06:20 | 20K | |
![[ ]](/icons/layout.gif) | 1318_[0,0] Richard H..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1315_[0,0] James Tur..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1314_Fixed Abode Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6342_Tobias Cripps -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 6335_T D Rollerdoors..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 5679_All Door Engine..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5678_East Anglia Rol..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4411_PlumbRight Dave..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4408_Garage Doors No..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4402_SDL Door Repair..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4401_SDL Door Repair..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4399_Elevate Doors L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4396_Stephen Fairbro..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4391_Stephen McDermo..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4390_Ralph English -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3560_William Radford..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3555_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3554_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3550_East Anglia Rol..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3549_Carl Carnell - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3548_[0,0] Lui Field..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3538_Carl Carnell - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3529_MJS Installatio..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3522_James Wall - WA..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3521_Simon Absalom -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3520_James Wall - WA..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3511_Suddon - SUDD00..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3508_Suddon - SUDD00..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3496_[0,0] Allan Ste..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3484_Jakub Samp - SA..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3483_MJS Installatio..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3480_Jakub Samp - SA..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3275_S R W Services ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3272_Palms Construct..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3271_Palms Construct..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3270_Palms Construct..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 3265_Nikki Sabatini ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1306_[0,0] Steve Pac..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1301_[0,0] Ryan Mell..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1298_G A K Developme..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1295_Imir Sela - SEL..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1284_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1283_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1279_David Price - P..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1278_[0,0] Wayne Gil..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1276_Bobby Wright - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1272_Aj Trade Aj Tr..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1271_[0,0] AJ Trade..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1265_Fortress_Doors ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1263_Imir Sela - SEL..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1257_Wayne Bingley -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1254_UK Rollerdoors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1253_Lewis - LEWI000..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1252_AAES Electrical..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1244_[0,0] Ranie Day..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1243_[0,0] Ranie Day..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1242_Guy Hubbard Dou..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3262_Nick Garlick - ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 3261_Nick Garlick - ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3260_Nick Garlick - ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3250_Ideal Industria..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3245_Deri Evans - EV..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3242_James Macmorlan..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3239_[0,0] Nicola Ha..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 3235_Daniel Jackson ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3234_Daniel Jackson ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3233_Daniel Jackson ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3225_M. A. E. Window..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 3222_M. A. E. Window..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3221_[0,0] Mike Brow..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3219_John Neale - NE..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3213_John Neale - NE..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3199_[0,0] Dean Bark..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3196_Rhino Windows A..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3195_Rhino Windows A..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3185_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3183_Highlands Elect..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7173_WADE WINDOWS IP..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5970_Stephen Fairbro..> | 2025-11-11 06:20 | 122K | |
![[ ]](/icons/layout.gif) | 5969_Go Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5968_Doorolla Ltd St..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5961_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8024_Martin Snell - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2657_Elegant Windows..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 1237_NBC Commercial ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1236_[0,0] Maximum ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1234_Doorolla Steve ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1233_Wellingborough ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1232_Elevate Doors L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 266_Wellinborough Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 264_Wellinborough Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 263_Optimum Doors Vl..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 262_TJS Maintenance ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 261_Eco Windows & Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 260_Eco Windows & Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 252_Garage Door Solu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 251_Garage Door Solu..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 248_Regal Windows Lu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 247_Regal Windows Lu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 244_Hanney Glazed Lt..> | 2025-11-11 06:20 | 14K | |
![[ ]](/icons/layout.gif) | 240_Eco Windows & Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 234_Ace Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 233_Ace Garage Doors..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 224_The Lothian Gara..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 223_Andy Devine - DE..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 212_Avon Automated G..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 211_C&M Glass Servic..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 207_3 Counties (Sand..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 205_C & P Doors Crai..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 204_C & P Doors Crai..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11483_Julian Dick - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 11477_Rhino Windows ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10819_James Wilde - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10434_Rolltex Hutter..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10433_Oliver Pilgers..> | 2025-11-11 06:20 | 123K | |
![[ ]](/icons/layout.gif) | 10431_Wanstall Ltd. ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10430_Ace Garage Doo..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5960_Go Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3561_William Radford..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 198_Doors 4 You Ltd ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 193_Hanney Glazed Lt..> | 2025-11-11 06:20 | 14K | |
![[ ]](/icons/layout.gif) | 184_NW Automatic Doo..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 181_[0,0] Reid - RE..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 180_[0,0] Reid - RE..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 163_M. A. E. Windows..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 162_M. A. E. Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10429_Oliver Pilgers..> | 2025-11-11 06:20 | 122K | |
![[ ]](/icons/layout.gif) | 10428_Barbara Ebanks..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10427_NW Automatic D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10426_J Brady Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10419_JM Doors Jon B..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9903_Derek Wright - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9902_Derek Wright - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9901_Derek Wright - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9873_Andrew Boylett ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 9129_M. A. E. Window..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8638_J Brady Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5992_Neil Patching -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5161_Robert Vinney -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 559_Ian Prior - PRIO..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 558_Ian Prior - PRIO..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 557_Stuart Challinor..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 556_Stuart Challinor..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 555_Reid - REID0001 ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 92_Chelmsford Roller..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 554_Ian Smith - SMIT..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 553_Garry Parkes - P..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 552_Sean Hemens - HE..> | 2025-11-11 06:20 | 45K | |
![[ ]](/icons/layout.gif) | 550_Spa Roller Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 549_John Williams - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 548_A Stackhouse Win..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 547_Fix My Garage Do..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 546_Clifford Lowdell..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 535_Garage Door Repa..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 534_Garage Door Repa..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 533_Garage Door Repa..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 532_Roll Right Garag..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 528_Access Door Serv..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 527_Access Door Serv..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 526_SDS (Isle Of Man..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 525_SDS (Isle Of Man..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 524_SDS (Isle Of Man..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 522_Hanney Glazed Lt..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 521_Hanney Glazed Lt..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 519_Northants Garage..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 518_Northants Garage..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 516_M & S Home Insta..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 514_Roll Right Garag..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 512_Roll Right Garag..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 510_Roll Right Garag..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 509_Protect Installa..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 498_Roll Right Garag..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 490_Roll Right Garag..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 485_AM Shutters Mot..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 484_Eclipse Doors Di..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 481_Fortress_Doors A..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 479_Fortress_Doors A..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 477_Rhino Windows An..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 474_Rhino Windows An..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 473_Elevate Doors Lt..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 470_Replacement Gara..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 467_Garage Door Solu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 466_Garage Door Solu..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 463_Garage Door Solu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 462_Doors 4 You. Pau..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 460_Doors 4 You. Pau..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 458_Lidget Compton L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 456_Doors 4 You. Pau..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 455_Doors 4 You. Pau..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 454_Ideal Home Solut..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 8323_Phillip Holland..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8320_Phillip Holland..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8303_Swift Doors Ltd..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8301_Eclipse Doors D..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8298_Dad Property Ma..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 8297_Dad Property Ma..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 8296_Dad Property Ma..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8291_My Garage Door ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8281_NW Automatic Do..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8276_NW Automatic Do..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 8267_Ray Woodruff - ..> | 2025-11-11 06:20 | 36K | |
![[ ]](/icons/layout.gif) | 8264_Ray Woodruff - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 8260_1st Shield Darr..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8250_Mark Budden - B..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8234_Simon Yeomans -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8233_Admiral Home Im..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8220_Trevor Thirwell..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 8213_J Brady Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8211_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8210_J Brady Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8207_Garage Door Rep..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 8202_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8196_P & R Door Syst..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 453_Harpers Door Spe..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 452_Tru-Fit Windows ..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 451_C&M Glass Servic..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 450_C&M Glass Servic..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 448_Protect Installa..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 447_WINDOW WIZE LTD ..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 445_All About Doors...> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 428_Garage Door Solu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 411_JS Home Improvem..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 406_Fixed Abode Gara..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 405_Fortress_Doors A..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 371_UK Rollerdoors D..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 352_Fortress_Doors A..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 351_Southern Conserv..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11904_Colin Adams Wi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8189_Go Garage Doors..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 8186_Wall Garage Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8185_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8183_Go Garage Doors..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 8181_LT Carpentry Le..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 8174_Ace Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8173_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8170_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8166_Oakley Windows ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 8165_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8164_Rhino Windows A..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8163_Ian Sanderson E..> | 2025-11-11 06:20 | 86K | |
![[ ]](/icons/layout.gif) | 8162_Mark Garrod - M..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 8161_Mark Garrod - M..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8154_Dave Cordell Da..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 8149_Shutter Tech UK..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8144_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8141_Beaver Plastic ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8138_Ace Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8137_BRISTOL GARAGE ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8136_Garage Door Sol..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8133_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8130_Garage Door Sol..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8129_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8128_All About Doors..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 8125_Shutter Tech UK..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8120_1st Shield Darr..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8119_James Dean - DE..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8118_Jordan Shepphar..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 8116_Jordan Shepphar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8115_James Dean - DE..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8114_RP Manufacturin..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 8112_RP Manufacturin..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8110_Ray Woodruff - ..> | 2025-11-11 06:20 | 36K | |
![[ ]](/icons/layout.gif) | 13426_Lewis Ward - W..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 13425_Lewis Ward - W..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 13416_Darren Thompso..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 13414_Darren Thompso..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 13410_TPS Gates & Do..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 13396_Nathanael Cicc..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 13391_Barker - Marty..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13372_LNR Door Solut..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13364_Rhino Windows ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 13362_Eastern Frames..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13361_Eastern Frames..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13360_Warnsham Windo..> | 2025-11-11 06:20 | 14K | |
![[ ]](/icons/layout.gif) | 13333_Fortress Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13332_Fortress Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13331_Fortress Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13330_Catherine Evan..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 13327_John Cuthberts..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 13323_John Cuthberts..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8108_Ray Woodruff - ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8106_M Scott - Glenn..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8105_A Complete Wind..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 8087_AM Shutters Ste..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8075_Ideal Industria..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13319_Go Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13318_Roll Right Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 13316_Go Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13315_MCR Building M..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13314_Andrew Morgan ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 13311_Bradley Hine-R..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 13310_Doorolla Ltd S..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 13309_The Lothian Ga..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 13307_The Lothian Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 13297_Omnia Build & ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 13228_Doors 4 You Lt..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13225_Verdi Home Imp..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13206_Mowbrey Partne..> | 2025-11-11 06:20 | 50K | |
![[ ]](/icons/layout.gif) | 13203_Mowbrey Partne..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 13202_Rhino Windows ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13200_NTRAP NR11 7NZ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 13199_NTRAP NR11 7NZ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 13191_Norfolk Broads..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 13170_East Anglia Ro..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13166_Norfolk Roller..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13151_Catherine Evan..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 13150_Zest Propertie..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 13134_Zest Propertie..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 13132_Nuvo Windows P..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 13131_Nuvo Windows P..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 13128_Nuvo Windows P..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 13122_Tru-Fit Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 13121_C&M Glass Serv..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 13118_C&M Glass Serv..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 13117_C&M Glass Serv..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 13103_Island Home Im..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 13096_Windowcraft De..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 13094_Windowcraft De..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 13038_TH Installatio..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12961_TH Installatio..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12938_Mark Warner - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 12937_Mark Warner - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12936_Mark Warner - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 12935_Eclipse Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12934_Eclipse Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12931_Charlie Dune-A..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 12930_Charlie Dune-A..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12929_Elevate Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12921_Barbara Baker ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 12914_Rhino Windows ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12913_Bradley Hine-R..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3174_Cooper - COOP00..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3173_Cooper - COOP00..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3171_Suddon - SUDD00..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3168_Suddon - SUDD00..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3167_Suddon - SUDD00..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3163_Elevate Doors L..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 3161_Vincent Cross -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3160_Simon Absalom -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3159_Simon Absalom -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3157_Cooper - COOP00..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3156_1st Shield Darr..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3153_Highlands Elect..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3151_Elevate Doors L..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 3144_Carl Carnell - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3143_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3142_Carl Carnell - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3132_[0,0] Nicola Ha..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3130_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3119_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3111_Roy Roynting - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3110_Roy Roynting - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3103_Roy Roynting - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3101_Whewell - WHEW0..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3093_[0,0] Paul Stew..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3091_[0,0] Beasley ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3090_Doors 4 Garages..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3089_Doors 4 Garages..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 3087_Ecosse Garage D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3086_[0,0] Nigel Ter..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3085_[0,0] Nigel Ter..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3079_Prime Shutters ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3075_[0,0] S Terry -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3074_Jon Taylor - ....> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3073_1st Choice Secu..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7852_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7851_Sean Hemens - H..> | 2025-11-11 06:20 | 45K | |
![[ ]](/icons/layout.gif) | 7850_Nuvo Windows Pa..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 7818_A J Cope Builde..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7812_Harpers Door Sp..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 3072_1st Choice Secu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3070_1st Choice Secu..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 3038_Secured Door & ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3035_Mark Riggal Ele..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3033_Windoworld Tayl..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3025_[0,0] James Tur..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3024_[0,0] James Tur..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3022_Daniel Jackson ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3019_[0,0] WINDOWORL..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3018_Daniel Jackson ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3010_Secured Door & ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3005_Andrew Hodges -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2972_Goldhill Glazin..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2956_Highlands Elect..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2954_[0,0] Victoria ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2953_[0,0] Nicola Ha..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 2947_[0,0] Nicola Ha..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2946_[0,0] Steve Ben..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 2943_David Read - Dw..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2939_David Read - Dw..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2925_Prime Shutters ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2920_James Howard - ..> | 2025-11-11 06:20 | 45K | |
![[ ]](/icons/layout.gif) | 2881_Nick Garlick - ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 2872_Rollermatic Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2870_Eco Windows & D..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2869_Eco Windows & D..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2865_Rollermatic Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2861_Daniel Jackson ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2860_Eco Windows & D..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2858_Eco Windows & D..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7808_Warnsham Window..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7807_Elevate Doors L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7800_Karen Price - P..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7791_Karen Price - P..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7785_Jurassic Doors ..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7784_Doors 4 Garages..> | 2025-11-11 06:20 | 15K | |
![[ ]](/icons/layout.gif) | 7781_Doors 4 Garages..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7778_Jurassic Doors ..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7776_Gilberts Home I..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7775_Gilberts Home I..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7774_Gilberts Home I..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7773_Gilberts Home I..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7770_Gilberts Home I..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7768_Avon Automated ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7767_Rollermatic Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7766_Taundry Doors W..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7765_Roll Right Gara..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7763_Roll Right Gara..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7762_Roll Right Gara..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7761_Lidget Compton ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7760_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7758_C&M Glass Servi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7757_CWD Improvement..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7753_Jean-Michel Can..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7752_Jean-Michel Can..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7746_Beaver Plastic ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7745_Ian Callagham I..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7744_Beaver Plastic ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7739_Ian Callagham I..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 7737_Doors 4 Garages..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7713_SDL Door Repair..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 7708_SDL Door Repair..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7706_Michael Straker..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7705_Michael Straker..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 7702_SW Trade Frames..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7696_SDL Door Repair..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 7694_Proud 2 Fix Mat..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7693_Wellingborough ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7692_NBC Commercial ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7691_NBC Commercial ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7690_TJS Maintenance..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 7689_JWK Electrical ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7688_Hanney Glazed L..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7686_Tilehurst Home ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7672_TPS Gates & Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7669_Wellingborough ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 7666_Nigel Ealand - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7662_Ross Garage Doo..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7661_Do Not Use Jame..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7660_J Brady Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7659_Cromer Garage D..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7658_Cromer Garage D..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7656_Do Not Use Jame..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7655_J Brady Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7654_C&M Glass Servi..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 7653_J Brady Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7651_J Brady Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2404_Simon Dobson - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2386_Sara Morris - M..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2385_Sara Morris - M..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2384_Sara Morris - M..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2378_Michael Selby -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2377_Michael Selby -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2376_Michael Selby -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2370_Leo Cordingley ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2369_Leo Cordingley ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1909_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1908_Academy Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1907_Gordon Knight -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1906_Gordon Knight -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1903_[0,0] Levart -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1900_[0,0] Levart -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1893_HARRISON - HARR..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1864_M. A. E. Window..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1861_M. A. E. Window..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1857_MJS Installatio..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 1856_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1854_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1851_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1843_[0,0] Restaric..> | 2025-11-11 06:20 | 38K | |
![[ ]](/icons/layout.gif) | 1830_Sarah Calderban..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1829_Sarah Calderban..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1828_Sarah Calderban..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1820_Paul Withers - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1819_David Dawson - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1818_David Dawson - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1817_David Dawson - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1812_Graham Packham ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1811_Graham Packham ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1810_Graham Packham ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1806_Thomas Fitzgera..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1805_Thomas Fitzgera..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1804_Thomas Fitzgera..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1798_[0,0] Paul Birk..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1793_[0,0] Avon Aut..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 1792_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1791_Ace Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1790_Elegant Windows..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1789_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1788_[0,0] Dean Bark..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1783_[0,0] Thomas Ne..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1782_Chelmsford Roll..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 1778_Jon .. - ..JO00..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1772_Michael Rogers ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1684_[0,0] Dayil Ran..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 1682_Four Counties D..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 1681_Four Counties D..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1680_Four Counties D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1675_AMK Gatwick - A..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1674_Prime Shutters ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1671_Anton Mirosnits..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1670_Palms Construct..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1668_Wilkins - WILK0..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1664_MJS Installatio..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1663_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1662_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1661_C&M Glass Servi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1660_AM Shutters Ste..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11903_Greg Bearsley ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11888_L & C Bracey L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11871_L & C Bracey L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11869_ASSW Ltd ASSW..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 11868_L & C Bracey L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11866_Garage Doors 2..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11865_ASSW Ltd BS10 ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11848_Scotia Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11843_Scotia Garage ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11841_Scotia Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11832_Windowcraft De..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11826_Ian Davies - D..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 11804_Gerrard Collin..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11803_Gerrard Collin..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11801_UK Door System..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11795_Gerrard Collin..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11791_Pete Metcalfe ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11789_Pete Metcalfe ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11787_Garage DoorMan..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11786_Garage DoorMan..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11783_Garage DoorMan..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11776_Island Home Im..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11774_Brenda Bussey ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11773_Brenda Bussey ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11771_Brenda Bussey ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11768_Replacement Ga..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11766_Brenda Bussey ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11752_Replacement Ga..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11733_Kevin Grosveno..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 11729_Replacement Ga..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11722_Gilberts Home ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11720_Gilberts Home ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11718_Avon Automated..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11717_Tech HQ Dean B..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1658_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1657_[0,0] Serenade..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1654_[0,0] Dayil Ran..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 11716_Daniel Jackson..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 11706_Doorolla Ltd S..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11701_Doorolla Ltd S..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11691_Elevate Doors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11689_Hanney Glazed ..> | 2025-11-11 06:20 | 14K | |
![[ ]](/icons/layout.gif) | 11685_C&M Glass Serv..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11683_Replacement Ga..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11674_Warnsham Windo..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11668_Gilberts Home ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11663_Replacement Ga..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11660_Highlands Elec..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11654_Replacement Ga..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11653_Eastern Frames..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11652_Rollermatic Ga..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11651_Rollermatic Ga..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11650_Rollermatic Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11648_Rollermatic Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11579_Doors 4 Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11542_CPS Custom Pro..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11539_CPS Custom Pro..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11536_EZ2OWN Ltd Pau..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11533_Myers Garage D..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11532_Myers Garage D..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11528_CPS Custom Pro..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11527_J Brady Garage..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11525_J Brady Garage..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11523_J Brady Garage..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11521_Guy Hubbard Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11520_Home secure so..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11519_SDL Door Repai..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11475_Colin Hartgrov..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11468_Tilehurst Home..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11466_Rhino Windows ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11463_Oakley Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11462_Mclaren - Serv..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11458_Oakley Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11457_Oakley Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11456_D H Gates and ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11410_Julian Dick - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 11394_Wellingborough..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11388_Garage Door So..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11387_Chelmsford Rol..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 11380_Garage Door So..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11370_J Brady Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11367_J Brady Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11365_RBC Electrical..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11274_Oakley Windows..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 11259_Doorolla Ltd S..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11246_EcoGlaze Group..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11238_Wall Garage Do..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11229_Ross Garage Do..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11223_Ross Garage Do..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11215_Oakley Windows..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11208_M. A. E. Windo..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11204_Myers Garage D..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11192_Warnsham Windo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11181_Rhino Windows ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11180_Rhino Windows ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11173_The Lothian Ga..> | 2025-11-11 06:20 | 14K | |
![[ ]](/icons/layout.gif) | 11161_The Lothian Ga..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11159_The Lothian Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11153_Jonathan Mills..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 11150_Kevin Slater -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11149_Kevin Slater -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11146_Kevin Slater -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11144_M. A. E. Windo..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11142_M. A. E. Windo..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 11141_Martyn Cox - M..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 11140_Martyn Cox - M..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 11124_C&M Glass Serv..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 11123_C&M Glass Serv..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11118_IBuild Mark In..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 11117_IBuild Mark In..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 11111_Barbara Ebanks..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 11107_Barbara Ebanks..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 11095_T D Rollerdoor..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 11094_Ace Garage Doo..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11092_TPS Gates & Do..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11084_TPS Gates & Do..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11073_Absolute Garag..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 11071_Fixed Abode Ga..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11068_Colin Adams Wi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11067_ThermoGreen Lt..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11065_Absolute Garag..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11063_Absolute Garag..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11060_Glen McNulty -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11059_J Brady Garage..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11057_J Brady Garage..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11055_J Brady Garage..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11051_RDM Engineerin..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 11050_RDM Engineerin..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 11048_T D Rollerdoor..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9116_Warnsham Window..> | 2025-11-11 06:20 | 14K | |
![[ ]](/icons/layout.gif) | 9108_Joshua Mossop -..> | 2025-11-11 06:20 | 117K | |
![[ ]](/icons/layout.gif) | 9107_Rising Group Lt..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 9106_Jack Scrivens -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9104_Jack Scrivens -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9078_Matt Head - HEA..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9076_Matt Head - HEA..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 9042_The Lothian Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9041_The Lothian Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9035_Elevate Doors L..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 9033_Elevate Doors L..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 9029_Elevate Doors L..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 9027_Elevate Doors L..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 9025_Elevate Doors L..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 9023_Elevate Doors L..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 9020_Elevate Doors L..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9018_Elevate Doors L..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9014_Elevate Doors L..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9011_Elevate Doors L..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9002_Elevate Doors L..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9000_Elevate Doors L..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8998_WJM Cars Willia..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8997_WJM Cars Willia..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 8993_Avon Automated ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8991_Dream Installat..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 8989_Stewart Paul St..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8986_Bart Gardener -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 8980_Bart Bart Garde..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 8975_Doorolla Ltd St..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 8967_ThermoGreen Ltd..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 8960_Warnsham Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10818_East Anglia Ro..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10817_East Anglia Ro..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10815_James Irons - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 10812_Absolute Garag..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10811_Absolute Garag..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10809_James Wilde - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10808_James Wilde - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 10805_James Wilde - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10804_James Wilde - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10802_Matthew Armita..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10801_Matthew Armita..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10800_Matthew Armita..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10795_Brian Hooper -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10794_Brian Hooper -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10793_Brian Hooper -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8945_Mark Budden - B..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10773_James Anderson..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10772_James Anderson..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10771_James Anderson..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10753_Damien Lobb - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10751_T D Rollerdoor..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10734_Windowcraft De..> | 2025-11-11 06:20 | 86K | |
![[ ]](/icons/layout.gif) | 10709_RDM Engineerin..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10703_Matt Head - HE..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 10702_Matt Head - HE..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10701_Matt Head - HE..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10693_Ross Garage Do..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10679_Lee Langley - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10678_Fixed Abode Ga..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10657_3 Brothers Bui..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10654_Ian Davies - D..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10648_AS Industrial ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10647_Izzed Izet - I..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10638_Kevin Credland..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10637_Kevin Credland..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10636_Kevin Credland..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10629_Ian Davies - D..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10625_Kenneth Jones ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10624_Kenneth Jones ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10621_Kenneth Jones ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10535_Izzed Izet - I..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10522_Oliver Pilgers..> | 2025-11-11 06:20 | 123K | |
![[ ]](/icons/layout.gif) | 10519_Rollermatic Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10517_Harpers Door S..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10516_Oliver Pilgers..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 10511_Oliver Pilgers..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10510_James Irons - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10502_Oliver Pilgers..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10491_Chelmsford Rol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10482_Chelmsford Rol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10471_J Bowman Garag..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10470_Chelmsford Rol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10459_Doorolla Ltd S..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10455_EcoGlaze Group..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10454_Fortress Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10452_Barbara Ebanks..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 10451_Barbara Ebanks..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 10448_Fortress Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10447_Ian Sanderson ..> | 2025-11-11 06:20 | 86K | |
![[ ]](/icons/layout.gif) | 10445_Knowles Brothe..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 10442_Knowles Brothe..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10441_Windowcraft De..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10440_Warnsham Windo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10437_Garage Door So..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10436_Wellingborough..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1767_C&M Glass Servi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1763_Craig Skinner -..> | 2025-11-11 06:20 | 45K | |
![[ ]](/icons/layout.gif) | 1762_Craig Skinner -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 1750_Glen Layfield -..> | 2025-11-11 06:20 | 122K | |
![[ ]](/icons/layout.gif) | 1749_Glen Layfield -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 1495_[0,0] AJ Trade..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 1490_NBC Commercial ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1487_NBC Commercial ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1483_St Helens Upvc ..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 1480_St Helens Upvc ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1478_Swift Doors Ltd..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 1475_M. A. E. Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1474_[0,0] Dean Bark..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 1473_[0,0] Travis Ad..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1472_Michael Rogers ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1471_Tru-Fit Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1470_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1469_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1468_The Lothian Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1467_Edmund Walaszek..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1466_Nathan Edmondso..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1465_[0,0] Steve Ter..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1464_Tru-Fit Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1462_The Lothian Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1461_William White -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1459_AM Shutters Ste..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 1458_[0,0] D B Reno..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1456_SS Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1453_Regal Windows L..> | 2025-11-11 06:20 | 52K | |
![[ ]](/icons/layout.gif) | 1451_[0,0] Dean Bark..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 1449_Paul Withers - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1448_[0,0] Ryan Mell..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1446_David Ball - BA..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1445_David Ball - BA..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1442_[0,0] Dean Bark..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1441_[0,0] Beasley ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1440_Craig Skinner -..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 1435_[0,0] SDL Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1429_Aj Trade Aj Tr..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 1425_G A K Developme..> | 2025-11-11 06:20 | 22K | |
![[ ]](/icons/layout.gif) | 1418_Swift Doors Ltd..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1417_Rollermatic Gar..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 1414_Doorolla S Terr..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1409_Arron Locke - L..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1408_Swift Doors Ltd..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1405_Dream Installat..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1402_Prime Shutters ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1400_[0,0] R Higgs -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1389_[0,0] Dean Bark..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1386_Fixed Abode Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1384_3 Counties (San..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1383_Dream Installat..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1382_Ezi-Dor Ltd Tra..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1381_The Lothian Gar..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 1380_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1379_Oakley Windows ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1378_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1376_Andrew Stibbs -..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 1341_Robert Coutts -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1340_SDS (Isle Of Ma..> | 2025-11-11 06:20 | 39K | |
![[ ]](/icons/layout.gif) | 1339_[0,0] Rob Smith..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4389_Ralph English -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4387_Simeon Lloyd - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4386_Simeon Lloyd - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4378_Simeon Lloyd - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4377_Ray Bailey - BA..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4376_Ray Bailey - BA..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4373_Mary Eim - EIMM..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4372_Mary Eim - EIMM..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4357_C&M Glass Servi..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 4354_C&M Glass Servi..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 4351_Lockdown Doors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4348_Simon Barker - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4347_Simon Barker - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4345_Bespoke UPVC Wi..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4342_Bespoke UPVC Wi..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4338_Lockdown Doors ..> | 2025-11-11 06:20 | 15K | |
![[ ]](/icons/layout.gif) | 4332_Eclipse Doors D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4331_R Chambers - R ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4327_Adrian Michael ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4308_James Webster -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4303_David Heckford ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4300_David Heckford ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4294_David Heckford ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4287_David Jenkinson..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4278_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4253_PlumbRight Dave..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4245_Rollerdoors 24 ..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 4234_Garage Doors No..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4230_Garage Doors No..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4229_Garage Doors No..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4226_Garage Doors No..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4224_Rollerdoors 24 ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4223_Richard Moore -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4220_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4219_John Sheppard -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4218_Kaz Suleman - S..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4213_[0,0] Jason Wal..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 4212_[0,0] Jason Wal..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4211_Elaine Hurley -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4210_Elaine Hurley -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4187_[0,0] Avon Aut..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4186_[0,0] Avon Aut..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4185_Richard Stockbr..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 4169_Fresh Frames Ry..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 4166_Ace Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4165_Fresh Frames Ry..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 4158_Anton Mirosnits..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4157_Anton Mirosnits..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4150_Swift Doors Ltd..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4148_Evans & Fry Ltd..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 4145_Tru-Fit Windows..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4143_[0,0] Beasley ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4140_Evans & Fry Ltd..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 4139_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4126_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4119_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4115_Windowcraft Des..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4112_[0,0] Jason Wal..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4094_The Lothian Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4093_The Lothian Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4079_[0,0] James Bow..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4077_[0,0] James Bow..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4074_East Anglia Rol..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4072_East Anglia Rol..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4071_Andy Green - GR..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4070_Andy Green - GR..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4069_[0,0] Nicola Ha..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4066_East Anglia Rol..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4051_Tom Cliffen - T..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4048_Ian Sanderson E..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4028_Rollermatic Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4027_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4025_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4017_Rollermatic Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3986_Bijan Fouladfga..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 3981_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3980_M. A. E. Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3978_[0,0] Beasley ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3977_Evans & Fry Ltd..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3976_Evans & Fry Ltd..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 3974_[0,0] Beasley ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3969_Chris Pearce - ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3968_Fresh Frames Ry..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3965_Fresh Frames Ry..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3964_Fresh Frames Ry..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3959_Paul Withers - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3958_Paul Withers - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3956_Paul Withers - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3955_Oakley Windows ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3953_PB Doors Paul B..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 3951_Leonard Harriso..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3948_Leonard Harriso..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3946_Leonard Harriso..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3931_Evans & Fry Ltd..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 73_A Stackhouse Wind..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3929_Paul Withers - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3928_Paul Withers - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3910_PB Doors Paul B..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3894_Jody Baxter - B..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3892_Jody Baxter - B..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3887_Jody Baxter - B..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 3843_James Newton - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3842_James Newton - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3841_Eastern Frames ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3836_[0,0] Chelmsfo..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 3835_[0,0] Wayne Gil..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3834_[0,0] Dave Bran..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3833_PB Doors Paul B..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3814_Cerromar Soluti..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3813_Cerromar Soluti..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3810_Ken Ingram - IN..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3809_Cerromar Soluti..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3804_Kaz Suleman - S..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3803_Kaz Suleman - S..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3802_Kaz Suleman - S..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3799_Mark Shaw - SHA..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3793_M Lewis - LEWI0..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3788_M Lewis - LEWI0..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 3780_[0,0] Peter Urq..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3776_Mary Eim - EIMM..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3775_Stephen Fairbro..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3774_Stephen Fairbro..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3773_Stephen Fairbro..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3771_Cerromar Soluti..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3770_Stephen McDermo..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3769_Eclipse Doors D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3669_[0,0] Steve Ter..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 67_[0,0] Jason Walke..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 63_Cash Sale Cash Sa..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 60_Clifford Lowdell ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 53_Fix My Garage Doo..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 9715_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9651_Hanney Glazed L..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 9639_C & M Glass Chr..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 9048_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7797_Boombastic Door..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7700_Blobby Garage D..> | 2025-11-11 06:20 | 111K | |
![[ ]](/icons/layout.gif) | 7695_Blaster Garage ..> | 2025-11-11 06:20 | 111K | |
![[ ]](/icons/layout.gif) | 7694_The Lothian Gar..> | 2025-11-11 06:20 | 112K | |
![[ ]](/icons/layout.gif) | 7693_The Lothian Gar..> | 2025-11-11 06:20 | 86K | |
![[ ]](/icons/layout.gif) | 7692_The Lothian Gar..> | 2025-11-11 06:20 | 112K | |
![[ ]](/icons/layout.gif) | 7691_Boombastic Door..> | 2025-11-11 06:20 | 86K | |
![[ ]](/icons/layout.gif) | 3768_Henry Attree - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1746_Simon Wood - WO..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1745_Simon Wood - WO..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 1652_[0,0] Fletcher ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1651_[0,0] Fletcher ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1647_[0,0] Fletcher ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 1645_Ian Ross Ross -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 1644_Ian Ross Ross -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1641_Ian Ross Ross -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1638_[0,0] Wayne Gil..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1637_Regal Windows L..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1632_[0,0] ASSW Ltd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1630_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 1364_Regal Windows L..> | 2025-11-11 06:20 | 52K | |
![[ ]](/icons/layout.gif) | 1358_[0,0] Martin Ch..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1357_[0,0] Martin Ch..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1352_[0,0] Beasley ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1038_Doors 4 Garages..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1037_Doors 4 Garages..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1033_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 349_Southern Conserv..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 348_All Doors Repair..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 52_Fix My Garage Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 48_Clifford Lowdell ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 42_Clifford Lowdell ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 41_Clifford Lowdell ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 1629_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1626_Absolute Garage..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 1625_[0,0] Banniste..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1624_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1623_Absolute Garage..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 1622_Absolute Garage..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 1617_AM Shutters Ste..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1613_ASM Windows Ada..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 1612_M. A. E. Window..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1608_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1607_UK Rollerdoors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1606_Elevate Doors L..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 1605_[0,0] James Wal..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1603_Kelvin Bolton -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1599_CPS - Custom Pr..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1596_AM Shutters Ste..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1593_Proud 2 Fix Mat..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1591_John Barker - J..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1588_[0,0] Rob Smith..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1587_[0,0] Turners ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1585_Edmund Walaszek..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1577_David Page - PA..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1576_David Page - PA..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1570_Dawn Watson - D..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 1569_ASSW Ltd ASSW ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1568_Fortress_Doors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1567_Fortress_Doors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1566_Fortress_Doors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1565_Replacement Gar..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1562_Tru-Fit Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1559_Dave Edwards - ..> | 2025-11-11 06:20 | 36K | |
![[ ]](/icons/layout.gif) | 1554_Avon Automated ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1553_Avon Automated ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1552_[0,0] Mark Perh..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1551_[0,0] Mark Perh..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1548_Paul Strachan -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1547_Paul Strachan -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1546_Nathan Hayes - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1545_Nathan Hayes - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2368_Leo Cordingley ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2364_Garage Door Sol..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2363_Samuel Hockaday..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2362_Samuel Hockaday..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2358_Samuel Hockaday..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2357_Samuel Hockaday..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2356_Samuel Hockaday..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2355_Steve Marriott ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2352_Steve Marriott ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2350_Windowcraft Des..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2349_Windowcraft Des..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2348_Windowcraft Des..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2347_[0,0] James Tur..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2346_[0,0] James Tur..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2341_[0,0] Nathan Wa..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2338_MR Mosin - MOSI..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2336_Barclay - BARC0..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2304_David Goodhew -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2303_David Goodhew -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2297_[0,0] Nathan Wa..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2291_[0,0] Nathan Wa..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2288_SW Trade Frames..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1744_[0,0] Laura R J..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1740_J Bowman Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1738_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1727_Antony Rowe - R..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1725_Antony Rowe - R..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 1721_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1709_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1708_Gordon Knight -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1707_Gordon Knight -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 1704_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1540_Avon Automated ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1538_[0,0] D B Reno..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1534_[0,0] D B Reno..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1514_[0,0] Jason Wal..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1504_Secured Door & ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2287_[0,0] Andrew Ho..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 2286_[0,0] Andrew Ho..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 2285_[0,0] Andrew Ho..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2283_Deri Evans - EV..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2282_Deri Evans - EV..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2278_Deri Evans - EV..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2274_Ideal Industria..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2273_Ideal Industria..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2272_Ideal Industria..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 2269_Ideal Industria..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2264_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2263_Nigel Bramley -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2260_Nigel Bramley -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2257_Nigel Bramley -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2255_James Macmorlan..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2252_James Macmorlan..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2251_James Macmorlan..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2249_Academy Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2248_Russell White -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2245_Russell White -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2243_Academy Windows..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2240_Robert Cox - CO..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2239_Robert Cox - CO..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 2237_Tahmid Kamal - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2236_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 2233_Tahmid Kamal - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2232_C&M Glass Servi..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 2230_C&M Glass Servi..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 2226_Tahmid Kamal - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2224_Gareth Shepherd..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2223_Greg Brett - BR..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2222_Absolute Garage..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 2220_Absolute Garage..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 2219_David Bracken -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2218_David Bracken -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2214_David Bracken -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3476_[0,0] James Bow..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 3471_[0,0] James Bow..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3470_Vincent Cross -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3467_Vincent Cross -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3465_[0,0] Victoria ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3463_[0,0] Iain Hair..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3460_[0,0] Iain Hair..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3458_M.Adams Martin ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3457_Anton Mirosnits..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3456_Anton Mirosnits..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3449_Anton Mirosnits..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3447_Anton Mirosnits..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3445_All Door Engine..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3434_Richard Stockbr..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3433_[0,0] Wayne Gil..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3432_Replacement Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3424_[0,0] Wayne Gil..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3422_Ken Ingram - IN..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3417_[0,0] Peter Urq..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3416_[0,0] Peter Urq..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3407_[0,0] Chelmsfo..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3406_WINDOW WIZE LTD..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3403_Mark Prevost - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3401_Mark Prevost - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3399_Gareth Shepherd..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3379_Gareth Shepherd..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3375_William Radford..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3374_William Radford..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 3369_William Radford..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3349_Gareth Shepherd..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3347_Gareth Shepherd..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3342_[0,0] Victoria ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3340_[0,0] Derek Lar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3334_[0,0] Dave Bran..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 3329_Doors 4 Garages..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 2209_Greg Brett - BR..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 2205_Greg Brett - BR..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 2203_Greg Brett - BR..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2198_Neil Plumridge ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 2197_Neil Plumridge ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3767_Henry Attree - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3762_Simeon Lloyd - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3760_UK Rollerdoors ..> | 2025-11-11 06:20 | 38K | |
![[ ]](/icons/layout.gif) | 3758_Daniel Jackson ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3738_Ken Ingram - IN..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3737_Ken Ingram - IN..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 3732_Richard Stockbr..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3720_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3714_Ideal Industria..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3709_Elevate Doors L..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 3708_Elevate Doors L..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 3326_Richard Stockbr..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 3323_Richard Stockbr..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3318_C&M Glass Servi..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3315_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3309_[0,0] Chelmsfo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3302_Highlands Elect..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3301_Michael Mazur ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 3289_[0,0] Nicola Ha..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 3288_[0,0] Nicola Ha..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 3280_TH Installation..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 3278_TH Installation..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3277_[0,0] Nicola Ha..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 3276_Sargent & Powel..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9872_Eclipse Doors D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9868_M. A. E. Window..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9866_Andrew Boylett ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9865_Andrew Boylett ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9863_M. A. E. Window..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9853_M. A. E. Window..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9849_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9847_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9840_M. A. E. Window..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 5988_Neil Patching -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3699_Gareth Shepherd..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 3675_Highlands Elect..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 3671_Anton Mirosnits..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9839_M. A. E. Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9831_Admiral Home Im..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9826_Fortress Doors ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9818_Fortress Doors ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9806_Roll Right Gara..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9805_Roll Right Gara..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9803_Roll Right Gara..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9802_Serenade Home I..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9801_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9800_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9799_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9798_Tony Saunders -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9797_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9796_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9795_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9794_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9793_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9792_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9791_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9790_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9789_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9788_Elevate Doors L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9773_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9771_Fortress Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9765_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9760_M. A. E. Window..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9757_M. A. E. Window..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9743_Hobbs - Straps ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12416_Martyn Cox - M..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 12412_Barbara Ebanks..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12402_Izzed Izet - I..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12398_L & C Bracey L..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12380_RDM Engineerin..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12377_RDM Engineerin..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12363_Absolute Garag..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12362_Peter Figg - H..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9742_Hobbs - Straps ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9735_Hobbs - Straps ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9733_Hobbs - Straps ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 9725_Secure Entrance..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9724_Rhino Windows A..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9722_Chiltern Doors ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9720_Ecosse Garage D..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 9718_Ecosse Garage D..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 9716_G A K Developme..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 9714_Roll Right Gara..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9704_M Scott - Glenn..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9702_MnK Windows Ke..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9700_MnK Windows Ke..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9696_Roll Right Gara..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9695_Roll Right Gara..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9676_Copper Jax Jami..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 9670_Copper Jax Jami..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 9666_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9663_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9652_Marcus Akid - G..> | 2025-11-11 06:20 | 38K | |
![[ ]](/icons/layout.gif) | 9629_TH Installation..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9626_TH Installation..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9623_T D Rollerdoors..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9620_T D Rollerdoors..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 9600_Harrold Knight ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 9582_Replacement Gar..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 9565_Chelmsford Roll..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12360_Peter Figg - H..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12354_Absolute Garag..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12350_Absolute Garag..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12310_PB Doors Paul ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12289_MM Doors Micha..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12288_MM Doors Micha..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12284_Anvile Enginee..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12279_Anvile Enginee..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12274_Anvile Enginee..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12264_Chelmsford Rol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12248_Tech HQ Dean B..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 12247_Tech HQ Dean B..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 12246_Tech HQ Dean B..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12242_Paul Cooper - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12239_Marcus Akid - ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12238_Marcus Akid - ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12234_Avon Automated..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12231_Avon Automated..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12226_Ideal Industri..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12225_Garage Door So..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12222_S R W Services..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12221_S R W Services..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12217_D J Furness Co..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12210_C&M Glass Serv..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12209_Nigel Bramley ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 12208_James Howard -..> | 2025-11-11 06:20 | 45K | |
![[ ]](/icons/layout.gif) | 12207_Garage Door Re..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12205_Custom Trade S..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12200_Eastern Frames..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12198_Eastern Frames..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12196_Eastern Frames..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12194_Eastern Frames..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12191_All Door Engin..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12190_Phil Page Phil..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 12188_All Door Engin..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12186_All Door Engin..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12184_Highgrove Cons..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 12183_Shutter Tech U..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 12181_Shutter Tech U..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12179_Shutter Tech U..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12173_Shutter Tech U..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 12158_J Brady Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12156_Danbury Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12154_Danbury Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12152_Avon Automated..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12150_Avon Automated..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12148_Avon Automated..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12146_Avon Automated..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12143_Avon Automated..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 12141_Go Garage Door..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 12139_Go Garage Door..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 12134_Colin Barrow -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 12133_Colin Barrow -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 12113_D J Furness Co..> | 2025-11-11 06:20 | 14K | |
![[ ]](/icons/layout.gif) | 12103_Adams Industri..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 12097_PDL Fabricatio..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1230_Ross Garage Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1228_B - B0000001 - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1225_Alan Davis - DA..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1222_B - B0000001 - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1221_Alan Davis - DA..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1220_Ross Garage Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1216_All Door Engine..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1213_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1212_[0,0] Andrew Wa..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1211_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1205_David Price - P..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1203_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1202_The Lothian Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1201_The Lothian Gar..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1199_1st Shield Darr..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1194_J Bowman Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1193_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1192_AM Shutters Ste..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1191_Richard Hoyle -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1180_Roz Taylor - TA..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 1176_James Wall - WA..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1175_[0,0] James Wal..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1164_ASM Windows Ada..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1156_Secured Door & ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1155_Secured Door & ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1152_Ideal Industria..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1145_Ideal Industria..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1136_G A K Developme..> | 2025-11-11 06:20 | 52K | |
![[ ]](/icons/layout.gif) | 1127_Chargepoint Ins..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1123_[0,0] Burgess ..> | 2025-11-11 06:20 | 51K | |
![[ ]](/icons/layout.gif) | 1118_Rollermatic Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1116_John Nicholson ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1113_East Anglia Rol..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1112_Swift Doors Ltd..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1111_Andy Knight - K..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1110_Proud 2 Fix Mat..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1109_J Bowman Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1108_Jurassic Doors ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1107_Craig Skinner -..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 1106_Rhino Windows A..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1104_Gilberts Home I..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1102_Elevate Doors L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1101_Doors 4 Garages..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1100_Leo Cordingley ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1099_Leo Cordingley ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1095_Herts & Essex G..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1093_Herts & Essex G..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1090_John Nicholson ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1089_Access Door Ser..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1088_Access Door Ser..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1085_NBC Commercial ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1082_NBC Commercial ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1080_AAES Electrical..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 1078_AAES Electrical..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1076_Replacement Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1075_Oakley Windows ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1066_Oakley Windows ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1065_Adrian Jackson ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1060_Alex Hope - HOP..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 1056_Access Door Ser..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1053_Fortress_Doors ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1050_Scotia Garage D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1043_B - B0000001 - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 1039_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 805_Doors 4 Garages ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 803_Doors 4 Garages ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 802_Doors 4 Garages ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 801_NW Automatic Doo..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 800_Hanney Glazed Lt..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 799_Hanney Glazed Lt..> | 2025-11-11 06:20 | 10K | |
![[ ]](/icons/layout.gif) | 798_Hanney Glazed Lt..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 797_NW Automatic Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 796_NW Automatic Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 795_CPS - Custom Pro..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 783_Oakley Windows L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 782_Craig Heard - HE..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 781_Gallagher Mainte..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 780_Gallagher Mainte..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 779_Gallagher Mainte..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 777_Replacement Gara..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 776_Fortress_Doors A..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 775_JP Hills James H..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 774_M & S Home Insta..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 769_Fortress_Doors A..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 768_Fortress_Doors A..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 759_Garage Door Repa..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 757_Regal Windows Lu..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 756_East Anglia Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 753_Chargepoint Inst..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 752_Chargepoint Inst..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 750_C&M Glass Servic..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 745_Jan - JAN00001 -..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 744_Clifford Lowdell..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 743_JP Hills James H..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 742_P & R Door Syste..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 741_ASM Windows Adam..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 738_Heavy Metal Engi..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 736_J Brady Garage D..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 732_JP Hills James H..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 731_BH Electrical Se..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 730_BH Electrical Se..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 729_Custom Trade Sys..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 725_JD Cars Ltd Jero..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 720_C&M Glass Servic..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 719_Heather Foster -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 718_Heather Foster -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 712_Heather Foster -..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 709_Andy Green - GRE..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 708_Andy Green - GRE..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 707_Andy Green - GRE..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 706_C&M Glass Servic..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 701_J Brady Garage D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 697_J Brady Garage D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 696_J Brady Garage D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 690_J Brady Garage D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 689_Nature's Design ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 687_Ross Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 686_Ross Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 685_Ross Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 684_CRS Maintenance ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 683_Rollermatic Gara..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 682_Neil McDonald - ..> | 2025-11-11 06:20 | 45K | |
![[ ]](/icons/layout.gif) | 679_Neil McDonald - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 678_Elevate Doors Lt..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 677_Adrian Jackson -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 676_Greig Matthewson..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 674_Bob Ewins - EWIN..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 673_Fortress_Doors A..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 672_Pardeep Chahal -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 668_Neil Ward - WARD..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 663_David Kirby - KI..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 659_Gary Reynolds - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 658_East Anglia Roll..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 657_East Anglia Roll..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 654_Oakley Windows L..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 653_Oakley Windows L..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 648_Stuart Lorimer -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 647_[0,0] Stuart Lor..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 646_Fortress_Doors A..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 644_Fortress_Doors A..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 643_Flavio Arruda - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 642_Northants Garage..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 638_NW Automatic Doo..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 637_Ezi-Dor Ltd Trac..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 634_East Anglia Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 633_Ian Smith - SMIT..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 629_Ian Smith - SMIT..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 627_Pardeep Chahal -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 625_Neil McDonald - ..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 624_Doors 4 Garages ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 623_Neil McDonald - ..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 622_Doors 4 Garages ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 621_Wanstall Ltd. De..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 620_Harpers Door Spe..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 619_Wanstall Ltd. De..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 618_East Anglia Roll..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 617_East Anglia Roll..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 616_M & S Home Insta..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 615_Roll Right Garag..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 614_Roll Right Garag..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 613_Roll Right Garag..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 612_Roll Right Garag..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 611_Rhino Windows An..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 610_Rhino Windows An..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 609_Garage Door Solu..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 608_Josh MacDonald -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 607_Chelmsford Rolle..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 606_Josh MacDonald -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 605_John Williams - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 604_Chargepoint Inst..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 601_Adam Jenkins - J..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 600_Adam Jenkins - J..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 599_Adam Jenkins - J..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 8521_T D Rollerdoors..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7628_Blaster Garage ..> | 2025-11-11 06:20 | 111K | |
![[ ]](/icons/layout.gif) | 7625_Blaster Garage ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 7619_Boombastic Door..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 7618_Fortress Doors ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7617_Fortress Doors ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 7616_Fortress Doors ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 597_Kris Glenwright ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 596_Kris Glenwright ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 595_Kris Glenwright ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 594_Gary Pont - PONT..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 593_Gary Pont - PONT..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 592_Gary Pont - PONT..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 591_Trevor Gibson - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 590_Trevor Gibson - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 589_Trevor Gibson - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 586_Barry Powell - P..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 585_Barry Powell - P..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 584_Garage DoorMan M..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 583_Garage DoorMan M..> | 2025-11-11 06:20 | 15K | |
![[ ]](/icons/layout.gif) | 582_Avon Automated G..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 581_Wyon Ltd Giles D..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 580_Steve Broughton ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 577_Absolute Garage ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 576_Absolute Garage ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 574_Julie Noble - NO..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 573_Julie Noble - NO..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 572_Eclipse Doors Di..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 570_Steve Watts - WA..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 569_Steve Watts - WA..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 567_Steve Watts - WA..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 565_Aidan Murphy - M..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 564_Aidan Murphy - M..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 563_Aidan Murphy - M..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 562_Steve Hubbard - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 561_Steve Hubbard - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 560_Steve Hubbard - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10417_Avon Automated..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10413_NW Automatic D..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10410_NW Automatic D..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10409_EcoGlaze Group..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10407_Knowles Brothe..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 10404_Knowles Brothe..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10402_Oliver Pilgers..> | 2025-11-11 06:20 | 122K | |
![[ ]](/icons/layout.gif) | 10399_Matthew Richar..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10398_Paul Watkins -..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 10395_Mark Budden - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 10392_Mark Budden - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10385_Fortress Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10384_J Bowman Garag..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10379_J Bowman Garag..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10377_Ross Garage Do..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10373_The Lothian Ga..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10371_The Lothian Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10344_Oakley Windows..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 10342_J Brady Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10340_Eclipse Doors ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10336_Replacement Ga..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10332_Replacement Ga..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10330_Replacement Ga..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10328_Replacement Ga..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10326_Replacement Ga..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10319_Robert Bak - B..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 10316_Robert Bak - B..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10310_Robert Bak - B..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10294_Hughes House &..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10293_Hughes House &..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10290_Hughes House &..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10288_Adams Industri..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10285_Avon Automated..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10271_Doorolla Ltd S..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10265_Doorolla Ltd S..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 7548_Terry Pratchet ..> | 2025-11-11 06:20 | 111K | |
![[ ]](/icons/layout.gif) | 7547_Terry Pratchet ..> | 2025-11-11 06:20 | 111K | |
![[ ]](/icons/layout.gif) | 7546_Terry Pratchet ..> | 2025-11-11 06:20 | 111K | |
![[ ]](/icons/layout.gif) | 1351_Oakley Windows ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1348_AAES Electrical..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10262_UK Rollerdoors..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10260_UK Rollerdoors..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10258_Doorolla Ltd S..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10253_Carol Izatt - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10252_Carol Izatt - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10249_Carol Izatt - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10246_All Door Engin..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10242_Paul Harman - ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10241_Paul Harman - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10236_Paul Harman - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 10205_1st Choice Sec..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10196_PB Doors Paul ..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 10168_Bart Gardener ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10151_Jonathan Mills..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10150_Mark Budden - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 10145_Rollermatic Ga..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10143_Avon Automated..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 10135_Mark Budden - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 10122_Ecosse Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10119_Ecosse Garage ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 10117_Ecosse Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 10114_Ecosse Garage ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 10054_WADE WINDOWS I..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10052_WADE WINDOWS I..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10039_Damien Lobb - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 10034_Damien Lobb - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 10014_Tru-Fit Windo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 10011_Tru-Fit Windo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 9999_Robert Coutts -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4894_PGD Doors Ltd S..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 4886_[0,0] Steve Ter..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4885_[0,0] Steve Ter..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4868_C & P Doors Cra..> | 2025-11-11 06:20 | 86K | |
![[ ]](/icons/layout.gif) | 4854_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4845_L G Glazing Ltd..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 4832_Dan O'Brien - O..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 4822_Ace Garage Door..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 4814_David Heckford ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4811_David Heckford ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4801_Bijan Fouladfga..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 4799_[0,0] James Tur..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4798_[0,0] James Tur..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4791_Ace Garage Door..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 4776_PB Doors Paul B..> | 2025-11-11 06:20 | 79K | |
![[ ]](/icons/layout.gif) | 4768_The Garage Door..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 4765_The Garage Door..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 4764_Beltinge Glazin..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4760_Beltinge Glazin..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 4758_Mark Tapper - T..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4753_C&M Glass Servi..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4752_The Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4748_The Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4745_Carl Hayfield -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4734_The Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4733_Stephen Haygart..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4732_Stephen Haygart..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4730_The Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4728_Ian Lamonby - L..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4724_Ian Lamonby - L..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4715_Sean Kiely - KS..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4712_Sean Kiely - KS..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4638_Stephen McDermo..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4634_Stephen McDermo..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 4627_Cerromar Ltd (T..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4622_P & R Door Syst..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4621_Sean Kiely - KS..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4608_Sean K - KSEA00..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4586_Andy Knowles - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4585_Doorolla Steve ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4583_Doorolla Steve ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4575_Elevate Doors L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4574_Garage Doors 24..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4554_Colin Hartgrove..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4544_Sean K - KSEA00..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4542_Carl Hayfield -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4540_Danbury Garage ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4534_Cerromar Ltd (T..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4532_Cerromar Ltd (T..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4513_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4506_Oscar Okoronta ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4502_Next Generation..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4500_Mark Tapper - T..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4499_Oscar Okoronta ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4497_Birchley Homes ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4496_Oscar Okortonta..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4495_Tom Carter - CA..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4462_Elliott Mills -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4427_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6970_[0,0] Thomas Ne..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6968_Prorenovate Ian..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6963_The Lothian Gar..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6961_C & P Doors Cra..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6948_C & P Doors Cra..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 4423_Jon Taylor - ....> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 4422_[0,0] Victoria ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4417_Ace Garage Door..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6946_East Anglia Rol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6944_C & P Doors Cra..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6926_Rollermatic Gar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6925_RS Doors Rob Sm..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6924_A Complete Wind..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6923_Victoria Bundle..> | 2025-11-11 06:20 | 36K | |
![[ ]](/icons/layout.gif) | 6922_Victoria Bundle..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 6918_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6915_AMP Carpentry A..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6914_AMP Carpentry A..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6905_A.S.M Windows L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6902_Doors 4 Garages..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6901_Piper Window Sy..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6898_C&M Glass Servi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6894_Garage Door And..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6884_Doors 4 You Ltd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6882_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6880_Avon Automated ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6874_Piper Window Sy..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6857_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6847_Oakley Windows ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6845_T D Rollerdoors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6844_Avon Automated ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6841_Avon Automated ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6839_RS Doors Rob Sm..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6838_Avon Automated ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6836_Avon Automated ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6831_Oakley Homes C..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6830_Eastern Frames ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6827_Alps Home Impro..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 6814_Maureen Bell - ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6811_JDL Plumbing Jo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6807_Go Garage Doors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6805_Go Garage Doors..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6798_AJ Trade Andrew..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6797_AJ Trade Andrew..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6790_Hadrian Joinery..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6789_Hadrian Joinery..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6785_Jay Dale - Jay ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 6783_Jay Dale - Jay ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 6779_Garage Door Sol..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6777_RS Doors Rob Sm..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6776_RS Doors Rob Sm..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6774_Garage Door Sol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6767_Dream Installat..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6766_Beltinge Glazin..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 6762_SW Trade Frames..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 6761_Midland Garage ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6759_Midland Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6754_Midland Garage ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 6753_Midland Garage ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6744_Victoria Bundle..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 6742_Mark Perham Mar..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6731_NW Automatic Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6728_Norfolk Broads ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6727_NW Automatic Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 6717_Norfolk Broads ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 6714_Ebtech Engineer..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 4910_Danbury Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4909_[0,0] Steve Ter..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 4908_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4907_DPS Building Se..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4899_[0,0] Andy Sedd..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 4898_[0,0] James Bow..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5948_The Lothian Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5946_Sean Kiely - KS..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5695_Beaver Soluitio..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5684_Bryan Thompson ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 4896_PGD Doors Ltd S..> | 2025-11-11 06:20 | 48K | |
![[ ]](/icons/layout.gif) | 5945_Sean Kiely - KS..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5938_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5936_Trevor Dousfiel..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5935_Trevor Dousfiel..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5924_Garage Doors 24..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5907_Alps Home Impro..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5903_Alps Home Impro..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5899_Oakley Bates - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5893_Elegant Windows..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5889_Elegant Windows..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5888_Geoff Holloway ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5880_[0,0] Allan Ste..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5876_Geoff Holloway ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5873_J Bowman Garage..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5871_J Bowman Garage..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5870_All Aspects Con..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5860_NW Automatic Do..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5857_NW Automatic Do..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5856_Simon Yeomans -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5852_Simon Yeomans -..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5849_Oakley Bates - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5838_Rollermatic Gar..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5834_M. A. E. Window..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5832_M. A. E. Window..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5830_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5828_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5827_Harley Lorence ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5826_Absolute Garage..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5824_Absolute Garage..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5823_Fortress Doors ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5822_Chelmsford Roll..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5818_The Lothian Gar..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 5816_Eclipse Doors D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5815_NW Automatic Do..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 5809_Windowcraft Des..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5800_Ricky Foulgar -..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 5797_S R W Services ..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5794_S R W Services ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5793_S R W Services ..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 5792_Elegant Windows..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 5789_Ricky Foulgar -..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5784_Jay Dale - Jay ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 5782_Go Garage Doors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5780_Go Garage Doors..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5778_Ace Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5777_Ace Garage Door..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 5772_Go Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5771_David Mann - Ex..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 5765_Custom Trade Sy..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 5761_Shutter Tech UK..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5754_Chelmsford Roll..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 5753_Ace Garage Door..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5746_AJ Trade Andrew..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5742_Elevate Doors L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5739_[0,0] Lui Field..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 5738_J Brady Garage ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5735_[0,0] Lui Field..> | 2025-11-11 06:20 | 76K | |
![[ ]](/icons/layout.gif) | 5734_East Anglia Rol..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 5732_Doorolla Ltd St..> | 2025-11-11 06:20 | 14K | |
![[ ]](/icons/layout.gif) | 5708_Mick Walklate W..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5706_G B Installatio..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5701_Oakley Windows ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 911_JM Doors Jon Bun..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 908_JM Doors Jon Bun..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 907_Garage Door Repa..> | 2025-11-11 06:20 | 38K | |
![[ ]](/icons/layout.gif) | 906_JWK Electrical L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 904_SDS (Isle Of Man..> | 2025-11-11 06:20 | 18K | |
![[ ]](/icons/layout.gif) | 903_Smart Doors Henr..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 901_Smart Doors Henr..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 900_Ffenestri Amlwch..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 897_Ffenestri Amlwch..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 896_Cromer Garage Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 895_Access Door Serv..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 893_Access Door Serv..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 891_Greig Matthewson..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 890_Greig Matthewson..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 887_Neil Ward - WARD..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 886_Neil Ward - WARD..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 875_James Radford - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 874_Nature's Design ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 873_Nature's Design ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 872_Martin Wallbank ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 868_Garage Door Repa..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 863_[0,0] Steve Bobb..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 861_Nature's Design ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 857_Elevate Doors Lt..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 855_Heavy Metal Engi..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 853_1st Choice Secur..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 852_Heavy Metal Engi..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 851_J Brady Garage D..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 849_Rhino Windows An..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 847_Rhino Windows An..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 846_Absolute Garage ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 845_Absolute Garage ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 843_Bob Ewins - EWIN..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 842_Bob Ewins - EWIN..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 839_Richard Horspool..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 837_The Lothian Gara..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 835_Gary Reynolds - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 834_Greig Matthewson..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 833_Neil McDonald - ..> | 2025-11-11 06:20 | 45K | |
![[ ]](/icons/layout.gif) | 832_TJS Maintenance ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 831_TJS Maintenance ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 826_Marcus Aston - A..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 825_Marcus Aston - A..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 824_Alan Davis - DAV..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 820_David Kirby - KI..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 819_Flavio Arruda - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 995_JWK Electrical L..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 991_J Brady Garage D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 988_Nigel Travis - T..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 987_Nigel Travis - T..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 985_Doors 4 Garages ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 983_Doors 4 Garages ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 982_[0,0] Steve Bobb..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 981_Garage Door Repa..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 980_Dream Installati..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 976_J Brady Garage D..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 975_CRS Maintenance ..> | 2025-11-11 06:20 | 46K | |
![[ ]](/icons/layout.gif) | 972_CRS Maintenance ..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 971_Andrew Stibbs - ..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 969_Absolute Garage ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 958_Ace Garage Doors..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 954_TPS Gates & Door..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 952_TPS Gates & Door..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 950_SDS (Isle Of Man..> | 2025-11-11 06:20 | 18K | |
![[ ]](/icons/layout.gif) | 949_All Door Enginee..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 948_NW Automatic Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 947_NW Automatic Doo..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 946_Adrian Jackson -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 945_David Kirby - KI..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 944_David Kirby - KI..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 943_Elliott Clark - ..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 942_Scotia Garage Do..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 940_James Radford - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 937_Secured Door & G..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 936_James Radford - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 934_Adrian Jackson -..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 933_Alex Hope - HOPE..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 931_Ideal Industrial..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 928_JM Doors Jon Bun..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 925_JM Doors Jon Bun..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 924_AM Shutters Stev..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 923_JM Doors Jon Bun..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 818_Flavio Arruda - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 815_Neil Ward - WARD..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 814_Bob Ewins - EWIN..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 813_P & R Door Syste..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 811_Gary Reynolds - ..> | 2025-11-11 06:20 | 44K | |
![[ ]](/icons/layout.gif) | 810_Gary Reynolds - ..> | 2025-11-11 06:20 | 35K | |
![[ ]](/icons/layout.gif) | 1122_East Anglia Rol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1121_East Anglia Rol..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1120_[0,0] Martin Ch..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1119_3 Counties (San..> | 2025-11-11 06:20 | 78K | |
![[ ]](/icons/layout.gif) | 1032_Garage Doors 24..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1028_Chargepoint Ins..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1027_Hanney Glazed L..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1026_JD Cars Ltd Jer..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1022_Hanney Glazed L..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1020_JD Cars Ltd Jer..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1019_JD Cars Ltd Jer..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 1014_Secured Door & ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1013_Rodger Gooding ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1012_Rodger Gooding ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1009_Rodger Gooding ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1007_Secured Door & ..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 1005_Secured Door & ..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 1004_Highlands Elect..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1003_Highlands Elect..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 1000_Craig Skinner -..> | 2025-11-11 06:20 | 121K | |
![[ ]](/icons/layout.gif) | 999_Alex Hope - HOPE..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 998_Danbury Garage D..> | 2025-11-11 06:20 | 13K | |
![[ ]](/icons/layout.gif) | 997_Danbury Garage D..> | 2025-11-11 06:20 | 11K | |
![[ ]](/icons/layout.gif) | 996_JWK Electrical L..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 922_JM Doors Jon Bun..> | 2025-11-11 06:20 | 37K | |
![[ ]](/icons/layout.gif) | 921_Alan Davis - DAV..> | 2025-11-11 06:20 | 120K | |
![[ ]](/icons/layout.gif) | 920_M & S Home Insta..> | 2025-11-11 06:20 | 47K | |
![[ ]](/icons/layout.gif) | 916_JM Doors Jon Bun..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 915_Avon Automated G..> | 2025-11-11 06:20 | 12K | |
![[ ]](/icons/layout.gif) | 913_Garage Door Repa..> | 2025-11-11 06:20 | 38K | |
![[ ]](/icons/layout.gif) | 912_Gilberts Home Im..> | 2025-11-11 06:20 | 77K | |
![[ ]](/icons/layout.gif) | 5699_All Door Engine..> | 2025-11-11 06:20 | 13K | |
![[DIR]](/icons/folder.gif) | 13434_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6796_[0,0] Devlinc ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 9639_Doorolla Ltd St..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 3731_[0,0] SW Trade..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4177_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4161_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4156_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 9586_Chargepoint Ins..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 4180_[0,0] Steve Ter..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 106_Chargepoint Inst..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 12862_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 11053_Chargepoint In..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6784_[0,0] Devlinc ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6778_[0,0] Devlinc ..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 13415_Doorolla Ltd S..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 603_Chargepoint Inst..> | 2025-11-11 06:20 | - | |
![[DIR]](/icons/folder.gif) | 6723_SW Trade Frames..> | 2025-11-11 06:20 | - | |
|